diff options
408 files changed, 33356 insertions, 0 deletions
diff --git a/plugins/acl/acl.js b/plugins/acl/acl.js new file mode 100644 index 000000000..488e72722 --- /dev/null +++ b/plugins/acl/acl.js @@ -0,0 +1,341 @@ +/** + * ACL plugin script + * + * @version 0.6.2 + * @author Aleksander Machniak <alec@alec.pl> + */ + +if (window.rcmail) { + rcmail.addEventListener('init', function() { + if (rcmail.gui_objects.acltable) { + rcmail.acl_list_init(); + // enable autocomplete on user input + if (rcmail.env.acl_users_source) { + rcmail.init_address_input_events($('#acluser'), {action:'settings/plugin.acl-autocomplete'}); + // fix inserted value + rcmail.addEventListener('autocomplete_insert', function(e) { + if (e.field.id != 'acluser') + return; + + var value = e.insert; + // get UID from the entry value + if (value.match(/\s*\(([^)]+)\)[, ]*$/)) + value = RegExp.$1; + e.field.value = value; + }); + } + } + + rcmail.enable_command('acl-create', 'acl-save', 'acl-cancel', 'acl-mode-switch', true); + rcmail.enable_command('acl-delete', 'acl-edit', false); + }); +} + +// Display new-entry form +rcube_webmail.prototype.acl_create = function() +{ + this.acl_init_form(); +} + +// Display ACL edit form +rcube_webmail.prototype.acl_edit = function() +{ + // @TODO: multi-row edition + var id = this.acl_list.get_single_selection(); + if (id) + this.acl_init_form(id); +} + +// ACL entry delete +rcube_webmail.prototype.acl_delete = function() +{ + var users = this.acl_get_usernames(); + + if (users && users.length && confirm(this.get_label('acl.deleteconfirm'))) { + this.http_request('settings/plugin.acl', '_act=delete&_user='+urlencode(users.join(',')) + + '&_mbox='+urlencode(this.env.mailbox), + this.set_busy(true, 'acl.deleting')); + } +} + +// Save ACL data +rcube_webmail.prototype.acl_save = function() +{ + var user = $('#acluser').val(), rights = '', type; + + $(':checkbox', this.env.acl_advanced ? $('#advancedrights') : sim_ul = $('#simplerights')).map(function() { + if (this.checked) + rights += this.value; + }); + + if (type = $('input:checked[name=usertype]').val()) { + if (type != 'user') + user = type; + } + + if (!user) { + alert(this.get_label('acl.nouser')); + return; + } + if (!rights) { + alert(this.get_label('acl.norights')); + return; + } + + this.http_request('settings/plugin.acl', '_act=save' + + '&_user='+urlencode(user) + + '&_acl=' +rights + + '&_mbox='+urlencode(this.env.mailbox) + + (this.acl_id ? '&_old='+this.acl_id : ''), + this.set_busy(true, 'acl.saving')); +} + +// Cancel/Hide form +rcube_webmail.prototype.acl_cancel = function() +{ + this.ksearch_blur(); + this.acl_form.hide(); +} + +// Update data after save (and hide form) +rcube_webmail.prototype.acl_update = function(o) +{ + // delete old row + if (o.old) + this.acl_remove_row(o.old); + // make sure the same ID doesn't exist + else if (this.env.acl[o.id]) + this.acl_remove_row(o.id); + + // add new row + this.acl_add_row(o, true); + // hide autocomplete popup + this.ksearch_blur(); + // hide form + this.acl_form.hide(); +} + +// Switch table display mode +rcube_webmail.prototype.acl_mode_switch = function(elem) +{ + this.env.acl_advanced = !this.env.acl_advanced; + this.enable_command('acl-delete', 'acl-edit', false); + this.http_request('settings/plugin.acl', '_act=list' + + '&_mode='+(this.env.acl_advanced ? 'advanced' : 'simple') + + '&_mbox='+urlencode(this.env.mailbox), + this.set_busy(true, 'loading')); +} + +// ACL table initialization +rcube_webmail.prototype.acl_list_init = function() +{ + this.acl_list = new rcube_list_widget(this.gui_objects.acltable, + {multiselect:true, draggable:false, keyboard:true, toggleselect:true}); + this.acl_list.addEventListener('select', function(o) { rcmail.acl_list_select(o); }); + this.acl_list.addEventListener('dblclick', function(o) { rcmail.acl_list_dblclick(o); }); + this.acl_list.addEventListener('keypress', function(o) { rcmail.acl_list_keypress(o); }); + this.acl_list.init(); +} + +// ACL table row selection handler +rcube_webmail.prototype.acl_list_select = function(list) +{ + rcmail.enable_command('acl-delete', list.selection.length > 0); + rcmail.enable_command('acl-edit', list.selection.length == 1); + list.focus(); +} + +// ACL table double-click handler +rcube_webmail.prototype.acl_list_dblclick = function(list) +{ + this.acl_edit(); +} + +// ACL table keypress handler +rcube_webmail.prototype.acl_list_keypress = function(list) +{ + if (list.key_pressed == list.ENTER_KEY) + this.command('acl-edit'); + else if (list.key_pressed == list.DELETE_KEY || list.key_pressed == list.BACKSPACE_KEY) + if (!this.acl_form || !this.acl_form.is(':visible')) + this.command('acl-delete'); +} + +// Reloads ACL table +rcube_webmail.prototype.acl_list_update = function(html) +{ + $(this.gui_objects.acltable).html(html); + this.acl_list_init(); +} + +// Returns names of users in selected rows +rcube_webmail.prototype.acl_get_usernames = function() +{ + var users = [], n, len, cell, row, + list = this.acl_list, + selection = list.get_selection(); + + for (n=0, len=selection.length; n<len; n++) { + if (this.env.acl_specials.length && $.inArray(selection[n], this.env.acl_specials) >= 0) { + users.push(selection[n]); + } + else { + row = list.rows[selection[n]].obj; + cell = $('td.user', row); + if (cell.length == 1) + users.push(cell.text()); + } + } + + return users; +} + +// Removes ACL table row +rcube_webmail.prototype.acl_remove_row = function(id) +{ + this.acl_list.remove_row(id); + // we don't need it anymore (remove id conflict) + $('#rcmrow'+id).remove(); + this.env.acl[id] = null; +} + +// Adds ACL table row +rcube_webmail.prototype.acl_add_row = function(o, sel) +{ + var n, len, ids = [], spec = [], id = o.id, list = this.acl_list, + items = this.env.acl_advanced ? [] : this.env.acl_items, + table = this.gui_objects.acltable, + row = $('thead > tr', table).clone(); + + // Update new row + $('td', row).map(function() { + var r, cl = this.className.replace(/^acl/, ''); + + if (items && items[cl]) + cl = items[cl]; + + if (cl == 'user') + $(this).text(o.username); + else + $(this).addClass(rcmail.acl_class(o.acl, cl)).text(''); + }); + + row.attr('id', 'rcmrow'+id); + row = row.get(0); + + this.env.acl[id] = o.acl; + + // sorting... (create an array of user identifiers, then sort it) + for (n in this.env.acl) { + if (this.env.acl[n]) { + if (this.env.acl_specials.length && $.inArray(n, this.env.acl_specials) >= 0) + spec.push(n); + else + ids.push(n); + } + } + ids.sort(); + // specials on the top + ids = spec.concat(ids); + + // find current id + for (n=0, len=ids.length; n<len; n++) + if (ids[n] == id) + break; + + // add row + if (n && n < len) { + $('#rcmrow'+ids[n-1]).after(row); + list.init_row(row); + list.rowcount++; + } + else + list.insert_row(row); + + if (sel) + list.select_row(o.id); +} + +// Initializes and shows ACL create/edit form +rcube_webmail.prototype.acl_init_form = function(id) +{ + var ul, row, val = '', type = 'user', li_elements, body = $('body'), + adv_ul = $('#advancedrights'), sim_ul = $('#simplerights'), + name_input = $('#acluser'); + + if (!this.acl_form) { + var fn = function () { $('input[value=user]').prop('checked', true); }; + name_input.click(fn).keypress(fn); + } + + this.acl_form = $('#aclform'); + + // Hide unused items + if (this.env.acl_advanced) { + adv_ul.show(); + sim_ul.hide(); + ul = adv_ul; + } + else { + sim_ul.show(); + adv_ul.hide(); + ul = sim_ul; + } + + // initialize form fields + li_elements = $(':checkbox', ul); + li_elements.attr('checked', false); + + if (id) { + row = this.acl_list.rows[id].obj; + li_elements.map(function() { + var val = this.value, td = $('td.'+this.id, row); + if (td && td.hasClass('enabled')) + this.checked = true; + }); + + if (!this.env.acl_specials.length || $.inArray(id, this.env.acl_specials) < 0) + val = $('td.user', row).text(); + else + type = id; + } + + name_input.val(val); + $('input[value='+type+']').prop('checked', true); + + this.acl_id = id; + + // position the form horizontally + var bw = body.width(), mw = this.acl_form.width(); + + if (bw >= mw) + this.acl_form.css({left: parseInt((bw - mw)/2)+'px'}); + + // display it + this.acl_form.show(); + if (type == 'user') + name_input.focus(); + + // unfocus the list, make backspace key in name input field working + this.acl_list.blur(); +} + +// Returns class name according to ACL comparision result +rcube_webmail.prototype.acl_class = function(acl1, acl2) +{ + var i, len, found = 0; + + acl1 = String(acl1); + acl2 = String(acl2); + + for (i=0, len=acl2.length; i<len; i++) + if (acl1.indexOf(acl2[i]) > -1) + found++; + + if (found == len) + return 'enabled'; + else if (found) + return 'partial'; + + return 'disabled'; +} diff --git a/plugins/acl/acl.php b/plugins/acl/acl.php new file mode 100644 index 000000000..fe7d0d5eb --- /dev/null +++ b/plugins/acl/acl.php @@ -0,0 +1,701 @@ +<?php + +/** + * Folders Access Control Lists Management (RFC4314, RFC2086) + * + * @version 0.6.2 + * @author Aleksander Machniak <alec@alec.pl> + * + * + * Copyright (C) 2011, Kolab Systems AG + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License version 2 + * as published by the Free Software Foundation. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License along + * with this program; if not, write to the Free Software Foundation, Inc., + * 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. + */ + +class acl extends rcube_plugin +{ + public $task = 'settings|addressbook|calendar'; + + private $rc; + private $supported = null; + private $mbox; + private $ldap; + private $specials = array('anyone', 'anonymous'); + + /** + * Plugin initialization + */ + function init() + { + $this->rc = rcmail::get_instance(); + + // Register hooks + $this->add_hook('folder_form', array($this, 'folder_form')); + // kolab_addressbook plugin + $this->add_hook('addressbook_form', array($this, 'folder_form')); + $this->add_hook('calendar_form_kolab', array($this, 'folder_form')); + // Plugin actions + $this->register_action('plugin.acl', array($this, 'acl_actions')); + $this->register_action('plugin.acl-autocomplete', array($this, 'acl_autocomplete')); + } + + /** + * Handler for plugin actions (AJAX) + */ + function acl_actions() + { + $action = trim(get_input_value('_act', RCUBE_INPUT_GPC)); + + // Connect to IMAP + $this->rc->imap_init(); + $this->rc->imap_connect(); + + // Load localization and configuration + $this->add_texts('localization/'); + $this->load_config(); + + if ($action == 'save') { + $this->action_save(); + } + else if ($action == 'delete') { + $this->action_delete(); + } + else if ($action == 'list') { + $this->action_list(); + } + + // Only AJAX actions + $this->rc->output->send(); + } + + /** + * Handler for user login autocomplete request + */ + function acl_autocomplete() + { + $this->load_config(); + + $search = get_input_value('_search', RCUBE_INPUT_GPC, true); + $sid = get_input_value('_id', RCUBE_INPUT_GPC); + $users = array(); + + if ($this->init_ldap()) { + $this->ldap->set_pagesize((int)$this->rc->config->get('autocomplete_max', 15)); + $result = $this->ldap->search('*', $search); + + foreach ($result->records as $record) { + $user = $record['uid']; + + if (is_array($user)) { + $user = array_filter($user); + $user = $user[0]; + } + + if ($user) { + if ($record['name']) + $user = $record['name'] . ' (' . $user . ')'; + + $users[] = $user; + } + } + } + + sort($users, SORT_LOCALE_STRING); + + $this->rc->output->command('ksearch_query_results', $users, $search, $sid); + $this->rc->output->send(); + } + + /** + * Handler for 'folder_form' hook + * + * @param array $args Hook arguments array (form data) + * + * @return array Hook arguments array + */ + function folder_form($args) + { + // Edited folder name (empty in create-folder mode) + $mbox_imap = $args['options']['name']; + if (!strlen($mbox_imap)) { + return $args; + } +/* + // Do nothing on protected folders (?) + if ($args['options']['protected']) { + return $args; + } +*/ + // Namespace root + if ($args['options']['is_root']) { + return $args; + } + + // Get MYRIGHTS + if (!($myrights = $args['options']['rights'])) { + return $args; + } + + // Do nothing if no ACL support + if (!$this->rc->imap->get_capability('ACL')) { + return $args; + } + + // Load localization and include scripts + $this->load_config(); + $this->add_texts('localization/', array('deleteconfirm', 'norights', + 'nouser', 'deleting', 'saving')); + $this->include_script('acl.js'); + $this->rc->output->include_script('list.js'); + $this->include_stylesheet($this->local_skin_path().'/acl.css'); + + // add Info fieldset if it doesn't exist + if (!isset($args['form']['props']['fieldsets']['info'])) + $args['form']['props']['fieldsets']['info'] = array( + 'name' => rcube_label('info'), + 'content' => array()); + + // Display folder rights to 'Info' fieldset + $args['form']['props']['fieldsets']['info']['content']['myrights'] = array( + 'label' => Q($this->gettext('myrights')), + 'value' => $this->acl2text($myrights) + ); + + // Return if not folder admin + if (!in_array('a', $myrights)) { + return $args; + } + + // The 'Sharing' tab + $this->mbox = $mbox_imap; + $this->rc->output->set_env('acl_users_source', (bool) $this->rc->config->get('acl_users_source')); + $this->rc->output->set_env('mailbox', $mbox_imap); + $this->rc->output->add_handlers(array( + 'acltable' => array($this, 'templ_table'), + 'acluser' => array($this, 'templ_user'), + 'aclrights' => array($this, 'templ_rights'), + )); + + $this->rc->output->set_env('autocomplete_max', (int)$this->rc->config->get('autocomplete_max', 15)); + $this->rc->output->set_env('autocomplete_min_length', $this->rc->config->get('autocomplete_min_length')); + $this->rc->output->add_label('autocompletechars', 'autocompletemore'); + + $args['form']['sharing'] = array( + 'name' => Q($this->gettext('sharing')), + 'content' => $this->rc->output->parse('acl.table', false, false), + ); + + return $args; + } + + /** + * Creates ACL rights table + * + * @param array $attrib Template object attributes + * + * @return string HTML Content + */ + function templ_table($attrib) + { + if (empty($attrib['id'])) + $attrib['id'] = 'acl-table'; + + $out = $this->list_rights($attrib); + + $this->rc->output->add_gui_object('acltable', $attrib['id']); + + return $out; + } + + /** + * Creates ACL rights form (rights list part) + * + * @param array $attrib Template object attributes + * + * @return string HTML Content + */ + function templ_rights($attrib) + { + // Get supported rights + $supported = $this->rights_supported(); + + // depending on server capability either use 'te' or 'd' for deleting msgs + $deleteright = implode(array_intersect(str_split('ted'), $supported)); + + $out = ''; + $ul = ''; + $input = new html_checkbox(); + + // Advanced rights + $attrib['id'] = 'advancedrights'; + foreach ($supported as $val) { + $id = "acl$val"; + $ul .= html::tag('li', null, + $input->show('', array( + 'name' => "acl[$val]", 'value' => $val, 'id' => $id)) + . html::label(array('for' => $id, 'title' => $this->gettext('longacl'.$val)), + $this->gettext('acl'.$val))); + } + + $out = html::tag('ul', $attrib, $ul, html::$common_attrib); + + // Simple rights + $ul = ''; + $attrib['id'] = 'simplerights'; + $items = array( + 'read' => 'lrs', + 'write' => 'wi', + 'delete' => $deleteright, + 'other' => preg_replace('/[lrswi'.$deleteright.']/', '', implode($supported)), + ); + + foreach ($items as $key => $val) { + $id = "acl$key"; + $ul .= html::tag('li', null, + $input->show('', array( + 'name' => "acl[$val]", 'value' => $val, 'id' => $id)) + . html::label(array('for' => $id, 'title' => $this->gettext('longacl'.$key)), + $this->gettext('acl'.$key))); + } + + $out .= "\n" . html::tag('ul', $attrib, $ul, html::$common_attrib); + + $this->rc->output->set_env('acl_items', $items); + + return $out; + } + + /** + * Creates ACL rights form (user part) + * + * @param array $attrib Template object attributes + * + * @return string HTML Content + */ + function templ_user($attrib) + { + // Create username input + $attrib['name'] = 'acluser'; + + $textfield = new html_inputfield($attrib); + + $fields['user'] = html::label(array('for' => 'iduser'), $this->gettext('username')) + . ' ' . $textfield->show(); + + // Add special entries + if (!empty($this->specials)) { + foreach ($this->specials as $key) { + $fields[$key] = html::label(array('for' => 'id'.$key), $this->gettext($key)); + } + } + + $this->rc->output->set_env('acl_specials', $this->specials); + + // Create list with radio buttons + if (count($fields) > 1) { + $ul = ''; + $radio = new html_radiobutton(array('name' => 'usertype')); + foreach ($fields as $key => $val) { + $ul .= html::tag('li', null, $radio->show($key == 'user' ? 'user' : '', + array('value' => $key, 'id' => 'id'.$key)) + . $val); + } + + $out = html::tag('ul', array('id' => 'usertype'), $ul, html::$common_attrib); + } + // Display text input alone + else { + $out = $fields['user']; + } + + return $out; + } + + /** + * Creates ACL rights table + * + * @param array $attrib Template object attributes + * + * @return string HTML Content + */ + private function list_rights($attrib=array()) + { + // Get ACL for the folder + $acl = $this->rc->imap->get_acl($this->mbox); + + if (!is_array($acl)) { + $acl = array(); + } + + // Keep special entries (anyone/anonymous) on top of the list + if (!empty($this->specials) && !empty($acl)) { + foreach ($this->specials as $key) { + if (isset($acl[$key])) { + $acl_special[$key] = $acl[$key]; + unset($acl[$key]); + } + } + } + + // Sort the list by username + uksort($acl, 'strnatcasecmp'); + + if (!empty($acl_special)) { + $acl = array_merge($acl_special, $acl); + } + + // Get supported rights and build column names + $supported = $this->rights_supported(); + + // depending on server capability either use 'te' or 'd' for deleting msgs + $deleteright = implode(array_intersect(str_split('ted'), $supported)); + + // Use advanced or simple (grouped) rights + $advanced = $this->rc->config->get('acl_advanced_mode'); + + if ($advanced) { + $items = array(); + foreach ($supported as $sup) { + $items[$sup] = $sup; + } + } + else { + $items = array( + 'read' => 'lrs', + 'write' => 'wi', + 'delete' => $deleteright, + 'other' => preg_replace('/[lrswi'.$deleteright.']/', '', implode($supported)), + ); + } + + // Create the table + $attrib['noheader'] = true; + $table = new html_table($attrib); + + // Create table header + $table->add_header('user', $this->gettext('identifier')); + foreach (array_keys($items) as $key) { + $table->add_header('acl'.$key, $this->gettext('shortacl'.$key)); + } + + $i = 1; + $js_table = array(); + foreach ($acl as $user => $rights) { + if ($this->rc->imap->conn->user == $user) { + continue; + } + + // filter out virtual rights (c or d) the server may return + $userrights = array_intersect($rights, $supported); + $userid = html_identifier($user); + + if (!empty($this->specials) && in_array($user, $this->specials)) { + $user = $this->gettext($user); + } + + $table->add_row(array('id' => 'rcmrow'.$userid)); + $table->add('user', Q($user)); + + foreach ($items as $key => $right) { + $in = $this->acl_compare($userrights, $right); + switch ($in) { + case 2: $class = 'enabled'; break; + case 1: $class = 'partial'; break; + default: $class = 'disabled'; break; + } + $table->add('acl' . $key . ' ' . $class, ''); + } + + $js_table[$userid] = implode($userrights); + } + + $this->rc->output->set_env('acl', $js_table); + $this->rc->output->set_env('acl_advanced', $advanced); + + $out = $table->show(); + + return $out; + } + + /** + * Handler for ACL update/create action + */ + private function action_save() + { + $mbox = trim(get_input_value('_mbox', RCUBE_INPUT_GPC, true)); // UTF7-IMAP + $user = trim(get_input_value('_user', RCUBE_INPUT_GPC)); + $acl = trim(get_input_value('_acl', RCUBE_INPUT_GPC)); + $oldid = trim(get_input_value('_old', RCUBE_INPUT_GPC)); + + $acl = array_intersect(str_split($acl), $this->rights_supported()); + + if (!empty($this->specials) && in_array($user, $this->specials)) { + $username = $this->gettext($user); + } + else { + if (!strpos($user, '@') && ($realm = $this->get_realm())) { + $user .= '@' . rcube_idn_to_ascii(preg_replace('/^@/', '', $realm)); + } + $username = $user; + } + + if ($acl && $user && $user != $_SESSION['username'] && strlen($mbox)) { + $result = $this->rc->imap->set_acl($mbox, $user, $acl); + } + + if ($result) { + $ret = array('id' => html_identifier($user), + 'username' => $username, 'acl' => implode($acl), 'old' => $oldid); + $this->rc->output->command('acl_update', $ret); + $this->rc->output->show_message($oldid ? 'acl.updatesuccess' : 'acl.createsuccess', 'confirmation'); + } + else { + $this->rc->output->show_message($oldid ? 'acl.updateerror' : 'acl.createerror', 'error'); + } + } + + /** + * Handler for ACL delete action + */ + private function action_delete() + { + $mbox = trim(get_input_value('_mbox', RCUBE_INPUT_GPC, true)); //UTF7-IMAP + $user = trim(get_input_value('_user', RCUBE_INPUT_GPC)); + + $user = explode(',', $user); + + foreach ($user as $u) { + if ($this->rc->imap->delete_acl($mbox, $u)) { + $this->rc->output->command('acl_remove_row', html_identifier($u)); + } + else { + $error = true; + } + } + + if (!$error) { + $this->rc->output->show_message('acl.deletesuccess', 'confirmation'); + } + else { + $this->rc->output->show_message('acl.deleteerror', 'error'); + } + } + + /** + * Handler for ACL list update action (with display mode change) + */ + private function action_list() + { + if (in_array('acl_advanced_mode', (array)$this->rc->config->get('dont_override'))) { + return; + } + + $this->mbox = trim(get_input_value('_mbox', RCUBE_INPUT_GPC, true)); // UTF7-IMAP + $advanced = trim(get_input_value('_mode', RCUBE_INPUT_GPC)); + $advanced = $advanced == 'advanced' ? true : false; + + // Save state in user preferences + $this->rc->user->save_prefs(array('acl_advanced_mode' => $advanced)); + + $out = $this->list_rights(); + + $out = preg_replace(array('/^<table[^>]+>/', '/<\/table>$/'), '', $out); + + $this->rc->output->command('acl_list_update', $out); + } + + /** + * Creates <UL> list with descriptive access rights + * + * @param array $rights MYRIGHTS result + * + * @return string HTML content + */ + function acl2text($rights) + { + if (empty($rights)) { + return ''; + } + + $supported = $this->rights_supported(); + $list = array(); + $attrib = array( + 'name' => 'rcmyrights', + 'style' => 'margin:0; padding:0 15px;', + ); + + foreach ($supported as $right) { + if (in_array($right, $rights)) { + $list[] = html::tag('li', null, Q($this->gettext('acl' . $right))); + } + } + + if (count($list) == count($supported)) + return Q($this->gettext('aclfull')); + + return html::tag('ul', $attrib, implode("\n", $list)); + } + + /** + * Compares two ACLs (according to supported rights) + * + * @param array $acl1 ACL rights array (or string) + * @param array $acl2 ACL rights array (or string) + * + * @param int Comparision result, 2 - full match, 1 - partial match, 0 - no match + */ + function acl_compare($acl1, $acl2) + { + if (!is_array($acl1)) $acl1 = str_split($acl1); + if (!is_array($acl2)) $acl2 = str_split($acl2); + + $rights = $this->rights_supported(); + + $acl1 = array_intersect($acl1, $rights); + $acl2 = array_intersect($acl2, $rights); + $res = array_intersect($acl1, $acl2); + + $cnt1 = count($res); + $cnt2 = count($acl2); + + if ($cnt1 == $cnt2) + return 2; + else if ($cnt1) + return 1; + else + return 0; + } + + /** + * Get list of supported access rights (according to RIGHTS capability) + * + * @return array List of supported access rights abbreviations + */ + function rights_supported() + { + if ($this->supported !== null) { + return $this->supported; + } + + $capa = $this->rc->imap->get_capability('RIGHTS'); + + if (is_array($capa)) { + $rights = strtolower($capa[0]); + } + else { + $rights = 'cd'; + } + + return $this->supported = str_split('lrswi' . $rights . 'pa'); + } + + /** + * Username realm detection. + * + * @return string Username realm (domain) + */ + private function get_realm() + { + // When user enters a username without domain part, realm + // alows to add it to the username (and display correct username in the table) + + if (isset($_SESSION['acl_username_realm'])) { + return $_SESSION['acl_username_realm']; + } + + // find realm in username of logged user (?) + list($name, $domain) = explode('@', $_SESSION['username']); + + // Use (always existent) ACL entry on the INBOX for the user to determine + // whether or not the user ID in ACL entries need to be qualified and how + // they would need to be qualified. + if (empty($domain)) { + $acl = $this->rc->imap->get_acl('INBOX'); + if (is_array($acl)) { + $regexp = '/^' . preg_quote($_SESSION['username'], '/') . '@(.*)$/'; + $regexp = '/^' . preg_quote('aleksander.machniak', '/') . '@(.*)$/'; + foreach (array_keys($acl) as $name) { + if (preg_match($regexp, $name, $matches)) { + $domain = $matches[1]; + break; + } + } + } + } + + return $_SESSION['acl_username_realm'] = $domain; + } + + /** + * Initializes autocomplete LDAP backend + */ + private function init_ldap() + { + if ($this->ldap) + return $this->ldap->ready; + + // get LDAP config + $config = $this->rc->config->get('acl_users_source'); + + if (empty($config)) { + return false; + } + + // not an array, use configured ldap_public source + if (!is_array($config)) { + $ldap_config = (array) $this->rc->config->get('ldap_public'); + $config = $ldap_config[$config]; + } + + $uid_field = $this->rc->config->get('acl_users_field', 'mail'); + $filter = $this->rc->config->get('acl_users_filter'); + + if (empty($uid_field) || empty($config)) { + return false; + } + + // get name attribute + if (!empty($config['fieldmap'])) { + $name_field = $config['fieldmap']['name']; + } + // ... no fieldmap, use the old method + if (empty($name_field)) { + $name_field = $config['name_field']; + } + + // add UID field to fieldmap, so it will be returned in a record with name + $config['fieldmap'] = array( + 'name' => $name_field, + 'uid' => $uid_field, + ); + + // search in UID and name fields + $config['search_fields'] = array_values($config['fieldmap']); + $config['required_fields'] = array($uid_field); + + // set search filter + if ($filter) + $config['filter'] = $filter; + + // disable vlv + $config['vlv'] = false; + + // Initialize LDAP connection + $this->ldap = new rcube_ldap($config, + $this->rc->config->get('ldap_debug'), + $this->rc->config->mail_domain($_SESSION['imap_host'])); + + return $this->ldap->ready; + } +} diff --git a/plugins/acl/config.inc.php.dist b/plugins/acl/config.inc.php.dist new file mode 100644 index 000000000..f957a233a --- /dev/null +++ b/plugins/acl/config.inc.php.dist @@ -0,0 +1,19 @@ +<?php + +// Default look of access rights table +// In advanced mode all access rights are displayed separately +// In simple mode access rights are grouped into four groups: read, write, delete, full +$rcmail_config['acl_advanced_mode'] = false; + +// LDAP addressbook that would be searched for user names autocomplete. +// That should be an array refering to the $rcmail_config['ldap_public'] array key +// or complete addressbook configuration array. +$rcmail_config['acl_users_source'] = ''; + +// The LDAP attribute which will be used as ACL user identifier +$rcmail_config['acl_users_field'] = 'mail'; + +// The LDAP search filter will be &'d with search queries +$rcmail_config['acl_users_filter'] = ''; + +?> diff --git a/plugins/acl/localization/de_DE.inc b/plugins/acl/localization/de_DE.inc new file mode 100644 index 000000000..92c7e4290 --- /dev/null +++ b/plugins/acl/localization/de_DE.inc @@ -0,0 +1,83 @@ +<?php + +$labels['sharing'] = 'Freigabe'; +$labels['myrights'] = 'Zugriffsrechte'; +$labels['username'] = 'Benutzer:'; +$labels['advanced'] = 'erweiterter Modus'; +$labels['newuser'] = 'Eintrag hinzufügen'; +$labels['actions'] = 'Zugriffsrechte Aktionen...'; +$labels['anyone'] = 'Alle Benutzer (anyone)'; +$labels['anonymous'] = 'Gäste (anonymous)'; +$labels['identifier'] = 'Bezeichnung'; + +$labels['acll'] = 'Ordner sichtbar'; +$labels['aclr'] = 'Nachrichten lesen'; +$labels['acls'] = 'Lesestatus ändern'; +$labels['aclw'] = 'Flags schreiben'; +$labels['acli'] = 'Nachrichten Hinzufügen'; +$labels['aclp'] = 'Nachrichten Senden an'; +$labels['aclc'] = 'Unterordner erstellen'; +$labels['aclk'] = 'Unterordner erstellen'; +$labels['acld'] = 'Nachrichten als gelöscht markieren'; +$labels['aclt'] = 'Nachrichten als gelöscht markieren'; +$labels['acle'] = 'Nachrichten endgültig Löschen'; +$labels['aclx'] = 'Ordner löschen'; +$labels['acla'] = 'Zugriffsrechte Verwalten'; + +$labels['aclfull'] = 'Vollzugriff'; +$labels['aclother'] = 'Andere'; +$labels['aclread'] = 'Lesen'; +$labels['aclwrite'] = 'Schreiben'; +$labels['acldelete'] = 'Löschen'; + +$labels['shortacll'] = 'Sichtbar'; +$labels['shortaclr'] = 'Lesen'; +$labels['shortacls'] = 'Lesestatus'; +$labels['shortaclw'] = 'Flags ändern'; +$labels['shortacli'] = 'Hinzufügen'; +$labels['shortaclp'] = 'Senden an'; +$labels['shortaclc'] = 'Erstellen'; +$labels['shortaclk'] = 'Erstellen'; +$labels['shortacld'] = 'Löschen'; +$labels['shortaclt'] = 'Löschen'; +$labels['shortacle'] = 'endgültig löschen'; +$labels['shortaclx'] = 'Ordner löschen'; +$labels['shortacla'] = 'Verwalten'; + +$labels['shortaclother'] = 'Andere'; +$labels['shortaclread'] = 'Lesen'; +$labels['shortaclwrite'] = 'Schreiben'; +$labels['shortacldelete'] = 'Löschen'; + +$labels['longacll'] = 'Der Ordner ist sichtbar und kann abonniert werden'; +$labels['longaclr'] = 'Nachrichten im Ordner können gelesen werden'; +$labels['longacls'] = 'Der Lesestatus von Nachrichten kann geändert werden'; +$labels['longaclw'] = 'Alle Nachrichten-Flags und Schlüsselwörter außer "Gelesen" und "Gelöscht" können geändert werden'; +$labels['longacli'] = 'Nachrichten können in diesen Ordner kopiert oder verschoben werden'; +$labels['longaclp'] = 'Nachrichten können an diesen Ordner gesendet werden'; +$labels['longaclc'] = 'Unterordner können in diesem Ordner erstellt oder umbenannt werden'; +$labels['longaclk'] = 'Unterordner können in diesem Ordner erstellt oder umbenannt werden'; +$labels['longacld'] = 'Der "gelöscht" Status von Nachrichten kann geändert werden'; +$labels['longaclt'] = 'Der "gelöscht" Status von Nachrichten kann geändert werden'; +$labels['longacle'] = 'Als "gelöscht" markiert Nachrichten können gelöscht werden.'; +$labels['longaclx'] = 'Der Ordner kann gelöscht oder umbenannt werden'; +$labels['longacla'] = 'Die Zugriffsrechte des Ordners können geändert werden'; + +$labels['longaclfull'] = 'Vollzugriff inklusive Ordner-Verwaltung'; +$labels['longaclread'] = 'Der Ordnerinhalt kann gelesen werden'; +$labels['longaclwrite'] = 'Nachrichten können markiert, an den Ordner gesendet und in den Ordner kopiert oder verschoben werden'; +$labels['longacldelete'] = 'Nachrichten können gelöscht werden'; + +$messages['deleting'] = 'Zugriffsrechte werden entzogen...'; +$messages['saving'] = 'Zugriffsrechte werden gewährt...'; +$messages['updatesuccess'] = 'Zugriffsrechte erfolgreich geändert'; +$messages['deletesuccess'] = 'Zugriffsrechte erfolgreich entzogen'; +$messages['createsuccess'] = 'Zugriffsrechte erfolgreich gewährt'; +$messages['updateerror'] = 'Zugriffsrechte konnten nicht geändert werden'; +$messages['deleteerror'] = 'Zugriffsrechte konnten nicht entzogen werden'; +$messages['createerror'] = 'Zugriffsrechte konnten nicht gewährt werden'; +$messages['deleteconfirm'] = 'Sind Sie sicher, daß Sie die Zugriffsrechte den ausgewählten Benutzern entziehen möchten?'; +$messages['norights'] = 'Es wurden keine Zugriffsrechte ausgewählt!'; +$messages['nouser'] = 'Es wurde kein Benutzer ausgewählt!'; + +?> diff --git a/plugins/acl/localization/en_US.inc b/plugins/acl/localization/en_US.inc new file mode 100644 index 000000000..f5b1ae64d --- /dev/null +++ b/plugins/acl/localization/en_US.inc @@ -0,0 +1,83 @@ +<?php + +$labels['sharing'] = 'Sharing'; +$labels['myrights'] = 'Access Rights'; +$labels['username'] = 'User:'; +$labels['advanced'] = 'advanced mode'; +$labels['newuser'] = 'Add entry'; +$labels['actions'] = 'Access right actions...'; +$labels['anyone'] = 'All users (anyone)'; +$labels['anonymous'] = 'Guests (anonymous)'; +$labels['identifier'] = 'Identifier'; + +$labels['acll'] = 'Lookup'; +$labels['aclr'] = 'Read messages'; +$labels['acls'] = 'Keep Seen state'; +$labels['aclw'] = 'Write flags'; +$labels['acli'] = 'Insert (Copy into)'; +$labels['aclp'] = 'Post'; +$labels['aclc'] = 'Create subfolders'; +$labels['aclk'] = 'Create subfolders'; +$labels['acld'] = 'Delete messages'; +$labels['aclt'] = 'Delete messages'; +$labels['acle'] = 'Expunge'; +$labels['aclx'] = 'Delete folder'; +$labels['acla'] = 'Administer'; + +$labels['aclfull'] = 'Full control'; +$labels['aclother'] = 'Other'; +$labels['aclread'] = 'Read'; +$labels['aclwrite'] = 'Write'; +$labels['acldelete'] = 'Delete'; + +$labels['shortacll'] = 'Lookup'; +$labels['shortaclr'] = 'Read'; +$labels['shortacls'] = 'Keep'; +$labels['shortaclw'] = 'Write'; +$labels['shortacli'] = 'Insert'; +$labels['shortaclp'] = 'Post'; +$labels['shortaclc'] = 'Create'; +$labels['shortaclk'] = 'Create'; +$labels['shortacld'] = 'Delete'; +$labels['shortaclt'] = 'Delete'; +$labels['shortacle'] = 'Expunge'; +$labels['shortaclx'] = 'Folder delete'; +$labels['shortacla'] = 'Administer'; + +$labels['shortaclother'] = 'Other'; +$labels['shortaclread'] = 'Read'; +$labels['shortaclwrite'] = 'Write'; +$labels['shortacldelete'] = 'Delete'; + +$labels['longacll'] = 'The folder is visible on lists and can be subscribed to'; +$labels['longaclr'] = 'The folder can be opened for reading'; +$labels['longacls'] = 'Messages Seen flag can be changed'; +$labels['longaclw'] = 'Messages flags and keywords can be changed, except Seen and Deleted'; +$labels['longacli'] = 'Messages can be written or copied to the folder'; +$labels['longaclp'] = 'Messages can be posted to this folder'; +$labels['longaclc'] = 'Folders can be created (or renamed) directly under this folder'; +$labels['longaclk'] = 'Folders can be created (or renamed) directly under this folder'; +$labels['longacld'] = 'Messages Delete flag can be changed'; +$labels['longaclt'] = 'Messages Delete flag can be changed'; +$labels['longacle'] = 'Messages can be expunged'; +$labels['longaclx'] = 'The folder can be deleted or renamed'; +$labels['longacla'] = 'The folder access rights can be changed'; + +$labels['longaclfull'] = 'Full control including folder administration'; +$labels['longaclread'] = 'The folder can be opened for reading'; +$labels['longaclwrite'] = 'Messages can be marked, written or copied to the folder'; +$labels['longacldelete'] = 'Messages can be deleted'; + +$messages['deleting'] = 'Deleting access rights...'; +$messages['saving'] = 'Saving access rights...'; +$messages['updatesuccess'] = 'Successfully changed access rights'; +$messages['deletesuccess'] = 'Successfully deleted access rights'; +$messages['createsuccess'] = 'Successfully added access rights'; +$messages['updateerror'] = 'Ubable to update access rights'; +$messages['deleteerror'] = 'Unable to delete access rights'; +$messages['createerror'] = 'Unable to add access rights'; +$messages['deleteconfirm'] = 'Are you sure, you want to remove access rights of selected user(s)?'; +$messages['norights'] = 'No rights has been specified!'; +$messages['nouser'] = 'No username has been specified!'; + +?> diff --git a/plugins/acl/localization/pl_PL.inc b/plugins/acl/localization/pl_PL.inc new file mode 100644 index 000000000..0b3689927 --- /dev/null +++ b/plugins/acl/localization/pl_PL.inc @@ -0,0 +1,83 @@ +<?php + +$labels['sharing'] = 'Udostępnianie'; +$labels['myrights'] = 'Prawa dostępu'; +$labels['username'] = 'Użytkownik:'; +$labels['advanced'] = 'tryb zaawansowany'; +$labels['newuser'] = 'Dodaj rekord'; +$labels['actions'] = 'Akcje na prawach...'; +$labels['anyone'] = 'Wszyscy (anyone)'; +$labels['anonymous'] = 'Goście (anonymous)'; +$labels['identifier'] = 'Identyfikator'; + +$labels['acll'] = 'Podgląd (Lookup)'; +$labels['aclr'] = 'Odczyt (Read)'; +$labels['acls'] = 'Zmiana stanu wiadomości (Keep)'; +$labels['aclw'] = 'Zmiana flag wiadomości (Write)'; +$labels['acli'] = 'Dodawanie/Kopiowanie do (Insert)'; +$labels['aclp'] = 'Wysyłanie (Post)'; +$labels['aclc'] = 'Tworzenie podfolderów (Create)'; +$labels['aclk'] = 'Tworzenie podfolderów (Create)'; +$labels['acld'] = 'Usuwanie wiadomości (Delete)'; +$labels['aclt'] = 'Usuwanie wiadomości (Delete)'; +$labels['acle'] = 'Porządkowanie folderu (Expunge)'; +$labels['aclx'] = 'Usuwanie folderu (Delete)'; +$labels['acla'] = 'Administracja (Administer)'; + +$labels['aclfull'] = 'Wszystkie'; +$labels['aclother'] = 'Inne'; +$labels['aclread'] = 'Odczyt'; +$labels['aclwrite'] = 'Zapis'; +$labels['acldelete'] = 'Usuwanie'; + +$labels['shortacll'] = 'Podgląd'; +$labels['shortaclr'] = 'Odczyt'; +$labels['shortacls'] = 'Zmiana'; +$labels['shortaclw'] = 'Zmiana flag'; +$labels['shortacli'] = 'Dodawanie'; +$labels['shortaclp'] = 'Wysyłanie'; +$labels['shortaclc'] = 'Tworzenie'; +$labels['shortaclk'] = 'Tworzenie'; +$labels['shortacld'] = 'Usuwanie'; +$labels['shortaclt'] = 'Usuwanie'; +$labels['shortacle'] = 'Porządkowanie'; +$labels['shortaclx'] = 'Usuwanie folderu'; +$labels['shortacla'] = 'Administracja'; + +$labels['shortaclother'] = 'Pozostałe'; +$labels['shortaclread'] = 'Odczyt'; +$labels['shortaclwrite'] = 'Zapis'; +$labels['shortacldelete'] = 'Usuwanie'; + +$labels['longacll'] = 'Pozwala na subskrybowanie folderu i powoduje, że jest on widoczny na liście'; +$labels['longaclr'] = 'Pozwala na otwarcie folderu w trybie do odczytu'; +$labels['longacls'] = 'Pozwala na zmienę stanu wiadomości'; +$labels['longaclw'] = 'Pozwala zmieniać wszystkie flagi wiadomości, oprócz "Przeczytano" i "Usunięto"'; +$labels['longacli'] = 'Pozwala zapisywać wiadomości i kopiować do folderu'; +$labels['longaclp'] = 'Pozwala wysyłać wiadomości do folderu'; +$labels['longaclc'] = 'Pozwala tworzyć (lub zmieniać nazwę) podfoldery'; +$labels['longaclk'] = 'Pozwala tworzyć (lub zmieniać nazwę) podfoldery'; +$labels['longacld'] = 'Pozwala zmianiać flagę "Usunięto" wiadomości'; +$labels['longaclt'] = 'Pozwala zmianiać flagę "Usunięto" wiadomości'; +$labels['longacle'] = 'Pozwala na usuwanie wiadomości oznaczonych do usunięcia'; +$labels['longaclx'] = 'Pozwala na zmianę nazwy lub usunięcie folderu'; +$labels['longacla'] = 'Pozwala na zmiane praw dostępu do folderu'; + +$labels['longaclfull'] = 'Pełna kontrola włącznie z administrowaniem folderem'; +$labels['longaclread'] = 'Folder może być otwarty w trybie do odczytu'; +$labels['longaclwrite'] = 'Wiadomości mogą być oznaczane, zapisywane i kopiowane do folderu'; +$labels['longacldelete'] = 'Wiadomości mogą być usuwane'; + +$messages['deleting'] = 'Usuwanie praw dostępu...'; +$messages['saving'] = 'Zapisywanie praw dostępu...'; +$messages['updatesuccess'] = 'Pomyślnie zmieniono prawa dostępu'; +$messages['deletesuccess'] = 'Pomyślnie usunięto prawa dostępu'; +$messages['createsuccess'] = 'Pomyślnie dodano prawa dostępu'; +$messages['updateerror'] = 'Nie udało się zmienić praw dostępu'; +$messages['deleteerror'] = 'Nie udało się usunąć praw dostępu'; +$messages['createerror'] = 'Nie udało się dodać praw dostępu'; +$messages['deleteconfirm'] = 'Czy na pewno chcesz usunąć prawa wybranym użytkownikom?'; +$messages['norights'] = 'Nie wybrano praw dostępu!'; +$messages['nouser'] = 'Nie podano nazwy użytkownika!'; + +?> diff --git a/plugins/acl/skins/default/acl.css b/plugins/acl/skins/default/acl.css new file mode 100644 index 000000000..cf3391f49 --- /dev/null +++ b/plugins/acl/skins/default/acl.css @@ -0,0 +1,100 @@ +#aclmanager +{ + position: relative; + border: 1px solid #999; + min-height: 302px; +} + +#aclcontainer +{ + overflow-x: auto; +} + +#acltable +{ + width: 100%; + border-collapse: collapse; + background-color: #F9F9F9; +} + +#acltable td +{ + width: 1%; + white-space: nowrap; +} + +#acltable thead td +{ + padding: 0 4px 0 2px; +} + +#acltable tbody td +{ + text-align: center; + padding: 2px; + border-bottom: 1px solid #999999; + cursor: default; +} + +#acltable tbody td.user +{ + width: 96%; + text-align: left; + overflow: hidden; + text-overflow: ellipsis; + -o-text-overflow: ellipsis; +} + +#acltable tbody td.partial +{ + background: url(images/partial.png) center no-repeat; +} + +#acltable tbody td.enabled +{ + background: url(images/enabled.png) center no-repeat; +} + +#acltable tr.selected td +{ + color: #FFFFFF; + background-color: #CC3333; +} + +#acltable tr.unfocused td +{ + color: #FFFFFF; + background-color: #929292; +} + +#acladvswitch +{ + position: absolute; + right: 4px; + text-align: right; + line-height: 22px; +} + +#acladvswitch input +{ + vertical-align: middle; +} + +#acladvswitch span +{ + display: block; +} + +#aclform +{ + top: 80px; + width: 480px; + padding: 10px; +} + +#aclform div +{ + padding: 0; + text-align: center; + clear: both; +} diff --git a/plugins/acl/skins/default/images/enabled.png b/plugins/acl/skins/default/images/enabled.png Binary files differnew file mode 100644 index 000000000..98215f68c --- /dev/null +++ b/plugins/acl/skins/default/images/enabled.png diff --git a/plugins/acl/skins/default/images/partial.png b/plugins/acl/skins/default/images/partial.png Binary files differnew file mode 100644 index 000000000..12023f057 --- /dev/null +++ b/plugins/acl/skins/default/images/partial.png diff --git a/plugins/acl/skins/default/templates/table.html b/plugins/acl/skins/default/templates/table.html new file mode 100644 index 000000000..2365ef757 --- /dev/null +++ b/plugins/acl/skins/default/templates/table.html @@ -0,0 +1,54 @@ +<!--[if lte IE 6]> + <style type="text/css"> + #aclmanager { height: expression(Math.min(302, parseInt(document.documentElement.clientHeight))+'px'); } + </style> +<![endif]--> + +<div id="aclmanager"> +<div id="aclcontainer" class="boxlistcontent" style="top:0"> + <roundcube:object name="acltable" id="acltable" class="records-table" /> +</div> +<div class="boxfooter"> + <roundcube:button command="acl-create" id="aclcreatelink" type="link" title="acl.newuser" class="buttonPas addgroup" classAct="button addgroup" content=" " /> + <roundcube:button name="aclmenulink" id="aclmenulink" type="link" title="acl.actions" class="button groupactions" onclick="show_aclmenu(); return false" content=" " /> + <roundcube:if condition="!in_array('acl_advanced_mode', (array)config:dont_override)" /> + <div id="acladvswitch" class="pagenav"> + <span><label for="acl-switch"><roundcube:label name="acl.advanced" /></label> + <input type="checkbox" id="acl-switch" onclick="rcmail.command('acl-mode-switch')"<roundcube:exp expression="config:acl_advanced_mode == true ? ' checked=checked' : ''" /> /> + </span> + </div> + <roundcube:endif /> +</div> +</div> + +<div id="aclmenu" class="popupmenu"> + <ul> + <li><roundcube:button command="acl-edit" label="edit" classAct="active" /></li> + <li><roundcube:button command="acl-delete" label="delete" classAct="active" /></li> + </ul> +</div> + +<div id="aclform" class="popupmenu"> + <fieldset class="thinbordered"><legend><roundcube:label name="acl.identifier" /></legend> + <roundcube:object name="acluser" class="toolbarmenu" id="acluser" size="35" /> + </fieldset> + <fieldset class="thinbordered"><legend><roundcube:label name="acl.myrights" /></legend> + <roundcube:object name="aclrights" class="toolbarmenu" /> + </fieldset> + <div> + <roundcube:button command="acl-cancel" type="input" class="button" label="cancel" /> + <roundcube:button command="acl-save" type="input" class="button mainaction" label="save" /> + </div> +</div> + +<script type="text/javascript"> +function show_aclmenu() +{ + if (!rcmail_ui) { + rcube_init_mail_ui(); + rcmail_ui.popups.aclmenu = {id:'aclmenu', above:1, obj: $('#aclmenu')}; + } + + rcmail_ui.show_popup('aclmenu'); +} +</script> diff --git a/plugins/additional_message_headers/additional_message_headers.php b/plugins/additional_message_headers/additional_message_headers.php new file mode 100644 index 000000000..80c58d58b --- /dev/null +++ b/plugins/additional_message_headers/additional_message_headers.php @@ -0,0 +1,43 @@ +<?php + +/** + * Additional Message Headers + * + * Very simple plugin which will add additional headers + * to or remove them from outgoing messages. + * + * Enable the plugin in config/main.inc.php and add your desired headers: + * $rcmail_config['additional_message_headers'] = array('User-Agent'); + * + * @version @package_version@ + * @author Ziba Scott + * @website http://roundcube.net + */ +class additional_message_headers extends rcube_plugin +{ + public $task = 'mail'; + + function init() + { + $this->add_hook('message_outgoing_headers', array($this, 'message_headers')); + } + + function message_headers($args) + { + $this->load_config(); + + // additional email headers + $additional_headers = rcmail::get_instance()->config->get('additional_message_headers',array()); + foreach($additional_headers as $header=>$value){ + if (null === $value) { + unset($args['headers'][$header]); + } else { + $args['headers'][$header] = $value; + } + } + + return $args; + } +} + +?> diff --git a/plugins/additional_message_headers/config.inc.php.dist b/plugins/additional_message_headers/config.inc.php.dist new file mode 100644 index 000000000..83ccd869c --- /dev/null +++ b/plugins/additional_message_headers/config.inc.php.dist @@ -0,0 +1,14 @@ +<?php + +// $rcmail_config['additional_message_headers']['X-Remote-Browser'] = $_SERVER['HTTP_USER_AGENT']; +// $rcmail_config['additional_message_headers']['X-Originating-IP'] = $_SERVER['REMOTE_ADDR']; +// $rcmail_config['additional_message_headers']['X-RoundCube-Server'] = $_SERVER['SERVER_ADDR']; + +// if( isset( $_SERVER['MACHINE_NAME'] )) { +// $rcmail_config['additional_message_headers']['X-RoundCube-Server'] .= ' (' . $_SERVER['MACHINE_NAME'] . ')'; +// } + +// To remove (e.g. X-Sender) message header use null value +// $rcmail_config['additional_message_headers']['X-Sender'] = null; + +?> diff --git a/plugins/additional_message_headers/package.xml b/plugins/additional_message_headers/package.xml new file mode 100644 index 000000000..d79dbaef1 --- /dev/null +++ b/plugins/additional_message_headers/package.xml @@ -0,0 +1,47 @@ +<?xml version="1.0" encoding="UTF-8"?> +<package packagerversion="1.9.0" version="2.0" xmlns="http://pear.php.net/dtd/package-2.0" xmlns:tasks="http://pear.php.net/dtd/tasks-1.0" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xsi:schemaLocation="http://pear.php.net/dtd/tasks-1.0 + http://pear.php.net/dtd/tasks-1.0.xsd + http://pear.php.net/dtd/package-2.0 + http://pear.php.net/dtd/package-2.0.xsd"> + <name>additional_message_headers</name> + <channel>pear.roundcube.net</channel> + <summary>Additional message headers for Roundcube</summary> + <description>Very simple plugin which will add additional headers to or remove them from outgoing messages.</description> + <lead> + <name>Ziba Scott</name> + <user>ziba</user> + <email>email@example.org</email> + <active>yes</active> + </lead> + <date>2010-01-16</date> + <time>18:19:33</time> + <version> + <release>1.1.0</release> + <api>1.1.0</api> + </version> + <stability> + <release>stable</release> + <api>stable</api> + </stability> + <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPL v2</license> + <notes>-</notes> + <contents> + <dir baseinstalldir="/" name="/"> + <file name="additional_message_headers.php" role="php"> + <tasks:replace from="@name@" to="name" type="package-info" /> + <tasks:replace from="@package_version@" to="version" type="package-info" /> + </file> + </dir> <!-- / --> + </contents> + <dependencies> + <required> + <php> + <min>5.2.1</min> + </php> + <pearinstaller> + <min>1.7.0</min> + </pearinstaller> + </required> + </dependencies> + <phprelease /> +</package> diff --git a/plugins/archive/archive.js b/plugins/archive/archive.js new file mode 100644 index 000000000..a83750819 --- /dev/null +++ b/plugins/archive/archive.js @@ -0,0 +1,34 @@ +/* + * Archive plugin script + * @version @package_version@ + */ + +function rcmail_archive(prop) +{ + if (!rcmail.env.uid && (!rcmail.message_list || !rcmail.message_list.get_selection().length)) + return; + + if (rcmail.env.mailbox != rcmail.env.archive_folder) + rcmail.command('moveto', rcmail.env.archive_folder); +} + +// callback for app-onload event +if (window.rcmail) { + rcmail.addEventListener('init', function(evt) { + + // register command (directly enable in message view mode) + rcmail.register_command('plugin.archive', rcmail_archive, (rcmail.env.uid && rcmail.env.mailbox != rcmail.env.archive_folder)); + + // add event-listener to message list + if (rcmail.message_list) + rcmail.message_list.addEventListener('select', function(list){ + rcmail.enable_command('plugin.archive', (list.get_selection().length > 0 && rcmail.env.mailbox != rcmail.env.archive_folder)); + }); + + // set css style for archive folder + var li; + if (rcmail.env.archive_folder && rcmail.env.archive_folder_icon && (li = rcmail.get_folder_li(rcmail.env.archive_folder))) + $(li).css('background-image', 'url(' + rcmail.env.archive_folder_icon + ')'); + }) +} + diff --git a/plugins/archive/archive.php b/plugins/archive/archive.php new file mode 100644 index 000000000..a56806263 --- /dev/null +++ b/plugins/archive/archive.php @@ -0,0 +1,124 @@ +<?php + +/** + * Archive + * + * Plugin that adds a new button to the mailbox toolbar + * to move messages to a (user selectable) archive folder. + * + * @version @package_version@ + * @author Andre Rodier, Thomas Bruederli + */ +class archive extends rcube_plugin +{ + public $task = 'mail|settings'; + + function init() + { + $rcmail = rcmail::get_instance(); + + // There is no "Archived flags" + // $GLOBALS['IMAP_FLAGS']['ARCHIVED'] = 'Archive'; + if ($rcmail->task == 'mail' && ($rcmail->action == '' || $rcmail->action == 'show') + && ($archive_folder = $rcmail->config->get('archive_mbox'))) { + $skin_path = $this->local_skin_path(); + + $this->include_script('archive.js'); + $this->add_texts('localization', true); + $this->add_button( + array( + 'command' => 'plugin.archive', + 'imagepas' => $skin_path.'/archive_pas.png', + 'imageact' => $skin_path.'/archive_act.png', + 'width' => 32, + 'height' => 32, + 'title' => 'buttontitle', + 'domain' => $this->ID, + ), + 'toolbar'); + + // register hook to localize the archive folder + $this->add_hook('render_mailboxlist', array($this, 'render_mailboxlist')); + + // set env variable for client + $rcmail->output->set_env('archive_folder', $archive_folder); + $rcmail->output->set_env('archive_folder_icon', $this->url($skin_path.'/foldericon.png')); + + // add archive folder to the list of default mailboxes + if (($default_folders = $rcmail->config->get('default_imap_folders')) && !in_array($archive_folder, $default_folders)) { + $default_folders[] = $archive_folder; + $rcmail->config->set('default_imap_folders', $default_folders); + } + } + else if ($rcmail->task == 'settings') { + $dont_override = $rcmail->config->get('dont_override', array()); + if (!in_array('archive_mbox', $dont_override)) { + $this->add_hook('preferences_list', array($this, 'prefs_table')); + $this->add_hook('preferences_save', array($this, 'save_prefs')); + } + } + } + + function render_mailboxlist($p) + { + $rcmail = rcmail::get_instance(); + $archive_folder = $rcmail->config->get('archive_mbox'); + + // set localized name for the configured archive folder + if ($archive_folder) { + if (isset($p['list'][$archive_folder])) + $p['list'][$archive_folder]['name'] = $this->gettext('archivefolder'); + else // search in subfolders + $this->_mod_folder_name($p['list'], $archive_folder, $this->gettext('archivefolder')); + } + + return $p; + } + + function _mod_folder_name(&$list, $folder, $new_name) + { + foreach ($list as $idx => $item) { + if ($item['id'] == $folder) { + $list[$idx]['name'] = $new_name; + return true; + } else if (!empty($item['folders'])) + if ($this->_mod_folder_name($list[$idx]['folders'], $folder, $new_name)) + return true; + } + return false; + } + + function prefs_table($args) + { + global $CURR_SECTION; + + if ($args['section'] == 'folders') { + $this->add_texts('localization'); + + $rcmail = rcmail::get_instance(); + + // load folders list when needed + if ($CURR_SECTION) + $select = rcmail_mailbox_select(array('noselection' => '---', 'realnames' => true, + 'maxlength' => 30, 'exceptions' => array('INBOX'), 'folder_filter' => 'mail', 'folder_rights' => 'w')); + else + $select = new html_select(); + + $args['blocks']['main']['options']['archive_mbox'] = array( + 'title' => $this->gettext('archivefolder'), + 'content' => $select->show($rcmail->config->get('archive_mbox'), array('name' => "_archive_mbox")) + ); + } + + return $args; + } + + function save_prefs($args) + { + if ($args['section'] == 'folders') { + $args['prefs']['archive_mbox'] = get_input_value('_archive_mbox', RCUBE_INPUT_POST); + return $args; + } + } + +} diff --git a/plugins/archive/localization/cs_CZ.inc b/plugins/archive/localization/cs_CZ.inc new file mode 100644 index 000000000..bb257bca0 --- /dev/null +++ b/plugins/archive/localization/cs_CZ.inc @@ -0,0 +1,25 @@ +<?php + +/* + ++-----------------------------------------------------------------------+ +| language/cs_CZ/labels.inc | +| | +| Language file of the Roundcube archive plugin | +| Copyright (C) 2005-2009, The Roundcube Dev Team | +| Licensed under the GNU GPL | +| | ++-----------------------------------------------------------------------+ +| Author: Milan Kozak <hodza@hodza.net> | ++-----------------------------------------------------------------------+ + +@version $Id: labels.inc 2993 2009-09-26 18:32:07Z alec $ + +*/ + +$labels = array(); +$labels['buttontitle'] = 'Archivovat zprávu'; +$labels['archived'] = 'Úspěšně vloženo do archivu'; +$labels['archivefolder'] = 'Archiv'; + +?> diff --git a/plugins/archive/localization/de_CH.inc b/plugins/archive/localization/de_CH.inc new file mode 100644 index 000000000..2ed0f5ac8 --- /dev/null +++ b/plugins/archive/localization/de_CH.inc @@ -0,0 +1,8 @@ +<?php + +$labels = array(); +$labels['buttontitle'] = 'Nachricht archivieren'; +$labels['archived'] = 'Nachricht erfolgreich archiviert'; +$labels['archivefolder'] = 'Archiv'; + +?> diff --git a/plugins/archive/localization/de_DE.inc b/plugins/archive/localization/de_DE.inc new file mode 100644 index 000000000..2ed0f5ac8 --- /dev/null +++ b/plugins/archive/localization/de_DE.inc @@ -0,0 +1,8 @@ +<?php + +$labels = array(); +$labels['buttontitle'] = 'Nachricht archivieren'; +$labels['archived'] = 'Nachricht erfolgreich archiviert'; +$labels['archivefolder'] = 'Archiv'; + +?> diff --git a/plugins/archive/localization/en_US.inc b/plugins/archive/localization/en_US.inc new file mode 100644 index 000000000..fce31a0b5 --- /dev/null +++ b/plugins/archive/localization/en_US.inc @@ -0,0 +1,8 @@ +<?php + +$labels = array(); +$labels['buttontitle'] = 'Archive this message'; +$labels['archived'] = 'Successfully archived'; +$labels['archivefolder'] = 'Archive'; + +?> diff --git a/plugins/archive/localization/es_AR.inc b/plugins/archive/localization/es_AR.inc new file mode 100644 index 000000000..7d021f561 --- /dev/null +++ b/plugins/archive/localization/es_AR.inc @@ -0,0 +1,10 @@ +<?php + +// MPBAUPGRADE + +$labels = array(); +$labels['buttontitle'] = 'Archivar este mensaje'; +$labels['archived'] = 'Mensaje Archivado'; +$labels['archivefolder'] = 'Archivo'; + +?> diff --git a/plugins/archive/localization/es_ES.inc b/plugins/archive/localization/es_ES.inc new file mode 100644 index 000000000..7d021f561 --- /dev/null +++ b/plugins/archive/localization/es_ES.inc @@ -0,0 +1,10 @@ +<?php + +// MPBAUPGRADE + +$labels = array(); +$labels['buttontitle'] = 'Archivar este mensaje'; +$labels['archived'] = 'Mensaje Archivado'; +$labels['archivefolder'] = 'Archivo'; + +?> diff --git a/plugins/archive/localization/et_EE.inc b/plugins/archive/localization/et_EE.inc new file mode 100644 index 000000000..e3968d755 --- /dev/null +++ b/plugins/archive/localization/et_EE.inc @@ -0,0 +1,8 @@ +<?php + +$labels = array(); +$labels['buttontitle'] = 'Arhiveeri see kiri'; +$labels['archived'] = 'Edukalt arhiveeritud'; +$labels['archivefolder'] = 'Arhiveeri'; + +?> diff --git a/plugins/archive/localization/fr_FR.inc b/plugins/archive/localization/fr_FR.inc new file mode 100644 index 000000000..f44f30f44 --- /dev/null +++ b/plugins/archive/localization/fr_FR.inc @@ -0,0 +1,8 @@ +<?php + +$labels = array(); +$labels['buttontitle'] = 'Archiver ce message'; +$labels['archived'] = 'Message archiv avec success'; +$labels['archivefolder'] = 'Archive'; + +?> diff --git a/plugins/archive/localization/gl_ES.inc b/plugins/archive/localization/gl_ES.inc new file mode 100644 index 000000000..62a767869 --- /dev/null +++ b/plugins/archive/localization/gl_ES.inc @@ -0,0 +1,10 @@ +<?php + +// MPBAUPGRADE + +$labels = array(); +$labels['buttontitle'] = 'Arquivar esta mensaxe'; +$labels['archived'] = 'Aquivouse a mensaxe'; +$labels['archivefolder'] = 'Arquivo'; + +?> diff --git a/plugins/archive/localization/ja_JP.inc b/plugins/archive/localization/ja_JP.inc new file mode 100644 index 000000000..31fa15267 --- /dev/null +++ b/plugins/archive/localization/ja_JP.inc @@ -0,0 +1,10 @@ +<?php + +// EN-Revision: 3891 + +$labels = array(); +$labels['buttontitle'] = 'このメッセージのアーカイブ'; +$labels['archived'] = 'アーカイブに成功しました。'; +$labels['archivefolder'] = 'アーカイブ'; + +?> diff --git a/plugins/archive/localization/nl_NL.inc b/plugins/archive/localization/nl_NL.inc new file mode 100644 index 000000000..0d47f7b9c --- /dev/null +++ b/plugins/archive/localization/nl_NL.inc @@ -0,0 +1,8 @@ +<?php + +$labels = array(); +$labels['buttontitle'] = 'Archiveer dit bericht'; +$labels['archived'] = 'Succesvol gearchiveerd'; +$labels['archivefolder'] = 'Archief'; + +?> diff --git a/plugins/archive/localization/pl_PL.inc b/plugins/archive/localization/pl_PL.inc new file mode 100644 index 000000000..2ecc77991 --- /dev/null +++ b/plugins/archive/localization/pl_PL.inc @@ -0,0 +1,8 @@ +<?php + +$labels = array(); +$labels['buttontitle'] = 'Przenieś do archiwum'; +$labels['archived'] = 'Pomyślnie zarchiwizowano'; +$labels['archivefolder'] = 'Archiwum'; + +?> diff --git a/plugins/archive/localization/pt_BR.inc b/plugins/archive/localization/pt_BR.inc new file mode 100644 index 000000000..224f53caa --- /dev/null +++ b/plugins/archive/localization/pt_BR.inc @@ -0,0 +1,8 @@ +<?php + +$labels = array(); +$labels['buttontitle'] = 'Arquivar esta mensagem'; +$labels['archived'] = 'Arquivada com sucesso'; +$labels['archivefolder'] = 'Arquivo'; + +?> diff --git a/plugins/archive/localization/ru_RU.inc b/plugins/archive/localization/ru_RU.inc new file mode 100644 index 000000000..e377ad017 --- /dev/null +++ b/plugins/archive/localization/ru_RU.inc @@ -0,0 +1,8 @@ +<?php + +$labels = array(); +$labels['buttontitle'] = 'Переместить выбранное в архив'; +$labels['archived'] = 'Перенесено в Архив'; +$labels['archivefolder'] = 'Архив'; + +?> diff --git a/plugins/archive/localization/sv_SE.inc b/plugins/archive/localization/sv_SE.inc new file mode 100644 index 000000000..c55da7aaf --- /dev/null +++ b/plugins/archive/localization/sv_SE.inc @@ -0,0 +1,8 @@ +<?php + +$labels = array(); +$labels['buttontitle'] = 'Arkivera meddelande'; +$labels['archived'] = 'Meddelandet är arkiverat'; +$labels['archivefolder'] = 'Arkiv'; + +?> diff --git a/plugins/archive/localization/zh_TW.inc b/plugins/archive/localization/zh_TW.inc new file mode 100644 index 000000000..5cccebbdc --- /dev/null +++ b/plugins/archive/localization/zh_TW.inc @@ -0,0 +1,8 @@ +<?php + +$labels = array(); +$labels['buttontitle'] = '封存此信件'; +$labels['archived'] = '已成功封存'; +$labels['archivefolder'] = '封存'; + +?> diff --git a/plugins/archive/package.xml b/plugins/archive/package.xml new file mode 100644 index 000000000..c442a5c4d --- /dev/null +++ b/plugins/archive/package.xml @@ -0,0 +1,64 @@ +<?xml version="1.0" encoding="UTF-8"?> +<package xmlns="http://pear.php.net/dtd/package-2.0" xmlns:tasks="http://pear.php.net/dtd/tasks-1.0" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" packagerversion="1.9.0" version="2.0" xsi:schemaLocation="http://pear.php.net/dtd/tasks-1.0 + http://pear.php.net/dtd/tasks-1.0.xsd + http://pear.php.net/dtd/package-2.0 + http://pear.php.net/dtd/package-2.0.xsd"> + <name>archive</name> + <channel>pear.roundcube.net</channel> + <summary>Archive feature for Roundcube</summary> + <description>This adds a button to move the selected messages to an archive folder. The folder can be selected in the settings panel.</description> + <lead> + <name>Thomas Bruederli</name> + <user>thomasb</user> + <email>roundcube@gmail.com</email> + <active>yes</active> + </lead> + <date>2010-02-06</date> + <time>12:12:00</time> + <version> + <release>1.4</release> + <api>1.4</api> + </version> + <stability> + <release>stable</release> + <api>stable</api> + </stability> + <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license> + <notes>-</notes> + <contents> + <dir baseinstalldir="/" name="/"> + <file name="archive.php" role="php"> + <tasks:replace from="@name@" to="name" type="package-info"/> + <tasks:replace from="@package_version@" to="version" type="package-info"/> + </file> + <file name="archive.js" role="data"> + <tasks:replace from="@name@" to="name" type="package-info"/> + <tasks:replace from="@package_version@" to="version" type="package-info"/> + </file> + <file name="localization/en_US.inc" role="data"></file> + <file name="localization/cs_CZ.inc" role="data"></file> + <file name="localization/de_CH.inc" role="data"></file> + <file name="localization/de_DE.inc" role="data"></file> + <file name="localization/et_EE.inc" role="data"></file> + <file name="localization/fr_FR.inc" role="data"></file> + <file name="localization/pl_PL.inc" role="data"></file> + <file name="localization/ru_RU.inc" role="data"></file> + <file name="localization/zh_TW.inc" role="data"></file> + <file name="skins/default/archive_act.png" role="data"></file> + <file name="skins/default/archive_pas.png" role="data"></file> + <file name="skins/default/foldericon.png" role="data"></file> + </dir> + <!-- / --> + </contents> + <dependencies> + <required> + <php> + <min>5.2.1</min> + </php> + <pearinstaller> + <min>1.7.0</min> + </pearinstaller> + </required> + </dependencies> + <phprelease/> +</package> diff --git a/plugins/archive/skins/default/archive_act.png b/plugins/archive/skins/default/archive_act.png Binary files differnew file mode 100644 index 000000000..2a1735868 --- /dev/null +++ b/plugins/archive/skins/default/archive_act.png diff --git a/plugins/archive/skins/default/archive_pas.png b/plugins/archive/skins/default/archive_pas.png Binary files differnew file mode 100644 index 000000000..8de208583 --- /dev/null +++ b/plugins/archive/skins/default/archive_pas.png diff --git a/plugins/archive/skins/default/foldericon.png b/plugins/archive/skins/default/foldericon.png Binary files differnew file mode 100644 index 000000000..ec0853c44 --- /dev/null +++ b/plugins/archive/skins/default/foldericon.png diff --git a/plugins/autologon/autologon.php b/plugins/autologon/autologon.php new file mode 100644 index 000000000..9601d61a6 --- /dev/null +++ b/plugins/autologon/autologon.php @@ -0,0 +1,47 @@ +<?php + +/** + * Sample plugin to try out some hooks. + * This performs an automatic login if accessed from localhost + */ +class autologon extends rcube_plugin +{ + public $task = 'login'; + + function init() + { + $this->add_hook('startup', array($this, 'startup')); + $this->add_hook('authenticate', array($this, 'authenticate')); + } + + function startup($args) + { + $rcmail = rcmail::get_instance(); + + // change action to login + if (empty($_SESSION['user_id']) && !empty($_GET['_autologin']) && $this->is_localhost()) + $args['action'] = 'login'; + + return $args; + } + + function authenticate($args) + { + if (!empty($_GET['_autologin']) && $this->is_localhost()) { + $args['user'] = 'me'; + $args['pass'] = '******'; + $args['host'] = 'localhost'; + $args['cookiecheck'] = false; + $args['valid'] = true; + } + + return $args; + } + + function is_localhost() + { + return $_SERVER['REMOTE_ADDR'] == '::1' || $_SERVER['REMOTE_ADDR'] == '127.0.0.1'; + } + +} + diff --git a/plugins/database_attachments/database_attachments.php b/plugins/database_attachments/database_attachments.php new file mode 100644 index 000000000..32461cff6 --- /dev/null +++ b/plugins/database_attachments/database_attachments.php @@ -0,0 +1,168 @@ +<?php +/** + * Filesystem Attachments + * + * This plugin which provides database backed storage for temporary + * attachment file handling. The primary advantage of this plugin + * is its compatibility with round-robin dns multi-server roundcube + * installations. + * + * This plugin relies on the core filesystem_attachments plugin + * + * @author Ziba Scott <ziba@umich.edu> + * + */ +require_once('plugins/filesystem_attachments/filesystem_attachments.php'); +class database_attachments extends filesystem_attachments +{ + + // A prefix for the cache key used in the session and in the key field of the cache table + private $cache_prefix = "db_attach"; + + /** + * Helper method to generate a unique key for the given attachment file + */ + private function _key($args) + { + $uname = $args['path'] ? $args['path'] : $args['name']; + return $this->cache_prefix . $args['group'] . md5(mktime() . $uname . $_SESSION['user_id']); + } + + /** + * Save a newly uploaded attachment + */ + function upload($args) + { + $args['status'] = false; + $rcmail = rcmail::get_instance(); + $key = $this->_key($args); + + $data = file_get_contents($args['path']); + + if ($data === false) + return $args; + + $data = base64_encode($data); + + $status = $rcmail->db->query( + "INSERT INTO ".get_table_name('cache')." + (created, user_id, cache_key, data) + VALUES (".$rcmail->db->now().", ?, ?, ?)", + $_SESSION['user_id'], + $key, + $data); + + if ($status) { + $args['id'] = $key; + $args['status'] = true; + unset($args['path']); + } + + return $args; + } + + /** + * Save an attachment from a non-upload source (draft or forward) + */ + function save($args) + { + $args['status'] = false; + $rcmail = rcmail::get_instance(); + + $key = $this->_key($args); + + if ($args['path']) { + $args['data'] = file_get_contents($args['path']); + + if ($args['data'] === false) + return $args; + } + + $data = base64_encode($args['data']); + + $status = $rcmail->db->query( + "INSERT INTO ".get_table_name('cache')." + (created, user_id, cache_key, data) + VALUES (".$rcmail->db->now().", ?, ?, ?)", + $_SESSION['user_id'], + $key, + $data); + + if ($status) { + $args['id'] = $key; + $args['status'] = true; + } + + return $args; + } + + /** + * Remove an attachment from storage + * This is triggered by the remove attachment button on the compose screen + */ + function remove($args) + { + $args['status'] = false; + $rcmail = rcmail::get_instance(); + $status = $rcmail->db->query( + "DELETE FROM ".get_table_name('cache')." + WHERE user_id=? + AND cache_key=?", + $_SESSION['user_id'], + $args['id']); + + if ($status) { + $args['status'] = true; + } + + return $args; + } + + /** + * When composing an html message, image attachments may be shown + * For this plugin, $this->get() will check the file and + * return it's contents + */ + function display($args) + { + return $this->get($args); + } + + /** + * When displaying or sending the attachment the file contents are fetched + * using this method. This is also called by the attachment_display hook. + */ + function get($args) + { + $rcmail = rcmail::get_instance(); + + $sql_result = $rcmail->db->query( + "SELECT cache_id, data + FROM ".get_table_name('cache')." + WHERE user_id=? + AND cache_key=?", + $_SESSION['user_id'], + $args['id']); + + if ($sql_arr = $rcmail->db->fetch_assoc($sql_result)) { + $args['data'] = base64_decode($sql_arr['data']); + $args['status'] = true; + } + + return $args; + } + + /** + * Delete all temp files associated with this user + */ + function cleanup($args) + { + $prefix = $this->cache_prefix . $args['group']; + $rcmail = rcmail::get_instance(); + $rcmail->db->query( + "DELETE FROM ".get_table_name('cache')." + WHERE user_id=? + AND cache_key like '{$prefix}%'", + $_SESSION['user_id']); + } +} diff --git a/plugins/debug_logger/debug_logger.php b/plugins/debug_logger/debug_logger.php new file mode 100644 index 000000000..f04ba6a61 --- /dev/null +++ b/plugins/debug_logger/debug_logger.php @@ -0,0 +1,146 @@ +<?php + +/** + * Debug Logger + * + * Enhanced logging for debugging purposes. It is not recommened + * to be enabled on production systems without testing because of + * the somewhat increased memory, cpu and disk i/o overhead. + * + * Debug Logger listens for existing console("message") calls and + * introduces start and end tags as well as free form tagging + * which can redirect messages to files. The resulting log files + * provide timing and tag quantity results. + * + * Enable the plugin in config/main.inc.php and add your desired + * log types and files. + * + * @version 1.0 + * @author Ziba Scott + * @website http://roundcube.net + * + * Example: + * + * config/main.inc.php: + * + * // $rcmail_config['debug_logger'][type of logging] = name of file in log_dir + * // The 'master' log includes timing information + * $rcmail_config['debug_logger']['master'] = 'master'; + * // If you want sql messages to also go into a separate file + * $rcmail_config['debug_logger']['sql'] = 'sql'; + * + * index.php (just after $RCMAIL->plugins->init()): + * + * console("my test","start"); + * console("my message"); + * console("my sql calls","start"); + * console("cp -r * /dev/null","shell exec"); + * console("select * from example","sql"); + * console("select * from example","sql"); + * console("select * from example","sql"); + * console("end"); + * console("end"); + * + * + * logs/master (after reloading the main page): + * + * [17-Feb-2009 16:51:37 -0500] start: Task: mail. + * [17-Feb-2009 16:51:37 -0500] start: my test + * [17-Feb-2009 16:51:37 -0500] my message + * [17-Feb-2009 16:51:37 -0500] shell exec: cp -r * /dev/null + * [17-Feb-2009 16:51:37 -0500] start: my sql calls + * [17-Feb-2009 16:51:37 -0500] sql: select * from example + * [17-Feb-2009 16:51:37 -0500] sql: select * from example + * [17-Feb-2009 16:51:37 -0500] sql: select * from example + * [17-Feb-2009 16:51:37 -0500] end: my sql calls - 0.0018 seconds shell exec: 1, sql: 3, + * [17-Feb-2009 16:51:37 -0500] end: my test - 0.0055 seconds shell exec: 1, sql: 3, + * [17-Feb-2009 16:51:38 -0500] end: Task: mail. - 0.8854 seconds shell exec: 1, sql: 3, + * + * logs/sql (after reloading the main page): + * + * [17-Feb-2009 16:51:37 -0500] sql: select * from example + * [17-Feb-2009 16:51:37 -0500] sql: select * from example + * [17-Feb-2009 16:51:37 -0500] sql: select * from example + */ +class debug_logger extends rcube_plugin +{ + function init() + { + require_once(dirname(__FILE__).'/runlog/runlog.php'); + $this->runlog = new runlog(); + + if(!rcmail::get_instance()->config->get('log_dir')){ + rcmail::get_instance()->config->set('log_dir',INSTALL_PATH.'logs'); + } + + $log_config = rcmail::get_instance()->config->get('debug_logger',array()); + + foreach($log_config as $type=>$file){ + $this->runlog->set_file(rcmail::get_instance()->config->get('log_dir').'/'.$file, $type); + } + + $start_string = ""; + $action = rcmail::get_instance()->action; + $task = rcmail::get_instance()->task; + if($action){ + $start_string .= "Action: ".$action.". "; + } + if($task){ + $start_string .= "Task: ".$task.". "; + } + $this->runlog->start($start_string); + + $this->add_hook('console', array($this, 'console')); + $this->add_hook('authenticate', array($this, 'authenticate')); + } + + function authenticate($args){ + $this->runlog->note('Authenticating '.$args['user'].'@'.$args['host']); + return $args; + } + + function console($args){ + $note = $args[0]; + $type = $args[1]; + + + if(!isset($args[1])){ + // This could be extended to detect types based on the + // file which called console. For now only rcube_imap.inc is supported + $bt = debug_backtrace(); + $file = $bt[3]['file']; + switch(basename($file)){ + case 'rcube_imap.php': + $type = 'imap'; + break; + default: + $type = FALSE; + break; + } + } + switch($note){ + case 'end': + $type = 'end'; + break; + } + + + switch($type){ + case 'start': + $this->runlog->start($note); + break; + case 'end': + $this->runlog->end(); + break; + default: + $this->runlog->note($note, $type); + break; + } + return $args; + } + + function __destruct(){ + $this->runlog->end(); + } +} +?> diff --git a/plugins/debug_logger/runlog/runlog.php b/plugins/debug_logger/runlog/runlog.php new file mode 100644 index 000000000..c9f672615 --- /dev/null +++ b/plugins/debug_logger/runlog/runlog.php @@ -0,0 +1,227 @@ +<?php + +/** + * runlog + * + * @author Ziba Scott <ziba@umich.edu> + */ +class runlog { + + private $start_time = FALSE; + + private $parent_stack = array(); + + public $print_to_console = FALSE; + + private $file_handles = array(); + + private $indent = 0; + + public $threshold = 0; + + public $tag_count = array(); + + public $timestamp = "d-M-Y H:i:s O"; + + public $max_line_size = 150; + + private $run_log = array(); + + function runlog() + { + $this->start_time = microtime( TRUE ); + } + + public function start( $name, $tag = FALSE ) + { + $this->run_log[] = array( 'type' => 'start', + 'tag' => $tag, + 'index' => count($this->run_log), + 'value' => $name, + 'time' => microtime( TRUE ), + 'parents' => $this->parent_stack, + 'ended' => false, + ); + $this->parent_stack[] = $name; + + $this->print_to_console("start: ".$name, $tag, 'start'); + $this->print_to_file("start: ".$name, $tag, 'start'); + $this->indent++; + } + + public function end() + { + $name = array_pop( $this->parent_stack ); + foreach ( $this->run_log as $k => $entry ) { + if ( $entry['value'] == $name && $entry['type'] == 'start' && $entry['ended'] == false) { + $lastk = $k; + } + } + $start = $this->run_log[$lastk]['time']; + $this->run_log[$lastk]['duration'] = microtime( TRUE ) - $start; + $this->run_log[$lastk]['ended'] = true; + + $this->run_log[] = array( 'type' => 'end', + 'tag' => $this->run_log[$lastk]['tag'], + 'index' => $lastk, + 'value' => $name, + 'time' => microtime( TRUE ), + 'duration' => microtime( TRUE ) - $start, + 'parents' => $this->parent_stack, + ); + $this->indent--; + if($this->run_log[$lastk]['duration'] >= $this->threshold){ + $tag_report = ""; + foreach($this->tag_count as $tag=>$count){ + $tag_report .= "$tag: $count, "; + } + if(!empty($tag_report)){ +// $tag_report = "\n$tag_report\n"; + } + $end_txt = sprintf("end: $name - %0.4f seconds $tag_report", $this->run_log[$lastk]['duration'] ); + $this->print_to_console($end_txt, $this->run_log[$lastk]['tag'] , 'end'); + $this->print_to_file($end_txt, $this->run_log[$lastk]['tag'], 'end'); + } + } + + public function increase_tag_count($tag){ + if(!isset($this->tag_count[$tag])){ + $this->tag_count[$tag] = 0; + } + $this->tag_count[$tag]++; + } + + public function get_text(){ + $text = ""; + foreach($this->run_log as $entry){ + $text .= str_repeat(" ",count($entry['parents'])); + if($entry['tag'] != 'text'){ + $text .= $entry['tag'].': '; + } + $text .= $entry['value']; + + if($entry['tag'] == 'end'){ + $text .= sprintf(" - %0.4f seconds", $entry['duration'] ); + } + + $text .= "\n"; + } + return $text; + } + + public function set_file($filename, $tag = 'master'){ + if(!isset($this->file_handle[$tag])){ + $this->file_handles[$tag] = fopen($filename, 'a'); + if(!$this->file_handles[$tag]){ + trigger_error('Could not open file for writing: '.$filename); + } + } + } + + public function note( $msg, $tag = FALSE ) + { + if($tag){ + $this->increase_tag_count($tag); + } + if ( is_array( $msg )) { + $msg = '<pre>' . print_r( $msg, TRUE ) . '</pre>'; + } + $this->debug_messages[] = $msg; + $this->run_log[] = array( 'type' => 'note', + 'tag' => $tag ? $tag:"text", + 'value' => htmlentities($msg), + 'time' => microtime( TRUE ), + 'parents' => $this->parent_stack, + ); + + $this->print_to_file($msg, $tag); + $this->print_to_console($msg, $tag); + + } + + public function print_to_file($msg, $tag = FALSE, $type = FALSE){ + if(!$tag){ + $file_handle_tag = 'master'; + } + else{ + $file_handle_tag = $tag; + } + if($file_handle_tag != 'master' && isset($this->file_handles[$file_handle_tag])){ + $buffer = $this->get_indent(); + $buffer .= "$msg\n"; + if(!empty($this->timestamp)){ + $buffer = sprintf("[%s] %s",date($this->timestamp, mktime()), $buffer); + } + fwrite($this->file_handles[$file_handle_tag], wordwrap($buffer, $this->max_line_size, "\n ")); + } + if(isset($this->file_handles['master']) && $this->file_handles['master']){ + $buffer = $this->get_indent(); + if($tag){ + $buffer .= "$tag: "; + } + $msg = str_replace("\n","",$msg); + $buffer .= "$msg"; + if(!empty($this->timestamp)){ + $buffer = sprintf("[%s] %s",date($this->timestamp, mktime()), $buffer); + } + if(strlen($buffer) > $this->max_line_size){ + $buffer = substr($buffer,0,$this->max_line_size - 3)."..."; + } + fwrite($this->file_handles['master'], $buffer."\n"); + } + } + + public function print_to_console($msg, $tag=FALSE){ + if($this->print_to_console){ + if(is_array($this->print_to_console)){ + if(in_array($tag, $this->print_to_console)){ + echo $this->get_indent(); + if($tag){ + echo "$tag: "; + } + echo "$msg\n"; + } + } + else{ + echo $this->get_indent(); + if($tag){ + echo "$tag: "; + } + echo "$msg\n"; + } + } + } + + public function print_totals(){ + $totals = array(); + foreach ( $this->run_log as $k => $entry ) { + if ( $entry['type'] == 'start' && $entry['ended'] == true) { + $totals[$entry['value']]['duration'] += $entry['duration']; + $totals[$entry['value']]['count'] += 1; + } + } + if($this->file_handle){ + foreach($totals as $name=>$details){ + fwrite($this->file_handle,$name.": ".number_format($details['duration'],4)."sec, ".$details['count']." calls \n"); + } + } + } + + private function get_indent(){ + $buf = ""; + for($i = 0; $i < $this->indent; $i++){ + $buf .= " "; + } + return $buf; + } + + + function __destruct(){ + foreach($this->file_handles as $handle){ + fclose($handle); + } + } + +} + +?> diff --git a/plugins/emoticons/emoticons.php b/plugins/emoticons/emoticons.php new file mode 100644 index 000000000..95f5ecf39 --- /dev/null +++ b/plugins/emoticons/emoticons.php @@ -0,0 +1,77 @@ +<?php + +/** + * Display Emoticons + * + * Sample plugin to replace emoticons in plain text message body with real icons + * + * @version 1.3 + * @author Thomas Bruederli + * @author Aleksander Machniak + * @website http://roundcube.net + */ +class emoticons extends rcube_plugin +{ + public $task = 'mail'; + + function init() + { + $this->add_hook('message_part_after', array($this, 'replace')); + } + + function replace($args) + { + // This is a lookbehind assertion which will exclude html entities + // E.g. situation when ";)" in "")" shouldn't be replaced by the icon + // It's so long because of assertion format restrictions + $entity = '(?<!&' + . '[a-zA-Z0-9]{2}' . '|' . '#[0-9]{2}' . '|' + . '[a-zA-Z0-9]{3}' . '|' . '#[0-9]{3}' . '|' + . '[a-zA-Z0-9]{4}' . '|' . '#[0-9]{4}' . '|' + . '[a-zA-Z0-9]{5}' . '|' + . '[a-zA-Z0-9]{6}' . '|' + . '[a-zA-Z0-9]{7}' + . ')'; + + // map of emoticon replacements + $map = array( + '/:\)/' => $this->img_tag('smiley-smile.gif', ':)' ), + '/:-\)/' => $this->img_tag('smiley-smile.gif', ':-)' ), + '/(?<!mailto):D/' => $this->img_tag('smiley-laughing.gif', ':D' ), + '/:-D/' => $this->img_tag('smiley-laughing.gif', ':-D' ), + '/:\(/' => $this->img_tag('smiley-frown.gif', ':(' ), + '/:-\(/' => $this->img_tag('smiley-frown.gif', ':-(' ), + '/'.$entity.';\)/' => $this->img_tag('smiley-wink.gif', ';)' ), + '/'.$entity.';-\)/' => $this->img_tag('smiley-wink.gif', ';-)' ), + '/8\)/' => $this->img_tag('smiley-cool.gif', '8)' ), + '/8-\)/' => $this->img_tag('smiley-cool.gif', '8-)' ), + '/(?<!mailto):O/i' => $this->img_tag('smiley-surprised.gif', ':O' ), + '/(?<!mailto):-O/i' => $this->img_tag('smiley-surprised.gif', ':-O' ), + '/(?<!mailto):P/i' => $this->img_tag('smiley-tongue-out.gif', ':P' ), + '/(?<!mailto):-P/i' => $this->img_tag('smiley-tongue-out.gif', ':-P' ), + '/(?<!mailto):@/i' => $this->img_tag('smiley-yell.gif', ':@' ), + '/(?<!mailto):-@/i' => $this->img_tag('smiley-yell.gif', ':-@' ), + '/O:\)/i' => $this->img_tag('smiley-innocent.gif', 'O:)' ), + '/O:-\)/i' => $this->img_tag('smiley-innocent.gif', 'O:-)' ), + '/(?<!mailto):$/' => $this->img_tag('smiley-embarassed.gif', ':$' ), + '/(?<!mailto):-$/' => $this->img_tag('smiley-embarassed.gif', ':-$' ), + '/(?<!mailto):\*/i' => $this->img_tag('smiley-kiss.gif', ':*' ), + '/(?<!mailto):-\*/i' => $this->img_tag('smiley-kiss.gif', ':-*' ), + '/(?<!mailto):S/i' => $this->img_tag('smiley-undecided.gif', ':S' ), + '/(?<!mailto):-S/i' => $this->img_tag('smiley-undecided.gif', ':-S' ), + ); + + if ($args['type'] == 'plain') { + $args['body'] = preg_replace( + array_keys($map), array_values($map), $args['body']); + } + + return $args; + } + + private function img_tag($ico, $title) + { + $path = './program/js/tiny_mce/plugins/emotions/img/'; + return html::img(array('src' => $path.$ico, 'title' => $title)); + } +} diff --git a/plugins/enigma/README b/plugins/enigma/README new file mode 100644 index 000000000..22d6e513a --- /dev/null +++ b/plugins/enigma/README @@ -0,0 +1,35 @@ +------------------------------------------------------------------ +THIS IS NOT EVEN AN "ALPHA" STATE. USE ONLY FOR DEVELOPMENT!!!!!!! +------------------------------------------------------------------ + +WARNING: Don't use with gnupg-2.x! + +Enigma Plugin Status: + +* DONE: + +- PGP signed messages verification +- Handling of PGP keys files attached to incoming messages +- PGP encrypted messages decryption (started) +- PGP keys management UI (started) + +* TODO (must have): + +- Parsing of decrypted messages into array (see rcube_mime_struct) and then into rcube_message_part structure + (create core class rcube_mime_parser or take over PEAR::Mail_mimeDecode package and improve it) +- Sending encrypted/signed messages (probably some changes in core will be needed) +- Per-Identity settings (including keys/certs) +- Handling big messages with temp files (including changes in Roundcube core) +- Performance improvements (some caching, code review) +- better (and more) icons + +* TODO (later): + +- Keys generation +- Certs generation +- Keys/Certs info in Contacts details page (+ split Contact details page into tabs) +- Key server support +- S/MIME signed messages verification +- S/MIME encrypted messages decryption +- Handling of S/MIME certs files attached to incoming messages +- SSL (S/MIME) Certs management diff --git a/plugins/enigma/config.inc.php.dist b/plugins/enigma/config.inc.php.dist new file mode 100644 index 000000000..ca841d0ac --- /dev/null +++ b/plugins/enigma/config.inc.php.dist @@ -0,0 +1,14 @@ +<?php + +// Enigma Plugin options +// -------------------- + +// A driver to use for PGP. Default: "gnupg". +$rcmail_config['enigma_pgp_driver'] = 'gnupg'; + +// A driver to use for S/MIME. Default: "phpssl". +$rcmail_config['enigma_smime_driver'] = 'phpssl'; + +// Keys directory for all users. Default 'enigma/home'. +// Must be writeable by PHP process +$rcmail_config['enigma_pgp_homedir'] = null; diff --git a/plugins/enigma/enigma.js b/plugins/enigma/enigma.js new file mode 100644 index 000000000..29c648224 --- /dev/null +++ b/plugins/enigma/enigma.js @@ -0,0 +1,206 @@ +/* Enigma Plugin */ + +if (window.rcmail) +{ + rcmail.addEventListener('init', function(evt) + { + if (rcmail.env.task == 'settings') { + rcmail.register_command('plugin.enigma', function() { rcmail.goto_url('plugin.enigma') }, true); + rcmail.register_command('plugin.enigma-key-import', function() { rcmail.enigma_key_import() }, true); + rcmail.register_command('plugin.enigma-key-export', function() { rcmail.enigma_key_export() }, true); + + if (rcmail.gui_objects.keyslist) + { + var p = rcmail; + rcmail.keys_list = new rcube_list_widget(rcmail.gui_objects.keyslist, + {multiselect:false, draggable:false, keyboard:false}); + rcmail.keys_list.addEventListener('select', function(o){ p.enigma_key_select(o); }); + rcmail.keys_list.init(); + rcmail.keys_list.focus(); + + rcmail.enigma_list(); + + rcmail.register_command('firstpage', function(props) {return rcmail.enigma_list_page('first'); }); + rcmail.register_command('previouspage', function(props) {return rcmail.enigma_list_page('previous'); }); + rcmail.register_command('nextpage', function(props) {return rcmail.enigma_list_page('next'); }); + rcmail.register_command('lastpage', function(props) {return rcmail.enigma_list_page('last'); }); + } + + if (rcmail.env.action == 'edit-prefs') { + rcmail.register_command('search', function(props) {return rcmail.enigma_search(props); }, true); + rcmail.register_command('reset-search', function(props) {return rcmail.enigma_search_reset(props); }, true); + } + else if (rcmail.env.action == 'plugin.enigma') { + rcmail.register_command('plugin.enigma-import', function() { rcmail.enigma_import() }, true); + rcmail.register_command('plugin.enigma-export', function() { rcmail.enigma_export() }, true); + } + } + }); +} + +/*********************************************************/ +/********* Enigma Settings/Keys/Certs UI *********/ +/*********************************************************/ + +// Display key(s) import form +rcube_webmail.prototype.enigma_key_import = function() +{ + this.enigma_loadframe(null, '&_a=keyimport'); +}; + +// Submit key(s) form +rcube_webmail.prototype.enigma_import = function() +{ + var form, file; + if (form = this.gui_objects.importform) { + file = document.getElementById('rcmimportfile'); + if (file && !file.value) { + alert(this.get_label('selectimportfile')); + return; + } + form.submit(); + this.set_busy(true, 'importwait'); + this.lock_form(form, true); + } +}; + +// list row selection handler +rcube_webmail.prototype.enigma_key_select = function(list) +{ + var id; + if (id = list.get_single_selection()) + this.enigma_loadframe(id); +}; + +// load key frame +rcube_webmail.prototype.enigma_loadframe = function(id, url) +{ + var frm, win; + if (this.env.contentframe && window.frames && (frm = window.frames[this.env.contentframe])) { + if (!id && !url && (win = window.frames[this.env.contentframe])) { + if (win.location && win.location.href.indexOf(this.env.blankpage)<0) + win.location.href = this.env.blankpage; + return; + } + this.set_busy(true); + if (!url) + url = '&_a=keyinfo&_id='+id; + frm.location.href = this.env.comm_path+'&_action=plugin.enigma&_framed=1' + url; + } +}; + +// Search keys/certs +rcube_webmail.prototype.enigma_search = function(props) +{ + if (!props && this.gui_objects.qsearchbox) + props = this.gui_objects.qsearchbox.value; + + if (props || this.env.search_request) { + var params = {'_a': 'keysearch', '_q': urlencode(props)}, + lock = this.set_busy(true, 'searching'); +// if (this.gui_objects.search_filter) + // addurl += '&_filter=' + this.gui_objects.search_filter.value; + this.env.current_page = 1; + this.enigma_loadframe(); + this.enigma_clear_list(); + this.http_post('plugin.enigma', params, lock); + } + + return false; +} + +// Reset search filter and the list +rcube_webmail.prototype.enigma_search_reset = function(props) +{ + var s = this.env.search_request; + this.reset_qsearch(); + + if (s) { + this.enigma_loadframe(); + this.enigma_clear_list(); + + // refresh the list + this.enigma_list(); + } + + return false; +} + +// Keys/certs listing +rcube_webmail.prototype.enigma_list = function(page) +{ + var params = {'_a': 'keylist'}, + lock = this.set_busy(true, 'loading'); + + this.env.current_page = page ? page : 1; + + if (this.env.search_request) + params._q = this.env.search_request; + if (page) + params._p = page; + + this.enigma_clear_list(); + this.http_post('plugin.enigma', params, lock); +} + +// Change list page +rcube_webmail.prototype.enigma_list_page = function(page) +{ + if (page == 'next') + page = this.env.current_page + 1; + else if (page == 'last') + page = this.env.pagecount; + else if (page == 'prev' && this.env.current_page > 1) + page = this.env.current_page - 1; + else if (page == 'first' && this.env.current_page > 1) + page = 1; + + this.enigma_list(page); +} + +// Remove list rows +rcube_webmail.prototype.enigma_clear_list = function() +{ + this.enigma_loadframe(); + if (this.keys_list) + this.keys_list.clear(true); +} + +// Adds a row to the list +rcube_webmail.prototype.enigma_add_list_row = function(r) +{ + if (!this.gui_objects.keyslist || !this.keys_list) + return false; + + var list = this.keys_list, + tbody = this.gui_objects.keyslist.tBodies[0], + rowcount = tbody.rows.length, + even = rowcount%2, + css_class = 'message' + + (even ? ' even' : ' odd'), + // for performance use DOM instead of jQuery here + row = document.createElement('tr'), + col = document.createElement('td'); + + row.id = 'rcmrow' + r.id; + row.className = css_class; + + col.innerHTML = r.name; + row.appendChild(col); + list.insert_row(row); +} + +/*********************************************************/ +/********* Enigma Message methods *********/ +/*********************************************************/ + +// Import attached keys/certs file +rcube_webmail.prototype.enigma_import_attachment = function(mime_id) +{ + var lock = this.set_busy(true, 'loading'); + this.http_post('plugin.enigmaimport', '_uid='+this.env.uid+'&_mbox=' + +urlencode(this.env.mailbox)+'&_part='+urlencode(mime_id), lock); + + return false; +}; + diff --git a/plugins/enigma/enigma.php b/plugins/enigma/enigma.php new file mode 100644 index 000000000..fb7c98635 --- /dev/null +++ b/plugins/enigma/enigma.php @@ -0,0 +1,475 @@ +<?php +/* + +-------------------------------------------------------------------------+ + | Enigma Plugin for Roundcube | + | Version 0.1 | + | | + | This program is free software; you can redistribute it and/or modify | + | it under the terms of the GNU General Public License version 2 | + | as published by the Free Software Foundation. | + | | + | This program is distributed in the hope that it will be useful, | + | but WITHOUT ANY WARRANTY; without even the implied warranty of | + | MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the | + | GNU General Public License for more details. | + | | + | You should have received a copy of the GNU General Public License along | + | with this program; if not, write to the Free Software Foundation, Inc., | + | 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. | + | | + +-------------------------------------------------------------------------+ + | Author: Aleksander Machniak <alec@alec.pl> | + +-------------------------------------------------------------------------+ +*/ + +/* + This class contains only hooks and action handlers. + Most plugin logic is placed in enigma_engine and enigma_ui classes. +*/ + +class enigma extends rcube_plugin +{ + public $task = 'mail|settings'; + public $rc; + public $engine; + + private $env_loaded; + private $message; + private $keys_parts = array(); + private $keys_bodies = array(); + + + /** + * Plugin initialization. + */ + function init() + { + $rcmail = rcmail::get_instance(); + $this->rc = $rcmail; + + if ($this->rc->task == 'mail') { + // message parse/display hooks + $this->add_hook('message_part_structure', array($this, 'parse_structure')); + $this->add_hook('message_body_prefix', array($this, 'status_message')); + + // message displaying + if ($rcmail->action == 'show' || $rcmail->action == 'preview') { + $this->add_hook('message_load', array($this, 'message_load')); + $this->add_hook('template_object_messagebody', array($this, 'message_output')); + $this->register_action('plugin.enigmaimport', array($this, 'import_file')); + } + // message composing + else if ($rcmail->action == 'compose') { + $this->load_ui(); + $this->ui->init($section); + } + // message sending (and draft storing) + else if ($rcmail->action == 'sendmail') { + //$this->add_hook('outgoing_message_body', array($this, 'msg_encode')); + //$this->add_hook('outgoing_message_body', array($this, 'msg_sign')); + } + } + else if ($this->rc->task == 'settings') { + // add hooks for Enigma settings + $this->add_hook('preferences_sections_list', array($this, 'preferences_section')); + $this->add_hook('preferences_list', array($this, 'preferences_list')); + $this->add_hook('preferences_save', array($this, 'preferences_save')); + + // register handler for keys/certs management + $this->register_action('plugin.enigma', array($this, 'preferences_ui')); + + // grab keys/certs management iframe requests + $section = get_input_value('_section', RCUBE_INPUT_GET); + if ($this->rc->action == 'edit-prefs' && preg_match('/^enigma(certs|keys)/', $section)) { + $this->load_ui(); + $this->ui->init($section); + } + } + } + + /** + * Plugin environment initialization. + */ + function load_env() + { + if ($this->env_loaded) + return; + + $this->env_loaded = true; + + // Add include path for Enigma classes and drivers + $include_path = $this->home . '/lib' . PATH_SEPARATOR; + $include_path .= ini_get('include_path'); + set_include_path($include_path); + + // load the Enigma plugin configuration + $this->load_config(); + + // include localization (if wasn't included before) + $this->add_texts('localization/'); + } + + /** + * Plugin UI initialization. + */ + function load_ui() + { + if ($this->ui) + return; + + // load config/localization + $this->load_env(); + + // Load UI + $this->ui = new enigma_ui($this, $this->home); + } + + /** + * Plugin engine initialization. + */ + function load_engine() + { + if ($this->engine) + return; + + // load config/localization + $this->load_env(); + + $this->engine = new enigma_engine($this); + } + + /** + * Handler for message_part_structure hook. + * Called for every part of the message. + * + * @param array Original parameters + * + * @return array Modified parameters + */ + function parse_structure($p) + { + $struct = $p['structure']; + + if ($p['mimetype'] == 'text/plain' || $p['mimetype'] == 'application/pgp') { + $this->parse_plain($p); + } + else if ($p['mimetype'] == 'multipart/signed') { + $this->parse_signed($p); + } + else if ($p['mimetype'] == 'multipart/encrypted') { + $this->parse_encrypted($p); + } + else if ($p['mimetype'] == 'application/pkcs7-mime') { + $this->parse_encrypted($p); + } + + return $p; + } + + /** + * Handler for preferences_sections_list hook. + * Adds Enigma settings sections into preferences sections list. + * + * @param array Original parameters + * + * @return array Modified parameters + */ + function preferences_section($p) + { + // add labels + $this->add_texts('localization/'); + + $p['list']['enigmasettings'] = array( + 'id' => 'enigmasettings', 'section' => $this->gettext('enigmasettings'), + ); + $p['list']['enigmacerts'] = array( + 'id' => 'enigmacerts', 'section' => $this->gettext('enigmacerts'), + ); + $p['list']['enigmakeys'] = array( + 'id' => 'enigmakeys', 'section' => $this->gettext('enigmakeys'), + ); + + return $p; + } + + /** + * Handler for preferences_list hook. + * Adds options blocks into Enigma settings sections in Preferences. + * + * @param array Original parameters + * + * @return array Modified parameters + */ + function preferences_list($p) + { + if ($p['section'] == 'enigmasettings') { + // This makes that section is not removed from the list + $p['blocks']['dummy']['options']['dummy'] = array(); + } + else if ($p['section'] == 'enigmacerts') { + // This makes that section is not removed from the list + $p['blocks']['dummy']['options']['dummy'] = array(); + } + else if ($p['section'] == 'enigmakeys') { + // This makes that section is not removed from the list + $p['blocks']['dummy']['options']['dummy'] = array(); + } + + return $p; + } + + /** + * Handler for preferences_save hook. + * Executed on Enigma settings form submit. + * + * @param array Original parameters + * + * @return array Modified parameters + */ + function preferences_save($p) + { + if ($p['section'] == 'enigmasettings') { + $a['prefs'] = array( +// 'dummy' => get_input_value('_dummy', RCUBE_INPUT_POST), + ); + } + + return $p; + } + + /** + * Handler for keys/certs management UI template. + */ + function preferences_ui() + { + $this->load_ui(); + $this->ui->init(); + } + + /** + * Handler for message_body_prefix hook. + * Called for every displayed (content) part of the message. + * Adds infobox about signature verification and/or decryption + * status above the body. + * + * @param array Original parameters + * + * @return array Modified parameters + */ + function status_message($p) + { + $part_id = $p['part']->mime_id; + + // skip: not a message part + if ($p['part'] instanceof rcube_message) + return $p; + + // skip: message has no signed/encoded content + if (!$this->engine) + return $p; + + // Decryption status + if (isset($this->engine->decryptions[$part_id])) { + + // get decryption status + $status = $this->engine->decryptions[$part_id]; + + // Load UI and add css script + $this->load_ui(); + $this->ui->add_css(); + + // display status info + $attrib['id'] = 'enigma-message'; + + if ($status instanceof enigma_error) { + $attrib['class'] = 'enigmaerror'; + $code = $status->getCode(); + if ($code == enigma_error::E_KEYNOTFOUND) + $msg = Q(str_replace('$keyid', enigma_key::format_id($status->getData('id')), + $this->gettext('decryptnokey'))); + else if ($code == enigma_error::E_BADPASS) + $msg = Q($this->gettext('decryptbadpass')); + else + $msg = Q($this->gettext('decrypterror')); + } + else { + $attrib['class'] = 'enigmanotice'; + $msg = Q($this->gettext('decryptok')); + } + + $p['prefix'] .= html::div($attrib, $msg); + } + + // Signature verification status + if (isset($this->engine->signed_parts[$part_id]) + && ($sig = $this->engine->signatures[$this->engine->signed_parts[$part_id]]) + ) { + // add css script + $this->load_ui(); + $this->ui->add_css(); + + // display status info + $attrib['id'] = 'enigma-message'; + + if ($sig instanceof enigma_signature) { + if ($sig->valid) { + $attrib['class'] = 'enigmanotice'; + $sender = ($sig->name ? $sig->name . ' ' : '') . '<' . $sig->email . '>'; + $msg = Q(str_replace('$sender', $sender, $this->gettext('sigvalid'))); + } + else { + $attrib['class'] = 'enigmawarning'; + $sender = ($sig->name ? $sig->name . ' ' : '') . '<' . $sig->email . '>'; + $msg = Q(str_replace('$sender', $sender, $this->gettext('siginvalid'))); + } + } + else if ($sig->getCode() == enigma_error::E_KEYNOTFOUND) { + $attrib['class'] = 'enigmawarning'; + $msg = Q(str_replace('$keyid', enigma_key::format_id($sig->getData('id')), + $this->gettext('signokey'))); + } + else { + $attrib['class'] = 'enigmaerror'; + $msg = Q($this->gettext('sigerror')); + } +/* + $msg .= ' ' . html::a(array('href' => "#sigdetails", + 'onclick' => JS_OBJECT_NAME.".command('enigma-sig-details')"), + Q($this->gettext('showdetails'))); +*/ + // test +// $msg .= '<br /><pre>'.$sig->body.'</pre>'; + + $p['prefix'] .= html::div($attrib, $msg); + + // Display each signature message only once + unset($this->engine->signatures[$this->engine->signed_parts[$part_id]]); + } + + return $p; + } + + /** + * Handler for plain/text message. + * + * @param array Reference to hook's parameters (see enigma::parse_structure()) + */ + private function parse_plain(&$p) + { + $this->load_engine(); + $this->engine->parse_plain($p); + } + + /** + * Handler for multipart/signed message. + * Verifies signature. + * + * @param array Reference to hook's parameters (see enigma::parse_structure()) + */ + private function parse_signed(&$p) + { + $this->load_engine(); + $this->engine->parse_signed($p); + } + + /** + * Handler for multipart/encrypted and application/pkcs7-mime message. + * + * @param array Reference to hook's parameters (see enigma::parse_structure()) + */ + private function parse_encrypted(&$p) + { + $this->load_engine(); + $this->engine->parse_encrypted($p); + } + + /** + * Handler for message_load hook. + * Check message bodies and attachments for keys/certs. + */ + function message_load($p) + { + $this->message = $p['object']; + + // handle attachments vcard attachments + foreach ((array)$this->message->attachments as $attachment) { + if ($this->is_keys_part($attachment)) { + $this->keys_parts[] = $attachment->mime_id; + } + } + // the same with message bodies + foreach ((array)$this->message->parts as $idx => $part) { + if ($this->is_keys_part($part)) { + $this->keys_parts[] = $part->mime_id; + $this->keys_bodies[] = $part->mime_id; + } + } + // @TODO: inline PGP keys + + if ($this->keys_parts) { + $this->add_texts('localization'); + } + } + + /** + * Handler for template_object_messagebody hook. + * This callback function adds a box below the message content + * if there is a key/cert attachment available + */ + function message_output($p) + { + $attach_script = false; + + foreach ($this->keys_parts as $part) { + + // remove part's body + if (in_array($part, $this->keys_bodies)) + $p['content'] = ''; + + $style = "margin:0 1em; padding:0.2em 0.5em; border:1px solid #999; width: auto" + ." border-radius:4px; -moz-border-radius:4px; -webkit-border-radius:4px"; + + // add box below messsage body + $p['content'] .= html::p(array('style' => $style), + html::a(array( + 'href' => "#", + 'onclick' => "return ".JS_OBJECT_NAME.".enigma_import_attachment('".JQ($part)."')", + 'title' => $this->gettext('keyattimport')), + html::img(array('src' => $this->url('skins/default/key_add.png'), 'style' => "vertical-align:middle"))) + . ' ' . html::span(null, $this->gettext('keyattfound'))); + + $attach_script = true; + } + + if ($attach_script) { + $this->include_script('enigma.js'); + } + + return $p; + } + + /** + * Handler for attached keys/certs import + */ + function import_file() + { + $this->load_engine(); + $this->engine->import_file(); + } + + /** + * Checks if specified message part is a PGP-key or S/MIME cert data + * + * @param rcube_message_part Part object + * + * @return boolean True if part is a key/cert + */ + private function is_keys_part($part) + { + // @TODO: S/MIME + return ( + // Content-Type: application/pgp-keys + $part->mimetype == 'application/pgp-keys' + ); + } +} diff --git a/plugins/enigma/home/.htaccess b/plugins/enigma/home/.htaccess new file mode 100644 index 000000000..8e6a345dc --- /dev/null +++ b/plugins/enigma/home/.htaccess @@ -0,0 +1,2 @@ +Order allow,deny +Deny from all
\ No newline at end of file diff --git a/plugins/enigma/lib/Crypt/GPG.php b/plugins/enigma/lib/Crypt/GPG.php new file mode 100644 index 000000000..6e8e717e8 --- /dev/null +++ b/plugins/enigma/lib/Crypt/GPG.php @@ -0,0 +1,2542 @@ +<?php + +/* vim: set expandtab tabstop=4 shiftwidth=4 softtabstop=4: */ + +/** + * Crypt_GPG is a package to use GPG from PHP + * + * This package provides an object oriented interface to GNU Privacy + * Guard (GPG). It requires the GPG executable to be on the system. + * + * Though GPG can support symmetric-key cryptography, this package is intended + * only to facilitate public-key cryptography. + * + * This file contains the main GPG class. The class in this file lets you + * encrypt, decrypt, sign and verify data; import and delete keys; and perform + * other useful GPG tasks. + * + * Example usage: + * <code> + * <?php + * // encrypt some data + * $gpg = new Crypt_GPG(); + * $gpg->addEncryptKey($mySecretKeyId); + * $encryptedData = $gpg->encrypt($data); + * ?> + * </code> + * + * PHP version 5 + * + * LICENSE: + * + * This library is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as + * published by the Free Software Foundation; either version 2.1 of the + * License, or (at your option) any later version. + * + * This library is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + * Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public + * License along with this library; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA + * + * @category Encryption + * @package Crypt_GPG + * @author Nathan Fredrickson <nathan@silverorange.com> + * @author Michael Gauthier <mike@silverorange.com> + * @copyright 2005-2010 silverorange + * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1 + * @version CVS: $Id: GPG.php 302814 2010-08-26 15:43:07Z gauthierm $ + * @link http://pear.php.net/package/Crypt_GPG + * @link http://pear.php.net/manual/en/package.encryption.crypt-gpg.php + * @link http://www.gnupg.org/ + */ + +/** + * Signature handler class + */ +require_once 'Crypt/GPG/VerifyStatusHandler.php'; + +/** + * Decryption handler class + */ +require_once 'Crypt/GPG/DecryptStatusHandler.php'; + +/** + * GPG key class + */ +require_once 'Crypt/GPG/Key.php'; + +/** + * GPG sub-key class + */ +require_once 'Crypt/GPG/SubKey.php'; + +/** + * GPG user id class + */ +require_once 'Crypt/GPG/UserId.php'; + +/** + * GPG process and I/O engine class + */ +require_once 'Crypt/GPG/Engine.php'; + +/** + * GPG exception classes + */ +require_once 'Crypt/GPG/Exceptions.php'; + +// {{{ class Crypt_GPG + +/** + * A class to use GPG from PHP + * + * This class provides an object oriented interface to GNU Privacy Guard (GPG). + * + * Though GPG can support symmetric-key cryptography, this class is intended + * only to facilitate public-key cryptography. + * + * @category Encryption + * @package Crypt_GPG + * @author Nathan Fredrickson <nathan@silverorange.com> + * @author Michael Gauthier <mike@silverorange.com> + * @copyright 2005-2010 silverorange + * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1 + * @link http://pear.php.net/package/Crypt_GPG + * @link http://www.gnupg.org/ + */ +class Crypt_GPG +{ + // {{{ class error constants + + /** + * Error code returned when there is no error. + */ + const ERROR_NONE = 0; + + /** + * Error code returned when an unknown or unhandled error occurs. + */ + const ERROR_UNKNOWN = 1; + + /** + * Error code returned when a bad passphrase is used. + */ + const ERROR_BAD_PASSPHRASE = 2; + + /** + * Error code returned when a required passphrase is missing. + */ + const ERROR_MISSING_PASSPHRASE = 3; + + /** + * Error code returned when a key that is already in the keyring is + * imported. + */ + const ERROR_DUPLICATE_KEY = 4; + + /** + * Error code returned the required data is missing for an operation. + * + * This could be missing key data, missing encrypted data or missing + * signature data. + */ + const ERROR_NO_DATA = 5; + + /** + * Error code returned when an unsigned key is used. + */ + const ERROR_UNSIGNED_KEY = 6; + + /** + * Error code returned when a key that is not self-signed is used. + */ + const ERROR_NOT_SELF_SIGNED = 7; + + /** + * Error code returned when a public or private key that is not in the + * keyring is used. + */ + const ERROR_KEY_NOT_FOUND = 8; + + /** + * Error code returned when an attempt to delete public key having a + * private key is made. + */ + const ERROR_DELETE_PRIVATE_KEY = 9; + + /** + * Error code returned when one or more bad signatures are detected. + */ + const ERROR_BAD_SIGNATURE = 10; + + /** + * Error code returned when there is a problem reading GnuPG data files. + */ + const ERROR_FILE_PERMISSIONS = 11; + + // }}} + // {{{ class constants for data signing modes + + /** + * Signing mode for normal signing of data. The signed message will not + * be readable without special software. + * + * This is the default signing mode. + * + * @see Crypt_GPG::sign() + * @see Crypt_GPG::signFile() + */ + const SIGN_MODE_NORMAL = 1; + + /** + * Signing mode for clearsigning data. Clearsigned signatures are ASCII + * armored data and are readable without special software. If the signed + * message is unencrypted, the message will still be readable. The message + * text will be in the original encoding. + * + * @see Crypt_GPG::sign() + * @see Crypt_GPG::signFile() + */ + const SIGN_MODE_CLEAR = 2; + + /** + * Signing mode for creating a detached signature. When using detached + * signatures, only the signature data is returned. The original message + * text may be distributed separately from the signature data. This is + * useful for miltipart/signed email messages as per + * {@link http://www.ietf.org/rfc/rfc3156.txt RFC 3156}. + * + * @see Crypt_GPG::sign() + * @see Crypt_GPG::signFile() + */ + const SIGN_MODE_DETACHED = 3; + + // }}} + // {{{ class constants for fingerprint formats + + /** + * No formatting is performed. + * + * Example: C3BC615AD9C766E5A85C1F2716D27458B1BBA1C4 + * + * @see Crypt_GPG::getFingerprint() + */ + const FORMAT_NONE = 1; + + /** + * Fingerprint is formatted in the format used by the GnuPG gpg command's + * default output. + * + * Example: C3BC 615A D9C7 66E5 A85C 1F27 16D2 7458 B1BB A1C4 + * + * @see Crypt_GPG::getFingerprint() + */ + const FORMAT_CANONICAL = 2; + + /** + * Fingerprint is formatted in the format used when displaying X.509 + * certificates + * + * Example: C3:BC:61:5A:D9:C7:66:E5:A8:5C:1F:27:16:D2:74:58:B1:BB:A1:C4 + * + * @see Crypt_GPG::getFingerprint() + */ + const FORMAT_X509 = 3; + + // }}} + // {{{ other class constants + + /** + * URI at which package bugs may be reported. + */ + const BUG_URI = 'http://pear.php.net/bugs/report.php?package=Crypt_GPG'; + + // }}} + // {{{ protected class properties + + /** + * Engine used to control the GPG subprocess + * + * @var Crypt_GPG_Engine + * + * @see Crypt_GPG::setEngine() + */ + protected $engine = null; + + /** + * Keys used to encrypt + * + * The array is of the form: + * <code> + * array( + * $key_id => array( + * 'fingerprint' => $fingerprint, + * 'passphrase' => null + * ) + * ); + * </code> + * + * @var array + * @see Crypt_GPG::addEncryptKey() + * @see Crypt_GPG::clearEncryptKeys() + */ + protected $encryptKeys = array(); + + /** + * Keys used to decrypt + * + * The array is of the form: + * <code> + * array( + * $key_id => array( + * 'fingerprint' => $fingerprint, + * 'passphrase' => $passphrase + * ) + * ); + * </code> + * + * @var array + * @see Crypt_GPG::addSignKey() + * @see Crypt_GPG::clearSignKeys() + */ + protected $signKeys = array(); + + /** + * Keys used to sign + * + * The array is of the form: + * <code> + * array( + * $key_id => array( + * 'fingerprint' => $fingerprint, + * 'passphrase' => $passphrase + * ) + * ); + * </code> + * + * @var array + * @see Crypt_GPG::addDecryptKey() + * @see Crypt_GPG::clearDecryptKeys() + */ + protected $decryptKeys = array(); + + // }}} + // {{{ __construct() + + /** + * Creates a new GPG object + * + * Available options are: + * + * - <kbd>string homedir</kbd> - the directory where the GPG + * keyring files are stored. If not + * specified, Crypt_GPG uses the + * default of <kbd>~/.gnupg</kbd>. + * - <kbd>string publicKeyring</kbd> - the file path of the public + * keyring. Use this if the public + * keyring is not in the homedir, or + * if the keyring is in a directory + * not writable by the process + * invoking GPG (like Apache). Then + * you can specify the path to the + * keyring with this option + * (/foo/bar/pubring.gpg), and specify + * a writable directory (like /tmp) + * using the <i>homedir</i> option. + * - <kbd>string privateKeyring</kbd> - the file path of the private + * keyring. Use this if the private + * keyring is not in the homedir, or + * if the keyring is in a directory + * not writable by the process + * invoking GPG (like Apache). Then + * you can specify the path to the + * keyring with this option + * (/foo/bar/secring.gpg), and specify + * a writable directory (like /tmp) + * using the <i>homedir</i> option. + * - <kbd>string trustDb</kbd> - the file path of the web-of-trust + * database. Use this if the trust + * database is not in the homedir, or + * if the database is in a directory + * not writable by the process + * invoking GPG (like Apache). Then + * you can specify the path to the + * trust database with this option + * (/foo/bar/trustdb.gpg), and specify + * a writable directory (like /tmp) + * using the <i>homedir</i> option. + * - <kbd>string binary</kbd> - the location of the GPG binary. If + * not specified, the driver attempts + * to auto-detect the GPG binary + * location using a list of known + * default locations for the current + * operating system. The option + * <kbd>gpgBinary</kbd> is a + * deprecated alias for this option. + * - <kbd>boolean debug</kbd> - whether or not to use debug mode. + * When debug mode is on, all + * communication to and from the GPG + * subprocess is logged. This can be + * + * @param array $options optional. An array of options used to create the + * GPG object. All options are optional and are + * represented as key-value pairs. + * + * @throws Crypt_GPG_FileException if the <kbd>homedir</kbd> does not exist + * and cannot be created. This can happen if <kbd>homedir</kbd> is + * not specified, Crypt_GPG is run as the web user, and the web + * user has no home directory. This exception is also thrown if any + * of the options <kbd>publicKeyring</kbd>, + * <kbd>privateKeyring</kbd> or <kbd>trustDb</kbd> options are + * specified but the files do not exist or are are not readable. + * This can happen if the user running the Crypt_GPG process (for + * example, the Apache user) does not have permission to read the + * files. + * + * @throws PEAR_Exception if the provided <kbd>binary</kbd> is invalid, or + * if no <kbd>binary</kbd> is provided and no suitable binary could + * be found. + */ + public function __construct(array $options = array()) + { + $this->setEngine(new Crypt_GPG_Engine($options)); + } + + // }}} + // {{{ importKey() + + /** + * Imports a public or private key into the keyring + * + * Keys may be removed from the keyring using + * {@link Crypt_GPG::deletePublicKey()} or + * {@link Crypt_GPG::deletePrivateKey()}. + * + * @param string $data the key data to be imported. + * + * @return array an associative array containing the following elements: + * - <kbd>fingerprint</kbd> - the fingerprint of the + * imported key, + * - <kbd>public_imported</kbd> - the number of public + * keys imported, + * - <kbd>public_unchanged</kbd> - the number of unchanged + * public keys, + * - <kbd>private_imported</kbd> - the number of private + * keys imported, + * - <kbd>private_unchanged</kbd> - the number of unchanged + * private keys. + * + * @throws Crypt_GPG_NoDataException if the key data is missing or if the + * data is is not valid key data. + * + * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs. + * Use the <kbd>debug</kbd> option and file a bug report if these + * exceptions occur. + */ + public function importKey($data) + { + return $this->_importKey($data, false); + } + + // }}} + // {{{ importKeyFile() + + /** + * Imports a public or private key file into the keyring + * + * Keys may be removed from the keyring using + * {@link Crypt_GPG::deletePublicKey()} or + * {@link Crypt_GPG::deletePrivateKey()}. + * + * @param string $filename the key file to be imported. + * + * @return array an associative array containing the following elements: + * - <kbd>fingerprint</kbd> - the fingerprint of the + * imported key, + * - <kbd>public_imported</kbd> - the number of public + * keys imported, + * - <kbd>public_unchanged</kbd> - the number of unchanged + * public keys, + * - <kbd>private_imported</kbd> - the number of private + * keys imported, + * - <kbd>private_unchanged</kbd> - the number of unchanged + * private keys. + * private keys. + * + * @throws Crypt_GPG_NoDataException if the key data is missing or if the + * data is is not valid key data. + * + * @throws Crypt_GPG_FileException if the key file is not readable. + * + * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs. + * Use the <kbd>debug</kbd> option and file a bug report if these + * exceptions occur. + */ + public function importKeyFile($filename) + { + return $this->_importKey($filename, true); + } + + // }}} + // {{{ exportPublicKey() + + /** + * Exports a public key from the keyring + * + * The exported key remains on the keyring. To delete the public key, use + * {@link Crypt_GPG::deletePublicKey()}. + * + * If more than one key fingerprint is available for the specified + * <kbd>$keyId</kbd> (for example, if you use a non-unique uid) only the + * first public key is exported. + * + * @param string $keyId either the full uid of the public key, the email + * part of the uid of the public key or the key id of + * the public key. For example, + * "Test User (example) <test@example.com>", + * "test@example.com" or a hexadecimal string. + * @param boolean $armor optional. If true, ASCII armored data is returned; + * otherwise, binary data is returned. Defaults to + * true. + * + * @return string the public key data. + * + * @throws Crypt_GPG_KeyNotFoundException if a public key with the given + * <kbd>$keyId</kbd> is not found. + * + * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs. + * Use the <kbd>debug</kbd> option and file a bug report if these + * exceptions occur. + */ + public function exportPublicKey($keyId, $armor = true) + { + $fingerprint = $this->getFingerprint($keyId); + + if ($fingerprint === null) { + throw new Crypt_GPG_KeyNotFoundException( + 'Public key not found: ' . $keyId, + Crypt_GPG::ERROR_KEY_NOT_FOUND, $keyId); + } + + $keyData = ''; + $operation = '--export ' . escapeshellarg($fingerprint); + $arguments = ($armor) ? array('--armor') : array(); + + $this->engine->reset(); + $this->engine->setOutput($keyData); + $this->engine->setOperation($operation, $arguments); + $this->engine->run(); + + $code = $this->engine->getErrorCode(); + + if ($code !== Crypt_GPG::ERROR_NONE) { + throw new Crypt_GPG_Exception( + 'Unknown error exporting public key. Please use the ' . + '\'debug\' option when creating the Crypt_GPG object, and ' . + 'file a bug report at ' . self::BUG_URI, $code); + } + + return $keyData; + } + + // }}} + // {{{ deletePublicKey() + + /** + * Deletes a public key from the keyring + * + * If more than one key fingerprint is available for the specified + * <kbd>$keyId</kbd> (for example, if you use a non-unique uid) only the + * first public key is deleted. + * + * The private key must be deleted first or an exception will be thrown. + * See {@link Crypt_GPG::deletePrivateKey()}. + * + * @param string $keyId either the full uid of the public key, the email + * part of the uid of the public key or the key id of + * the public key. For example, + * "Test User (example) <test@example.com>", + * "test@example.com" or a hexadecimal string. + * + * @return void + * + * @throws Crypt_GPG_KeyNotFoundException if a public key with the given + * <kbd>$keyId</kbd> is not found. + * + * @throws Crypt_GPG_DeletePrivateKeyException if the specified public key + * has an associated private key on the keyring. The private key + * must be deleted first. + * + * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs. + * Use the <kbd>debug</kbd> option and file a bug report if these + * exceptions occur. + */ + public function deletePublicKey($keyId) + { + $fingerprint = $this->getFingerprint($keyId); + + if ($fingerprint === null) { + throw new Crypt_GPG_KeyNotFoundException( + 'Public key not found: ' . $keyId, + Crypt_GPG::ERROR_KEY_NOT_FOUND, $keyId); + } + + $operation = '--delete-key ' . escapeshellarg($fingerprint); + $arguments = array( + '--batch', + '--yes' + ); + + $this->engine->reset(); + $this->engine->setOperation($operation, $arguments); + $this->engine->run(); + + $code = $this->engine->getErrorCode(); + + switch ($code) { + case Crypt_GPG::ERROR_NONE: + break; + case Crypt_GPG::ERROR_DELETE_PRIVATE_KEY: + throw new Crypt_GPG_DeletePrivateKeyException( + 'Private key must be deleted before public key can be ' . + 'deleted.', $code, $keyId); + default: + throw new Crypt_GPG_Exception( + 'Unknown error deleting public key. Please use the ' . + '\'debug\' option when creating the Crypt_GPG object, and ' . + 'file a bug report at ' . self::BUG_URI, $code); + } + } + + // }}} + // {{{ deletePrivateKey() + + /** + * Deletes a private key from the keyring + * + * If more than one key fingerprint is available for the specified + * <kbd>$keyId</kbd> (for example, if you use a non-unique uid) only the + * first private key is deleted. + * + * Calls GPG with the <kbd>--delete-secret-key</kbd> command. + * + * @param string $keyId either the full uid of the private key, the email + * part of the uid of the private key or the key id of + * the private key. For example, + * "Test User (example) <test@example.com>", + * "test@example.com" or a hexadecimal string. + * + * @return void + * + * @throws Crypt_GPG_KeyNotFoundException if a private key with the given + * <kbd>$keyId</kbd> is not found. + * + * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs. + * Use the <kbd>debug</kbd> option and file a bug report if these + * exceptions occur. + */ + public function deletePrivateKey($keyId) + { + $fingerprint = $this->getFingerprint($keyId); + + if ($fingerprint === null) { + throw new Crypt_GPG_KeyNotFoundException( + 'Private key not found: ' . $keyId, + Crypt_GPG::ERROR_KEY_NOT_FOUND, $keyId); + } + + $operation = '--delete-secret-key ' . escapeshellarg($fingerprint); + $arguments = array( + '--batch', + '--yes' + ); + + $this->engine->reset(); + $this->engine->setOperation($operation, $arguments); + $this->engine->run(); + + $code = $this->engine->getErrorCode(); + + switch ($code) { + case Crypt_GPG::ERROR_NONE: + break; + case Crypt_GPG::ERROR_KEY_NOT_FOUND: + throw new Crypt_GPG_KeyNotFoundException( + 'Private key not found: ' . $keyId, + $code, $keyId); + default: + throw new Crypt_GPG_Exception( + 'Unknown error deleting private key. Please use the ' . + '\'debug\' option when creating the Crypt_GPG object, and ' . + 'file a bug report at ' . self::BUG_URI, $code); + } + } + + // }}} + // {{{ getKeys() + + /** + * Gets the available keys in the keyring + * + * Calls GPG with the <kbd>--list-keys</kbd> command and grabs keys. See + * the first section of <b>doc/DETAILS</b> in the + * {@link http://www.gnupg.org/download/ GPG package} for a detailed + * description of how the GPG command output is parsed. + * + * @param string $keyId optional. Only keys with that match the specified + * pattern are returned. The pattern may be part of + * a user id, a key id or a key fingerprint. If not + * specified, all keys are returned. + * + * @return array an array of {@link Crypt_GPG_Key} objects. If no keys + * match the specified <kbd>$keyId</kbd> an empty array is + * returned. + * + * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs. + * Use the <kbd>debug</kbd> option and file a bug report if these + * exceptions occur. + * + * @see Crypt_GPG_Key + */ + public function getKeys($keyId = '') + { + // get private key fingerprints + if ($keyId == '') { + $operation = '--list-secret-keys'; + } else { + $operation = '--list-secret-keys ' . escapeshellarg($keyId); + } + + // According to The file 'doc/DETAILS' in the GnuPG distribution, using + // double '--with-fingerprint' also prints the fingerprint for subkeys. + $arguments = array( + '--with-colons', + '--with-fingerprint', + '--with-fingerprint', + '--fixed-list-mode' + ); + + $output = ''; + + $this->engine->reset(); + $this->engine->setOutput($output); + $this->engine->setOperation($operation, $arguments); + $this->engine->run(); + + $code = $this->engine->getErrorCode(); + + switch ($code) { + case Crypt_GPG::ERROR_NONE: + case Crypt_GPG::ERROR_KEY_NOT_FOUND: + // ignore not found key errors + break; + case Crypt_GPG::ERROR_FILE_PERMISSIONS: + $filename = $this->engine->getErrorFilename(); + if ($filename) { + throw new Crypt_GPG_FileException(sprintf( + 'Error reading GnuPG data file \'%s\'. Check to make ' . + 'sure it is readable by the current user.', $filename), + $code, $filename); + } + throw new Crypt_GPG_FileException( + 'Error reading GnuPG data file. Check to make GnuPG data ' . + 'files are readable by the current user.', $code); + default: + throw new Crypt_GPG_Exception( + 'Unknown error getting keys. Please use the \'debug\' option ' . + 'when creating the Crypt_GPG object, and file a bug report ' . + 'at ' . self::BUG_URI, $code); + } + + $privateKeyFingerprints = array(); + + $lines = explode(PHP_EOL, $output); + foreach ($lines as $line) { + $lineExp = explode(':', $line); + if ($lineExp[0] == 'fpr') { + $privateKeyFingerprints[] = $lineExp[9]; + } + } + + // get public keys + if ($keyId == '') { + $operation = '--list-public-keys'; + } else { + $operation = '--list-public-keys ' . escapeshellarg($keyId); + } + + $output = ''; + + $this->engine->reset(); + $this->engine->setOutput($output); + $this->engine->setOperation($operation, $arguments); + $this->engine->run(); + + $code = $this->engine->getErrorCode(); + + switch ($code) { + case Crypt_GPG::ERROR_NONE: + case Crypt_GPG::ERROR_KEY_NOT_FOUND: + // ignore not found key errors + break; + case Crypt_GPG::ERROR_FILE_PERMISSIONS: + $filename = $this->engine->getErrorFilename(); + if ($filename) { + throw new Crypt_GPG_FileException(sprintf( + 'Error reading GnuPG data file \'%s\'. Check to make ' . + 'sure it is readable by the current user.', $filename), + $code, $filename); + } + throw new Crypt_GPG_FileException( + 'Error reading GnuPG data file. Check to make GnuPG data ' . + 'files are readable by the current user.', $code); + default: + throw new Crypt_GPG_Exception( + 'Unknown error getting keys. Please use the \'debug\' option ' . + 'when creating the Crypt_GPG object, and file a bug report ' . + 'at ' . self::BUG_URI, $code); + } + + $keys = array(); + + $key = null; // current key + $subKey = null; // current sub-key + + $lines = explode(PHP_EOL, $output); + foreach ($lines as $line) { + $lineExp = explode(':', $line); + + if ($lineExp[0] == 'pub') { + + // new primary key means last key should be added to the array + if ($key !== null) { + $keys[] = $key; + } + + $key = new Crypt_GPG_Key(); + + $subKey = Crypt_GPG_SubKey::parse($line); + $key->addSubKey($subKey); + + } elseif ($lineExp[0] == 'sub') { + + $subKey = Crypt_GPG_SubKey::parse($line); + $key->addSubKey($subKey); + + } elseif ($lineExp[0] == 'fpr') { + + $fingerprint = $lineExp[9]; + + // set current sub-key fingerprint + $subKey->setFingerprint($fingerprint); + + // if private key exists, set has private to true + if (in_array($fingerprint, $privateKeyFingerprints)) { + $subKey->setHasPrivate(true); + } + + } elseif ($lineExp[0] == 'uid') { + + $string = stripcslashes($lineExp[9]); // as per documentation + $userId = new Crypt_GPG_UserId($string); + + if ($lineExp[1] == 'r') { + $userId->setRevoked(true); + } + + $key->addUserId($userId); + + } + } + + // add last key + if ($key !== null) { + $keys[] = $key; + } + + return $keys; + } + + // }}} + // {{{ getFingerprint() + + /** + * Gets a key fingerprint from the keyring + * + * If more than one key fingerprint is available (for example, if you use + * a non-unique user id) only the first key fingerprint is returned. + * + * Calls the GPG <kbd>--list-keys</kbd> command with the + * <kbd>--with-fingerprint</kbd> option to retrieve a public key + * fingerprint. + * + * @param string $keyId either the full user id of the key, the email + * part of the user id of the key, or the key id of + * the key. For example, + * "Test User (example) <test@example.com>", + * "test@example.com" or a hexadecimal string. + * @param integer $format optional. How the fingerprint should be formatted. + * Use {@link Crypt_GPG::FORMAT_X509} for X.509 + * certificate format, + * {@link Crypt_GPG::FORMAT_CANONICAL} for the format + * used by GnuPG output and + * {@link Crypt_GPG::FORMAT_NONE} for no formatting. + * Defaults to <code>Crypt_GPG::FORMAT_NONE</code>. + * + * @return string the fingerprint of the key, or null if no fingerprint + * is found for the given <kbd>$keyId</kbd>. + * + * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs. + * Use the <kbd>debug</kbd> option and file a bug report if these + * exceptions occur. + */ + public function getFingerprint($keyId, $format = Crypt_GPG::FORMAT_NONE) + { + $output = ''; + $operation = '--list-keys ' . escapeshellarg($keyId); + $arguments = array( + '--with-colons', + '--with-fingerprint' + ); + + $this->engine->reset(); + $this->engine->setOutput($output); + $this->engine->setOperation($operation, $arguments); + $this->engine->run(); + + $code = $this->engine->getErrorCode(); + + switch ($code) { + case Crypt_GPG::ERROR_NONE: + case Crypt_GPG::ERROR_KEY_NOT_FOUND: + // ignore not found key errors + break; + default: + throw new Crypt_GPG_Exception( + 'Unknown error getting key fingerprint. Please use the ' . + '\'debug\' option when creating the Crypt_GPG object, and ' . + 'file a bug report at ' . self::BUG_URI, $code); + } + + $fingerprint = null; + + $lines = explode(PHP_EOL, $output); + foreach ($lines as $line) { + if (substr($line, 0, 3) == 'fpr') { + $lineExp = explode(':', $line); + $fingerprint = $lineExp[9]; + + switch ($format) { + case Crypt_GPG::FORMAT_CANONICAL: + $fingerprintExp = str_split($fingerprint, 4); + $format = '%s %s %s %s %s %s %s %s %s %s'; + $fingerprint = vsprintf($format, $fingerprintExp); + break; + + case Crypt_GPG::FORMAT_X509: + $fingerprintExp = str_split($fingerprint, 2); + $fingerprint = implode(':', $fingerprintExp); + break; + } + + break; + } + } + + return $fingerprint; + } + + // }}} + // {{{ encrypt() + + /** + * Encrypts string data + * + * Data is ASCII armored by default but may optionally be returned as + * binary. + * + * @param string $data the data to be encrypted. + * @param boolean $armor optional. If true, ASCII armored data is returned; + * otherwise, binary data is returned. Defaults to + * true. + * + * @return string the encrypted data. + * + * @throws Crypt_GPG_KeyNotFoundException if no encryption key is specified. + * See {@link Crypt_GPG::addEncryptKey()}. + * + * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs. + * Use the <kbd>debug</kbd> option and file a bug report if these + * exceptions occur. + * + * @sensitive $data + */ + public function encrypt($data, $armor = true) + { + return $this->_encrypt($data, false, null, $armor); + } + + // }}} + // {{{ encryptFile() + + /** + * Encrypts a file + * + * Encrypted data is ASCII armored by default but may optionally be saved + * as binary. + * + * @param string $filename the filename of the file to encrypt. + * @param string $encryptedFile optional. The filename of the file in + * which to store the encrypted data. If null + * or unspecified, the encrypted data is + * returned as a string. + * @param boolean $armor optional. If true, ASCII armored data is + * returned; otherwise, binary data is + * returned. Defaults to true. + * + * @return void|string if the <kbd>$encryptedFile</kbd> parameter is null, + * a string containing the encrypted data is returned. + * + * @throws Crypt_GPG_KeyNotFoundException if no encryption key is specified. + * See {@link Crypt_GPG::addEncryptKey()}. + * + * @throws Crypt_GPG_FileException if the output file is not writeable or + * if the input file is not readable. + * + * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs. + * Use the <kbd>debug</kbd> option and file a bug report if these + * exceptions occur. + */ + public function encryptFile($filename, $encryptedFile = null, $armor = true) + { + return $this->_encrypt($filename, true, $encryptedFile, $armor); + } + + // }}} + // {{{ encryptAndSign() + + /** + * Encrypts and signs data + * + * Data is encrypted and signed in a single pass. + * + * NOTE: Until GnuPG version 1.4.10, it was not possible to verify + * encrypted-signed data without decrypting it at the same time. If you try + * to use {@link Crypt_GPG::verify()} method on encrypted-signed data with + * earlier GnuPG versions, you will get an error. Please use + * {@link Crypt_GPG::decryptAndVerify()} to verify encrypted-signed data. + * + * @param string $data the data to be encrypted and signed. + * @param boolean $armor optional. If true, ASCII armored data is returned; + * otherwise, binary data is returned. Defaults to + * true. + * + * @return string the encrypted signed data. + * + * @throws Crypt_GPG_KeyNotFoundException if no encryption key is specified + * or if no signing key is specified. See + * {@link Crypt_GPG::addEncryptKey()} and + * {@link Crypt_GPG::addSignKey()}. + * + * @throws Crypt_GPG_BadPassphraseException if a specified passphrase is + * incorrect or if a required passphrase is not specified. + * + * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs. + * Use the <kbd>debug</kbd> option and file a bug report if these + * exceptions occur. + * + * @see Crypt_GPG::decryptAndVerify() + */ + public function encryptAndSign($data, $armor = true) + { + return $this->_encryptAndSign($data, false, null, $armor); + } + + // }}} + // {{{ encryptAndSignFile() + + /** + * Encrypts and signs a file + * + * The file is encrypted and signed in a single pass. + * + * NOTE: Until GnuPG version 1.4.10, it was not possible to verify + * encrypted-signed files without decrypting them at the same time. If you + * try to use {@link Crypt_GPG::verify()} method on encrypted-signed files + * with earlier GnuPG versions, you will get an error. Please use + * {@link Crypt_GPG::decryptAndVerifyFile()} to verify encrypted-signed + * files. + * + * @param string $filename the name of the file containing the data to + * be encrypted and signed. + * @param string $signedFile optional. The name of the file in which the + * encrypted, signed data should be stored. If + * null or unspecified, the encrypted, signed + * data is returned as a string. + * @param boolean $armor optional. If true, ASCII armored data is + * returned; otherwise, binary data is returned. + * Defaults to true. + * + * @return void|string if the <kbd>$signedFile</kbd> parameter is null, a + * string containing the encrypted, signed data is + * returned. + * + * @throws Crypt_GPG_KeyNotFoundException if no encryption key is specified + * or if no signing key is specified. See + * {@link Crypt_GPG::addEncryptKey()} and + * {@link Crypt_GPG::addSignKey()}. + * + * @throws Crypt_GPG_BadPassphraseException if a specified passphrase is + * incorrect or if a required passphrase is not specified. + * + * @throws Crypt_GPG_FileException if the output file is not writeable or + * if the input file is not readable. + * + * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs. + * Use the <kbd>debug</kbd> option and file a bug report if these + * exceptions occur. + * + * @see Crypt_GPG::decryptAndVerifyFile() + */ + public function encryptAndSignFile($filename, $signedFile = null, + $armor = true + ) { + return $this->_encryptAndSign($filename, true, $signedFile, $armor); + } + + // }}} + // {{{ decrypt() + + /** + * Decrypts string data + * + * This method assumes the required private key is available in the keyring + * and throws an exception if the private key is not available. To add a + * private key to the keyring, use the {@link Crypt_GPG::importKey()} or + * {@link Crypt_GPG::importKeyFile()} methods. + * + * @param string $encryptedData the data to be decrypted. + * + * @return string the decrypted data. + * + * @throws Crypt_GPG_KeyNotFoundException if the private key needed to + * decrypt the data is not in the user's keyring. + * + * @throws Crypt_GPG_NoDataException if specified data does not contain + * GPG encrypted data. + * + * @throws Crypt_GPG_BadPassphraseException if a required passphrase is + * incorrect or if a required passphrase is not specified. See + * {@link Crypt_GPG::addDecryptKey()}. + * + * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs. + * Use the <kbd>debug</kbd> option and file a bug report if these + * exceptions occur. + */ + public function decrypt($encryptedData) + { + return $this->_decrypt($encryptedData, false, null); + } + + // }}} + // {{{ decryptFile() + + /** + * Decrypts a file + * + * This method assumes the required private key is available in the keyring + * and throws an exception if the private key is not available. To add a + * private key to the keyring, use the {@link Crypt_GPG::importKey()} or + * {@link Crypt_GPG::importKeyFile()} methods. + * + * @param string $encryptedFile the name of the encrypted file data to + * decrypt. + * @param string $decryptedFile optional. The name of the file to which the + * decrypted data should be written. If null + * or unspecified, the decrypted data is + * returned as a string. + * + * @return void|string if the <kbd>$decryptedFile</kbd> parameter is null, + * a string containing the decrypted data is returned. + * + * @throws Crypt_GPG_KeyNotFoundException if the private key needed to + * decrypt the data is not in the user's keyring. + * + * @throws Crypt_GPG_NoDataException if specified data does not contain + * GPG encrypted data. + * + * @throws Crypt_GPG_BadPassphraseException if a required passphrase is + * incorrect or if a required passphrase is not specified. See + * {@link Crypt_GPG::addDecryptKey()}. + * + * @throws Crypt_GPG_FileException if the output file is not writeable or + * if the input file is not readable. + * + * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs. + * Use the <kbd>debug</kbd> option and file a bug report if these + * exceptions occur. + */ + public function decryptFile($encryptedFile, $decryptedFile = null) + { + return $this->_decrypt($encryptedFile, true, $decryptedFile); + } + + // }}} + // {{{ decryptAndVerify() + + /** + * Decrypts and verifies string data + * + * This method assumes the required private key is available in the keyring + * and throws an exception if the private key is not available. To add a + * private key to the keyring, use the {@link Crypt_GPG::importKey()} or + * {@link Crypt_GPG::importKeyFile()} methods. + * + * @param string $encryptedData the encrypted, signed data to be decrypted + * and verified. + * + * @return array two element array. The array has an element 'data' + * containing the decrypted data and an element + * 'signatures' containing an array of + * {@link Crypt_GPG_Signature} objects for the signed data. + * + * @throws Crypt_GPG_KeyNotFoundException if the private key needed to + * decrypt the data is not in the user's keyring. + * + * @throws Crypt_GPG_NoDataException if specified data does not contain + * GPG encrypted data. + * + * @throws Crypt_GPG_BadPassphraseException if a required passphrase is + * incorrect or if a required passphrase is not specified. See + * {@link Crypt_GPG::addDecryptKey()}. + * + * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs. + * Use the <kbd>debug</kbd> option and file a bug report if these + * exceptions occur. + */ + public function decryptAndVerify($encryptedData) + { + return $this->_decryptAndVerify($encryptedData, false, null); + } + + // }}} + // {{{ decryptAndVerifyFile() + + /** + * Decrypts and verifies a signed, encrypted file + * + * This method assumes the required private key is available in the keyring + * and throws an exception if the private key is not available. To add a + * private key to the keyring, use the {@link Crypt_GPG::importKey()} or + * {@link Crypt_GPG::importKeyFile()} methods. + * + * @param string $encryptedFile the name of the signed, encrypted file to + * to decrypt and verify. + * @param string $decryptedFile optional. The name of the file to which the + * decrypted data should be written. If null + * or unspecified, the decrypted data is + * returned in the results array. + * + * @return array two element array. The array has an element 'data' + * containing the decrypted data and an element + * 'signatures' containing an array of + * {@link Crypt_GPG_Signature} objects for the signed data. + * If the decrypted data is written to a file, the 'data' + * element is null. + * + * @throws Crypt_GPG_KeyNotFoundException if the private key needed to + * decrypt the data is not in the user's keyring. + * + * @throws Crypt_GPG_NoDataException if specified data does not contain + * GPG encrypted data. + * + * @throws Crypt_GPG_BadPassphraseException if a required passphrase is + * incorrect or if a required passphrase is not specified. See + * {@link Crypt_GPG::addDecryptKey()}. + * + * @throws Crypt_GPG_FileException if the output file is not writeable or + * if the input file is not readable. + * + * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs. + * Use the <kbd>debug</kbd> option and file a bug report if these + * exceptions occur. + */ + public function decryptAndVerifyFile($encryptedFile, $decryptedFile = null) + { + return $this->_decryptAndVerify($encryptedFile, true, $decryptedFile); + } + + // }}} + // {{{ sign() + + /** + * Signs data + * + * Data may be signed using any one of the three available signing modes: + * - {@link Crypt_GPG::SIGN_MODE_NORMAL} + * - {@link Crypt_GPG::SIGN_MODE_CLEAR} + * - {@link Crypt_GPG::SIGN_MODE_DETACHED} + * + * @param string $data the data to be signed. + * @param boolean $mode optional. The data signing mode to use. Should + * be one of {@link Crypt_GPG::SIGN_MODE_NORMAL}, + * {@link Crypt_GPG::SIGN_MODE_CLEAR} or + * {@link Crypt_GPG::SIGN_MODE_DETACHED}. If not + * specified, defaults to + * <kbd>Crypt_GPG::SIGN_MODE_NORMAL</kbd>. + * @param boolean $armor optional. If true, ASCII armored data is + * returned; otherwise, binary data is returned. + * Defaults to true. This has no effect if the + * mode <kbd>Crypt_GPG::SIGN_MODE_CLEAR</kbd> is + * used. + * @param boolean $textmode optional. If true, line-breaks in signed data + * are normalized. Use this option when signing + * e-mail, or for greater compatibility between + * systems with different line-break formats. + * Defaults to false. This has no effect if the + * mode <kbd>Crypt_GPG::SIGN_MODE_CLEAR</kbd> is + * used as clear-signing always uses textmode. + * + * @return string the signed data, or the signature data if a detached + * signature is requested. + * + * @throws Crypt_GPG_KeyNotFoundException if no signing key is specified. + * See {@link Crypt_GPG::addSignKey()}. + * + * @throws Crypt_GPG_BadPassphraseException if a specified passphrase is + * incorrect or if a required passphrase is not specified. + * + * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs. + * Use the <kbd>debug</kbd> option and file a bug report if these + * exceptions occur. + */ + public function sign($data, $mode = Crypt_GPG::SIGN_MODE_NORMAL, + $armor = true, $textmode = false + ) { + return $this->_sign($data, false, null, $mode, $armor, $textmode); + } + + // }}} + // {{{ signFile() + + /** + * Signs a file + * + * The file may be signed using any one of the three available signing + * modes: + * - {@link Crypt_GPG::SIGN_MODE_NORMAL} + * - {@link Crypt_GPG::SIGN_MODE_CLEAR} + * - {@link Crypt_GPG::SIGN_MODE_DETACHED} + * + * @param string $filename the name of the file containing the data to + * be signed. + * @param string $signedFile optional. The name of the file in which the + * signed data should be stored. If null or + * unspecified, the signed data is returned as a + * string. + * @param boolean $mode optional. The data signing mode to use. Should + * be one of {@link Crypt_GPG::SIGN_MODE_NORMAL}, + * {@link Crypt_GPG::SIGN_MODE_CLEAR} or + * {@link Crypt_GPG::SIGN_MODE_DETACHED}. If not + * specified, defaults to + * <kbd>Crypt_GPG::SIGN_MODE_NORMAL</kbd>. + * @param boolean $armor optional. If true, ASCII armored data is + * returned; otherwise, binary data is returned. + * Defaults to true. This has no effect if the + * mode <kbd>Crypt_GPG::SIGN_MODE_CLEAR</kbd> is + * used. + * @param boolean $textmode optional. If true, line-breaks in signed data + * are normalized. Use this option when signing + * e-mail, or for greater compatibility between + * systems with different line-break formats. + * Defaults to false. This has no effect if the + * mode <kbd>Crypt_GPG::SIGN_MODE_CLEAR</kbd> is + * used as clear-signing always uses textmode. + * + * @return void|string if the <kbd>$signedFile</kbd> parameter is null, a + * string containing the signed data (or the signature + * data if a detached signature is requested) is + * returned. + * + * @throws Crypt_GPG_KeyNotFoundException if no signing key is specified. + * See {@link Crypt_GPG::addSignKey()}. + * + * @throws Crypt_GPG_BadPassphraseException if a specified passphrase is + * incorrect or if a required passphrase is not specified. + * + * @throws Crypt_GPG_FileException if the output file is not writeable or + * if the input file is not readable. + * + * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs. + * Use the <kbd>debug</kbd> option and file a bug report if these + * exceptions occur. + */ + public function signFile($filename, $signedFile = null, + $mode = Crypt_GPG::SIGN_MODE_NORMAL, $armor = true, $textmode = false + ) { + return $this->_sign( + $filename, + true, + $signedFile, + $mode, + $armor, + $textmode + ); + } + + // }}} + // {{{ verify() + + /** + * Verifies signed data + * + * The {@link Crypt_GPG::decrypt()} method may be used to get the original + * message if the signed data is not clearsigned and does not use a + * detached signature. + * + * @param string $signedData the signed data to be verified. + * @param string $signature optional. If verifying data signed using a + * detached signature, this must be the detached + * signature data. The data that was signed is + * specified in <kbd>$signedData</kbd>. + * + * @return array an array of {@link Crypt_GPG_Signature} objects for the + * signed data. For each signature that is valid, the + * {@link Crypt_GPG_Signature::isValid()} will return true. + * + * @throws Crypt_GPG_NoDataException if the provided data is not signed + * data. + * + * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs. + * Use the <kbd>debug</kbd> option and file a bug report if these + * exceptions occur. + * + * @see Crypt_GPG_Signature + */ + public function verify($signedData, $signature = '') + { + return $this->_verify($signedData, false, $signature); + } + + // }}} + // {{{ verifyFile() + + /** + * Verifies a signed file + * + * The {@link Crypt_GPG::decryptFile()} method may be used to get the + * original message if the signed data is not clearsigned and does not use + * a detached signature. + * + * @param string $filename the signed file to be verified. + * @param string $signature optional. If verifying a file signed using a + * detached signature, this must be the detached + * signature data. The file that was signed is + * specified in <kbd>$filename</kbd>. + * + * @return array an array of {@link Crypt_GPG_Signature} objects for the + * signed data. For each signature that is valid, the + * {@link Crypt_GPG_Signature::isValid()} will return true. + * + * @throws Crypt_GPG_NoDataException if the provided data is not signed + * data. + * + * @throws Crypt_GPG_FileException if the input file is not readable. + * + * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs. + * Use the <kbd>debug</kbd> option and file a bug report if these + * exceptions occur. + * + * @see Crypt_GPG_Signature + */ + public function verifyFile($filename, $signature = '') + { + return $this->_verify($filename, true, $signature); + } + + // }}} + // {{{ addDecryptKey() + + /** + * Adds a key to use for decryption + * + * @param mixed $key the key to use. This may be a key identifier, + * user id, fingerprint, {@link Crypt_GPG_Key} or + * {@link Crypt_GPG_SubKey}. The key must be able + * to encrypt. + * @param string $passphrase optional. The passphrase of the key required + * for decryption. + * + * @return void + * + * @see Crypt_GPG::decrypt() + * @see Crypt_GPG::decryptFile() + * @see Crypt_GPG::clearDecryptKeys() + * @see Crypt_GPG::_addKey() + * @see Crypt_GPG_DecryptStatusHandler + * + * @sensitive $passphrase + */ + public function addDecryptKey($key, $passphrase = null) + { + $this->_addKey($this->decryptKeys, true, false, $key, $passphrase); + } + + // }}} + // {{{ addEncryptKey() + + /** + * Adds a key to use for encryption + * + * @param mixed $key the key to use. This may be a key identifier, user id + * user id, fingerprint, {@link Crypt_GPG_Key} or + * {@link Crypt_GPG_SubKey}. The key must be able to + * encrypt. + * + * @return void + * + * @see Crypt_GPG::encrypt() + * @see Crypt_GPG::encryptFile() + * @see Crypt_GPG::clearEncryptKeys() + * @see Crypt_GPG::_addKey() + */ + public function addEncryptKey($key) + { + $this->_addKey($this->encryptKeys, true, false, $key); + } + + // }}} + // {{{ addSignKey() + + /** + * Adds a key to use for signing + * + * @param mixed $key the key to use. This may be a key identifier, + * user id, fingerprint, {@link Crypt_GPG_Key} or + * {@link Crypt_GPG_SubKey}. The key must be able + * to sign. + * @param string $passphrase optional. The passphrase of the key required + * for signing. + * + * @return void + * + * @see Crypt_GPG::sign() + * @see Crypt_GPG::signFile() + * @see Crypt_GPG::clearSignKeys() + * @see Crypt_GPG::handleSignStatus() + * @see Crypt_GPG::_addKey() + * + * @sensitive $passphrase + */ + public function addSignKey($key, $passphrase = null) + { + $this->_addKey($this->signKeys, false, true, $key, $passphrase); + } + + // }}} + // {{{ clearDecryptKeys() + + /** + * Clears all decryption keys + * + * @return void + * + * @see Crypt_GPG::decrypt() + * @see Crypt_GPG::addDecryptKey() + */ + public function clearDecryptKeys() + { + $this->decryptKeys = array(); + } + + // }}} + // {{{ clearEncryptKeys() + + /** + * Clears all encryption keys + * + * @return void + * + * @see Crypt_GPG::encrypt() + * @see Crypt_GPG::addEncryptKey() + */ + public function clearEncryptKeys() + { + $this->encryptKeys = array(); + } + + // }}} + // {{{ clearSignKeys() + + /** + * Clears all signing keys + * + * @return void + * + * @see Crypt_GPG::sign() + * @see Crypt_GPG::addSignKey() + */ + public function clearSignKeys() + { + $this->signKeys = array(); + } + + // }}} + // {{{ handleSignStatus() + + /** + * Handles the status output from GPG for the sign operation + * + * This method is responsible for sending the passphrase commands when + * required by the {@link Crypt_GPG::sign()} method. See <b>doc/DETAILS</b> + * in the {@link http://www.gnupg.org/download/ GPG distribution} for + * detailed information on GPG's status output. + * + * @param string $line the status line to handle. + * + * @return void + * + * @see Crypt_GPG::sign() + */ + public function handleSignStatus($line) + { + $tokens = explode(' ', $line); + switch ($tokens[0]) { + case 'NEED_PASSPHRASE': + $subKeyId = $tokens[1]; + if (array_key_exists($subKeyId, $this->signKeys)) { + $passphrase = $this->signKeys[$subKeyId]['passphrase']; + $this->engine->sendCommand($passphrase); + } else { + $this->engine->sendCommand(''); + } + break; + } + } + + // }}} + // {{{ handleImportKeyStatus() + + /** + * Handles the status output from GPG for the import operation + * + * This method is responsible for building the result array that is + * returned from the {@link Crypt_GPG::importKey()} method. See + * <b>doc/DETAILS</b> in the + * {@link http://www.gnupg.org/download/ GPG distribution} for detailed + * information on GPG's status output. + * + * @param string $line the status line to handle. + * @param array &$result the current result array being processed. + * + * @return void + * + * @see Crypt_GPG::importKey() + * @see Crypt_GPG::importKeyFile() + * @see Crypt_GPG_Engine::addStatusHandler() + */ + public function handleImportKeyStatus($line, array &$result) + { + $tokens = explode(' ', $line); + switch ($tokens[0]) { + case 'IMPORT_OK': + $result['fingerprint'] = $tokens[2]; + break; + + case 'IMPORT_RES': + $result['public_imported'] = intval($tokens[3]); + $result['public_unchanged'] = intval($tokens[5]); + $result['private_imported'] = intval($tokens[11]); + $result['private_unchanged'] = intval($tokens[12]); + break; + } + } + + // }}} + // {{{ setEngine() + + /** + * Sets the I/O engine to use for GnuPG operations + * + * Normally this method does not need to be used. It provides a means for + * dependency injection. + * + * @param Crypt_GPG_Engine $engine the engine to use. + * + * @return void + */ + public function setEngine(Crypt_GPG_Engine $engine) + { + $this->engine = $engine; + } + + // }}} + // {{{ _addKey() + + /** + * Adds a key to one of the internal key arrays + * + * This handles resolving full key objects from the provided + * <kbd>$key</kbd> value. + * + * @param array &$array the array to which the key should be added. + * @param boolean $encrypt whether or not the key must be able to + * encrypt. + * @param boolean $sign whether or not the key must be able to sign. + * @param mixed $key the key to add. This may be a key identifier, + * user id, fingerprint, {@link Crypt_GPG_Key} or + * {@link Crypt_GPG_SubKey}. + * @param string $passphrase optional. The passphrase associated with the + * key. + * + * @return void + * + * @sensitive $passphrase + */ + private function _addKey(array &$array, $encrypt, $sign, $key, + $passphrase = null + ) { + $subKeys = array(); + + if (is_scalar($key)) { + $keys = $this->getKeys($key); + if (count($keys) == 0) { + throw new Crypt_GPG_KeyNotFoundException( + 'Key "' . $key . '" not found.', 0, $key); + } + $key = $keys[0]; + } + + if ($key instanceof Crypt_GPG_Key) { + if ($encrypt && !$key->canEncrypt()) { + throw new InvalidArgumentException( + 'Key "' . $key . '" cannot encrypt.'); + } + + if ($sign && !$key->canSign()) { + throw new InvalidArgumentException( + 'Key "' . $key . '" cannot sign.'); + } + + foreach ($key->getSubKeys() as $subKey) { + $canEncrypt = $subKey->canEncrypt(); + $canSign = $subKey->canSign(); + if ( ($encrypt && $sign && $canEncrypt && $canSign) + || ($encrypt && !$sign && $canEncrypt) + || (!$encrypt && $sign && $canSign) + ) { + // We add all subkeys that meet the requirements because we + // were not told which subkey is required. + $subKeys[] = $subKey; + } + } + } elseif ($key instanceof Crypt_GPG_SubKey) { + $subKeys[] = $key; + } + + if (count($subKeys) === 0) { + throw new InvalidArgumentException( + 'Key "' . $key . '" is not in a recognized format.'); + } + + foreach ($subKeys as $subKey) { + if ($encrypt && !$subKey->canEncrypt()) { + throw new InvalidArgumentException( + 'Key "' . $key . '" cannot encrypt.'); + } + + if ($sign && !$subKey->canSign()) { + throw new InvalidArgumentException( + 'Key "' . $key . '" cannot sign.'); + } + + $array[$subKey->getId()] = array( + 'fingerprint' => $subKey->getFingerprint(), + 'passphrase' => $passphrase + ); + } + } + + // }}} + // {{{ _importKey() + + /** + * Imports a public or private key into the keyring + * + * @param string $key the key to be imported. + * @param boolean $isFile whether or not the input is a filename. + * + * @return array an associative array containing the following elements: + * - <kbd>fingerprint</kbd> - the fingerprint of the + * imported key, + * - <kbd>public_imported</kbd> - the number of public + * keys imported, + * - <kbd>public_unchanged</kbd> - the number of unchanged + * public keys, + * - <kbd>private_imported</kbd> - the number of private + * keys imported, + * - <kbd>private_unchanged</kbd> - the number of unchanged + * private keys. + * + * @throws Crypt_GPG_NoDataException if the key data is missing or if the + * data is is not valid key data. + * + * @throws Crypt_GPG_FileException if the key file is not readable. + * + * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs. + * Use the <kbd>debug</kbd> option and file a bug report if these + * exceptions occur. + */ + private function _importKey($key, $isFile) + { + $result = array(); + + if ($isFile) { + $input = @fopen($key, 'rb'); + if ($input === false) { + throw new Crypt_GPG_FileException('Could not open key file "' . + $key . '" for importing.', 0, $key); + } + } else { + $input = strval($key); + if ($input == '') { + throw new Crypt_GPG_NoDataException( + 'No valid GPG key data found.', Crypt_GPG::ERROR_NO_DATA); + } + } + + $arguments = array(); + $version = $this->engine->getVersion(); + + if ( version_compare($version, '1.0.5', 'ge') + && version_compare($version, '1.0.7', 'lt') + ) { + $arguments[] = '--allow-secret-key-import'; + } + + $this->engine->reset(); + $this->engine->addStatusHandler( + array($this, 'handleImportKeyStatus'), + array(&$result) + ); + + $this->engine->setOperation('--import', $arguments); + $this->engine->setInput($input); + $this->engine->run(); + + if ($isFile) { + fclose($input); + } + + $code = $this->engine->getErrorCode(); + + switch ($code) { + case Crypt_GPG::ERROR_DUPLICATE_KEY: + case Crypt_GPG::ERROR_NONE: + // ignore duplicate key import errors + break; + case Crypt_GPG::ERROR_NO_DATA: + throw new Crypt_GPG_NoDataException( + 'No valid GPG key data found.', $code); + default: + throw new Crypt_GPG_Exception( + 'Unknown error importing GPG key. Please use the \'debug\' ' . + 'option when creating the Crypt_GPG object, and file a bug ' . + 'report at ' . self::BUG_URI, $code); + } + + return $result; + } + + // }}} + // {{{ _encrypt() + + /** + * Encrypts data + * + * @param string $data the data to encrypt. + * @param boolean $isFile whether or not the data is a filename. + * @param string $outputFile the filename of the file in which to store + * the encrypted data. If null, the encrypted + * data is returned as a string. + * @param boolean $armor if true, ASCII armored data is returned; + * otherwise, binary data is returned. + * + * @return void|string if the <kbd>$outputFile</kbd> parameter is null, a + * string containing the encrypted data is returned. + * + * @throws Crypt_GPG_KeyNotFoundException if no encryption key is specified. + * See {@link Crypt_GPG::addEncryptKey()}. + * + * @throws Crypt_GPG_FileException if the output file is not writeable or + * if the input file is not readable. + * + * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs. + * Use the <kbd>debug</kbd> option and file a bug report if these + * exceptions occur. + */ + private function _encrypt($data, $isFile, $outputFile, $armor) + { + if (count($this->encryptKeys) === 0) { + throw new Crypt_GPG_KeyNotFoundException( + 'No encryption keys specified.'); + } + + if ($isFile) { + $input = @fopen($data, 'rb'); + if ($input === false) { + throw new Crypt_GPG_FileException('Could not open input file "' . + $data . '" for encryption.', 0, $data); + } + } else { + $input = strval($data); + } + + if ($outputFile === null) { + $output = ''; + } else { + $output = @fopen($outputFile, 'wb'); + if ($output === false) { + if ($isFile) { + fclose($input); + } + throw new Crypt_GPG_FileException('Could not open output ' . + 'file "' . $outputFile . '" for storing encrypted data.', + 0, $outputFile); + } + } + + $arguments = ($armor) ? array('--armor') : array(); + foreach ($this->encryptKeys as $key) { + $arguments[] = '--recipient ' . escapeshellarg($key['fingerprint']); + } + + $this->engine->reset(); + $this->engine->setInput($input); + $this->engine->setOutput($output); + $this->engine->setOperation('--encrypt', $arguments); + $this->engine->run(); + + if ($isFile) { + fclose($input); + } + + if ($outputFile !== null) { + fclose($output); + } + + $code = $this->engine->getErrorCode(); + + if ($code !== Crypt_GPG::ERROR_NONE) { + throw new Crypt_GPG_Exception( + 'Unknown error encrypting data. Please use the \'debug\' ' . + 'option when creating the Crypt_GPG object, and file a bug ' . + 'report at ' . self::BUG_URI, $code); + } + + if ($outputFile === null) { + return $output; + } + } + + // }}} + // {{{ _decrypt() + + /** + * Decrypts data + * + * @param string $data the data to be decrypted. + * @param boolean $isFile whether or not the data is a filename. + * @param string $outputFile the name of the file to which the decrypted + * data should be written. If null, the decrypted + * data is returned as a string. + * + * @return void|string if the <kbd>$outputFile</kbd> parameter is null, a + * string containing the decrypted data is returned. + * + * @throws Crypt_GPG_KeyNotFoundException if the private key needed to + * decrypt the data is not in the user's keyring. + * + * @throws Crypt_GPG_NoDataException if specified data does not contain + * GPG encrypted data. + * + * @throws Crypt_GPG_BadPassphraseException if a required passphrase is + * incorrect or if a required passphrase is not specified. See + * {@link Crypt_GPG::addDecryptKey()}. + * + * @throws Crypt_GPG_FileException if the output file is not writeable or + * if the input file is not readable. + * + * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs. + * Use the <kbd>debug</kbd> option and file a bug report if these + * exceptions occur. + */ + private function _decrypt($data, $isFile, $outputFile) + { + if ($isFile) { + $input = @fopen($data, 'rb'); + if ($input === false) { + throw new Crypt_GPG_FileException('Could not open input file "' . + $data . '" for decryption.', 0, $data); + } + } else { + $input = strval($data); + if ($input == '') { + throw new Crypt_GPG_NoDataException( + 'Cannot decrypt data. No PGP encrypted data was found in '. + 'the provided data.', Crypt_GPG::ERROR_NO_DATA); + } + } + + if ($outputFile === null) { + $output = ''; + } else { + $output = @fopen($outputFile, 'wb'); + if ($output === false) { + if ($isFile) { + fclose($input); + } + throw new Crypt_GPG_FileException('Could not open output ' . + 'file "' . $outputFile . '" for storing decrypted data.', + 0, $outputFile); + } + } + + $handler = new Crypt_GPG_DecryptStatusHandler($this->engine, + $this->decryptKeys); + + $this->engine->reset(); + $this->engine->addStatusHandler(array($handler, 'handle')); + $this->engine->setOperation('--decrypt'); + $this->engine->setInput($input); + $this->engine->setOutput($output); + $this->engine->run(); + + if ($isFile) { + fclose($input); + } + + if ($outputFile !== null) { + fclose($output); + } + + // if there was any problem decrypting the data, the handler will + // deal with it here. + $handler->throwException(); + + if ($outputFile === null) { + return $output; + } + } + + // }}} + // {{{ _sign() + + /** + * Signs data + * + * @param string $data the data to be signed. + * @param boolean $isFile whether or not the data is a filename. + * @param string $outputFile the name of the file in which the signed data + * should be stored. If null, the signed data is + * returned as a string. + * @param boolean $mode the data signing mode to use. Should be one of + * {@link Crypt_GPG::SIGN_MODE_NORMAL}, + * {@link Crypt_GPG::SIGN_MODE_CLEAR} or + * {@link Crypt_GPG::SIGN_MODE_DETACHED}. + * @param boolean $armor if true, ASCII armored data is returned; + * otherwise, binary data is returned. This has + * no effect if the mode + * <kbd>Crypt_GPG::SIGN_MODE_CLEAR</kbd> is + * used. + * @param boolean $textmode if true, line-breaks in signed data be + * normalized. Use this option when signing + * e-mail, or for greater compatibility between + * systems with different line-break formats. + * Defaults to false. This has no effect if the + * mode <kbd>Crypt_GPG::SIGN_MODE_CLEAR</kbd> is + * used as clear-signing always uses textmode. + * + * @return void|string if the <kbd>$outputFile</kbd> parameter is null, a + * string containing the signed data (or the signature + * data if a detached signature is requested) is + * returned. + * + * @throws Crypt_GPG_KeyNotFoundException if no signing key is specified. + * See {@link Crypt_GPG::addSignKey()}. + * + * @throws Crypt_GPG_BadPassphraseException if a specified passphrase is + * incorrect or if a required passphrase is not specified. + * + * @throws Crypt_GPG_FileException if the output file is not writeable or + * if the input file is not readable. + * + * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs. + * Use the <kbd>debug</kbd> option and file a bug report if these + * exceptions occur. + */ + private function _sign($data, $isFile, $outputFile, $mode, $armor, + $textmode + ) { + if (count($this->signKeys) === 0) { + throw new Crypt_GPG_KeyNotFoundException( + 'No signing keys specified.'); + } + + if ($isFile) { + $input = @fopen($data, 'rb'); + if ($input === false) { + throw new Crypt_GPG_FileException('Could not open input ' . + 'file "' . $data . '" for signing.', 0, $data); + } + } else { + $input = strval($data); + } + + if ($outputFile === null) { + $output = ''; + } else { + $output = @fopen($outputFile, 'wb'); + if ($output === false) { + if ($isFile) { + fclose($input); + } + throw new Crypt_GPG_FileException('Could not open output ' . + 'file "' . $outputFile . '" for storing signed ' . + 'data.', 0, $outputFile); + } + } + + switch ($mode) { + case Crypt_GPG::SIGN_MODE_DETACHED: + $operation = '--detach-sign'; + break; + case Crypt_GPG::SIGN_MODE_CLEAR: + $operation = '--clearsign'; + break; + case Crypt_GPG::SIGN_MODE_NORMAL: + default: + $operation = '--sign'; + break; + } + + $arguments = array(); + + if ($armor) { + $arguments[] = '--armor'; + } + if ($textmode) { + $arguments[] = '--textmode'; + } + + foreach ($this->signKeys as $key) { + $arguments[] = '--local-user ' . + escapeshellarg($key['fingerprint']); + } + + $this->engine->reset(); + $this->engine->addStatusHandler(array($this, 'handleSignStatus')); + $this->engine->setInput($input); + $this->engine->setOutput($output); + $this->engine->setOperation($operation, $arguments); + $this->engine->run(); + + if ($isFile) { + fclose($input); + } + + if ($outputFile !== null) { + fclose($output); + } + + $code = $this->engine->getErrorCode(); + + switch ($code) { + case Crypt_GPG::ERROR_NONE: + break; + case Crypt_GPG::ERROR_KEY_NOT_FOUND: + throw new Crypt_GPG_KeyNotFoundException( + 'Cannot sign data. Private key not found. Import the '. + 'private key before trying to sign data.', $code, + $this->engine->getErrorKeyId()); + case Crypt_GPG::ERROR_BAD_PASSPHRASE: + throw new Crypt_GPG_BadPassphraseException( + 'Cannot sign data. Incorrect passphrase provided.', $code); + case Crypt_GPG::ERROR_MISSING_PASSPHRASE: + throw new Crypt_GPG_BadPassphraseException( + 'Cannot sign data. No passphrase provided.', $code); + default: + throw new Crypt_GPG_Exception( + 'Unknown error signing data. Please use the \'debug\' option ' . + 'when creating the Crypt_GPG object, and file a bug report ' . + 'at ' . self::BUG_URI, $code); + } + + if ($outputFile === null) { + return $output; + } + } + + // }}} + // {{{ _encryptAndSign() + + /** + * Encrypts and signs data + * + * @param string $data the data to be encrypted and signed. + * @param boolean $isFile whether or not the data is a filename. + * @param string $outputFile the name of the file in which the encrypted, + * signed data should be stored. If null, the + * encrypted, signed data is returned as a + * string. + * @param boolean $armor if true, ASCII armored data is returned; + * otherwise, binary data is returned. + * + * @return void|string if the <kbd>$outputFile</kbd> parameter is null, a + * string containing the encrypted, signed data is + * returned. + * + * @throws Crypt_GPG_KeyNotFoundException if no encryption key is specified + * or if no signing key is specified. See + * {@link Crypt_GPG::addEncryptKey()} and + * {@link Crypt_GPG::addSignKey()}. + * + * @throws Crypt_GPG_BadPassphraseException if a specified passphrase is + * incorrect or if a required passphrase is not specified. + * + * @throws Crypt_GPG_FileException if the output file is not writeable or + * if the input file is not readable. + * + * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs. + * Use the <kbd>debug</kbd> option and file a bug report if these + * exceptions occur. + */ + private function _encryptAndSign($data, $isFile, $outputFile, $armor) + { + if (count($this->signKeys) === 0) { + throw new Crypt_GPG_KeyNotFoundException( + 'No signing keys specified.'); + } + + if (count($this->encryptKeys) === 0) { + throw new Crypt_GPG_KeyNotFoundException( + 'No encryption keys specified.'); + } + + + if ($isFile) { + $input = @fopen($data, 'rb'); + if ($input === false) { + throw new Crypt_GPG_FileException('Could not open input ' . + 'file "' . $data . '" for encrypting and signing.', 0, + $data); + } + } else { + $input = strval($data); + } + + if ($outputFile === null) { + $output = ''; + } else { + $output = @fopen($outputFile, 'wb'); + if ($output === false) { + if ($isFile) { + fclose($input); + } + throw new Crypt_GPG_FileException('Could not open output ' . + 'file "' . $outputFile . '" for storing encrypted, ' . + 'signed data.', 0, $outputFile); + } + } + + $arguments = ($armor) ? array('--armor') : array(); + + foreach ($this->signKeys as $key) { + $arguments[] = '--local-user ' . + escapeshellarg($key['fingerprint']); + } + + foreach ($this->encryptKeys as $key) { + $arguments[] = '--recipient ' . escapeshellarg($key['fingerprint']); + } + + $this->engine->reset(); + $this->engine->addStatusHandler(array($this, 'handleSignStatus')); + $this->engine->setInput($input); + $this->engine->setOutput($output); + $this->engine->setOperation('--encrypt --sign', $arguments); + $this->engine->run(); + + if ($isFile) { + fclose($input); + } + + if ($outputFile !== null) { + fclose($output); + } + + $code = $this->engine->getErrorCode(); + + switch ($code) { + case Crypt_GPG::ERROR_NONE: + break; + case Crypt_GPG::ERROR_KEY_NOT_FOUND: + throw new Crypt_GPG_KeyNotFoundException( + 'Cannot sign encrypted data. Private key not found. Import '. + 'the private key before trying to sign the encrypted data.', + $code, $this->engine->getErrorKeyId()); + case Crypt_GPG::ERROR_BAD_PASSPHRASE: + throw new Crypt_GPG_BadPassphraseException( + 'Cannot sign encrypted data. Incorrect passphrase provided.', + $code); + case Crypt_GPG::ERROR_MISSING_PASSPHRASE: + throw new Crypt_GPG_BadPassphraseException( + 'Cannot sign encrypted data. No passphrase provided.', $code); + default: + throw new Crypt_GPG_Exception( + 'Unknown error encrypting and signing data. Please use the ' . + '\'debug\' option when creating the Crypt_GPG object, and ' . + 'file a bug report at ' . self::BUG_URI, $code); + } + + if ($outputFile === null) { + return $output; + } + } + + // }}} + // {{{ _verify() + + /** + * Verifies data + * + * @param string $data the signed data to be verified. + * @param boolean $isFile whether or not the data is a filename. + * @param string $signature if verifying a file signed using a detached + * signature, this must be the detached signature + * data. Otherwise, specify ''. + * + * @return array an array of {@link Crypt_GPG_Signature} objects for the + * signed data. + * + * @throws Crypt_GPG_NoDataException if the provided data is not signed + * data. + * + * @throws Crypt_GPG_FileException if the input file is not readable. + * + * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs. + * Use the <kbd>debug</kbd> option and file a bug report if these + * exceptions occur. + * + * @see Crypt_GPG_Signature + */ + private function _verify($data, $isFile, $signature) + { + if ($signature == '') { + $operation = '--verify'; + $arguments = array(); + } else { + // Signed data goes in FD_MESSAGE, detached signature data goes in + // FD_INPUT. + $operation = '--verify - "-&' . Crypt_GPG_Engine::FD_MESSAGE. '"'; + $arguments = array('--enable-special-filenames'); + } + + $handler = new Crypt_GPG_VerifyStatusHandler(); + + if ($isFile) { + $input = @fopen($data, 'rb'); + if ($input === false) { + throw new Crypt_GPG_FileException('Could not open input ' . + 'file "' . $data . '" for verifying.', 0, $data); + } + } else { + $input = strval($data); + if ($input == '') { + throw new Crypt_GPG_NoDataException( + 'No valid signature data found.', Crypt_GPG::ERROR_NO_DATA); + } + } + + $this->engine->reset(); + $this->engine->addStatusHandler(array($handler, 'handle')); + + if ($signature == '') { + // signed or clearsigned data + $this->engine->setInput($input); + } else { + // detached signature + $this->engine->setInput($signature); + $this->engine->setMessage($input); + } + + $this->engine->setOperation($operation, $arguments); + $this->engine->run(); + + if ($isFile) { + fclose($input); + } + + $code = $this->engine->getErrorCode(); + + switch ($code) { + case Crypt_GPG::ERROR_NONE: + case Crypt_GPG::ERROR_BAD_SIGNATURE: + break; + case Crypt_GPG::ERROR_NO_DATA: + throw new Crypt_GPG_NoDataException( + 'No valid signature data found.', $code); + case Crypt_GPG::ERROR_KEY_NOT_FOUND: + throw new Crypt_GPG_KeyNotFoundException( + 'Public key required for data verification not in keyring.', + $code, $this->engine->getErrorKeyId()); + default: + throw new Crypt_GPG_Exception( + 'Unknown error validating signature details. Please use the ' . + '\'debug\' option when creating the Crypt_GPG object, and ' . + 'file a bug report at ' . self::BUG_URI, $code); + } + + return $handler->getSignatures(); + } + + // }}} + // {{{ _decryptAndVerify() + + /** + * Decrypts and verifies encrypted, signed data + * + * @param string $data the encrypted signed data to be decrypted and + * verified. + * @param boolean $isFile whether or not the data is a filename. + * @param string $outputFile the name of the file to which the decrypted + * data should be written. If null, the decrypted + * data is returned in the results array. + * + * @return array two element array. The array has an element 'data' + * containing the decrypted data and an element + * 'signatures' containing an array of + * {@link Crypt_GPG_Signature} objects for the signed data. + * If the decrypted data is written to a file, the 'data' + * element is null. + * + * @throws Crypt_GPG_KeyNotFoundException if the private key needed to + * decrypt the data is not in the user's keyring or it the public + * key needed for verification is not in the user's keyring. + * + * @throws Crypt_GPG_NoDataException if specified data does not contain + * GPG signed, encrypted data. + * + * @throws Crypt_GPG_BadPassphraseException if a required passphrase is + * incorrect or if a required passphrase is not specified. See + * {@link Crypt_GPG::addDecryptKey()}. + * + * @throws Crypt_GPG_FileException if the output file is not writeable or + * if the input file is not readable. + * + * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs. + * Use the <kbd>debug</kbd> option and file a bug report if these + * exceptions occur. + * + * @see Crypt_GPG_Signature + */ + private function _decryptAndVerify($data, $isFile, $outputFile) + { + if ($isFile) { + $input = @fopen($data, 'rb'); + if ($input === false) { + throw new Crypt_GPG_FileException('Could not open input ' . + 'file "' . $data . '" for decrypting and verifying.', 0, + $data); + } + } else { + $input = strval($data); + if ($input == '') { + throw new Crypt_GPG_NoDataException( + 'No valid encrypted signed data found.', + Crypt_GPG::ERROR_NO_DATA); + } + } + + if ($outputFile === null) { + $output = ''; + } else { + $output = @fopen($outputFile, 'wb'); + if ($output === false) { + if ($isFile) { + fclose($input); + } + throw new Crypt_GPG_FileException('Could not open output ' . + 'file "' . $outputFile . '" for storing decrypted data.', + 0, $outputFile); + } + } + + $verifyHandler = new Crypt_GPG_VerifyStatusHandler(); + + $decryptHandler = new Crypt_GPG_DecryptStatusHandler($this->engine, + $this->decryptKeys); + + $this->engine->reset(); + $this->engine->addStatusHandler(array($verifyHandler, 'handle')); + $this->engine->addStatusHandler(array($decryptHandler, 'handle')); + $this->engine->setInput($input); + $this->engine->setOutput($output); + $this->engine->setOperation('--decrypt'); + $this->engine->run(); + + if ($isFile) { + fclose($input); + } + + if ($outputFile !== null) { + fclose($output); + } + + $return = array( + 'data' => null, + 'signatures' => $verifyHandler->getSignatures() + ); + + // if there was any problem decrypting the data, the handler will + // deal with it here. + try { + $decryptHandler->throwException(); + } catch (Exception $e) { + if ($e instanceof Crypt_GPG_KeyNotFoundException) { + throw new Crypt_GPG_KeyNotFoundException( + 'Public key required for data verification not in ', + 'the keyring. Either no suitable private decryption key ' . + 'is in the keyring or the public key required for data ' . + 'verification is not in the keyring. Import a suitable ' . + 'key before trying to decrypt and verify this data.', + self::ERROR_KEY_NOT_FOUND, $this->engine->getErrorKeyId()); + } + + if ($e instanceof Crypt_GPG_NoDataException) { + throw new Crypt_GPG_NoDataException( + 'Cannot decrypt and verify data. No PGP encrypted data ' . + 'was found in the provided data.', self::ERROR_NO_DATA); + } + + throw $e; + } + + if ($outputFile === null) { + $return['data'] = $output; + } + + return $return; + } + + // }}} +} + +// }}} + +?> diff --git a/plugins/enigma/lib/Crypt/GPG/DecryptStatusHandler.php b/plugins/enigma/lib/Crypt/GPG/DecryptStatusHandler.php new file mode 100644 index 000000000..40e8d50ed --- /dev/null +++ b/plugins/enigma/lib/Crypt/GPG/DecryptStatusHandler.php @@ -0,0 +1,336 @@ +<?php + +/* vim: set expandtab tabstop=4 shiftwidth=4 softtabstop=4: */ + +/** + * Crypt_GPG is a package to use GPG from PHP + * + * This file contains an object that handles GPG's status output for the + * decrypt operation. + * + * PHP version 5 + * + * LICENSE: + * + * This library is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as + * published by the Free Software Foundation; either version 2.1 of the + * License, or (at your option) any later version. + * + * This library is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + * Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public + * License along with this library; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA + * + * @category Encryption + * @package Crypt_GPG + * @author Michael Gauthier <mike@silverorange.com> + * @copyright 2008-2009 silverorange + * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1 + * @version CVS: $Id: DecryptStatusHandler.php 302814 2010-08-26 15:43:07Z gauthierm $ + * @link http://pear.php.net/package/Crypt_GPG + * @link http://www.gnupg.org/ + */ + +/** + * Crypt_GPG base class + */ +require_once 'Crypt/GPG.php'; + +/** + * GPG exception classes + */ +require_once 'Crypt/GPG/Exceptions.php'; + + +/** + * Status line handler for the decrypt operation + * + * This class is used internally by Crypt_GPG and does not need be used + * directly. See the {@link Crypt_GPG} class for end-user API. + * + * This class is responsible for sending the passphrase commands when required + * by the {@link Crypt_GPG::decrypt()} method. See <b>doc/DETAILS</b> in the + * {@link http://www.gnupg.org/download/ GPG distribution} for detailed + * information on GPG's status output for the decrypt operation. + * + * This class is also responsible for parsing error status and throwing a + * meaningful exception in the event that decryption fails. + * + * @category Encryption + * @package Crypt_GPG + * @author Michael Gauthier <mike@silverorange.com> + * @copyright 2008 silverorange + * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1 + * @link http://pear.php.net/package/Crypt_GPG + * @link http://www.gnupg.org/ + */ +class Crypt_GPG_DecryptStatusHandler +{ + // {{{ protected properties + + /** + * Keys used to decrypt + * + * The array is of the form: + * <code> + * array( + * $key_id => array( + * 'fingerprint' => $fingerprint, + * 'passphrase' => $passphrase + * ) + * ); + * </code> + * + * @var array + */ + protected $keys = array(); + + /** + * Engine used to which passphrases are passed + * + * @var Crypt_GPG_Engine + */ + protected $engine = null; + + /** + * The id of the current sub-key used for decryption + * + * @var string + */ + protected $currentSubKey = ''; + + /** + * Whether or not decryption succeeded + * + * If the message is only signed (compressed) and not encrypted, this is + * always true. If the message is encrypted, this flag is set to false + * until we know the decryption succeeded. + * + * @var boolean + */ + protected $decryptionOkay = true; + + /** + * Whether or not there was no data for decryption + * + * @var boolean + */ + protected $noData = false; + + /** + * Keys for which the passhprase is missing + * + * This contains primary user ids indexed by sub-key id and is used to + * create helpful exception messages. + * + * @var array + */ + protected $missingPassphrases = array(); + + /** + * Keys for which the passhprase is incorrect + * + * This contains primary user ids indexed by sub-key id and is used to + * create helpful exception messages. + * + * @var array + */ + protected $badPassphrases = array(); + + /** + * Keys that can be used to decrypt the data but are missing from the + * keychain + * + * This is an array with both the key and value being the sub-key id of + * the missing keys. + * + * @var array + */ + protected $missingKeys = array(); + + // }}} + // {{{ __construct() + + /** + * Creates a new decryption status handler + * + * @param Crypt_GPG_Engine $engine the GPG engine to which passphrases are + * passed. + * @param array $keys the decryption keys to use. + */ + public function __construct(Crypt_GPG_Engine $engine, array $keys) + { + $this->engine = $engine; + $this->keys = $keys; + } + + // }}} + // {{{ handle() + + /** + * Handles a status line + * + * @param string $line the status line to handle. + * + * @return void + */ + public function handle($line) + { + $tokens = explode(' ', $line); + switch ($tokens[0]) { + case 'ENC_TO': + // Now we know the message is encrypted. Set flag to check if + // decryption succeeded. + $this->decryptionOkay = false; + + // this is the new key message + $this->currentSubKeyId = $tokens[1]; + break; + + case 'NEED_PASSPHRASE': + // send passphrase to the GPG engine + $subKeyId = $tokens[1]; + if (array_key_exists($subKeyId, $this->keys)) { + $passphrase = $this->keys[$subKeyId]['passphrase']; + $this->engine->sendCommand($passphrase); + } else { + $this->engine->sendCommand(''); + } + break; + + case 'USERID_HINT': + // remember the user id for pretty exception messages + $this->badPassphrases[$tokens[1]] + = implode(' ', array_splice($tokens, 2)); + + break; + + case 'GOOD_PASSPHRASE': + // if we got a good passphrase, remove the key from the list of + // bad passphrases. + unset($this->badPassphrases[$this->currentSubKeyId]); + break; + + case 'MISSING_PASSPHRASE': + $this->missingPassphrases[$this->currentSubKeyId] + = $this->currentSubKeyId; + + break; + + case 'NO_SECKEY': + // note: this message is also received if there are multiple + // recipients and a previous key had a correct passphrase. + $this->missingKeys[$tokens[1]] = $tokens[1]; + break; + + case 'NODATA': + $this->noData = true; + break; + + case 'DECRYPTION_OKAY': + // If the message is encrypted, this is the all-clear signal. + $this->decryptionOkay = true; + break; + } + } + + // }}} + // {{{ throwException() + + /** + * Takes the final status of the decrypt operation and throws an + * appropriate exception + * + * If decryption was successful, no exception is thrown. + * + * @return void + * + * @throws Crypt_GPG_KeyNotFoundException if the private key needed to + * decrypt the data is not in the user's keyring. + * + * @throws Crypt_GPG_NoDataException if specified data does not contain + * GPG encrypted data. + * + * @throws Crypt_GPG_BadPassphraseException if a required passphrase is + * incorrect or if a required passphrase is not specified. See + * {@link Crypt_GPG::addDecryptKey()}. + * + * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs. + * Use the <i>debug</i> option and file a bug report if these + * exceptions occur. + */ + public function throwException() + { + $code = Crypt_GPG::ERROR_NONE; + + if (!$this->decryptionOkay) { + if (count($this->badPassphrases) > 0) { + $code = Crypt_GPG::ERROR_BAD_PASSPHRASE; + } elseif (count($this->missingKeys) > 0) { + $code = Crypt_GPG::ERROR_KEY_NOT_FOUND; + } else { + $code = Crypt_GPG::ERROR_UNKNOWN; + } + } elseif ($this->noData) { + $code = Crypt_GPG::ERROR_NO_DATA; + } + + switch ($code) { + case Crypt_GPG::ERROR_NONE: + break; + + case Crypt_GPG::ERROR_KEY_NOT_FOUND: + if (count($this->missingKeys) > 0) { + $keyId = reset($this->missingKeys); + } else { + $keyId = ''; + } + throw new Crypt_GPG_KeyNotFoundException( + 'Cannot decrypt data. No suitable private key is in the ' . + 'keyring. Import a suitable private key before trying to ' . + 'decrypt this data.', $code, $keyId); + + case Crypt_GPG::ERROR_BAD_PASSPHRASE: + $badPassphrases = array_diff_key( + $this->badPassphrases, + $this->missingPassphrases + ); + + $missingPassphrases = array_intersect_key( + $this->badPassphrases, + $this->missingPassphrases + ); + + $message = 'Cannot decrypt data.'; + if (count($badPassphrases) > 0) { + $message = ' Incorrect passphrase provided for keys: "' . + implode('", "', $badPassphrases) . '".'; + } + if (count($missingPassphrases) > 0) { + $message = ' No passphrase provided for keys: "' . + implode('", "', $badPassphrases) . '".'; + } + + throw new Crypt_GPG_BadPassphraseException($message, $code, + $badPassphrases, $missingPassphrases); + + case Crypt_GPG::ERROR_NO_DATA: + throw new Crypt_GPG_NoDataException( + 'Cannot decrypt data. No PGP encrypted data was found in '. + 'the provided data.', $code); + + default: + throw new Crypt_GPG_Exception( + 'Unknown error decrypting data.', $code); + } + } + + // }}} +} + +?> diff --git a/plugins/enigma/lib/Crypt/GPG/Engine.php b/plugins/enigma/lib/Crypt/GPG/Engine.php new file mode 100644 index 000000000..081be8e21 --- /dev/null +++ b/plugins/enigma/lib/Crypt/GPG/Engine.php @@ -0,0 +1,1758 @@ +<?php + +/* vim: set expandtab tabstop=4 shiftwidth=4 softtabstop=4: */ + +/** + * Crypt_GPG is a package to use GPG from PHP + * + * This file contains an engine that handles GPG subprocess control and I/O. + * PHP's process manipulation functions are used to handle the GPG subprocess. + * + * PHP version 5 + * + * LICENSE: + * + * This library is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as + * published by the Free Software Foundation; either version 2.1 of the + * License, or (at your option) any later version. + * + * This library is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + * Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public + * License along with this library; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA + * + * @category Encryption + * @package Crypt_GPG + * @author Nathan Fredrickson <nathan@silverorange.com> + * @author Michael Gauthier <mike@silverorange.com> + * @copyright 2005-2010 silverorange + * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1 + * @version CVS: $Id: Engine.php 302822 2010-08-26 17:30:57Z gauthierm $ + * @link http://pear.php.net/package/Crypt_GPG + * @link http://www.gnupg.org/ + */ + +/** + * Crypt_GPG base class. + */ +require_once 'Crypt/GPG.php'; + +/** + * GPG exception classes. + */ +require_once 'Crypt/GPG/Exceptions.php'; + +/** + * Standard PEAR exception is used if GPG binary is not found. + */ +require_once 'PEAR/Exception.php'; + +// {{{ class Crypt_GPG_Engine + +/** + * Native PHP Crypt_GPG I/O engine + * + * This class is used internally by Crypt_GPG and does not need be used + * directly. See the {@link Crypt_GPG} class for end-user API. + * + * This engine uses PHP's native process control functions to directly control + * the GPG process. The GPG executable is required to be on the system. + * + * All data is passed to the GPG subprocess using file descriptors. This is the + * most secure method of passing data to the GPG subprocess. + * + * @category Encryption + * @package Crypt_GPG + * @author Nathan Fredrickson <nathan@silverorange.com> + * @author Michael Gauthier <mike@silverorange.com> + * @copyright 2005-2010 silverorange + * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1 + * @link http://pear.php.net/package/Crypt_GPG + * @link http://www.gnupg.org/ + */ +class Crypt_GPG_Engine +{ + // {{{ constants + + /** + * Size of data chunks that are sent to and retrieved from the IPC pipes. + * + * PHP reads 8192 bytes. If this is set to less than 8192, PHP reads 8192 + * and buffers the rest so we might as well just read 8192. + * + * Using values other than 8192 also triggers PHP bugs. + * + * @see http://bugs.php.net/bug.php?id=35224 + */ + const CHUNK_SIZE = 8192; + + /** + * Standard input file descriptor. This is used to pass data to the GPG + * process. + */ + const FD_INPUT = 0; + + /** + * Standard output file descriptor. This is used to receive normal output + * from the GPG process. + */ + const FD_OUTPUT = 1; + + /** + * Standard output file descriptor. This is used to receive error output + * from the GPG process. + */ + const FD_ERROR = 2; + + /** + * GPG status output file descriptor. The status file descriptor outputs + * detailed information for many GPG commands. See the second section of + * the file <b>doc/DETAILS</b> in the + * {@link http://www.gnupg.org/download/ GPG package} for a detailed + * description of GPG's status output. + */ + const FD_STATUS = 3; + + /** + * Command input file descriptor. This is used for methods requiring + * passphrases. + */ + const FD_COMMAND = 4; + + /** + * Extra message input file descriptor. This is used for passing signed + * data when verifying a detached signature. + */ + const FD_MESSAGE = 5; + + /** + * Minimum version of GnuPG that is supported. + */ + const MIN_VERSION = '1.0.2'; + + // }}} + // {{{ private class properties + + /** + * Whether or not to use debugging mode + * + * When set to true, every GPG command is echoed before it is run. Sensitive + * data is always handled using pipes and is not specified as part of the + * command. As a result, sensitive data is never displayed when debug is + * enabled. Sensitive data includes private key data and passphrases. + * + * Debugging is off by default. + * + * @var boolean + * @see Crypt_GPG_Engine::__construct() + */ + private $_debug = false; + + /** + * Location of GPG binary + * + * @var string + * @see Crypt_GPG_Engine::__construct() + * @see Crypt_GPG_Engine::_getBinary() + */ + private $_binary = ''; + + /** + * Directory containing the GPG key files + * + * This property only contains the path when the <i>homedir</i> option + * is specified in the constructor. + * + * @var string + * @see Crypt_GPG_Engine::__construct() + */ + private $_homedir = ''; + + /** + * File path of the public keyring + * + * This property only contains the file path when the <i>public_keyring</i> + * option is specified in the constructor. + * + * If the specified file path starts with <kbd>~/</kbd>, the path is + * relative to the <i>homedir</i> if specified, otherwise to + * <kbd>~/.gnupg</kbd>. + * + * @var string + * @see Crypt_GPG_Engine::__construct() + */ + private $_publicKeyring = ''; + + /** + * File path of the private (secret) keyring + * + * This property only contains the file path when the <i>private_keyring</i> + * option is specified in the constructor. + * + * If the specified file path starts with <kbd>~/</kbd>, the path is + * relative to the <i>homedir</i> if specified, otherwise to + * <kbd>~/.gnupg</kbd>. + * + * @var string + * @see Crypt_GPG_Engine::__construct() + */ + private $_privateKeyring = ''; + + /** + * File path of the trust database + * + * This property only contains the file path when the <i>trust_db</i> + * option is specified in the constructor. + * + * If the specified file path starts with <kbd>~/</kbd>, the path is + * relative to the <i>homedir</i> if specified, otherwise to + * <kbd>~/.gnupg</kbd>. + * + * @var string + * @see Crypt_GPG_Engine::__construct() + */ + private $_trustDb = ''; + + /** + * Array of pipes used for communication with the GPG binary + * + * This is an array of file descriptor resources. + * + * @var array + */ + private $_pipes = array(); + + /** + * Array of currently opened pipes + * + * This array is used to keep track of remaining opened pipes so they can + * be closed when the GPG subprocess is finished. This array is a subset of + * the {@link Crypt_GPG_Engine::$_pipes} array and contains opened file + * descriptor resources. + * + * @var array + * @see Crypt_GPG_Engine::_closePipe() + */ + private $_openPipes = array(); + + /** + * A handle for the GPG process + * + * @var resource + */ + private $_process = null; + + /** + * Whether or not the operating system is Darwin (OS X) + * + * @var boolean + */ + private $_isDarwin = false; + + /** + * Commands to be sent to GPG's command input stream + * + * @var string + * @see Crypt_GPG_Engine::sendCommand() + */ + private $_commandBuffer = ''; + + /** + * Array of status line handlers + * + * @var array + * @see Crypt_GPG_Engine::addStatusHandler() + */ + private $_statusHandlers = array(); + + /** + * Array of error line handlers + * + * @var array + * @see Crypt_GPG_Engine::addErrorHandler() + */ + private $_errorHandlers = array(); + + /** + * The error code of the current operation + * + * @var integer + * @see Crypt_GPG_Engine::getErrorCode() + */ + private $_errorCode = Crypt_GPG::ERROR_NONE; + + /** + * File related to the error code of the current operation + * + * @var string + * @see Crypt_GPG_Engine::getErrorFilename() + */ + private $_errorFilename = ''; + + /** + * Key id related to the error code of the current operation + * + * @var string + * @see Crypt_GPG_Engine::getErrorKeyId() + */ + private $_errorkeyId = ''; + + /** + * The number of currently needed passphrases + * + * If this is not zero when the GPG command is completed, the error code is + * set to {@link Crypt_GPG::ERROR_MISSING_PASSPHRASE}. + * + * @var integer + */ + private $_needPassphrase = 0; + + /** + * The input source + * + * This is data to send to GPG. Either a string or a stream resource. + * + * @var string|resource + * @see Crypt_GPG_Engine::setInput() + */ + private $_input = null; + + /** + * The extra message input source + * + * Either a string or a stream resource. + * + * @var string|resource + * @see Crypt_GPG_Engine::setMessage() + */ + private $_message = null; + + /** + * The output location + * + * This is where the output from GPG is sent. Either a string or a stream + * resource. + * + * @var string|resource + * @see Crypt_GPG_Engine::setOutput() + */ + private $_output = ''; + + /** + * The GPG operation to execute + * + * @var string + * @see Crypt_GPG_Engine::setOperation() + */ + private $_operation; + + /** + * Arguments for the current operation + * + * @var array + * @see Crypt_GPG_Engine::setOperation() + */ + private $_arguments = array(); + + /** + * The version number of the GPG binary + * + * @var string + * @see Crypt_GPG_Engine::getVersion() + */ + private $_version = ''; + + /** + * Cached value indicating whether or not mbstring function overloading is + * on for strlen + * + * This is cached for optimal performance inside the I/O loop. + * + * @var boolean + * @see Crypt_GPG_Engine::_byteLength() + * @see Crypt_GPG_Engine::_byteSubstring() + */ + private static $_mbStringOverload = null; + + // }}} + // {{{ __construct() + + /** + * Creates a new GPG engine + * + * Available options are: + * + * - <kbd>string homedir</kbd> - the directory where the GPG + * keyring files are stored. If not + * specified, Crypt_GPG uses the + * default of <kbd>~/.gnupg</kbd>. + * - <kbd>string publicKeyring</kbd> - the file path of the public + * keyring. Use this if the public + * keyring is not in the homedir, or + * if the keyring is in a directory + * not writable by the process + * invoking GPG (like Apache). Then + * you can specify the path to the + * keyring with this option + * (/foo/bar/pubring.gpg), and specify + * a writable directory (like /tmp) + * using the <i>homedir</i> option. + * - <kbd>string privateKeyring</kbd> - the file path of the private + * keyring. Use this if the private + * keyring is not in the homedir, or + * if the keyring is in a directory + * not writable by the process + * invoking GPG (like Apache). Then + * you can specify the path to the + * keyring with this option + * (/foo/bar/secring.gpg), and specify + * a writable directory (like /tmp) + * using the <i>homedir</i> option. + * - <kbd>string trustDb</kbd> - the file path of the web-of-trust + * database. Use this if the trust + * database is not in the homedir, or + * if the database is in a directory + * not writable by the process + * invoking GPG (like Apache). Then + * you can specify the path to the + * trust database with this option + * (/foo/bar/trustdb.gpg), and specify + * a writable directory (like /tmp) + * using the <i>homedir</i> option. + * - <kbd>string binary</kbd> - the location of the GPG binary. If + * not specified, the driver attempts + * to auto-detect the GPG binary + * location using a list of known + * default locations for the current + * operating system. The option + * <kbd>gpgBinary</kbd> is a + * deprecated alias for this option. + * - <kbd>boolean debug</kbd> - whether or not to use debug mode. + * When debug mode is on, all + * communication to and from the GPG + * subprocess is logged. This can be + * useful to diagnose errors when + * using Crypt_GPG. + * + * @param array $options optional. An array of options used to create the + * GPG object. All options are optional and are + * represented as key-value pairs. + * + * @throws Crypt_GPG_FileException if the <kbd>homedir</kbd> does not exist + * and cannot be created. This can happen if <kbd>homedir</kbd> is + * not specified, Crypt_GPG is run as the web user, and the web + * user has no home directory. This exception is also thrown if any + * of the options <kbd>publicKeyring</kbd>, + * <kbd>privateKeyring</kbd> or <kbd>trustDb</kbd> options are + * specified but the files do not exist or are are not readable. + * This can happen if the user running the Crypt_GPG process (for + * example, the Apache user) does not have permission to read the + * files. + * + * @throws PEAR_Exception if the provided <kbd>binary</kbd> is invalid, or + * if no <kbd>binary</kbd> is provided and no suitable binary could + * be found. + */ + public function __construct(array $options = array()) + { + $this->_isDarwin = (strncmp(strtoupper(PHP_OS), 'DARWIN', 6) === 0); + + // populate mbstring overloading cache if not set + if (self::$_mbStringOverload === null) { + self::$_mbStringOverload = (extension_loaded('mbstring') + && (ini_get('mbstring.func_overload') & 0x02) === 0x02); + } + + // get homedir + if (array_key_exists('homedir', $options)) { + $this->_homedir = (string)$options['homedir']; + } else { + // note: this requires the package OS dep exclude 'windows' + $info = posix_getpwuid(posix_getuid()); + $this->_homedir = $info['dir'].'/.gnupg'; + } + + // attempt to create homedir if it does not exist + if (!is_dir($this->_homedir)) { + if (@mkdir($this->_homedir, 0777, true)) { + // Set permissions on homedir. Parent directories are created + // with 0777, homedir is set to 0700. + chmod($this->_homedir, 0700); + } else { + throw new Crypt_GPG_FileException('The \'homedir\' "' . + $this->_homedir . '" is not readable or does not exist '. + 'and cannot be created. This can happen if \'homedir\' '. + 'is not specified in the Crypt_GPG options, Crypt_GPG is '. + 'run as the web user, and the web user has no home '. + 'directory.', + 0, $this->_homedir); + } + } + + // get binary + if (array_key_exists('binary', $options)) { + $this->_binary = (string)$options['binary']; + } elseif (array_key_exists('gpgBinary', $options)) { + // deprecated alias + $this->_binary = (string)$options['gpgBinary']; + } else { + $this->_binary = $this->_getBinary(); + } + + if ($this->_binary == '' || !is_executable($this->_binary)) { + throw new PEAR_Exception('GPG binary not found. If you are sure '. + 'the GPG binary is installed, please specify the location of '. + 'the GPG binary using the \'binary\' driver option.'); + } + + /* + * Note: + * + * Normally, GnuPG expects keyrings to be in the homedir and expects + * to be able to write temporary files in the homedir. Sometimes, + * keyrings are not in the homedir, or location of the keyrings does + * not allow writing temporary files. In this case, the <i>homedir</i> + * option by itself is not enough to specify the keyrings because GnuPG + * can not write required temporary files. Additional options are + * provided so you can specify the location of the keyrings separately + * from the homedir. + */ + + // get public keyring + if (array_key_exists('publicKeyring', $options)) { + $this->_publicKeyring = (string)$options['publicKeyring']; + if (!is_readable($this->_publicKeyring)) { + throw new Crypt_GPG_FileException('The \'publicKeyring\' "' . + $this->_publicKeyring . '" does not exist or is ' . + 'not readable. Check the location and ensure the file ' . + 'permissions are correct.', 0, $this->_publicKeyring); + } + } + + // get private keyring + if (array_key_exists('privateKeyring', $options)) { + $this->_privateKeyring = (string)$options['privateKeyring']; + if (!is_readable($this->_privateKeyring)) { + throw new Crypt_GPG_FileException('The \'privateKeyring\' "' . + $this->_privateKeyring . '" does not exist or is ' . + 'not readable. Check the location and ensure the file ' . + 'permissions are correct.', 0, $this->_privateKeyring); + } + } + + // get trust database + if (array_key_exists('trustDb', $options)) { + $this->_trustDb = (string)$options['trustDb']; + if (!is_readable($this->_trustDb)) { + throw new Crypt_GPG_FileException('The \'trustDb\' "' . + $this->_trustDb . '" does not exist or is not readable. ' . + 'Check the location and ensure the file permissions are ' . + 'correct.', 0, $this->_trustDb); + } + } + + if (array_key_exists('debug', $options)) { + $this->_debug = (boolean)$options['debug']; + } + } + + // }}} + // {{{ __destruct() + + /** + * Closes open GPG subprocesses when this object is destroyed + * + * Subprocesses should never be left open by this class unless there is + * an unknown error and unexpected script termination occurs. + */ + public function __destruct() + { + $this->_closeSubprocess(); + } + + // }}} + // {{{ addErrorHandler() + + /** + * Adds an error handler method + * + * The method is run every time a new error line is received from the GPG + * subprocess. The handler method must accept the error line to be handled + * as its first parameter. + * + * @param callback $callback the callback method to use. + * @param array $args optional. Additional arguments to pass as + * parameters to the callback method. + * + * @return void + */ + public function addErrorHandler($callback, array $args = array()) + { + $this->_errorHandlers[] = array( + 'callback' => $callback, + 'args' => $args + ); + } + + // }}} + // {{{ addStatusHandler() + + /** + * Adds a status handler method + * + * The method is run every time a new status line is received from the + * GPG subprocess. The handler method must accept the status line to be + * handled as its first parameter. + * + * @param callback $callback the callback method to use. + * @param array $args optional. Additional arguments to pass as + * parameters to the callback method. + * + * @return void + */ + public function addStatusHandler($callback, array $args = array()) + { + $this->_statusHandlers[] = array( + 'callback' => $callback, + 'args' => $args + ); + } + + // }}} + // {{{ sendCommand() + + /** + * Sends a command to the GPG subprocess over the command file-descriptor + * pipe + * + * @param string $command the command to send. + * + * @return void + * + * @sensitive $command + */ + public function sendCommand($command) + { + if (array_key_exists(self::FD_COMMAND, $this->_openPipes)) { + $this->_commandBuffer .= $command . PHP_EOL; + } + } + + // }}} + // {{{ reset() + + /** + * Resets the GPG engine, preparing it for a new operation + * + * @return void + * + * @see Crypt_GPG_Engine::run() + * @see Crypt_GPG_Engine::setOperation() + */ + public function reset() + { + $this->_operation = ''; + $this->_arguments = array(); + $this->_input = null; + $this->_message = null; + $this->_output = ''; + $this->_errorCode = Crypt_GPG::ERROR_NONE; + $this->_needPassphrase = 0; + $this->_commandBuffer = ''; + + $this->_statusHandlers = array(); + $this->_errorHandlers = array(); + + $this->addStatusHandler(array($this, '_handleErrorStatus')); + $this->addErrorHandler(array($this, '_handleErrorError')); + + if ($this->_debug) { + $this->addStatusHandler(array($this, '_handleDebugStatus')); + $this->addErrorHandler(array($this, '_handleDebugError')); + } + } + + // }}} + // {{{ run() + + /** + * Runs the current GPG operation + * + * This creates and manages the GPG subprocess. + * + * The operation must be set with {@link Crypt_GPG_Engine::setOperation()} + * before this method is called. + * + * @return void + * + * @throws Crypt_GPG_InvalidOperationException if no operation is specified. + * + * @see Crypt_GPG_Engine::reset() + * @see Crypt_GPG_Engine::setOperation() + */ + public function run() + { + if ($this->_operation === '') { + throw new Crypt_GPG_InvalidOperationException('No GPG operation ' . + 'specified. Use Crypt_GPG_Engine::setOperation() before ' . + 'calling Crypt_GPG_Engine::run().'); + } + + $this->_openSubprocess(); + $this->_process(); + $this->_closeSubprocess(); + } + + // }}} + // {{{ getErrorCode() + + /** + * Gets the error code of the last executed operation + * + * This value is only meaningful after {@link Crypt_GPG_Engine::run()} has + * been executed. + * + * @return integer the error code of the last executed operation. + */ + public function getErrorCode() + { + return $this->_errorCode; + } + + // }}} + // {{{ getErrorFilename() + + /** + * Gets the file related to the error code of the last executed operation + * + * This value is only meaningful after {@link Crypt_GPG_Engine::run()} has + * been executed. If there is no file related to the error, an empty string + * is returned. + * + * @return string the file related to the error code of the last executed + * operation. + */ + public function getErrorFilename() + { + return $this->_errorFilename; + } + + // }}} + // {{{ getErrorKeyId() + + /** + * Gets the key id related to the error code of the last executed operation + * + * This value is only meaningful after {@link Crypt_GPG_Engine::run()} has + * been executed. If there is no key id related to the error, an empty + * string is returned. + * + * @return string the key id related to the error code of the last executed + * operation. + */ + public function getErrorKeyId() + { + return $this->_errorKeyId; + } + + // }}} + // {{{ setInput() + + /** + * Sets the input source for the current GPG operation + * + * @param string|resource &$input either a reference to the string + * containing the input data or an open + * stream resource containing the input + * data. + * + * @return void + */ + public function setInput(&$input) + { + $this->_input =& $input; + } + + // }}} + // {{{ setMessage() + + /** + * Sets the message source for the current GPG operation + * + * Detached signature data should be specified here. + * + * @param string|resource &$message either a reference to the string + * containing the message data or an open + * stream resource containing the message + * data. + * + * @return void + */ + public function setMessage(&$message) + { + $this->_message =& $message; + } + + // }}} + // {{{ setOutput() + + /** + * Sets the output destination for the current GPG operation + * + * @param string|resource &$output either a reference to the string in + * which to store GPG output or an open + * stream resource to which the output data + * should be written. + * + * @return void + */ + public function setOutput(&$output) + { + $this->_output =& $output; + } + + // }}} + // {{{ setOperation() + + /** + * Sets the operation to perform + * + * @param string $operation the operation to perform. This should be one + * of GPG's operations. For example, + * <kbd>--encrypt</kbd>, <kbd>--decrypt</kbd>, + * <kbd>--sign</kbd>, etc. + * @param array $arguments optional. Additional arguments for the GPG + * subprocess. See the GPG manual for specific + * values. + * + * @return void + * + * @see Crypt_GPG_Engine::reset() + * @see Crypt_GPG_Engine::run() + */ + public function setOperation($operation, array $arguments = array()) + { + $this->_operation = $operation; + $this->_arguments = $arguments; + } + + // }}} + // {{{ getVersion() + + /** + * Gets the version of the GnuPG binary + * + * @return string a version number string containing the version of GnuPG + * being used. This value is suitable to use with PHP's + * version_compare() function. + * + * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs. + * Use the <kbd>debug</kbd> option and file a bug report if these + * exceptions occur. + * + * @throws Crypt_GPG_UnsupportedException if the provided binary is not + * GnuPG or if the GnuPG version is less than 1.0.2. + */ + public function getVersion() + { + if ($this->_version == '') { + + $options = array( + 'homedir' => $this->_homedir, + 'binary' => $this->_binary, + 'debug' => $this->_debug + ); + + $engine = new self($options); + $info = ''; + + // Set a garbage version so we do not end up looking up the version + // recursively. + $engine->_version = '1.0.0'; + + $engine->reset(); + $engine->setOutput($info); + $engine->setOperation('--version'); + $engine->run(); + + $code = $this->getErrorCode(); + + if ($code !== Crypt_GPG::ERROR_NONE) { + throw new Crypt_GPG_Exception( + 'Unknown error getting GnuPG version information. Please ' . + 'use the \'debug\' option when creating the Crypt_GPG ' . + 'object, and file a bug report at ' . Crypt_GPG::BUG_URI, + $code); + } + + $matches = array(); + $expression = '/gpg \(GnuPG\) (\S+)/'; + + if (preg_match($expression, $info, $matches) === 1) { + $this->_version = $matches[1]; + } else { + throw new Crypt_GPG_Exception( + 'No GnuPG version information provided by the binary "' . + $this->_binary . '". Are you sure it is GnuPG?'); + } + + if (version_compare($this->_version, self::MIN_VERSION, 'lt')) { + throw new Crypt_GPG_Exception( + 'The version of GnuPG being used (' . $this->_version . + ') is not supported by Crypt_GPG. The minimum version ' . + 'required by Crypt_GPG is ' . self::MIN_VERSION); + } + } + + + return $this->_version; + } + + // }}} + // {{{ _handleErrorStatus() + + /** + * Handles error values in the status output from GPG + * + * This method is responsible for setting the + * {@link Crypt_GPG_Engine::$_errorCode}. See <b>doc/DETAILS</b> in the + * {@link http://www.gnupg.org/download/ GPG distribution} for detailed + * information on GPG's status output. + * + * @param string $line the status line to handle. + * + * @return void + */ + private function _handleErrorStatus($line) + { + $tokens = explode(' ', $line); + switch ($tokens[0]) { + case 'BAD_PASSPHRASE': + $this->_errorCode = Crypt_GPG::ERROR_BAD_PASSPHRASE; + break; + + case 'MISSING_PASSPHRASE': + $this->_errorCode = Crypt_GPG::ERROR_MISSING_PASSPHRASE; + break; + + case 'NODATA': + $this->_errorCode = Crypt_GPG::ERROR_NO_DATA; + break; + + case 'DELETE_PROBLEM': + if ($tokens[1] == '1') { + $this->_errorCode = Crypt_GPG::ERROR_KEY_NOT_FOUND; + break; + } elseif ($tokens[1] == '2') { + $this->_errorCode = Crypt_GPG::ERROR_DELETE_PRIVATE_KEY; + break; + } + break; + + case 'IMPORT_RES': + if ($tokens[12] > 0) { + $this->_errorCode = Crypt_GPG::ERROR_DUPLICATE_KEY; + } + break; + + case 'NO_PUBKEY': + case 'NO_SECKEY': + $this->_errorKeyId = $tokens[1]; + $this->_errorCode = Crypt_GPG::ERROR_KEY_NOT_FOUND; + break; + + case 'NEED_PASSPHRASE': + $this->_needPassphrase++; + break; + + case 'GOOD_PASSPHRASE': + $this->_needPassphrase--; + break; + + case 'EXPSIG': + case 'EXPKEYSIG': + case 'REVKEYSIG': + case 'BADSIG': + $this->_errorCode = Crypt_GPG::ERROR_BAD_SIGNATURE; + break; + + } + } + + // }}} + // {{{ _handleErrorError() + + /** + * Handles error values in the error output from GPG + * + * This method is responsible for setting the + * {@link Crypt_GPG_Engine::$_errorCode}. + * + * @param string $line the error line to handle. + * + * @return void + */ + private function _handleErrorError($line) + { + if ($this->_errorCode === Crypt_GPG::ERROR_NONE) { + $pattern = '/no valid OpenPGP data found/'; + if (preg_match($pattern, $line) === 1) { + $this->_errorCode = Crypt_GPG::ERROR_NO_DATA; + } + } + + if ($this->_errorCode === Crypt_GPG::ERROR_NONE) { + $pattern = '/No secret key|secret key not available/'; + if (preg_match($pattern, $line) === 1) { + $this->_errorCode = Crypt_GPG::ERROR_KEY_NOT_FOUND; + } + } + + if ($this->_errorCode === Crypt_GPG::ERROR_NONE) { + $pattern = '/No public key|public key not found/'; + if (preg_match($pattern, $line) === 1) { + $this->_errorCode = Crypt_GPG::ERROR_KEY_NOT_FOUND; + } + } + + if ($this->_errorCode === Crypt_GPG::ERROR_NONE) { + $matches = array(); + $pattern = '/can\'t (?:access|open) `(.*?)\'/'; + if (preg_match($pattern, $line, $matches) === 1) { + $this->_errorFilename = $matches[1]; + $this->_errorCode = Crypt_GPG::ERROR_FILE_PERMISSIONS; + } + } + } + + // }}} + // {{{ _handleDebugStatus() + + /** + * Displays debug output for status lines + * + * @param string $line the status line to handle. + * + * @return void + */ + private function _handleDebugStatus($line) + { + $this->_debug('STATUS: ' . $line); + } + + // }}} + // {{{ _handleDebugError() + + /** + * Displays debug output for error lines + * + * @param string $line the error line to handle. + * + * @return void + */ + private function _handleDebugError($line) + { + $this->_debug('ERROR: ' . $line); + } + + // }}} + // {{{ _process() + + /** + * Performs internal streaming operations for the subprocess using either + * strings or streams as input / output points + * + * This is the main I/O loop for streaming to and from the GPG subprocess. + * + * The implementation of this method is verbose mainly for performance + * reasons. Adding streams to a lookup array and looping the array inside + * the main I/O loop would be siginficantly slower for large streams. + * + * @return void + * + * @throws Crypt_GPG_Exception if there is an error selecting streams for + * reading or writing. If this occurs, please file a bug report at + * http://pear.php.net/bugs/report.php?package=Crypt_GPG. + */ + private function _process() + { + $this->_debug('BEGIN PROCESSING'); + + $this->_commandBuffer = ''; // buffers input to GPG + $messageBuffer = ''; // buffers input to GPG + $inputBuffer = ''; // buffers input to GPG + $outputBuffer = ''; // buffers output from GPG + $statusBuffer = ''; // buffers output from GPG + $errorBuffer = ''; // buffers output from GPG + $inputComplete = false; // input stream is completely buffered + $messageComplete = false; // message stream is completely buffered + + if (is_string($this->_input)) { + $inputBuffer = $this->_input; + $inputComplete = true; + } + + if (is_string($this->_message)) { + $messageBuffer = $this->_message; + $messageComplete = true; + } + + if (is_string($this->_output)) { + $outputBuffer =& $this->_output; + } + + // convenience variables + $fdInput = $this->_pipes[self::FD_INPUT]; + $fdOutput = $this->_pipes[self::FD_OUTPUT]; + $fdError = $this->_pipes[self::FD_ERROR]; + $fdStatus = $this->_pipes[self::FD_STATUS]; + $fdCommand = $this->_pipes[self::FD_COMMAND]; + $fdMessage = $this->_pipes[self::FD_MESSAGE]; + + while (true) { + + $inputStreams = array(); + $outputStreams = array(); + $exceptionStreams = array(); + + // set up input streams + if (is_resource($this->_input) && !$inputComplete) { + if (feof($this->_input)) { + $inputComplete = true; + } else { + $inputStreams[] = $this->_input; + } + } + + // close GPG input pipe if there is no more data + if ($inputBuffer == '' && $inputComplete) { + $this->_debug('=> closing GPG input pipe'); + $this->_closePipe(self::FD_INPUT); + } + + if (is_resource($this->_message) && !$messageComplete) { + if (feof($this->_message)) { + $messageComplete = true; + } else { + $inputStreams[] = $this->_message; + } + } + + // close GPG message pipe if there is no more data + if ($messageBuffer == '' && $messageComplete) { + $this->_debug('=> closing GPG message pipe'); + $this->_closePipe(self::FD_MESSAGE); + } + + if (!feof($fdOutput)) { + $inputStreams[] = $fdOutput; + } + + if (!feof($fdStatus)) { + $inputStreams[] = $fdStatus; + } + + if (!feof($fdError)) { + $inputStreams[] = $fdError; + } + + // set up output streams + if ($outputBuffer != '' && is_resource($this->_output)) { + $outputStreams[] = $this->_output; + } + + if ($this->_commandBuffer != '') { + $outputStreams[] = $fdCommand; + } + + if ($messageBuffer != '') { + $outputStreams[] = $fdMessage; + } + + if ($inputBuffer != '') { + $outputStreams[] = $fdInput; + } + + // no streams left to read or write, we're all done + if (count($inputStreams) === 0 && count($outputStreams) === 0) { + break; + } + + $this->_debug('selecting streams'); + + $ready = stream_select( + $inputStreams, + $outputStreams, + $exceptionStreams, + null + ); + + $this->_debug('=> got ' . $ready); + + if ($ready === false) { + throw new Crypt_GPG_Exception( + 'Error selecting stream for communication with GPG ' . + 'subprocess. Please file a bug report at: ' . + 'http://pear.php.net/bugs/report.php?package=Crypt_GPG'); + } + + if ($ready === 0) { + throw new Crypt_GPG_Exception( + 'stream_select() returned 0. This can not happen! Please ' . + 'file a bug report at: ' . + 'http://pear.php.net/bugs/report.php?package=Crypt_GPG'); + } + + // write input (to GPG) + if (in_array($fdInput, $outputStreams)) { + $this->_debug('GPG is ready for input'); + + $chunk = self::_byteSubstring( + $inputBuffer, + 0, + self::CHUNK_SIZE + ); + + $length = self::_byteLength($chunk); + + $this->_debug( + '=> about to write ' . $length . ' bytes to GPG input' + ); + + $length = fwrite($fdInput, $chunk, $length); + + $this->_debug('=> wrote ' . $length . ' bytes'); + + $inputBuffer = self::_byteSubstring( + $inputBuffer, + $length + ); + } + + // read input (from PHP stream) + if (in_array($this->_input, $inputStreams)) { + $this->_debug('input stream is ready for reading'); + $this->_debug( + '=> about to read ' . self::CHUNK_SIZE . + ' bytes from input stream' + ); + + $chunk = fread($this->_input, self::CHUNK_SIZE); + $length = self::_byteLength($chunk); + $inputBuffer .= $chunk; + + $this->_debug('=> read ' . $length . ' bytes'); + } + + // write message (to GPG) + if (in_array($fdMessage, $outputStreams)) { + $this->_debug('GPG is ready for message data'); + + $chunk = self::_byteSubstring( + $messageBuffer, + 0, + self::CHUNK_SIZE + ); + + $length = self::_byteLength($chunk); + + $this->_debug( + '=> about to write ' . $length . ' bytes to GPG message' + ); + + $length = fwrite($fdMessage, $chunk, $length); + $this->_debug('=> wrote ' . $length . ' bytes'); + + $messageBuffer = self::_byteSubstring($messageBuffer, $length); + } + + // read message (from PHP stream) + if (in_array($this->_message, $inputStreams)) { + $this->_debug('message stream is ready for reading'); + $this->_debug( + '=> about to read ' . self::CHUNK_SIZE . + ' bytes from message stream' + ); + + $chunk = fread($this->_message, self::CHUNK_SIZE); + $length = self::_byteLength($chunk); + $messageBuffer .= $chunk; + + $this->_debug('=> read ' . $length . ' bytes'); + } + + // read output (from GPG) + if (in_array($fdOutput, $inputStreams)) { + $this->_debug('GPG output stream ready for reading'); + $this->_debug( + '=> about to read ' . self::CHUNK_SIZE . + ' bytes from GPG output' + ); + + $chunk = fread($fdOutput, self::CHUNK_SIZE); + $length = self::_byteLength($chunk); + $outputBuffer .= $chunk; + + $this->_debug('=> read ' . $length . ' bytes'); + } + + // write output (to PHP stream) + if (in_array($this->_output, $outputStreams)) { + $this->_debug('output stream is ready for data'); + + $chunk = self::_byteSubstring( + $outputBuffer, + 0, + self::CHUNK_SIZE + ); + + $length = self::_byteLength($chunk); + + $this->_debug( + '=> about to write ' . $length . ' bytes to output stream' + ); + + $length = fwrite($this->_output, $chunk, $length); + + $this->_debug('=> wrote ' . $length . ' bytes'); + + $outputBuffer = self::_byteSubstring($outputBuffer, $length); + } + + // read error (from GPG) + if (in_array($fdError, $inputStreams)) { + $this->_debug('GPG error stream ready for reading'); + $this->_debug( + '=> about to read ' . self::CHUNK_SIZE . + ' bytes from GPG error' + ); + + $chunk = fread($fdError, self::CHUNK_SIZE); + $length = self::_byteLength($chunk); + $errorBuffer .= $chunk; + + $this->_debug('=> read ' . $length . ' bytes'); + + // pass lines to error handlers + while (($pos = strpos($errorBuffer, PHP_EOL)) !== false) { + $line = self::_byteSubstring($errorBuffer, 0, $pos); + foreach ($this->_errorHandlers as $handler) { + array_unshift($handler['args'], $line); + call_user_func_array( + $handler['callback'], + $handler['args'] + ); + + array_shift($handler['args']); + } + $errorBuffer = self::_byteSubString( + $errorBuffer, + $pos + self::_byteLength(PHP_EOL) + ); + } + } + + // read status (from GPG) + if (in_array($fdStatus, $inputStreams)) { + $this->_debug('GPG status stream ready for reading'); + $this->_debug( + '=> about to read ' . self::CHUNK_SIZE . + ' bytes from GPG status' + ); + + $chunk = fread($fdStatus, self::CHUNK_SIZE); + $length = self::_byteLength($chunk); + $statusBuffer .= $chunk; + + $this->_debug('=> read ' . $length . ' bytes'); + + // pass lines to status handlers + while (($pos = strpos($statusBuffer, PHP_EOL)) !== false) { + $line = self::_byteSubstring($statusBuffer, 0, $pos); + // only pass lines beginning with magic prefix + if (self::_byteSubstring($line, 0, 9) == '[GNUPG:] ') { + $line = self::_byteSubstring($line, 9); + foreach ($this->_statusHandlers as $handler) { + array_unshift($handler['args'], $line); + call_user_func_array( + $handler['callback'], + $handler['args'] + ); + + array_shift($handler['args']); + } + } + $statusBuffer = self::_byteSubString( + $statusBuffer, + $pos + self::_byteLength(PHP_EOL) + ); + } + } + + // write command (to GPG) + if (in_array($fdCommand, $outputStreams)) { + $this->_debug('GPG is ready for command data'); + + // send commands + $chunk = self::_byteSubstring( + $this->_commandBuffer, + 0, + self::CHUNK_SIZE + ); + + $length = self::_byteLength($chunk); + + $this->_debug( + '=> about to write ' . $length . ' bytes to GPG command' + ); + + $length = fwrite($fdCommand, $chunk, $length); + + $this->_debug('=> wrote ' . $length); + + $this->_commandBuffer = self::_byteSubstring( + $this->_commandBuffer, + $length + ); + } + + } // end loop while streams are open + + $this->_debug('END PROCESSING'); + } + + // }}} + // {{{ _openSubprocess() + + /** + * Opens an internal GPG subprocess for the current operation + * + * Opens a GPG subprocess, then connects the subprocess to some pipes. Sets + * the private class property {@link Crypt_GPG_Engine::$_process} to + * the new subprocess. + * + * @return void + * + * @throws Crypt_GPG_OpenSubprocessException if the subprocess could not be + * opened. + * + * @see Crypt_GPG_Engine::setOperation() + * @see Crypt_GPG_Engine::_closeSubprocess() + * @see Crypt_GPG_Engine::$_process + */ + private function _openSubprocess() + { + $version = $this->getVersion(); + + $env = $_ENV; + + // Newer versions of GnuPG return localized results. Crypt_GPG only + // works with English, so set the locale to 'C' for the subprocess. + $env['LC_ALL'] = 'C'; + + $commandLine = $this->_binary; + + $defaultArguments = array( + '--status-fd ' . escapeshellarg(self::FD_STATUS), + '--command-fd ' . escapeshellarg(self::FD_COMMAND), + '--no-secmem-warning', + '--no-tty', + '--no-default-keyring', // ignored if keying files are not specified + '--no-options' // prevent creation of ~/.gnupg directory + ); + + if (version_compare($version, '1.0.7', 'ge')) { + if (version_compare($version, '2.0.0', 'lt')) { + $defaultArguments[] = '--no-use-agent'; + } + $defaultArguments[] = '--no-permission-warning'; + } + + if (version_compare($version, '1.4.2', 'ge')) { + $defaultArguments[] = '--exit-on-status-write-error'; + } + + if (version_compare($version, '1.3.2', 'ge')) { + $defaultArguments[] = '--trust-model always'; + } else { + $defaultArguments[] = '--always-trust'; + } + + $arguments = array_merge($defaultArguments, $this->_arguments); + + if ($this->_homedir) { + $arguments[] = '--homedir ' . escapeshellarg($this->_homedir); + + // the random seed file makes subsequent actions faster so only + // disable it if we have to. + if (!is_writeable($this->_homedir)) { + $arguments[] = '--no-random-seed-file'; + } + } + + if ($this->_publicKeyring) { + $arguments[] = '--keyring ' . escapeshellarg($this->_publicKeyring); + } + + if ($this->_privateKeyring) { + $arguments[] = '--secret-keyring ' . + escapeshellarg($this->_privateKeyring); + } + + if ($this->_trustDb) { + $arguments[] = '--trustdb-name ' . escapeshellarg($this->_trustDb); + } + + $commandLine .= ' ' . implode(' ', $arguments) . ' ' . + $this->_operation; + + // Binary operations will not work on Windows with PHP < 5.2.6. This is + // in case stream_select() ever works on Windows. + $rb = (version_compare(PHP_VERSION, '5.2.6') < 0) ? 'r' : 'rb'; + $wb = (version_compare(PHP_VERSION, '5.2.6') < 0) ? 'w' : 'wb'; + + $descriptorSpec = array( + self::FD_INPUT => array('pipe', $rb), // stdin + self::FD_OUTPUT => array('pipe', $wb), // stdout + self::FD_ERROR => array('pipe', $wb), // stderr + self::FD_STATUS => array('pipe', $wb), // status + self::FD_COMMAND => array('pipe', $rb), // command + self::FD_MESSAGE => array('pipe', $rb) // message + ); + + $this->_debug('OPENING SUBPROCESS WITH THE FOLLOWING COMMAND:'); + $this->_debug($commandLine); + + $this->_process = proc_open( + $commandLine, + $descriptorSpec, + $this->_pipes, + null, + $env, + array('binary_pipes' => true) + ); + + if (!is_resource($this->_process)) { + throw new Crypt_GPG_OpenSubprocessException( + 'Unable to open GPG subprocess.', 0, $commandLine); + } + + $this->_openPipes = $this->_pipes; + $this->_errorCode = Crypt_GPG::ERROR_NONE; + } + + // }}} + // {{{ _closeSubprocess() + + /** + * Closes a the internal GPG subprocess + * + * Closes the internal GPG subprocess. Sets the private class property + * {@link Crypt_GPG_Engine::$_process} to null. + * + * @return void + * + * @see Crypt_GPG_Engine::_openSubprocess() + * @see Crypt_GPG_Engine::$_process + */ + private function _closeSubprocess() + { + if (is_resource($this->_process)) { + $this->_debug('CLOSING SUBPROCESS'); + + // close remaining open pipes + foreach (array_keys($this->_openPipes) as $pipeNumber) { + $this->_closePipe($pipeNumber); + } + + $exitCode = proc_close($this->_process); + + if ($exitCode != 0) { + $this->_debug( + '=> subprocess returned an unexpected exit code: ' . + $exitCode + ); + + if ($this->_errorCode === Crypt_GPG::ERROR_NONE) { + if ($this->_needPassphrase > 0) { + $this->_errorCode = Crypt_GPG::ERROR_MISSING_PASSPHRASE; + } else { + $this->_errorCode = Crypt_GPG::ERROR_UNKNOWN; + } + } + } + + $this->_process = null; + $this->_pipes = array(); + } + } + + // }}} + // {{{ _closePipe() + + /** + * Closes an opened pipe used to communicate with the GPG subprocess + * + * If the pipe is already closed, it is ignored. If the pipe is open, it + * is flushed and then closed. + * + * @param integer $pipeNumber the file descriptor number of the pipe to + * close. + * + * @return void + */ + private function _closePipe($pipeNumber) + { + $pipeNumber = intval($pipeNumber); + if (array_key_exists($pipeNumber, $this->_openPipes)) { + fflush($this->_openPipes[$pipeNumber]); + fclose($this->_openPipes[$pipeNumber]); + unset($this->_openPipes[$pipeNumber]); + } + } + + // }}} + // {{{ _getBinary() + + /** + * Gets the name of the GPG binary for the current operating system + * + * This method is called if the '<kbd>binary</kbd>' option is <i>not</i> + * specified when creating this driver. + * + * @return string the name of the GPG binary for the current operating + * system. If no suitable binary could be found, an empty + * string is returned. + */ + private function _getBinary() + { + $binary = ''; + + if ($this->_isDarwin) { + $binaryFiles = array( + '/opt/local/bin/gpg', // MacPorts + '/usr/local/bin/gpg', // Mac GPG + '/sw/bin/gpg', // Fink + '/usr/bin/gpg' + ); + } else { + $binaryFiles = array( + '/usr/bin/gpg', + '/usr/local/bin/gpg' + ); + } + + foreach ($binaryFiles as $binaryFile) { + if (is_executable($binaryFile)) { + $binary = $binaryFile; + break; + } + } + + return $binary; + } + + // }}} + // {{{ _debug() + + /** + * Displays debug text if debugging is turned on + * + * Debugging text is prepended with a debug identifier and echoed to stdout. + * + * @param string $text the debugging text to display. + * + * @return void + */ + private function _debug($text) + { + if ($this->_debug) { + if (array_key_exists('SHELL', $_ENV)) { + foreach (explode(PHP_EOL, $text) as $line) { + echo "Crypt_GPG DEBUG: ", $line, PHP_EOL; + } + } else { + // running on a web server, format debug output nicely + foreach (explode(PHP_EOL, $text) as $line) { + echo "Crypt_GPG DEBUG: <strong>", $line, + '</strong><br />', PHP_EOL; + } + } + } + } + + // }}} + // {{{ _byteLength() + + /** + * Gets the length of a string in bytes even if mbstring function + * overloading is turned on + * + * This is used for stream-based communication with the GPG subprocess. + * + * @param string $string the string for which to get the length. + * + * @return integer the length of the string in bytes. + * + * @see Crypt_GPG_Engine::$_mbStringOverload + */ + private static function _byteLength($string) + { + if (self::$_mbStringOverload) { + return mb_strlen($string, '8bit'); + } + + return strlen((binary)$string); + } + + // }}} + // {{{ _byteSubstring() + + /** + * Gets the substring of a string in bytes even if mbstring function + * overloading is turned on + * + * This is used for stream-based communication with the GPG subprocess. + * + * @param string $string the input string. + * @param integer $start the starting point at which to get the substring. + * @param integer $length optional. The length of the substring. + * + * @return string the extracted part of the string. Unlike the default PHP + * <kbd>substr()</kbd> function, the returned value is + * always a string and never false. + * + * @see Crypt_GPG_Engine::$_mbStringOverload + */ + private static function _byteSubstring($string, $start, $length = null) + { + if (self::$_mbStringOverload) { + if ($length === null) { + return mb_substr( + $string, + $start, + self::_byteLength($string) - $start, '8bit' + ); + } + + return mb_substr($string, $start, $length, '8bit'); + } + + if ($length === null) { + return (string)substr((binary)$string, $start); + } + + return (string)substr((binary)$string, $start, $length); + } + + // }}} +} + +// }}} + +?> diff --git a/plugins/enigma/lib/Crypt/GPG/Exceptions.php b/plugins/enigma/lib/Crypt/GPG/Exceptions.php new file mode 100644 index 000000000..744acf5d4 --- /dev/null +++ b/plugins/enigma/lib/Crypt/GPG/Exceptions.php @@ -0,0 +1,473 @@ +<?php + +/* vim: set expandtab tabstop=4 shiftwidth=4 softtabstop=4: */ + +/** + * Various exception handling classes for Crypt_GPG + * + * Crypt_GPG provides an object oriented interface to GNU Privacy + * Guard (GPG). It requires the GPG executable to be on the system. + * + * This file contains various exception classes used by the Crypt_GPG package. + * + * PHP version 5 + * + * LICENSE: + * + * This library is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as + * published by the Free Software Foundation; either version 2.1 of the + * License, or (at your option) any later version. + * + * This library is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + * Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public + * License along with this library; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA + * + * @category Encryption + * @package Crypt_GPG + * @author Nathan Fredrickson <nathan@silverorange.com> + * @author Michael Gauthier <mike@silverorange.com> + * @copyright 2005 silverorange + * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1 + * @version CVS: $Id: Exceptions.php 273745 2009-01-18 05:24:25Z gauthierm $ + * @link http://pear.php.net/package/Crypt_GPG + */ + +/** + * PEAR Exception handler and base class + */ +require_once 'PEAR/Exception.php'; + +// {{{ class Crypt_GPG_Exception + +/** + * An exception thrown by the Crypt_GPG package + * + * @category Encryption + * @package Crypt_GPG + * @author Michael Gauthier <mike@silverorange.com> + * @copyright 2005 silverorange + * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1 + * @link http://pear.php.net/package/Crypt_GPG + */ +class Crypt_GPG_Exception extends PEAR_Exception +{ +} + +// }}} +// {{{ class Crypt_GPG_FileException + +/** + * An exception thrown when a file is used in ways it cannot be used + * + * For example, if an output file is specified and the file is not writeable, or + * if an input file is specified and the file is not readable, this exception + * is thrown. + * + * @category Encryption + * @package Crypt_GPG + * @author Michael Gauthier <mike@silverorange.com> + * @copyright 2007-2008 silverorange + * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1 + * @link http://pear.php.net/package/Crypt_GPG + */ +class Crypt_GPG_FileException extends Crypt_GPG_Exception +{ + // {{{ private class properties + + /** + * The name of the file that caused this exception + * + * @var string + */ + private $_filename = ''; + + // }}} + // {{{ __construct() + + /** + * Creates a new Crypt_GPG_FileException + * + * @param string $message an error message. + * @param integer $code a user defined error code. + * @param string $filename the name of the file that caused this exception. + */ + public function __construct($message, $code = 0, $filename = '') + { + $this->_filename = $filename; + parent::__construct($message, $code); + } + + // }}} + // {{{ getFilename() + + /** + * Returns the filename of the file that caused this exception + * + * @return string the filename of the file that caused this exception. + * + * @see Crypt_GPG_FileException::$_filename + */ + public function getFilename() + { + return $this->_filename; + } + + // }}} +} + +// }}} +// {{{ class Crypt_GPG_OpenSubprocessException + +/** + * An exception thrown when the GPG subprocess cannot be opened + * + * This exception is thrown when the {@link Crypt_GPG_Engine} tries to open a + * new subprocess and fails. + * + * @category Encryption + * @package Crypt_GPG + * @author Michael Gauthier <mike@silverorange.com> + * @copyright 2005 silverorange + * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1 + * @link http://pear.php.net/package/Crypt_GPG + */ +class Crypt_GPG_OpenSubprocessException extends Crypt_GPG_Exception +{ + // {{{ private class properties + + /** + * The command used to try to open the subprocess + * + * @var string + */ + private $_command = ''; + + // }}} + // {{{ __construct() + + /** + * Creates a new Crypt_GPG_OpenSubprocessException + * + * @param string $message an error message. + * @param integer $code a user defined error code. + * @param string $command the command that was called to open the + * new subprocess. + * + * @see Crypt_GPG::_openSubprocess() + */ + public function __construct($message, $code = 0, $command = '') + { + $this->_command = $command; + parent::__construct($message, $code); + } + + // }}} + // {{{ getCommand() + + /** + * Returns the contents of the internal _command property + * + * @return string the command used to open the subprocess. + * + * @see Crypt_GPG_OpenSubprocessException::$_command + */ + public function getCommand() + { + return $this->_command; + } + + // }}} +} + +// }}} +// {{{ class Crypt_GPG_InvalidOperationException + +/** + * An exception thrown when an invalid GPG operation is attempted + * + * @category Encryption + * @package Crypt_GPG + * @author Michael Gauthier <mike@silverorange.com> + * @copyright 2008 silverorange + * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1 + * @link http://pear.php.net/package/Crypt_GPG + */ +class Crypt_GPG_InvalidOperationException extends Crypt_GPG_Exception +{ + // {{{ private class properties + + /** + * The attempted operation + * + * @var string + */ + private $_operation = ''; + + // }}} + // {{{ __construct() + + /** + * Creates a new Crypt_GPG_OpenSubprocessException + * + * @param string $message an error message. + * @param integer $code a user defined error code. + * @param string $operation the operation. + */ + public function __construct($message, $code = 0, $operation = '') + { + $this->_operation = $operation; + parent::__construct($message, $code); + } + + // }}} + // {{{ getOperation() + + /** + * Returns the contents of the internal _operation property + * + * @return string the attempted operation. + * + * @see Crypt_GPG_InvalidOperationException::$_operation + */ + public function getOperation() + { + return $this->_operation; + } + + // }}} +} + +// }}} +// {{{ class Crypt_GPG_KeyNotFoundException + +/** + * An exception thrown when Crypt_GPG fails to find the key for various + * operations + * + * @category Encryption + * @package Crypt_GPG + * @author Michael Gauthier <mike@silverorange.com> + * @copyright 2005 silverorange + * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1 + * @link http://pear.php.net/package/Crypt_GPG + */ +class Crypt_GPG_KeyNotFoundException extends Crypt_GPG_Exception +{ + // {{{ private class properties + + /** + * The key identifier that was searched for + * + * @var string + */ + private $_keyId = ''; + + // }}} + // {{{ __construct() + + /** + * Creates a new Crypt_GPG_KeyNotFoundException + * + * @param string $message an error message. + * @param integer $code a user defined error code. + * @param string $keyId the key identifier of the key. + */ + public function __construct($message, $code = 0, $keyId= '') + { + $this->_keyId = $keyId; + parent::__construct($message, $code); + } + + // }}} + // {{{ getKeyId() + + /** + * Gets the key identifier of the key that was not found + * + * @return string the key identifier of the key that was not found. + */ + public function getKeyId() + { + return $this->_keyId; + } + + // }}} +} + +// }}} +// {{{ class Crypt_GPG_NoDataException + +/** + * An exception thrown when Crypt_GPG cannot find valid data for various + * operations + * + * @category Encryption + * @package Crypt_GPG + * @author Michael Gauthier <mike@silverorange.com> + * @copyright 2006 silverorange + * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1 + * @link http://pear.php.net/package/Crypt_GPG + */ +class Crypt_GPG_NoDataException extends Crypt_GPG_Exception +{ +} + +// }}} +// {{{ class Crypt_GPG_BadPassphraseException + +/** + * An exception thrown when a required passphrase is incorrect or missing + * + * @category Encryption + * @package Crypt_GPG + * @author Michael Gauthier <mike@silverorange.com> + * @copyright 2006-2008 silverorange + * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1 + * @link http://pear.php.net/package/Crypt_GPG + */ +class Crypt_GPG_BadPassphraseException extends Crypt_GPG_Exception +{ + // {{{ private class properties + + /** + * Keys for which the passhprase is missing + * + * This contains primary user ids indexed by sub-key id. + * + * @var array + */ + private $_missingPassphrases = array(); + + /** + * Keys for which the passhprase is incorrect + * + * This contains primary user ids indexed by sub-key id. + * + * @var array + */ + private $_badPassphrases = array(); + + // }}} + // {{{ __construct() + + /** + * Creates a new Crypt_GPG_BadPassphraseException + * + * @param string $message an error message. + * @param integer $code a user defined error code. + * @param string $badPassphrases an array containing user ids of keys + * for which the passphrase is incorrect. + * @param string $missingPassphrases an array containing user ids of keys + * for which the passphrase is missing. + */ + public function __construct($message, $code = 0, + array $badPassphrases = array(), array $missingPassphrases = array() + ) { + $this->_badPassphrases = $badPassphrases; + $this->_missingPassphrases = $missingPassphrases; + + parent::__construct($message, $code); + } + + // }}} + // {{{ getBadPassphrases() + + /** + * Gets keys for which the passhprase is incorrect + * + * @return array an array of keys for which the passphrase is incorrect. + * The array contains primary user ids indexed by the sub-key + * id. + */ + public function getBadPassphrases() + { + return $this->_badPassphrases; + } + + // }}} + // {{{ getMissingPassphrases() + + /** + * Gets keys for which the passhprase is missing + * + * @return array an array of keys for which the passphrase is missing. + * The array contains primary user ids indexed by the sub-key + * id. + */ + public function getMissingPassphrases() + { + return $this->_missingPassphrases; + } + + // }}} +} + +// }}} +// {{{ class Crypt_GPG_DeletePrivateKeyException + +/** + * An exception thrown when an attempt is made to delete public key that has an + * associated private key on the keyring + * + * @category Encryption + * @package Crypt_GPG + * @author Michael Gauthier <mike@silverorange.com> + * @copyright 2008 silverorange + * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1 + * @link http://pear.php.net/package/Crypt_GPG + */ +class Crypt_GPG_DeletePrivateKeyException extends Crypt_GPG_Exception +{ + // {{{ private class properties + + /** + * The key identifier the deletion attempt was made upon + * + * @var string + */ + private $_keyId = ''; + + // }}} + // {{{ __construct() + + /** + * Creates a new Crypt_GPG_DeletePrivateKeyException + * + * @param string $message an error message. + * @param integer $code a user defined error code. + * @param string $keyId the key identifier of the public key that was + * attempted to delete. + * + * @see Crypt_GPG::deletePublicKey() + */ + public function __construct($message, $code = 0, $keyId = '') + { + $this->_keyId = $keyId; + parent::__construct($message, $code); + } + + // }}} + // {{{ getKeyId() + + /** + * Gets the key identifier of the key that was not found + * + * @return string the key identifier of the key that was not found. + */ + public function getKeyId() + { + return $this->_keyId; + } + + // }}} +} + +// }}} + +?> diff --git a/plugins/enigma/lib/Crypt/GPG/Key.php b/plugins/enigma/lib/Crypt/GPG/Key.php new file mode 100644 index 000000000..67a4b9c7d --- /dev/null +++ b/plugins/enigma/lib/Crypt/GPG/Key.php @@ -0,0 +1,223 @@ +<?php + +/* vim: set expandtab tabstop=4 shiftwidth=4 softtabstop=4: */ + +/** + * Contains a class representing GPG keys + * + * PHP version 5 + * + * LICENSE: + * + * This library is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as + * published by the Free Software Foundation; either version 2.1 of the + * License, or (at your option) any later version. + * + * This library is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + * Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public + * License along with this library; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA + * + * @category Encryption + * @package Crypt_GPG + * @author Michael Gauthier <mike@silverorange.com> + * @copyright 2008-2010 silverorange + * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1 + * @version CVS: $Id: Key.php 295621 2010-03-01 04:18:54Z gauthierm $ + * @link http://pear.php.net/package/Crypt_GPG + */ + +/** + * Sub-key class definition + */ +require_once 'Crypt/GPG/SubKey.php'; + +/** + * User id class definition + */ +require_once 'Crypt/GPG/UserId.php'; + +// {{{ class Crypt_GPG_Key + +/** + * A data class for GPG key information + * + * This class is used to store the results of the {@link Crypt_GPG::getKeys()} + * method. + * + * @category Encryption + * @package Crypt_GPG + * @author Michael Gauthier <mike@silverorange.com> + * @copyright 2008-2010 silverorange + * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1 + * @link http://pear.php.net/package/Crypt_GPG + * @see Crypt_GPG::getKeys() + */ +class Crypt_GPG_Key +{ + // {{{ class properties + + /** + * The user ids associated with this key + * + * This is an array of {@link Crypt_GPG_UserId} objects. + * + * @var array + * + * @see Crypt_GPG_Key::addUserId() + * @see Crypt_GPG_Key::getUserIds() + */ + private $_userIds = array(); + + /** + * The subkeys of this key + * + * This is an array of {@link Crypt_GPG_SubKey} objects. + * + * @var array + * + * @see Crypt_GPG_Key::addSubKey() + * @see Crypt_GPG_Key::getSubKeys() + */ + private $_subKeys = array(); + + // }}} + // {{{ getSubKeys() + + /** + * Gets the sub-keys of this key + * + * @return array the sub-keys of this key. + * + * @see Crypt_GPG_Key::addSubKey() + */ + public function getSubKeys() + { + return $this->_subKeys; + } + + // }}} + // {{{ getUserIds() + + /** + * Gets the user ids of this key + * + * @return array the user ids of this key. + * + * @see Crypt_GPG_Key::addUserId() + */ + public function getUserIds() + { + return $this->_userIds; + } + + // }}} + // {{{ getPrimaryKey() + + /** + * Gets the primary sub-key of this key + * + * The primary key is the first added sub-key. + * + * @return Crypt_GPG_SubKey the primary sub-key of this key. + */ + public function getPrimaryKey() + { + $primary_key = null; + if (count($this->_subKeys) > 0) { + $primary_key = $this->_subKeys[0]; + } + return $primary_key; + } + + // }}} + // {{{ canSign() + + /** + * Gets whether or not this key can sign data + * + * This key can sign data if any sub-key of this key can sign data. + * + * @return boolean true if this key can sign data and false if this key + * cannot sign data. + */ + public function canSign() + { + $canSign = false; + foreach ($this->_subKeys as $subKey) { + if ($subKey->canSign()) { + $canSign = true; + break; + } + } + return $canSign; + } + + // }}} + // {{{ canEncrypt() + + /** + * Gets whether or not this key can encrypt data + * + * This key can encrypt data if any sub-key of this key can encrypt data. + * + * @return boolean true if this key can encrypt data and false if this + * key cannot encrypt data. + */ + public function canEncrypt() + { + $canEncrypt = false; + foreach ($this->_subKeys as $subKey) { + if ($subKey->canEncrypt()) { + $canEncrypt = true; + break; + } + } + return $canEncrypt; + } + + // }}} + // {{{ addSubKey() + + /** + * Adds a sub-key to this key + * + * The first added sub-key will be the primary key of this key. + * + * @param Crypt_GPG_SubKey $subKey the sub-key to add. + * + * @return Crypt_GPG_Key the current object, for fluent interface. + */ + public function addSubKey(Crypt_GPG_SubKey $subKey) + { + $this->_subKeys[] = $subKey; + return $this; + } + + // }}} + // {{{ addUserId() + + /** + * Adds a user id to this key + * + * @param Crypt_GPG_UserId $userId the user id to add. + * + * @return Crypt_GPG_Key the current object, for fluent interface. + */ + public function addUserId(Crypt_GPG_UserId $userId) + { + $this->_userIds[] = $userId; + return $this; + } + + // }}} +} + +// }}} + +?> diff --git a/plugins/enigma/lib/Crypt/GPG/Signature.php b/plugins/enigma/lib/Crypt/GPG/Signature.php new file mode 100644 index 000000000..03ab44c53 --- /dev/null +++ b/plugins/enigma/lib/Crypt/GPG/Signature.php @@ -0,0 +1,428 @@ +<?php + +/* vim: set expandtab tabstop=4 shiftwidth=4 softtabstop=4: */ + +/** + * A class representing GPG signatures + * + * This file contains a data class representing a GPG signature. + * + * PHP version 5 + * + * LICENSE: + * + * This library is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as + * published by the Free Software Foundation; either version 2.1 of the + * License, or (at your option) any later version. + * + * This library is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + * Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public + * License along with this library; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA + * + * @category Encryption + * @package Crypt_GPG + * @author Nathan Fredrickson <nathan@silverorange.com> + * @copyright 2005-2010 silverorange + * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1 + * @version CVS: $Id: Signature.php 302773 2010-08-25 14:16:28Z gauthierm $ + * @link http://pear.php.net/package/Crypt_GPG + */ + +/** + * User id class definition + */ +require_once 'Crypt/GPG/UserId.php'; + +// {{{ class Crypt_GPG_Signature + +/** + * A class for GPG signature information + * + * This class is used to store the results of the Crypt_GPG::verify() method. + * + * @category Encryption + * @package Crypt_GPG + * @author Nathan Fredrickson <nathan@silverorange.com> + * @author Michael Gauthier <mike@silverorange.com> + * @copyright 2005-2010 silverorange + * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1 + * @link http://pear.php.net/package/Crypt_GPG + * @see Crypt_GPG::verify() + */ +class Crypt_GPG_Signature +{ + // {{{ class properties + + /** + * A base64-encoded string containing a unique id for this signature if + * this signature has been verified as ok + * + * This id is used to prevent replay attacks and is not present for all + * types of signatures. + * + * @var string + */ + private $_id = ''; + + /** + * The fingerprint of the key used to create the signature + * + * @var string + */ + private $_keyFingerprint = ''; + + /** + * The id of the key used to create the signature + * + * @var string + */ + private $_keyId = ''; + + /** + * The creation date of this signature + * + * This is a Unix timestamp. + * + * @var integer + */ + private $_creationDate = 0; + + /** + * The expiration date of the signature + * + * This is a Unix timestamp. If this signature does not expire, this will + * be zero. + * + * @var integer + */ + private $_expirationDate = 0; + + /** + * The user id associated with this signature + * + * @var Crypt_GPG_UserId + */ + private $_userId = null; + + /** + * Whether or not this signature is valid + * + * @var boolean + */ + private $_isValid = false; + + // }}} + // {{{ __construct() + + /** + * Creates a new signature + * + * Signatures can be initialized from an array of named values. Available + * names are: + * + * - <kbd>string id</kbd> - the unique id of this signature. + * - <kbd>string fingerprint</kbd> - the fingerprint of the key used to + * create the signature. The fingerprint + * should not contain formatting + * characters. + * - <kbd>string keyId</kbd> - the id of the key used to create the + * the signature. + * - <kbd>integer creation</kbd> - the date the signature was created. + * This is a UNIX timestamp. + * - <kbd>integer expiration</kbd> - the date the signature expired. This + * is a UNIX timestamp. If the signature + * does not expire, use 0. + * - <kbd>boolean valid</kbd> - whether or not the signature is valid. + * - <kbd>string userId</kbd> - the user id associated with the + * signature. This may also be a + * {@link Crypt_GPG_UserId} object. + * + * @param Crypt_GPG_Signature|array $signature optional. Either an existing + * signature object, which is copied; or an array of initial values. + */ + public function __construct($signature = null) + { + // copy from object + if ($signature instanceof Crypt_GPG_Signature) { + $this->_id = $signature->_id; + $this->_keyFingerprint = $signature->_keyFingerprint; + $this->_keyId = $signature->_keyId; + $this->_creationDate = $signature->_creationDate; + $this->_expirationDate = $signature->_expirationDate; + $this->_isValid = $signature->_isValid; + + if ($signature->_userId instanceof Crypt_GPG_UserId) { + $this->_userId = clone $signature->_userId; + } else { + $this->_userId = $signature->_userId; + } + } + + // initialize from array + if (is_array($signature)) { + if (array_key_exists('id', $signature)) { + $this->setId($signature['id']); + } + + if (array_key_exists('fingerprint', $signature)) { + $this->setKeyFingerprint($signature['fingerprint']); + } + + if (array_key_exists('keyId', $signature)) { + $this->setKeyId($signature['keyId']); + } + + if (array_key_exists('creation', $signature)) { + $this->setCreationDate($signature['creation']); + } + + if (array_key_exists('expiration', $signature)) { + $this->setExpirationDate($signature['expiration']); + } + + if (array_key_exists('valid', $signature)) { + $this->setValid($signature['valid']); + } + + if (array_key_exists('userId', $signature)) { + $userId = new Crypt_GPG_UserId($signature['userId']); + $this->setUserId($userId); + } + } + } + + // }}} + // {{{ getId() + + /** + * Gets the id of this signature + * + * @return string a base64-encoded string containing a unique id for this + * signature. This id is used to prevent replay attacks and + * is not present for all types of signatures. + */ + public function getId() + { + return $this->_id; + } + + // }}} + // {{{ getKeyFingerprint() + + /** + * Gets the fingerprint of the key used to create this signature + * + * @return string the fingerprint of the key used to create this signature. + */ + public function getKeyFingerprint() + { + return $this->_keyFingerprint; + } + + // }}} + // {{{ getKeyId() + + /** + * Gets the id of the key used to create this signature + * + * Whereas the fingerprint of the signing key may not always be available + * (for example if the signature is bad), the id should always be + * available. + * + * @return string the id of the key used to create this signature. + */ + public function getKeyId() + { + return $this->_keyId; + } + + // }}} + // {{{ getCreationDate() + + /** + * Gets the creation date of this signature + * + * @return integer the creation date of this signature. This is a Unix + * timestamp. + */ + public function getCreationDate() + { + return $this->_creationDate; + } + + // }}} + // {{{ getExpirationDate() + + /** + * Gets the expiration date of the signature + * + * @return integer the expiration date of this signature. This is a Unix + * timestamp. If this signature does not expire, this will + * be zero. + */ + public function getExpirationDate() + { + return $this->_expirationDate; + } + + // }}} + // {{{ getUserId() + + /** + * Gets the user id associated with this signature + * + * @return Crypt_GPG_UserId the user id associated with this signature. + */ + public function getUserId() + { + return $this->_userId; + } + + // }}} + // {{{ isValid() + + /** + * Gets whether or no this signature is valid + * + * @return boolean true if this signature is valid and false if it is not. + */ + public function isValid() + { + return $this->_isValid; + } + + // }}} + // {{{ setId() + + /** + * Sets the id of this signature + * + * @param string $id a base64-encoded string containing a unique id for + * this signature. + * + * @return Crypt_GPG_Signature the current object, for fluent interface. + * + * @see Crypt_GPG_Signature::getId() + */ + public function setId($id) + { + $this->_id = strval($id); + return $this; + } + + // }}} + // {{{ setKeyFingerprint() + + /** + * Sets the key fingerprint of this signature + * + * @param string $fingerprint the key fingerprint of this signature. This + * is the fingerprint of the primary key used to + * create this signature. + * + * @return Crypt_GPG_Signature the current object, for fluent interface. + */ + public function setKeyFingerprint($fingerprint) + { + $this->_keyFingerprint = strval($fingerprint); + return $this; + } + + // }}} + // {{{ setKeyId() + + /** + * Sets the key id of this signature + * + * @param string $id the key id of this signature. This is the id of the + * primary key used to create this signature. + * + * @return Crypt_GPG_Signature the current object, for fluent interface. + */ + public function setKeyId($id) + { + $this->_keyId = strval($id); + return $this; + } + + // }}} + // {{{ setCreationDate() + + /** + * Sets the creation date of this signature + * + * @param integer $creationDate the creation date of this signature. This + * is a Unix timestamp. + * + * @return Crypt_GPG_Signature the current object, for fluent interface. + */ + public function setCreationDate($creationDate) + { + $this->_creationDate = intval($creationDate); + return $this; + } + + // }}} + // {{{ setExpirationDate() + + /** + * Sets the expiration date of this signature + * + * @param integer $expirationDate the expiration date of this signature. + * This is a Unix timestamp. Specify zero if + * this signature does not expire. + * + * @return Crypt_GPG_Signature the current object, for fluent interface. + */ + public function setExpirationDate($expirationDate) + { + $this->_expirationDate = intval($expirationDate); + return $this; + } + + // }}} + // {{{ setUserId() + + /** + * Sets the user id associated with this signature + * + * @param Crypt_GPG_UserId $userId the user id associated with this + * signature. + * + * @return Crypt_GPG_Signature the current object, for fluent interface. + */ + public function setUserId(Crypt_GPG_UserId $userId) + { + $this->_userId = $userId; + return $this; + } + + // }}} + // {{{ setValid() + + /** + * Sets whether or not this signature is valid + * + * @param boolean $isValid true if this signature is valid and false if it + * is not. + * + * @return Crypt_GPG_Signature the current object, for fluent interface. + */ + public function setValid($isValid) + { + $this->_isValid = ($isValid) ? true : false; + return $this; + } + + // }}} +} + +// }}} + +?> diff --git a/plugins/enigma/lib/Crypt/GPG/SubKey.php b/plugins/enigma/lib/Crypt/GPG/SubKey.php new file mode 100644 index 000000000..b6316e99f --- /dev/null +++ b/plugins/enigma/lib/Crypt/GPG/SubKey.php @@ -0,0 +1,649 @@ +<?php + +/* vim: set expandtab tabstop=4 shiftwidth=4 softtabstop=4: */ + +/** + * Contains a class representing GPG sub-keys and constants for GPG algorithms + * + * PHP version 5 + * + * LICENSE: + * + * This library is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as + * published by the Free Software Foundation; either version 2.1 of the + * License, or (at your option) any later version. + * + * This library is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + * Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public + * License along with this library; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA + * + * @category Encryption + * @package Crypt_GPG + * @author Michael Gauthier <mike@silverorange.com> + * @author Nathan Fredrickson <nathan@silverorange.com> + * @copyright 2005-2010 silverorange + * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1 + * @version CVS: $Id: SubKey.php 302768 2010-08-25 13:45:52Z gauthierm $ + * @link http://pear.php.net/package/Crypt_GPG + */ + +// {{{ class Crypt_GPG_SubKey + +/** + * A class for GPG sub-key information + * + * This class is used to store the results of the {@link Crypt_GPG::getKeys()} + * method. Sub-key objects are members of a {@link Crypt_GPG_Key} object. + * + * @category Encryption + * @package Crypt_GPG + * @author Michael Gauthier <mike@silverorange.com> + * @author Nathan Fredrickson <nathan@silverorange.com> + * @copyright 2005-2010 silverorange + * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1 + * @link http://pear.php.net/package/Crypt_GPG + * @see Crypt_GPG::getKeys() + * @see Crypt_GPG_Key::getSubKeys() + */ +class Crypt_GPG_SubKey +{ + // {{{ class constants + + /** + * RSA encryption algorithm. + */ + const ALGORITHM_RSA = 1; + + /** + * Elgamal encryption algorithm (encryption only). + */ + const ALGORITHM_ELGAMAL_ENC = 16; + + /** + * DSA encryption algorithm (sometimes called DH, sign only). + */ + const ALGORITHM_DSA = 17; + + /** + * Elgamal encryption algorithm (signage and encryption - should not be + * used). + */ + const ALGORITHM_ELGAMAL_ENC_SGN = 20; + + // }}} + // {{{ class properties + + /** + * The id of this sub-key + * + * @var string + */ + private $_id = ''; + + /** + * The algorithm used to create this sub-key + * + * The value is one of the Crypt_GPG_SubKey::ALGORITHM_* constants. + * + * @var integer + */ + private $_algorithm = 0; + + /** + * The fingerprint of this sub-key + * + * @var string + */ + private $_fingerprint = ''; + + /** + * Length of this sub-key in bits + * + * @var integer + */ + private $_length = 0; + + /** + * Date this sub-key was created + * + * This is a Unix timestamp. + * + * @var integer + */ + private $_creationDate = 0; + + /** + * Date this sub-key expires + * + * This is a Unix timestamp. If this sub-key does not expire, this will be + * zero. + * + * @var integer + */ + private $_expirationDate = 0; + + /** + * Whether or not this sub-key can sign data + * + * @var boolean + */ + private $_canSign = false; + + /** + * Whether or not this sub-key can encrypt data + * + * @var boolean + */ + private $_canEncrypt = false; + + /** + * Whether or not the private key for this sub-key exists in the keyring + * + * @var boolean + */ + private $_hasPrivate = false; + + /** + * Whether or not this sub-key is revoked + * + * @var boolean + */ + private $_isRevoked = false; + + // }}} + // {{{ __construct() + + /** + * Creates a new sub-key object + * + * Sub-keys can be initialized from an array of named values. Available + * names are: + * + * - <kbd>string id</kbd> - the key id of the sub-key. + * - <kbd>integer algorithm</kbd> - the encryption algorithm of the + * sub-key. + * - <kbd>string fingerprint</kbd> - the fingerprint of the sub-key. The + * fingerprint should not contain + * formatting characters. + * - <kbd>integer length</kbd> - the length of the sub-key in bits. + * - <kbd>integer creation</kbd> - the date the sub-key was created. + * This is a UNIX timestamp. + * - <kbd>integer expiration</kbd> - the date the sub-key expires. This + * is a UNIX timestamp. If the sub-key + * does not expire, use 0. + * - <kbd>boolean canSign</kbd> - whether or not the sub-key can be + * used to sign data. + * - <kbd>boolean canEncrypt</kbd> - whether or not the sub-key can be + * used to encrypt data. + * - <kbd>boolean hasPrivate</kbd> - whether or not the private key for + * the sub-key exists in the keyring. + * - <kbd>boolean isRevoked</kbd> - whether or not this sub-key is + * revoked. + * + * @param Crypt_GPG_SubKey|string|array $key optional. Either an existing + * sub-key object, which is copied; a sub-key string, which is + * parsed; or an array of initial values. + */ + public function __construct($key = null) + { + // parse from string + if (is_string($key)) { + $key = self::parse($key); + } + + // copy from object + if ($key instanceof Crypt_GPG_SubKey) { + $this->_id = $key->_id; + $this->_algorithm = $key->_algorithm; + $this->_fingerprint = $key->_fingerprint; + $this->_length = $key->_length; + $this->_creationDate = $key->_creationDate; + $this->_expirationDate = $key->_expirationDate; + $this->_canSign = $key->_canSign; + $this->_canEncrypt = $key->_canEncrypt; + $this->_hasPrivate = $key->_hasPrivate; + $this->_isRevoked = $key->_isRevoked; + } + + // initialize from array + if (is_array($key)) { + if (array_key_exists('id', $key)) { + $this->setId($key['id']); + } + + if (array_key_exists('algorithm', $key)) { + $this->setAlgorithm($key['algorithm']); + } + + if (array_key_exists('fingerprint', $key)) { + $this->setFingerprint($key['fingerprint']); + } + + if (array_key_exists('length', $key)) { + $this->setLength($key['length']); + } + + if (array_key_exists('creation', $key)) { + $this->setCreationDate($key['creation']); + } + + if (array_key_exists('expiration', $key)) { + $this->setExpirationDate($key['expiration']); + } + + if (array_key_exists('canSign', $key)) { + $this->setCanSign($key['canSign']); + } + + if (array_key_exists('canEncrypt', $key)) { + $this->setCanEncrypt($key['canEncrypt']); + } + + if (array_key_exists('hasPrivate', $key)) { + $this->setHasPrivate($key['hasPrivate']); + } + + if (array_key_exists('isRevoked', $key)) { + $this->setRevoked($key['isRevoked']); + } + } + } + + // }}} + // {{{ getId() + + /** + * Gets the id of this sub-key + * + * @return string the id of this sub-key. + */ + public function getId() + { + return $this->_id; + } + + // }}} + // {{{ getAlgorithm() + + /** + * Gets the algorithm used by this sub-key + * + * The algorithm should be one of the Crypt_GPG_SubKey::ALGORITHM_* + * constants. + * + * @return integer the algorithm used by this sub-key. + */ + public function getAlgorithm() + { + return $this->_algorithm; + } + + // }}} + // {{{ getCreationDate() + + /** + * Gets the creation date of this sub-key + * + * This is a Unix timestamp. + * + * @return integer the creation date of this sub-key. + */ + public function getCreationDate() + { + return $this->_creationDate; + } + + // }}} + // {{{ getExpirationDate() + + /** + * Gets the date this sub-key expires + * + * This is a Unix timestamp. If this sub-key does not expire, this will be + * zero. + * + * @return integer the date this sub-key expires. + */ + public function getExpirationDate() + { + return $this->_expirationDate; + } + + // }}} + // {{{ getFingerprint() + + /** + * Gets the fingerprint of this sub-key + * + * @return string the fingerprint of this sub-key. + */ + public function getFingerprint() + { + return $this->_fingerprint; + } + + // }}} + // {{{ getLength() + + /** + * Gets the length of this sub-key in bits + * + * @return integer the length of this sub-key in bits. + */ + public function getLength() + { + return $this->_length; + } + + // }}} + // {{{ canSign() + + /** + * Gets whether or not this sub-key can sign data + * + * @return boolean true if this sub-key can sign data and false if this + * sub-key can not sign data. + */ + public function canSign() + { + return $this->_canSign; + } + + // }}} + // {{{ canEncrypt() + + /** + * Gets whether or not this sub-key can encrypt data + * + * @return boolean true if this sub-key can encrypt data and false if this + * sub-key can not encrypt data. + */ + public function canEncrypt() + { + return $this->_canEncrypt; + } + + // }}} + // {{{ hasPrivate() + + /** + * Gets whether or not the private key for this sub-key exists in the + * keyring + * + * @return boolean true the private key for this sub-key exists in the + * keyring and false if it does not. + */ + public function hasPrivate() + { + return $this->_hasPrivate; + } + + // }}} + // {{{ isRevoked() + + /** + * Gets whether or not this sub-key is revoked + * + * @return boolean true if this sub-key is revoked and false if it is not. + */ + public function isRevoked() + { + return $this->_isRevoked; + } + + // }}} + // {{{ setCreationDate() + + /** + * Sets the creation date of this sub-key + * + * The creation date is a Unix timestamp. + * + * @param integer $creationDate the creation date of this sub-key. + * + * @return Crypt_GPG_SubKey the current object, for fluent interface. + */ + public function setCreationDate($creationDate) + { + $this->_creationDate = intval($creationDate); + return $this; + } + + // }}} + // {{{ setExpirationDate() + + /** + * Sets the expiration date of this sub-key + * + * The expiration date is a Unix timestamp. Specify zero if this sub-key + * does not expire. + * + * @param integer $expirationDate the expiration date of this sub-key. + * + * @return Crypt_GPG_SubKey the current object, for fluent interface. + */ + public function setExpirationDate($expirationDate) + { + $this->_expirationDate = intval($expirationDate); + return $this; + } + + // }}} + // {{{ setId() + + /** + * Sets the id of this sub-key + * + * @param string $id the id of this sub-key. + * + * @return Crypt_GPG_SubKey the current object, for fluent interface. + */ + public function setId($id) + { + $this->_id = strval($id); + return $this; + } + + // }}} + // {{{ setAlgorithm() + + /** + * Sets the algorithm used by this sub-key + * + * @param integer $algorithm the algorithm used by this sub-key. + * + * @return Crypt_GPG_SubKey the current object, for fluent interface. + */ + public function setAlgorithm($algorithm) + { + $this->_algorithm = intval($algorithm); + return $this; + } + + // }}} + // {{{ setFingerprint() + + /** + * Sets the fingerprint of this sub-key + * + * @param string $fingerprint the fingerprint of this sub-key. + * + * @return Crypt_GPG_SubKey the current object, for fluent interface. + */ + public function setFingerprint($fingerprint) + { + $this->_fingerprint = strval($fingerprint); + return $this; + } + + // }}} + // {{{ setLength() + + /** + * Sets the length of this sub-key in bits + * + * @param integer $length the length of this sub-key in bits. + * + * @return Crypt_GPG_SubKey the current object, for fluent interface. + */ + public function setLength($length) + { + $this->_length = intval($length); + return $this; + } + + // }}} + // {{{ setCanSign() + + /** + * Sets whether of not this sub-key can sign data + * + * @param boolean $canSign true if this sub-key can sign data and false if + * it can not. + * + * @return Crypt_GPG_SubKey the current object, for fluent interface. + */ + public function setCanSign($canSign) + { + $this->_canSign = ($canSign) ? true : false; + return $this; + } + + // }}} + // {{{ setCanEncrypt() + + /** + * Sets whether of not this sub-key can encrypt data + * + * @param boolean $canEncrypt true if this sub-key can encrypt data and + * false if it can not. + * + * @return Crypt_GPG_SubKey the current object, for fluent interface. + */ + public function setCanEncrypt($canEncrypt) + { + $this->_canEncrypt = ($canEncrypt) ? true : false; + return $this; + } + + // }}} + // {{{ setHasPrivate() + + /** + * Sets whether of not the private key for this sub-key exists in the + * keyring + * + * @param boolean $hasPrivate true if the private key for this sub-key + * exists in the keyring and false if it does + * not. + * + * @return Crypt_GPG_SubKey the current object, for fluent interface. + */ + public function setHasPrivate($hasPrivate) + { + $this->_hasPrivate = ($hasPrivate) ? true : false; + return $this; + } + + // }}} + // {{{ setRevoked() + + /** + * Sets whether or not this sub-key is revoked + * + * @param boolean $isRevoked whether or not this sub-key is revoked. + * + * @return Crypt_GPG_SubKey the current object, for fluent interface. + */ + public function setRevoked($isRevoked) + { + $this->_isRevoked = ($isRevoked) ? true : false; + return $this; + } + + // }}} + // {{{ parse() + + /** + * Parses a sub-key object from a sub-key string + * + * See <b>doc/DETAILS</b> in the + * {@link http://www.gnupg.org/download/ GPG distribution} for information + * on how the sub-key string is parsed. + * + * @param string $string the string containing the sub-key. + * + * @return Crypt_GPG_SubKey the sub-key object parsed from the string. + */ + public static function parse($string) + { + $tokens = explode(':', $string); + + $subKey = new Crypt_GPG_SubKey(); + + $subKey->setId($tokens[4]); + $subKey->setLength($tokens[2]); + $subKey->setAlgorithm($tokens[3]); + $subKey->setCreationDate(self::_parseDate($tokens[5])); + $subKey->setExpirationDate(self::_parseDate($tokens[6])); + + if ($tokens[1] == 'r') { + $subKey->setRevoked(true); + } + + if (strpos($tokens[11], 's') !== false) { + $subKey->setCanSign(true); + } + + if (strpos($tokens[11], 'e') !== false) { + $subKey->setCanEncrypt(true); + } + + return $subKey; + } + + // }}} + // {{{ _parseDate() + + /** + * Parses a date string as provided by GPG into a UNIX timestamp + * + * @param string $string the date string. + * + * @return integer the UNIX timestamp corresponding to the provided date + * string. + */ + private static function _parseDate($string) + { + if ($string == '') { + $timestamp = 0; + } else { + // all times are in UTC according to GPG documentation + $timeZone = new DateTimeZone('UTC'); + + if (strpos($string, 'T') === false) { + // interpret as UNIX timestamp + $string = '@' . $string; + } + + $date = new DateTime($string, $timeZone); + + // convert to UNIX timestamp + $timestamp = intval($date->format('U')); + } + + return $timestamp; + } + + // }}} +} + +// }}} + +?> diff --git a/plugins/enigma/lib/Crypt/GPG/UserId.php b/plugins/enigma/lib/Crypt/GPG/UserId.php new file mode 100644 index 000000000..04435708c --- /dev/null +++ b/plugins/enigma/lib/Crypt/GPG/UserId.php @@ -0,0 +1,373 @@ +<?php + +/* vim: set expandtab tabstop=4 shiftwidth=4 softtabstop=4: */ + +/** + * Contains a data class representing a GPG user id + * + * PHP version 5 + * + * LICENSE: + * + * This library is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as + * published by the Free Software Foundation; either version 2.1 of the + * License, or (at your option) any later version. + * + * This library is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + * Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public + * License along with this library; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA + * + * @category Encryption + * @package Crypt_GPG + * @author Michael Gauthier <mike@silverorange.com> + * @copyright 2008-2010 silverorange + * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1 + * @version CVS: $Id: UserId.php 295621 2010-03-01 04:18:54Z gauthierm $ + * @link http://pear.php.net/package/Crypt_GPG + */ + +// {{{ class Crypt_GPG_UserId + +/** + * A class for GPG user id information + * + * This class is used to store the results of the {@link Crypt_GPG::getKeys()} + * method. User id objects are members of a {@link Crypt_GPG_Key} object. + * + * @category Encryption + * @package Crypt_GPG + * @author Michael Gauthier <mike@silverorange.com> + * @copyright 2008-2010 silverorange + * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1 + * @link http://pear.php.net/package/Crypt_GPG + * @see Crypt_GPG::getKeys() + * @see Crypt_GPG_Key::getUserIds() + */ +class Crypt_GPG_UserId +{ + // {{{ class properties + + /** + * The name field of this user id + * + * @var string + */ + private $_name = ''; + + /** + * The comment field of this user id + * + * @var string + */ + private $_comment = ''; + + /** + * The email field of this user id + * + * @var string + */ + private $_email = ''; + + /** + * Whether or not this user id is revoked + * + * @var boolean + */ + private $_isRevoked = false; + + /** + * Whether or not this user id is valid + * + * @var boolean + */ + private $_isValid = true; + + // }}} + // {{{ __construct() + + /** + * Creates a new user id + * + * User ids can be initialized from an array of named values. Available + * names are: + * + * - <kbd>string name</kbd> - the name field of the user id. + * - <kbd>string comment</kbd> - the comment field of the user id. + * - <kbd>string email</kbd> - the email field of the user id. + * - <kbd>boolean valid</kbd> - whether or not the user id is valid. + * - <kbd>boolean revoked</kbd> - whether or not the user id is revoked. + * + * @param Crypt_GPG_UserId|string|array $userId optional. Either an + * existing user id object, which is copied; a user id string, which + * is parsed; or an array of initial values. + */ + public function __construct($userId = null) + { + // parse from string + if (is_string($userId)) { + $userId = self::parse($userId); + } + + // copy from object + if ($userId instanceof Crypt_GPG_UserId) { + $this->_name = $userId->_name; + $this->_comment = $userId->_comment; + $this->_email = $userId->_email; + $this->_isRevoked = $userId->_isRevoked; + $this->_isValid = $userId->_isValid; + } + + // initialize from array + if (is_array($userId)) { + if (array_key_exists('name', $userId)) { + $this->setName($userId['name']); + } + + if (array_key_exists('comment', $userId)) { + $this->setComment($userId['comment']); + } + + if (array_key_exists('email', $userId)) { + $this->setEmail($userId['email']); + } + + if (array_key_exists('revoked', $userId)) { + $this->setRevoked($userId['revoked']); + } + + if (array_key_exists('valid', $userId)) { + $this->setValid($userId['valid']); + } + } + } + + // }}} + // {{{ getName() + + /** + * Gets the name field of this user id + * + * @return string the name field of this user id. + */ + public function getName() + { + return $this->_name; + } + + // }}} + // {{{ getComment() + + /** + * Gets the comments field of this user id + * + * @return string the comments field of this user id. + */ + public function getComment() + { + return $this->_comment; + } + + // }}} + // {{{ getEmail() + + /** + * Gets the email field of this user id + * + * @return string the email field of this user id. + */ + public function getEmail() + { + return $this->_email; + } + + // }}} + // {{{ isRevoked() + + /** + * Gets whether or not this user id is revoked + * + * @return boolean true if this user id is revoked and false if it is not. + */ + public function isRevoked() + { + return $this->_isRevoked; + } + + // }}} + // {{{ isValid() + + /** + * Gets whether or not this user id is valid + * + * @return boolean true if this user id is valid and false if it is not. + */ + public function isValid() + { + return $this->_isValid; + } + + // }}} + // {{{ __toString() + + /** + * Gets a string representation of this user id + * + * The string is formatted as: + * <b><kbd>name (comment) <email-address></kbd></b>. + * + * @return string a string representation of this user id. + */ + public function __toString() + { + $components = array(); + + if (strlen($this->_name) > 0) { + $components[] = $this->_name; + } + + if (strlen($this->_comment) > 0) { + $components[] = '(' . $this->_comment . ')'; + } + + if (strlen($this->_email) > 0) { + $components[] = '<' . $this->_email. '>'; + } + + return implode(' ', $components); + } + + // }}} + // {{{ setName() + + /** + * Sets the name field of this user id + * + * @param string $name the name field of this user id. + * + * @return Crypt_GPG_UserId the current object, for fluent interface. + */ + public function setName($name) + { + $this->_name = strval($name); + return $this; + } + + // }}} + // {{{ setComment() + + /** + * Sets the comment field of this user id + * + * @param string $comment the comment field of this user id. + * + * @return Crypt_GPG_UserId the current object, for fluent interface. + */ + public function setComment($comment) + { + $this->_comment = strval($comment); + return $this; + } + + // }}} + // {{{ setEmail() + + /** + * Sets the email field of this user id + * + * @param string $email the email field of this user id. + * + * @return Crypt_GPG_UserId the current object, for fluent interface. + */ + public function setEmail($email) + { + $this->_email = strval($email); + return $this; + } + + // }}} + // {{{ setRevoked() + + /** + * Sets whether or not this user id is revoked + * + * @param boolean $isRevoked whether or not this user id is revoked. + * + * @return Crypt_GPG_UserId the current object, for fluent interface. + */ + public function setRevoked($isRevoked) + { + $this->_isRevoked = ($isRevoked) ? true : false; + return $this; + } + + // }}} + // {{{ setValid() + + /** + * Sets whether or not this user id is valid + * + * @param boolean $isValid whether or not this user id is valid. + * + * @return Crypt_GPG_UserId the current object, for fluent interface. + */ + public function setValid($isValid) + { + $this->_isValid = ($isValid) ? true : false; + return $this; + } + + // }}} + // {{{ parse() + + /** + * Parses a user id object from a user id string + * + * A user id string is of the form: + * <b><kbd>name (comment) <email-address></kbd></b> with the <i>comment</i> + * and <i>email-address</i> fields being optional. + * + * @param string $string the user id string to parse. + * + * @return Crypt_GPG_UserId the user id object parsed from the string. + */ + public static function parse($string) + { + $userId = new Crypt_GPG_UserId(); + $email = ''; + $comment = ''; + + // get email address from end of string if it exists + $matches = array(); + if (preg_match('/^(.+?) <([^>]+)>$/', $string, $matches) === 1) { + $string = $matches[1]; + $email = $matches[2]; + } + + // get comment from end of string if it exists + $matches = array(); + if (preg_match('/^(.+?) \(([^\)]+)\)$/', $string, $matches) === 1) { + $string = $matches[1]; + $comment = $matches[2]; + } + + $name = $string; + + $userId->setName($name); + $userId->setComment($comment); + $userId->setEmail($email); + + return $userId; + } + + // }}} +} + +// }}} + +?> diff --git a/plugins/enigma/lib/Crypt/GPG/VerifyStatusHandler.php b/plugins/enigma/lib/Crypt/GPG/VerifyStatusHandler.php new file mode 100644 index 000000000..083bd3012 --- /dev/null +++ b/plugins/enigma/lib/Crypt/GPG/VerifyStatusHandler.php @@ -0,0 +1,216 @@ +<?php + +/* vim: set expandtab tabstop=4 shiftwidth=4 softtabstop=4: */ + +/** + * Crypt_GPG is a package to use GPG from PHP + * + * This file contains an object that handles GPG's status output for the verify + * operation. + * + * PHP version 5 + * + * LICENSE: + * + * This library is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as + * published by the Free Software Foundation; either version 2.1 of the + * License, or (at your option) any later version. + * + * This library is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + * Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public + * License along with this library; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA + * + * @category Encryption + * @package Crypt_GPG + * @author Michael Gauthier <mike@silverorange.com> + * @copyright 2008 silverorange + * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1 + * @version CVS: $Id: VerifyStatusHandler.php 302908 2010-08-31 03:56:54Z gauthierm $ + * @link http://pear.php.net/package/Crypt_GPG + * @link http://www.gnupg.org/ + */ + +/** + * Signature object class definition + */ +require_once 'Crypt/GPG/Signature.php'; + +/** + * Status line handler for the verify operation + * + * This class is used internally by Crypt_GPG and does not need be used + * directly. See the {@link Crypt_GPG} class for end-user API. + * + * This class is responsible for building signature objects that are returned + * by the {@link Crypt_GPG::verify()} method. See <b>doc/DETAILS</b> in the + * {@link http://www.gnupg.org/download/ GPG distribution} for detailed + * information on GPG's status output for the verify operation. + * + * @category Encryption + * @package Crypt_GPG + * @author Michael Gauthier <mike@silverorange.com> + * @copyright 2008 silverorange + * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1 + * @link http://pear.php.net/package/Crypt_GPG + * @link http://www.gnupg.org/ + */ +class Crypt_GPG_VerifyStatusHandler +{ + // {{{ protected properties + + /** + * The current signature id + * + * Ths signature id is emitted by GPG before the new signature line so we + * must remember it temporarily. + * + * @var string + */ + protected $signatureId = ''; + + /** + * List of parsed {@link Crypt_GPG_Signature} objects + * + * @var array + */ + protected $signatures = array(); + + /** + * Array index of the current signature + * + * @var integer + */ + protected $index = -1; + + // }}} + // {{{ handle() + + /** + * Handles a status line + * + * @param string $line the status line to handle. + * + * @return void + */ + public function handle($line) + { + $tokens = explode(' ', $line); + switch ($tokens[0]) { + case 'GOODSIG': + case 'EXPSIG': + case 'EXPKEYSIG': + case 'REVKEYSIG': + case 'BADSIG': + $signature = new Crypt_GPG_Signature(); + + // if there was a signature id, set it on the new signature + if ($this->signatureId != '') { + $signature->setId($this->signatureId); + $this->signatureId = ''; + } + + // Detect whether fingerprint or key id was returned and set + // signature values appropriately. Key ids are strings of either + // 16 or 8 hexadecimal characters. Fingerprints are strings of 40 + // hexadecimal characters. The key id is the last 16 characters of + // the key fingerprint. + if (strlen($tokens[1]) > 16) { + $signature->setKeyFingerprint($tokens[1]); + $signature->setKeyId(substr($tokens[1], -16)); + } else { + $signature->setKeyId($tokens[1]); + } + + // get user id string + $string = implode(' ', array_splice($tokens, 2)); + $string = rawurldecode($string); + + $signature->setUserId(Crypt_GPG_UserId::parse($string)); + + $this->index++; + $this->signatures[$this->index] = $signature; + break; + + case 'ERRSIG': + $signature = new Crypt_GPG_Signature(); + + // if there was a signature id, set it on the new signature + if ($this->signatureId != '') { + $signature->setId($this->signatureId); + $this->signatureId = ''; + } + + // Detect whether fingerprint or key id was returned and set + // signature values appropriately. Key ids are strings of either + // 16 or 8 hexadecimal characters. Fingerprints are strings of 40 + // hexadecimal characters. The key id is the last 16 characters of + // the key fingerprint. + if (strlen($tokens[1]) > 16) { + $signature->setKeyFingerprint($tokens[1]); + $signature->setKeyId(substr($tokens[1], -16)); + } else { + $signature->setKeyId($tokens[1]); + } + + $this->index++; + $this->signatures[$this->index] = $signature; + + break; + + case 'VALIDSIG': + if (!array_key_exists($this->index, $this->signatures)) { + break; + } + + $signature = $this->signatures[$this->index]; + + $signature->setValid(true); + $signature->setKeyFingerprint($tokens[1]); + + if (strpos($tokens[3], 'T') === false) { + $signature->setCreationDate($tokens[3]); + } else { + $signature->setCreationDate(strtotime($tokens[3])); + } + + if (array_key_exists(4, $tokens)) { + if (strpos($tokens[4], 'T') === false) { + $signature->setExpirationDate($tokens[4]); + } else { + $signature->setExpirationDate(strtotime($tokens[4])); + } + } + + break; + + case 'SIG_ID': + // note: signature id comes before new signature line and may not + // exist for some signature types + $this->signatureId = $tokens[1]; + break; + } + } + + // }}} + // {{{ getSignatures() + + /** + * Gets the {@link Crypt_GPG_Signature} objects parsed by this handler + * + * @return array the signature objects parsed by this handler. + */ + public function getSignatures() + { + return $this->signatures; + } + + // }}} +} + +?> diff --git a/plugins/enigma/lib/enigma_driver.php b/plugins/enigma/lib/enigma_driver.php new file mode 100644 index 000000000..a9a3e4715 --- /dev/null +++ b/plugins/enigma/lib/enigma_driver.php @@ -0,0 +1,106 @@ +<?php +/* + +-------------------------------------------------------------------------+ + | Abstract driver for the Enigma Plugin | + | | + | This program is free software; you can redistribute it and/or modify | + | it under the terms of the GNU General Public License version 2 | + | as published by the Free Software Foundation. | + | | + | This program is distributed in the hope that it will be useful, | + | but WITHOUT ANY WARRANTY; without even the implied warranty of | + | MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the | + | GNU General Public License for more details. | + | | + | You should have received a copy of the GNU General Public License along | + | with this program; if not, write to the Free Software Foundation, Inc., | + | 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. | + | | + +-------------------------------------------------------------------------+ + | Author: Aleksander Machniak <alec@alec.pl> | + +-------------------------------------------------------------------------+ +*/ + +abstract class enigma_driver +{ + /** + * Class constructor. + * + * @param string User name (email address) + */ + abstract function __construct($user); + + /** + * Driver initialization. + * + * @return mixed NULL on success, enigma_error on failure + */ + abstract function init(); + + /** + * Encryption. + */ + abstract function encrypt($text, $keys); + + /** + * Decryption.. + */ + abstract function decrypt($text, $key, $passwd); + + /** + * Signing. + */ + abstract function sign($text, $key, $passwd); + + /** + * Signature verification. + * + * @param string Message body + * @param string Signature, if message is of type PGP/MIME and body doesn't contain it + * + * @return mixed Signature information (enigma_signature) or enigma_error + */ + abstract function verify($text, $signature); + + /** + * Key/Cert file import. + * + * @param string File name or file content + * @param bollean True if first argument is a filename + * + * @return mixed Import status array or enigma_error + */ + abstract function import($content, $isfile=false); + + /** + * Keys listing. + * + * @param string Optional pattern for key ID, user ID or fingerprint + * + * @return mixed Array of enigma_key objects or enigma_error + */ + abstract function list_keys($pattern=''); + + /** + * Single key information. + * + * @param string Key ID, user ID or fingerprint + * + * @return mixed Key (enigma_key) object or enigma_error + */ + abstract function get_key($keyid); + + /** + * Key pair generation. + * + * @param array Key/User data + * + * @return mixed Key (enigma_key) object or enigma_error + */ + abstract function gen_key($data); + + /** + * Key deletion. + */ + abstract function del_key($keyid); +} diff --git a/plugins/enigma/lib/enigma_driver_gnupg.php b/plugins/enigma/lib/enigma_driver_gnupg.php new file mode 100644 index 000000000..5aa32217e --- /dev/null +++ b/plugins/enigma/lib/enigma_driver_gnupg.php @@ -0,0 +1,305 @@ +<?php +/* + +-------------------------------------------------------------------------+ + | GnuPG (PGP) driver for the Enigma Plugin | + | | + | This program is free software; you can redistribute it and/or modify | + | it under the terms of the GNU General Public License version 2 | + | as published by the Free Software Foundation. | + | | + | This program is distributed in the hope that it will be useful, | + | but WITHOUT ANY WARRANTY; without even the implied warranty of | + | MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the | + | GNU General Public License for more details. | + | | + | You should have received a copy of the GNU General Public License along | + | with this program; if not, write to the Free Software Foundation, Inc., | + | 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. | + | | + +-------------------------------------------------------------------------+ + | Author: Aleksander Machniak <alec@alec.pl> | + +-------------------------------------------------------------------------+ +*/ + +require_once 'Crypt/GPG.php'; + +class enigma_driver_gnupg extends enigma_driver +{ + private $rc; + private $gpg; + private $homedir; + private $user; + + function __construct($user) + { + $rcmail = rcmail::get_instance(); + $this->rc = $rcmail; + $this->user = $user; + } + + /** + * Driver initialization and environment checking. + * Should only return critical errors. + * + * @return mixed NULL on success, enigma_error on failure + */ + function init() + { + $homedir = $this->rc->config->get('enigma_pgp_homedir', INSTALL_PATH . '/plugins/enigma/home'); + + if (!$homedir) + return new enigma_error(enigma_error::E_INTERNAL, + "Option 'enigma_pgp_homedir' not specified"); + + // check if homedir exists (create it if not) and is readable + if (!file_exists($homedir)) + return new enigma_error(enigma_error::E_INTERNAL, + "Keys directory doesn't exists: $homedir"); + if (!is_writable($homedir)) + return new enigma_error(enigma_error::E_INTERNAL, + "Keys directory isn't writeable: $homedir"); + + $homedir = $homedir . '/' . $this->user; + + // check if user's homedir exists (create it if not) and is readable + if (!file_exists($homedir)) + mkdir($homedir, 0700); + + if (!file_exists($homedir)) + return new enigma_error(enigma_error::E_INTERNAL, + "Unable to create keys directory: $homedir"); + if (!is_writable($homedir)) + return new enigma_error(enigma_error::E_INTERNAL, + "Unable to write to keys directory: $homedir"); + + $this->homedir = $homedir; + + // Create Crypt_GPG object + try { + $this->gpg = new Crypt_GPG(array( + 'homedir' => $this->homedir, +// 'debug' => true, + )); + } + catch (Exception $e) { + return $this->get_error_from_exception($e); + } + } + + function encrypt($text, $keys) + { +/* + foreach ($keys as $key) { + $this->gpg->addEncryptKey($key); + } + $enc = $this->gpg->encrypt($text); + return $enc; +*/ + } + + function decrypt($text, $key, $passwd) + { +// $this->gpg->addDecryptKey($key, $passwd); + try { + $dec = $this->gpg->decrypt($text); + return $dec; + } + catch (Exception $e) { + return $this->get_error_from_exception($e); + } + } + + function sign($text, $key, $passwd) + { +/* + $this->gpg->addSignKey($key, $passwd); + $signed = $this->gpg->sign($text, Crypt_GPG::SIGN_MODE_DETACHED); + return $signed; +*/ + } + + function verify($text, $signature) + { + try { + $verified = $this->gpg->verify($text, $signature); + return $this->parse_signature($verified[0]); + } + catch (Exception $e) { + return $this->get_error_from_exception($e); + } + } + + public function import($content, $isfile=false) + { + try { + if ($isfile) + return $this->gpg->importKeyFile($content); + else + return $this->gpg->importKey($content); + } + catch (Exception $e) { + return $this->get_error_from_exception($e); + } + } + + public function list_keys($pattern='') + { + try { + $keys = $this->gpg->getKeys($pattern); + $result = array(); +//print_r($keys); + foreach ($keys as $idx => $key) { + $result[] = $this->parse_key($key); + unset($keys[$idx]); + } +//print_r($result); + return $result; + } + catch (Exception $e) { + return $this->get_error_from_exception($e); + } + } + + public function get_key($keyid) + { + $list = $this->list_keys($keyid); + + if (is_array($list)) + return array_shift($list); + + // error + return $list; + } + + public function gen_key($data) + { + } + + public function del_key($keyid) + { +// $this->get_key($keyid); + + + } + + public function del_privkey($keyid) + { + try { + $this->gpg->deletePrivateKey($keyid); + return true; + } + catch (Exception $e) { + return $this->get_error_from_exception($e); + } + } + + public function del_pubkey($keyid) + { + try { + $this->gpg->deletePublicKey($keyid); + return true; + } + catch (Exception $e) { + return $this->get_error_from_exception($e); + } + } + + /** + * Converts Crypt_GPG exception into Enigma's error object + * + * @param mixed Exception object + * + * @return enigma_error Error object + */ + private function get_error_from_exception($e) + { + $data = array(); + + if ($e instanceof Crypt_GPG_KeyNotFoundException) { + $error = enigma_error::E_KEYNOTFOUND; + $data['id'] = $e->getKeyId(); + } + else if ($e instanceof Crypt_GPG_BadPassphraseException) { + $error = enigma_error::E_BADPASS; + $data['bad'] = $e->getBadPassphrases(); + $data['missing'] = $e->getMissingPassphrases(); + } + else if ($e instanceof Crypt_GPG_NoDataException) + $error = enigma_error::E_NODATA; + else if ($e instanceof Crypt_GPG_DeletePrivateKeyException) + $error = enigma_error::E_DELKEY; + else + $error = enigma_error::E_INTERNAL; + + $msg = $e->getMessage(); + + return new enigma_error($error, $msg, $data); + } + + /** + * Converts Crypt_GPG_Signature object into Enigma's signature object + * + * @param Crypt_GPG_Signature Signature object + * + * @return enigma_signature Signature object + */ + private function parse_signature($sig) + { + $user = $sig->getUserId(); + + $data = new enigma_signature(); + $data->id = $sig->getId(); + $data->valid = $sig->isValid(); + $data->fingerprint = $sig->getKeyFingerprint(); + $data->created = $sig->getCreationDate(); + $data->expires = $sig->getExpirationDate(); + $data->name = $user->getName(); + $data->comment = $user->getComment(); + $data->email = $user->getEmail(); + + return $data; + } + + /** + * Converts Crypt_GPG_Key object into Enigma's key object + * + * @param Crypt_GPG_Key Key object + * + * @return enigma_key Key object + */ + private function parse_key($key) + { + $ekey = new enigma_key(); + + foreach ($key->getUserIds() as $idx => $user) { + $id = new enigma_userid(); + $id->name = $user->getName(); + $id->comment = $user->getComment(); + $id->email = $user->getEmail(); + $id->valid = $user->isValid(); + $id->revoked = $user->isRevoked(); + + $ekey->users[$idx] = $id; + } + + $ekey->name = trim($ekey->users[0]->name . ' <' . $ekey->users[0]->email . '>'); + + foreach ($key->getSubKeys() as $idx => $subkey) { + $skey = new enigma_subkey(); + $skey->id = $subkey->getId(); + $skey->revoked = $subkey->isRevoked(); + $skey->created = $subkey->getCreationDate(); + $skey->expires = $subkey->getExpirationDate(); + $skey->fingerprint = $subkey->getFingerprint(); + $skey->has_private = $subkey->hasPrivate(); + $skey->can_sign = $subkey->canSign(); + $skey->can_encrypt = $subkey->canEncrypt(); + + $ekey->subkeys[$idx] = $skey; + }; + + $ekey->id = $ekey->subkeys[0]->id; + + return $ekey; + } +} diff --git a/plugins/enigma/lib/enigma_engine.php b/plugins/enigma/lib/enigma_engine.php new file mode 100644 index 000000000..59ae1202c --- /dev/null +++ b/plugins/enigma/lib/enigma_engine.php @@ -0,0 +1,547 @@ +<?php +/* + +-------------------------------------------------------------------------+ + | Engine of the Enigma Plugin | + | | + | This program is free software; you can redistribute it and/or modify | + | it under the terms of the GNU General Public License version 2 | + | as published by the Free Software Foundation. | + | | + | This program is distributed in the hope that it will be useful, | + | but WITHOUT ANY WARRANTY; without even the implied warranty of | + | MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the | + | GNU General Public License for more details. | + | | + | You should have received a copy of the GNU General Public License along | + | with this program; if not, write to the Free Software Foundation, Inc., | + | 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. | + | | + +-------------------------------------------------------------------------+ + | Author: Aleksander Machniak <alec@alec.pl> | + +-------------------------------------------------------------------------+ + +*/ + +/* + RFC2440: OpenPGP Message Format + RFC3156: MIME Security with OpenPGP + RFC3851: S/MIME +*/ + +class enigma_engine +{ + private $rc; + private $enigma; + private $pgp_driver; + private $smime_driver; + + public $decryptions = array(); + public $signatures = array(); + public $signed_parts = array(); + + + /** + * Plugin initialization. + */ + function __construct($enigma) + { + $rcmail = rcmail::get_instance(); + $this->rc = $rcmail; + $this->enigma = $enigma; + } + + /** + * PGP driver initialization. + */ + function load_pgp_driver() + { + if ($this->pgp_driver) + return; + + $driver = 'enigma_driver_' . $this->rc->config->get('enigma_pgp_driver', 'gnupg'); + $username = $this->rc->user->get_username(); + + // Load driver + $this->pgp_driver = new $driver($username); + + if (!$this->pgp_driver) { + raise_error(array( + 'code' => 600, 'type' => 'php', + 'file' => __FILE__, 'line' => __LINE__, + 'message' => "Enigma plugin: Unable to load PGP driver: $driver" + ), true, true); + } + + // Initialise driver + $result = $this->pgp_driver->init(); + + if ($result instanceof enigma_error) { + raise_error(array( + 'code' => 600, 'type' => 'php', + 'file' => __FILE__, 'line' => __LINE__, + 'message' => "Enigma plugin: ".$result->getMessage() + ), true, true); + } + } + + /** + * S/MIME driver initialization. + */ + function load_smime_driver() + { + if ($this->smime_driver) + return; + + // NOT IMPLEMENTED! + return; + + $driver = 'enigma_driver_' . $this->rc->config->get('enigma_smime_driver', 'phpssl'); + $username = $this->rc->user->get_username(); + + // Load driver + $this->smime_driver = new $driver($username); + + if (!$this->smime_driver) { + raise_error(array( + 'code' => 600, 'type' => 'php', + 'file' => __FILE__, 'line' => __LINE__, + 'message' => "Enigma plugin: Unable to load S/MIME driver: $driver" + ), true, true); + } + + // Initialise driver + $result = $this->smime_driver->init(); + + if ($result instanceof enigma_error) { + raise_error(array( + 'code' => 600, 'type' => 'php', + 'file' => __FILE__, 'line' => __LINE__, + 'message' => "Enigma plugin: ".$result->getMessage() + ), true, true); + } + } + + /** + * Handler for plain/text message. + * + * @param array Reference to hook's parameters + */ + function parse_plain(&$p) + { + $part = $p['structure']; + + // Get message body from IMAP server + $this->set_part_body($part, $p['object']->uid); + + // @TODO: big message body can be a file resource + // PGP signed message + if (preg_match('/^-----BEGIN PGP SIGNED MESSAGE-----/', $part->body)) { + $this->parse_plain_signed($p); + } + // PGP encrypted message + else if (preg_match('/^-----BEGIN PGP MESSAGE-----/', $part->body)) { + $this->parse_plain_encrypted($p); + } + } + + /** + * Handler for multipart/signed message. + * + * @param array Reference to hook's parameters + */ + function parse_signed(&$p) + { + $struct = $p['structure']; + + // S/MIME + if ($struct->parts[1] && $struct->parts[1]->mimetype == 'application/pkcs7-signature') { + $this->parse_smime_signed($p); + } + // PGP/MIME: + // The multipart/signed body MUST consist of exactly two parts. + // The first part contains the signed data in MIME canonical format, + // including a set of appropriate content headers describing the data. + // The second body MUST contain the PGP digital signature. It MUST be + // labeled with a content type of "application/pgp-signature". + else if ($struct->parts[1] && $struct->parts[1]->mimetype == 'application/pgp-signature') { + $this->parse_pgp_signed($p); + } + } + + /** + * Handler for multipart/encrypted message. + * + * @param array Reference to hook's parameters + */ + function parse_encrypted(&$p) + { + $struct = $p['structure']; + + // S/MIME + if ($struct->mimetype == 'application/pkcs7-mime') { + $this->parse_smime_encrypted($p); + } + // PGP/MIME: + // The multipart/encrypted MUST consist of exactly two parts. The first + // MIME body part must have a content type of "application/pgp-encrypted". + // This body contains the control information. + // The second MIME body part MUST contain the actual encrypted data. It + // must be labeled with a content type of "application/octet-stream". + else if ($struct->parts[0] && $struct->parts[0]->mimetype == 'application/pgp-encrypted' && + $struct->parts[1] && $struct->parts[1]->mimetype == 'application/octet-stream' + ) { + $this->parse_pgp_encrypted($p); + } + } + + /** + * Handler for plain signed message. + * Excludes message and signature bodies and verifies signature. + * + * @param array Reference to hook's parameters + */ + private function parse_plain_signed(&$p) + { + $this->load_pgp_driver(); + $part = $p['structure']; + + // Verify signature + if ($this->rc->action == 'show' || $this->rc->action == 'preview') { + $sig = $this->pgp_verify($part->body); + } + + // @TODO: Handle big bodies using (temp) files + + // In this way we can use fgets on string as on file handle + $fh = fopen('php://memory', 'br+'); + // @TODO: fopen/fwrite errors handling + if ($fh) { + fwrite($fh, $part->body); + rewind($fh); + } + $part->body = null; + + // Extract body (and signature?) + while (!feof($fh)) { + $line = fgets($fh, 1024); + + if ($part->body === null) + $part->body = ''; + else if (preg_match('/^-----BEGIN PGP SIGNATURE-----/', $line)) + break; + else + $part->body .= $line; + } + + // Remove "Hash" Armor Headers + $part->body = preg_replace('/^.*\r*\n\r*\n/', '', $part->body); + // de-Dash-Escape (RFC2440) + $part->body = preg_replace('/(^|\n)- -/', '\\1-', $part->body); + + // Store signature data for display + if (!empty($sig)) { + $this->signed_parts[$part->mime_id] = $part->mime_id; + $this->signatures[$part->mime_id] = $sig; + } + + fclose($fh); + } + + /** + * Handler for PGP/MIME signed message. + * Verifies signature. + * + * @param array Reference to hook's parameters + */ + private function parse_pgp_signed(&$p) + { + $this->load_pgp_driver(); + $struct = $p['structure']; + + // Verify signature + if ($this->rc->action == 'show' || $this->rc->action == 'preview') { + $msg_part = $struct->parts[0]; + $sig_part = $struct->parts[1]; + + // Get bodies + $this->set_part_body($msg_part, $p['object']->uid); + $this->set_part_body($sig_part, $p['object']->uid); + + // Verify + $sig = $this->pgp_verify($msg_part->body, $sig_part->body); + + // Store signature data for display + $this->signatures[$struct->mime_id] = $sig; + + // Message can be multipart (assign signature to each subpart) + if (!empty($msg_part->parts)) { + foreach ($msg_part->parts as $part) + $this->signed_parts[$part->mime_id] = $struct->mime_id; + } + else + $this->signed_parts[$msg_part->mime_id] = $struct->mime_id; + + // Remove signature file from attachments list + unset($struct->parts[1]); + } + } + + /** + * Handler for S/MIME signed message. + * Verifies signature. + * + * @param array Reference to hook's parameters + */ + private function parse_smime_signed(&$p) + { + $this->load_smime_driver(); + } + + /** + * Handler for plain encrypted message. + * + * @param array Reference to hook's parameters + */ + private function parse_plain_encrypted(&$p) + { + $this->load_pgp_driver(); + $part = $p['structure']; + + // Get body + $this->set_part_body($part, $p['object']->uid); + + // Decrypt + $result = $this->pgp_decrypt($part->body); + + // Store decryption status + $this->decryptions[$part->mime_id] = $result; + + // Parse decrypted message + if ($result === true) { + // @TODO + } + } + + /** + * Handler for PGP/MIME encrypted message. + * + * @param array Reference to hook's parameters + */ + private function parse_pgp_encrypted(&$p) + { + $this->load_pgp_driver(); + $struct = $p['structure']; + $part = $struct->parts[1]; + + // Get body + $this->set_part_body($part, $p['object']->uid); + + // Decrypt + $result = $this->pgp_decrypt($part->body); + + $this->decryptions[$part->mime_id] = $result; +//print_r($part); + // Parse decrypted message + if ($result === true) { + // @TODO + } + else { + // Make sure decryption status message will be displayed + $part->type = 'content'; + $p['object']->parts[] = $part; + } + } + + /** + * Handler for S/MIME encrypted message. + * + * @param array Reference to hook's parameters + */ + private function parse_smime_encrypted(&$p) + { + $this->load_smime_driver(); + } + + /** + * PGP signature verification. + * + * @param mixed Message body + * @param mixed Signature body (for MIME messages) + * + * @return mixed enigma_signature or enigma_error + */ + private function pgp_verify(&$msg_body, $sig_body=null) + { + // @TODO: Handle big bodies using (temp) files + // @TODO: caching of verification result + + $sig = $this->pgp_driver->verify($msg_body, $sig_body); + + if (($sig instanceof enigma_error) && $sig->getCode() != enigma_error::E_KEYNOTFOUND) + raise_error(array( + 'code' => 600, 'type' => 'php', + 'file' => __FILE__, 'line' => __LINE__, + 'message' => "Enigma plugin: " . $error->getMessage() + ), true, false); + +//print_r($sig); + return $sig; + } + + /** + * PGP message decryption. + * + * @param mixed Message body + * + * @return mixed True or enigma_error + */ + private function pgp_decrypt(&$msg_body) + { + // @TODO: Handle big bodies using (temp) files + // @TODO: caching of verification result + + $result = $this->pgp_driver->decrypt($msg_body, $key, $pass); + +//print_r($result); + + if ($result instanceof enigma_error) { + $err_code = $result->getCode(); + if (!in_array($err_code, array(enigma_error::E_KEYNOTFOUND, enigma_error::E_BADPASS))) + raise_error(array( + 'code' => 600, 'type' => 'php', + 'file' => __FILE__, 'line' => __LINE__, + 'message' => "Enigma plugin: " . $result->getMessage() + ), true, false); + return $result; + } + +// $msg_body = $result; + return true; + } + + /** + * PGP keys listing. + * + * @param mixed Key ID/Name pattern + * + * @return mixed Array of keys or enigma_error + */ + function list_keys($pattern='') + { + $this->load_pgp_driver(); + $result = $this->pgp_driver->list_keys($pattern); + + if ($result instanceof enigma_error) { + raise_error(array( + 'code' => 600, 'type' => 'php', + 'file' => __FILE__, 'line' => __LINE__, + 'message' => "Enigma plugin: " . $result->getMessage() + ), true, false); + } + + return $result; + } + + /** + * PGP key details. + * + * @param mixed Key ID + * + * @return mixed enigma_key or enigma_error + */ + function get_key($keyid) + { + $this->load_pgp_driver(); + $result = $this->pgp_driver->get_key($keyid); + + if ($result instanceof enigma_error) { + raise_error(array( + 'code' => 600, 'type' => 'php', + 'file' => __FILE__, 'line' => __LINE__, + 'message' => "Enigma plugin: " . $result->getMessage() + ), true, false); + } + + return $result; + } + + /** + * PGP keys/certs importing. + * + * @param mixed Import file name or content + * @param boolean True if first argument is a filename + * + * @return mixed Import status data array or enigma_error + */ + function import_key($content, $isfile=false) + { + $this->load_pgp_driver(); + $result = $this->pgp_driver->import($content, $isfile); + + if ($result instanceof enigma_error) { + raise_error(array( + 'code' => 600, 'type' => 'php', + 'file' => __FILE__, 'line' => __LINE__, + 'message' => "Enigma plugin: " . $result->getMessage() + ), true, false); + } + else { + $result['imported'] = $result['public_imported'] + $result['private_imported']; + $result['unchanged'] = $result['public_unchanged'] + $result['private_unchanged']; + } + + return $result; + } + + /** + * Handler for keys/certs import request action + */ + function import_file() + { + $uid = get_input_value('_uid', RCUBE_INPUT_POST); + $mbox = get_input_value('_mbox', RCUBE_INPUT_POST); + $mime_id = get_input_value('_part', RCUBE_INPUT_POST); + + if ($uid && $mime_id) { + $part = $this->rc->imap->get_message_part($uid, $mime_id); + } + + if ($part && is_array($result = $this->import_key($part))) { + $this->rc->output->show_message('enigma.keysimportsuccess', 'confirmation', + array('new' => $result['imported'], 'old' => $result['unchanged'])); + } + else + $this->rc->output->show_message('enigma.keysimportfailed', 'error'); + + $this->rc->output->send(); + } + + /** + * Checks if specified message part contains body data. + * If body is not set it will be fetched from IMAP server. + * + * @param rcube_message_part Message part object + * @param integer Message UID + */ + private function set_part_body($part, $uid) + { + // @TODO: Create such function in core + // @TODO: Handle big bodies using file handles + if (!isset($part->body)) { + $part->body = $this->rc->imap->get_message_part( + $uid, $part->mime_id, $part); + } + } + + /** + * Adds CSS style file to the page header. + */ + private function add_css() + { + $skin = $this->rc->config->get('skin'); + if (!file_exists($this->home . "/skins/$skin/enigma.css")) + $skin = 'default'; + + $this->include_stylesheet("skins/$skin/enigma.css"); + } +} diff --git a/plugins/enigma/lib/enigma_error.php b/plugins/enigma/lib/enigma_error.php new file mode 100644 index 000000000..9f424dc2b --- /dev/null +++ b/plugins/enigma/lib/enigma_error.php @@ -0,0 +1,62 @@ +<?php +/* + +-------------------------------------------------------------------------+ + | Error class for the Enigma Plugin | + | | + | This program is free software; you can redistribute it and/or modify | + | it under the terms of the GNU General Public License version 2 | + | as published by the Free Software Foundation. | + | | + | This program is distributed in the hope that it will be useful, | + | but WITHOUT ANY WARRANTY; without even the implied warranty of | + | MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the | + | GNU General Public License for more details. | + | | + | You should have received a copy of the GNU General Public License along | + | with this program; if not, write to the Free Software Foundation, Inc., | + | 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. | + | | + +-------------------------------------------------------------------------+ + | Author: Aleksander Machniak <alec@alec.pl> | + +-------------------------------------------------------------------------+ +*/ + +class enigma_error +{ + private $code; + private $message; + private $data = array(); + + // error codes + const E_OK = 0; + const E_INTERNAL = 1; + const E_NODATA = 2; + const E_KEYNOTFOUND = 3; + const E_DELKEY = 4; + const E_BADPASS = 5; + + function __construct($code = null, $message = '', $data = array()) + { + $this->code = $code; + $this->message = $message; + $this->data = $data; + } + + function getCode() + { + return $this->code; + } + + function getMessage() + { + return $this->message; + } + + function getData($name) + { + if ($name) + return $this->data[$name]; + else + return $this->data; + } +} diff --git a/plugins/enigma/lib/enigma_key.php b/plugins/enigma/lib/enigma_key.php new file mode 100644 index 000000000..520c36b0b --- /dev/null +++ b/plugins/enigma/lib/enigma_key.php @@ -0,0 +1,129 @@ +<?php +/* + +-------------------------------------------------------------------------+ + | Key class for the Enigma Plugin | + | | + | This program is free software; you can redistribute it and/or modify | + | it under the terms of the GNU General Public License version 2 | + | as published by the Free Software Foundation. | + | | + | This program is distributed in the hope that it will be useful, | + | but WITHOUT ANY WARRANTY; without even the implied warranty of | + | MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the | + | GNU General Public License for more details. | + | | + | You should have received a copy of the GNU General Public License along | + | with this program; if not, write to the Free Software Foundation, Inc., | + | 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. | + | | + +-------------------------------------------------------------------------+ + | Author: Aleksander Machniak <alec@alec.pl> | + +-------------------------------------------------------------------------+ +*/ + +class enigma_key +{ + public $id; + public $name; + public $users = array(); + public $subkeys = array(); + + const TYPE_UNKNOWN = 0; + const TYPE_KEYPAIR = 1; + const TYPE_PUBLIC = 2; + + /** + * Keys list sorting callback for usort() + */ + static function cmp($a, $b) + { + return strcmp($a->name, $b->name); + } + + /** + * Returns key type + */ + function get_type() + { + if ($this->subkeys[0]->has_private) + return enigma_key::TYPE_KEYPAIR; + else if (!empty($this->subkeys[0])) + return enigma_key::TYPE_PUBLIC; + + return enigma_key::TYPE_UNKNOWN; + } + + /** + * Returns true if all user IDs are revoked + */ + function is_revoked() + { + foreach ($this->subkeys as $subkey) + if (!$subkey->revoked) + return false; + + return true; + } + + /** + * Returns true if any user ID is valid + */ + function is_valid() + { + foreach ($this->users as $user) + if ($user->valid) + return true; + + return false; + } + + /** + * Returns true if any of subkeys is not expired + */ + function is_expired() + { + $now = time(); + + foreach ($this->subkeys as $subkey) + if (!$subkey->expires || $subkey->expires > $now) + return true; + + return false; + } + + /** + * Converts long ID or Fingerprint to short ID + * Crypt_GPG uses internal, but e.g. Thunderbird's Enigmail displays short ID + * + * @param string Key ID or fingerprint + * @return string Key short ID + */ + static function format_id($id) + { + // E.g. 04622F2089E037A5 => 89E037A5 + + return substr($id, -8); + } + + /** + * Formats fingerprint string + * + * @param string Key fingerprint + * + * @return string Formatted fingerprint (with spaces) + */ + static function format_fingerprint($fingerprint) + { + if (!$fingerprint) + return ''; + + $result = ''; + for ($i=0; $i<40; $i++) { + if ($i % 4 == 0) + $result .= ' '; + $result .= $fingerprint[$i]; + } + return $result; + } + +} diff --git a/plugins/enigma/lib/enigma_signature.php b/plugins/enigma/lib/enigma_signature.php new file mode 100644 index 000000000..65990903b --- /dev/null +++ b/plugins/enigma/lib/enigma_signature.php @@ -0,0 +1,34 @@ +<?php +/* + +-------------------------------------------------------------------------+ + | Signature class for the Enigma Plugin | + | | + | This program is free software; you can redistribute it and/or modify | + | it under the terms of the GNU General Public License version 2 | + | as published by the Free Software Foundation. | + | | + | This program is distributed in the hope that it will be useful, | + | but WITHOUT ANY WARRANTY; without even the implied warranty of | + | MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the | + | GNU General Public License for more details. | + | | + | You should have received a copy of the GNU General Public License along | + | with this program; if not, write to the Free Software Foundation, Inc., | + | 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. | + | | + +-------------------------------------------------------------------------+ + | Author: Aleksander Machniak <alec@alec.pl> | + +-------------------------------------------------------------------------+ +*/ + +class enigma_signature +{ + public $id; + public $valid; + public $fingerprint; + public $created; + public $expires; + public $name; + public $comment; + public $email; +} diff --git a/plugins/enigma/lib/enigma_subkey.php b/plugins/enigma/lib/enigma_subkey.php new file mode 100644 index 000000000..1b9fb95ad --- /dev/null +++ b/plugins/enigma/lib/enigma_subkey.php @@ -0,0 +1,57 @@ +<?php +/* + +-------------------------------------------------------------------------+ + | SubKey class for the Enigma Plugin | + | | + | This program is free software; you can redistribute it and/or modify | + | it under the terms of the GNU General Public License version 2 | + | as published by the Free Software Foundation. | + | | + | This program is distributed in the hope that it will be useful, | + | but WITHOUT ANY WARRANTY; without even the implied warranty of | + | MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the | + | GNU General Public License for more details. | + | | + | You should have received a copy of the GNU General Public License along | + | with this program; if not, write to the Free Software Foundation, Inc., | + | 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. | + | | + +-------------------------------------------------------------------------+ + | Author: Aleksander Machniak <alec@alec.pl> | + +-------------------------------------------------------------------------+ +*/ + +class enigma_subkey +{ + public $id; + public $fingerprint; + public $expires; + public $created; + public $revoked; + public $has_private; + public $can_sign; + public $can_encrypt; + + /** + * Converts internal ID to short ID + * Crypt_GPG uses internal, but e.g. Thunderbird's Enigmail displays short ID + * + * @return string Key ID + */ + function get_short_id() + { + // E.g. 04622F2089E037A5 => 89E037A5 + return enigma_key::format_id($this->id); + } + + /** + * Getter for formatted fingerprint + * + * @return string Formatted fingerprint + */ + function get_fingerprint() + { + return enigma_key::format_fingerprint($this->fingerprint); + } + +} diff --git a/plugins/enigma/lib/enigma_ui.php b/plugins/enigma/lib/enigma_ui.php new file mode 100644 index 000000000..b9ccff53d --- /dev/null +++ b/plugins/enigma/lib/enigma_ui.php @@ -0,0 +1,459 @@ +<?php +/* + +-------------------------------------------------------------------------+ + | User Interface for the Enigma Plugin | + | | + | This program is free software; you can redistribute it and/or modify | + | it under the terms of the GNU General Public License version 2 | + | as published by the Free Software Foundation. | + | | + | This program is distributed in the hope that it will be useful, | + | but WITHOUT ANY WARRANTY; without even the implied warranty of | + | MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the | + | GNU General Public License for more details. | + | | + | You should have received a copy of the GNU General Public License along | + | with this program; if not, write to the Free Software Foundation, Inc., | + | 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. | + | | + +-------------------------------------------------------------------------+ + | Author: Aleksander Machniak <alec@alec.pl> | + +-------------------------------------------------------------------------+ +*/ + +class enigma_ui +{ + private $rc; + private $enigma; + private $home; + private $css_added; + private $data; + + + function __construct($enigma_plugin, $home='') + { + $this->enigma = $enigma_plugin; + $this->rc = $enigma_plugin->rc; + // we cannot use $enigma_plugin->home here + $this->home = $home; + } + + /** + * UI initialization and requests handlers. + * + * @param string Preferences section + */ + function init($section='') + { + $this->enigma->include_script('enigma.js'); + + // Enigma actions + if ($this->rc->action == 'plugin.enigma') { + $action = get_input_value('_a', RCUBE_INPUT_GPC); + + switch ($action) { + case 'keyedit': + $this->key_edit(); + break; + case 'keyimport': + $this->key_import(); + break; + case 'keysearch': + case 'keylist': + $this->key_list(); + break; + case 'keyinfo': + default: + $this->key_info(); + } + } + // Message composing UI + else if ($this->rc->action == 'compose') { + $this->compose_ui(); + } + // Preferences UI + else { // if ($this->rc->action == 'edit-prefs') { + if ($section == 'enigmacerts') { + $this->rc->output->add_handlers(array( + 'keyslist' => array($this, 'tpl_certs_list'), + 'keyframe' => array($this, 'tpl_cert_frame'), + 'countdisplay' => array($this, 'tpl_certs_rowcount'), + 'searchform' => array($this->rc->output, 'search_form'), + )); + $this->rc->output->set_pagetitle($this->enigma->gettext('enigmacerts')); + $this->rc->output->send('enigma.certs'); + } + else { + $this->rc->output->add_handlers(array( + 'keyslist' => array($this, 'tpl_keys_list'), + 'keyframe' => array($this, 'tpl_key_frame'), + 'countdisplay' => array($this, 'tpl_keys_rowcount'), + 'searchform' => array($this->rc->output, 'search_form'), + )); + $this->rc->output->set_pagetitle($this->enigma->gettext('enigmakeys')); + $this->rc->output->send('enigma.keys'); + } + } + } + + /** + * Adds CSS style file to the page header. + */ + function add_css() + { + if ($this->css_loaded) + return; + + $skin = $this->rc->config->get('skin'); + if (!file_exists($this->home . "/skins/$skin/enigma.css")) + $skin = 'default'; + + $this->enigma->include_stylesheet("skins/$skin/enigma.css"); + $this->css_added = true; + } + + /** + * Template object for key info/edit frame. + * + * @param array Object attributes + * + * @return string HTML output + */ + function tpl_key_frame($attrib) + { + if (!$attrib['id']) { + $attrib['id'] = 'rcmkeysframe'; + } + + $attrib['name'] = $attrib['id']; + + $this->rc->output->set_env('contentframe', $attrib['name']); + $this->rc->output->set_env('blankpage', $attrib['src'] ? + $this->rc->output->abs_url($attrib['src']) : 'program/blank.gif'); + + return html::tag('iframe', $attrib); + } + + /** + * Template object for list of keys. + * + * @param array Object attributes + * + * @return string HTML content + */ + function tpl_keys_list($attrib) + { + // add id to message list table if not specified + if (!strlen($attrib['id'])) { + $attrib['id'] = 'rcmenigmakeyslist'; + } + + // define list of cols to be displayed + $a_show_cols = array('name'); + + // create XHTML table + $out = rcube_table_output($attrib, array(), $a_show_cols, 'id'); + + // set client env + $this->rc->output->add_gui_object('keyslist', $attrib['id']); + $this->rc->output->include_script('list.js'); + + // add some labels to client + $this->rc->output->add_label('enigma.keyconfirmdelete'); + + return $out; + } + + /** + * Key listing (and searching) request handler + */ + private function key_list() + { + $this->enigma->load_engine(); + + $pagesize = $this->rc->config->get('pagesize', 100); + $page = max(intval(get_input_value('_p', RCUBE_INPUT_GPC)), 1); + $search = get_input_value('_q', RCUBE_INPUT_GPC); + + // define list of cols to be displayed + $a_show_cols = array('name'); + $result = array(); + + // Get the list + $list = $this->enigma->engine->list_keys($search); + + if ($list && ($list instanceof enigma_error)) + $this->rc->output->show_message('enigma.keylisterror', 'error'); + else if (empty($list)) + $this->rc->output->show_message('enigma.nokeysfound', 'notice'); + else { + if (is_array($list)) { + // Save the size + $listsize = count($list); + + // Sort the list by key (user) name + usort($list, array('enigma_key', 'cmp')); + + // Slice current page + $list = array_slice($list, ($page - 1) * $pagesize, $pagesize); + + $size = count($list); + + // Add rows + foreach($list as $idx => $key) { + $this->rc->output->command('enigma_add_list_row', + array('name' => Q($key->name), 'id' => $key->id)); + } + } + } + + $this->rc->output->set_env('search_request', $search); + $this->rc->output->set_env('pagecount', ceil($listsize/$pagesize)); + $this->rc->output->set_env('current_page', $page); + $this->rc->output->command('set_rowcount', + $this->get_rowcount_text($listsize, $size, $page)); + + $this->rc->output->send(); + } + + /** + * Template object for list records counter. + * + * @param array Object attributes + * + * @return string HTML output + */ + function tpl_keys_rowcount($attrib) + { + if (!$attrib['id']) + $attrib['id'] = 'rcmcountdisplay'; + + $this->rc->output->add_gui_object('countdisplay', $attrib['id']); + + return html::span($attrib, $this->get_rowcount_text()); + } + + /** + * Returns text representation of list records counter + */ + private function get_rowcount_text($all=0, $curr_count=0, $page=1) + { + if (!$curr_count) + $out = $this->enigma->gettext('nokeysfound'); + else { + $pagesize = $this->rc->config->get('pagesize', 100); + $first = ($page - 1) * $pagesize; + + $out = $this->enigma->gettext(array( + 'name' => 'keysfromto', + 'vars' => array( + 'from' => $first + 1, + 'to' => $first + $curr_count, + 'count' => $all) + )); + } + + return $out; + } + + /** + * Key information page handler + */ + private function key_info() + { + $id = get_input_value('_id', RCUBE_INPUT_GET); + + $this->enigma->load_engine(); + $res = $this->enigma->engine->get_key($id); + + if ($res instanceof enigma_key) + $this->data = $res; + else { // error + $this->rc->output->show_message('enigma.keyopenerror', 'error'); + $this->rc->output->command('parent.enigma_loadframe'); + $this->rc->output->send('iframe'); + } + + $this->rc->output->add_handlers(array( + 'keyname' => array($this, 'tpl_key_name'), + 'keydata' => array($this, 'tpl_key_data'), + )); + + $this->rc->output->set_pagetitle($this->enigma->gettext('keyinfo')); + $this->rc->output->send('enigma.keyinfo'); + } + + /** + * Template object for key name + */ + function tpl_key_name($attrib) + { + return Q($this->data->name); + } + + /** + * Template object for key information page content + */ + function tpl_key_data($attrib) + { + $out = ''; + $table = new html_table(array('cols' => 2)); + + // Key user ID + $table->add('title', $this->enigma->gettext('keyuserid')); + $table->add(null, Q($this->data->name)); + // Key ID + $table->add('title', $this->enigma->gettext('keyid')); + $table->add(null, $this->data->subkeys[0]->get_short_id()); + // Key type + $keytype = $this->data->get_type(); + if ($keytype == enigma_key::TYPE_KEYPAIR) + $type = $this->enigma->gettext('typekeypair'); + else if ($keytype == enigma_key::TYPE_PUBLIC) + $type = $this->enigma->gettext('typepublickey'); + $table->add('title', $this->enigma->gettext('keytype')); + $table->add(null, $type); + // Key fingerprint + $table->add('title', $this->enigma->gettext('fingerprint')); + $table->add(null, $this->data->subkeys[0]->get_fingerprint()); + + $out .= html::tag('fieldset', null, + html::tag('legend', null, + $this->enigma->gettext('basicinfo')) . $table->show($attrib)); + + // Subkeys + $table = new html_table(array('cols' => 6)); + // Columns: Type, ID, Algorithm, Size, Created, Expires + + $out .= html::tag('fieldset', null, + html::tag('legend', null, + $this->enigma->gettext('subkeys')) . $table->show($attrib)); + + // Additional user IDs + $table = new html_table(array('cols' => 2)); + // Columns: User ID, Validity + + $out .= html::tag('fieldset', null, + html::tag('legend', null, + $this->enigma->gettext('userids')) . $table->show($attrib)); + + return $out; + } + + /** + * Key import page handler + */ + private function key_import() + { + // Import process + if ($_FILES['_file']['tmp_name'] && is_uploaded_file($_FILES['_file']['tmp_name'])) { + $this->enigma->load_engine(); + $result = $this->enigma->engine->import_key($_FILES['_file']['tmp_name'], true); + + if (is_array($result)) { + // reload list if any keys has been added + if ($result['imported']) { + $this->rc->output->command('parent.enigma_list', 1); + } + else + $this->rc->output->command('parent.enigma_loadframe'); + + $this->rc->output->show_message('enigma.keysimportsuccess', 'confirmation', + array('new' => $result['imported'], 'old' => $result['unchanged'])); + + $this->rc->output->send('iframe'); + } + else + $this->rc->output->show_message('enigma.keysimportfailed', 'error'); + } + else if ($err = $_FILES['_file']['error']) { + if ($err == UPLOAD_ERR_INI_SIZE || $err == UPLOAD_ERR_FORM_SIZE) { + $this->rc->output->show_message('filesizeerror', 'error', + array('size' => show_bytes(parse_bytes(ini_get('upload_max_filesize'))))); + } else { + $this->rc->output->show_message('fileuploaderror', 'error'); + } + } + + $this->rc->output->add_handlers(array( + 'importform' => array($this, 'tpl_key_import_form'), + )); + + $this->rc->output->set_pagetitle($this->enigma->gettext('keyimport')); + $this->rc->output->send('enigma.keyimport'); + } + + /** + * Template object for key import (upload) form + */ + function tpl_key_import_form($attrib) + { + $attrib += array('id' => 'rcmKeyImportForm'); + + $upload = new html_inputfield(array('type' => 'file', 'name' => '_file', + 'id' => 'rcmimportfile', 'size' => 30)); + + $form = html::p(null, + Q($this->enigma->gettext('keyimporttext'), 'show') + . html::br() . html::br() . $upload->show() + ); + + $this->rc->output->add_label('selectimportfile', 'importwait'); + $this->rc->output->add_gui_object('importform', $attrib['id']); + + $out = $this->rc->output->form_tag(array( + 'action' => $this->rc->url(array('action' => 'plugin.enigma', 'a' => 'keyimport')), + 'method' => 'post', + 'enctype' => 'multipart/form-data') + $attrib, + $form); + + return $out; + } + + private function compose_ui() + { + if (!is_array($_SESSION['compose']) || $_SESSION['compose']['id'] != get_input_value('_id', RCUBE_INPUT_GET)) + return; + + // Options menu button + // @TODO: make this work with non-default skins + $this->enigma->add_button(array( + 'name' => 'enigmamenu', + 'imagepas' => 'skins/default/enigma.png', + 'imageact' => 'skins/default/enigma.png', + 'onclick' => "rcmail_ui.show_popup('enigmamenu', true); return false", + 'title' => 'securityoptions', + 'domain' => 'enigma', + ), 'toolbar'); + + // Options menu contents + $this->enigma->add_hook('render_page', array($this, 'compose_menu')); + } + + function compose_menu($p) + { + $menu = new html_table(array('cols' => 2)); + $chbox = new html_checkbox(array('value' => 1)); + + $menu->add(null, html::label(array('for' => 'enigmadefaultopt'), + Q($this->enigma->gettext('identdefault')))); + $menu->add(null, $chbox->show(1, array('name' => '_enigma_default', 'id' => 'enigmadefaultopt'))); + + $menu->add(null, html::label(array('for' => 'enigmasignopt'), + Q($this->enigma->gettext('signmsg')))); + $menu->add(null, $chbox->show(1, array('name' => '_enigma_sign', 'id' => 'enigmasignopt'))); + + $menu->add(null, html::label(array('for' => 'enigmacryptopt'), + Q($this->enigma->gettext('encryptmsg')))); + $menu->add(null, $chbox->show(1, array('name' => '_enigma_crypt', 'id' => 'enigmacryptopt'))); + + $menu = html::div(array('id' => 'enigmamenu', 'class' => 'popupmenu'), + $menu->show()); + + $p['content'] = preg_replace('/(<form name="form"[^>]+>)/i', '\\1'."\n$menu", $p['content']); + + return $p; + + } + +} diff --git a/plugins/enigma/lib/enigma_userid.php b/plugins/enigma/lib/enigma_userid.php new file mode 100644 index 000000000..36185e718 --- /dev/null +++ b/plugins/enigma/lib/enigma_userid.php @@ -0,0 +1,31 @@ +<?php +/* + +-------------------------------------------------------------------------+ + | User ID class for the Enigma Plugin | + | | + | This program is free software; you can redistribute it and/or modify | + | it under the terms of the GNU General Public License version 2 | + | as published by the Free Software Foundation. | + | | + | This program is distributed in the hope that it will be useful, | + | but WITHOUT ANY WARRANTY; without even the implied warranty of | + | MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the | + | GNU General Public License for more details. | + | | + | You should have received a copy of the GNU General Public License along | + | with this program; if not, write to the Free Software Foundation, Inc., | + | 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. | + | | + +-------------------------------------------------------------------------+ + | Author: Aleksander Machniak <alec@alec.pl> | + +-------------------------------------------------------------------------+ +*/ + +class enigma_userid +{ + public $revoked; + public $valid; + public $name; + public $comment; + public $email; +} diff --git a/plugins/enigma/localization/en_US.inc b/plugins/enigma/localization/en_US.inc new file mode 100644 index 000000000..e0f03d9a0 --- /dev/null +++ b/plugins/enigma/localization/en_US.inc @@ -0,0 +1,53 @@ +<?php + +$labels = array(); +$labels['enigmasettings'] = 'Enigma: Settings'; +$labels['enigmacerts'] = 'Enigma: Certificates (S/MIME)'; +$labels['enigmakeys'] = 'Enigma: Keys (PGP)'; +$labels['keysfromto'] = 'Keys $from to $to of $count'; +$labels['keyname'] = 'Name'; +$labels['keyid'] = 'Key ID'; +$labels['keyuserid'] = 'User ID'; +$labels['keytype'] = 'Key type'; +$labels['fingerprint'] = 'Fingerprint'; +$labels['subkeys'] = 'Subkeys'; +$labels['basicinfo'] = 'Basic Information'; +$labels['userids'] = 'Additional User IDs'; +$labels['typepublickey'] = 'public key'; +$labels['typekeypair'] = 'key pair'; +$labels['keyattfound'] = 'This message contains attached PGP key(s).'; +$labels['keyattimport'] = 'Import key(s)'; + +$labels['createkeys'] = 'Create a new key pair'; +$labels['importkeys'] = 'Import key(s)'; +$labels['exportkeys'] = 'Export key(s)'; +$labels['deletekeys'] = 'Delete key(s)'; +$labels['keyactions'] = 'Key actions...'; +$labels['keydisable'] = 'Disable key'; +$labels['keyrevoke'] = 'Revoke key'; +$labels['keysend'] = 'Send public key in a message'; +$labels['keychpass'] = 'Change password'; + +$labels['securityoptions'] = 'Message security options...'; +$labels['identdefault'] = 'Use settings of selected identity'; +$labels['encryptmsg'] = 'Encrypt this message'; +$labels['signmsg'] = 'Digitally sign this message'; + +$messages = array(); +$messages['sigvalid'] = 'Verified signature from $sender.'; +$messages['siginvalid'] = 'Invalid signature from $sender.'; +$messages['signokey'] = 'Unverified signature. Public key not found. Key ID: $keyid.'; +$messages['sigerror'] = 'Unverified signature. Internal error.'; +$messages['decryptok'] = 'Message decrypted.'; +$messages['decrypterror'] = 'Decryption failed.'; +$messages['decryptnokey'] = 'Decryption failed. Private key not found. Key ID: $keyid.'; +$messages['decryptbadpass'] = 'Decryption failed. Bad password.'; +$messages['nokeysfound'] = 'No keys found'; +$messages['keyopenerror'] = 'Unable to get key information! Internal error.'; +$messages['keylisterror'] = 'Unable to list keys! Internal error.'; +$messages['keysimportfailed'] = 'Unable to import key(s)! Internal error.'; +$messages['keysimportsuccess'] = 'Key(s) imported successfully. Imported: $new, unchanged: $old.'; +$messages['keyconfirmdelete'] = 'Are you sure, you want to delete selected key(s)?'; +$messages['keyimporttext'] = 'You can import private and public key(s) or revocation signatures in ASCII-Armor format.'; + +?> diff --git a/plugins/enigma/localization/ja_JP.inc b/plugins/enigma/localization/ja_JP.inc new file mode 100644 index 000000000..882014440 --- /dev/null +++ b/plugins/enigma/localization/ja_JP.inc @@ -0,0 +1,55 @@ +<?php + +// EN-Revision: 4203 + +$labels = array(); +$labels['enigmasettings'] = 'Enigma: 設定'; +$labels['enigmacerts'] = 'Enigma: 証明書 (S/MIME)'; +$labels['enigmakeys'] = 'Enigma: 鍵 (PGP)'; +$labels['keysfromto'] = '鍵の一覧 $from ～ $to (合計: $count )'; +$labels['keyname'] = '名前'; +$labels['keyid'] = '鍵 ID'; +$labels['keyuserid'] = 'ユーザー ID'; +$labels['keytype'] = '鍵の種類'; +$labels['fingerprint'] = '指紋'; +$labels['subkeys'] = 'Subkeys'; +$labels['basicinfo'] = '基本情報'; +$labels['userids'] = '追加のユーザー ID'; +$labels['typepublickey'] = '公開鍵'; +$labels['typekeypair'] = '鍵のペア'; +$labels['keyattfound'] = 'このメールは PGP 鍵の添付があります。'; +$labels['keyattimport'] = '鍵のインポート'; + +$labels['createkeys'] = '新しい鍵のペアを作成する'; +$labels['importkeys'] = '鍵のインポート'; +$labels['exportkeys'] = '鍵のエクスポート'; +$labels['deletekeys'] = '鍵の削除'; +$labels['keyactions'] = '鍵の操作...'; +$labels['keydisable'] = '鍵を無効にする'; +$labels['keyrevoke'] = '鍵を取り消す'; +$labels['keysend'] = 'メッセージに公開鍵を含んで送信する'; +$labels['keychpass'] = 'パスワードの変更'; + +$labels['securityoptions'] = 'メールのセキュリティ オプション...'; +$labels['identdefault'] = '選択した識別子の設定を使う'; +$labels['encryptmsg'] = 'このメールの暗号化'; +$labels['signmsg'] = 'このメールのデジタル署名'; + +$messages = array(); +$messages['sigvalid'] = '$sender からの署名を検証しました。'; +$messages['siginvalid'] = '$sender からの署名が正しくありません。'; +$messages['signokey'] = '署名は未検証です。公開鍵が見つかりません。鍵 ID: $keyid'; +$messages['sigerror'] = '署名は未検証です。内部エラーです。'; +$messages['decryptok'] = 'メールを復号しました。'; +$messages['decrypterror'] = '復号に失敗しました。'; +$messages['decryptnokey'] = '復号に失敗しました。秘密鍵が見つかりません。鍵 ID: $keyid.'; +$messages['decryptbadpass'] = '復号に失敗しました。パスワードが正しくありません。'; +$messages['nokeysfound'] = '鍵が見つかりません。'; +$messages['keyopenerror'] = '鍵情報の取得に失敗しました! 内部エラーです。'; +$messages['keylisterror'] = '鍵情報のリストに失敗しました! 内部エラーです。'; +$messages['keysimportfailed'] = '鍵のインポートに失敗しました! 内部エラーです。'; +$messages['keysimportsuccess'] = '鍵をインポートしました。インポート: $new, 未変更: $old'; +$messages['keyconfirmdelete'] = '選択した鍵を本当に削除しますか?'; +$messages['keyimporttext'] = '秘密鍵と公開鍵のインポート、または ASCII 形式の署名を無効にできます。'; + +?> diff --git a/plugins/enigma/localization/ru_RU.inc b/plugins/enigma/localization/ru_RU.inc new file mode 100644 index 000000000..3033d002c --- /dev/null +++ b/plugins/enigma/localization/ru_RU.inc @@ -0,0 +1,65 @@ +<?php +/* + ++-----------------------------------------------------------------------+ +| plugins/enigma/localization/ru_RU.inc | +| | +| Russian translation for roundcube/enigma plugin | +| Copyright (C) 2010 | +| Licensed under the GNU GPL | +| | ++-----------------------------------------------------------------------+ +| Author: Sergey Dukachev <iam@dukess.ru> | +| Updates: | ++-----------------------------------------------------------------------+ + +@version 2010-12-23 + +*/ + +$labels = array(); +$labels['enigmasettings'] = 'Enigma: Настройки'; +$labels['enigmacerts'] = 'Enigma: Сертификаты (S/MIME)'; +$labels['enigmakeys'] = 'Enigma: Ключи (PGP)'; +$labels['keysfromto'] = 'Ключи от $from к $to в количестве $count'; +$labels['keyname'] = 'Имя'; +$labels['keyid'] = 'Идентификатор ключа'; +$labels['keyuserid'] = 'Идентификатор пользователя'; +$labels['keytype'] = 'Тип ключа'; +$labels['fingerprint'] = 'Отпечаток (хэш) ключа'; +$labels['subkeys'] = 'Подразделы'; +$labels['basicinfo'] = 'Основные сведения'; +$labels['userids'] = 'Дополнительные идентификаторы пользователя'; +$labels['typepublickey'] = 'Открытый ключ'; +$labels['typekeypair'] = 'пара ключей'; +$labels['keyattfound'] = 'Это сообщение содержит один или несколько ключей PGP.'; +$labels['keyattimport'] = 'Импортировать ключи'; + +$labels['createkeys'] = 'Создать новую пару ключей'; +$labels['importkeys'] = 'Импортировать ключ(и)'; +$labels['exportkeys'] = 'Экспортировать ключ(и)'; +$labels['deletekeys'] = 'Удалить ключ(и)'; +$labels['keyactions'] = 'Действия с ключами...'; +$labels['keydisable'] = 'Отключить ключ'; +$labels['keyrevoke'] = 'Отозвать ключ'; +$labels['keysend'] = 'Отправить публичный ключ в собщении'; +$labels['keychpass'] = 'Изменить пароль'; + +$messages = array(); +$messages['sigvalid'] = 'Проверенная подпись у $sender.'; +$messages['siginvalid'] = 'Неверная подпись у $sender.'; +$messages['signokey'] = 'Непроверяемая подпись. Открытый ключ не найден. Идентификатор ключа: $keyid.'; +$messages['sigerror'] = 'Непроверяемая подпись. Внутренняя ошибка.'; +$messages['decryptok'] = 'Сообщение расшифровано.'; +$messages['decrypterror'] = 'Расшифровка не удалась.'; +$messages['decryptnokey'] = 'Расшифровка не удалась. Секретный ключ не найден. Идентификатор ключа: $keyid.'; +$messages['decryptbadpass'] = 'Расшифровка не удалась. Неправильный пароль.'; +$messages['nokeysfound'] = 'Ключи не найдены'; +$messages['keyopenerror'] = 'Невозможно получить информацию о ключе! Внутренняя ошибка.'; +$messages['keylisterror'] = 'Невозможно сделать список ключей! Внутренняя ошибка.'; +$messages['keysimportfailed'] = 'Невозможно импортировать ключ(и)! Внутренняя ошибка.'; +$messages['keysimportsuccess'] = 'Ключи успешно импортированы. Импортировано: $new, без изменений: $old.'; +$messages['keyconfirmdelete'] = 'Вы точно хотите удалить выбранные ключи?'; +$messages['keyimporttext'] = 'Вы можете импортировать открытые и секретные ключи или сообщения об отзыве ключей в формате ASCII-Armor.'; + +?> diff --git a/plugins/enigma/skins/default/enigma.css b/plugins/enigma/skins/default/enigma.css new file mode 100644 index 000000000..b1c656f82 --- /dev/null +++ b/plugins/enigma/skins/default/enigma.css @@ -0,0 +1,182 @@ +/*** Style for Enigma plugin ***/ + +/***** Messages displaying *****/ + +#enigma-message, +/* fixes border-top */ +#messagebody div #enigma-message +{ + margin: 0; + margin-bottom: 5px; + min-height: 20px; + padding: 10px 10px 6px 46px; +} + +div.enigmaerror, +/* fixes border-top */ +#messagebody div.enigmaerror +{ + background: url(enigma_error.png) 6px 1px no-repeat; + background-color: #EF9398; + border: 1px solid #DC5757; +} + +div.enigmanotice, +/* fixes border-top */ +#messagebody div.enigmanotice +{ + background: url(enigma.png) 6px 1px no-repeat; + background-color: #A6EF7B; + border: 1px solid #76C83F; +} + +div.enigmawarning, +/* fixes border-top */ +#messagebody div.enigmawarning +{ + background: url(enigma.png) 6px 1px no-repeat; + background-color: #F7FDCB; + border: 1px solid #C2D071; +} + +#enigma-message a +{ + color: #666666; + padding-left: 10px; +} + +#enigma-message a:hover +{ + color: #333333; +} + +/***** Keys/Certs Management *****/ + +div.enigmascreen +{ + position: absolute; + top: 65px; + right: 10px; + bottom: 10px; + left: 10px; +} + +#enigmacontent-box +{ + position: absolute; + top: 0px; + left: 290px; + right: 0px; + bottom: 0px; + border: 1px solid #999999; + overflow: hidden; +} + +#enigmakeyslist +{ + position: absolute; + top: 0; + bottom: 0; + left: 0; + border: 1px solid #999999; + background-color: #F9F9F9; + overflow: hidden; +} + +#keylistcountbar +{ + margin-top: 4px; + margin-left: 4px; +} + +#keys-table +{ + width: 100%; + table-layout: fixed; +} + +#keys-table td +{ + cursor: default; + text-overflow: ellipsis; + -o-text-overflow: ellipsis; +} + +#key-details table td.title +{ + font-weight: bold; + text-align: right; +} + +#keystoolbar +{ + position: absolute; + top: 30px; + left: 10px; + height: 35px; +} + +#keystoolbar a +{ + padding-right: 10px; +} + +#keystoolbar a.button, +#keystoolbar a.buttonPas, +#keystoolbar span.separator { + display: block; + float: left; + width: 32px; + height: 32px; + padding: 0; + margin-right: 10px; + overflow: hidden; + background: url(keys_toolbar.png) 0 0 no-repeat transparent; + opacity: 0.99; /* this is needed to make buttons appear correctly in Chrome */ +} + +#keystoolbar a.buttonPas { + opacity: 0.35; +} + +#keystoolbar a.createSel { + background-position: 0 -32px; +} + +#keystoolbar a.create { + background-position: 0 0; +} + +#keystoolbar a.deleteSel { + background-position: -32px -32px; +} + +#keystoolbar a.delete { + background-position: -32px 0; +} + +#keystoolbar a.importSel { + background-position: -64px -32px; +} + +#keystoolbar a.import { + background-position: -64px 0; +} + +#keystoolbar a.exportSel { + background-position: -96px -32px; +} + +#keystoolbar a.export { + background-position: -96px 0; +} + +#keystoolbar a.keymenu { + background-position: -128px 0; + width: 36px; +} + +#keystoolbar span.separator { + width: 5px; + background-position: -166px 0; +} diff --git a/plugins/enigma/skins/default/enigma.png b/plugins/enigma/skins/default/enigma.png Binary files differnew file mode 100644 index 000000000..3ef106e2a --- /dev/null +++ b/plugins/enigma/skins/default/enigma.png diff --git a/plugins/enigma/skins/default/enigma_error.png b/plugins/enigma/skins/default/enigma_error.png Binary files differnew file mode 100644 index 000000000..9bf100efd --- /dev/null +++ b/plugins/enigma/skins/default/enigma_error.png diff --git a/plugins/enigma/skins/default/key.png b/plugins/enigma/skins/default/key.png Binary files differnew file mode 100644 index 000000000..ea1cbd11c --- /dev/null +++ b/plugins/enigma/skins/default/key.png diff --git a/plugins/enigma/skins/default/key_add.png b/plugins/enigma/skins/default/key_add.png Binary files differnew file mode 100644 index 000000000..f22cc870a --- /dev/null +++ b/plugins/enigma/skins/default/key_add.png diff --git a/plugins/enigma/skins/default/keys_toolbar.png b/plugins/enigma/skins/default/keys_toolbar.png Binary files differnew file mode 100644 index 000000000..7cc258cc8 --- /dev/null +++ b/plugins/enigma/skins/default/keys_toolbar.png diff --git a/plugins/enigma/skins/default/templates/keyimport.html b/plugins/enigma/skins/default/templates/keyimport.html new file mode 100644 index 000000000..4e0b304a5 --- /dev/null +++ b/plugins/enigma/skins/default/templates/keyimport.html @@ -0,0 +1,20 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<title><roundcube:object name="pagetitle" /></title> +<roundcube:include file="/includes/links.html" /> +<link rel="stylesheet" type="text/css" href="/this/enigma.css" /> +</head> +<body class="iframe"> + +<div id="keyimport-title" class="boxtitle"><roundcube:label name="enigma.importkeys" /></div> + +<div id="import-form" class="boxcontent"> + <roundcube:object name="importform" /> + <p> + <br /><roundcube:button command="plugin.enigma-import" type="input" class="button mainaction" label="import" /> + </p> +</div> + +</body> +</html> diff --git a/plugins/enigma/skins/default/templates/keyinfo.html b/plugins/enigma/skins/default/templates/keyinfo.html new file mode 100644 index 000000000..2e8ed61db --- /dev/null +++ b/plugins/enigma/skins/default/templates/keyinfo.html @@ -0,0 +1,17 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<title><roundcube:object name="pagetitle" /></title> +<roundcube:include file="/includes/links.html" /> +<link rel="stylesheet" type="text/css" href="/this/enigma.css" /> +</head> +<body class="iframe"> + +<div id="keyinfo-title" class="boxtitle"><roundcube:object name="keyname" part="name" /></div> + +<div id="key-details" class="boxcontent"> + <roundcube:object name="keydata" /> +</div> + +</body> +</html> diff --git a/plugins/enigma/skins/default/templates/keys.html b/plugins/enigma/skins/default/templates/keys.html new file mode 100644 index 000000000..810c4a211 --- /dev/null +++ b/plugins/enigma/skins/default/templates/keys.html @@ -0,0 +1,76 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<title><roundcube:object name="pagetitle" /></title> +<roundcube:include file="/includes/links.html" /> +<link rel="stylesheet" type="text/css" href="/this/enigma.css" /> +<script type="text/javascript" src="/functions.js"></script> +<script type="text/javascript" src="/splitter.js"></script> +<style type="text/css"> +#enigmakeyslist { width: <roundcube:exp expression="!empty(cookie:enigmaviewsplitter) ? cookie:enigmaviewsplitter-5 : 210" />px; } +#enigmacontent-box { left: <roundcube:exp expression="!empty(cookie:enigmaviewsplitter) ? cookie:enigmaviewsplitter+5 : 220" />px; +<roundcube:exp expression="browser:ie ? ('width:expression((parseInt(this.parentNode.offsetWidth)-'.(!empty(cookie:enigmaeviewsplitter) ? cookie:enigmaviewsplitter+5 : 220).')+\\'px\\');') : ''" /> +} +</style> +</head> +<body class="iframe" onload="rcube_init_mail_ui()"> + +<div id="prefs-title" class="boxtitle"><roundcube:label name="enigma.enigmakeys" /></div> +<div id="prefs-details" class="boxcontent"> + +<div id="keystoolbar"> + <roundcube:button command="plugin.enigma-key-create" type="link" class="buttonPas create" classAct="button create" classSel="button createSel" title="enigma.createkeys" content=" " /> + <roundcube:button command="plugin.enigma-key-delete" type="link" class="buttonPas delete" classAct="button delete" classSel="button deleteSel" title="enigma.deletekeys" content=" " /> + <span class="separator"> </span> + <roundcube:button command="plugin.enigma-key-import" type="link" class="buttonPas import" classAct="button import" classSel="button importSel" title="enigma.importkeys" content=" " /> + <roundcube:button command="plugin.enigma-key-export" type="link" class="buttonPas export" classAct="button export" classSel="button exportSel" title="enigma.exportkeys" content=" " /> + <roundcube:button name="messagemenulink" id="messagemenulink" type="link" class="button keymenu" title="enigma.keyactions" onclick="rcmail_ui.show_popup('messagemenu');return false" content=" " /> +</div> + +<div id="quicksearchbar" style="top: 35px; right: 10px;"> + <roundcube:button name="searchmenulink" id="searchmenulink" image="/images/icons/glass.png" /> + <roundcube:object name="searchform" id="quicksearchbox" /> + <roundcube:button command="reset-search" id="searchreset" image="/images/icons/reset.gif" title="resetsearch" /> +</div> + +<div class="enigmascreen"> + +<div id="enigmakeyslist"> +<div class="boxtitle"><roundcube:label name="enigma.keyname" /></div> +<div class="boxlistcontent"> + <roundcube:object name="keyslist" id="keys-table" class="records-table" cellspacing="0" noheader="true" /> +</div> +<div class="boxfooter"> +<div id="keylistcountbar" class="pagenav"> + <roundcube:button command="firstpage" type="link" class="buttonPas firstpage" classAct="button firstpage" classSel="button firstpageSel" title="firstpage" content=" " /> + <roundcube:button command="previouspage" type="link" class="buttonPas prevpage" classAct="button prevpage" classSel="button prevpageSel" title="previouspage" content=" " /> + <roundcube:object name="countdisplay" style="padding:0 .5em; float:left" /> + <roundcube:button command="nextpage" type="link" class="buttonPas nextpage" classAct="button nextpage" classSel="button nextpageSel" title="nextpage" content=" " /> + <roundcube:button command="lastpage" type="link" class="buttonPas lastpage" classAct="button lastpage" classSel="button lastpageSel" title="lastpage" content=" " /> +</div> +</div> +</div> + +<script type="text/javascript"> + var enigmaviewsplit = new rcube_splitter({id:'enigmaviewsplitter', p1: 'enigmakeyslist', p2: 'enigmacontent-box', orientation: 'v', relative: true, start: 215}); + rcmail.add_onload('enigmaviewsplit.init()'); +</script> + +<div id="enigmacontent-box"> + <roundcube:object name="keyframe" id="keyframe" width="100%" height="100%" frameborder="0" src="/watermark.html" /> +</div> + +</div> +</div> + +<div id="messagemenu" class="popupmenu"> + <ul class="toolbarmenu"> + <li><roundcube:button class="disablelink" command="enigma.key-disable" label="enigma.keydisable" target="_blank" classAct="disablelink active" /></li> + <li><roundcube:button class="revokelink" command="enigma.key-revoke" label="enigma.keyrevoke" classAct="revokelink active" /></li> + <li class="separator_below"><roundcube:button class="sendlink" command="enigma.key-send" label="enigma.keysend" classAct="sendlink active" /></li> + <li><roundcube:button class="chpasslink" command="enigma.key-chpass" label="enigma.keychpass" classAct="chpasslink active" /></li> + </ul> +</div> + +</body> +</html> diff --git a/plugins/example_addressbook/example_addressbook.php b/plugins/example_addressbook/example_addressbook.php new file mode 100644 index 000000000..a15461f44 --- /dev/null +++ b/plugins/example_addressbook/example_addressbook.php @@ -0,0 +1,50 @@ +<?php + +require_once(dirname(__FILE__) . '/example_addressbook_backend.php'); + +/** + * Sample plugin to add a new address book + * with just a static list of contacts + */ +class example_addressbook extends rcube_plugin +{ + private $abook_id = 'static'; + private $abook_name = 'Static List'; + + public function init() + { + $this->add_hook('addressbooks_list', array($this, 'address_sources')); + $this->add_hook('addressbook_get', array($this, 'get_address_book')); + + // use this address book for autocompletion queries + // (maybe this should be configurable by the user?) + $config = rcmail::get_instance()->config; + $sources = (array) $config->get('autocomplete_addressbooks', array('sql')); + if (!in_array($this->abook_id, $sources)) { + $sources[] = $this->abook_id; + $config->set('autocomplete_addressbooks', $sources); + } + } + + public function address_sources($p) + { + $abook = new example_addressbook_backend($this->abook_name); + $p['sources'][$this->abook_id] = array( + 'id' => $this->abook_id, + 'name' => $this->abook_name, + 'readonly' => $abook->readonly, + 'groups' => $abook->groups, + ); + return $p; + } + + public function get_address_book($p) + { + if ($p['id'] === $this->abook_id) { + $p['instance'] = new example_addressbook_backend($this->abook_name); + } + + return $p; + } + +} diff --git a/plugins/example_addressbook/example_addressbook_backend.php b/plugins/example_addressbook/example_addressbook_backend.php new file mode 100644 index 000000000..8c143c25f --- /dev/null +++ b/plugins/example_addressbook/example_addressbook_backend.php @@ -0,0 +1,116 @@ +<?php + +/** + * Example backend class for a custom address book + * + * This one just holds a static list of address records + * + * @author Thomas Bruederli + */ +class example_addressbook_backend extends rcube_addressbook +{ + public $primary_key = 'ID'; + public $readonly = true; + public $groups = true; + + private $filter; + private $result; + private $name; + + public function __construct($name) + { + $this->ready = true; + $this->name = $name; + } + + public function get_name() + { + return $this->name; + } + + public function set_search_set($filter) + { + $this->filter = $filter; + } + + public function get_search_set() + { + return $this->filter; + } + + public function reset() + { + $this->result = null; + $this->filter = null; + } + + function list_groups($search = null) + { + return array( + array('ID' => 'testgroup1', 'name' => "Testgroup"), + array('ID' => 'testgroup2', 'name' => "Sample Group"), + ); + } + + public function list_records($cols=null, $subset=0) + { + $this->result = $this->count(); + $this->result->add(array('ID' => '111', 'name' => "Example Contact", 'firstname' => "Example", 'surname' => "Contact", 'email' => "example@roundcube.net")); + + return $this->result; + } + + public function search($fields, $value, $strict=false, $select=true, $nocount=false, $required=array()) + { + // no search implemented, just list all records + return $this->list_records(); + } + + public function count() + { + return new rcube_result_set(1, ($this->list_page-1) * $this->page_size); + } + + public function get_result() + { + return $this->result; + } + + public function get_record($id, $assoc=false) + { + $this->list_records(); + $first = $this->result->first(); + $sql_arr = $first['ID'] == $id ? $first : null; + + return $assoc && $sql_arr ? $sql_arr : $this->result; + } + + + function create_group($name) + { + $result = false; + + return $result; + } + + function delete_group($gid) + { + return false; + } + + function rename_group($gid, $newname) + { + return $newname; + } + + function add_to_group($group_id, $ids) + { + return false; + } + + function remove_from_group($group_id, $ids) + { + return false; + } + +} diff --git a/plugins/filesystem_attachments/filesystem_attachments.php b/plugins/filesystem_attachments/filesystem_attachments.php new file mode 100644 index 000000000..12c78d973 --- /dev/null +++ b/plugins/filesystem_attachments/filesystem_attachments.php @@ -0,0 +1,161 @@ +<?php +/** + * Filesystem Attachments + * + * This is a core plugin which provides basic, filesystem based + * attachment temporary file handling. This includes storing + * attachments of messages currently being composed, writing attachments + * to disk when drafts with attachments are re-opened and writing + * attachments to disk for inline display in current html compositions. + * + * Developers may wish to extend this class when creating attachment + * handler plugins: + * require_once('plugins/filesystem_attachments/filesystem_attachments.php'); + * class myCustom_attachments extends filesystem_attachments + * + * @author Ziba Scott <ziba@umich.edu> + * @author Thomas Bruederli <roundcube@gmail.com> + * + */ +class filesystem_attachments extends rcube_plugin +{ + public $task = '?(?!login).*'; + + function init() + { + // Save a newly uploaded attachment + $this->add_hook('attachment_upload', array($this, 'upload')); + + // Save an attachment from a non-upload source (draft or forward) + $this->add_hook('attachment_save', array($this, 'save')); + + // Remove an attachment from storage + $this->add_hook('attachment_delete', array($this, 'remove')); + + // When composing an html message, image attachments may be shown + $this->add_hook('attachment_display', array($this, 'display')); + + // Get the attachment from storage and place it on disk to be sent + $this->add_hook('attachment_get', array($this, 'get')); + + // Delete all temp files associated with this user + $this->add_hook('attachments_cleanup', array($this, 'cleanup')); + $this->add_hook('session_destroy', array($this, 'cleanup')); + } + + /** + * Save a newly uploaded attachment + */ + function upload($args) + { + $args['status'] = false; + $group = $args['group']; + $rcmail = rcmail::get_instance(); + + // use common temp dir for file uploads + $temp_dir = $rcmail->config->get('temp_dir'); + $tmpfname = tempnam($temp_dir, 'rcmAttmnt'); + + if (move_uploaded_file($args['path'], $tmpfname) && file_exists($tmpfname)) { + $args['id'] = $this->file_id(); + $args['path'] = $tmpfname; + $args['status'] = true; + + // Note the file for later cleanup + $_SESSION['plugins']['filesystem_attachments'][$group][] = $tmpfname; + } + + return $args; + } + + /** + * Save an attachment from a non-upload source (draft or forward) + */ + function save($args) + { + $group = $args['group']; + $args['status'] = false; + + if (!$args['path']) { + $rcmail = rcmail::get_instance(); + $temp_dir = $rcmail->config->get('temp_dir'); + $tmp_path = tempnam($temp_dir, 'rcmAttmnt'); + + if ($fp = fopen($tmp_path, 'w')) { + fwrite($fp, $args['data']); + fclose($fp); + $args['path'] = $tmp_path; + } else + return $args; + } + + $args['id'] = $this->file_id(); + $args['status'] = true; + + // Note the file for later cleanup + $_SESSION['plugins']['filesystem_attachments'][$group][] = $args['path']; + + return $args; + } + + /** + * Remove an attachment from storage + * This is triggered by the remove attachment button on the compose screen + */ + function remove($args) + { + $args['status'] = @unlink($args['path']); + return $args; + } + + /** + * When composing an html message, image attachments may be shown + * For this plugin, the file is already in place, just check for + * the existance of the proper metadata + */ + function display($args) + { + $args['status'] = file_exists($args['path']); + return $args; + } + + /** + * This attachment plugin doesn't require any steps to put the file + * on disk for use. This stub function is kept here to make this + * class handy as a parent class for other plugins which may need it. + */ + function get($args) + { + return $args; + } + + /** + * Delete all temp files associated with this user + */ + function cleanup($args) + { + // $_SESSION['compose']['attachments'] is not a complete record of + // temporary files because loading a draft or starting a forward copies + // the file to disk, but does not make an entry in that array + if (is_array($_SESSION['plugins']['filesystem_attachments'])){ + foreach ($_SESSION['plugins']['filesystem_attachments'] as $group => $files) { + if ($args['group'] && $args['group'] != $group) + continue; + foreach ((array)$files as $filename){ + if(file_exists($filename)){ + unlink($filename); + } + } + unset($_SESSION['plugins']['filesystem_attachments'][$group]); + } + } + return $args; + } + + function file_id() + { + $userid = rcmail::get_instance()->user->ID; + list($usec, $sec) = explode(' ', microtime()); + return preg_replace('/[^0-9]/', '', $userid . $sec . $usec); + } +} diff --git a/plugins/help/config.inc.php.dist b/plugins/help/config.inc.php.dist new file mode 100644 index 000000000..d440dbbcc --- /dev/null +++ b/plugins/help/config.inc.php.dist @@ -0,0 +1,5 @@ +<?php + +// Help content iframe source +// $rcmail_config['help_source'] = 'http://trac.roundcube.net/wiki'; +$rcmail_config['help_source'] = ''; diff --git a/plugins/help/content/about.html b/plugins/help/content/about.html new file mode 100644 index 000000000..c5bc2f477 --- /dev/null +++ b/plugins/help/content/about.html @@ -0,0 +1,39 @@ +<div id="helpabout"> +<h3 align="center">Copyright © 2005-2010, The Roundcube Dev Team</h3> + +<p>This program is free software; you can redistribute it and/or modify +it under the terms of the GNU General Public License version 2 +as published by the Free Software Foundation. +</p> +<p> +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. +</p> +<p> +You should have received a copy of the GNU General Public License along +with this program; if not, write to the Free Software Foundation, Inc., +51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. +</p> + +<div align="center"> +<h3>Project management and administration</h3> +<b>Thomas Bruederli (thomasb)</b> - Project leader and head developer<br /> +<b>Till Klampäckel (till)</b> - Co-leader<br /> +<b>Brett Patterson</b> - Forum administrator<br /> +<b>Adam Grelck</b> - Trac administrator<br /> +<b>Jason Fesler</b> - Mailing list administrator<br /> +<b>Brennan Stehling</b> - Mentor, Coordinator + +<h3>Developers</h3> +<b>Eric Stadtherr (estadtherr)</b><br /> +<b>Robin Elfrink (robin, wobin)</b><br /> +<b>Rich Sandberg (richs)</b><br /> +<b>Tomasz Pajor (tomekp)</b><br /> +<b>Fourat Zouari (fourat.zouari)</b><br /> +<b>Aleksander Machniak (alec)</b> + +<p><br/>Website: <a href="http://roundcube.net">roundcube.net</a></p> +</div> +</div> diff --git a/plugins/help/content/license.html b/plugins/help/content/license.html new file mode 100644 index 000000000..2d83c6013 --- /dev/null +++ b/plugins/help/content/license.html @@ -0,0 +1,387 @@ +<div id="helplicense"> +<h3>GNU GENERAL PUBLIC LICENSE</h3> +<p> +Version 2, June 1991 +</p> + +<pre> +Copyright (C) 1989, 1991 Free Software Foundation, Inc. +51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA + +Everyone is permitted to copy and distribute verbatim copies +of this license document, but changing it is not allowed. +</pre> + +<h3>Preamble</h3> + +<p> +The licenses for most software are designed to take away your +freedom to share and change it. By contrast, the GNU General Public +License is intended to guarantee your freedom to share and change free +software--to make sure the software is free for all its users. This +General Public License applies to most of the Free Software +Foundation's software and to any other program whose authors commit to +using it. (Some other Free Software Foundation software is covered by +the GNU Lesser General Public License instead.) You can apply it to +your programs, too. +</p> + +<p> +When we speak of free software, we are referring to freedom, not +price. Our General Public Licenses are designed to make sure that you +have the freedom to distribute copies of free software (and charge for +this service if you wish), that you receive source code or can get it +if you want it, that you can change the software or use pieces of it +in new free programs; and that you know you can do these things. +</p> + +<p> +To protect your rights, we need to make restrictions that forbid +anyone to deny you these rights or to ask you to surrender the rights. +These restrictions translate to certain responsibilities for you if you +distribute copies of the software, or if you modify it. +</p> + +<p> +For example, if you distribute copies of such a program, whether +gratis or for a fee, you must give the recipients all the rights that +you have. You must make sure that they, too, receive or can get the +source code. And you must show them these terms so they know their +rights. +</p> + +<p> +We protect your rights with two steps: (1) copyright the software, and +(2) offer you this license which gives you legal permission to copy, +distribute and/or modify the software. +</p> + +<p> +Also, for each author's protection and ours, we want to make certain +that everyone understands that there is no warranty for this free +software. If the software is modified by someone else and passed on, we +want its recipients to know that what they have is not the original, so +that any problems introduced by others will not reflect on the original +authors' reputations. +</p> + +<p> +Finally, any free program is threatened constantly by software +patents. We wish to avoid the danger that redistributors of a free +program will individually obtain patent licenses, in effect making the +program proprietary. To prevent this, we have made it clear that any +patent must be licensed for everyone's free use or not licensed at all. +</p> + +<p> + The precise terms and conditions for copying, distribution and +modification follow. +</p> + + +<h3>TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION</h3> + + +<p> +<strong>0.</strong> +This License applies to any program or other work which contains +a notice placed by the copyright holder saying it may be distributed +under the terms of this General Public License. The "Program", below, +refers to any such program or work, and a "work based on the Program" +means either the Program or any derivative work under copyright law: +that is to say, a work containing the Program or a portion of it, +either verbatim or with modifications and/or translated into another +language. (Hereinafter, translation is included without limitation in +the term "modification".) Each licensee is addressed as "you". +</p> + +<p> +Activities other than copying, distribution and modification are not +covered by this License; they are outside its scope. The act of +running the Program is not restricted, and the output from the Program +is covered only if its contents constitute a work based on the +Program (independent of having been made by running the Program). +Whether that is true depends on what the Program does. +</p> + +<p> +<strong>1.</strong> +You may copy and distribute verbatim copies of the Program's +source code as you receive it, in any medium, provided that you +conspicuously and appropriately publish on each copy an appropriate +copyright notice and disclaimer of warranty; keep intact all the +notices that refer to this License and to the absence of any warranty; +and give any other recipients of the Program a copy of this License +along with the Program. +</p> + +<p> +You may charge a fee for the physical act of transferring a copy, and +you may at your option offer warranty protection in exchange for a fee. +</p> + +<p> +<strong>2.</strong> +You may modify your copy or copies of the Program or any portion +of it, thus forming a work based on the Program, and copy and +distribute such modifications or work under the terms of Section 1 +above, provided that you also meet all of these conditions: +</p> + +<dl> + <dt></dt> + <dd> + <strong>a)</strong> + You must cause the modified files to carry prominent notices + stating that you changed the files and the date of any change. + </dd> + <dt></dt> + <dd> + <strong>b)</strong> + You must cause any work that you distribute or publish, that in + whole or in part contains or is derived from the Program or any + part thereof, to be licensed as a whole at no charge to all third + parties under the terms of this License. + </dd> + <dt></dt> + <dd> + <strong>c)</strong> + If the modified program normally reads commands interactively + when run, you must cause it, when started running for such + interactive use in the most ordinary way, to print or display an + announcement including an appropriate copyright notice and a + notice that there is no warranty (or else, saying that you provide + a warranty) and that users may redistribute the program under + these conditions, and telling the user how to view a copy of this + License. (Exception: if the Program itself is interactive but + does not normally print such an announcement, your work based on + the Program is not required to print an announcement.) + </dd> +</dl> + +<p> +These requirements apply to the modified work as a whole. If +identifiable sections of that work are not derived from the Program, +and can be reasonably considered independent and separate works in +themselves, then this License, and its terms, do not apply to those +sections when you distribute them as separate works. But when you +distribute the same sections as part of a whole which is a work based +on the Program, the distribution of the whole must be on the terms of +this License, whose permissions for other licensees extend to the +entire whole, and thus to each and every part regardless of who wrote it. +</p> + +<p> +Thus, it is not the intent of this section to claim rights or contest +your rights to work written entirely by you; rather, the intent is to +exercise the right to control the distribution of derivative or +collective works based on the Program. +</p> + +<p> +In addition, mere aggregation of another work not based on the Program +with the Program (or with a work based on the Program) on a volume of +a storage or distribution medium does not bring the other work under +the scope of this License. +</p> + +<p> +<strong>3.</strong> +You may copy and distribute the Program (or a work based on it, +under Section 2) in object code or executable form under the terms of +Sections 1 and 2 above provided that you also do one of the following: +</p> + +<dl> + <dt></dt> + <dd> + <strong>a)</strong> + Accompany it with the complete corresponding machine-readable + source code, which must be distributed under the terms of Sections + 1 and 2 above on a medium customarily used for software interchange; or, + </dd> + <dt></dt> + <dd> + <strong>b)</strong> + Accompany it with a written offer, valid for at least three + years, to give any third party, for a charge no more than your + cost of physically performing source distribution, a complete + machine-readable copy of the corresponding source code, to be + distributed under the terms of Sections 1 and 2 above on a medium + customarily used for software interchange; or, + </dd> + <dt></dt> + <dd> + <strong>c)</strong> + Accompany it with the information you received as to the offer + to distribute corresponding source code. (This alternative is + allowed only for noncommercial distribution and only if you + received the program in object code or executable form with such + an offer, in accord with Subsection b above.) + </dd> +</dl> + +<p> +The source code for a work means the preferred form of the work for +making modifications to it. For an executable work, complete source +code means all the source code for all modules it contains, plus any +associated interface definition files, plus the scripts used to +control compilation and installation of the executable. However, as a +special exception, the source code distributed need not include +anything that is normally distributed (in either source or binary +form) with the major components (compiler, kernel, and so on) of the +operating system on which the executable runs, unless that component +itself accompanies the executable. +</p> + +<p> +If distribution of executable or object code is made by offering +access to copy from a designated place, then offering equivalent +access to copy the source code from the same place counts as +distribution of the source code, even though third parties are not +compelled to copy the source along with the object code. +</p> + +<p> +<strong>4.</strong> +You may not copy, modify, sublicense, or distribute the Program +except as expressly provided under this License. Any attempt +otherwise to copy, modify, sublicense or distribute the Program is +void, and will automatically terminate your rights under this License. +However, parties who have received copies, or rights, from you under +this License will not have their licenses terminated so long as such +parties remain in full compliance. +</p> + +<p> +<strong>5.</strong> +You are not required to accept this License, since you have not +signed it. However, nothing else grants you permission to modify or +distribute the Program or its derivative works. These actions are +prohibited by law if you do not accept this License. Therefore, by +modifying or distributing the Program (or any work based on the +Program), you indicate your acceptance of this License to do so, and +all its terms and conditions for copying, distributing or modifying +the Program or works based on it. +</p> + +<p> +<strong>6.</strong> +Each time you redistribute the Program (or any work based on the +Program), the recipient automatically receives a license from the +original licensor to copy, distribute or modify the Program subject to +these terms and conditions. You may not impose any further +restrictions on the recipients' exercise of the rights granted herein. +You are not responsible for enforcing compliance by third parties to +this License. +</p> + +<p> +<strong>7.</strong> +If, as a consequence of a court judgment or allegation of patent +infringement or for any other reason (not limited to patent issues), +conditions are imposed on you (whether by court order, agreement or +otherwise) that contradict the conditions of this License, they do not +excuse you from the conditions of this License. If you cannot +distribute so as to satisfy simultaneously your obligations under this +License and any other pertinent obligations, then as a consequence you +may not distribute the Program at all. For example, if a patent +license would not permit royalty-free redistribution of the Program by +all those who receive copies directly or indirectly through you, then +the only way you could satisfy both it and this License would be to +refrain entirely from distribution of the Program. +</p> + +<p> +If any portion of this section is held invalid or unenforceable under +any particular circumstance, the balance of the section is intended to +apply and the section as a whole is intended to apply in other +circumstances. +</p> + +<p> +It is not the purpose of this section to induce you to infringe any +patents or other property right claims or to contest validity of any +such claims; this section has the sole purpose of protecting the +integrity of the free software distribution system, which is +implemented by public license practices. Many people have made +generous contributions to the wide range of software distributed +through that system in reliance on consistent application of that +system; it is up to the author/donor to decide if he or she is willing +to distribute software through any other system and a licensee cannot +impose that choice. +</p> + +<p> +This section is intended to make thoroughly clear what is believed to +be a consequence of the rest of this License. +</p> + +<p> +<strong>8.</strong> +If the distribution and/or use of the Program is restricted in +certain countries either by patents or by copyrighted interfaces, the +original copyright holder who places the Program under this License +may add an explicit geographical distribution limitation excluding +those countries, so that distribution is permitted only in or among +countries not thus excluded. In such case, this License incorporates +the limitation as if written in the body of this License. +</p> + +<p> +<strong>9.</strong> +The Free Software Foundation may publish revised and/or new versions +of the General Public License from time to time. Such new versions will +be similar in spirit to the present version, but may differ in detail to +address new problems or concerns. +</p> + +<p> +Each version is given a distinguishing version number. If the Program +specifies a version number of this License which applies to it and "any +later version", you have the option of following the terms and conditions +either of that version or of any later version published by the Free +Software Foundation. If the Program does not specify a version number of +this License, you may choose any version ever published by the Free Software +Foundation. +</p> + +<p> +<strong>10.</strong> +If you wish to incorporate parts of the Program into other free +programs whose distribution conditions are different, write to the author +to ask for permission. For software which is copyrighted by the Free +Software Foundation, write to the Free Software Foundation; we sometimes +make exceptions for this. Our decision will be guided by the two goals +of preserving the free status of all derivatives of our free software and +of promoting the sharing and reuse of software generally. +</p> + +<p><strong>NO WARRANTY</strong></p> + +<p> +<strong>11.</strong> +BECAUSE THE PROGRAM IS LICENSED FREE OF CHARGE, THERE IS NO WARRANTY +FOR THE PROGRAM, TO THE EXTENT PERMITTED BY APPLICABLE LAW. EXCEPT WHEN +OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR OTHER PARTIES +PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY OF ANY KIND, EITHER EXPRESSED +OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE. THE ENTIRE RISK AS +TO THE QUALITY AND PERFORMANCE OF THE PROGRAM IS WITH YOU. SHOULD THE +PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF ALL NECESSARY SERVICING, +REPAIR OR CORRECTION. +</p> + +<p> +<strong>12.</strong> +IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING +WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY AND/OR +REDISTRIBUTE THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES, +INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING +OUT OF THE USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED +TO LOSS OF DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY +YOU OR THIRD PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER +PROGRAMS), EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE +POSSIBILITY OF SUCH DAMAGES. +</p> +</div> diff --git a/plugins/help/help.php b/plugins/help/help.php new file mode 100644 index 000000000..ccf80820b --- /dev/null +++ b/plugins/help/help.php @@ -0,0 +1,107 @@ +<?php + +/** + * Help Plugin + * + * @author Aleksander 'A.L.E.C' Machniak + * @licence GNU GPL + * + * Configuration (see config.inc.php.dist) + * + **/ + +class help extends rcube_plugin +{ + // all task excluding 'login' and 'logout' + public $task = '?(?!login|logout).*'; + // we've got no ajax handlers + public $noajax = true; + // skip frames + public $noframe = true; + + function init() + { + $rcmail = rcmail::get_instance(); + + $this->add_texts('localization/', false); + + // register task + $this->register_task('help'); + + // register actions + $this->register_action('index', array($this, 'action')); + $this->register_action('about', array($this, 'action')); + $this->register_action('license', array($this, 'action')); + + // add taskbar button + $this->add_button(array( + 'name' => 'helptask', + 'class' => 'button-help', + 'label' => 'help.help', + 'href' => './?_task=help', + 'onclick' => sprintf("return %s.command('help')", JS_OBJECT_NAME) + ), 'taskbar'); + + $rcmail->output->add_script( + JS_OBJECT_NAME . ".enable_command('help', true);\n" . + JS_OBJECT_NAME . ".help = function () { location.href = './?_task=help'; }", + 'head'); + + $skin = $rcmail->config->get('skin'); + if (!file_exists($this->home."/skins/$skin/help.css")) + $skin = 'default'; + + // add style for taskbar button (must be here) and Help UI + $this->include_stylesheet("skins/$skin/help.css"); + } + + function action() + { + $rcmail = rcmail::get_instance(); + + $this->load_config(); + + // register UI objects + $rcmail->output->add_handlers(array( + 'helpcontent' => array($this, 'content'), + )); + + if ($rcmail->action == 'about') + $rcmail->output->set_pagetitle($this->gettext('about')); + else if ($rcmail->action == 'license') + $rcmail->output->set_pagetitle($this->gettext('license')); + else + $rcmail->output->set_pagetitle($this->gettext('help')); + + $rcmail->output->send('help.help'); + } + + function content($attrib) + { + $rcmail = rcmail::get_instance(); + + if ($rcmail->action == 'about') { + return @file_get_contents($this->home.'/content/about.html'); + } + else if ($rcmail->action == 'license') { + return @file_get_contents($this->home.'/content/license.html'); + } + + // default content: iframe + + if ($src = $rcmail->config->get('help_source')) + $attrib['src'] = $src; + + if (empty($attrib['id'])) + $attrib['id'] = 'rcmailhelpcontent'; + + // allow the following attributes to be added to the <iframe> tag + $attrib_str = create_attrib_string($attrib, array( + 'id', 'class', 'style', 'src', 'width', 'height', 'frameborder')); + + $out = sprintf('<iframe name="%s"%s></iframe>'."\n", $attrib['id'], $attrib_str); + + return $out; + } + +} diff --git a/plugins/help/localization/cs_CZ.inc b/plugins/help/localization/cs_CZ.inc new file mode 100644 index 000000000..ae8b39a06 --- /dev/null +++ b/plugins/help/localization/cs_CZ.inc @@ -0,0 +1,25 @@ +<?php + +/* + ++-----------------------------------------------------------------------+ +| language/cs_CZ/labels.inc | +| | +| Language file of the Roundcube help plugin | +| Copyright (C) 2005-2009, The Roundcube Dev Team | +| Licensed under the GNU GPL | +| | ++-----------------------------------------------------------------------+ +| Author: Milan Kozak <hodza@hodza.net> | ++-----------------------------------------------------------------------+ + +@version $Id: labels.inc 2993 2009-09-26 18:32:07Z alec $ + +*/ + +$labels = array(); +$labels['help'] = 'Nápověda'; +$labels['about'] = 'O aplikaci'; +$labels['license'] = 'Licence'; + +?> diff --git a/plugins/help/localization/da_DK.inc b/plugins/help/localization/da_DK.inc new file mode 100644 index 000000000..753301220 --- /dev/null +++ b/plugins/help/localization/da_DK.inc @@ -0,0 +1,8 @@ +<?php + +$labels = array(); +$labels['help'] = 'Hjælp'; +$labels['about'] = 'Om'; +$labels['license'] = 'Licens'; + +?> diff --git a/plugins/help/localization/de_DE.inc b/plugins/help/localization/de_DE.inc new file mode 100644 index 000000000..55d75e21c --- /dev/null +++ b/plugins/help/localization/de_DE.inc @@ -0,0 +1,8 @@ +<?php +// translation done by Ulli Heist - http://heist.hobby-site.org/ +$labels = array(); +$labels['help'] = 'Hilfe'; +$labels['about'] = 'Über'; +$labels['license'] = 'Lizenz'; + +?> diff --git a/plugins/help/localization/en_GB.inc b/plugins/help/localization/en_GB.inc new file mode 100644 index 000000000..8c2d1517c --- /dev/null +++ b/plugins/help/localization/en_GB.inc @@ -0,0 +1,8 @@ +<?php + +$labels = array(); +$labels['help'] = 'Help'; +$labels['about'] = 'About'; +$labels['license'] = 'License'; + +?> diff --git a/plugins/help/localization/en_US.inc b/plugins/help/localization/en_US.inc new file mode 100644 index 000000000..8c2d1517c --- /dev/null +++ b/plugins/help/localization/en_US.inc @@ -0,0 +1,8 @@ +<?php + +$labels = array(); +$labels['help'] = 'Help'; +$labels['about'] = 'About'; +$labels['license'] = 'License'; + +?> diff --git a/plugins/help/localization/es_ES.inc b/plugins/help/localization/es_ES.inc new file mode 100644 index 000000000..1d921859a --- /dev/null +++ b/plugins/help/localization/es_ES.inc @@ -0,0 +1,8 @@ +<?php + +$labels = array(); +$labels['help'] = 'Ayuda'; +$labels['about'] = 'Acerca de'; +$labels['license'] = 'Licencia'; + +?> diff --git a/plugins/help/localization/et_EE.inc b/plugins/help/localization/et_EE.inc new file mode 100644 index 000000000..f95f09824 --- /dev/null +++ b/plugins/help/localization/et_EE.inc @@ -0,0 +1,8 @@ +<?php + +$labels = array(); +$labels['help'] = 'Abi'; +$labels['about'] = 'Roundcube info'; +$labels['license'] = 'Litsents'; + +?> diff --git a/plugins/help/localization/gl_ES.inc b/plugins/help/localization/gl_ES.inc new file mode 100644 index 000000000..2895dad30 --- /dev/null +++ b/plugins/help/localization/gl_ES.inc @@ -0,0 +1,8 @@ +<?php + +$labels = array(); +$labels['help'] = 'Axuda'; +$labels['about'] = 'Acerca de'; +$labels['license'] = 'Licencia'; + +?> diff --git a/plugins/help/localization/hu_HU.inc b/plugins/help/localization/hu_HU.inc new file mode 100644 index 000000000..6ff4f248e --- /dev/null +++ b/plugins/help/localization/hu_HU.inc @@ -0,0 +1,8 @@ +<?php + +$labels = array(); +$labels['help'] = 'Segítség'; +$labels['about'] = 'Névjegy'; +$labels['license'] = 'Licenc'; + +?> diff --git a/plugins/help/localization/ja_JP.inc b/plugins/help/localization/ja_JP.inc new file mode 100644 index 000000000..18081bb7d --- /dev/null +++ b/plugins/help/localization/ja_JP.inc @@ -0,0 +1,10 @@ +<?php + +// EN-Revision: 3891 + +$labels = array(); +$labels['help'] = 'ヘルプ'; +$labels['about'] = '紹介'; +$labels['license'] = 'ライセンス'; + +?> diff --git a/plugins/help/localization/pl_PL.inc b/plugins/help/localization/pl_PL.inc new file mode 100644 index 000000000..087bc0726 --- /dev/null +++ b/plugins/help/localization/pl_PL.inc @@ -0,0 +1,8 @@ +<?php + +$labels = array(); +$labels['help'] = 'Pomoc'; +$labels['about'] = 'O programie'; +$labels['license'] = 'Licencja'; + +?> diff --git a/plugins/help/localization/pt_BR.inc b/plugins/help/localization/pt_BR.inc new file mode 100644 index 000000000..f557ad267 --- /dev/null +++ b/plugins/help/localization/pt_BR.inc @@ -0,0 +1,8 @@ +<?php + +$labels = array(); +$labels['help'] = 'Ajuda'; +$labels['about'] = 'Sobre'; +$labels['license'] = 'Licença'; + +?> diff --git a/plugins/help/localization/ru_RU.inc b/plugins/help/localization/ru_RU.inc new file mode 100644 index 000000000..9f1de410c --- /dev/null +++ b/plugins/help/localization/ru_RU.inc @@ -0,0 +1,23 @@ +<?php + +/* + ++-----------------------------------------------------------------------+ +| plugins/help/localization/ru_RU.inc | +| | +| Language file of the Roundcube help plugin | +| Copyright (C) 2005-2010, The Roundcube Dev Team | +| Licensed under the GNU GPL | +| | ++-----------------------------------------------------------------------+ +| Author: Sergey Dukachev <iam@dukess.ru> | ++-----------------------------------------------------------------------+ + +*/ + +$labels = array(); +$labels['help'] = 'Помощь'; +$labels['about'] = 'О программе'; +$labels['license'] = 'Лицензия'; + +?> diff --git a/plugins/help/localization/sv_SE.inc b/plugins/help/localization/sv_SE.inc new file mode 100644 index 000000000..8b0d48741 --- /dev/null +++ b/plugins/help/localization/sv_SE.inc @@ -0,0 +1,8 @@ +<?php + +$labels = array(); +$labels['help'] = 'Hjälp'; +$labels['about'] = 'Om'; +$labels['license'] = 'Licens'; + +?> diff --git a/plugins/help/localization/zh_TW.inc b/plugins/help/localization/zh_TW.inc new file mode 100644 index 000000000..603283761 --- /dev/null +++ b/plugins/help/localization/zh_TW.inc @@ -0,0 +1,8 @@ +<?php + +$labels = array(); +$labels['help'] = '說明'; +$labels['about'] = '關於'; +$labels['license'] = '許可證'; + +?> diff --git a/plugins/help/skins/default/help.css b/plugins/help/skins/default/help.css new file mode 100644 index 000000000..8f67f111e --- /dev/null +++ b/plugins/help/skins/default/help.css @@ -0,0 +1,29 @@ +/***** Roundcube|Mail Help task styles *****/ + +#taskbar a.button-help +{ + background-image: url('help.gif'); +} + +.help-box +{ + overflow: auto; + background-color: #F2F2F2; +} + +#helplicense, #helpabout +{ + width: 46em; + padding: 1em 2em; +} + +#helplicense a, #helpabout a +{ + color: #900; +} + +#helpabout +{ + margin: 0 auto; +} + diff --git a/plugins/help/skins/default/help.gif b/plugins/help/skins/default/help.gif Binary files differnew file mode 100644 index 000000000..fe41e43c0 --- /dev/null +++ b/plugins/help/skins/default/help.gif diff --git a/plugins/help/skins/default/templates/help.html b/plugins/help/skins/default/templates/help.html new file mode 100644 index 000000000..98beb6655 --- /dev/null +++ b/plugins/help/skins/default/templates/help.html @@ -0,0 +1,37 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<title><roundcube:object name="pagetitle" /></title> +<roundcube:include file="/includes/links.html" /> +<link rel="stylesheet" type="text/css" href="/this/help.css" /> +<link rel="stylesheet" type="text/css" href="/settings.css" /> +<script type="text/javascript"> +function help_init_settings_tabs() +{ + var action, tab = '#helptabdefault'; + if (window.rcmail && (action = rcmail.env.action)) { + tab = '#helptab' + (action ? action : 'default'); + } + $(tab).addClass('tablink-selected'); +} +</script> +</head> +<body> + +<roundcube:include file="/includes/taskbar.html" /> +<roundcube:include file="/includes/header.html" /> + +<div id="tabsbar"> +<span id="helptabdefault" class="tablink"><roundcube:button name="helpdefault" href="?_task=help" type="link" label="help.help" title="help.help" /></span> +<span id="helptababout" class="tablink"><roundcube:button name="helpabout" href="?_task=help&_action=about" type="link" label="help.about" title="help.about" class="tablink" /></span> +<span id="helptablicense" class="tablink"><roundcube:button name="helplicense" href="?_task=help&_action=license" type="link" label="help.license" title="help.license" class="tablink" /></span> +<roundcube:container name="helptabs" id="helptabsbar" /> +<script type="text/javascript"> if (window.rcmail) rcmail.add_onload(help_init_settings_tabs);</script> +</div> + +<div id="mainscreen" class="box help-box"> +<roundcube:object name="helpcontent" id="helpcontentframe" width="100%" height="100%" frameborder="0" src="/watermark.html" /> +</div> + +</body> +</html> diff --git a/plugins/http_authentication/http_authentication.php b/plugins/http_authentication/http_authentication.php new file mode 100644 index 000000000..be49b52be --- /dev/null +++ b/plugins/http_authentication/http_authentication.php @@ -0,0 +1,66 @@ +<?php + +/** + * HTTP Basic Authentication + * + * Make use of an existing HTTP authentication and perform login with the existing user credentials + * + * Configuration: + * // redirect the client to this URL after logout. This page is then responsible to clear HTTP auth + * $rcmail_config['logout_url'] = 'http://server.tld/logout.html'; + * + * See logout.html (in this directory) for an example how HTTP auth can be cleared. + * + * @version 1.4 + * @author Thomas Bruederli + */ +class http_authentication extends rcube_plugin +{ + public $task = 'login|logout'; + + function init() + { + $this->add_hook('startup', array($this, 'startup')); + $this->add_hook('authenticate', array($this, 'authenticate')); + $this->add_hook('logout_after', array($this, 'logout')); + } + + function startup($args) + { + // change action to login + if (empty($args['action']) && empty($_SESSION['user_id']) + && !empty($_SERVER['PHP_AUTH_USER']) && !empty($_SERVER['PHP_AUTH_PW'])) + $args['action'] = 'login'; + + return $args; + } + + function authenticate($args) + { + // Allow entering other user data in login form, + // e.g. after log out (#1487953) + if (!empty($args['user'])) { + return $args; + } + + if (!empty($_SERVER['PHP_AUTH_USER']) && !empty($_SERVER['PHP_AUTH_PW'])) { + $args['user'] = $_SERVER['PHP_AUTH_USER']; + $args['pass'] = $_SERVER['PHP_AUTH_PW']; + } + + $args['cookiecheck'] = false; + $args['valid'] = true; + + return $args; + } + + function logout($args) + { + // redirect to configured URL in order to clear HTTP auth credentials + if (!empty($_SERVER['PHP_AUTH_USER']) && $args['user'] == $_SERVER['PHP_AUTH_USER'] && ($url = rcmail::get_instance()->config->get('logout_url'))) { + header("Location: $url", true, 307); + } + } + +} + diff --git a/plugins/http_authentication/logout.html b/plugins/http_authentication/logout.html new file mode 100644 index 000000000..0a78a62f2 --- /dev/null +++ b/plugins/http_authentication/logout.html @@ -0,0 +1,29 @@ +<!DOCTYPE html> +<html> +<head> +<meta http-equiv="Content-Type" content="text/html; charset=utf-8"> +<title>Logout</title> +<script type="text/javascript" src="https://ajax.googleapis.com/ajax/libs/jquery/1.6/jquery.min.js"></script> +<script type="text/javascript"> + +// as seen on http://stackoverflow.com/questions/31326/is-there-a-browser-equivalent-to-ies-clearauthenticationcache +$(document).ready(function(){ + if (document.all && document.execCommand) { + document.execCommand("ClearAuthenticationCache", "false"); + } + else { + $.ajax({ + url: location.href, + type: 'POST', + username: '__LOGOUT__', + password: '***********' + }); + } +}); + +</script> +</head> +<body> +<h1>You've successully been logged out!</h1> + +</body>
\ No newline at end of file diff --git a/plugins/jqueryui/README b/plugins/jqueryui/README new file mode 100644 index 000000000..10f8dad75 --- /dev/null +++ b/plugins/jqueryui/README @@ -0,0 +1,29 @@ ++-------------------------------------------------------------------------+ +| +| Author: Cor Bosman (roundcube@wa.ter.net) +| Plugin: jqueryui +| Version: 1.8.14 +| Purpose: Add jquery-ui to roundcube for every plugin to use +| ++-------------------------------------------------------------------------+ + +jqueryui adds the complete jquery-ui library including the smoothness +theme to roundcube. This allows other plugins to use jquery-ui without +having to load their own version. The benefit of using 1 central jquery-ui +is that we wont run into problems of conflicting jquery libraries being +loaded. All plugins that want to use jquery-ui should use this plugin as +a requirement. + +It is possible for plugin authors to override the default smoothness theme. +To do this, go to the jquery-ui website, and use the download feature to +download your own theme. In the advanced settings, provide a scope class to +your theme and add that class to all your UI elements. Finally, load the +downloaded css files in your own plugin. + +Some jquery-ui modules provide localization. One example is the datepicker module. +If you want to load localization for a specific module, then set up config.inc.php. +Check the config.inc.php.dist file on how to set this up for the datepicker module. + +As of version 1.8.6 this plugin also supports other themes. If you're a theme +developer and would like a different default theme to be used for your RC theme +then let me know and we can set things up. diff --git a/plugins/jqueryui/config.inc.php.dist b/plugins/jqueryui/config.inc.php.dist new file mode 100644 index 000000000..8526e6a79 --- /dev/null +++ b/plugins/jqueryui/config.inc.php.dist @@ -0,0 +1,11 @@ +<?php + +// if you want to load localization strings for specific sub-libraries of jquery-ui, configure them here +$rcmail_config['jquery_ui_i18n'] = array('datepicker'); + +// map Roundcube skins with jquery-ui themes here +$rcmail_config['jquery_ui_skin_map'] = array( + 'groupvice4' => 'redmond', +); + +?> diff --git a/plugins/jqueryui/jqueryui.php b/plugins/jqueryui/jqueryui.php new file mode 100644 index 000000000..7ed201873 --- /dev/null +++ b/plugins/jqueryui/jqueryui.php @@ -0,0 +1,54 @@ +<?php + +/** + * jQuery UI + * + * Provide the jQuery UI library with according themes. + * + * @version 1.8.14 + * @author Cor Bosman <roundcube@wa.ter.net> + * @author Thomas Bruederli <roundcube@gmail.com> + */ +class jqueryui extends rcube_plugin +{ + public $noajax = true; + + public function init() + { + $version = '1.8.14'; + + $rcmail = rcmail::get_instance(); + $this->load_config(); + + // include UI scripts + $this->include_script("js/jquery-ui-$version.custom.min.js"); + + // include UI stylesheet + $skin = $rcmail->config->get('skin', 'default'); + $ui_map = $rcmail->config->get('jquery_ui_skin_map', array()); + $ui_theme = $ui_map[$skin] ? $ui_map[$skin] : 'default'; + + if (file_exists($this->home . "/themes/$ui_theme/jquery-ui-$version.custom.css")) { + $this->include_stylesheet("themes/$ui_theme/jquery-ui-$version.custom.css"); + } + else { + $this->include_stylesheet("themes/default/jquery-ui-$version.custom.css"); + } + + // jquery UI localization + $jquery_ui_i18n = $rcmail->config->get('jquery_ui_i18n', array()); + if (count($jquery_ui_i18n) > 0) { + $lang_l = str_replace('_', '-', substr($_SESSION['language'], 0, 5)); + $lang_s = substr($_SESSION['language'], 0, 2); + foreach($jquery_ui_i18n as $package) { + if (file_exists($this->home . "/js/i18n/jquery.ui.$package-$lang_l.js")) { + $this->include_script("js/i18n/jquery.ui.$package-$lang_l.js"); + } + else if (file_exists($this->home . "/js/i18n/jquery.ui.$package-$lang_s.js")) { + $this->include_script("js/i18n/jquery.ui.$package-$lang_s.js"); + } + } + } + } + +} diff --git a/plugins/jqueryui/js/i18n/jquery-ui-i18n.js b/plugins/jqueryui/js/i18n/jquery-ui-i18n.js new file mode 100644 index 000000000..1e5977ef6 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery-ui-i18n.js @@ -0,0 +1,1242 @@ +/* Afrikaans initialisation for the jQuery UI date picker plugin. */ +/* Written by Renier Pretorius. */ +jQuery(function($){ + $.datepicker.regional['af'] = { + closeText: 'Selekteer', + prevText: 'Vorige', + nextText: 'Volgende', + currentText: 'Vandag', + monthNames: ['Januarie','Februarie','Maart','April','Mei','Junie', + 'Julie','Augustus','September','Oktober','November','Desember'], + monthNamesShort: ['Jan', 'Feb', 'Mrt', 'Apr', 'Mei', 'Jun', + 'Jul', 'Aug', 'Sep', 'Okt', 'Nov', 'Des'], + dayNames: ['Sondag', 'Maandag', 'Dinsdag', 'Woensdag', 'Donderdag', 'Vrydag', 'Saterdag'], + dayNamesShort: ['Son', 'Maa', 'Din', 'Woe', 'Don', 'Vry', 'Sat'], + dayNamesMin: ['So','Ma','Di','Wo','Do','Vr','Sa'], + weekHeader: 'Wk', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['af']); +}); +/* Arabic Translation for jQuery UI date picker plugin. */ +/* Khaled Al Horani -- koko.dw@gmail.com */ +/* خالد الحوراني -- koko.dw@gmail.com */ +/* NOTE: monthNames are the original months names and they are the Arabic names, not the new months name فبراير - يناير and there isn't any Arabic roots for these months */ +jQuery(function($){ + $.datepicker.regional['ar'] = { + closeText: 'إغلاق', + prevText: '<السابق', + nextText: 'التالي>', + currentText: 'اليوم', + monthNames: ['كانون الثاني', 'شباط', 'آذار', 'نيسان', 'آذار', 'حزيران', + 'تموز', 'آب', 'أيلول', 'تشرين الأول', 'تشرين الثاني', 'كانون الأول'], + monthNamesShort: ['1','2','3','4','5','6','7','8','9','10','11','12'], + dayNames: ['السبت', 'الأحد', 'الاثنين', 'الثلاثاء', 'الأربعاء', 'الخميس', 'الجمعة'], + dayNamesShort: ['سبت', 'أحد', 'اثنين', 'ثلاثاء', 'أربعاء', 'خميس', 'جمعة'], + dayNamesMin: ['سبت', 'أحد', 'اثنين', 'ثلاثاء', 'أربعاء', 'خميس', 'جمعة'], + weekHeader: 'أسبوع', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: true, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['ar']); +});/* Azerbaijani (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Jamil Najafov (necefov33@gmail.com). */ +jQuery(function($) { + $.datepicker.regional['az'] = { + closeText: 'Bağla', + prevText: '<Geri', + nextText: 'İrəli>', + currentText: 'Bugün', + monthNames: ['Yanvar','Fevral','Mart','Aprel','May','İyun', + 'İyul','Avqust','Sentyabr','Oktyabr','Noyabr','Dekabr'], + monthNamesShort: ['Yan','Fev','Mar','Apr','May','İyun', + 'İyul','Avq','Sen','Okt','Noy','Dek'], + dayNames: ['Bazar','Bazar ertəsi','Çərşənbə axşamı','Çərşənbə','Cümə axşamı','Cümə','Şənbə'], + dayNamesShort: ['B','Be','Ça','Ç','Ca','C','Ş'], + dayNamesMin: ['B','B','Ç','С','Ç','C','Ş'], + weekHeader: 'Hf', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['az']); +});/* Bulgarian initialisation for the jQuery UI date picker plugin. */ +/* Written by Stoyan Kyosev (http://svest.org). */ +jQuery(function($){ + $.datepicker.regional['bg'] = { + closeText: 'затвори', + prevText: '<назад', + nextText: 'напред>', + nextBigText: '>>', + currentText: 'днес', + monthNames: ['Януари','Февруари','Март','Април','Май','Юни', + 'Юли','Август','Септември','Октомври','Ноември','Декември'], + monthNamesShort: ['Яну','Фев','Мар','Апр','Май','Юни', + 'Юли','Авг','Сеп','Окт','Нов','Дек'], + dayNames: ['Неделя','Понеделник','Вторник','Сряда','Четвъртък','Петък','Събота'], + dayNamesShort: ['Нед','Пон','Вто','Сря','Чет','Пет','Съб'], + dayNamesMin: ['Не','По','Вт','Ср','Че','Пе','Съ'], + weekHeader: 'Wk', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['bg']); +}); +/* Bosnian i18n for the jQuery UI date picker plugin. */ +/* Written by Kenan Konjo. */ +jQuery(function($){ + $.datepicker.regional['bs'] = { + closeText: 'Zatvori', + prevText: '<', + nextText: '>', + currentText: 'Danas', + monthNames: ['Januar','Februar','Mart','April','Maj','Juni', + 'Juli','August','Septembar','Oktobar','Novembar','Decembar'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun', + 'Jul','Aug','Sep','Okt','Nov','Dec'], + dayNames: ['Nedelja','Ponedeljak','Utorak','Srijeda','Četvrtak','Petak','Subota'], + dayNamesShort: ['Ned','Pon','Uto','Sri','Čet','Pet','Sub'], + dayNamesMin: ['Ne','Po','Ut','Sr','Če','Pe','Su'], + weekHeader: 'Wk', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['bs']); +});/* Inicialització en català per a l'extenció 'calendar' per jQuery. */ +/* Writers: (joan.leon@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['ca'] = { + closeText: 'Tancar', + prevText: '<Ant', + nextText: 'Seg>', + currentText: 'Avui', + monthNames: ['Gener','Febrer','Març','Abril','Maig','Juny', + 'Juliol','Agost','Setembre','Octubre','Novembre','Desembre'], + monthNamesShort: ['Gen','Feb','Mar','Abr','Mai','Jun', + 'Jul','Ago','Set','Oct','Nov','Des'], + dayNames: ['Diumenge','Dilluns','Dimarts','Dimecres','Dijous','Divendres','Dissabte'], + dayNamesShort: ['Dug','Dln','Dmt','Dmc','Djs','Dvn','Dsb'], + dayNamesMin: ['Dg','Dl','Dt','Dc','Dj','Dv','Ds'], + weekHeader: 'Sm', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['ca']); +});/* Czech initialisation for the jQuery UI date picker plugin. */ +/* Written by Tomas Muller (tomas@tomas-muller.net). */ +jQuery(function($){ + $.datepicker.regional['cs'] = { + closeText: 'Zavřít', + prevText: '<Dříve', + nextText: 'Později>', + currentText: 'Nyní', + monthNames: ['leden','únor','březen','duben','květen','červen', + 'červenec','srpen','září','říjen','listopad','prosinec'], + monthNamesShort: ['led','úno','bře','dub','kvě','čer', + 'čvc','srp','zář','říj','lis','pro'], + dayNames: ['neděle', 'pondělí', 'úterý', 'středa', 'čtvrtek', 'pátek', 'sobota'], + dayNamesShort: ['ne', 'po', 'út', 'st', 'čt', 'pá', 'so'], + dayNamesMin: ['ne','po','út','st','čt','pá','so'], + weekHeader: 'Týd', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['cs']); +}); +/* Danish initialisation for the jQuery UI date picker plugin. */ +/* Written by Jan Christensen ( deletestuff@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['da'] = { + closeText: 'Luk', + prevText: '<Forrige', + nextText: 'Næste>', + currentText: 'Idag', + monthNames: ['Januar','Februar','Marts','April','Maj','Juni', + 'Juli','August','September','Oktober','November','December'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun', + 'Jul','Aug','Sep','Okt','Nov','Dec'], + dayNames: ['Søndag','Mandag','Tirsdag','Onsdag','Torsdag','Fredag','Lørdag'], + dayNamesShort: ['Søn','Man','Tir','Ons','Tor','Fre','Lør'], + dayNamesMin: ['Sø','Ma','Ti','On','To','Fr','Lø'], + weekHeader: 'Uge', + dateFormat: 'dd-mm-yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['da']); +}); +/* German initialisation for the jQuery UI date picker plugin. */ +/* Written by Milian Wolff (mail@milianw.de). */ +jQuery(function($){ + $.datepicker.regional['de'] = { + closeText: 'schließen', + prevText: '<zurück', + nextText: 'Vor>', + currentText: 'heute', + monthNames: ['Januar','Februar','März','April','Mai','Juni', + 'Juli','August','September','Oktober','November','Dezember'], + monthNamesShort: ['Jan','Feb','Mär','Apr','Mai','Jun', + 'Jul','Aug','Sep','Okt','Nov','Dez'], + dayNames: ['Sonntag','Montag','Dienstag','Mittwoch','Donnerstag','Freitag','Samstag'], + dayNamesShort: ['So','Mo','Di','Mi','Do','Fr','Sa'], + dayNamesMin: ['So','Mo','Di','Mi','Do','Fr','Sa'], + weekHeader: 'Wo', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['de']); +}); +/* Greek (el) initialisation for the jQuery UI date picker plugin. */ +/* Written by Alex Cicovic (http://www.alexcicovic.com) */ +jQuery(function($){ + $.datepicker.regional['el'] = { + closeText: 'Κλείσιμο', + prevText: 'Προηγούμενος', + nextText: 'Επόμενος', + currentText: 'Τρέχων Μήνας', + monthNames: ['Ιανουάριος','Φεβρουάριος','Μάρτιος','Απρίλιος','Μάιος','Ιούνιος', + 'Ιούλιος','Αύγουστος','Σεπτέμβριος','Οκτώβριος','Νοέμβριος','Δεκέμβριος'], + monthNamesShort: ['Ιαν','Φεβ','Μαρ','Απρ','Μαι','Ιουν', + 'Ιουλ','Αυγ','Σεπ','Οκτ','Νοε','Δεκ'], + dayNames: ['Κυριακή','Δευτέρα','Τρίτη','Τετάρτη','Πέμπτη','Παρασκευή','Σάββατο'], + dayNamesShort: ['Κυρ','Δευ','Τρι','Τετ','Πεμ','Παρ','Σαβ'], + dayNamesMin: ['Κυ','Δε','Τρ','Τε','Πε','Πα','Σα'], + weekHeader: 'Εβδ', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['el']); +});/* English/UK initialisation for the jQuery UI date picker plugin. */ +/* Written by Stuart. */ +jQuery(function($){ + $.datepicker.regional['en-GB'] = { + closeText: 'Done', + prevText: 'Prev', + nextText: 'Next', + currentText: 'Today', + monthNames: ['January','February','March','April','May','June', + 'July','August','September','October','November','December'], + monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', + 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], + dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], + dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], + dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], + weekHeader: 'Wk', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['en-GB']); +}); +/* Esperanto initialisation for the jQuery UI date picker plugin. */ +/* Written by Olivier M. (olivierweb@ifrance.com). */ +jQuery(function($){ + $.datepicker.regional['eo'] = { + closeText: 'Fermi', + prevText: '<Anta', + nextText: 'Sekv>', + currentText: 'Nuna', + monthNames: ['Januaro','Februaro','Marto','Aprilo','Majo','Junio', + 'Julio','Aŭgusto','Septembro','Oktobro','Novembro','Decembro'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun', + 'Jul','Aŭg','Sep','Okt','Nov','Dec'], + dayNames: ['Dimanĉo','Lundo','Mardo','Merkredo','Ĵaŭdo','Vendredo','Sabato'], + dayNamesShort: ['Dim','Lun','Mar','Mer','Ĵaŭ','Ven','Sab'], + dayNamesMin: ['Di','Lu','Ma','Me','Ĵa','Ve','Sa'], + weekHeader: 'Sb', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['eo']); +}); +/* Inicialización en español para la extensión 'UI date picker' para jQuery. */ +/* Traducido por Vester (xvester@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['es'] = { + closeText: 'Cerrar', + prevText: '<Ant', + nextText: 'Sig>', + currentText: 'Hoy', + monthNames: ['Enero','Febrero','Marzo','Abril','Mayo','Junio', + 'Julio','Agosto','Septiembre','Octubre','Noviembre','Diciembre'], + monthNamesShort: ['Ene','Feb','Mar','Abr','May','Jun', + 'Jul','Ago','Sep','Oct','Nov','Dic'], + dayNames: ['Domingo','Lunes','Martes','Miércoles','Jueves','Viernes','Sábado'], + dayNamesShort: ['Dom','Lun','Mar','Mié','Juv','Vie','Sáb'], + dayNamesMin: ['Do','Lu','Ma','Mi','Ju','Vi','Sá'], + weekHeader: 'Sm', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['es']); +});/* Estonian initialisation for the jQuery UI date picker plugin. */ +/* Written by Mart Sõmermaa (mrts.pydev at gmail com). */ +jQuery(function($){ + $.datepicker.regional['et'] = { + closeText: 'Sulge', + prevText: 'Eelnev', + nextText: 'Järgnev', + currentText: 'Täna', + monthNames: ['Jaanuar','Veebruar','Märts','Aprill','Mai','Juuni', + 'Juuli','August','September','Oktoober','November','Detsember'], + monthNamesShort: ['Jaan', 'Veebr', 'Märts', 'Apr', 'Mai', 'Juuni', + 'Juuli', 'Aug', 'Sept', 'Okt', 'Nov', 'Dets'], + dayNames: ['Pühapäev', 'Esmaspäev', 'Teisipäev', 'Kolmapäev', 'Neljapäev', 'Reede', 'Laupäev'], + dayNamesShort: ['Pühap', 'Esmasp', 'Teisip', 'Kolmap', 'Neljap', 'Reede', 'Laup'], + dayNamesMin: ['P','E','T','K','N','R','L'], + weekHeader: 'Sm', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['et']); +}); /* Euskarako oinarria 'UI date picker' jquery-ko extentsioarentzat */ +/* Karrikas-ek itzulia (karrikas@karrikas.com) */ +jQuery(function($){ + $.datepicker.regional['eu'] = { + closeText: 'Egina', + prevText: '<Aur', + nextText: 'Hur>', + currentText: 'Gaur', + monthNames: ['Urtarrila','Otsaila','Martxoa','Apirila','Maiatza','Ekaina', + 'Uztaila','Abuztua','Iraila','Urria','Azaroa','Abendua'], + monthNamesShort: ['Urt','Ots','Mar','Api','Mai','Eka', + 'Uzt','Abu','Ira','Urr','Aza','Abe'], + dayNames: ['Igandea','Astelehena','Asteartea','Asteazkena','Osteguna','Ostirala','Larunbata'], + dayNamesShort: ['Iga','Ast','Ast','Ast','Ost','Ost','Lar'], + dayNamesMin: ['Ig','As','As','As','Os','Os','La'], + weekHeader: 'Wk', + dateFormat: 'yy/mm/dd', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['eu']); +});/* Persian (Farsi) Translation for the jQuery UI date picker plugin. */ +/* Javad Mowlanezhad -- jmowla@gmail.com */ +/* Jalali calendar should supported soon! (Its implemented but I have to test it) */ +jQuery(function($) { + $.datepicker.regional['fa'] = { + closeText: 'بستن', + prevText: '<قبلي', + nextText: 'بعدي>', + currentText: 'امروز', + monthNames: ['فروردين','ارديبهشت','خرداد','تير','مرداد','شهريور', + 'مهر','آبان','آذر','دي','بهمن','اسفند'], + monthNamesShort: ['1','2','3','4','5','6','7','8','9','10','11','12'], + dayNames: ['يکشنبه','دوشنبه','سهشنبه','چهارشنبه','پنجشنبه','جمعه','شنبه'], + dayNamesShort: ['ي','د','س','چ','پ','ج', 'ش'], + dayNamesMin: ['ي','د','س','چ','پ','ج', 'ش'], + weekHeader: 'هف', + dateFormat: 'yy/mm/dd', + firstDay: 6, + isRTL: true, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['fa']); +});/* Finnish initialisation for the jQuery UI date picker plugin. */ +/* Written by Harri Kilpi� (harrikilpio@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['fi'] = { + closeText: 'Sulje', + prevText: '«Edellinen', + nextText: 'Seuraava»', + currentText: 'Tänään', + monthNames: ['Tammikuu','Helmikuu','Maaliskuu','Huhtikuu','Toukokuu','Kesäkuu', + 'Heinäkuu','Elokuu','Syyskuu','Lokakuu','Marraskuu','Joulukuu'], + monthNamesShort: ['Tammi','Helmi','Maalis','Huhti','Touko','Kesä', + 'Heinä','Elo','Syys','Loka','Marras','Joulu'], + dayNamesShort: ['Su','Ma','Ti','Ke','To','Pe','Su'], + dayNames: ['Sunnuntai','Maanantai','Tiistai','Keskiviikko','Torstai','Perjantai','Lauantai'], + dayNamesMin: ['Su','Ma','Ti','Ke','To','Pe','La'], + weekHeader: 'Vk', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['fi']); +}); +/* Faroese initialisation for the jQuery UI date picker plugin */ +/* Written by Sverri Mohr Olsen, sverrimo@gmail.com */ +jQuery(function($){ + $.datepicker.regional['fo'] = { + closeText: 'Lat aftur', + prevText: '<Fyrra', + nextText: 'Næsta>', + currentText: 'Í dag', + monthNames: ['Januar','Februar','Mars','Apríl','Mei','Juni', + 'Juli','August','September','Oktober','November','Desember'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Mei','Jun', + 'Jul','Aug','Sep','Okt','Nov','Des'], + dayNames: ['Sunnudagur','Mánadagur','Týsdagur','Mikudagur','Hósdagur','Fríggjadagur','Leyardagur'], + dayNamesShort: ['Sun','Mán','Týs','Mik','Hós','Frí','Ley'], + dayNamesMin: ['Su','Má','Tý','Mi','Hó','Fr','Le'], + weekHeader: 'Vk', + dateFormat: 'dd-mm-yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['fo']); +}); +/* Swiss-French initialisation for the jQuery UI date picker plugin. */ +/* Written Martin Voelkle (martin.voelkle@e-tc.ch). */ +jQuery(function($){ + $.datepicker.regional['fr-CH'] = { + closeText: 'Fermer', + prevText: '<Préc', + nextText: 'Suiv>', + currentText: 'Courant', + monthNames: ['Janvier','Février','Mars','Avril','Mai','Juin', + 'Juillet','Août','Septembre','Octobre','Novembre','Décembre'], + monthNamesShort: ['Jan','Fév','Mar','Avr','Mai','Jun', + 'Jul','Aoû','Sep','Oct','Nov','Déc'], + dayNames: ['Dimanche','Lundi','Mardi','Mercredi','Jeudi','Vendredi','Samedi'], + dayNamesShort: ['Dim','Lun','Mar','Mer','Jeu','Ven','Sam'], + dayNamesMin: ['Di','Lu','Ma','Me','Je','Ve','Sa'], + weekHeader: 'Sm', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['fr-CH']); +});/* French initialisation for the jQuery UI date picker plugin. */ +/* Written by Keith Wood (kbwood{at}iinet.com.au) and Stéphane Nahmani (sholby@sholby.net). */ +jQuery(function($){ + $.datepicker.regional['fr'] = { + closeText: 'Fermer', + prevText: '<Préc', + nextText: 'Suiv>', + currentText: 'Courant', + monthNames: ['Janvier','Février','Mars','Avril','Mai','Juin', + 'Juillet','Août','Septembre','Octobre','Novembre','Décembre'], + monthNamesShort: ['Jan','Fév','Mar','Avr','Mai','Jun', + 'Jul','Aoû','Sep','Oct','Nov','Déc'], + dayNames: ['Dimanche','Lundi','Mardi','Mercredi','Jeudi','Vendredi','Samedi'], + dayNamesShort: ['Dim','Lun','Mar','Mer','Jeu','Ven','Sam'], + dayNamesMin: ['Di','Lu','Ma','Me','Je','Ve','Sa'], + weekHeader: 'Sm', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['fr']); +});/* Galician localization for 'UI date picker' jQuery extension. */ +/* Translated by Jorge Barreiro <yortx.barry@gmail.com>. */ +jQuery(function($){ + $.datepicker.regional['gl'] = { + closeText: 'Pechar', + prevText: '<Ant', + nextText: 'Seg>', + currentText: 'Hoxe', + monthNames: ['Xaneiro','Febreiro','Marzo','Abril','Maio','Xuño', + 'Xullo','Agosto','Setembro','Outubro','Novembro','Decembro'], + monthNamesShort: ['Xan','Feb','Mar','Abr','Mai','Xuñ', + 'Xul','Ago','Set','Out','Nov','Dec'], + dayNames: ['Domingo','Luns','Martes','Mércores','Xoves','Venres','Sábado'], + dayNamesShort: ['Dom','Lun','Mar','Mér','Xov','Ven','Sáb'], + dayNamesMin: ['Do','Lu','Ma','Mé','Xo','Ve','Sá'], + weekHeader: 'Sm', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['gl']); +});/* Hebrew initialisation for the UI Datepicker extension. */ +/* Written by Amir Hardon (ahardon at gmail dot com). */ +jQuery(function($){ + $.datepicker.regional['he'] = { + closeText: 'סגור', + prevText: '<הקודם', + nextText: 'הבא>', + currentText: 'היום', + monthNames: ['ינואר','פברואר','מרץ','אפריל','מאי','יוני', + 'יולי','אוגוסט','ספטמבר','אוקטובר','נובמבר','דצמבר'], + monthNamesShort: ['1','2','3','4','5','6', + '7','8','9','10','11','12'], + dayNames: ['ראשון','שני','שלישי','רביעי','חמישי','שישי','שבת'], + dayNamesShort: ['א\'','ב\'','ג\'','ד\'','ה\'','ו\'','שבת'], + dayNamesMin: ['א\'','ב\'','ג\'','ד\'','ה\'','ו\'','שבת'], + weekHeader: 'Wk', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: true, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['he']); +}); +/* Croatian i18n for the jQuery UI date picker plugin. */ +/* Written by Vjekoslav Nesek. */ +jQuery(function($){ + $.datepicker.regional['hr'] = { + closeText: 'Zatvori', + prevText: '<', + nextText: '>', + currentText: 'Danas', + monthNames: ['Siječanj','Veljača','Ožujak','Travanj','Svibanj','Lipanj', + 'Srpanj','Kolovoz','Rujan','Listopad','Studeni','Prosinac'], + monthNamesShort: ['Sij','Velj','Ožu','Tra','Svi','Lip', + 'Srp','Kol','Ruj','Lis','Stu','Pro'], + dayNames: ['Nedjelja','Ponedjeljak','Utorak','Srijeda','Četvrtak','Petak','Subota'], + dayNamesShort: ['Ned','Pon','Uto','Sri','Čet','Pet','Sub'], + dayNamesMin: ['Ne','Po','Ut','Sr','Če','Pe','Su'], + weekHeader: 'Tje', + dateFormat: 'dd.mm.yy.', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['hr']); +});/* Hungarian initialisation for the jQuery UI date picker plugin. */ +/* Written by Istvan Karaszi (jquery@spam.raszi.hu). */ +jQuery(function($){ + $.datepicker.regional['hu'] = { + closeText: 'bezárás', + prevText: '« vissza', + nextText: 'előre »', + currentText: 'ma', + monthNames: ['Január', 'Február', 'Március', 'Április', 'Május', 'Június', + 'Július', 'Augusztus', 'Szeptember', 'Október', 'November', 'December'], + monthNamesShort: ['Jan', 'Feb', 'Már', 'Ápr', 'Máj', 'Jún', + 'Júl', 'Aug', 'Szep', 'Okt', 'Nov', 'Dec'], + dayNames: ['Vasárnap', 'Hétfö', 'Kedd', 'Szerda', 'Csütörtök', 'Péntek', 'Szombat'], + dayNamesShort: ['Vas', 'Hét', 'Ked', 'Sze', 'Csü', 'Pén', 'Szo'], + dayNamesMin: ['V', 'H', 'K', 'Sze', 'Cs', 'P', 'Szo'], + weekHeader: 'Hé', + dateFormat: 'yy-mm-dd', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['hu']); +}); +/* Armenian(UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Levon Zakaryan (levon.zakaryan@gmail.com)*/ +jQuery(function($){ + $.datepicker.regional['hy'] = { + closeText: 'Փակել', + prevText: '<Նախ.', + nextText: 'Հաջ.>', + currentText: 'Այսօր', + monthNames: ['Հունվար','Փետրվար','Մարտ','Ապրիլ','Մայիս','Հունիս', + 'Հուլիս','Օգոստոս','Սեպտեմբեր','Հոկտեմբեր','Նոյեմբեր','Դեկտեմբեր'], + monthNamesShort: ['Հունվ','Փետր','Մարտ','Ապր','Մայիս','Հունիս', + 'Հուլ','Օգս','Սեպ','Հոկ','Նոյ','Դեկ'], + dayNames: ['կիրակի','եկուշաբթի','երեքշաբթի','չորեքշաբթի','հինգշաբթի','ուրբաթ','շաբաթ'], + dayNamesShort: ['կիր','երկ','երք','չրք','հնգ','ուրբ','շբթ'], + dayNamesMin: ['կիր','երկ','երք','չրք','հնգ','ուրբ','շբթ'], + weekHeader: 'ՇԲՏ', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['hy']); +});/* Indonesian initialisation for the jQuery UI date picker plugin. */ +/* Written by Deden Fathurahman (dedenf@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['id'] = { + closeText: 'Tutup', + prevText: '<mundur', + nextText: 'maju>', + currentText: 'hari ini', + monthNames: ['Januari','Februari','Maret','April','Mei','Juni', + 'Juli','Agustus','September','Oktober','Nopember','Desember'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Mei','Jun', + 'Jul','Agus','Sep','Okt','Nop','Des'], + dayNames: ['Minggu','Senin','Selasa','Rabu','Kamis','Jumat','Sabtu'], + dayNamesShort: ['Min','Sen','Sel','Rab','kam','Jum','Sab'], + dayNamesMin: ['Mg','Sn','Sl','Rb','Km','jm','Sb'], + weekHeader: 'Mg', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['id']); +});/* Icelandic initialisation for the jQuery UI date picker plugin. */ +/* Written by Haukur H. Thorsson (haukur@eskill.is). */ +jQuery(function($){ + $.datepicker.regional['is'] = { + closeText: 'Loka', + prevText: '< Fyrri', + nextText: 'Næsti >', + currentText: 'Í dag', + monthNames: ['Janúar','Febrúar','Mars','Apríl','Maí','Júní', + 'Júlí','Ágúst','September','Október','Nóvember','Desember'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maí','Jún', + 'Júl','Ágú','Sep','Okt','Nóv','Des'], + dayNames: ['Sunnudagur','Mánudagur','Þriðjudagur','Miðvikudagur','Fimmtudagur','Föstudagur','Laugardagur'], + dayNamesShort: ['Sun','Mán','Þri','Mið','Fim','Fös','Lau'], + dayNamesMin: ['Su','Má','Þr','Mi','Fi','Fö','La'], + weekHeader: 'Vika', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['is']); +});/* Italian initialisation for the jQuery UI date picker plugin. */ +/* Written by Antonello Pasella (antonello.pasella@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['it'] = { + closeText: 'Chiudi', + prevText: '<Prec', + nextText: 'Succ>', + currentText: 'Oggi', + monthNames: ['Gennaio','Febbraio','Marzo','Aprile','Maggio','Giugno', + 'Luglio','Agosto','Settembre','Ottobre','Novembre','Dicembre'], + monthNamesShort: ['Gen','Feb','Mar','Apr','Mag','Giu', + 'Lug','Ago','Set','Ott','Nov','Dic'], + dayNames: ['Domenica','Lunedì','Martedì','Mercoledì','Giovedì','Venerdì','Sabato'], + dayNamesShort: ['Dom','Lun','Mar','Mer','Gio','Ven','Sab'], + dayNamesMin: ['Do','Lu','Ma','Me','Gi','Ve','Sa'], + weekHeader: 'Sm', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['it']); +}); +/* Japanese initialisation for the jQuery UI date picker plugin. */ +/* Written by Kentaro SATO (kentaro@ranvis.com). */ +jQuery(function($){ + $.datepicker.regional['ja'] = { + closeText: '閉じる', + prevText: '<前', + nextText: '次>', + currentText: '今日', + monthNames: ['1月','2月','3月','4月','5月','6月', + '7月','8月','9月','10月','11月','12月'], + monthNamesShort: ['1月','2月','3月','4月','5月','6月', + '7月','8月','9月','10月','11月','12月'], + dayNames: ['日曜日','月曜日','火曜日','水曜日','木曜日','金曜日','土曜日'], + dayNamesShort: ['日','月','火','水','木','金','土'], + dayNamesMin: ['日','月','火','水','木','金','土'], + weekHeader: '週', + dateFormat: 'yy/mm/dd', + firstDay: 0, + isRTL: false, + showMonthAfterYear: true, + yearSuffix: '年'}; + $.datepicker.setDefaults($.datepicker.regional['ja']); +});/* Korean initialisation for the jQuery calendar extension. */ +/* Written by DaeKwon Kang (ncrash.dk@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['ko'] = { + closeText: '닫기', + prevText: '이전달', + nextText: '다음달', + currentText: '오늘', + monthNames: ['1월(JAN)','2월(FEB)','3월(MAR)','4월(APR)','5월(MAY)','6월(JUN)', + '7월(JUL)','8월(AUG)','9월(SEP)','10월(OCT)','11월(NOV)','12월(DEC)'], + monthNamesShort: ['1월(JAN)','2월(FEB)','3월(MAR)','4월(APR)','5월(MAY)','6월(JUN)', + '7월(JUL)','8월(AUG)','9월(SEP)','10월(OCT)','11월(NOV)','12월(DEC)'], + dayNames: ['일','월','화','수','목','금','토'], + dayNamesShort: ['일','월','화','수','목','금','토'], + dayNamesMin: ['일','월','화','수','목','금','토'], + weekHeader: 'Wk', + dateFormat: 'yy-mm-dd', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: '년'}; + $.datepicker.setDefaults($.datepicker.regional['ko']); +});/* Kazakh (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Dmitriy Karasyov (dmitriy.karasyov@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['kz'] = { + closeText: 'Жабу', + prevText: '<Алдыңғы', + nextText: 'Келесі>', + currentText: 'Бүгін', + monthNames: ['Қаңтар','Ақпан','Наурыз','Сәуір','Мамыр','Маусым', + 'Шілде','Тамыз','Қыркүйек','Қазан','Қараша','Желтоқсан'], + monthNamesShort: ['Қаң','Ақп','Нау','Сәу','Мам','Мау', + 'Шіл','Там','Қыр','Қаз','Қар','Жел'], + dayNames: ['Жексенбі','Дүйсенбі','Сейсенбі','Сәрсенбі','Бейсенбі','Жұма','Сенбі'], + dayNamesShort: ['жкс','дсн','ссн','срс','бсн','жма','снб'], + dayNamesMin: ['Жк','Дс','Сс','Ср','Бс','Жм','Сн'], + weekHeader: 'Не', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['kz']); +}); +/* Lithuanian (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* @author Arturas Paleicikas <arturas@avalon.lt> */ +jQuery(function($){ + $.datepicker.regional['lt'] = { + closeText: 'Uždaryti', + prevText: '<Atgal', + nextText: 'Pirmyn>', + currentText: 'Šiandien', + monthNames: ['Sausis','Vasaris','Kovas','Balandis','Gegužė','Birželis', + 'Liepa','Rugpjūtis','Rugsėjis','Spalis','Lapkritis','Gruodis'], + monthNamesShort: ['Sau','Vas','Kov','Bal','Geg','Bir', + 'Lie','Rugp','Rugs','Spa','Lap','Gru'], + dayNames: ['sekmadienis','pirmadienis','antradienis','trečiadienis','ketvirtadienis','penktadienis','šeštadienis'], + dayNamesShort: ['sek','pir','ant','tre','ket','pen','šeš'], + dayNamesMin: ['Se','Pr','An','Tr','Ke','Pe','Še'], + weekHeader: 'Wk', + dateFormat: 'yy-mm-dd', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['lt']); +});/* Latvian (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* @author Arturas Paleicikas <arturas.paleicikas@metasite.net> */ +jQuery(function($){ + $.datepicker.regional['lv'] = { + closeText: 'Aizvērt', + prevText: 'Iepr', + nextText: 'Nāka', + currentText: 'Šodien', + monthNames: ['Janvāris','Februāris','Marts','Aprīlis','Maijs','Jūnijs', + 'Jūlijs','Augusts','Septembris','Oktobris','Novembris','Decembris'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Mai','Jūn', + 'Jūl','Aug','Sep','Okt','Nov','Dec'], + dayNames: ['svētdiena','pirmdiena','otrdiena','trešdiena','ceturtdiena','piektdiena','sestdiena'], + dayNamesShort: ['svt','prm','otr','tre','ctr','pkt','sst'], + dayNamesMin: ['Sv','Pr','Ot','Tr','Ct','Pk','Ss'], + weekHeader: 'Nav', + dateFormat: 'dd-mm-yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['lv']); +});/* Malaysian initialisation for the jQuery UI date picker plugin. */ +/* Written by Mohd Nawawi Mohamad Jamili (nawawi@ronggeng.net). */ +jQuery(function($){ + $.datepicker.regional['ms'] = { + closeText: 'Tutup', + prevText: '<Sebelum', + nextText: 'Selepas>', + currentText: 'hari ini', + monthNames: ['Januari','Februari','Mac','April','Mei','Jun', + 'Julai','Ogos','September','Oktober','November','Disember'], + monthNamesShort: ['Jan','Feb','Mac','Apr','Mei','Jun', + 'Jul','Ogo','Sep','Okt','Nov','Dis'], + dayNames: ['Ahad','Isnin','Selasa','Rabu','Khamis','Jumaat','Sabtu'], + dayNamesShort: ['Aha','Isn','Sel','Rab','kha','Jum','Sab'], + dayNamesMin: ['Ah','Is','Se','Ra','Kh','Ju','Sa'], + weekHeader: 'Mg', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['ms']); +});/* Dutch (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Mathias Bynens <http://mathiasbynens.be/> */ +jQuery(function($){ + $.datepicker.regional.nl = { + closeText: 'Sluiten', + prevText: '←', + nextText: '→', + currentText: 'Vandaag', + monthNames: ['januari', 'februari', 'maart', 'april', 'mei', 'juni', + 'juli', 'augustus', 'september', 'oktober', 'november', 'december'], + monthNamesShort: ['jan', 'feb', 'maa', 'apr', 'mei', 'jun', + 'jul', 'aug', 'sep', 'okt', 'nov', 'dec'], + dayNames: ['zondag', 'maandag', 'dinsdag', 'woensdag', 'donderdag', 'vrijdag', 'zaterdag'], + dayNamesShort: ['zon', 'maa', 'din', 'woe', 'don', 'vri', 'zat'], + dayNamesMin: ['zo', 'ma', 'di', 'wo', 'do', 'vr', 'za'], + weekHeader: 'Wk', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional.nl); +});/* Norwegian initialisation for the jQuery UI date picker plugin. */ +/* Written by Naimdjon Takhirov (naimdjon@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['no'] = { + closeText: 'Lukk', + prevText: '«Forrige', + nextText: 'Neste»', + currentText: 'I dag', + monthNames: ['Januar','Februar','Mars','April','Mai','Juni', + 'Juli','August','September','Oktober','November','Desember'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Mai','Jun', + 'Jul','Aug','Sep','Okt','Nov','Des'], + dayNamesShort: ['Søn','Man','Tir','Ons','Tor','Fre','Lør'], + dayNames: ['Søndag','Mandag','Tirsdag','Onsdag','Torsdag','Fredag','Lørdag'], + dayNamesMin: ['Sø','Ma','Ti','On','To','Fr','Lø'], + weekHeader: 'Uke', + dateFormat: 'yy-mm-dd', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['no']); +}); +/* Polish initialisation for the jQuery UI date picker plugin. */ +/* Written by Jacek Wysocki (jacek.wysocki@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['pl'] = { + closeText: 'Zamknij', + prevText: '<Poprzedni', + nextText: 'Następny>', + currentText: 'Dziś', + monthNames: ['Styczeń','Luty','Marzec','Kwiecień','Maj','Czerwiec', + 'Lipiec','Sierpień','Wrzesień','Październik','Listopad','Grudzień'], + monthNamesShort: ['Sty','Lu','Mar','Kw','Maj','Cze', + 'Lip','Sie','Wrz','Pa','Lis','Gru'], + dayNames: ['Niedziela','Poniedziałek','Wtorek','Środa','Czwartek','Piątek','Sobota'], + dayNamesShort: ['Nie','Pn','Wt','Śr','Czw','Pt','So'], + dayNamesMin: ['N','Pn','Wt','Śr','Cz','Pt','So'], + weekHeader: 'Tydz', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['pl']); +}); +/* Brazilian initialisation for the jQuery UI date picker plugin. */ +/* Written by Leonildo Costa Silva (leocsilva@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['pt-BR'] = { + closeText: 'Fechar', + prevText: '<Anterior', + nextText: 'Próximo>', + currentText: 'Hoje', + monthNames: ['Janeiro','Fevereiro','Março','Abril','Maio','Junho', + 'Julho','Agosto','Setembro','Outubro','Novembro','Dezembro'], + monthNamesShort: ['Jan','Fev','Mar','Abr','Mai','Jun', + 'Jul','Ago','Set','Out','Nov','Dez'], + dayNames: ['Domingo','Segunda-feira','Terça-feira','Quarta-feira','Quinta-feira','Sexta-feira','Sábado'], + dayNamesShort: ['Dom','Seg','Ter','Qua','Qui','Sex','Sáb'], + dayNamesMin: ['Dom','Seg','Ter','Qua','Qui','Sex','Sáb'], + weekHeader: 'Sm', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['pt-BR']); +});/* Portuguese initialisation for the jQuery UI date picker plugin. */ +jQuery(function($){ + $.datepicker.regional['pt'] = { + closeText: 'Fechar', + prevText: '<Anterior', + nextText: 'Seguinte', + currentText: 'Hoje', + monthNames: ['Janeiro','Fevereiro','Março','Abril','Maio','Junho', + 'Julho','Agosto','Setembro','Outubro','Novembro','Dezembro'], + monthNamesShort: ['Jan','Fev','Mar','Abr','Mai','Jun', + 'Jul','Ago','Set','Out','Nov','Dez'], + dayNames: ['Domingo','Segunda-feira','Terça-feira','Quarta-feira','Quinta-feira','Sexta-feira','Sábado'], + dayNamesShort: ['Dom','Seg','Ter','Qua','Qui','Sex','Sáb'], + dayNamesMin: ['Dom','Seg','Ter','Qua','Qui','Sex','Sáb'], + weekHeader: 'Sem', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['pt']); +});/* Romanian initialisation for the jQuery UI date picker plugin. + * + * Written by Edmond L. (ll_edmond@walla.com) + * and Ionut G. Stan (ionut.g.stan@gmail.com) + */ +jQuery(function($){ + $.datepicker.regional['ro'] = { + closeText: 'Închide', + prevText: '« Luna precedentă', + nextText: 'Luna următoare »', + currentText: 'Azi', + monthNames: ['Ianuarie','Februarie','Martie','Aprilie','Mai','Iunie', + 'Iulie','August','Septembrie','Octombrie','Noiembrie','Decembrie'], + monthNamesShort: ['Ian', 'Feb', 'Mar', 'Apr', 'Mai', 'Iun', + 'Iul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], + dayNames: ['Duminică', 'Luni', 'Marţi', 'Miercuri', 'Joi', 'Vineri', 'Sâmbătă'], + dayNamesShort: ['Dum', 'Lun', 'Mar', 'Mie', 'Joi', 'Vin', 'Sâm'], + dayNamesMin: ['Du','Lu','Ma','Mi','Jo','Vi','Sâ'], + weekHeader: 'Săpt', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['ro']); +}); +/* Russian (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Andrew Stromnov (stromnov@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['ru'] = { + closeText: 'Закрыть', + prevText: '<Пред', + nextText: 'След>', + currentText: 'Сегодня', + monthNames: ['Январь','Февраль','Март','Апрель','Май','Июнь', + 'Июль','Август','Сентябрь','Октябрь','Ноябрь','Декабрь'], + monthNamesShort: ['Янв','Фев','Мар','Апр','Май','Июн', + 'Июл','Авг','Сен','Окт','Ноя','Дек'], + dayNames: ['воскресенье','понедельник','вторник','среда','четверг','пятница','суббота'], + dayNamesShort: ['вск','пнд','втр','срд','чтв','птн','сбт'], + dayNamesMin: ['Вс','Пн','Вт','Ср','Чт','Пт','Сб'], + weekHeader: 'Нед', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['ru']); +});/* Slovak initialisation for the jQuery UI date picker plugin. */ +/* Written by Vojtech Rinik (vojto@hmm.sk). */ +jQuery(function($){ + $.datepicker.regional['sk'] = { + closeText: 'Zavrieť', + prevText: '<Predchádzajúci', + nextText: 'Nasledujúci>', + currentText: 'Dnes', + monthNames: ['Január','Február','Marec','Apríl','Máj','Jún', + 'Júl','August','September','Október','November','December'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Máj','Jún', + 'Júl','Aug','Sep','Okt','Nov','Dec'], + dayNames: ['Nedel\'a','Pondelok','Utorok','Streda','Štvrtok','Piatok','Sobota'], + dayNamesShort: ['Ned','Pon','Uto','Str','Štv','Pia','Sob'], + dayNamesMin: ['Ne','Po','Ut','St','Št','Pia','So'], + weekHeader: 'Ty', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['sk']); +}); +/* Slovenian initialisation for the jQuery UI date picker plugin. */ +/* Written by Jaka Jancar (jaka@kubje.org). */ +/* c = č, s = š z = ž C = Č S = Š Z = Ž */ +jQuery(function($){ + $.datepicker.regional['sl'] = { + closeText: 'Zapri', + prevText: '<Prejšnji', + nextText: 'Naslednji>', + currentText: 'Trenutni', + monthNames: ['Januar','Februar','Marec','April','Maj','Junij', + 'Julij','Avgust','September','Oktober','November','December'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun', + 'Jul','Avg','Sep','Okt','Nov','Dec'], + dayNames: ['Nedelja','Ponedeljek','Torek','Sreda','Četrtek','Petek','Sobota'], + dayNamesShort: ['Ned','Pon','Tor','Sre','Čet','Pet','Sob'], + dayNamesMin: ['Ne','Po','To','Sr','Če','Pe','So'], + weekHeader: 'Teden', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['sl']); +}); +/* Albanian initialisation for the jQuery UI date picker plugin. */ +/* Written by Flakron Bytyqi (flakron@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['sq'] = { + closeText: 'mbylle', + prevText: '<mbrapa', + nextText: 'Përpara>', + currentText: 'sot', + monthNames: ['Janar','Shkurt','Mars','Prill','Maj','Qershor', + 'Korrik','Gusht','Shtator','Tetor','Nëntor','Dhjetor'], + monthNamesShort: ['Jan','Shk','Mar','Pri','Maj','Qer', + 'Kor','Gus','Sht','Tet','Nën','Dhj'], + dayNames: ['E Diel','E Hënë','E Martë','E Mërkurë','E Enjte','E Premte','E Shtune'], + dayNamesShort: ['Di','Hë','Ma','Më','En','Pr','Sh'], + dayNamesMin: ['Di','Hë','Ma','Më','En','Pr','Sh'], + weekHeader: 'Ja', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['sq']); +}); +/* Serbian i18n for the jQuery UI date picker plugin. */ +/* Written by Dejan Dimić. */ +jQuery(function($){ + $.datepicker.regional['sr-SR'] = { + closeText: 'Zatvori', + prevText: '<', + nextText: '>', + currentText: 'Danas', + monthNames: ['Januar','Februar','Mart','April','Maj','Jun', + 'Jul','Avgust','Septembar','Oktobar','Novembar','Decembar'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun', + 'Jul','Avg','Sep','Okt','Nov','Dec'], + dayNames: ['Nedelja','Ponedeljak','Utorak','Sreda','Četvrtak','Petak','Subota'], + dayNamesShort: ['Ned','Pon','Uto','Sre','Čet','Pet','Sub'], + dayNamesMin: ['Ne','Po','Ut','Sr','Če','Pe','Su'], + weekHeader: 'Sed', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['sr-SR']); +}); +/* Serbian i18n for the jQuery UI date picker plugin. */ +/* Written by Dejan Dimić. */ +jQuery(function($){ + $.datepicker.regional['sr'] = { + closeText: 'Затвори', + prevText: '<', + nextText: '>', + currentText: 'Данас', + monthNames: ['Јануар','Фебруар','Март','Април','Мај','Јун', + 'Јул','Август','Септембар','Октобар','Новембар','Децембар'], + monthNamesShort: ['Јан','Феб','Мар','Апр','Мај','Јун', + 'Јул','Авг','Сеп','Окт','Нов','Дец'], + dayNames: ['Недеља','Понедељак','Уторак','Среда','Четвртак','Петак','Субота'], + dayNamesShort: ['Нед','Пон','Уто','Сре','Чет','Пет','Суб'], + dayNamesMin: ['Не','По','Ут','Ср','Че','Пе','Су'], + weekHeader: 'Сед', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['sr']); +}); +/* Swedish initialisation for the jQuery UI date picker plugin. */ +/* Written by Anders Ekdahl ( anders@nomadiz.se). */ +jQuery(function($){ + $.datepicker.regional['sv'] = { + closeText: 'Stäng', + prevText: '«Förra', + nextText: 'Nästa»', + currentText: 'Idag', + monthNames: ['Januari','Februari','Mars','April','Maj','Juni', + 'Juli','Augusti','September','Oktober','November','December'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun', + 'Jul','Aug','Sep','Okt','Nov','Dec'], + dayNamesShort: ['Sön','Mån','Tis','Ons','Tor','Fre','Lör'], + dayNames: ['Söndag','Måndag','Tisdag','Onsdag','Torsdag','Fredag','Lördag'], + dayNamesMin: ['Sö','Må','Ti','On','To','Fr','Lö'], + weekHeader: 'Ve', + dateFormat: 'yy-mm-dd', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['sv']); +}); +/* Tamil (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by S A Sureshkumar (saskumar@live.com). */ +jQuery(function($){ + $.datepicker.regional['ta'] = { + closeText: 'மூடு', + prevText: 'முன்னையது', + nextText: 'அடுத்தது', + currentText: 'இன்று', + monthNames: ['தை','மாசி','பங்குனி','சித்திரை','வைகாசி','ஆனி', + 'ஆடி','ஆவணி','புரட்டாசி','ஐப்பசி','கார்த்திகை','மார்கழி'], + monthNamesShort: ['தை','மாசி','பங்','சித்','வைகா','ஆனி', + 'ஆடி','ஆவ','புர','ஐப்','கார்','மார்'], + dayNames: ['ஞாயிற்றுக்கிழமை','திங்கட்கிழமை','செவ்வாய்க்கிழமை','புதன்கிழமை','வியாழக்கிழமை','வெள்ளிக்கிழமை','சனிக்கிழமை'], + dayNamesShort: ['ஞாயிறு','திங்கள்','செவ்வாய்','புதன்','வியாழன்','வெள்ளி','சனி'], + dayNamesMin: ['ஞா','தி','செ','பு','வி','வெ','ச'], + weekHeader: 'Не', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['ta']); +}); +/* Thai initialisation for the jQuery UI date picker plugin. */ +/* Written by pipo (pipo@sixhead.com). */ +jQuery(function($){ + $.datepicker.regional['th'] = { + closeText: 'ปิด', + prevText: '« ย้อน', + nextText: 'ถัดไป »', + currentText: 'วันนี้', + monthNames: ['มกราคม','กุมภาพันธ์','มีนาคม','เมษายน','พฤษภาคม','มิถุนายน', + 'กรกฏาคม','สิงหาคม','กันยายน','ตุลาคม','พฤศจิกายน','ธันวาคม'], + monthNamesShort: ['ม.ค.','ก.พ.','มี.ค.','เม.ย.','พ.ค.','มิ.ย.', + 'ก.ค.','ส.ค.','ก.ย.','ต.ค.','พ.ย.','ธ.ค.'], + dayNames: ['อาทิตย์','จันทร์','อังคาร','พุธ','พฤหัสบดี','ศุกร์','เสาร์'], + dayNamesShort: ['อา.','จ.','อ.','พ.','พฤ.','ศ.','ส.'], + dayNamesMin: ['อา.','จ.','อ.','พ.','พฤ.','ศ.','ส.'], + weekHeader: 'Wk', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['th']); +});/* Turkish initialisation for the jQuery UI date picker plugin. */ +/* Written by Izzet Emre Erkan (kara@karalamalar.net). */ +jQuery(function($){ + $.datepicker.regional['tr'] = { + closeText: 'kapat', + prevText: '<geri', + nextText: 'ileri>', + currentText: 'bugün', + monthNames: ['Ocak','Şubat','Mart','Nisan','Mayıs','Haziran', + 'Temmuz','Ağustos','Eylül','Ekim','Kasım','Aralık'], + monthNamesShort: ['Oca','Şub','Mar','Nis','May','Haz', + 'Tem','Ağu','Eyl','Eki','Kas','Ara'], + dayNames: ['Pazar','Pazartesi','Salı','Çarşamba','Perşembe','Cuma','Cumartesi'], + dayNamesShort: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'], + dayNamesMin: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'], + weekHeader: 'Hf', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['tr']); +});/* Ukrainian (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Maxim Drogobitskiy (maxdao@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['uk'] = { + closeText: 'Закрити', + prevText: '<', + nextText: '>', + currentText: 'Сьогодні', + monthNames: ['Січень','Лютий','Березень','Квітень','Травень','Червень', + 'Липень','Серпень','Вересень','Жовтень','Листопад','Грудень'], + monthNamesShort: ['Січ','Лют','Бер','Кві','Тра','Чер', + 'Лип','Сер','Вер','Жов','Лис','Гру'], + dayNames: ['неділя','понеділок','вівторок','середа','четвер','п’ятниця','субота'], + dayNamesShort: ['нед','пнд','вів','срд','чтв','птн','сбт'], + dayNamesMin: ['Нд','Пн','Вт','Ср','Чт','Пт','Сб'], + weekHeader: 'Не', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['uk']); +});/* Vietnamese initialisation for the jQuery UI date picker plugin. */ +/* Translated by Le Thanh Huy (lthanhhuy@cit.ctu.edu.vn). */ +jQuery(function($){ + $.datepicker.regional['vi'] = { + closeText: 'Đóng', + prevText: '<Trước', + nextText: 'Tiếp>', + currentText: 'Hôm nay', + monthNames: ['Tháng Một', 'Tháng Hai', 'Tháng Ba', 'Tháng Tư', 'Tháng Năm', 'Tháng Sáu', + 'Tháng Bảy', 'Tháng Tám', 'Tháng Chín', 'Tháng Mười', 'Tháng Mười Một', 'Tháng Mười Hai'], + monthNamesShort: ['Tháng 1', 'Tháng 2', 'Tháng 3', 'Tháng 4', 'Tháng 5', 'Tháng 6', + 'Tháng 7', 'Tháng 8', 'Tháng 9', 'Tháng 10', 'Tháng 11', 'Tháng 12'], + dayNames: ['Chủ Nhật', 'Thứ Hai', 'Thứ Ba', 'Thứ Tư', 'Thứ Năm', 'Thứ Sáu', 'Thứ Bảy'], + dayNamesShort: ['CN', 'T2', 'T3', 'T4', 'T5', 'T6', 'T7'], + dayNamesMin: ['CN', 'T2', 'T3', 'T4', 'T5', 'T6', 'T7'], + weekHeader: 'Tu', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['vi']); +}); +/* Chinese initialisation for the jQuery UI date picker plugin. */ +/* Written by Cloudream (cloudream@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['zh-CN'] = { + closeText: '关闭', + prevText: '<上月', + nextText: '下月>', + currentText: '今天', + monthNames: ['一月','二月','三月','四月','五月','六月', + '七月','八月','九月','十月','十一月','十二月'], + monthNamesShort: ['一','二','三','四','五','六', + '七','八','九','十','十一','十二'], + dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'], + dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'], + dayNamesMin: ['日','一','二','三','四','五','六'], + weekHeader: '周', + dateFormat: 'yy-mm-dd', + firstDay: 1, + isRTL: false, + showMonthAfterYear: true, + yearSuffix: '年'}; + $.datepicker.setDefaults($.datepicker.regional['zh-CN']); +}); +/* Chinese initialisation for the jQuery UI date picker plugin. */ +/* Written by SCCY (samuelcychan@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['zh-HK'] = { + closeText: '關閉', + prevText: '<上月', + nextText: '下月>', + currentText: '今天', + monthNames: ['一月','二月','三月','四月','五月','六月', + '七月','八月','九月','十月','十一月','十二月'], + monthNamesShort: ['一','二','三','四','五','六', + '七','八','九','十','十一','十二'], + dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'], + dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'], + dayNamesMin: ['日','一','二','三','四','五','六'], + weekHeader: '周', + dateFormat: 'dd-mm-yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: true, + yearSuffix: '年'}; + $.datepicker.setDefaults($.datepicker.regional['zh-HK']); +}); +/* Chinese initialisation for the jQuery UI date picker plugin. */ +/* Written by Ressol (ressol@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['zh-TW'] = { + closeText: '關閉', + prevText: '<上月', + nextText: '下月>', + currentText: '今天', + monthNames: ['一月','二月','三月','四月','五月','六月', + '七月','八月','九月','十月','十一月','十二月'], + monthNamesShort: ['一','二','三','四','五','六', + '七','八','九','十','十一','十二'], + dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'], + dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'], + dayNamesMin: ['日','一','二','三','四','五','六'], + weekHeader: '周', + dateFormat: 'yy/mm/dd', + firstDay: 1, + isRTL: false, + showMonthAfterYear: true, + yearSuffix: '年'}; + $.datepicker.setDefaults($.datepicker.regional['zh-TW']); +}); diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-af.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-af.js new file mode 100644 index 000000000..43fbf6cd8 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-af.js @@ -0,0 +1,23 @@ +/* Afrikaans initialisation for the jQuery UI date picker plugin. */ +/* Written by Renier Pretorius. */ +jQuery(function($){ + $.datepicker.regional['af'] = { + closeText: 'Selekteer', + prevText: 'Vorige', + nextText: 'Volgende', + currentText: 'Vandag', + monthNames: ['Januarie','Februarie','Maart','April','Mei','Junie', + 'Julie','Augustus','September','Oktober','November','Desember'], + monthNamesShort: ['Jan', 'Feb', 'Mrt', 'Apr', 'Mei', 'Jun', + 'Jul', 'Aug', 'Sep', 'Okt', 'Nov', 'Des'], + dayNames: ['Sondag', 'Maandag', 'Dinsdag', 'Woensdag', 'Donderdag', 'Vrydag', 'Saterdag'], + dayNamesShort: ['Son', 'Maa', 'Din', 'Woe', 'Don', 'Vry', 'Sat'], + dayNamesMin: ['So','Ma','Di','Wo','Do','Vr','Sa'], + weekHeader: 'Wk', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['af']); +}); diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ar.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ar.js new file mode 100644 index 000000000..c799b48d8 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ar.js @@ -0,0 +1,24 @@ +/* Arabic Translation for jQuery UI date picker plugin. */ +/* Khaled Al Horani -- koko.dw@gmail.com */ +/* خالد الحوراني -- koko.dw@gmail.com */ +/* NOTE: monthNames are the original months names and they are the Arabic names, not the new months name فبراير - يناير and there isn't any Arabic roots for these months */ +jQuery(function($){ + $.datepicker.regional['ar'] = { + closeText: 'إغلاق', + prevText: '<السابق', + nextText: 'التالي>', + currentText: 'اليوم', + monthNames: ['كانون الثاني', 'شباط', 'آذار', 'نيسان', 'آذار', 'حزيران', + 'تموز', 'آب', 'أيلول', 'تشرين الأول', 'تشرين الثاني', 'كانون الأول'], + monthNamesShort: ['1','2','3','4','5','6','7','8','9','10','11','12'], + dayNames: ['السبت', 'الأحد', 'الاثنين', 'الثلاثاء', 'الأربعاء', 'الخميس', 'الجمعة'], + dayNamesShort: ['سبت', 'أحد', 'اثنين', 'ثلاثاء', 'أربعاء', 'خميس', 'جمعة'], + dayNamesMin: ['سبت', 'أحد', 'اثنين', 'ثلاثاء', 'أربعاء', 'خميس', 'جمعة'], + weekHeader: 'أسبوع', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: true, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['ar']); +});
\ No newline at end of file diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-az.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-az.js new file mode 100644 index 000000000..b5434057b --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-az.js @@ -0,0 +1,23 @@ +/* Azerbaijani (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Jamil Najafov (necefov33@gmail.com). */ +jQuery(function($) { + $.datepicker.regional['az'] = { + closeText: 'Bağla', + prevText: '<Geri', + nextText: 'İrəli>', + currentText: 'Bugün', + monthNames: ['Yanvar','Fevral','Mart','Aprel','May','İyun', + 'İyul','Avqust','Sentyabr','Oktyabr','Noyabr','Dekabr'], + monthNamesShort: ['Yan','Fev','Mar','Apr','May','İyun', + 'İyul','Avq','Sen','Okt','Noy','Dek'], + dayNames: ['Bazar','Bazar ertəsi','Çərşənbə axşamı','Çərşənbə','Cümə axşamı','Cümə','Şənbə'], + dayNamesShort: ['B','Be','Ça','Ç','Ca','C','Ş'], + dayNamesMin: ['B','B','Ç','С','Ç','C','Ş'], + weekHeader: 'Hf', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['az']); +});
\ No newline at end of file diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-bg.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-bg.js new file mode 100644 index 000000000..b5113f781 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-bg.js @@ -0,0 +1,24 @@ +/* Bulgarian initialisation for the jQuery UI date picker plugin. */ +/* Written by Stoyan Kyosev (http://svest.org). */ +jQuery(function($){ + $.datepicker.regional['bg'] = { + closeText: 'затвори', + prevText: '<назад', + nextText: 'напред>', + nextBigText: '>>', + currentText: 'днес', + monthNames: ['Януари','Февруари','Март','Април','Май','Юни', + 'Юли','Август','Септември','Октомври','Ноември','Декември'], + monthNamesShort: ['Яну','Фев','Мар','Апр','Май','Юни', + 'Юли','Авг','Сеп','Окт','Нов','Дек'], + dayNames: ['Неделя','Понеделник','Вторник','Сряда','Четвъртък','Петък','Събота'], + dayNamesShort: ['Нед','Пон','Вто','Сря','Чет','Пет','Съб'], + dayNamesMin: ['Не','По','Вт','Ср','Че','Пе','Съ'], + weekHeader: 'Wk', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['bg']); +}); diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-bs.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-bs.js new file mode 100644 index 000000000..30ab826b0 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-bs.js @@ -0,0 +1,23 @@ +/* Bosnian i18n for the jQuery UI date picker plugin. */ +/* Written by Kenan Konjo. */ +jQuery(function($){ + $.datepicker.regional['bs'] = { + closeText: 'Zatvori', + prevText: '<', + nextText: '>', + currentText: 'Danas', + monthNames: ['Januar','Februar','Mart','April','Maj','Juni', + 'Juli','August','Septembar','Oktobar','Novembar','Decembar'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun', + 'Jul','Aug','Sep','Okt','Nov','Dec'], + dayNames: ['Nedelja','Ponedeljak','Utorak','Srijeda','Četvrtak','Petak','Subota'], + dayNamesShort: ['Ned','Pon','Uto','Sri','Čet','Pet','Sub'], + dayNamesMin: ['Ne','Po','Ut','Sr','Če','Pe','Su'], + weekHeader: 'Wk', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['bs']); +});
\ No newline at end of file diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ca.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ca.js new file mode 100644 index 000000000..b128e699e --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ca.js @@ -0,0 +1,23 @@ +/* Inicialització en català per a l'extenció 'calendar' per jQuery. */ +/* Writers: (joan.leon@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['ca'] = { + closeText: 'Tancar', + prevText: '<Ant', + nextText: 'Seg>', + currentText: 'Avui', + monthNames: ['Gener','Febrer','Març','Abril','Maig','Juny', + 'Juliol','Agost','Setembre','Octubre','Novembre','Desembre'], + monthNamesShort: ['Gen','Feb','Mar','Abr','Mai','Jun', + 'Jul','Ago','Set','Oct','Nov','Des'], + dayNames: ['Diumenge','Dilluns','Dimarts','Dimecres','Dijous','Divendres','Dissabte'], + dayNamesShort: ['Dug','Dln','Dmt','Dmc','Djs','Dvn','Dsb'], + dayNamesMin: ['Dg','Dl','Dt','Dc','Dj','Dv','Ds'], + weekHeader: 'Sm', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['ca']); +});
\ No newline at end of file diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-cs.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-cs.js new file mode 100644 index 000000000..c3c07ea67 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-cs.js @@ -0,0 +1,23 @@ +/* Czech initialisation for the jQuery UI date picker plugin. */ +/* Written by Tomas Muller (tomas@tomas-muller.net). */ +jQuery(function($){ + $.datepicker.regional['cs'] = { + closeText: 'Zavřít', + prevText: '<Dříve', + nextText: 'Později>', + currentText: 'Nyní', + monthNames: ['leden','únor','březen','duben','květen','červen', + 'červenec','srpen','září','říjen','listopad','prosinec'], + monthNamesShort: ['led','úno','bře','dub','kvě','čer', + 'čvc','srp','zář','říj','lis','pro'], + dayNames: ['neděle', 'pondělí', 'úterý', 'středa', 'čtvrtek', 'pátek', 'sobota'], + dayNamesShort: ['ne', 'po', 'út', 'st', 'čt', 'pá', 'so'], + dayNamesMin: ['ne','po','út','st','čt','pá','so'], + weekHeader: 'Týd', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['cs']); +}); diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-da.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-da.js new file mode 100644 index 000000000..4a99a5833 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-da.js @@ -0,0 +1,23 @@ +/* Danish initialisation for the jQuery UI date picker plugin. */ +/* Written by Jan Christensen ( deletestuff@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['da'] = { + closeText: 'Luk', + prevText: '<Forrige', + nextText: 'Næste>', + currentText: 'Idag', + monthNames: ['Januar','Februar','Marts','April','Maj','Juni', + 'Juli','August','September','Oktober','November','December'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun', + 'Jul','Aug','Sep','Okt','Nov','Dec'], + dayNames: ['Søndag','Mandag','Tirsdag','Onsdag','Torsdag','Fredag','Lørdag'], + dayNamesShort: ['Søn','Man','Tir','Ons','Tor','Fre','Lør'], + dayNamesMin: ['Sø','Ma','Ti','On','To','Fr','Lø'], + weekHeader: 'Uge', + dateFormat: 'dd-mm-yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['da']); +}); diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-de-CH.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-de-CH.js new file mode 100644 index 000000000..f31e418a4 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-de-CH.js @@ -0,0 +1,23 @@ +/* Swiss-German initialisation for the jQuery UI date picker plugin. */ +/* By Douglas Jose & Juerg Meier. */ +jQuery(function($){ + $.datepicker.regional['de-CH'] = { + closeText: 'schliessen', + prevText: '<zurück', + nextText: 'nächster>', + currentText: 'heute', + monthNames: ['Januar','Februar','März','April','Mai','Juni', + 'Juli','August','September','Oktober','November','Dezember'], + monthNamesShort: ['Jan','Feb','Mär','Apr','Mai','Jun', + 'Jul','Aug','Sep','Okt','Nov','Dez'], + dayNames: ['Sonntag','Montag','Dienstag','Mittwoch','Donnerstag','Freitag','Samstag'], + dayNamesShort: ['So','Mo','Di','Mi','Do','Fr','Sa'], + dayNamesMin: ['So','Mo','Di','Mi','Do','Fr','Sa'], + weekHeader: 'Wo', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['de-CH']); +});
\ No newline at end of file diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-de.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-de.js new file mode 100644 index 000000000..ac2d516aa --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-de.js @@ -0,0 +1,23 @@ +/* German initialisation for the jQuery UI date picker plugin. */ +/* Written by Milian Wolff (mail@milianw.de). */ +jQuery(function($){ + $.datepicker.regional['de'] = { + closeText: 'schließen', + prevText: '<zurück', + nextText: 'Vor>', + currentText: 'heute', + monthNames: ['Januar','Februar','März','April','Mai','Juni', + 'Juli','August','September','Oktober','November','Dezember'], + monthNamesShort: ['Jan','Feb','Mär','Apr','Mai','Jun', + 'Jul','Aug','Sep','Okt','Nov','Dez'], + dayNames: ['Sonntag','Montag','Dienstag','Mittwoch','Donnerstag','Freitag','Samstag'], + dayNamesShort: ['So','Mo','Di','Mi','Do','Fr','Sa'], + dayNamesMin: ['So','Mo','Di','Mi','Do','Fr','Sa'], + weekHeader: 'Wo', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['de']); +}); diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-el.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-el.js new file mode 100644 index 000000000..9542769d9 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-el.js @@ -0,0 +1,23 @@ +/* Greek (el) initialisation for the jQuery UI date picker plugin. */ +/* Written by Alex Cicovic (http://www.alexcicovic.com) */ +jQuery(function($){ + $.datepicker.regional['el'] = { + closeText: 'Κλείσιμο', + prevText: 'Προηγούμενος', + nextText: 'Επόμενος', + currentText: 'Τρέχων Μήνας', + monthNames: ['Ιανουάριος','Φεβρουάριος','Μάρτιος','Απρίλιος','Μάιος','Ιούνιος', + 'Ιούλιος','Αύγουστος','Σεπτέμβριος','Οκτώβριος','Νοέμβριος','Δεκέμβριος'], + monthNamesShort: ['Ιαν','Φεβ','Μαρ','Απρ','Μαι','Ιουν', + 'Ιουλ','Αυγ','Σεπ','Οκτ','Νοε','Δεκ'], + dayNames: ['Κυριακή','Δευτέρα','Τρίτη','Τετάρτη','Πέμπτη','Παρασκευή','Σάββατο'], + dayNamesShort: ['Κυρ','Δευ','Τρι','Τετ','Πεμ','Παρ','Σαβ'], + dayNamesMin: ['Κυ','Δε','Τρ','Τε','Πε','Πα','Σα'], + weekHeader: 'Εβδ', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['el']); +});
\ No newline at end of file diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-en-GB.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-en-GB.js new file mode 100644 index 000000000..aac7b6195 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-en-GB.js @@ -0,0 +1,23 @@ +/* English/UK initialisation for the jQuery UI date picker plugin. */ +/* Written by Stuart. */ +jQuery(function($){ + $.datepicker.regional['en-GB'] = { + closeText: 'Done', + prevText: 'Prev', + nextText: 'Next', + currentText: 'Today', + monthNames: ['January','February','March','April','May','June', + 'July','August','September','October','November','December'], + monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', + 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], + dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], + dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], + dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], + weekHeader: 'Wk', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['en-GB']); +}); diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-eo.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-eo.js new file mode 100644 index 000000000..ba5715687 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-eo.js @@ -0,0 +1,23 @@ +/* Esperanto initialisation for the jQuery UI date picker plugin. */ +/* Written by Olivier M. (olivierweb@ifrance.com). */ +jQuery(function($){ + $.datepicker.regional['eo'] = { + closeText: 'Fermi', + prevText: '<Anta', + nextText: 'Sekv>', + currentText: 'Nuna', + monthNames: ['Januaro','Februaro','Marto','Aprilo','Majo','Junio', + 'Julio','Aŭgusto','Septembro','Oktobro','Novembro','Decembro'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun', + 'Jul','Aŭg','Sep','Okt','Nov','Dec'], + dayNames: ['Dimanĉo','Lundo','Mardo','Merkredo','Ĵaŭdo','Vendredo','Sabato'], + dayNamesShort: ['Dim','Lun','Mar','Mer','Ĵaŭ','Ven','Sab'], + dayNamesMin: ['Di','Lu','Ma','Me','Ĵa','Ve','Sa'], + weekHeader: 'Sb', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['eo']); +}); diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-es.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-es.js new file mode 100644 index 000000000..a02133de3 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-es.js @@ -0,0 +1,23 @@ +/* Inicialización en español para la extensión 'UI date picker' para jQuery. */ +/* Traducido por Vester (xvester@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['es'] = { + closeText: 'Cerrar', + prevText: '<Ant', + nextText: 'Sig>', + currentText: 'Hoy', + monthNames: ['Enero','Febrero','Marzo','Abril','Mayo','Junio', + 'Julio','Agosto','Septiembre','Octubre','Noviembre','Diciembre'], + monthNamesShort: ['Ene','Feb','Mar','Abr','May','Jun', + 'Jul','Ago','Sep','Oct','Nov','Dic'], + dayNames: ['Domingo','Lunes','Martes','Miércoles','Jueves','Viernes','Sábado'], + dayNamesShort: ['Dom','Lun','Mar','Mié','Juv','Vie','Sáb'], + dayNamesMin: ['Do','Lu','Ma','Mi','Ju','Vi','Sá'], + weekHeader: 'Sm', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['es']); +});
\ No newline at end of file diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-et.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-et.js new file mode 100644 index 000000000..f97311f31 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-et.js @@ -0,0 +1,23 @@ +/* Estonian initialisation for the jQuery UI date picker plugin. */ +/* Written by Mart Sõmermaa (mrts.pydev at gmail com). */ +jQuery(function($){ + $.datepicker.regional['et'] = { + closeText: 'Sulge', + prevText: 'Eelnev', + nextText: 'Järgnev', + currentText: 'Täna', + monthNames: ['Jaanuar','Veebruar','Märts','Aprill','Mai','Juuni', + 'Juuli','August','September','Oktoober','November','Detsember'], + monthNamesShort: ['Jaan', 'Veebr', 'Märts', 'Apr', 'Mai', 'Juuni', + 'Juuli', 'Aug', 'Sept', 'Okt', 'Nov', 'Dets'], + dayNames: ['Pühapäev', 'Esmaspäev', 'Teisipäev', 'Kolmapäev', 'Neljapäev', 'Reede', 'Laupäev'], + dayNamesShort: ['Pühap', 'Esmasp', 'Teisip', 'Kolmap', 'Neljap', 'Reede', 'Laup'], + dayNamesMin: ['P','E','T','K','N','R','L'], + weekHeader: 'Sm', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['et']); +});
\ No newline at end of file diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-eu.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-eu.js new file mode 100644 index 000000000..9ba6ee22e --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-eu.js @@ -0,0 +1,23 @@ +/* Euskarako oinarria 'UI date picker' jquery-ko extentsioarentzat */ +/* Karrikas-ek itzulia (karrikas@karrikas.com) */ +jQuery(function($){ + $.datepicker.regional['eu'] = { + closeText: 'Egina', + prevText: '<Aur', + nextText: 'Hur>', + currentText: 'Gaur', + monthNames: ['Urtarrila','Otsaila','Martxoa','Apirila','Maiatza','Ekaina', + 'Uztaila','Abuztua','Iraila','Urria','Azaroa','Abendua'], + monthNamesShort: ['Urt','Ots','Mar','Api','Mai','Eka', + 'Uzt','Abu','Ira','Urr','Aza','Abe'], + dayNames: ['Igandea','Astelehena','Asteartea','Asteazkena','Osteguna','Ostirala','Larunbata'], + dayNamesShort: ['Iga','Ast','Ast','Ast','Ost','Ost','Lar'], + dayNamesMin: ['Ig','As','As','As','Os','Os','La'], + weekHeader: 'Wk', + dateFormat: 'yy/mm/dd', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['eu']); +});
\ No newline at end of file diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-fa.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-fa.js new file mode 100644 index 000000000..adb3709fe --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-fa.js @@ -0,0 +1,23 @@ +/* Persian (Farsi) Translation for the jQuery UI date picker plugin. */ +/* Javad Mowlanezhad -- jmowla@gmail.com */ +/* Jalali calendar should supported soon! (Its implemented but I have to test it) */ +jQuery(function($) { + $.datepicker.regional['fa'] = { + closeText: 'بستن', + prevText: '<قبلي', + nextText: 'بعدي>', + currentText: 'امروز', + monthNames: ['فروردين','ارديبهشت','خرداد','تير','مرداد','شهريور', + 'مهر','آبان','آذر','دي','بهمن','اسفند'], + monthNamesShort: ['1','2','3','4','5','6','7','8','9','10','11','12'], + dayNames: ['يکشنبه','دوشنبه','سهشنبه','چهارشنبه','پنجشنبه','جمعه','شنبه'], + dayNamesShort: ['ي','د','س','چ','پ','ج', 'ش'], + dayNamesMin: ['ي','د','س','چ','پ','ج', 'ش'], + weekHeader: 'هف', + dateFormat: 'yy/mm/dd', + firstDay: 6, + isRTL: true, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['fa']); +});
\ No newline at end of file diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-fi.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-fi.js new file mode 100644 index 000000000..e1f25fd84 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-fi.js @@ -0,0 +1,23 @@ +/* Finnish initialisation for the jQuery UI date picker plugin. */ +/* Written by Harri Kilpi� (harrikilpio@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['fi'] = { + closeText: 'Sulje', + prevText: '«Edellinen', + nextText: 'Seuraava»', + currentText: 'Tänään', + monthNames: ['Tammikuu','Helmikuu','Maaliskuu','Huhtikuu','Toukokuu','Kesäkuu', + 'Heinäkuu','Elokuu','Syyskuu','Lokakuu','Marraskuu','Joulukuu'], + monthNamesShort: ['Tammi','Helmi','Maalis','Huhti','Touko','Kesä', + 'Heinä','Elo','Syys','Loka','Marras','Joulu'], + dayNamesShort: ['Su','Ma','Ti','Ke','To','Pe','Su'], + dayNames: ['Sunnuntai','Maanantai','Tiistai','Keskiviikko','Torstai','Perjantai','Lauantai'], + dayNamesMin: ['Su','Ma','Ti','Ke','To','Pe','La'], + weekHeader: 'Vk', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['fi']); +}); diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-fo.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-fo.js new file mode 100644 index 000000000..c14362216 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-fo.js @@ -0,0 +1,23 @@ +/* Faroese initialisation for the jQuery UI date picker plugin */ +/* Written by Sverri Mohr Olsen, sverrimo@gmail.com */ +jQuery(function($){ + $.datepicker.regional['fo'] = { + closeText: 'Lat aftur', + prevText: '<Fyrra', + nextText: 'Næsta>', + currentText: 'Í dag', + monthNames: ['Januar','Februar','Mars','Apríl','Mei','Juni', + 'Juli','August','September','Oktober','November','Desember'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Mei','Jun', + 'Jul','Aug','Sep','Okt','Nov','Des'], + dayNames: ['Sunnudagur','Mánadagur','Týsdagur','Mikudagur','Hósdagur','Fríggjadagur','Leyardagur'], + dayNamesShort: ['Sun','Mán','Týs','Mik','Hós','Frí','Ley'], + dayNamesMin: ['Su','Má','Tý','Mi','Hó','Fr','Le'], + weekHeader: 'Vk', + dateFormat: 'dd-mm-yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['fo']); +}); diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-fr-CH.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-fr-CH.js new file mode 100644 index 000000000..38212d548 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-fr-CH.js @@ -0,0 +1,23 @@ +/* Swiss-French initialisation for the jQuery UI date picker plugin. */ +/* Written Martin Voelkle (martin.voelkle@e-tc.ch). */ +jQuery(function($){ + $.datepicker.regional['fr-CH'] = { + closeText: 'Fermer', + prevText: '<Préc', + nextText: 'Suiv>', + currentText: 'Courant', + monthNames: ['Janvier','Février','Mars','Avril','Mai','Juin', + 'Juillet','Août','Septembre','Octobre','Novembre','Décembre'], + monthNamesShort: ['Jan','Fév','Mar','Avr','Mai','Jun', + 'Jul','Aoû','Sep','Oct','Nov','Déc'], + dayNames: ['Dimanche','Lundi','Mardi','Mercredi','Jeudi','Vendredi','Samedi'], + dayNamesShort: ['Dim','Lun','Mar','Mer','Jeu','Ven','Sam'], + dayNamesMin: ['Di','Lu','Ma','Me','Je','Ve','Sa'], + weekHeader: 'Sm', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['fr-CH']); +});
\ No newline at end of file diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-fr.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-fr.js new file mode 100644 index 000000000..134bda65d --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-fr.js @@ -0,0 +1,23 @@ +/* French initialisation for the jQuery UI date picker plugin. */ +/* Written by Keith Wood (kbwood{at}iinet.com.au) and Stéphane Nahmani (sholby@sholby.net). */ +jQuery(function($){ + $.datepicker.regional['fr'] = { + closeText: 'Fermer', + prevText: '<Préc', + nextText: 'Suiv>', + currentText: 'Courant', + monthNames: ['Janvier','Février','Mars','Avril','Mai','Juin', + 'Juillet','Août','Septembre','Octobre','Novembre','Décembre'], + monthNamesShort: ['Jan','Fév','Mar','Avr','Mai','Jun', + 'Jul','Aoû','Sep','Oct','Nov','Déc'], + dayNames: ['Dimanche','Lundi','Mardi','Mercredi','Jeudi','Vendredi','Samedi'], + dayNamesShort: ['Dim','Lun','Mar','Mer','Jeu','Ven','Sam'], + dayNamesMin: ['Di','Lu','Ma','Me','Je','Ve','Sa'], + weekHeader: 'Sm', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['fr']); +});
\ No newline at end of file diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-gl.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-gl.js new file mode 100644 index 000000000..278403e8f --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-gl.js @@ -0,0 +1,23 @@ +/* Galician localization for 'UI date picker' jQuery extension. */ +/* Translated by Jorge Barreiro <yortx.barry@gmail.com>. */ +jQuery(function($){ + $.datepicker.regional['gl'] = { + closeText: 'Pechar', + prevText: '<Ant', + nextText: 'Seg>', + currentText: 'Hoxe', + monthNames: ['Xaneiro','Febreiro','Marzo','Abril','Maio','Xuño', + 'Xullo','Agosto','Setembro','Outubro','Novembro','Decembro'], + monthNamesShort: ['Xan','Feb','Mar','Abr','Mai','Xuñ', + 'Xul','Ago','Set','Out','Nov','Dec'], + dayNames: ['Domingo','Luns','Martes','Mércores','Xoves','Venres','Sábado'], + dayNamesShort: ['Dom','Lun','Mar','Mér','Xov','Ven','Sáb'], + dayNamesMin: ['Do','Lu','Ma','Mé','Xo','Ve','Sá'], + weekHeader: 'Sm', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['gl']); +});
\ No newline at end of file diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-he.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-he.js new file mode 100644 index 000000000..3b3dc387f --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-he.js @@ -0,0 +1,23 @@ +/* Hebrew initialisation for the UI Datepicker extension. */ +/* Written by Amir Hardon (ahardon at gmail dot com). */ +jQuery(function($){ + $.datepicker.regional['he'] = { + closeText: 'סגור', + prevText: '<הקודם', + nextText: 'הבא>', + currentText: 'היום', + monthNames: ['ינואר','פברואר','מרץ','אפריל','מאי','יוני', + 'יולי','אוגוסט','ספטמבר','אוקטובר','נובמבר','דצמבר'], + monthNamesShort: ['1','2','3','4','5','6', + '7','8','9','10','11','12'], + dayNames: ['ראשון','שני','שלישי','רביעי','חמישי','שישי','שבת'], + dayNamesShort: ['א\'','ב\'','ג\'','ד\'','ה\'','ו\'','שבת'], + dayNamesMin: ['א\'','ב\'','ג\'','ד\'','ה\'','ו\'','שבת'], + weekHeader: 'Wk', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: true, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['he']); +}); diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-hr.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-hr.js new file mode 100644 index 000000000..0285c1aa9 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-hr.js @@ -0,0 +1,23 @@ +/* Croatian i18n for the jQuery UI date picker plugin. */ +/* Written by Vjekoslav Nesek. */ +jQuery(function($){ + $.datepicker.regional['hr'] = { + closeText: 'Zatvori', + prevText: '<', + nextText: '>', + currentText: 'Danas', + monthNames: ['Siječanj','Veljača','Ožujak','Travanj','Svibanj','Lipanj', + 'Srpanj','Kolovoz','Rujan','Listopad','Studeni','Prosinac'], + monthNamesShort: ['Sij','Velj','Ožu','Tra','Svi','Lip', + 'Srp','Kol','Ruj','Lis','Stu','Pro'], + dayNames: ['Nedjelja','Ponedjeljak','Utorak','Srijeda','Četvrtak','Petak','Subota'], + dayNamesShort: ['Ned','Pon','Uto','Sri','Čet','Pet','Sub'], + dayNamesMin: ['Ne','Po','Ut','Sr','Če','Pe','Su'], + weekHeader: 'Tje', + dateFormat: 'dd.mm.yy.', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['hr']); +});
\ No newline at end of file diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-hu.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-hu.js new file mode 100644 index 000000000..249e7b0ef --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-hu.js @@ -0,0 +1,23 @@ +/* Hungarian initialisation for the jQuery UI date picker plugin. */ +/* Written by Istvan Karaszi (jquery@spam.raszi.hu). */ +jQuery(function($){ + $.datepicker.regional['hu'] = { + closeText: 'bezárás', + prevText: '« vissza', + nextText: 'előre »', + currentText: 'ma', + monthNames: ['Január', 'Február', 'Március', 'Április', 'Május', 'Június', + 'Július', 'Augusztus', 'Szeptember', 'Október', 'November', 'December'], + monthNamesShort: ['Jan', 'Feb', 'Már', 'Ápr', 'Máj', 'Jún', + 'Júl', 'Aug', 'Szep', 'Okt', 'Nov', 'Dec'], + dayNames: ['Vasárnap', 'Hétfö', 'Kedd', 'Szerda', 'Csütörtök', 'Péntek', 'Szombat'], + dayNamesShort: ['Vas', 'Hét', 'Ked', 'Sze', 'Csü', 'Pén', 'Szo'], + dayNamesMin: ['V', 'H', 'K', 'Sze', 'Cs', 'P', 'Szo'], + weekHeader: 'Hé', + dateFormat: 'yy-mm-dd', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['hu']); +}); diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-hy.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-hy.js new file mode 100644 index 000000000..c6cc1946c --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-hy.js @@ -0,0 +1,23 @@ +/* Armenian(UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Levon Zakaryan (levon.zakaryan@gmail.com)*/ +jQuery(function($){ + $.datepicker.regional['hy'] = { + closeText: 'Փակել', + prevText: '<Նախ.', + nextText: 'Հաջ.>', + currentText: 'Այսօր', + monthNames: ['Հունվար','Փետրվար','Մարտ','Ապրիլ','Մայիս','Հունիս', + 'Հուլիս','Օգոստոս','Սեպտեմբեր','Հոկտեմբեր','Նոյեմբեր','Դեկտեմբեր'], + monthNamesShort: ['Հունվ','Փետր','Մարտ','Ապր','Մայիս','Հունիս', + 'Հուլ','Օգս','Սեպ','Հոկ','Նոյ','Դեկ'], + dayNames: ['կիրակի','եկուշաբթի','երեքշաբթի','չորեքշաբթի','հինգշաբթի','ուրբաթ','շաբաթ'], + dayNamesShort: ['կիր','երկ','երք','չրք','հնգ','ուրբ','շբթ'], + dayNamesMin: ['կիր','երկ','երք','չրք','հնգ','ուրբ','շբթ'], + weekHeader: 'ՇԲՏ', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['hy']); +});
\ No newline at end of file diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-id.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-id.js new file mode 100644 index 000000000..c626fbb7b --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-id.js @@ -0,0 +1,23 @@ +/* Indonesian initialisation for the jQuery UI date picker plugin. */ +/* Written by Deden Fathurahman (dedenf@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['id'] = { + closeText: 'Tutup', + prevText: '<mundur', + nextText: 'maju>', + currentText: 'hari ini', + monthNames: ['Januari','Februari','Maret','April','Mei','Juni', + 'Juli','Agustus','September','Oktober','Nopember','Desember'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Mei','Jun', + 'Jul','Agus','Sep','Okt','Nop','Des'], + dayNames: ['Minggu','Senin','Selasa','Rabu','Kamis','Jumat','Sabtu'], + dayNamesShort: ['Min','Sen','Sel','Rab','kam','Jum','Sab'], + dayNamesMin: ['Mg','Sn','Sl','Rb','Km','jm','Sb'], + weekHeader: 'Mg', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['id']); +});
\ No newline at end of file diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-is.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-is.js new file mode 100644 index 000000000..c53235a49 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-is.js @@ -0,0 +1,23 @@ +/* Icelandic initialisation for the jQuery UI date picker plugin. */ +/* Written by Haukur H. Thorsson (haukur@eskill.is). */ +jQuery(function($){ + $.datepicker.regional['is'] = { + closeText: 'Loka', + prevText: '< Fyrri', + nextText: 'Næsti >', + currentText: 'Í dag', + monthNames: ['Janúar','Febrúar','Mars','Apríl','Maí','Júní', + 'Júlí','Ágúst','September','Október','Nóvember','Desember'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maí','Jún', + 'Júl','Ágú','Sep','Okt','Nóv','Des'], + dayNames: ['Sunnudagur','Mánudagur','Þriðjudagur','Miðvikudagur','Fimmtudagur','Föstudagur','Laugardagur'], + dayNamesShort: ['Sun','Mán','Þri','Mið','Fim','Fös','Lau'], + dayNamesMin: ['Su','Má','Þr','Mi','Fi','Fö','La'], + weekHeader: 'Vika', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['is']); +});
\ No newline at end of file diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-it.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-it.js new file mode 100644 index 000000000..59da2df67 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-it.js @@ -0,0 +1,23 @@ +/* Italian initialisation for the jQuery UI date picker plugin. */ +/* Written by Antonello Pasella (antonello.pasella@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['it'] = { + closeText: 'Chiudi', + prevText: '<Prec', + nextText: 'Succ>', + currentText: 'Oggi', + monthNames: ['Gennaio','Febbraio','Marzo','Aprile','Maggio','Giugno', + 'Luglio','Agosto','Settembre','Ottobre','Novembre','Dicembre'], + monthNamesShort: ['Gen','Feb','Mar','Apr','Mag','Giu', + 'Lug','Ago','Set','Ott','Nov','Dic'], + dayNames: ['Domenica','Lunedì','Martedì','Mercoledì','Giovedì','Venerdì','Sabato'], + dayNamesShort: ['Dom','Lun','Mar','Mer','Gio','Ven','Sab'], + dayNamesMin: ['Do','Lu','Ma','Me','Gi','Ve','Sa'], + weekHeader: 'Sm', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['it']); +}); diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ja.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ja.js new file mode 100644 index 000000000..79cd827c7 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ja.js @@ -0,0 +1,23 @@ +/* Japanese initialisation for the jQuery UI date picker plugin. */ +/* Written by Kentaro SATO (kentaro@ranvis.com). */ +jQuery(function($){ + $.datepicker.regional['ja'] = { + closeText: '閉じる', + prevText: '<前', + nextText: '次>', + currentText: '今日', + monthNames: ['1月','2月','3月','4月','5月','6月', + '7月','8月','9月','10月','11月','12月'], + monthNamesShort: ['1月','2月','3月','4月','5月','6月', + '7月','8月','9月','10月','11月','12月'], + dayNames: ['日曜日','月曜日','火曜日','水曜日','木曜日','金曜日','土曜日'], + dayNamesShort: ['日','月','火','水','木','金','土'], + dayNamesMin: ['日','月','火','水','木','金','土'], + weekHeader: '週', + dateFormat: 'yy/mm/dd', + firstDay: 0, + isRTL: false, + showMonthAfterYear: true, + yearSuffix: '年'}; + $.datepicker.setDefaults($.datepicker.regional['ja']); +});
\ No newline at end of file diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ko.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ko.js new file mode 100644 index 000000000..5b3531652 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ko.js @@ -0,0 +1,23 @@ +/* Korean initialisation for the jQuery calendar extension. */ +/* Written by DaeKwon Kang (ncrash.dk@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['ko'] = { + closeText: '닫기', + prevText: '이전달', + nextText: '다음달', + currentText: '오늘', + monthNames: ['1월(JAN)','2월(FEB)','3월(MAR)','4월(APR)','5월(MAY)','6월(JUN)', + '7월(JUL)','8월(AUG)','9월(SEP)','10월(OCT)','11월(NOV)','12월(DEC)'], + monthNamesShort: ['1월(JAN)','2월(FEB)','3월(MAR)','4월(APR)','5월(MAY)','6월(JUN)', + '7월(JUL)','8월(AUG)','9월(SEP)','10월(OCT)','11월(NOV)','12월(DEC)'], + dayNames: ['일','월','화','수','목','금','토'], + dayNamesShort: ['일','월','화','수','목','금','토'], + dayNamesMin: ['일','월','화','수','목','금','토'], + weekHeader: 'Wk', + dateFormat: 'yy-mm-dd', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: '년'}; + $.datepicker.setDefaults($.datepicker.regional['ko']); +});
\ No newline at end of file diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-kz.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-kz.js new file mode 100644 index 000000000..f1f897b00 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-kz.js @@ -0,0 +1,23 @@ +/* Kazakh (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Dmitriy Karasyov (dmitriy.karasyov@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['kz'] = { + closeText: 'Жабу', + prevText: '<Алдыңғы', + nextText: 'Келесі>', + currentText: 'Бүгін', + monthNames: ['Қаңтар','Ақпан','Наурыз','Сәуір','Мамыр','Маусым', + 'Шілде','Тамыз','Қыркүйек','Қазан','Қараша','Желтоқсан'], + monthNamesShort: ['Қаң','Ақп','Нау','Сәу','Мам','Мау', + 'Шіл','Там','Қыр','Қаз','Қар','Жел'], + dayNames: ['Жексенбі','Дүйсенбі','Сейсенбі','Сәрсенбі','Бейсенбі','Жұма','Сенбі'], + dayNamesShort: ['жкс','дсн','ссн','срс','бсн','жма','снб'], + dayNamesMin: ['Жк','Дс','Сс','Ср','Бс','Жм','Сн'], + weekHeader: 'Не', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['kz']); +}); diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-lt.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-lt.js new file mode 100644 index 000000000..67d5119ca --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-lt.js @@ -0,0 +1,23 @@ +/* Lithuanian (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* @author Arturas Paleicikas <arturas@avalon.lt> */ +jQuery(function($){ + $.datepicker.regional['lt'] = { + closeText: 'Uždaryti', + prevText: '<Atgal', + nextText: 'Pirmyn>', + currentText: 'Šiandien', + monthNames: ['Sausis','Vasaris','Kovas','Balandis','Gegužė','Birželis', + 'Liepa','Rugpjūtis','Rugsėjis','Spalis','Lapkritis','Gruodis'], + monthNamesShort: ['Sau','Vas','Kov','Bal','Geg','Bir', + 'Lie','Rugp','Rugs','Spa','Lap','Gru'], + dayNames: ['sekmadienis','pirmadienis','antradienis','trečiadienis','ketvirtadienis','penktadienis','šeštadienis'], + dayNamesShort: ['sek','pir','ant','tre','ket','pen','šeš'], + dayNamesMin: ['Se','Pr','An','Tr','Ke','Pe','Še'], + weekHeader: 'Wk', + dateFormat: 'yy-mm-dd', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['lt']); +});
\ No newline at end of file diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-lv.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-lv.js new file mode 100644 index 000000000..003934e72 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-lv.js @@ -0,0 +1,23 @@ +/* Latvian (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* @author Arturas Paleicikas <arturas.paleicikas@metasite.net> */ +jQuery(function($){ + $.datepicker.regional['lv'] = { + closeText: 'Aizvērt', + prevText: 'Iepr', + nextText: 'Nāka', + currentText: 'Šodien', + monthNames: ['Janvāris','Februāris','Marts','Aprīlis','Maijs','Jūnijs', + 'Jūlijs','Augusts','Septembris','Oktobris','Novembris','Decembris'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Mai','Jūn', + 'Jūl','Aug','Sep','Okt','Nov','Dec'], + dayNames: ['svētdiena','pirmdiena','otrdiena','trešdiena','ceturtdiena','piektdiena','sestdiena'], + dayNamesShort: ['svt','prm','otr','tre','ctr','pkt','sst'], + dayNamesMin: ['Sv','Pr','Ot','Tr','Ct','Pk','Ss'], + weekHeader: 'Nav', + dateFormat: 'dd-mm-yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['lv']); +});
\ No newline at end of file diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ms.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ms.js new file mode 100644 index 000000000..e953ac04f --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ms.js @@ -0,0 +1,23 @@ +/* Malaysian initialisation for the jQuery UI date picker plugin. */ +/* Written by Mohd Nawawi Mohamad Jamili (nawawi@ronggeng.net). */ +jQuery(function($){ + $.datepicker.regional['ms'] = { + closeText: 'Tutup', + prevText: '<Sebelum', + nextText: 'Selepas>', + currentText: 'hari ini', + monthNames: ['Januari','Februari','Mac','April','Mei','Jun', + 'Julai','Ogos','September','Oktober','November','Disember'], + monthNamesShort: ['Jan','Feb','Mac','Apr','Mei','Jun', + 'Jul','Ogo','Sep','Okt','Nov','Dis'], + dayNames: ['Ahad','Isnin','Selasa','Rabu','Khamis','Jumaat','Sabtu'], + dayNamesShort: ['Aha','Isn','Sel','Rab','kha','Jum','Sab'], + dayNamesMin: ['Ah','Is','Se','Ra','Kh','Ju','Sa'], + weekHeader: 'Mg', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['ms']); +});
\ No newline at end of file diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-nl-BE.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-nl-BE.js new file mode 100644 index 000000000..50217d878 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-nl-BE.js @@ -0,0 +1,23 @@ +/* Dutch/Belgian (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Mathias Bynens <http://mathiasbynens.be/> */ +jQuery(function($){ + $.datepicker.regional['nl-BE'] = { + closeText: 'Sluiten', + prevText: '←', + nextText: '→', + currentText: 'Vandaag', + monthNames: ['januari', 'februari', 'maart', 'april', 'mei', 'juni', + 'juli', 'augustus', 'september', 'oktober', 'november', 'december'], + monthNamesShort: ['jan', 'feb', 'maa', 'apr', 'mei', 'jun', + 'jul', 'aug', 'sep', 'okt', 'nov', 'dec'], + dayNames: ['zondag', 'maandag', 'dinsdag', 'woensdag', 'donderdag', 'vrijdag', 'zaterdag'], + dayNamesShort: ['zon', 'maa', 'din', 'woe', 'don', 'vri', 'zat'], + dayNamesMin: ['zo', 'ma', 'di', 'wo', 'do', 'vr', 'za'], + weekHeader: 'Wk', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['nl-BE']); +});
\ No newline at end of file diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-nl.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-nl.js new file mode 100644 index 000000000..663d6bb26 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-nl.js @@ -0,0 +1,23 @@ +/* Dutch (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Mathias Bynens <http://mathiasbynens.be/> */ +jQuery(function($){ + $.datepicker.regional.nl = { + closeText: 'Sluiten', + prevText: '←', + nextText: '→', + currentText: 'Vandaag', + monthNames: ['januari', 'februari', 'maart', 'april', 'mei', 'juni', + 'juli', 'augustus', 'september', 'oktober', 'november', 'december'], + monthNamesShort: ['jan', 'feb', 'maa', 'apr', 'mei', 'jun', + 'jul', 'aug', 'sep', 'okt', 'nov', 'dec'], + dayNames: ['zondag', 'maandag', 'dinsdag', 'woensdag', 'donderdag', 'vrijdag', 'zaterdag'], + dayNamesShort: ['zon', 'maa', 'din', 'woe', 'don', 'vri', 'zat'], + dayNamesMin: ['zo', 'ma', 'di', 'wo', 'do', 'vr', 'za'], + weekHeader: 'Wk', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional.nl); +});
\ No newline at end of file diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-no.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-no.js new file mode 100644 index 000000000..12b2356bf --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-no.js @@ -0,0 +1,23 @@ +/* Norwegian initialisation for the jQuery UI date picker plugin. */ +/* Written by Naimdjon Takhirov (naimdjon@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['no'] = { + closeText: 'Lukk', + prevText: '«Forrige', + nextText: 'Neste»', + currentText: 'I dag', + monthNames: ['Januar','Februar','Mars','April','Mai','Juni', + 'Juli','August','September','Oktober','November','Desember'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Mai','Jun', + 'Jul','Aug','Sep','Okt','Nov','Des'], + dayNamesShort: ['Søn','Man','Tir','Ons','Tor','Fre','Lør'], + dayNames: ['Søndag','Mandag','Tirsdag','Onsdag','Torsdag','Fredag','Lørdag'], + dayNamesMin: ['Sø','Ma','Ti','On','To','Fr','Lø'], + weekHeader: 'Uke', + dateFormat: 'yy-mm-dd', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['no']); +}); diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-pl.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-pl.js new file mode 100644 index 000000000..61fa29ccd --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-pl.js @@ -0,0 +1,23 @@ +/* Polish initialisation for the jQuery UI date picker plugin. */ +/* Written by Jacek Wysocki (jacek.wysocki@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['pl'] = { + closeText: 'Zamknij', + prevText: '<Poprzedni', + nextText: 'Następny>', + currentText: 'Dziś', + monthNames: ['Styczeń','Luty','Marzec','Kwiecień','Maj','Czerwiec', + 'Lipiec','Sierpień','Wrzesień','Październik','Listopad','Grudzień'], + monthNamesShort: ['Sty','Lu','Mar','Kw','Maj','Cze', + 'Lip','Sie','Wrz','Pa','Lis','Gru'], + dayNames: ['Niedziela','Poniedziałek','Wtorek','Środa','Czwartek','Piątek','Sobota'], + dayNamesShort: ['Nie','Pn','Wt','Śr','Czw','Pt','So'], + dayNamesMin: ['N','Pn','Wt','Śr','Cz','Pt','So'], + weekHeader: 'Tydz', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['pl']); +}); diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-pt-BR.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-pt-BR.js new file mode 100644 index 000000000..3cc8c796c --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-pt-BR.js @@ -0,0 +1,23 @@ +/* Brazilian initialisation for the jQuery UI date picker plugin. */ +/* Written by Leonildo Costa Silva (leocsilva@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['pt-BR'] = { + closeText: 'Fechar', + prevText: '<Anterior', + nextText: 'Próximo>', + currentText: 'Hoje', + monthNames: ['Janeiro','Fevereiro','Março','Abril','Maio','Junho', + 'Julho','Agosto','Setembro','Outubro','Novembro','Dezembro'], + monthNamesShort: ['Jan','Fev','Mar','Abr','Mai','Jun', + 'Jul','Ago','Set','Out','Nov','Dez'], + dayNames: ['Domingo','Segunda-feira','Terça-feira','Quarta-feira','Quinta-feira','Sexta-feira','Sábado'], + dayNamesShort: ['Dom','Seg','Ter','Qua','Qui','Sex','Sáb'], + dayNamesMin: ['Dom','Seg','Ter','Qua','Qui','Sex','Sáb'], + weekHeader: 'Sm', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['pt-BR']); +});
\ No newline at end of file diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-pt.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-pt.js new file mode 100644 index 000000000..f09f5aeb0 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-pt.js @@ -0,0 +1,22 @@ +/* Portuguese initialisation for the jQuery UI date picker plugin. */ +jQuery(function($){ + $.datepicker.regional['pt'] = { + closeText: 'Fechar', + prevText: '<Anterior', + nextText: 'Seguinte', + currentText: 'Hoje', + monthNames: ['Janeiro','Fevereiro','Março','Abril','Maio','Junho', + 'Julho','Agosto','Setembro','Outubro','Novembro','Dezembro'], + monthNamesShort: ['Jan','Fev','Mar','Abr','Mai','Jun', + 'Jul','Ago','Set','Out','Nov','Dez'], + dayNames: ['Domingo','Segunda-feira','Terça-feira','Quarta-feira','Quinta-feira','Sexta-feira','Sábado'], + dayNamesShort: ['Dom','Seg','Ter','Qua','Qui','Sex','Sáb'], + dayNamesMin: ['Dom','Seg','Ter','Qua','Qui','Sex','Sáb'], + weekHeader: 'Sem', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['pt']); +});
\ No newline at end of file diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ro.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ro.js new file mode 100644 index 000000000..4fe95aeac --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ro.js @@ -0,0 +1,26 @@ +/* Romanian initialisation for the jQuery UI date picker plugin. + * + * Written by Edmond L. (ll_edmond@walla.com) + * and Ionut G. Stan (ionut.g.stan@gmail.com) + */ +jQuery(function($){ + $.datepicker.regional['ro'] = { + closeText: 'Închide', + prevText: '« Luna precedentă', + nextText: 'Luna următoare »', + currentText: 'Azi', + monthNames: ['Ianuarie','Februarie','Martie','Aprilie','Mai','Iunie', + 'Iulie','August','Septembrie','Octombrie','Noiembrie','Decembrie'], + monthNamesShort: ['Ian', 'Feb', 'Mar', 'Apr', 'Mai', 'Iun', + 'Iul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], + dayNames: ['Duminică', 'Luni', 'Marţi', 'Miercuri', 'Joi', 'Vineri', 'Sâmbătă'], + dayNamesShort: ['Dum', 'Lun', 'Mar', 'Mie', 'Joi', 'Vin', 'Sâm'], + dayNamesMin: ['Du','Lu','Ma','Mi','Jo','Vi','Sâ'], + weekHeader: 'Săpt', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['ro']); +}); diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ru.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ru.js new file mode 100644 index 000000000..50a461352 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ru.js @@ -0,0 +1,23 @@ +/* Russian (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Andrew Stromnov (stromnov@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['ru'] = { + closeText: 'Закрыть', + prevText: '<Пред', + nextText: 'След>', + currentText: 'Сегодня', + monthNames: ['Январь','Февраль','Март','Апрель','Май','Июнь', + 'Июль','Август','Сентябрь','Октябрь','Ноябрь','Декабрь'], + monthNamesShort: ['Янв','Фев','Мар','Апр','Май','Июн', + 'Июл','Авг','Сен','Окт','Ноя','Дек'], + dayNames: ['воскресенье','понедельник','вторник','среда','четверг','пятница','суббота'], + dayNamesShort: ['вск','пнд','втр','срд','чтв','птн','сбт'], + dayNamesMin: ['Вс','Пн','Вт','Ср','Чт','Пт','Сб'], + weekHeader: 'Нед', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['ru']); +});
\ No newline at end of file diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-sk.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-sk.js new file mode 100644 index 000000000..8a6771c1e --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-sk.js @@ -0,0 +1,23 @@ +/* Slovak initialisation for the jQuery UI date picker plugin. */ +/* Written by Vojtech Rinik (vojto@hmm.sk). */ +jQuery(function($){ + $.datepicker.regional['sk'] = { + closeText: 'Zavrieť', + prevText: '<Predchádzajúci', + nextText: 'Nasledujúci>', + currentText: 'Dnes', + monthNames: ['Január','Február','Marec','Apríl','Máj','Jún', + 'Júl','August','September','Október','November','December'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Máj','Jún', + 'Júl','Aug','Sep','Okt','Nov','Dec'], + dayNames: ['Nedel\'a','Pondelok','Utorok','Streda','Štvrtok','Piatok','Sobota'], + dayNamesShort: ['Ned','Pon','Uto','Str','Štv','Pia','Sob'], + dayNamesMin: ['Ne','Po','Ut','St','Št','Pia','So'], + weekHeader: 'Ty', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['sk']); +}); diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-sl.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-sl.js new file mode 100644 index 000000000..516550192 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-sl.js @@ -0,0 +1,24 @@ +/* Slovenian initialisation for the jQuery UI date picker plugin. */ +/* Written by Jaka Jancar (jaka@kubje.org). */ +/* c = č, s = š z = ž C = Č S = Š Z = Ž */ +jQuery(function($){ + $.datepicker.regional['sl'] = { + closeText: 'Zapri', + prevText: '<Prejšnji', + nextText: 'Naslednji>', + currentText: 'Trenutni', + monthNames: ['Januar','Februar','Marec','April','Maj','Junij', + 'Julij','Avgust','September','Oktober','November','December'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun', + 'Jul','Avg','Sep','Okt','Nov','Dec'], + dayNames: ['Nedelja','Ponedeljek','Torek','Sreda','Četrtek','Petek','Sobota'], + dayNamesShort: ['Ned','Pon','Tor','Sre','Čet','Pet','Sob'], + dayNamesMin: ['Ne','Po','To','Sr','Če','Pe','So'], + weekHeader: 'Teden', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['sl']); +}); diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-sq.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-sq.js new file mode 100644 index 000000000..be84104c0 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-sq.js @@ -0,0 +1,23 @@ +/* Albanian initialisation for the jQuery UI date picker plugin. */ +/* Written by Flakron Bytyqi (flakron@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['sq'] = { + closeText: 'mbylle', + prevText: '<mbrapa', + nextText: 'Përpara>', + currentText: 'sot', + monthNames: ['Janar','Shkurt','Mars','Prill','Maj','Qershor', + 'Korrik','Gusht','Shtator','Tetor','Nëntor','Dhjetor'], + monthNamesShort: ['Jan','Shk','Mar','Pri','Maj','Qer', + 'Kor','Gus','Sht','Tet','Nën','Dhj'], + dayNames: ['E Diel','E Hënë','E Martë','E Mërkurë','E Enjte','E Premte','E Shtune'], + dayNamesShort: ['Di','Hë','Ma','Më','En','Pr','Sh'], + dayNamesMin: ['Di','Hë','Ma','Më','En','Pr','Sh'], + weekHeader: 'Ja', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['sq']); +}); diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-sr-SR.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-sr-SR.js new file mode 100644 index 000000000..8f8ea5e63 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-sr-SR.js @@ -0,0 +1,23 @@ +/* Serbian i18n for the jQuery UI date picker plugin. */ +/* Written by Dejan Dimić. */ +jQuery(function($){ + $.datepicker.regional['sr-SR'] = { + closeText: 'Zatvori', + prevText: '<', + nextText: '>', + currentText: 'Danas', + monthNames: ['Januar','Februar','Mart','April','Maj','Jun', + 'Jul','Avgust','Septembar','Oktobar','Novembar','Decembar'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun', + 'Jul','Avg','Sep','Okt','Nov','Dec'], + dayNames: ['Nedelja','Ponedeljak','Utorak','Sreda','Četvrtak','Petak','Subota'], + dayNamesShort: ['Ned','Pon','Uto','Sre','Čet','Pet','Sub'], + dayNamesMin: ['Ne','Po','Ut','Sr','Če','Pe','Su'], + weekHeader: 'Sed', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['sr-SR']); +}); diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-sr.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-sr.js new file mode 100644 index 000000000..49c9b4a30 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-sr.js @@ -0,0 +1,23 @@ +/* Serbian i18n for the jQuery UI date picker plugin. */ +/* Written by Dejan Dimić. */ +jQuery(function($){ + $.datepicker.regional['sr'] = { + closeText: 'Затвори', + prevText: '<', + nextText: '>', + currentText: 'Данас', + monthNames: ['Јануар','Фебруар','Март','Април','Мај','Јун', + 'Јул','Август','Септембар','Октобар','Новембар','Децембар'], + monthNamesShort: ['Јан','Феб','Мар','Апр','Мај','Јун', + 'Јул','Авг','Сеп','Окт','Нов','Дец'], + dayNames: ['Недеља','Понедељак','Уторак','Среда','Четвртак','Петак','Субота'], + dayNamesShort: ['Нед','Пон','Уто','Сре','Чет','Пет','Суб'], + dayNamesMin: ['Не','По','Ут','Ср','Че','Пе','Су'], + weekHeader: 'Сед', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['sr']); +}); diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-sv.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-sv.js new file mode 100644 index 000000000..8236b62b5 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-sv.js @@ -0,0 +1,23 @@ +/* Swedish initialisation for the jQuery UI date picker plugin. */ +/* Written by Anders Ekdahl ( anders@nomadiz.se). */ +jQuery(function($){ + $.datepicker.regional['sv'] = { + closeText: 'Stäng', + prevText: '«Förra', + nextText: 'Nästa»', + currentText: 'Idag', + monthNames: ['Januari','Februari','Mars','April','Maj','Juni', + 'Juli','Augusti','September','Oktober','November','December'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun', + 'Jul','Aug','Sep','Okt','Nov','Dec'], + dayNamesShort: ['Sön','Mån','Tis','Ons','Tor','Fre','Lör'], + dayNames: ['Söndag','Måndag','Tisdag','Onsdag','Torsdag','Fredag','Lördag'], + dayNamesMin: ['Sö','Må','Ti','On','To','Fr','Lö'], + weekHeader: 'Ve', + dateFormat: 'yy-mm-dd', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['sv']); +}); diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ta.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ta.js new file mode 100644 index 000000000..91116d387 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ta.js @@ -0,0 +1,23 @@ +/* Tamil (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by S A Sureshkumar (saskumar@live.com). */ +jQuery(function($){ + $.datepicker.regional['ta'] = { + closeText: 'மூடு', + prevText: 'முன்னையது', + nextText: 'அடுத்தது', + currentText: 'இன்று', + monthNames: ['தை','மாசி','பங்குனி','சித்திரை','வைகாசி','ஆனி', + 'ஆடி','ஆவணி','புரட்டாசி','ஐப்பசி','கார்த்திகை','மார்கழி'], + monthNamesShort: ['தை','மாசி','பங்','சித்','வைகா','ஆனி', + 'ஆடி','ஆவ','புர','ஐப்','கார்','மார்'], + dayNames: ['ஞாயிற்றுக்கிழமை','திங்கட்கிழமை','செவ்வாய்க்கிழமை','புதன்கிழமை','வியாழக்கிழமை','வெள்ளிக்கிழமை','சனிக்கிழமை'], + dayNamesShort: ['ஞாயிறு','திங்கள்','செவ்வாய்','புதன்','வியாழன்','வெள்ளி','சனி'], + dayNamesMin: ['ஞா','தி','செ','பு','வி','வெ','ச'], + weekHeader: 'Не', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['ta']); +}); diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-th.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-th.js new file mode 100644 index 000000000..978500ab1 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-th.js @@ -0,0 +1,23 @@ +/* Thai initialisation for the jQuery UI date picker plugin. */ +/* Written by pipo (pipo@sixhead.com). */ +jQuery(function($){ + $.datepicker.regional['th'] = { + closeText: 'ปิด', + prevText: '« ย้อน', + nextText: 'ถัดไป »', + currentText: 'วันนี้', + monthNames: ['มกราคม','กุมภาพันธ์','มีนาคม','เมษายน','พฤษภาคม','มิถุนายน', + 'กรกฏาคม','สิงหาคม','กันยายน','ตุลาคม','พฤศจิกายน','ธันวาคม'], + monthNamesShort: ['ม.ค.','ก.พ.','มี.ค.','เม.ย.','พ.ค.','มิ.ย.', + 'ก.ค.','ส.ค.','ก.ย.','ต.ค.','พ.ย.','ธ.ค.'], + dayNames: ['อาทิตย์','จันทร์','อังคาร','พุธ','พฤหัสบดี','ศุกร์','เสาร์'], + dayNamesShort: ['อา.','จ.','อ.','พ.','พฤ.','ศ.','ส.'], + dayNamesMin: ['อา.','จ.','อ.','พ.','พฤ.','ศ.','ส.'], + weekHeader: 'Wk', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['th']); +});
\ No newline at end of file diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-tr.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-tr.js new file mode 100644 index 000000000..dedfc7ff9 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-tr.js @@ -0,0 +1,23 @@ +/* Turkish initialisation for the jQuery UI date picker plugin. */ +/* Written by Izzet Emre Erkan (kara@karalamalar.net). */ +jQuery(function($){ + $.datepicker.regional['tr'] = { + closeText: 'kapat', + prevText: '<geri', + nextText: 'ileri>', + currentText: 'bugün', + monthNames: ['Ocak','Şubat','Mart','Nisan','Mayıs','Haziran', + 'Temmuz','Ağustos','Eylül','Ekim','Kasım','Aralık'], + monthNamesShort: ['Oca','Şub','Mar','Nis','May','Haz', + 'Tem','Ağu','Eyl','Eki','Kas','Ara'], + dayNames: ['Pazar','Pazartesi','Salı','Çarşamba','Perşembe','Cuma','Cumartesi'], + dayNamesShort: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'], + dayNamesMin: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'], + weekHeader: 'Hf', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['tr']); +});
\ No newline at end of file diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-uk.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-uk.js new file mode 100644 index 000000000..112b40e7f --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-uk.js @@ -0,0 +1,23 @@ +/* Ukrainian (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Maxim Drogobitskiy (maxdao@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['uk'] = { + closeText: 'Закрити', + prevText: '<', + nextText: '>', + currentText: 'Сьогодні', + monthNames: ['Січень','Лютий','Березень','Квітень','Травень','Червень', + 'Липень','Серпень','Вересень','Жовтень','Листопад','Грудень'], + monthNamesShort: ['Січ','Лют','Бер','Кві','Тра','Чер', + 'Лип','Сер','Вер','Жов','Лис','Гру'], + dayNames: ['неділя','понеділок','вівторок','середа','четвер','п’ятниця','субота'], + dayNamesShort: ['нед','пнд','вів','срд','чтв','птн','сбт'], + dayNamesMin: ['Нд','Пн','Вт','Ср','Чт','Пт','Сб'], + weekHeader: 'Не', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['uk']); +});
\ No newline at end of file diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-vi.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-vi.js new file mode 100644 index 000000000..9813a59e0 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-vi.js @@ -0,0 +1,23 @@ +/* Vietnamese initialisation for the jQuery UI date picker plugin. */ +/* Translated by Le Thanh Huy (lthanhhuy@cit.ctu.edu.vn). */ +jQuery(function($){ + $.datepicker.regional['vi'] = { + closeText: 'Đóng', + prevText: '<Trước', + nextText: 'Tiếp>', + currentText: 'Hôm nay', + monthNames: ['Tháng Một', 'Tháng Hai', 'Tháng Ba', 'Tháng Tư', 'Tháng Năm', 'Tháng Sáu', + 'Tháng Bảy', 'Tháng Tám', 'Tháng Chín', 'Tháng Mười', 'Tháng Mười Một', 'Tháng Mười Hai'], + monthNamesShort: ['Tháng 1', 'Tháng 2', 'Tháng 3', 'Tháng 4', 'Tháng 5', 'Tháng 6', + 'Tháng 7', 'Tháng 8', 'Tháng 9', 'Tháng 10', 'Tháng 11', 'Tháng 12'], + dayNames: ['Chủ Nhật', 'Thứ Hai', 'Thứ Ba', 'Thứ Tư', 'Thứ Năm', 'Thứ Sáu', 'Thứ Bảy'], + dayNamesShort: ['CN', 'T2', 'T3', 'T4', 'T5', 'T6', 'T7'], + dayNamesMin: ['CN', 'T2', 'T3', 'T4', 'T5', 'T6', 'T7'], + weekHeader: 'Tu', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['vi']); +}); diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-zh-CN.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-zh-CN.js new file mode 100644 index 000000000..6c4883f53 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-zh-CN.js @@ -0,0 +1,23 @@ +/* Chinese initialisation for the jQuery UI date picker plugin. */ +/* Written by Cloudream (cloudream@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['zh-CN'] = { + closeText: '关闭', + prevText: '<上月', + nextText: '下月>', + currentText: '今天', + monthNames: ['一月','二月','三月','四月','五月','六月', + '七月','八月','九月','十月','十一月','十二月'], + monthNamesShort: ['一','二','三','四','五','六', + '七','八','九','十','十一','十二'], + dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'], + dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'], + dayNamesMin: ['日','一','二','三','四','五','六'], + weekHeader: '周', + dateFormat: 'yy-mm-dd', + firstDay: 1, + isRTL: false, + showMonthAfterYear: true, + yearSuffix: '年'}; + $.datepicker.setDefaults($.datepicker.regional['zh-CN']); +}); diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-zh-HK.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-zh-HK.js new file mode 100644 index 000000000..06c4c628c --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-zh-HK.js @@ -0,0 +1,23 @@ +/* Chinese initialisation for the jQuery UI date picker plugin. */ +/* Written by SCCY (samuelcychan@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['zh-HK'] = { + closeText: '關閉', + prevText: '<上月', + nextText: '下月>', + currentText: '今天', + monthNames: ['一月','二月','三月','四月','五月','六月', + '七月','八月','九月','十月','十一月','十二月'], + monthNamesShort: ['一','二','三','四','五','六', + '七','八','九','十','十一','十二'], + dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'], + dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'], + dayNamesMin: ['日','一','二','三','四','五','六'], + weekHeader: '周', + dateFormat: 'dd-mm-yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: true, + yearSuffix: '年'}; + $.datepicker.setDefaults($.datepicker.regional['zh-HK']); +}); diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-zh-TW.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-zh-TW.js new file mode 100644 index 000000000..d211573c6 --- /dev/null +++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-zh-TW.js @@ -0,0 +1,23 @@ +/* Chinese initialisation for the jQuery UI date picker plugin. */ +/* Written by Ressol (ressol@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['zh-TW'] = { + closeText: '關閉', + prevText: '<上月', + nextText: '下月>', + currentText: '今天', + monthNames: ['一月','二月','三月','四月','五月','六月', + '七月','八月','九月','十月','十一月','十二月'], + monthNamesShort: ['一','二','三','四','五','六', + '七','八','九','十','十一','十二'], + dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'], + dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'], + dayNamesMin: ['日','一','二','三','四','五','六'], + weekHeader: '周', + dateFormat: 'yy/mm/dd', + firstDay: 1, + isRTL: false, + showMonthAfterYear: true, + yearSuffix: '年'}; + $.datepicker.setDefaults($.datepicker.regional['zh-TW']); +}); diff --git a/plugins/jqueryui/js/jquery-ui-1.8.14.custom.min.js b/plugins/jqueryui/js/jquery-ui-1.8.14.custom.min.js new file mode 100755 index 000000000..f9e4f1e84 --- /dev/null +++ b/plugins/jqueryui/js/jquery-ui-1.8.14.custom.min.js @@ -0,0 +1,789 @@ +/*! + * jQuery UI 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI + */ +(function(c,j){function k(a,b){var d=a.nodeName.toLowerCase();if("area"===d){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&l(a)}return(/input|select|textarea|button|object/.test(d)?!a.disabled:"a"==d?a.href||b:b)&&l(a)}function l(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.14", +keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=this;setTimeout(function(){c(d).focus(); +b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this,"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this, +"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection", +function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,m,n){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(m)g-=parseFloat(c.curCSS(f,"border"+this+"Width",true))||0;if(n)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight,outerWidth:c.fn.outerWidth, +outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h,d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){return k(a,!isNaN(c.attr(a,"tabindex")))},tabbable:function(a){var b=c.attr(a,"tabindex"),d=isNaN(b); +return(d||b>=0)&&k(a,!d)}});c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&a.element[0].parentNode)for(var e= +0;e<b.length;e++)a.options[b[e][0]]&&b[e][1].apply(a.element,d)}},contains:function(a,b){return document.compareDocumentPosition?a.compareDocumentPosition(b)&16:a!==b&&a.contains(b)},hasScroll:function(a,b){if(c(a).css("overflow")==="hidden")return false;b=b&&b==="left"?"scrollLeft":"scrollTop";var d=false;if(a[b]>0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a<b+d},isOver:function(a,b,d,e,h,i){return c.ui.isOverAxis(a,d,h)&&c.ui.isOverAxis(b,e,i)}})}})(jQuery); +;/*! + * jQuery UI Widget 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Widget + */ +(function(b,j){if(b.cleanData){var k=b.cleanData;b.cleanData=function(a){for(var c=0,d;(d=a[c])!=null;c++)b(d).triggerHandler("remove");k(a)}}else{var l=b.fn.remove;b.fn.remove=function(a,c){return this.each(function(){if(!c)if(!a||b.filter(a,[this]).length)b("*",this).add([this]).each(function(){b(this).triggerHandler("remove")});return l.call(b(this),a,c)})}}b.widget=function(a,c,d){var e=a.split(".")[0],f;a=a.split(".")[1];f=e+"-"+a;if(!d){d=c;c=b.Widget}b.expr[":"][f]=function(h){return!!b.data(h, +a)};b[e]=b[e]||{};b[e][a]=function(h,g){arguments.length&&this._createWidget(h,g)};c=new c;c.options=b.extend(true,{},c.options);b[e][a].prototype=b.extend(true,c,{namespace:e,widgetName:a,widgetEventPrefix:b[e][a].prototype.widgetEventPrefix||a,widgetBaseClass:f},d);b.widget.bridge(a,b[e][a])};b.widget.bridge=function(a,c){b.fn[a]=function(d){var e=typeof d==="string",f=Array.prototype.slice.call(arguments,1),h=this;d=!e&&f.length?b.extend.apply(null,[true,d].concat(f)):d;if(e&&d.charAt(0)==="_")return h; +e?this.each(function(){var g=b.data(this,a),i=g&&b.isFunction(g[d])?g[d].apply(g,f):g;if(i!==g&&i!==j){h=i;return false}}):this.each(function(){var g=b.data(this,a);g?g.option(d||{})._init():b.data(this,a,new c(d,this))});return h}};b.Widget=function(a,c){arguments.length&&this._createWidget(a,c)};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(a,c){b.data(c,this.widgetName,this);this.element=b(c);this.options=b.extend(true,{},this.options, +this._getCreateOptions(),a);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")}, +widget:function(){return this.element},option:function(a,c){var d=a;if(arguments.length===0)return b.extend({},this.options);if(typeof a==="string"){if(c===j)return this.options[a];d={};d[a]=c}this._setOptions(d);return this},_setOptions:function(a){var c=this;b.each(a,function(d,e){c._setOption(d,e)});return this},_setOption:function(a,c){this.options[a]=c;if(a==="disabled")this.widget()[c?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",c);return this}, +enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(a,c,d){var e=this.options[a];c=b.Event(c);c.type=(a===this.widgetEventPrefix?a:this.widgetEventPrefix+a).toLowerCase();d=d||{};if(c.originalEvent){a=b.event.props.length;for(var f;a;){f=b.event.props[--a];c[f]=c.originalEvent[f]}}this.element.trigger(c,d);return!(b.isFunction(e)&&e.call(this.element[0],c,d)===false||c.isDefaultPrevented())}}})(jQuery); +;/*! + * jQuery UI Mouse 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Mouse + * + * Depends: + * jquery.ui.widget.js + */ +(function(b){var d=false;b(document).mousedown(function(){d=false});b.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var a=this;this.element.bind("mousedown."+this.widgetName,function(c){return a._mouseDown(c)}).bind("click."+this.widgetName,function(c){if(true===b.data(c.target,a.widgetName+".preventClickEvent")){b.removeData(c.target,a.widgetName+".preventClickEvent");c.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+ +this.widgetName)},_mouseDown:function(a){if(!d){this._mouseStarted&&this._mouseUp(a);this._mouseDownEvent=a;var c=this,f=a.which==1,g=typeof this.options.cancel=="string"?b(a.target).closest(this.options.cancel).length:false;if(!f||g||!this._mouseCapture(a))return true;this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet)this._mouseDelayTimer=setTimeout(function(){c.mouseDelayMet=true},this.options.delay);if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a)){this._mouseStarted=this._mouseStart(a)!== +false;if(!this._mouseStarted){a.preventDefault();return true}}true===b.data(a.target,this.widgetName+".preventClickEvent")&&b.removeData(a.target,this.widgetName+".preventClickEvent");this._mouseMoveDelegate=function(e){return c._mouseMove(e)};this._mouseUpDelegate=function(e){return c._mouseUp(e)};b(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);a.preventDefault();return d=true}},_mouseMove:function(a){if(b.browser.msie&& +!(document.documentMode>=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted= +false;a.target==this._mouseDownEvent.target&&b.data(a.target,this.widgetName+".preventClickEvent",true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery); +;/* + * jQuery UI Position 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Position + */ +(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY, +left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+= +k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))||0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))||0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-= +m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left= +d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+= +a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b), +g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery); +;/* + * jQuery UI Draggable 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Draggables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function(d){d.widget("ui.draggable",d.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper== +"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b= +this.options;if(this.helper||b.disabled||d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;d(b.iframeFix===true?"iframe":b.iframeFix).each(function(){d('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(d(this).offset()).appendTo("body")});return true},_mouseStart:function(a){var b=this.options;this.helper= +this._createHelper(a);this._cacheHelperProportions();if(d.ui.ddmanager)d.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}); +this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions();d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);d.ui.ddmanager&&d.ui.ddmanager.dragStart(this,a);return true}, +_mouseDrag:function(a,b){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b= +false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b=d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!b||this.options.revert=="valid"&&b||this.options.revert===true||d.isFunction(this.options.revert)&&this.options.revert.call(this.element,b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration, +10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop",a)!==false&&this._clear();return false},_mouseUp:function(a){this.options.iframeFix===true&&d("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)});d.ui.ddmanager&&d.ui.ddmanager.dragStop(this,a);return d.ui.mouse.prototype._mouseUp.call(this,a)},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle|| +!d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone().removeAttr("id"):this.element;a.parents("body").length||a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed|absolute)/.test(a.css("position"))&& +a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent= +this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"), +10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"), +10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[a.containment=="document"?0:d(window).scrollLeft()-this.offset.relative.left-this.offset.parent.left,a.containment=="document"?0:d(window).scrollTop()-this.offset.relative.top-this.offset.parent.top, +(a.containment=="document"?0:d(window).scrollLeft())+d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a.containment=="document"?0:d(window).scrollTop())+(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)&&a.containment.constructor!=Array){a=d(a.containment);var b=a[0];if(b){a.offset();var c=d(b).css("overflow")!= +"hidden";this.containment=[(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0),(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0),(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"), +10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom];this.relative_container=a}}else if(a.containment.constructor==Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName);return{top:b.top+ +this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&& +!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName),e=a.pageX,h=a.pageY;if(this.originalPosition){var g;if(this.containment){if(this.relative_container){g=this.relative_container.offset();g=[this.containment[0]+g.left,this.containment[1]+g.top,this.containment[2]+g.left,this.containment[3]+g.top]}else g=this.containment;if(a.pageX-this.offset.click.left<g[0])e=g[0]+this.offset.click.left; +if(a.pageY-this.offset.click.top<g[1])h=g[1]+this.offset.click.top;if(a.pageX-this.offset.click.left>g[2])e=g[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>g[3])h=g[3]+this.offset.click.top}if(b.grid){h=b.grid[1]?this.originalPageY+Math.round((h-this.originalPageY)/b.grid[1])*b.grid[1]:this.originalPageY;h=g?!(h-this.offset.click.top<g[1]||h-this.offset.click.top>g[3])?h:!(h-this.offset.click.top<g[1])?h-b.grid[1]:h+b.grid[1]:h;e=b.grid[0]?this.originalPageX+Math.round((e-this.originalPageX)/ +b.grid[0])*b.grid[0]:this.originalPageX;e=g?!(e-this.offset.click.left<g[0]||e-this.offset.click.left>g[2])?e:!(e-this.offset.click.left<g[0])?e-b.grid[0]:e+b.grid[0]:e}}return{top:h-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop()),left:e-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&d.browser.version< +526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())}},_clear:function(){this.helper.removeClass("ui-draggable-dragging");this.helper[0]!=this.element[0]&&!this.cancelHelperRemoval&&this.helper.remove();this.helper=null;this.cancelHelperRemoval=false},_trigger:function(a,b,c){c=c||this._uiHash();d.ui.plugin.call(this,a,[b,c]);if(a=="drag")this.positionAbs=this._convertPositionTo("absolute");return d.Widget.prototype._trigger.call(this,a,b, +c)},plugins:{},_uiHash:function(){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition,offset:this.positionAbs}}});d.extend(d.ui.draggable,{version:"1.8.14"});d.ui.plugin.add("draggable","connectToSortable",{start:function(a,b){var c=d(this).data("draggable"),f=c.options,e=d.extend({},b,{item:c.element});c.sortables=[];d(f.connectToSortable).each(function(){var h=d.data(this,"sortable");if(h&&!h.options.disabled){c.sortables.push({instance:h,shouldRevert:h.options.revert}); +h.refreshPositions();h._trigger("activate",a,e)}})},stop:function(a,b){var c=d(this).data("draggable"),f=d.extend({},b,{item:c.element});d.each(c.sortables,function(){if(this.instance.isOver){this.instance.isOver=0;c.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert)this.instance.options.revert=true;this.instance._mouseStop(a);this.instance.options.helper=this.instance.options._helper;c.options.helper=="original"&&this.instance.currentItem.css({top:"auto",left:"auto"})}else{this.instance.cancelHelperRemoval= +false;this.instance._trigger("deactivate",a,f)}})},drag:function(a,b){var c=d(this).data("draggable"),f=this;d.each(c.sortables,function(){this.instance.positionAbs=c.positionAbs;this.instance.helperProportions=c.helperProportions;this.instance.offset.click=c.offset.click;if(this.instance._intersectsWith(this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=1;this.instance.currentItem=d(f).clone().removeAttr("id").appendTo(this.instance.element).data("sortable-item",true); +this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return b.helper[0]};a.target=this.instance.currentItem[0];this.instance._mouseCapture(a,true);this.instance._mouseStart(a,true,true);this.instance.offset.click.top=c.offset.click.top;this.instance.offset.click.left=c.offset.click.left;this.instance.offset.parent.left-=c.offset.parent.left-this.instance.offset.parent.left;this.instance.offset.parent.top-=c.offset.parent.top-this.instance.offset.parent.top; +c._trigger("toSortable",a);c.dropped=this.instance.element;c.currentItem=c.element;this.instance.fromOutside=c}this.instance.currentItem&&this.instance._mouseDrag(a)}else if(this.instance.isOver){this.instance.isOver=0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._trigger("out",a,this.instance._uiHash(this.instance));this.instance._mouseStop(a,true);this.instance.options.helper=this.instance.options._helper;this.instance.currentItem.remove();this.instance.placeholder&& +this.instance.placeholder.remove();c._trigger("fromSortable",a);c.dropped=false}})}});d.ui.plugin.add("draggable","cursor",{start:function(){var a=d("body"),b=d(this).data("draggable").options;if(a.css("cursor"))b._cursor=a.css("cursor");a.css("cursor",b.cursor)},stop:function(){var a=d(this).data("draggable").options;a._cursor&&d("body").css("cursor",a._cursor)}});d.ui.plugin.add("draggable","opacity",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("opacity"))b._opacity= +a.css("opacity");a.css("opacity",b.opacity)},stop:function(a,b){a=d(this).data("draggable").options;a._opacity&&d(b.helper).css("opacity",a._opacity)}});d.ui.plugin.add("draggable","scroll",{start:function(){var a=d(this).data("draggable");if(a.scrollParent[0]!=document&&a.scrollParent[0].tagName!="HTML")a.overflowOffset=a.scrollParent.offset()},drag:function(a){var b=d(this).data("draggable"),c=b.options,f=false;if(b.scrollParent[0]!=document&&b.scrollParent[0].tagName!="HTML"){if(!c.axis||c.axis!= +"x")if(b.overflowOffset.top+b.scrollParent[0].offsetHeight-a.pageY<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop+c.scrollSpeed;else if(a.pageY-b.overflowOffset.top<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop-c.scrollSpeed;if(!c.axis||c.axis!="y")if(b.overflowOffset.left+b.scrollParent[0].offsetWidth-a.pageX<c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft+c.scrollSpeed;else if(a.pageX-b.overflowOffset.left< +c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft-c.scrollSpeed}else{if(!c.axis||c.axis!="x")if(a.pageY-d(document).scrollTop()<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()-c.scrollSpeed);else if(d(window).height()-(a.pageY-d(document).scrollTop())<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()+c.scrollSpeed);if(!c.axis||c.axis!="y")if(a.pageX-d(document).scrollLeft()<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()- +c.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()+c.scrollSpeed)}f!==false&&d.ui.ddmanager&&!c.dropBehaviour&&d.ui.ddmanager.prepareOffsets(b,a)}});d.ui.plugin.add("draggable","snap",{start:function(){var a=d(this).data("draggable"),b=a.options;a.snapElements=[];d(b.snap.constructor!=String?b.snap.items||":data(draggable)":b.snap).each(function(){var c=d(this),f=c.offset();this!=a.element[0]&&a.snapElements.push({item:this, +width:c.outerWidth(),height:c.outerHeight(),top:f.top,left:f.left})})},drag:function(a,b){for(var c=d(this).data("draggable"),f=c.options,e=f.snapTolerance,h=b.offset.left,g=h+c.helperProportions.width,n=b.offset.top,o=n+c.helperProportions.height,i=c.snapElements.length-1;i>=0;i--){var j=c.snapElements[i].left,l=j+c.snapElements[i].width,k=c.snapElements[i].top,m=k+c.snapElements[i].height;if(j-e<h&&h<l+e&&k-e<n&&n<m+e||j-e<h&&h<l+e&&k-e<o&&o<m+e||j-e<g&&g<l+e&&k-e<n&&n<m+e||j-e<g&&g<l+e&&k-e<o&& +o<m+e){if(f.snapMode!="inner"){var p=Math.abs(k-o)<=e,q=Math.abs(m-n)<=e,r=Math.abs(j-g)<=e,s=Math.abs(l-h)<=e;if(p)b.position.top=c._convertPositionTo("relative",{top:k-c.helperProportions.height,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",{top:m,left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:j-c.helperProportions.width}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:l}).left-c.margins.left}var t= +p||q||r||s;if(f.snapMode!="outer"){p=Math.abs(k-n)<=e;q=Math.abs(m-o)<=e;r=Math.abs(j-h)<=e;s=Math.abs(l-g)<=e;if(p)b.position.top=c._convertPositionTo("relative",{top:k,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",{top:m-c.helperProportions.height,left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:j}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:l-c.helperProportions.width}).left-c.margins.left}if(!c.snapElements[i].snapping&& +(p||q||r||s||t))c.options.snap.snap&&c.options.snap.snap.call(c.element,a,d.extend(c._uiHash(),{snapItem:c.snapElements[i].item}));c.snapElements[i].snapping=p||q||r||s||t}else{c.snapElements[i].snapping&&c.options.snap.release&&c.options.snap.release.call(c.element,a,d.extend(c._uiHash(),{snapItem:c.snapElements[i].item}));c.snapElements[i].snapping=false}}}});d.ui.plugin.add("draggable","stack",{start:function(){var a=d(this).data("draggable").options;a=d.makeArray(d(a.stack)).sort(function(c,f){return(parseInt(d(c).css("zIndex"), +10)||0)-(parseInt(d(f).css("zIndex"),10)||0)});if(a.length){var b=parseInt(a[0].style.zIndex)||0;d(a).each(function(c){this.style.zIndex=b+c});this[0].style.zIndex=b+a.length}}});d.ui.plugin.add("draggable","zIndex",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("zIndex"))b._zIndex=a.css("zIndex");a.css("zIndex",b.zIndex)},stop:function(a,b){a=d(this).data("draggable").options;a._zIndex&&d(b.helper).css("zIndex",a._zIndex)}})})(jQuery); +;/* + * jQuery UI Droppable 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Droppables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.mouse.js + * jquery.ui.draggable.js + */ +(function(d){d.widget("ui.droppable",{widgetEventPrefix:"drop",options:{accept:"*",activeClass:false,addClasses:true,greedy:false,hoverClass:false,scope:"default",tolerance:"intersect"},_create:function(){var a=this.options,b=a.accept;this.isover=0;this.isout=1;this.accept=d.isFunction(b)?b:function(c){return c.is(b)};this.proportions={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight};d.ui.ddmanager.droppables[a.scope]=d.ui.ddmanager.droppables[a.scope]||[];d.ui.ddmanager.droppables[a.scope].push(this); +a.addClasses&&this.element.addClass("ui-droppable")},destroy:function(){for(var a=d.ui.ddmanager.droppables[this.options.scope],b=0;b<a.length;b++)a[b]==this&&a.splice(b,1);this.element.removeClass("ui-droppable ui-droppable-disabled").removeData("droppable").unbind(".droppable");return this},_setOption:function(a,b){if(a=="accept")this.accept=d.isFunction(b)?b:function(c){return c.is(b)};d.Widget.prototype._setOption.apply(this,arguments)},_activate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&& +this.element.addClass(this.options.activeClass);b&&this._trigger("activate",a,this.ui(b))},_deactivate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&&this.element.removeClass(this.options.activeClass);b&&this._trigger("deactivate",a,this.ui(b))},_over:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.addClass(this.options.hoverClass); +this._trigger("over",a,this.ui(b))}},_out:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("out",a,this.ui(b))}},_drop:function(a,b){var c=b||d.ui.ddmanager.current;if(!c||(c.currentItem||c.element)[0]==this.element[0])return false;var e=false;this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function(){var g= +d.data(this,"droppable");if(g.options.greedy&&!g.options.disabled&&g.options.scope==c.options.scope&&g.accept.call(g.element[0],c.currentItem||c.element)&&d.ui.intersect(c,d.extend(g,{offset:g.element.offset()}),g.options.tolerance)){e=true;return false}});if(e)return false;if(this.accept.call(this.element[0],c.currentItem||c.element)){this.options.activeClass&&this.element.removeClass(this.options.activeClass);this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("drop", +a,this.ui(c));return this.element}return false},ui:function(a){return{draggable:a.currentItem||a.element,helper:a.helper,position:a.position,offset:a.positionAbs}}});d.extend(d.ui.droppable,{version:"1.8.14"});d.ui.intersect=function(a,b,c){if(!b.offset)return false;var e=(a.positionAbs||a.position.absolute).left,g=e+a.helperProportions.width,f=(a.positionAbs||a.position.absolute).top,h=f+a.helperProportions.height,i=b.offset.left,k=i+b.proportions.width,j=b.offset.top,l=j+b.proportions.height; +switch(c){case "fit":return i<=e&&g<=k&&j<=f&&h<=l;case "intersect":return i<e+a.helperProportions.width/2&&g-a.helperProportions.width/2<k&&j<f+a.helperProportions.height/2&&h-a.helperProportions.height/2<l;case "pointer":return d.ui.isOver((a.positionAbs||a.position.absolute).top+(a.clickOffset||a.offset.click).top,(a.positionAbs||a.position.absolute).left+(a.clickOffset||a.offset.click).left,j,i,b.proportions.height,b.proportions.width);case "touch":return(f>=j&&f<=l||h>=j&&h<=l||f<j&&h>l)&&(e>= +i&&e<=k||g>=i&&g<=k||e<i&&g>k);default:return false}};d.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(a,b){var c=d.ui.ddmanager.droppables[a.options.scope]||[],e=b?b.type:null,g=(a.currentItem||a.element).find(":data(droppable)").andSelf(),f=0;a:for(;f<c.length;f++)if(!(c[f].options.disabled||a&&!c[f].accept.call(c[f].element[0],a.currentItem||a.element))){for(var h=0;h<g.length;h++)if(g[h]==c[f].element[0]){c[f].proportions.height=0;continue a}c[f].visible=c[f].element.css("display")!= +"none";if(c[f].visible){e=="mousedown"&&c[f]._activate.call(c[f],b);c[f].offset=c[f].element.offset();c[f].proportions={width:c[f].element[0].offsetWidth,height:c[f].element[0].offsetHeight}}}},drop:function(a,b){var c=false;d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(this.options){if(!this.options.disabled&&this.visible&&d.ui.intersect(a,this,this.options.tolerance))c=c||this._drop.call(this,b);if(!this.options.disabled&&this.visible&&this.accept.call(this.element[0],a.currentItem|| +a.element)){this.isout=1;this.isover=0;this._deactivate.call(this,b)}}});return c},dragStart:function(a,b){a.element.parentsUntil("body").bind("scroll.droppable",function(){a.options.refreshPositions||d.ui.ddmanager.prepareOffsets(a,b)})},drag:function(a,b){a.options.refreshPositions&&d.ui.ddmanager.prepareOffsets(a,b);d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(!(this.options.disabled||this.greedyChild||!this.visible)){var c=d.ui.intersect(a,this,this.options.tolerance);if(c= +!c&&this.isover==1?"isout":c&&this.isover==0?"isover":null){var e;if(this.options.greedy){var g=this.element.parents(":data(droppable):eq(0)");if(g.length){e=d.data(g[0],"droppable");e.greedyChild=c=="isover"?1:0}}if(e&&c=="isover"){e.isover=0;e.isout=1;e._out.call(e,b)}this[c]=1;this[c=="isout"?"isover":"isout"]=0;this[c=="isover"?"_over":"_out"].call(this,b);if(e&&c=="isout"){e.isout=0;e.isover=1;e._over.call(e,b)}}}})},dragStop:function(a,b){a.element.parentsUntil("body").unbind("scroll.droppable"); +a.options.refreshPositions||d.ui.ddmanager.prepareOffsets(a,b)}}})(jQuery); +;/* + * jQuery UI Resizable 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Resizables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function(e){e.widget("ui.resizable",e.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1E3},_create:function(){var b=this,a=this.options;this.element.addClass("ui-resizable");e.extend(this,{_aspectRatio:!!a.aspectRatio,aspectRatio:a.aspectRatio,originalElement:this.element, +_proportionallyResizeElements:[],_helper:a.helper||a.ghost||a.animate?a.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){/relative/.test(this.element.css("position"))&&e.browser.opera&&this.element.css({position:"relative",top:"auto",left:"auto"});this.element.wrap(e('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(), +top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle= +this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=a.handles||(!e(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne", +nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var c=this.handles.split(",");this.handles={};for(var d=0;d<c.length;d++){var f=e.trim(c[d]),g=e('<div class="ui-resizable-handle '+("ui-resizable-"+f)+'"></div>');/sw|se|ne|nw/.test(f)&&g.css({zIndex:++a.zIndex});"se"==f&&g.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[f]=".ui-resizable-"+f;this.element.append(g)}}this._renderAxis=function(h){h=h||this.element;for(var i in this.handles){if(this.handles[i].constructor== +String)this.handles[i]=e(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var j=e(this.handles[i],this.element),l=0;l=/sw|ne|nw|se|n|s/.test(i)?j.outerHeight():j.outerWidth();j=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join("");h.css(j,l);this._proportionallyResize()}e(this.handles[i])}};this._renderAxis(this.element);this._handles=e(".ui-resizable-handle",this.element).disableSelection(); +this._handles.mouseover(function(){if(!b.resizing){if(this.className)var h=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=h&&h[1]?h[1]:"se"}});if(a.autoHide){this._handles.hide();e(this.element).addClass("ui-resizable-autohide").hover(function(){if(!a.disabled){e(this).removeClass("ui-resizable-autohide");b._handles.show()}},function(){if(!a.disabled)if(!b.resizing){e(this).addClass("ui-resizable-autohide");b._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy(); +var b=function(c){e(c).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){b(this.element);var a=this.element;a.after(this.originalElement.css({position:a.css("position"),width:a.outerWidth(),height:a.outerHeight(),top:a.css("top"),left:a.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);b(this.originalElement);return this},_mouseCapture:function(b){var a= +false;for(var c in this.handles)if(e(this.handles[c])[0]==b.target)a=true;return!this.options.disabled&&a},_mouseStart:function(b){var a=this.options,c=this.element.position(),d=this.element;this.resizing=true;this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:c.top,left:c.left});e.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"}); +this._renderProxy();c=m(this.helper.css("left"));var f=m(this.helper.css("top"));if(a.containment){c+=e(a.containment).scrollLeft()||0;f+=e(a.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:c,top:f};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:c,top:f};this.sizeDiff= +{width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:b.pageX,top:b.pageY};this.aspectRatio=typeof a.aspectRatio=="number"?a.aspectRatio:this.originalSize.width/this.originalSize.height||1;a=e(".ui-resizable-"+this.axis).css("cursor");e("body").css("cursor",a=="auto"?this.axis+"-resize":a);d.addClass("ui-resizable-resizing");this._propagate("start",b);return true},_mouseDrag:function(b){var a=this.helper,c=this.originalMousePosition,d=this._change[this.axis]; +if(!d)return false;c=d.apply(this,[b,b.pageX-c.left||0,b.pageY-c.top||0]);this._updateVirtualBoundaries(b.shiftKey);if(this._aspectRatio||b.shiftKey)c=this._updateRatio(c,b);c=this._respectSize(c,b);this._propagate("resize",b);a.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(c);this._trigger("resize",b,this.ui());return false}, +_mouseStop:function(b){this.resizing=false;var a=this.options,c=this;if(this._helper){var d=this._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName);d=f&&e.ui.hasScroll(d[0],"left")?0:c.sizeDiff.height;f=f?0:c.sizeDiff.width;f={width:c.helper.width()-f,height:c.helper.height()-d};d=parseInt(c.element.css("left"),10)+(c.position.left-c.originalPosition.left)||null;var g=parseInt(c.element.css("top"),10)+(c.position.top-c.originalPosition.top)||null;a.animate||this.element.css(e.extend(f, +{top:g,left:d}));c.helper.height(c.size.height);c.helper.width(c.size.width);this._helper&&!a.animate&&this._proportionallyResize()}e("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",b);this._helper&&this.helper.remove();return false},_updateVirtualBoundaries:function(b){var a=this.options,c,d,f;a={minWidth:k(a.minWidth)?a.minWidth:0,maxWidth:k(a.maxWidth)?a.maxWidth:Infinity,minHeight:k(a.minHeight)?a.minHeight:0,maxHeight:k(a.maxHeight)?a.maxHeight: +Infinity};if(this._aspectRatio||b){b=a.minHeight*this.aspectRatio;d=a.minWidth/this.aspectRatio;c=a.maxHeight*this.aspectRatio;f=a.maxWidth/this.aspectRatio;if(b>a.minWidth)a.minWidth=b;if(d>a.minHeight)a.minHeight=d;if(c<a.maxWidth)a.maxWidth=c;if(f<a.maxHeight)a.maxHeight=f}this._vBoundaries=a},_updateCache:function(b){this.offset=this.helper.offset();if(k(b.left))this.position.left=b.left;if(k(b.top))this.position.top=b.top;if(k(b.height))this.size.height=b.height;if(k(b.width))this.size.width= +b.width},_updateRatio:function(b){var a=this.position,c=this.size,d=this.axis;if(k(b.height))b.width=b.height*this.aspectRatio;else if(k(b.width))b.height=b.width/this.aspectRatio;if(d=="sw"){b.left=a.left+(c.width-b.width);b.top=null}if(d=="nw"){b.top=a.top+(c.height-b.height);b.left=a.left+(c.width-b.width)}return b},_respectSize:function(b){var a=this._vBoundaries,c=this.axis,d=k(b.width)&&a.maxWidth&&a.maxWidth<b.width,f=k(b.height)&&a.maxHeight&&a.maxHeight<b.height,g=k(b.width)&&a.minWidth&& +a.minWidth>b.width,h=k(b.height)&&a.minHeight&&a.minHeight>b.height;if(g)b.width=a.minWidth;if(h)b.height=a.minHeight;if(d)b.width=a.maxWidth;if(f)b.height=a.maxHeight;var i=this.originalPosition.left+this.originalSize.width,j=this.position.top+this.size.height,l=/sw|nw|w/.test(c);c=/nw|ne|n/.test(c);if(g&&l)b.left=i-a.minWidth;if(d&&l)b.left=i-a.maxWidth;if(h&&c)b.top=j-a.minHeight;if(f&&c)b.top=j-a.maxHeight;if((a=!b.width&&!b.height)&&!b.left&&b.top)b.top=null;else if(a&&!b.top&&b.left)b.left= +null;return b},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var b=this.helper||this.element,a=0;a<this._proportionallyResizeElements.length;a++){var c=this._proportionallyResizeElements[a];if(!this.borderDif){var d=[c.css("borderTopWidth"),c.css("borderRightWidth"),c.css("borderBottomWidth"),c.css("borderLeftWidth")],f=[c.css("paddingTop"),c.css("paddingRight"),c.css("paddingBottom"),c.css("paddingLeft")];this.borderDif=e.map(d,function(g,h){g=parseInt(g,10)|| +0;h=parseInt(f[h],10)||0;return g+h})}e.browser.msie&&(e(b).is(":hidden")||e(b).parents(":hidden").length)||c.css({height:b.height()-this.borderDif[0]-this.borderDif[2]||0,width:b.width()-this.borderDif[1]-this.borderDif[3]||0})}},_renderProxy:function(){var b=this.options;this.elementOffset=this.element.offset();if(this._helper){this.helper=this.helper||e('<div style="overflow:hidden;"></div>');var a=e.browser.msie&&e.browser.version<7,c=a?1:0;a=a?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+ +a,height:this.element.outerHeight()+a,position:"absolute",left:this.elementOffset.left-c+"px",top:this.elementOffset.top-c+"px",zIndex:++b.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(b,a){return{width:this.originalSize.width+a}},w:function(b,a){return{left:this.originalPosition.left+a,width:this.originalSize.width-a}},n:function(b,a,c){return{top:this.originalPosition.top+c,height:this.originalSize.height-c}},s:function(b,a,c){return{height:this.originalSize.height+ +c}},se:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},sw:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,a,c]))},ne:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},nw:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,a,c]))}},_propagate:function(b,a){e.ui.plugin.call(this,b,[a,this.ui()]); +b!="resize"&&this._trigger(b,a,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});e.extend(e.ui.resizable,{version:"1.8.14"});e.ui.plugin.add("resizable","alsoResize",{start:function(){var b=e(this).data("resizable").options,a=function(c){e(c).each(function(){var d=e(this);d.data("resizable-alsoresize",{width:parseInt(d.width(), +10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};if(typeof b.alsoResize=="object"&&!b.alsoResize.parentNode)if(b.alsoResize.length){b.alsoResize=b.alsoResize[0];a(b.alsoResize)}else e.each(b.alsoResize,function(c){a(c)});else a(b.alsoResize)},resize:function(b,a){var c=e(this).data("resizable");b=c.options;var d=c.originalSize,f=c.originalPosition,g={height:c.size.height-d.height||0,width:c.size.width-d.width||0,top:c.position.top- +f.top||0,left:c.position.left-f.left||0},h=function(i,j){e(i).each(function(){var l=e(this),q=e(this).data("resizable-alsoresize"),p={},r=j&&j.length?j:l.parents(a.originalElement[0]).length?["width","height"]:["width","height","top","left"];e.each(r,function(n,o){if((n=(q[o]||0)+(g[o]||0))&&n>=0)p[o]=n||null});if(e.browser.opera&&/relative/.test(l.css("position"))){c._revertToRelativePosition=true;l.css({position:"absolute",top:"auto",left:"auto"})}l.css(p)})};typeof b.alsoResize=="object"&&!b.alsoResize.nodeType? +e.each(b.alsoResize,function(i,j){h(i,j)}):h(b.alsoResize)},stop:function(){var b=e(this).data("resizable"),a=b.options,c=function(d){e(d).each(function(){var f=e(this);f.css({position:f.data("resizable-alsoresize").position})})};if(b._revertToRelativePosition){b._revertToRelativePosition=false;typeof a.alsoResize=="object"&&!a.alsoResize.nodeType?e.each(a.alsoResize,function(d){c(d)}):c(a.alsoResize)}e(this).removeData("resizable-alsoresize")}});e.ui.plugin.add("resizable","animate",{stop:function(b){var a= +e(this).data("resizable"),c=a.options,d=a._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName),g=f&&e.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height;f={width:a.size.width-(f?0:a.sizeDiff.width),height:a.size.height-g};g=parseInt(a.element.css("left"),10)+(a.position.left-a.originalPosition.left)||null;var h=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;a.element.animate(e.extend(f,h&&g?{top:h,left:g}:{}),{duration:c.animateDuration,easing:c.animateEasing, +step:function(){var i={width:parseInt(a.element.css("width"),10),height:parseInt(a.element.css("height"),10),top:parseInt(a.element.css("top"),10),left:parseInt(a.element.css("left"),10)};d&&d.length&&e(d[0]).css({width:i.width,height:i.height});a._updateCache(i);a._propagate("resize",b)}})}});e.ui.plugin.add("resizable","containment",{start:function(){var b=e(this).data("resizable"),a=b.element,c=b.options.containment;if(a=c instanceof e?c.get(0):/parent/.test(c)?a.parent().get(0):c){b.containerElement= +e(a);if(/document/.test(c)||c==document){b.containerOffset={left:0,top:0};b.containerPosition={left:0,top:0};b.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()||document.body.parentNode.scrollHeight}}else{var d=e(a),f=[];e(["Top","Right","Left","Bottom"]).each(function(i,j){f[i]=m(d.css("padding"+j))});b.containerOffset=d.offset();b.containerPosition=d.position();b.containerSize={height:d.innerHeight()-f[3],width:d.innerWidth()-f[1]};c=b.containerOffset; +var g=b.containerSize.height,h=b.containerSize.width;h=e.ui.hasScroll(a,"left")?a.scrollWidth:h;g=e.ui.hasScroll(a)?a.scrollHeight:g;b.parentData={element:a,left:c.left,top:c.top,width:h,height:g}}}},resize:function(b){var a=e(this).data("resizable"),c=a.options,d=a.containerOffset,f=a.position;b=a._aspectRatio||b.shiftKey;var g={top:0,left:0},h=a.containerElement;if(h[0]!=document&&/static/.test(h.css("position")))g=d;if(f.left<(a._helper?d.left:0)){a.size.width+=a._helper?a.position.left-d.left: +a.position.left-g.left;if(b)a.size.height=a.size.width/c.aspectRatio;a.position.left=c.helper?d.left:0}if(f.top<(a._helper?d.top:0)){a.size.height+=a._helper?a.position.top-d.top:a.position.top;if(b)a.size.width=a.size.height*c.aspectRatio;a.position.top=a._helper?d.top:0}a.offset.left=a.parentData.left+a.position.left;a.offset.top=a.parentData.top+a.position.top;c=Math.abs((a._helper?a.offset.left-g.left:a.offset.left-g.left)+a.sizeDiff.width);d=Math.abs((a._helper?a.offset.top-g.top:a.offset.top- +d.top)+a.sizeDiff.height);f=a.containerElement.get(0)==a.element.parent().get(0);g=/relative|absolute/.test(a.containerElement.css("position"));if(f&&g)c-=a.parentData.left;if(c+a.size.width>=a.parentData.width){a.size.width=a.parentData.width-c;if(b)a.size.height=a.size.width/a.aspectRatio}if(d+a.size.height>=a.parentData.height){a.size.height=a.parentData.height-d;if(b)a.size.width=a.size.height*a.aspectRatio}},stop:function(){var b=e(this).data("resizable"),a=b.options,c=b.containerOffset,d=b.containerPosition, +f=b.containerElement,g=e(b.helper),h=g.offset(),i=g.outerWidth()-b.sizeDiff.width;g=g.outerHeight()-b.sizeDiff.height;b._helper&&!a.animate&&/relative/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g});b._helper&&!a.animate&&/static/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g})}});e.ui.plugin.add("resizable","ghost",{start:function(){var b=e(this).data("resizable"),a=b.options,c=b.size;b.ghost=b.originalElement.clone();b.ghost.css({opacity:0.25, +display:"block",position:"relative",height:c.height,width:c.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof a.ghost=="string"?a.ghost:"");b.ghost.appendTo(b.helper)},resize:function(){var b=e(this).data("resizable");b.ghost&&b.ghost.css({position:"relative",height:b.size.height,width:b.size.width})},stop:function(){var b=e(this).data("resizable");b.ghost&&b.helper&&b.helper.get(0).removeChild(b.ghost.get(0))}});e.ui.plugin.add("resizable","grid",{resize:function(){var b= +e(this).data("resizable"),a=b.options,c=b.size,d=b.originalSize,f=b.originalPosition,g=b.axis;a.grid=typeof a.grid=="number"?[a.grid,a.grid]:a.grid;var h=Math.round((c.width-d.width)/(a.grid[0]||1))*(a.grid[0]||1);a=Math.round((c.height-d.height)/(a.grid[1]||1))*(a.grid[1]||1);if(/^(se|s|e)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else if(/^(ne)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}else{if(/^(sw)$/.test(g)){b.size.width=d.width+h;b.size.height= +d.height+a}else{b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}b.position.left=f.left-h}}});var m=function(b){return parseInt(b,10)||0},k=function(b){return!isNaN(parseInt(b,10))}})(jQuery); +;/* + * jQuery UI Selectable 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function(e){e.widget("ui.selectable",e.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var c=this;this.element.addClass("ui-selectable");this.dragged=false;var f;this.refresh=function(){f=e(c.options.filter,c.element[0]);f.each(function(){var d=e(this),b=d.offset();e.data(this,"selectable-item",{element:this,$element:d,left:b.left,top:b.top,right:b.left+d.outerWidth(),bottom:b.top+d.outerHeight(),startselected:false,selected:d.hasClass("ui-selected"), +selecting:d.hasClass("ui-selecting"),unselecting:d.hasClass("ui-unselecting")})})};this.refresh();this.selectees=f.addClass("ui-selectee");this._mouseInit();this.helper=e("<div class='ui-selectable-helper'></div>")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(c){var f=this;this.opos=[c.pageX, +c.pageY];if(!this.options.disabled){var d=this.options;this.selectees=e(d.filter,this.element[0]);this._trigger("start",c);e(d.appendTo).append(this.helper);this.helper.css({left:c.clientX,top:c.clientY,width:0,height:0});d.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var b=e.data(this,"selectable-item");b.startselected=true;if(!c.metaKey){b.$element.removeClass("ui-selected");b.selected=false;b.$element.addClass("ui-unselecting");b.unselecting=true;f._trigger("unselecting", +c,{unselecting:b.element})}});e(c.target).parents().andSelf().each(function(){var b=e.data(this,"selectable-item");if(b){var g=!c.metaKey||!b.$element.hasClass("ui-selected");b.$element.removeClass(g?"ui-unselecting":"ui-selected").addClass(g?"ui-selecting":"ui-unselecting");b.unselecting=!g;b.selecting=g;(b.selected=g)?f._trigger("selecting",c,{selecting:b.element}):f._trigger("unselecting",c,{unselecting:b.element});return false}})}},_mouseDrag:function(c){var f=this;this.dragged=true;if(!this.options.disabled){var d= +this.options,b=this.opos[0],g=this.opos[1],h=c.pageX,i=c.pageY;if(b>h){var j=h;h=b;b=j}if(g>i){j=i;i=g;g=j}this.helper.css({left:b,top:g,width:h-b,height:i-g});this.selectees.each(function(){var a=e.data(this,"selectable-item");if(!(!a||a.element==f.element[0])){var k=false;if(d.tolerance=="touch")k=!(a.left>h||a.right<b||a.top>i||a.bottom<g);else if(d.tolerance=="fit")k=a.left>b&&a.right<h&&a.top>g&&a.bottom<i;if(k){if(a.selected){a.$element.removeClass("ui-selected");a.selected=false}if(a.unselecting){a.$element.removeClass("ui-unselecting"); +a.unselecting=false}if(!a.selecting){a.$element.addClass("ui-selecting");a.selecting=true;f._trigger("selecting",c,{selecting:a.element})}}else{if(a.selecting)if(c.metaKey&&a.startselected){a.$element.removeClass("ui-selecting");a.selecting=false;a.$element.addClass("ui-selected");a.selected=true}else{a.$element.removeClass("ui-selecting");a.selecting=false;if(a.startselected){a.$element.addClass("ui-unselecting");a.unselecting=true}f._trigger("unselecting",c,{unselecting:a.element})}if(a.selected)if(!c.metaKey&& +!a.startselected){a.$element.removeClass("ui-selected");a.selected=false;a.$element.addClass("ui-unselecting");a.unselecting=true;f._trigger("unselecting",c,{unselecting:a.element})}}}});return false}},_mouseStop:function(c){var f=this;this.dragged=false;e(".ui-unselecting",this.element[0]).each(function(){var d=e.data(this,"selectable-item");d.$element.removeClass("ui-unselecting");d.unselecting=false;d.startselected=false;f._trigger("unselected",c,{unselected:d.element})});e(".ui-selecting",this.element[0]).each(function(){var d= +e.data(this,"selectable-item");d.$element.removeClass("ui-selecting").addClass("ui-selected");d.selecting=false;d.selected=true;d.startselected=true;f._trigger("selected",c,{selected:d.element})});this._trigger("stop",c);this.helper.remove();return false}});e.extend(e.ui.selectable,{version:"1.8.14"})})(jQuery); +;/* + * jQuery UI Sortable 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Sortables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function(d){d.widget("ui.sortable",d.ui.mouse,{widgetEventPrefix:"sort",options:{appendTo:"parent",axis:false,connectWith:false,containment:false,cursor:"auto",cursorAt:false,dropOnEmpty:true,forcePlaceholderSize:false,forceHelperSize:false,grid:false,handle:false,helper:"original",items:"> *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){var a=this.options;this.containerCache={};this.element.addClass("ui-sortable"); +this.refresh();this.floating=this.items.length?a.axis==="x"||/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var a=this.items.length-1;a>=0;a--)this.items[a].item.removeData("sortable-item");return this},_setOption:function(a,b){if(a=== +"disabled"){this.options[a]=b;this.widget()[b?"addClass":"removeClass"]("ui-sortable-disabled")}else d.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(a,b){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(a);var c=null,e=this;d(a.target).parents().each(function(){if(d.data(this,"sortable-item")==e){c=d(this);return false}});if(d.data(a.target,"sortable-item")==e)c=d(a.target);if(!c)return false;if(this.options.handle&& +!b){var f=false;d(this.options.handle,c).find("*").andSelf().each(function(){if(this==a.target)f=true});if(!f)return false}this.currentItem=c;this._removeCurrentsFromItems();return true},_mouseStart:function(a,b,c){b=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(a);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top, +left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]}; +this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();b.containment&&this._setContainment();if(b.cursor){if(d("body").css("cursor"))this._storedCursor=d("body").css("cursor");d("body").css("cursor",b.cursor)}if(b.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",b.opacity)}if(b.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",b.zIndex)}if(this.scrollParent[0]!= +document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",a,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!c)for(c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("activate",a,e._uiHash(this));if(d.ui.ddmanager)d.ui.ddmanager.current=this;d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(a); +return true},_mouseDrag:function(a){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var b=this.options,c=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-a.pageY<b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop+b.scrollSpeed;else if(a.pageY-this.overflowOffset.top< +b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop-b.scrollSpeed;if(this.overflowOffset.left+this.scrollParent[0].offsetWidth-a.pageX<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft+b.scrollSpeed;else if(a.pageX-this.overflowOffset.left<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft-b.scrollSpeed}else{if(a.pageY-d(document).scrollTop()<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()- +b.scrollSpeed);else if(d(window).height()-(a.pageY-d(document).scrollTop())<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()+b.scrollSpeed);if(a.pageX-d(document).scrollLeft()<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()-b.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()+b.scrollSpeed)}c!==false&&d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this, +a)}this.positionAbs=this._convertPositionTo("absolute");if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";for(b=this.items.length-1;b>=0;b--){c=this.items[b];var e=c.item[0],f=this._intersectsWithPointer(c);if(f)if(e!=this.currentItem[0]&&this.placeholder[f==1?"next":"prev"]()[0]!=e&&!d.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!d.ui.contains(this.element[0], +e):true)){this.direction=f==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(c))this._rearrange(a,c);else break;this._trigger("change",a,this._uiHash());break}}this._contactContainers(a);d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);this._trigger("sort",a,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(a,b){if(a){d.ui.ddmanager&&!this.options.dropBehaviour&&d.ui.ddmanager.drop(this,a);if(this.options.revert){var c=this;b=c.placeholder.offset(); +c.reverting=true;d(this.helper).animate({left:b.left-this.offset.parent.left-c.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:b.top-this.offset.parent.top-c.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){c._clear(a)})}else this._clear(a,b);return false}},cancel:function(){var a=this;if(this.dragging){this._mouseUp({target:null});this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"): +this.currentItem.show();for(var b=this.containers.length-1;b>=0;b--){this.containers[b]._trigger("deactivate",null,a._uiHash(this));if(this.containers[b].containerCache.over){this.containers[b]._trigger("out",null,a._uiHash(this));this.containers[b].containerCache.over=0}}}if(this.placeholder){this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();d.extend(this,{helper:null, +dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?d(this.domPosition.prev).after(this.currentItem):d(this.domPosition.parent).prepend(this.currentItem)}return this},serialize:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};d(b).each(function(){var e=(d(a.item||this).attr(a.attribute||"id")||"").match(a.expression||/(.+)[-=_](.+)/);if(e)c.push((a.key||e[1]+"[]")+"="+(a.key&&a.expression?e[1]:e[2]))});!c.length&&a.key&&c.push(a.key+"=");return c.join("&")}, +toArray:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};b.each(function(){c.push(d(a.item||this).attr(a.attribute||"id")||"")});return c},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,e=this.positionAbs.top,f=e+this.helperProportions.height,g=a.left,h=g+a.width,i=a.top,k=i+a.height,j=this.offset.click.top,l=this.offset.click.left;j=e+j>i&&e+j<k&&b+l>g&&b+l<h;return this.options.tolerance=="pointer"||this.options.forcePointerForContainers|| +this.options.tolerance!="pointer"&&this.helperProportions[this.floating?"width":"height"]>a[this.floating?"width":"height"]?j:g<b+this.helperProportions.width/2&&c-this.helperProportions.width/2<h&&i<e+this.helperProportions.height/2&&f-this.helperProportions.height/2<k},_intersectsWithPointer:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left,a.width);b=b&&a;a=this._getDragVerticalDirection(); +var c=this._getDragHorizontalDirection();if(!b)return false;return this.floating?c&&c=="right"||a=="down"?2:1:a&&(a=="down"?2:1)},_intersectsWithSides:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top+a.height/2,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left+a.width/2,a.width);var c=this._getDragVerticalDirection(),e=this._getDragHorizontalDirection();return this.floating&&e?e=="right"&&a||e=="left"&&!a:c&&(c=="down"&&b||c=="up"&&!b)}, +_getDragVerticalDirection:function(){var a=this.positionAbs.top-this.lastPositionAbs.top;return a!=0&&(a>0?"down":"up")},_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){this._refreshItems(a);this.refreshPositions();return this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(a){var b=[],c=[],e=this._connectWith(); +if(e&&a)for(a=e.length-1;a>=0;a--)for(var f=d(e[a]),g=f.length-1;g>=0;g--){var h=d.data(f[g],"sortable");if(h&&h!=this&&!h.options.disabled)c.push([d.isFunction(h.options.items)?h.options.items.call(h.element):d(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}c.push([d.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):d(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"), +this]);for(a=c.length-1;a>=0;a--)c[a][0].each(function(){b.push(this)});return d(b)},_removeCurrentsFromItems:function(){for(var a=this.currentItem.find(":data(sortable-item)"),b=0;b<this.items.length;b++)for(var c=0;c<a.length;c++)a[c]==this.items[b].item[0]&&this.items.splice(b,1)},_refreshItems:function(a){this.items=[];this.containers=[this];var b=this.items,c=[[d.isFunction(this.options.items)?this.options.items.call(this.element[0],a,{item:this.currentItem}):d(this.options.items,this.element), +this]],e=this._connectWith();if(e)for(var f=e.length-1;f>=0;f--)for(var g=d(e[f]),h=g.length-1;h>=0;h--){var i=d.data(g[h],"sortable");if(i&&i!=this&&!i.options.disabled){c.push([d.isFunction(i.options.items)?i.options.items.call(i.element[0],a,{item:this.currentItem}):d(i.options.items,i.element),i]);this.containers.push(i)}}for(f=c.length-1;f>=0;f--){a=c[f][1];e=c[f][0];h=0;for(g=e.length;h<g;h++){i=d(e[h]);i.data("sortable-item",a);b.push({item:i,instance:a,width:0,height:0,left:0,top:0})}}},refreshPositions:function(a){if(this.offsetParent&& +this.helper)this.offset.parent=this._getParentOffset();for(var b=this.items.length-1;b>=0;b--){var c=this.items[b];if(!(c.instance!=this.currentContainer&&this.currentContainer&&c.item[0]!=this.currentItem[0])){var e=this.options.toleranceElement?d(this.options.toleranceElement,c.item):c.item;if(!a){c.width=e.outerWidth();c.height=e.outerHeight()}e=e.offset();c.left=e.left;c.top=e.top}}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(b= +this.containers.length-1;b>=0;b--){e=this.containers[b].element.offset();this.containers[b].containerCache.left=e.left;this.containers[b].containerCache.top=e.top;this.containers[b].containerCache.width=this.containers[b].element.outerWidth();this.containers[b].containerCache.height=this.containers[b].element.outerHeight()}return this},_createPlaceholder:function(a){var b=a||this,c=b.options;if(!c.placeholder||c.placeholder.constructor==String){var e=c.placeholder;c.placeholder={element:function(){var f= +d(document.createElement(b.currentItem[0].nodeName)).addClass(e||b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!e)f.style.visibility="hidden";return f},update:function(f,g){if(!(e&&!c.forcePlaceholderSize)){g.height()||g.height(b.currentItem.innerHeight()-parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10));g.width()||g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")|| +0,10))}}}}b.placeholder=d(c.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder);c.placeholder.update(b,b.placeholder)},_contactContainers:function(a){for(var b=null,c=null,e=this.containers.length-1;e>=0;e--)if(!d.ui.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(b&&d.ui.contains(this.containers[e].element[0],b.element[0]))){b=this.containers[e];c=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out", +a,this._uiHash(this));this.containers[e].containerCache.over=0}if(b)if(this.containers.length===1){this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}else if(this.currentContainer!=this.containers[c]){b=1E4;e=null;for(var f=this.positionAbs[this.containers[c].floating?"left":"top"],g=this.items.length-1;g>=0;g--)if(d.ui.contains(this.containers[c].element[0],this.items[g].item[0])){var h=this.items[g][this.containers[c].floating?"left":"top"];if(Math.abs(h- +f)<b){b=Math.abs(h-f);e=this.items[g]}}if(e||this.options.dropOnEmpty){this.currentContainer=this.containers[c];e?this._rearrange(a,e,null,true):this._rearrange(a,null,this.containers[c].element,true);this._trigger("change",a,this._uiHash());this.containers[c]._trigger("change",a,this._uiHash(this));this.options.placeholder.update(this.currentContainer,this.placeholder);this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}}},_createHelper:function(a){var b= +this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a,this.currentItem])):b.helper=="clone"?this.currentItem.clone():this.currentItem;a.parents("body").length||d(b.appendTo!="parent"?b.appendTo:this.currentItem[0].parentNode)[0].appendChild(a[0]);if(a[0]==this.currentItem[0])this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")};if(a[0].style.width== +""||b.forceHelperSize)a.width(this.currentItem.width());if(a[0].style.height==""||b.forceHelperSize)a.height(this.currentItem.height());return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top= +this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a= +{top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.currentItem.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.currentItem.css("marginLeft"), +10)||0,top:parseInt(this.currentItem.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,d(a.containment=="document"? +document:window).width()-this.helperProportions.width-this.margins.left,(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)){var b=d(a.containment)[0];a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0)-this.margins.left,a.top+(parseInt(d(b).css("borderTopWidth"), +10)||0)+(parseInt(d(b).css("paddingTop"),10)||0)-this.margins.top,a.left+(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(a,b){if(!b)b= +this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&& +this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);if(this.cssPosition=="relative"&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0]))this.offset.relative=this._getRelativeOffset(); +var f=a.pageX,g=a.pageY;if(this.originalPosition){if(this.containment){if(a.pageX-this.offset.click.left<this.containment[0])f=this.containment[0]+this.offset.click.left;if(a.pageY-this.offset.click.top<this.containment[1])g=this.containment[1]+this.offset.click.top;if(a.pageX-this.offset.click.left>this.containment[2])f=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g- +this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.top<this.containment[1]||g-this.offset.click.top>this.containment[3])?g:!(g-this.offset.click.top<this.containment[1])?g-b.grid[1]:g+b.grid[1]:g;f=this.originalPageX+Math.round((f-this.originalPageX)/b.grid[0])*b.grid[0];f=this.containment?!(f-this.offset.click.left<this.containment[0]||f-this.offset.click.left>this.containment[2])?f:!(f-this.offset.click.left<this.containment[0])?f-b.grid[0]:f+b.grid[0]:f}}return{top:g- +this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop()),left:f-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:c.scrollLeft())}},_rearrange:function(a,b,c,e){c?c[0].appendChild(this.placeholder[0]):b.item[0].parentNode.insertBefore(this.placeholder[0], +this.direction=="down"?b.item[0]:b.item[0].nextSibling);this.counter=this.counter?++this.counter:1;var f=this,g=this.counter;window.setTimeout(function(){g==f.counter&&f.refreshPositions(!e)},0)},_clear:function(a,b){this.reverting=false;var c=[];!this._noFinalSort&&this.currentItem.parent().length&&this.placeholder.before(this.currentItem);this._noFinalSort=null;if(this.helper[0]==this.currentItem[0]){for(var e in this._storedCSS)if(this._storedCSS[e]=="auto"||this._storedCSS[e]=="static")this._storedCSS[e]= +"";this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else this.currentItem.show();this.fromOutside&&!b&&c.push(function(f){this._trigger("receive",f,this._uiHash(this.fromOutside))});if((this.fromOutside||this.domPosition.prev!=this.currentItem.prev().not(".ui-sortable-helper")[0]||this.domPosition.parent!=this.currentItem.parent()[0])&&!b)c.push(function(f){this._trigger("update",f,this._uiHash())});if(!d.ui.contains(this.element[0],this.currentItem[0])){b||c.push(function(f){this._trigger("remove", +f,this._uiHash())});for(e=this.containers.length-1;e>=0;e--)if(d.ui.contains(this.containers[e].element[0],this.currentItem[0])&&!b){c.push(function(f){return function(g){f._trigger("receive",g,this._uiHash(this))}}.call(this,this.containers[e]));c.push(function(f){return function(g){f._trigger("update",g,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){b||c.push(function(f){return function(g){f._trigger("deactivate",g,this._uiHash(this))}}.call(this, +this.containers[e]));if(this.containers[e].containerCache.over){c.push(function(f){return function(g){f._trigger("out",g,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over=0}}this._storedCursor&&d("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!b){this._trigger("beforeStop", +a,this._uiHash());for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}return false}b||this._trigger("beforeStop",a,this._uiHash());this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.helper[0]!=this.currentItem[0]&&this.helper.remove();this.helper=null;if(!b){for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}this.fromOutside=false;return true},_trigger:function(){d.Widget.prototype._trigger.apply(this,arguments)===false&&this.cancel()}, +_uiHash:function(a){var b=a||this;return{helper:b.helper,placeholder:b.placeholder||d([]),position:b.position,originalPosition:b.originalPosition,offset:b.positionAbs,item:b.currentItem,sender:a?a.element:null}}});d.extend(d.ui.sortable,{version:"1.8.14"})})(jQuery); +;/* + * jQuery UI Accordion 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Accordion + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function(c){c.widget("ui.accordion",{options:{active:0,animated:"slide",autoHeight:true,clearStyle:false,collapsible:false,event:"click",fillSpace:false,header:"> li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var a=this,b=a.options;a.running=0;a.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix"); +a.headers=a.element.find(b.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){b.disabled||c(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){b.disabled||c(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){b.disabled||c(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){b.disabled||c(this).removeClass("ui-state-focus")});a.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom"); +if(b.navigation){var d=a.element.find("a").filter(b.navigationFilter).eq(0);if(d.length){var h=d.closest(".ui-accordion-header");a.active=h.length?h:d.closest(".ui-accordion-content").prev()}}a.active=a._findActive(a.active||b.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");a.active.next().addClass("ui-accordion-content-active");a._createIcons();a.resize();a.element.attr("role","tablist");a.headers.attr("role","tab").bind("keydown.accordion", +function(f){return a._keydown(f)}).next().attr("role","tabpanel");a.headers.not(a.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide();a.active.length?a.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}):a.headers.eq(0).attr("tabIndex",0);c.browser.safari||a.headers.find("a").attr("tabIndex",-1);b.event&&a.headers.bind(b.event.split(" ").join(".accordion ")+".accordion",function(f){a._clickHandler.call(a,f,this);f.preventDefault()})},_createIcons:function(){var a= +this.options;if(a.icons){c("<span></span>").addClass("ui-icon "+a.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(a.icons.header).toggleClass(a.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var a=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex"); +this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var b=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(a.autoHeight||a.fillHeight)b.css("height","");return c.Widget.prototype.destroy.call(this)},_setOption:function(a,b){c.Widget.prototype._setOption.apply(this,arguments);a=="active"&&this.activate(b);if(a=="icons"){this._destroyIcons(); +b&&this._createIcons()}if(a=="disabled")this.headers.add(this.headers.next())[b?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(a){if(!(this.options.disabled||a.altKey||a.ctrlKey)){var b=c.ui.keyCode,d=this.headers.length,h=this.headers.index(a.target),f=false;switch(a.keyCode){case b.RIGHT:case b.DOWN:f=this.headers[(h+1)%d];break;case b.LEFT:case b.UP:f=this.headers[(h-1+d)%d];break;case b.SPACE:case b.ENTER:this._clickHandler({target:a.target},a.target); +a.preventDefault()}if(f){c(a.target).attr("tabIndex",-1);c(f).attr("tabIndex",0);f.focus();return false}return true}},resize:function(){var a=this.options,b;if(a.fillSpace){if(c.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}b=this.element.parent().height();c.browser.msie&&this.element.parent().css("overflow",d);this.headers.each(function(){b-=c(this).outerHeight(true)});this.headers.next().each(function(){c(this).height(Math.max(0,b-c(this).innerHeight()+ +c(this).height()))}).css("overflow","auto")}else if(a.autoHeight){b=0;this.headers.next().each(function(){b=Math.max(b,c(this).height("").height())}).height(b)}return this},activate:function(a){this.options.active=a;a=this._findActive(a)[0];this._clickHandler({target:a},a);return this},_findActive:function(a){return a?typeof a==="number"?this.headers.filter(":eq("+a+")"):this.headers.not(this.headers.not(a)):a===false?c([]):this.headers.filter(":eq(0)")},_clickHandler:function(a,b){var d=this.options; +if(!d.disabled)if(a.target){a=c(a.currentTarget||b);b=a[0]===this.active[0];d.active=d.collapsible&&b?false:this.headers.index(a);if(!(this.running||!d.collapsible&&b)){var h=this.active;j=a.next();g=this.active.next();e={options:d,newHeader:b&&d.collapsible?c([]):a,oldHeader:this.active,newContent:b&&d.collapsible?c([]):j,oldContent:g};var f=this.headers.index(this.active[0])>this.headers.index(a[0]);this.active=b?c([]):a;this._toggle(j,g,e,b,f);h.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header); +if(!b){a.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected);a.next().addClass("ui-accordion-content-active")}}}else if(d.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);this.active.next().addClass("ui-accordion-content-active");var g=this.active.next(), +e={options:d,newHeader:c([]),oldHeader:d.active,newContent:c([]),oldContent:g},j=this.active=c([]);this._toggle(j,g,e)}},_toggle:function(a,b,d,h,f){var g=this,e=g.options;g.toShow=a;g.toHide=b;g.data=d;var j=function(){if(g)return g._completed.apply(g,arguments)};g._trigger("changestart",null,g.data);g.running=b.size()===0?a.size():b.size();if(e.animated){d={};d=e.collapsible&&h?{toShow:c([]),toHide:b,complete:j,down:f,autoHeight:e.autoHeight||e.fillSpace}:{toShow:a,toHide:b,complete:j,down:f,autoHeight:e.autoHeight|| +e.fillSpace};if(!e.proxied)e.proxied=e.animated;if(!e.proxiedDuration)e.proxiedDuration=e.duration;e.animated=c.isFunction(e.proxied)?e.proxied(d):e.proxied;e.duration=c.isFunction(e.proxiedDuration)?e.proxiedDuration(d):e.proxiedDuration;h=c.ui.accordion.animations;var i=e.duration,k=e.animated;if(k&&!h[k]&&!c.easing[k])k="slide";h[k]||(h[k]=function(l){this.slide(l,{easing:k,duration:i||700})});h[k](d)}else{if(e.collapsible&&h)a.toggle();else{b.hide();a.show()}j(true)}b.prev().attr({"aria-expanded":"false", +"aria-selected":"false",tabIndex:-1}).blur();a.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(a){this.running=a?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");if(this.toHide.length)this.toHide.parent()[0].className=this.toHide.parent()[0].className;this._trigger("change",null,this.data)}}});c.extend(c.ui.accordion,{version:"1.8.14", +animations:{slide:function(a,b){a=c.extend({easing:"swing",duration:300},a,b);if(a.toHide.size())if(a.toShow.size()){var d=a.toShow.css("overflow"),h=0,f={},g={},e;b=a.toShow;e=b[0].style.width;b.width(parseInt(b.parent().width(),10)-parseInt(b.css("paddingLeft"),10)-parseInt(b.css("paddingRight"),10)-(parseInt(b.css("borderLeftWidth"),10)||0)-(parseInt(b.css("borderRightWidth"),10)||0));c.each(["height","paddingTop","paddingBottom"],function(j,i){g[i]="hide";j=(""+c.css(a.toShow[0],i)).match(/^([\d+-.]+)(.*)$/); +f[i]={value:j[1],unit:j[2]||"px"}});a.toShow.css({height:0,overflow:"hidden"}).show();a.toHide.filter(":hidden").each(a.complete).end().filter(":visible").animate(g,{step:function(j,i){if(i.prop=="height")h=i.end-i.start===0?0:(i.now-i.start)/(i.end-i.start);a.toShow[0].style[i.prop]=h*f[i.prop].value+f[i.prop].unit},duration:a.duration,easing:a.easing,complete:function(){a.autoHeight||a.toShow.css("height","");a.toShow.css({width:e,overflow:d});a.complete()}})}else a.toHide.animate({height:"hide", +paddingTop:"hide",paddingBottom:"hide"},a);else a.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},a)},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1E3:200})}}})})(jQuery); +;/* + * jQuery UI Autocomplete 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.position.js + */ +(function(d){var e=0;d.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:false,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var a=this,b=this.element[0].ownerDocument,g;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(!(a.options.disabled||a.element.attr("readonly"))){g= +false;var f=d.ui.keyCode;switch(c.keyCode){case f.PAGE_UP:a._move("previousPage",c);break;case f.PAGE_DOWN:a._move("nextPage",c);break;case f.UP:a._move("previous",c);c.preventDefault();break;case f.DOWN:a._move("next",c);c.preventDefault();break;case f.ENTER:case f.NUMPAD_ENTER:if(a.menu.active){g=true;c.preventDefault()}case f.TAB:if(!a.menu.active)return;a.menu.select(c);break;case f.ESCAPE:a.element.val(a.term);a.close(c);break;default:clearTimeout(a.searching);a.searching=setTimeout(function(){if(a.term!= +a.element.val()){a.selectedItem=null;a.search(null,c)}},a.options.delay);break}}}).bind("keypress.autocomplete",function(c){if(g){g=false;c.preventDefault()}}).bind("focus.autocomplete",function(){if(!a.options.disabled){a.selectedItem=null;a.previous=a.element.val()}}).bind("blur.autocomplete",function(c){if(!a.options.disabled){clearTimeout(a.searching);a.closing=setTimeout(function(){a.close(c);a._change(c)},150)}});this._initSource();this.response=function(){return a._response.apply(a,arguments)}; +this.menu=d("<ul></ul>").addClass("ui-autocomplete").appendTo(d(this.options.appendTo||"body",b)[0]).mousedown(function(c){var f=a.menu.element[0];d(c.target).closest(".ui-menu-item").length||setTimeout(function(){d(document).one("mousedown",function(h){h.target!==a.element[0]&&h.target!==f&&!d.ui.contains(f,h.target)&&a.close()})},1);setTimeout(function(){clearTimeout(a.closing)},13)}).menu({focus:function(c,f){f=f.item.data("item.autocomplete");false!==a._trigger("focus",c,{item:f})&&/^key/.test(c.originalEvent.type)&& +a.element.val(f.value)},selected:function(c,f){var h=f.item.data("item.autocomplete"),i=a.previous;if(a.element[0]!==b.activeElement){a.element.focus();a.previous=i;setTimeout(function(){a.previous=i;a.selectedItem=h},1)}false!==a._trigger("select",c,{item:h})&&a.element.val(h.value);a.term=a.element.val();a.close(c);a.selectedItem=h},blur:function(){a.menu.element.is(":visible")&&a.element.val()!==a.term&&a.element.val(a.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu"); +d.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");this.menu.element.remove();d.Widget.prototype.destroy.call(this)},_setOption:function(a,b){d.Widget.prototype._setOption.apply(this,arguments);a==="source"&&this._initSource();if(a==="appendTo")this.menu.element.appendTo(d(b||"body",this.element[0].ownerDocument)[0]);a==="disabled"&& +b&&this.xhr&&this.xhr.abort()},_initSource:function(){var a=this,b,g;if(d.isArray(this.options.source)){b=this.options.source;this.source=function(c,f){f(d.ui.autocomplete.filter(b,c.term))}}else if(typeof this.options.source==="string"){g=this.options.source;this.source=function(c,f){a.xhr&&a.xhr.abort();a.xhr=d.ajax({url:g,data:c,dataType:"json",autocompleteRequest:++e,success:function(h){this.autocompleteRequest===e&&f(h)},error:function(){this.autocompleteRequest===e&&f([])}})}}else this.source= +this.options.source},search:function(a,b){a=a!=null?a:this.element.val();this.term=this.element.val();if(a.length<this.options.minLength)return this.close(b);clearTimeout(this.closing);if(this._trigger("search",b)!==false)return this._search(a)},_search:function(a){this.pending++;this.element.addClass("ui-autocomplete-loading");this.source({term:a},this.response)},_response:function(a){if(!this.options.disabled&&a&&a.length){a=this._normalize(a);this._suggest(a);this._trigger("open")}else this.close(); +this.pending--;this.pending||this.element.removeClass("ui-autocomplete-loading")},close:function(a){clearTimeout(this.closing);if(this.menu.element.is(":visible")){this.menu.element.hide();this.menu.deactivate();this._trigger("close",a)}},_change:function(a){this.previous!==this.element.val()&&this._trigger("change",a,{item:this.selectedItem})},_normalize:function(a){if(a.length&&a[0].label&&a[0].value)return a;return d.map(a,function(b){if(typeof b==="string")return{label:b,value:b};return d.extend({label:b.label|| +b.value,value:b.value||b.label},b)})},_suggest:function(a){var b=this.menu.element.empty().zIndex(this.element.zIndex()+1);this._renderMenu(b,a);this.menu.deactivate();this.menu.refresh();b.show();this._resizeMenu();b.position(d.extend({of:this.element},this.options.position));this.options.autoFocus&&this.menu.next(new d.Event("mouseover"))},_resizeMenu:function(){var a=this.menu.element;a.outerWidth(Math.max(a.width("").outerWidth(),this.element.outerWidth()))},_renderMenu:function(a,b){var g=this; +d.each(b,function(c,f){g._renderItem(a,f)})},_renderItem:function(a,b){return d("<li></li>").data("item.autocomplete",b).append(d("<a></a>").text(b.label)).appendTo(a)},_move:function(a,b){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term);this.menu.deactivate()}else this.menu[a](b);else this.search(null,b)},widget:function(){return this.menu.element}});d.extend(d.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, +"\\$&")},filter:function(a,b){var g=new RegExp(d.ui.autocomplete.escapeRegex(b),"i");return d.grep(a,function(c){return g.test(c.label||c.value||c)})}})})(jQuery); +(function(d){d.widget("ui.menu",{_create:function(){var e=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(a){if(d(a.target).closest(".ui-menu-item a").length){a.preventDefault();e.select(a)}});this.refresh()},refresh:function(){var e=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex", +-1).mouseenter(function(a){e.activate(a,d(this).parent())}).mouseleave(function(){e.deactivate()})},activate:function(e,a){this.deactivate();if(this.hasScroll()){var b=a.offset().top-this.element.offset().top,g=this.element.scrollTop(),c=this.element.height();if(b<0)this.element.scrollTop(g+b);else b>=c&&this.element.scrollTop(g+b-c+a.height())}this.active=a.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",e,{item:a})},deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id"); +this._trigger("blur");this.active=null}},next:function(e){this.move("next",".ui-menu-item:first",e)},previous:function(e){this.move("prev",".ui-menu-item:last",e)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(e,a,b){if(this.active){e=this.active[e+"All"](".ui-menu-item").eq(0);e.length?this.activate(b,e):this.activate(b,this.element.children(a))}else this.activate(b, +this.element.children(a))},nextPage:function(e){if(this.hasScroll())if(!this.active||this.last())this.activate(e,this.element.children(".ui-menu-item:first"));else{var a=this.active.offset().top,b=this.element.height(),g=this.element.children(".ui-menu-item").filter(function(){var c=d(this).offset().top-a-b+d(this).height();return c<10&&c>-10});g.length||(g=this.element.children(".ui-menu-item:last"));this.activate(e,g)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active|| +this.last()?":first":":last"))},previousPage:function(e){if(this.hasScroll())if(!this.active||this.first())this.activate(e,this.element.children(".ui-menu-item:last"));else{var a=this.active.offset().top,b=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var g=d(this).offset().top-a+b-d(this).height();return g<10&&g>-10});result.length||(result=this.element.children(".ui-menu-item:first"));this.activate(e,result)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active|| +this.first()?":last":":first"))},hasScroll:function(){return this.element.height()<this.element[d.fn.prop?"prop":"attr"]("scrollHeight")},select:function(e){this._trigger("selected",e,{item:this.active})}})})(jQuery); +;/* + * jQuery UI Button 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Button + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function(b){var h,i,j,g,l=function(){var a=b(this).find(":ui-button");setTimeout(function(){a.button("refresh")},1)},k=function(a){var c=a.name,e=a.form,f=b([]);if(c)f=e?b(e).find("[name='"+c+"']"):b("[name='"+c+"']",a.ownerDocument).filter(function(){return!this.form});return f};b.widget("ui.button",{options:{disabled:null,text:true,label:null,icons:{primary:null,secondary:null}},_create:function(){this.element.closest("form").unbind("reset.button").bind("reset.button",l);if(typeof this.options.disabled!== +"boolean")this.options.disabled=this.element.attr("disabled");this._determineButtonType();this.hasTitle=!!this.buttonElement.attr("title");var a=this,c=this.options,e=this.type==="checkbox"||this.type==="radio",f="ui-state-hover"+(!e?" ui-state-active":"");if(c.label===null)c.label=this.buttonElement.html();if(this.element.is(":disabled"))c.disabled=true;this.buttonElement.addClass("ui-button ui-widget ui-state-default ui-corner-all").attr("role","button").bind("mouseenter.button",function(){if(!c.disabled){b(this).addClass("ui-state-hover"); +this===h&&b(this).addClass("ui-state-active")}}).bind("mouseleave.button",function(){c.disabled||b(this).removeClass(f)}).bind("click.button",function(d){if(c.disabled){d.preventDefault();d.stopImmediatePropagation()}});this.element.bind("focus.button",function(){a.buttonElement.addClass("ui-state-focus")}).bind("blur.button",function(){a.buttonElement.removeClass("ui-state-focus")});if(e){this.element.bind("change.button",function(){g||a.refresh()});this.buttonElement.bind("mousedown.button",function(d){if(!c.disabled){g= +false;i=d.pageX;j=d.pageY}}).bind("mouseup.button",function(d){if(!c.disabled)if(i!==d.pageX||j!==d.pageY)g=true})}if(this.type==="checkbox")this.buttonElement.bind("click.button",function(){if(c.disabled||g)return false;b(this).toggleClass("ui-state-active");a.buttonElement.attr("aria-pressed",a.element[0].checked)});else if(this.type==="radio")this.buttonElement.bind("click.button",function(){if(c.disabled||g)return false;b(this).addClass("ui-state-active");a.buttonElement.attr("aria-pressed",true); +var d=a.element[0];k(d).not(d).map(function(){return b(this).button("widget")[0]}).removeClass("ui-state-active").attr("aria-pressed",false)});else{this.buttonElement.bind("mousedown.button",function(){if(c.disabled)return false;b(this).addClass("ui-state-active");h=this;b(document).one("mouseup",function(){h=null})}).bind("mouseup.button",function(){if(c.disabled)return false;b(this).removeClass("ui-state-active")}).bind("keydown.button",function(d){if(c.disabled)return false;if(d.keyCode==b.ui.keyCode.SPACE|| +d.keyCode==b.ui.keyCode.ENTER)b(this).addClass("ui-state-active")}).bind("keyup.button",function(){b(this).removeClass("ui-state-active")});this.buttonElement.is("a")&&this.buttonElement.keyup(function(d){d.keyCode===b.ui.keyCode.SPACE&&b(this).click()})}this._setOption("disabled",c.disabled);this._resetButton()},_determineButtonType:function(){this.type=this.element.is(":checkbox")?"checkbox":this.element.is(":radio")?"radio":this.element.is("input")?"input":"button";if(this.type==="checkbox"||this.type=== +"radio"){var a=this.element.parents().filter(":last"),c="label[for="+this.element.attr("id")+"]";this.buttonElement=a.find(c);if(!this.buttonElement.length){a=a.length?a.siblings():this.element.siblings();this.buttonElement=a.filter(c);if(!this.buttonElement.length)this.buttonElement=a.find(c)}this.element.addClass("ui-helper-hidden-accessible");(a=this.element.is(":checked"))&&this.buttonElement.addClass("ui-state-active");this.buttonElement.attr("aria-pressed",a)}else this.buttonElement=this.element}, +widget:function(){return this.buttonElement},destroy:function(){this.element.removeClass("ui-helper-hidden-accessible");this.buttonElement.removeClass("ui-button ui-widget ui-state-default ui-corner-all ui-state-hover ui-state-active ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only").removeAttr("role").removeAttr("aria-pressed").html(this.buttonElement.find(".ui-button-text").html());this.hasTitle||this.buttonElement.removeAttr("title"); +b.Widget.prototype.destroy.call(this)},_setOption:function(a,c){b.Widget.prototype._setOption.apply(this,arguments);if(a==="disabled")c?this.element.attr("disabled",true):this.element.removeAttr("disabled");else this._resetButton()},refresh:function(){var a=this.element.is(":disabled");a!==this.options.disabled&&this._setOption("disabled",a);if(this.type==="radio")k(this.element[0]).each(function(){b(this).is(":checked")?b(this).button("widget").addClass("ui-state-active").attr("aria-pressed",true): +b(this).button("widget").removeClass("ui-state-active").attr("aria-pressed",false)});else if(this.type==="checkbox")this.element.is(":checked")?this.buttonElement.addClass("ui-state-active").attr("aria-pressed",true):this.buttonElement.removeClass("ui-state-active").attr("aria-pressed",false)},_resetButton:function(){if(this.type==="input")this.options.label&&this.element.val(this.options.label);else{var a=this.buttonElement.removeClass("ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only"), +c=b("<span></span>").addClass("ui-button-text").html(this.options.label).appendTo(a.empty()).text(),e=this.options.icons,f=e.primary&&e.secondary,d=[];if(e.primary||e.secondary){if(this.options.text)d.push("ui-button-text-icon"+(f?"s":e.primary?"-primary":"-secondary"));e.primary&&a.prepend("<span class='ui-button-icon-primary ui-icon "+e.primary+"'></span>");e.secondary&&a.append("<span class='ui-button-icon-secondary ui-icon "+e.secondary+"'></span>");if(!this.options.text){d.push(f?"ui-button-icons-only": +"ui-button-icon-only");this.hasTitle||a.attr("title",c)}}else d.push("ui-button-text-only");a.addClass(d.join(" "))}}});b.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(a,c){a==="disabled"&&this.buttons.button("option",a,c);b.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){var a=this.element.css("direction")=== +"ltr";this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass(a?"ui-corner-left":"ui-corner-right").end().filter(":last").addClass(a?"ui-corner-right":"ui-corner-left").end().end()},destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy"); +b.Widget.prototype.destroy.call(this)}})})(jQuery); +;/* + * jQuery UI Dialog 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.button.js + * jquery.ui.draggable.js + * jquery.ui.mouse.js + * jquery.ui.position.js + * jquery.ui.resizable.js + */ +(function(c,l){var m={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},n={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true},o=c.attrFn||{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true,click:true};c.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false, +position:{my:"center",at:"center",collision:"fit",using:function(a){var b=c(this).css(a).offset().top;b<0&&c(this).css("top",a.top-b)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var a=this,b=a.options,d=b.title||" ",e=c.ui.dialog.getTitleId(a.element),g=(a.uiDialog=c("<div></div>")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+ +b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(i){a.moveToTop(false,i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var f=(a.uiDialogTitlebar=c("<div></div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g), +h=c('<a href="#"></a>').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).click(function(i){a.close(i);return false}).appendTo(f);(a.uiDialogTitlebarCloseText=c("<span></span>")).addClass("ui-icon ui-icon-closethick").text(b.closeText).appendTo(h);c("<span></span>").addClass("ui-dialog-title").attr("id", +e).html(d).prependTo(f);if(c.isFunction(b.beforeclose)&&!c.isFunction(b.beforeClose))b.beforeClose=b.beforeclose;f.find("*").add(f).disableSelection();b.draggable&&c.fn.draggable&&a._makeDraggable();b.resizable&&c.fn.resizable&&a._makeResizable();a._createButtons(b.buttons);a._isOpen=false;c.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;a.overlay&&a.overlay.destroy();a.uiDialog.hide();a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body"); +a.uiDialog.remove();a.originalTitle&&a.element.attr("title",a.originalTitle);return a},widget:function(){return this.uiDialog},close:function(a){var b=this,d,e;if(false!==b._trigger("beforeClose",a)){b.overlay&&b.overlay.destroy();b.uiDialog.unbind("keypress.ui-dialog");b._isOpen=false;if(b.options.hide)b.uiDialog.hide(b.options.hide,function(){b._trigger("close",a)});else{b.uiDialog.hide();b._trigger("close",a)}c.ui.dialog.overlay.resize();if(b.options.modal){d=0;c(".ui-dialog").each(function(){if(this!== +b.uiDialog[0]){e=c(this).css("z-index");isNaN(e)||(d=Math.max(d,e))}});c.ui.dialog.maxZ=d}return b}},isOpen:function(){return this._isOpen},moveToTop:function(a,b){var d=this,e=d.options;if(e.modal&&!a||!e.stack&&!e.modal)return d._trigger("focus",b);if(e.zIndex>c.ui.dialog.maxZ)c.ui.dialog.maxZ=e.zIndex;if(d.overlay){c.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=c.ui.dialog.maxZ)}a={scrollTop:d.element.attr("scrollTop"),scrollLeft:d.element.attr("scrollLeft")};c.ui.dialog.maxZ+= +1;d.uiDialog.css("z-index",c.ui.dialog.maxZ);d.element.attr(a);d._trigger("focus",b);return d},open:function(){if(!this._isOpen){var a=this,b=a.options,d=a.uiDialog;a.overlay=b.modal?new c.ui.dialog.overlay(a):null;a._size();a._position(b.position);d.show(b.show);a.moveToTop(true);b.modal&&d.bind("keypress.ui-dialog",function(e){if(e.keyCode===c.ui.keyCode.TAB){var g=c(":tabbable",this),f=g.filter(":first");g=g.filter(":last");if(e.target===g[0]&&!e.shiftKey){f.focus(1);return false}else if(e.target=== +f[0]&&e.shiftKey){g.focus(1);return false}}});c(a.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();a._isOpen=true;a._trigger("open");return a}},_createButtons:function(a){var b=this,d=false,e=c("<div></div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=c("<div></div>").addClass("ui-dialog-buttonset").appendTo(e);b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a, +function(){return!(d=true)});if(d){c.each(a,function(f,h){h=c.isFunction(h)?{click:h,text:f}:h;var i=c('<button type="button"></button>').click(function(){h.click.apply(b.element[0],arguments)}).appendTo(g);c.each(h,function(j,k){if(j!=="click")j in o?i[j](k):i.attr(j,k)});c.fn.button&&i.button()});e.appendTo(b.uiDialog)}},_makeDraggable:function(){function a(f){return{position:f.position,offset:f.offset}}var b=this,d=b.options,e=c(document),g;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close", +handle:".ui-dialog-titlebar",containment:"document",start:function(f,h){g=d.height==="auto"?"auto":c(this).height();c(this).height(c(this).height()).addClass("ui-dialog-dragging");b._trigger("dragStart",f,a(h))},drag:function(f,h){b._trigger("drag",f,a(h))},stop:function(f,h){d.position=[h.position.left-e.scrollLeft(),h.position.top-e.scrollTop()];c(this).removeClass("ui-dialog-dragging").height(g);b._trigger("dragStop",f,a(h));c.ui.dialog.overlay.resize()}})},_makeResizable:function(a){function b(f){return{originalPosition:f.originalPosition, +originalSize:f.originalSize,position:f.position,size:f.size}}a=a===l?this.options.resizable:a;var d=this,e=d.options,g=d.uiDialog.css("position");a=typeof a==="string"?a:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:a,start:function(f,h){c(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",f,b(h))},resize:function(f,h){d._trigger("resize", +f,b(h))},stop:function(f,h){c(this).removeClass("ui-dialog-resizing");e.height=c(this).height();e.width=c(this).width();d._trigger("resizeStop",f,b(h));c.ui.dialog.overlay.resize()}}).css("position",g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(a){var b=[],d=[0,0],e;if(a){if(typeof a==="string"||typeof a==="object"&&"0"in a){b=a.split?a.split(" "): +[a[0],a[1]];if(b.length===1)b[1]=b[0];c.each(["left","top"],function(g,f){if(+b[g]===b[g]){d[g]=b[g];b[g]=f}});a={my:b.join(" "),at:b.join(" "),offset:d.join(" ")}}a=c.extend({},c.ui.dialog.prototype.options.position,a)}else a=c.ui.dialog.prototype.options.position;(e=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(c.extend({of:window},a));e||this.uiDialog.hide()},_setOptions:function(a){var b=this,d={},e=false;c.each(a,function(g,f){b._setOption(g,f); +if(g in m)e=true;if(g in n)d[g]=f});e&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",d)},_setOption:function(a,b){var d=this,e=d.uiDialog;switch(a){case "beforeclose":a="beforeClose";break;case "buttons":d._createButtons(b);break;case "closeText":d.uiDialogTitlebarCloseText.text(""+b);break;case "dialogClass":e.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b);break;case "disabled":b?e.addClass("ui-dialog-disabled"): +e.removeClass("ui-dialog-disabled");break;case "draggable":var g=e.is(":data(draggable)");g&&!b&&e.draggable("destroy");!g&&b&&d._makeDraggable();break;case "position":d._position(b);break;case "resizable":(g=e.is(":data(resizable)"))&&!b&&e.resizable("destroy");g&&typeof b==="string"&&e.resizable("option","handles",b);!g&&b!==false&&d._makeResizable(b);break;case "title":c(".ui-dialog-title",d.uiDialogTitlebar).html(""+(b||" "));break}c.Widget.prototype._setOption.apply(d,arguments)},_size:function(){var a= +this.options,b,d,e=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(a.minWidth>a.width)a.width=a.minWidth;b=this.uiDialog.css({height:"auto",width:a.width}).height();d=Math.max(0,a.minHeight-b);if(a.height==="auto")if(c.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();a=this.element.css("height","auto").height();e||this.uiDialog.hide();this.element.height(Math.max(a,d))}else this.element.height(Math.max(a.height- +b,0));this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}});c.extend(c.ui.dialog,{version:"1.8.14",uuid:0,maxZ:0,getTitleId:function(a){a=a.attr("id");if(!a){this.uuid+=1;a=this.uuid}return"ui-dialog-title-"+a},overlay:function(a){this.$el=c.ui.dialog.overlay.create(a)}});c.extend(c.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "), +create:function(a){if(this.instances.length===0){setTimeout(function(){c.ui.dialog.overlay.instances.length&&c(document).bind(c.ui.dialog.overlay.events,function(d){if(c(d.target).zIndex()<c.ui.dialog.overlay.maxZ)return false})},1);c(document).bind("keydown.dialog-overlay",function(d){if(a.options.closeOnEscape&&d.keyCode&&d.keyCode===c.ui.keyCode.ESCAPE){a.close(d);d.preventDefault()}});c(window).bind("resize.dialog-overlay",c.ui.dialog.overlay.resize)}var b=(this.oldInstances.pop()||c("<div></div>").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(), +height:this.height()});c.fn.bgiframe&&b.bgiframe();this.instances.push(b);return b},destroy:function(a){var b=c.inArray(a,this.instances);b!=-1&&this.oldInstances.push(this.instances.splice(b,1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var d=0;c.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight); +b=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a<b?c(window).height()+"px":a+"px"}else return c(document).height()+"px"},width:function(){var a,b;if(c.browser.msie){a=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth);b=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth);return a<b?c(window).width()+"px":a+"px"}else return c(document).width()+"px"},resize:function(){var a=c([]);c.each(c.ui.dialog.overlay.instances,function(){a= +a.add(this)});a.css({width:0,height:0}).css({width:c.ui.dialog.overlay.width(),height:c.ui.dialog.overlay.height()})}});c.extend(c.ui.dialog.overlay.prototype,{destroy:function(){c.ui.dialog.overlay.destroy(this.$el)}})})(jQuery); +;/* + * jQuery UI Slider 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Slider + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function(d){d.widget("ui.slider",d.ui.mouse,{widgetEventPrefix:"slide",options:{animate:false,distance:0,max:100,min:0,orientation:"horizontal",range:false,step:1,value:0,values:null},_create:function(){var b=this,a=this.options,c=this.element.find(".ui-slider-handle").addClass("ui-state-default ui-corner-all"),f=a.values&&a.values.length||1,e=[];this._mouseSliding=this._keySliding=false;this._animateOff=true;this._handleIndex=null;this._detectOrientation();this._mouseInit();this.element.addClass("ui-slider ui-slider-"+ +this.orientation+" ui-widget ui-widget-content ui-corner-all"+(a.disabled?" ui-slider-disabled ui-disabled":""));this.range=d([]);if(a.range){if(a.range===true){if(!a.values)a.values=[this._valueMin(),this._valueMin()];if(a.values.length&&a.values.length!==2)a.values=[a.values[0],a.values[0]]}this.range=d("<div></div>").appendTo(this.element).addClass("ui-slider-range ui-widget-header"+(a.range==="min"||a.range==="max"?" ui-slider-range-"+a.range:""))}for(var j=c.length;j<f;j+=1)e.push("<a class='ui-slider-handle ui-state-default ui-corner-all' href='#'></a>"); +this.handles=c.add(d(e.join("")).appendTo(b.element));this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(g){g.preventDefault()}).hover(function(){a.disabled||d(this).addClass("ui-state-hover")},function(){d(this).removeClass("ui-state-hover")}).focus(function(){if(a.disabled)d(this).blur();else{d(".ui-slider .ui-state-focus").removeClass("ui-state-focus");d(this).addClass("ui-state-focus")}}).blur(function(){d(this).removeClass("ui-state-focus")});this.handles.each(function(g){d(this).data("index.ui-slider-handle", +g)});this.handles.keydown(function(g){var k=true,l=d(this).data("index.ui-slider-handle"),i,h,m;if(!b.options.disabled){switch(g.keyCode){case d.ui.keyCode.HOME:case d.ui.keyCode.END:case d.ui.keyCode.PAGE_UP:case d.ui.keyCode.PAGE_DOWN:case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:k=false;if(!b._keySliding){b._keySliding=true;d(this).addClass("ui-state-active");i=b._start(g,l);if(i===false)return}break}m=b.options.step;i=b.options.values&&b.options.values.length? +(h=b.values(l)):(h=b.value());switch(g.keyCode){case d.ui.keyCode.HOME:h=b._valueMin();break;case d.ui.keyCode.END:h=b._valueMax();break;case d.ui.keyCode.PAGE_UP:h=b._trimAlignValue(i+(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.PAGE_DOWN:h=b._trimAlignValue(i-(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:if(i===b._valueMax())return;h=b._trimAlignValue(i+m);break;case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:if(i===b._valueMin())return;h=b._trimAlignValue(i- +m);break}b._slide(g,l,h);return k}}).keyup(function(g){var k=d(this).data("index.ui-slider-handle");if(b._keySliding){b._keySliding=false;b._stop(g,k);b._change(g,k);d(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");this._mouseDestroy(); +return this},_mouseCapture:function(b){var a=this.options,c,f,e,j,g;if(a.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();c=this._normValueFromMouse({x:b.pageX,y:b.pageY});f=this._valueMax()-this._valueMin()+1;j=this;this.handles.each(function(k){var l=Math.abs(c-j.values(k));if(f>l){f=l;e=d(this);g=k}});if(a.range===true&&this.values(1)===a.min){g+=1;e=d(this.handles[g])}if(this._start(b,g)===false)return false; +this._mouseSliding=true;j._handleIndex=g;e.addClass("ui-state-active").focus();a=e.offset();this._clickOffset=!d(b.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:b.pageX-a.left-e.width()/2,top:b.pageY-a.top-e.height()/2-(parseInt(e.css("borderTopWidth"),10)||0)-(parseInt(e.css("borderBottomWidth"),10)||0)+(parseInt(e.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(b,g,c);return this._animateOff=true},_mouseStart:function(){return true},_mouseDrag:function(b){var a= +this._normValueFromMouse({x:b.pageX,y:b.pageY});this._slide(b,this._handleIndex,a);return false},_mouseStop:function(b){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(b,this._handleIndex);this._change(b,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(b){var a;if(this.orientation==="horizontal"){a= +this.elementSize.width;b=b.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{a=this.elementSize.height;b=b.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}a=b/a;if(a>1)a=1;if(a<0)a=0;if(this.orientation==="vertical")a=1-a;b=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+a*b)},_start:function(b,a){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(a); +c.values=this.values()}return this._trigger("start",b,c)},_slide:function(b,a,c){var f;if(this.options.values&&this.options.values.length){f=this.values(a?0:1);if(this.options.values.length===2&&this.options.range===true&&(a===0&&c>f||a===1&&c<f))c=f;if(c!==this.values(a)){f=this.values();f[a]=c;b=this._trigger("slide",b,{handle:this.handles[a],value:c,values:f});this.values(a?0:1);b!==false&&this.values(a,c,true)}}else if(c!==this.value()){b=this._trigger("slide",b,{handle:this.handles[a],value:c}); +b!==false&&this.value(c)}},_stop:function(b,a){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(a);c.values=this.values()}this._trigger("stop",b,c)},_change:function(b,a){if(!this._keySliding&&!this._mouseSliding){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(a);c.values=this.values()}this._trigger("change",b,c)}},value:function(b){if(arguments.length){this.options.value= +this._trimAlignValue(b);this._refreshValue();this._change(null,0)}else return this._value()},values:function(b,a){var c,f,e;if(arguments.length>1){this.options.values[b]=this._trimAlignValue(a);this._refreshValue();this._change(null,b)}else if(arguments.length)if(d.isArray(arguments[0])){c=this.options.values;f=arguments[0];for(e=0;e<c.length;e+=1){c[e]=this._trimAlignValue(f[e]);this._change(null,e)}this._refreshValue()}else return this.options.values&&this.options.values.length?this._values(b): +this.value();else return this._values()},_setOption:function(b,a){var c,f=0;if(d.isArray(this.options.values))f=this.options.values.length;d.Widget.prototype._setOption.apply(this,arguments);switch(b){case "disabled":if(a){this.handles.filter(".ui-state-focus").blur();this.handles.removeClass("ui-state-hover");this.handles.attr("disabled","disabled");this.element.addClass("ui-disabled")}else{this.handles.removeAttr("disabled");this.element.removeClass("ui-disabled")}break;case "orientation":this._detectOrientation(); +this.element.removeClass("ui-slider-horizontal ui-slider-vertical").addClass("ui-slider-"+this.orientation);this._refreshValue();break;case "value":this._animateOff=true;this._refreshValue();this._change(null,0);this._animateOff=false;break;case "values":this._animateOff=true;this._refreshValue();for(c=0;c<f;c+=1)this._change(null,c);this._animateOff=false;break}},_value:function(){var b=this.options.value;return b=this._trimAlignValue(b)},_values:function(b){var a,c;if(arguments.length){a=this.options.values[b]; +return a=this._trimAlignValue(a)}else{a=this.options.values.slice();for(c=0;c<a.length;c+=1)a[c]=this._trimAlignValue(a[c]);return a}},_trimAlignValue:function(b){if(b<=this._valueMin())return this._valueMin();if(b>=this._valueMax())return this._valueMax();var a=this.options.step>0?this.options.step:1,c=(b-this._valueMin())%a;alignValue=b-c;if(Math.abs(c)*2>=a)alignValue+=c>0?a:-a;return parseFloat(alignValue.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max}, +_refreshValue:function(){var b=this.options.range,a=this.options,c=this,f=!this._animateOff?a.animate:false,e,j={},g,k,l,i;if(this.options.values&&this.options.values.length)this.handles.each(function(h){e=(c.values(h)-c._valueMin())/(c._valueMax()-c._valueMin())*100;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";d(this).stop(1,1)[f?"animate":"css"](j,a.animate);if(c.options.range===true)if(c.orientation==="horizontal"){if(h===0)c.range.stop(1,1)[f?"animate":"css"]({left:e+"%"},a.animate); +if(h===1)c.range[f?"animate":"css"]({width:e-g+"%"},{queue:false,duration:a.animate})}else{if(h===0)c.range.stop(1,1)[f?"animate":"css"]({bottom:e+"%"},a.animate);if(h===1)c.range[f?"animate":"css"]({height:e-g+"%"},{queue:false,duration:a.animate})}g=e});else{k=this.value();l=this._valueMin();i=this._valueMax();e=i!==l?(k-l)/(i-l)*100:0;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";this.handle.stop(1,1)[f?"animate":"css"](j,a.animate);if(b==="min"&&this.orientation==="horizontal")this.range.stop(1, +1)[f?"animate":"css"]({width:e+"%"},a.animate);if(b==="max"&&this.orientation==="horizontal")this.range[f?"animate":"css"]({width:100-e+"%"},{queue:false,duration:a.animate});if(b==="min"&&this.orientation==="vertical")this.range.stop(1,1)[f?"animate":"css"]({height:e+"%"},a.animate);if(b==="max"&&this.orientation==="vertical")this.range[f?"animate":"css"]({height:100-e+"%"},{queue:false,duration:a.animate})}}});d.extend(d.ui.slider,{version:"1.8.14"})})(jQuery); +;/* + * jQuery UI Tabs 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function(d,p){function u(){return++v}function w(){return++x}var v=0,x=0;d.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"<div></div>",remove:null,select:null,show:null,spinner:"<em>Loading…</em>",tabTemplate:"<li><a href='#{href}'><span>#{label}</span></a></li>"},_create:function(){this._tabify(true)},_setOption:function(b,e){if(b=="selected")this.options.collapsible&& +e==this.options.selected||this.select(e);else{this.options[b]=e;this._tabify()}},_tabId:function(b){return b.title&&b.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+u()},_sanitizeSelector:function(b){return b.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+w());return d.cookie.apply(null,[b].concat(d.makeArray(arguments)))},_ui:function(b,e){return{tab:b,panel:e,index:this.anchors.index(b)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b= +d(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(b){function e(g,f){g.css("display","");!d.support.opacity&&f.opacity&&g[0].style.removeAttribute("filter")}var a=this,c=this.options,h=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=d(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return d("a",this)[0]});this.panels=d([]);this.anchors.each(function(g,f){var i=d(f).attr("href"),l=i.split("#")[0],q;if(l&&(l===location.toString().split("#")[0]|| +(q=d("base")[0])&&l===q.href)){i=f.hash;f.href=i}if(h.test(i))a.panels=a.panels.add(a.element.find(a._sanitizeSelector(i)));else if(i&&i!=="#"){d.data(f,"href.tabs",i);d.data(f,"load.tabs",i.replace(/#.*$/,""));i=a._tabId(f);f.href="#"+i;f=a.element.find("#"+i);if(!f.length){f=d(c.panelTemplate).attr("id",i).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(a.panels[g-1]||a.list);f.data("destroy.tabs",true)}a.panels=a.panels.add(f)}else c.disabled.push(g)});if(b){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"); +this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(c.selected===p){location.hash&&this.anchors.each(function(g,f){if(f.hash==location.hash){c.selected=g;return false}});if(typeof c.selected!=="number"&&c.cookie)c.selected=parseInt(a._cookie(),10);if(typeof c.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)c.selected= +this.lis.index(this.lis.filter(".ui-tabs-selected"));c.selected=c.selected||(this.lis.length?0:-1)}else if(c.selected===null)c.selected=-1;c.selected=c.selected>=0&&this.anchors[c.selected]||c.selected<0?c.selected:0;c.disabled=d.unique(c.disabled.concat(d.map(this.lis.filter(".ui-state-disabled"),function(g){return a.lis.index(g)}))).sort();d.inArray(c.selected,c.disabled)!=-1&&c.disabled.splice(d.inArray(c.selected,c.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active"); +if(c.selected>=0&&this.anchors.length){a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(c.selected).addClass("ui-tabs-selected ui-state-active");a.element.queue("tabs",function(){a._trigger("show",null,a._ui(a.anchors[c.selected],a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash))[0]))});this.load(c.selected)}d(window).bind("unload",function(){a.lis.add(a.anchors).unbind(".tabs");a.lis=a.anchors=a.panels=null})}else c.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")); +this.element[c.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");c.cookie&&this._cookie(c.selected,c.cookie);b=0;for(var j;j=this.lis[b];b++)d(j)[d.inArray(b,c.disabled)!=-1&&!d(j).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");c.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(c.event!=="mouseover"){var k=function(g,f){f.is(":not(.ui-state-disabled)")&&f.addClass("ui-state-"+g)},n=function(g,f){f.removeClass("ui-state-"+ +g)};this.lis.bind("mouseover.tabs",function(){k("hover",d(this))});this.lis.bind("mouseout.tabs",function(){n("hover",d(this))});this.anchors.bind("focus.tabs",function(){k("focus",d(this).closest("li"))});this.anchors.bind("blur.tabs",function(){n("focus",d(this).closest("li"))})}var m,o;if(c.fx)if(d.isArray(c.fx)){m=c.fx[0];o=c.fx[1]}else m=o=c.fx;var r=o?function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.hide().removeClass("ui-tabs-hide").animate(o,o.duration||"normal", +function(){e(f,o);a._trigger("show",null,a._ui(g,f[0]))})}:function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");a._trigger("show",null,a._ui(g,f[0]))},s=m?function(g,f){f.animate(m,m.duration||"normal",function(){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");e(f,m);a.element.dequeue("tabs")})}:function(g,f){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");a.element.dequeue("tabs")}; +this.anchors.bind(c.event+".tabs",function(){var g=this,f=d(g).closest("li"),i=a.panels.filter(":not(.ui-tabs-hide)"),l=a.element.find(a._sanitizeSelector(g.hash));if(f.hasClass("ui-tabs-selected")&&!c.collapsible||f.hasClass("ui-state-disabled")||f.hasClass("ui-state-processing")||a.panels.filter(":animated").length||a._trigger("select",null,a._ui(this,l[0]))===false){this.blur();return false}c.selected=a.anchors.index(this);a.abort();if(c.collapsible)if(f.hasClass("ui-tabs-selected")){c.selected= +-1;c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){s(g,i)}).dequeue("tabs");this.blur();return false}else if(!i.length){c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this));this.blur();return false}c.cookie&&a._cookie(c.selected,c.cookie);if(l.length){i.length&&a.element.queue("tabs",function(){s(g,i)});a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier."; +d.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(b){if(typeof b=="string")b=this.anchors.index(this.anchors.filter("[href$="+b+"]"));return b},destroy:function(){var b=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var e= +d.data(this,"href.tabs");if(e)this.href=e;var a=d(this).unbind(".tabs");d.each(["href","load","cache"],function(c,h){a.removeData(h+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){d.data(this,"destroy.tabs")?d(this).remove():d(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});b.cookie&&this._cookie(null,b.cookie);return this},add:function(b, +e,a){if(a===p)a=this.anchors.length;var c=this,h=this.options;e=d(h.tabTemplate.replace(/#\{href\}/g,b).replace(/#\{label\}/g,e));b=!b.indexOf("#")?b.replace("#",""):this._tabId(d("a",e)[0]);e.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var j=c.element.find("#"+b);j.length||(j=d(h.panelTemplate).attr("id",b).data("destroy.tabs",true));j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(a>=this.lis.length){e.appendTo(this.list);j.appendTo(this.list[0].parentNode)}else{e.insertBefore(this.lis[a]); +j.insertBefore(this.panels[a])}h.disabled=d.map(h.disabled,function(k){return k>=a?++k:k});this._tabify();if(this.anchors.length==1){h.selected=0;e.addClass("ui-tabs-selected ui-state-active");j.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){c._trigger("show",null,c._ui(c.anchors[0],c.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[a],this.panels[a]));return this},remove:function(b){b=this._getIndex(b);var e=this.options,a=this.lis.eq(b).remove(),c=this.panels.eq(b).remove(); +if(a.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(b+(b+1<this.anchors.length?1:-1));e.disabled=d.map(d.grep(e.disabled,function(h){return h!=b}),function(h){return h>=b?--h:h});this._tabify();this._trigger("remove",null,this._ui(a.find("a")[0],c[0]));return this},enable:function(b){b=this._getIndex(b);var e=this.options;if(d.inArray(b,e.disabled)!=-1){this.lis.eq(b).removeClass("ui-state-disabled");e.disabled=d.grep(e.disabled,function(a){return a!=b});this._trigger("enable",null, +this._ui(this.anchors[b],this.panels[b]));return this}},disable:function(b){b=this._getIndex(b);var e=this.options;if(b!=e.selected){this.lis.eq(b).addClass("ui-state-disabled");e.disabled.push(b);e.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[b],this.panels[b]))}return this},select:function(b){b=this._getIndex(b);if(b==-1)if(this.options.collapsible&&this.options.selected!=-1)b=this.options.selected;else return this;this.anchors.eq(b).trigger(this.options.event+".tabs");return this}, +load:function(b){b=this._getIndex(b);var e=this,a=this.options,c=this.anchors.eq(b)[0],h=d.data(c,"load.tabs");this.abort();if(!h||this.element.queue("tabs").length!==0&&d.data(c,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(b).addClass("ui-state-processing");if(a.spinner){var j=d("span",c);j.data("label.tabs",j.html()).html(a.spinner)}this.xhr=d.ajax(d.extend({},a.ajaxOptions,{url:h,success:function(k,n){e.element.find(e._sanitizeSelector(c.hash)).html(k);e._cleanup();a.cache&&d.data(c, +"cache.tabs",true);e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.success(k,n)}catch(m){}},error:function(k,n){e._cleanup();e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.error(k,n,b,c)}catch(m){}}}));e.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this}, +url:function(b,e){this.anchors.eq(b).removeData("cache.tabs").data("load.tabs",e);return this},length:function(){return this.anchors.length}});d.extend(d.ui.tabs,{version:"1.8.14"});d.extend(d.ui.tabs.prototype,{rotation:null,rotate:function(b,e){var a=this,c=this.options,h=a._rotate||(a._rotate=function(j){clearTimeout(a.rotation);a.rotation=setTimeout(function(){var k=c.selected;a.select(++k<a.anchors.length?k:0)},b);j&&j.stopPropagation()});e=a._unrotate||(a._unrotate=!e?function(j){j.clientX&& +a.rotate(null)}:function(){t=c.selected;h()});if(b){this.element.bind("tabsshow",h);this.anchors.bind(c.event+".tabs",e);h()}else{clearTimeout(a.rotation);this.element.unbind("tabsshow",h);this.anchors.unbind(c.event+".tabs",e);delete this._rotate;delete this._unrotate}return this}})})(jQuery); +;/* + * jQuery UI Datepicker 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Datepicker + * + * Depends: + * jquery.ui.core.js + */ +(function(d,C){function M(){this.debug=false;this._curInst=null;this._keyEvent=false;this._disabledInputs=[];this._inDialog=this._datepickerShowing=false;this._mainDivId="ui-datepicker-div";this._inlineClass="ui-datepicker-inline";this._appendClass="ui-datepicker-append";this._triggerClass="ui-datepicker-trigger";this._dialogClass="ui-datepicker-dialog";this._disableClass="ui-datepicker-disabled";this._unselectableClass="ui-datepicker-unselectable";this._currentClass="ui-datepicker-current-day";this._dayOverClass= +"ui-datepicker-days-cell-over";this.regional=[];this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su", +"Mo","Tu","We","Th","Fr","Sa"],weekHeader:"Wk",dateFormat:"mm/dd/yy",firstDay:0,isRTL:false,showMonthAfterYear:false,yearSuffix:""};this._defaults={showOn:"focus",showAnim:"fadeIn",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:false,hideIfNoPrevNext:false,navigationAsDateFormat:false,gotoCurrent:false,changeMonth:false,changeYear:false,yearRange:"c-10:c+10",showOtherMonths:false,selectOtherMonths:false,showWeek:false,calculateWeek:this.iso8601Week,shortYearCutoff:"+10", +minDate:null,maxDate:null,duration:"fast",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:true,showButtonPanel:false,autoSize:false};d.extend(this._defaults,this.regional[""]);this.dpDiv=N(d('<div id="'+this._mainDivId+'" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))}function N(a){return a.bind("mouseout",function(b){b= +d(b.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");b.length&&b.removeClass("ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover")}).bind("mouseover",function(b){b=d(b.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");if(!(d.datepicker._isDisabledDatepicker(J.inline?a.parent()[0]:J.input[0])||!b.length)){b.parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");b.addClass("ui-state-hover"); +b.hasClass("ui-datepicker-prev")&&b.addClass("ui-datepicker-prev-hover");b.hasClass("ui-datepicker-next")&&b.addClass("ui-datepicker-next-hover")}})}function H(a,b){d.extend(a,b);for(var c in b)if(b[c]==null||b[c]==C)a[c]=b[c];return a}d.extend(d.ui,{datepicker:{version:"1.8.14"}});var A=(new Date).getTime(),J;d.extend(M.prototype,{markerClassName:"hasDatepicker",maxRows:4,log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(a){H(this._defaults, +a||{});return this},_attachDatepicker:function(a,b){var c=null;for(var e in this._defaults){var f=a.getAttribute("date:"+e);if(f){c=c||{};try{c[e]=eval(f)}catch(h){c[e]=f}}}e=a.nodeName.toLowerCase();f=e=="div"||e=="span";if(!a.id){this.uuid+=1;a.id="dp"+this.uuid}var i=this._newInst(d(a),f);i.settings=d.extend({},b||{},c||{});if(e=="input")this._connectDatepicker(a,i);else f&&this._inlineDatepicker(a,i)},_newInst:function(a,b){return{id:a[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1"),input:a,selectedDay:0, +selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:!b?this.dpDiv:N(d('<div class="'+this._inlineClass+' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))}},_connectDatepicker:function(a,b){var c=d(a);b.append=d([]);b.trigger=d([]);if(!c.hasClass(this.markerClassName)){this._attachments(c,b);c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(e,f,h){b.settings[f]= +h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});this._autoSize(b);d.data(a,"datepicker",b)}},_attachments:function(a,b){var c=this._get(b,"appendText"),e=this._get(b,"isRTL");b.append&&b.append.remove();if(c){b.append=d('<span class="'+this._appendClass+'">'+c+"</span>");a[e?"before":"after"](b.append)}a.unbind("focus",this._showDatepicker);b.trigger&&b.trigger.remove();c=this._get(b,"showOn");if(c=="focus"||c=="both")a.focus(this._showDatepicker);if(c=="button"||c=="both"){c= +this._get(b,"buttonText");var f=this._get(b,"buttonImage");b.trigger=d(this._get(b,"buttonImageOnly")?d("<img/>").addClass(this._triggerClass).attr({src:f,alt:c,title:c}):d('<button type="button"></button>').addClass(this._triggerClass).html(f==""?c:d("<img/>").attr({src:f,alt:c,title:c})));a[e?"before":"after"](b.trigger);b.trigger.click(function(){d.datepicker._datepickerShowing&&d.datepicker._lastInput==a[0]?d.datepicker._hideDatepicker():d.datepicker._showDatepicker(a[0]);return false})}},_autoSize:function(a){if(this._get(a, +"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var e=function(f){for(var h=0,i=0,g=0;g<f.length;g++)if(f[g].length>h){h=f[g].length;i=g}return i};b.setMonth(e(this._get(a,c.match(/MM/)?"monthNames":"monthNamesShort")));b.setDate(e(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a,b){var c=d(a);if(!c.hasClass(this.markerClassName)){c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker", +function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});d.data(a,"datepicker",b);this._setDate(b,this._getDefaultDate(b),true);this._updateDatepicker(b);this._updateAlternate(b);b.dpDiv.show()}},_dialogDatepicker:function(a,b,c,e,f){a=this._dialogInst;if(!a){this.uuid+=1;this._dialogInput=d('<input type="text" id="'+("dp"+this.uuid)+'" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>');this._dialogInput.keydown(this._doKeyDown);d("body").append(this._dialogInput); +a=this._dialogInst=this._newInst(this._dialogInput,false);a.settings={};d.data(this._dialogInput[0],"datepicker",a)}H(a.settings,e||{});b=b&&b.constructor==Date?this._formatDate(a,b):b;this._dialogInput.val(b);this._pos=f?f.length?f:[f.pageX,f.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left", +this._pos[0]+20+"px").css("top",this._pos[1]+"px");a.settings.onSelect=c;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);this._showDatepicker(this._dialogInput[0]);d.blockUI&&d.blockUI(this.dpDiv);d.data(this._dialogInput[0],"datepicker",a);return this},_destroyDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();d.removeData(a,"datepicker");if(e=="input"){c.append.remove();c.trigger.remove();b.removeClass(this.markerClassName).unbind("focus", +this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)}else if(e=="div"||e=="span")b.removeClass(this.markerClassName).empty()}},_enableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=false;c.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(e=="div"||e=="span"){b= +b.children("."+this._inlineClass);b.children().removeClass("ui-state-disabled");b.find("select.ui-datepicker-month, select.ui-datepicker-year").removeAttr("disabled")}this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:f})}},_disableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=true;c.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5", +cursor:"default"})}else if(e=="div"||e=="span"){b=b.children("."+this._inlineClass);b.children().addClass("ui-state-disabled");b.find("select.ui-datepicker-month, select.ui-datepicker-year").attr("disabled","disabled")}this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:f});this._disabledInputs[this._disabledInputs.length]=a}},_isDisabledDatepicker:function(a){if(!a)return false;for(var b=0;b<this._disabledInputs.length;b++)if(this._disabledInputs[b]==a)return true;return false}, +_getInst:function(a){try{return d.data(a,"datepicker")}catch(b){throw"Missing instance data for this datepicker";}},_optionDatepicker:function(a,b,c){var e=this._getInst(a);if(arguments.length==2&&typeof b=="string")return b=="defaults"?d.extend({},d.datepicker._defaults):e?b=="all"?d.extend({},e.settings):this._get(e,b):null;var f=b||{};if(typeof b=="string"){f={};f[b]=c}if(e){this._curInst==e&&this._hideDatepicker();var h=this._getDateDatepicker(a,true),i=this._getMinMaxDate(e,"min"),g=this._getMinMaxDate(e, +"max");H(e.settings,f);if(i!==null&&f.dateFormat!==C&&f.minDate===C)e.settings.minDate=this._formatDate(e,i);if(g!==null&&f.dateFormat!==C&&f.maxDate===C)e.settings.maxDate=this._formatDate(e,g);this._attachments(d(a),e);this._autoSize(e);this._setDate(e,h);this._updateAlternate(e);this._updateDatepicker(e)}},_changeDatepicker:function(a,b,c){this._optionDatepicker(a,b,c)},_refreshDatepicker:function(a){(a=this._getInst(a))&&this._updateDatepicker(a)},_setDateDatepicker:function(a,b){if(a=this._getInst(a)){this._setDate(a, +b);this._updateDatepicker(a);this._updateAlternate(a)}},_getDateDatepicker:function(a,b){(a=this._getInst(a))&&!a.inline&&this._setDateFromField(a,b);return a?this._getDate(a):null},_doKeyDown:function(a){var b=d.datepicker._getInst(a.target),c=true,e=b.dpDiv.is(".ui-datepicker-rtl");b._keyEvent=true;if(d.datepicker._datepickerShowing)switch(a.keyCode){case 9:d.datepicker._hideDatepicker();c=false;break;case 13:c=d("td."+d.datepicker._dayOverClass+":not(."+d.datepicker._currentClass+")",b.dpDiv); +c[0]?d.datepicker._selectDay(a.target,b.selectedMonth,b.selectedYear,c[0]):d.datepicker._hideDatepicker();return false;case 27:d.datepicker._hideDatepicker();break;case 33:d.datepicker._adjustDate(a.target,a.ctrlKey?-d.datepicker._get(b,"stepBigMonths"):-d.datepicker._get(b,"stepMonths"),"M");break;case 34:d.datepicker._adjustDate(a.target,a.ctrlKey?+d.datepicker._get(b,"stepBigMonths"):+d.datepicker._get(b,"stepMonths"),"M");break;case 35:if(a.ctrlKey||a.metaKey)d.datepicker._clearDate(a.target); +c=a.ctrlKey||a.metaKey;break;case 36:if(a.ctrlKey||a.metaKey)d.datepicker._gotoToday(a.target);c=a.ctrlKey||a.metaKey;break;case 37:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,e?+1:-1,"D");c=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)d.datepicker._adjustDate(a.target,a.ctrlKey?-d.datepicker._get(b,"stepBigMonths"):-d.datepicker._get(b,"stepMonths"),"M");break;case 38:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,-7,"D");c=a.ctrlKey||a.metaKey;break;case 39:if(a.ctrlKey|| +a.metaKey)d.datepicker._adjustDate(a.target,e?-1:+1,"D");c=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)d.datepicker._adjustDate(a.target,a.ctrlKey?+d.datepicker._get(b,"stepBigMonths"):+d.datepicker._get(b,"stepMonths"),"M");break;case 40:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,+7,"D");c=a.ctrlKey||a.metaKey;break;default:c=false}else if(a.keyCode==36&&a.ctrlKey)d.datepicker._showDatepicker(this);else c=false;if(c){a.preventDefault();a.stopPropagation()}},_doKeyPress:function(a){var b= +d.datepicker._getInst(a.target);if(d.datepicker._get(b,"constrainInput")){b=d.datepicker._possibleChars(d.datepicker._get(b,"dateFormat"));var c=String.fromCharCode(a.charCode==C?a.keyCode:a.charCode);return a.ctrlKey||a.metaKey||c<" "||!b||b.indexOf(c)>-1}},_doKeyUp:function(a){a=d.datepicker._getInst(a.target);if(a.input.val()!=a.lastVal)try{if(d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),a.input?a.input.val():null,d.datepicker._getFormatConfig(a))){d.datepicker._setDateFromField(a); +d.datepicker._updateAlternate(a);d.datepicker._updateDatepicker(a)}}catch(b){d.datepicker.log(b)}return true},_showDatepicker:function(a){a=a.target||a;if(a.nodeName.toLowerCase()!="input")a=d("input",a.parentNode)[0];if(!(d.datepicker._isDisabledDatepicker(a)||d.datepicker._lastInput==a)){var b=d.datepicker._getInst(a);if(d.datepicker._curInst&&d.datepicker._curInst!=b){d.datepicker._datepickerShowing&&d.datepicker._triggerOnClose(d.datepicker._curInst);d.datepicker._curInst.dpDiv.stop(true,true)}var c= +d.datepicker._get(b,"beforeShow");H(b.settings,c?c.apply(a,[a,b]):{});b.lastVal=null;d.datepicker._lastInput=a;d.datepicker._setDateFromField(b);if(d.datepicker._inDialog)a.value="";if(!d.datepicker._pos){d.datepicker._pos=d.datepicker._findPos(a);d.datepicker._pos[1]+=a.offsetHeight}var e=false;d(a).parents().each(function(){e|=d(this).css("position")=="fixed";return!e});if(e&&d.browser.opera){d.datepicker._pos[0]-=document.documentElement.scrollLeft;d.datepicker._pos[1]-=document.documentElement.scrollTop}c= +{left:d.datepicker._pos[0],top:d.datepicker._pos[1]};d.datepicker._pos=null;b.dpDiv.empty();b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});d.datepicker._updateDatepicker(b);c=d.datepicker._checkOffset(b,c,e);b.dpDiv.css({position:d.datepicker._inDialog&&d.blockUI?"static":e?"fixed":"absolute",display:"none",left:c.left+"px",top:c.top+"px"});if(!b.inline){c=d.datepicker._get(b,"showAnim");var f=d.datepicker._get(b,"duration"),h=function(){var i=b.dpDiv.find("iframe.ui-datepicker-cover"); +if(i.length){var g=d.datepicker._getBorders(b.dpDiv);i.css({left:-g[0],top:-g[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})}};b.dpDiv.zIndex(d(a).zIndex()+1);d.datepicker._datepickerShowing=true;d.effects&&d.effects[c]?b.dpDiv.show(c,d.datepicker._get(b,"showOptions"),f,h):b.dpDiv[c||"show"](c?f:null,h);if(!c||!f)h();b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus();d.datepicker._curInst=b}}},_updateDatepicker:function(a){this.maxRows=4;var b=d.datepicker._getBorders(a.dpDiv); +J=a;a.dpDiv.empty().append(this._generateHTML(a));var c=a.dpDiv.find("iframe.ui-datepicker-cover");c.length&&c.css({left:-b[0],top:-b[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()});a.dpDiv.find("."+this._dayOverClass+" a").mouseover();b=this._getNumberOfMonths(a);c=b[1];a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");c>1&&a.dpDiv.addClass("ui-datepicker-multi-"+c).css("width",17*c+"em");a.dpDiv[(b[0]!=1||b[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi"); +a.dpDiv[(this._get(a,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");a==d.datepicker._curInst&&d.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&!a.input.is(":disabled")&&a.input[0]!=document.activeElement&&a.input.focus();if(a.yearshtml){var e=a.yearshtml;setTimeout(function(){e===a.yearshtml&&a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml);e=a.yearshtml=null},0)}},_getBorders:function(a){var b=function(c){return{thin:1,medium:2,thick:3}[c]|| +c};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]},_checkOffset:function(a,b,c){var e=a.dpDiv.outerWidth(),f=a.dpDiv.outerHeight(),h=a.input?a.input.outerWidth():0,i=a.input?a.input.outerHeight():0,g=document.documentElement.clientWidth+d(document).scrollLeft(),j=document.documentElement.clientHeight+d(document).scrollTop();b.left-=this._get(a,"isRTL")?e-h:0;b.left-=c&&b.left==a.input.offset().left?d(document).scrollLeft():0;b.top-=c&&b.top==a.input.offset().top+ +i?d(document).scrollTop():0;b.left-=Math.min(b.left,b.left+e>g&&g>e?Math.abs(b.left+e-g):0);b.top-=Math.min(b.top,b.top+f>j&&j>f?Math.abs(f+i):0);return b},_findPos:function(a){for(var b=this._get(this._getInst(a),"isRTL");a&&(a.type=="hidden"||a.nodeType!=1||d.expr.filters.hidden(a));)a=a[b?"previousSibling":"nextSibling"];a=d(a).offset();return[a.left,a.top]},_triggerOnClose:function(a){var b=this._get(a,"onClose");if(b)b.apply(a.input?a.input[0]:null,[a.input?a.input.val():"",a])},_hideDatepicker:function(a){var b= +this._curInst;if(!(!b||a&&b!=d.data(a,"datepicker")))if(this._datepickerShowing){a=this._get(b,"showAnim");var c=this._get(b,"duration"),e=function(){d.datepicker._tidyDialog(b);this._curInst=null};d.effects&&d.effects[a]?b.dpDiv.hide(a,d.datepicker._get(b,"showOptions"),c,e):b.dpDiv[a=="slideDown"?"slideUp":a=="fadeIn"?"fadeOut":"hide"](a?c:null,e);a||e();d.datepicker._triggerOnClose(b);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute", +left:"0",top:"-100px"});if(d.blockUI){d.unblockUI();d("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},_checkExternalClick:function(a){if(d.datepicker._curInst){a=d(a.target);a[0].id!=d.datepicker._mainDivId&&a.parents("#"+d.datepicker._mainDivId).length==0&&!a.hasClass(d.datepicker.markerClassName)&&!a.hasClass(d.datepicker._triggerClass)&&d.datepicker._datepickerShowing&&!(d.datepicker._inDialog&& +d.blockUI)&&d.datepicker._hideDatepicker()}},_adjustDate:function(a,b,c){a=d(a);var e=this._getInst(a[0]);if(!this._isDisabledDatepicker(a[0])){this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"):0),c);this._updateDatepicker(e)}},_gotoToday:function(a){a=d(a);var b=this._getInst(a[0]);if(this._get(b,"gotoCurrent")&&b.currentDay){b.selectedDay=b.currentDay;b.drawMonth=b.selectedMonth=b.currentMonth;b.drawYear=b.selectedYear=b.currentYear}else{var c=new Date;b.selectedDay=c.getDate();b.drawMonth= +b.selectedMonth=c.getMonth();b.drawYear=b.selectedYear=c.getFullYear()}this._notifyChange(b);this._adjustDate(a)},_selectMonthYear:function(a,b,c){a=d(a);var e=this._getInst(a[0]);e._selectingMonthYear=false;e["selected"+(c=="M"?"Month":"Year")]=e["draw"+(c=="M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10);this._notifyChange(e);this._adjustDate(a)},_clickMonthYear:function(a){var b=this._getInst(d(a)[0]);b.input&&b._selectingMonthYear&&setTimeout(function(){b.input.focus()},0);b._selectingMonthYear= +!b._selectingMonthYear},_selectDay:function(a,b,c,e){var f=d(a);if(!(d(e).hasClass(this._unselectableClass)||this._isDisabledDatepicker(f[0]))){f=this._getInst(f[0]);f.selectedDay=f.currentDay=d("a",e).html();f.selectedMonth=f.currentMonth=b;f.selectedYear=f.currentYear=c;this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))}},_clearDate:function(a){a=d(a);this._getInst(a[0]);this._selectDate(a,"")},_selectDate:function(a,b){a=this._getInst(d(a)[0]);b=b!=null?b:this._formatDate(a); +a.input&&a.input.val(b);this._updateAlternate(a);var c=this._get(a,"onSelect");if(c)c.apply(a.input?a.input[0]:null,[b,a]);else a.input&&a.input.trigger("change");if(a.inline)this._updateDatepicker(a);else{this._hideDatepicker();this._lastInput=a.input[0];typeof a.input[0]!="object"&&a.input.focus();this._lastInput=null}},_updateAlternate:function(a){var b=this._get(a,"altField");if(b){var c=this._get(a,"altFormat")||this._get(a,"dateFormat"),e=this._getDate(a),f=this.formatDate(c,e,this._getFormatConfig(a)); +d(b).each(function(){d(this).val(f)})}},noWeekends:function(a){a=a.getDay();return[a>0&&a<6,""]},iso8601Week:function(a){a=new Date(a.getTime());a.setDate(a.getDate()+4-(a.getDay()||7));var b=a.getTime();a.setMonth(0);a.setDate(1);return Math.floor(Math.round((b-a)/864E5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b=="object"?b.toString():b+"";if(b=="")return null;var e=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff;e=typeof e!="string"?e:(new Date).getFullYear()% +100+parseInt(e,10);for(var f=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,h=(c?c.dayNames:null)||this._defaults.dayNames,i=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,g=(c?c.monthNames:null)||this._defaults.monthNames,j=c=-1,l=-1,u=-1,k=false,o=function(p){(p=B+1<a.length&&a.charAt(B+1)==p)&&B++;return p},m=function(p){var D=o(p);p=new RegExp("^\\d{1,"+(p=="@"?14:p=="!"?20:p=="y"&&D?4:p=="o"?3:2)+"}");p=b.substring(q).match(p);if(!p)throw"Missing number at position "+q;q+= +p[0].length;return parseInt(p[0],10)},n=function(p,D,K){p=d.map(o(p)?K:D,function(w,x){return[[x,w]]}).sort(function(w,x){return-(w[1].length-x[1].length)});var E=-1;d.each(p,function(w,x){w=x[1];if(b.substr(q,w.length).toLowerCase()==w.toLowerCase()){E=x[0];q+=w.length;return false}});if(E!=-1)return E+1;else throw"Unknown name at position "+q;},s=function(){if(b.charAt(q)!=a.charAt(B))throw"Unexpected literal at position "+q;q++},q=0,B=0;B<a.length;B++)if(k)if(a.charAt(B)=="'"&&!o("'"))k=false; +else s();else switch(a.charAt(B)){case "d":l=m("d");break;case "D":n("D",f,h);break;case "o":u=m("o");break;case "m":j=m("m");break;case "M":j=n("M",i,g);break;case "y":c=m("y");break;case "@":var v=new Date(m("@"));c=v.getFullYear();j=v.getMonth()+1;l=v.getDate();break;case "!":v=new Date((m("!")-this._ticksTo1970)/1E4);c=v.getFullYear();j=v.getMonth()+1;l=v.getDate();break;case "'":if(o("'"))s();else k=true;break;default:s()}if(q<b.length)throw"Extra/unparsed characters found in date: "+b.substring(q); +if(c==-1)c=(new Date).getFullYear();else if(c<100)c+=(new Date).getFullYear()-(new Date).getFullYear()%100+(c<=e?0:-100);if(u>-1){j=1;l=u;do{e=this._getDaysInMonth(c,j-1);if(l<=e)break;j++;l-=e}while(1)}v=this._daylightSavingAdjust(new Date(c,j-1,l));if(v.getFullYear()!=c||v.getMonth()+1!=j||v.getDate()!=l)throw"Invalid date";return v},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y", +TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(a,b,c){if(!b)return"";var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?c.dayNames:null)||this._defaults.dayNames,h=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort;c=(c?c.monthNames:null)||this._defaults.monthNames;var i=function(o){(o=k+1<a.length&&a.charAt(k+1)==o)&&k++;return o},g=function(o,m,n){m=""+m;if(i(o))for(;m.length< +n;)m="0"+m;return m},j=function(o,m,n,s){return i(o)?s[m]:n[m]},l="",u=false;if(b)for(var k=0;k<a.length;k++)if(u)if(a.charAt(k)=="'"&&!i("'"))u=false;else l+=a.charAt(k);else switch(a.charAt(k)){case "d":l+=g("d",b.getDate(),2);break;case "D":l+=j("D",b.getDay(),e,f);break;case "o":l+=g("o",Math.round(((new Date(b.getFullYear(),b.getMonth(),b.getDate())).getTime()-(new Date(b.getFullYear(),0,0)).getTime())/864E5),3);break;case "m":l+=g("m",b.getMonth()+1,2);break;case "M":l+=j("M",b.getMonth(),h, +c);break;case "y":l+=i("y")?b.getFullYear():(b.getYear()%100<10?"0":"")+b.getYear()%100;break;case "@":l+=b.getTime();break;case "!":l+=b.getTime()*1E4+this._ticksTo1970;break;case "'":if(i("'"))l+="'";else u=true;break;default:l+=a.charAt(k)}return l},_possibleChars:function(a){for(var b="",c=false,e=function(h){(h=f+1<a.length&&a.charAt(f+1)==h)&&f++;return h},f=0;f<a.length;f++)if(c)if(a.charAt(f)=="'"&&!e("'"))c=false;else b+=a.charAt(f);else switch(a.charAt(f)){case "d":case "m":case "y":case "@":b+= +"0123456789";break;case "D":case "M":return null;case "'":if(e("'"))b+="'";else c=true;break;default:b+=a.charAt(f)}return b},_get:function(a,b){return a.settings[b]!==C?a.settings[b]:this._defaults[b]},_setDateFromField:function(a,b){if(a.input.val()!=a.lastVal){var c=this._get(a,"dateFormat"),e=a.lastVal=a.input?a.input.val():null,f,h;f=h=this._getDefaultDate(a);var i=this._getFormatConfig(a);try{f=this.parseDate(c,e,i)||h}catch(g){this.log(g);e=b?"":e}a.selectedDay=f.getDate();a.drawMonth=a.selectedMonth= +f.getMonth();a.drawYear=a.selectedYear=f.getFullYear();a.currentDay=e?f.getDate():0;a.currentMonth=e?f.getMonth():0;a.currentYear=e?f.getFullYear():0;this._adjustInstDate(a)}},_getDefaultDate:function(a){return this._restrictMinMax(a,this._determineDate(a,this._get(a,"defaultDate"),new Date))},_determineDate:function(a,b,c){var e=function(h){var i=new Date;i.setDate(i.getDate()+h);return i},f=function(h){try{return d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),h,d.datepicker._getFormatConfig(a))}catch(i){}var g= +(h.toLowerCase().match(/^c/)?d.datepicker._getDate(a):null)||new Date,j=g.getFullYear(),l=g.getMonth();g=g.getDate();for(var u=/([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g,k=u.exec(h);k;){switch(k[2]||"d"){case "d":case "D":g+=parseInt(k[1],10);break;case "w":case "W":g+=parseInt(k[1],10)*7;break;case "m":case "M":l+=parseInt(k[1],10);g=Math.min(g,d.datepicker._getDaysInMonth(j,l));break;case "y":case "Y":j+=parseInt(k[1],10);g=Math.min(g,d.datepicker._getDaysInMonth(j,l));break}k=u.exec(h)}return new Date(j, +l,g)};if(b=(b=b==null||b===""?c:typeof b=="string"?f(b):typeof b=="number"?isNaN(b)?c:e(b):new Date(b.getTime()))&&b.toString()=="Invalid Date"?c:b){b.setHours(0);b.setMinutes(0);b.setSeconds(0);b.setMilliseconds(0)}return this._daylightSavingAdjust(b)},_daylightSavingAdjust:function(a){if(!a)return null;a.setHours(a.getHours()>12?a.getHours()+2:0);return a},_setDate:function(a,b,c){var e=!b,f=a.selectedMonth,h=a.selectedYear;b=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay= +a.currentDay=b.getDate();a.drawMonth=a.selectedMonth=a.currentMonth=b.getMonth();a.drawYear=a.selectedYear=a.currentYear=b.getFullYear();if((f!=a.selectedMonth||h!=a.selectedYear)&&!c)this._notifyChange(a);this._adjustInstDate(a);if(a.input)a.input.val(e?"":this._formatDate(a))},_getDate:function(a){return!a.currentYear||a.input&&a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay))},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(), +b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),e=this._get(a,"showButtonPanel"),f=this._get(a,"hideIfNoPrevNext"),h=this._get(a,"navigationAsDateFormat"),i=this._getNumberOfMonths(a),g=this._get(a,"showCurrentAtPos"),j=this._get(a,"stepMonths"),l=i[0]!=1||i[1]!=1,u=this._daylightSavingAdjust(!a.currentDay?new Date(9999,9,9):new Date(a.currentYear,a.currentMonth,a.currentDay)),k=this._getMinMaxDate(a,"min"),o=this._getMinMaxDate(a,"max");g=a.drawMonth-g;var m=a.drawYear;if(g<0){g+=12;m--}if(o){var n= +this._daylightSavingAdjust(new Date(o.getFullYear(),o.getMonth()-i[0]*i[1]+1,o.getDate()));for(n=k&&n<k?k:n;this._daylightSavingAdjust(new Date(m,g,1))>n;){g--;if(g<0){g=11;m--}}}a.drawMonth=g;a.drawYear=m;n=this._get(a,"prevText");n=!h?n:this.formatDate(n,this._daylightSavingAdjust(new Date(m,g-j,1)),this._getFormatConfig(a));n=this._canAdjustMonth(a,-1,m,g)?'<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_'+A+".datepicker._adjustDate('#"+a.id+"', -"+j+", 'M');\" title=\""+n+'"><span class="ui-icon ui-icon-circle-triangle-'+ +(c?"e":"w")+'">'+n+"</span></a>":f?"":'<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+n+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"e":"w")+'">'+n+"</span></a>";var s=this._get(a,"nextText");s=!h?s:this.formatDate(s,this._daylightSavingAdjust(new Date(m,g+j,1)),this._getFormatConfig(a));f=this._canAdjustMonth(a,+1,m,g)?'<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_'+A+".datepicker._adjustDate('#"+a.id+"', +"+j+", 'M');\" title=\""+s+'"><span class="ui-icon ui-icon-circle-triangle-'+ +(c?"w":"e")+'">'+s+"</span></a>":f?"":'<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+s+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"w":"e")+'">'+s+"</span></a>";j=this._get(a,"currentText");s=this._get(a,"gotoCurrent")&&a.currentDay?u:b;j=!h?j:this.formatDate(j,s,this._getFormatConfig(a));h=!a.inline?'<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_'+A+'.datepicker._hideDatepicker();">'+this._get(a, +"closeText")+"</button>":"";e=e?'<div class="ui-datepicker-buttonpane ui-widget-content">'+(c?h:"")+(this._isInRange(a,s)?'<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_'+A+".datepicker._gotoToday('#"+a.id+"');\">"+j+"</button>":"")+(c?"":h)+"</div>":"";h=parseInt(this._get(a,"firstDay"),10);h=isNaN(h)?0:h;j=this._get(a,"showWeek");s=this._get(a,"dayNames");this._get(a,"dayNamesShort");var q=this._get(a,"dayNamesMin"),B= +this._get(a,"monthNames"),v=this._get(a,"monthNamesShort"),p=this._get(a,"beforeShowDay"),D=this._get(a,"showOtherMonths"),K=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var E=this._getDefaultDate(a),w="",x=0;x<i[0];x++){var O="";this.maxRows=4;for(var G=0;G<i[1];G++){var P=this._daylightSavingAdjust(new Date(m,g,a.selectedDay)),t=" ui-corner-all",y="";if(l){y+='<div class="ui-datepicker-group';if(i[1]>1)switch(G){case 0:y+=" ui-datepicker-group-first";t=" ui-corner-"+(c?"right": +"left");break;case i[1]-1:y+=" ui-datepicker-group-last";t=" ui-corner-"+(c?"left":"right");break;default:y+=" ui-datepicker-group-middle";t="";break}y+='">'}y+='<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix'+t+'">'+(/all|left/.test(t)&&x==0?c?f:n:"")+(/all|right/.test(t)&&x==0?c?n:f:"")+this._generateMonthYearHeader(a,g,m,k,o,x>0||G>0,B,v)+'</div><table class="ui-datepicker-calendar"><thead><tr>';var z=j?'<th class="ui-datepicker-week-col">'+this._get(a,"weekHeader")+"</th>": +"";for(t=0;t<7;t++){var r=(t+h)%7;z+="<th"+((t+h+6)%7>=5?' class="ui-datepicker-week-end"':"")+'><span title="'+s[r]+'">'+q[r]+"</span></th>"}y+=z+"</tr></thead><tbody>";z=this._getDaysInMonth(m,g);if(m==a.selectedYear&&g==a.selectedMonth)a.selectedDay=Math.min(a.selectedDay,z);t=(this._getFirstDayOfMonth(m,g)-h+7)%7;z=Math.ceil((t+z)/7);this.maxRows=z=l?this.maxRows>z?this.maxRows:z:z;r=this._daylightSavingAdjust(new Date(m,g,1-t));for(var Q=0;Q<z;Q++){y+="<tr>";var R=!j?"":'<td class="ui-datepicker-week-col">'+ +this._get(a,"calculateWeek")(r)+"</td>";for(t=0;t<7;t++){var I=p?p.apply(a.input?a.input[0]:null,[r]):[true,""],F=r.getMonth()!=g,L=F&&!K||!I[0]||k&&r<k||o&&r>o;R+='<td class="'+((t+h+6)%7>=5?" ui-datepicker-week-end":"")+(F?" ui-datepicker-other-month":"")+(r.getTime()==P.getTime()&&g==a.selectedMonth&&a._keyEvent||E.getTime()==r.getTime()&&E.getTime()==P.getTime()?" "+this._dayOverClass:"")+(L?" "+this._unselectableClass+" ui-state-disabled":"")+(F&&!D?"":" "+I[1]+(r.getTime()==u.getTime()?" "+ +this._currentClass:"")+(r.getTime()==b.getTime()?" ui-datepicker-today":""))+'"'+((!F||D)&&I[2]?' title="'+I[2]+'"':"")+(L?"":' onclick="DP_jQuery_'+A+".datepicker._selectDay('#"+a.id+"',"+r.getMonth()+","+r.getFullYear()+', this);return false;"')+">"+(F&&!D?" ":L?'<span class="ui-state-default">'+r.getDate()+"</span>":'<a class="ui-state-default'+(r.getTime()==b.getTime()?" ui-state-highlight":"")+(r.getTime()==u.getTime()?" ui-state-active":"")+(F?" ui-priority-secondary":"")+'" href="#">'+ +r.getDate()+"</a>")+"</td>";r.setDate(r.getDate()+1);r=this._daylightSavingAdjust(r)}y+=R+"</tr>"}g++;if(g>11){g=0;m++}y+="</tbody></table>"+(l?"</div>"+(i[0]>0&&G==i[1]-1?'<div class="ui-datepicker-row-break"></div>':""):"");O+=y}w+=O}w+=e+(d.browser.msie&&parseInt(d.browser.version,10)<7&&!a.inline?'<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>':"");a._keyEvent=false;return w},_generateMonthYearHeader:function(a,b,c,e,f,h,i,g){var j=this._get(a,"changeMonth"), +l=this._get(a,"changeYear"),u=this._get(a,"showMonthAfterYear"),k='<div class="ui-datepicker-title">',o="";if(h||!j)o+='<span class="ui-datepicker-month">'+i[b]+"</span>";else{i=e&&e.getFullYear()==c;var m=f&&f.getFullYear()==c;o+='<select class="ui-datepicker-month" onchange="DP_jQuery_'+A+".datepicker._selectMonthYear('#"+a.id+"', this, 'M');\" onclick=\"DP_jQuery_"+A+".datepicker._clickMonthYear('#"+a.id+"');\">";for(var n=0;n<12;n++)if((!i||n>=e.getMonth())&&(!m||n<=f.getMonth()))o+='<option value="'+ +n+'"'+(n==b?' selected="selected"':"")+">"+g[n]+"</option>";o+="</select>"}u||(k+=o+(h||!(j&&l)?" ":""));if(!a.yearshtml){a.yearshtml="";if(h||!l)k+='<span class="ui-datepicker-year">'+c+"</span>";else{g=this._get(a,"yearRange").split(":");var s=(new Date).getFullYear();i=function(q){q=q.match(/c[+-].*/)?c+parseInt(q.substring(1),10):q.match(/[+-].*/)?s+parseInt(q,10):parseInt(q,10);return isNaN(q)?s:q};b=i(g[0]);g=Math.max(b,i(g[1]||""));b=e?Math.max(b,e.getFullYear()):b;g=f?Math.min(g,f.getFullYear()): +g;for(a.yearshtml+='<select class="ui-datepicker-year" onchange="DP_jQuery_'+A+".datepicker._selectMonthYear('#"+a.id+"', this, 'Y');\" onclick=\"DP_jQuery_"+A+".datepicker._clickMonthYear('#"+a.id+"');\">";b<=g;b++)a.yearshtml+='<option value="'+b+'"'+(b==c?' selected="selected"':"")+">"+b+"</option>";a.yearshtml+="</select>";k+=a.yearshtml;a.yearshtml=null}}k+=this._get(a,"yearSuffix");if(u)k+=(h||!(j&&l)?" ":"")+o;k+="</div>";return k},_adjustInstDate:function(a,b,c){var e=a.drawYear+(c== +"Y"?b:0),f=a.drawMonth+(c=="M"?b:0);b=Math.min(a.selectedDay,this._getDaysInMonth(e,f))+(c=="D"?b:0);e=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(e,f,b)));a.selectedDay=e.getDate();a.drawMonth=a.selectedMonth=e.getMonth();a.drawYear=a.selectedYear=e.getFullYear();if(c=="M"||c=="Y")this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");b=c&&b<c?c:b;return b=a&&b>a?a:b},_notifyChange:function(a){var b=this._get(a,"onChangeMonthYear"); +if(b)b.apply(a.input?a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){a=this._get(a,"numberOfMonths");return a==null?[1,1]:typeof a=="number"?[1,a]:a},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-this._daylightSavingAdjust(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,e){var f=this._getNumberOfMonths(a); +c=this._daylightSavingAdjust(new Date(c,e+(b<0?b:f[0]*f[1]),1));b<0&&c.setDate(this._getDaysInMonth(c.getFullYear(),c.getMonth()));return this._isInRange(a,c)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!a||b.getTime()<=a.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10);return{shortYearCutoff:b,dayNamesShort:this._get(a, +"dayNamesShort"),dayNames:this._get(a,"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,e){if(!b){a.currentDay=a.selectedDay;a.currentMonth=a.selectedMonth;a.currentYear=a.selectedYear}b=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(e,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),b,this._getFormatConfig(a))}});d.fn.datepicker= +function(a){if(!this.length)return this;if(!d.datepicker.initialized){d(document).mousedown(d.datepicker._checkExternalClick).find("body").append(d.datepicker.dpDiv);d.datepicker.initialized=true}var b=Array.prototype.slice.call(arguments,1);if(typeof a=="string"&&(a=="isDisabled"||a=="getDate"||a=="widget"))return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));if(a=="option"&&arguments.length==2&&typeof arguments[1]=="string")return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker, +[this[0]].concat(b));return this.each(function(){typeof a=="string"?d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this].concat(b)):d.datepicker._attachDatepicker(this,a)})};d.datepicker=new M;d.datepicker.initialized=false;d.datepicker.uuid=(new Date).getTime();d.datepicker.version="1.8.14";window["DP_jQuery_"+A]=d})(jQuery); +;/* + * jQuery UI Progressbar 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function(b,d){b.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=b("<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"); +this.valueDiv.remove();b.Widget.prototype.destroy.apply(this,arguments)},value:function(a){if(a===d)return this._value();this._setOption("value",a);return this},_setOption:function(a,c){if(a==="value"){this.options.value=c;this._refreshValue();this._value()===this.options.max&&this._trigger("complete")}b.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;if(typeof a!=="number")a=0;return Math.min(this.options.max,Math.max(this.min,a))},_percentage:function(){return 100* +this._value()/this.options.max},_refreshValue:function(){var a=this.value(),c=this._percentage();if(this.oldValue!==a){this.oldValue=a;this._trigger("change")}this.valueDiv.toggle(a>this.min).toggleClass("ui-corner-right",a===this.options.max).width(c.toFixed(0)+"%");this.element.attr("aria-valuenow",a)}});b.extend(b.ui.progressbar,{version:"1.8.14"})})(jQuery); +;/* + * jQuery UI Effects 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/ + */ +jQuery.effects||function(f,j){function m(c){var a;if(c&&c.constructor==Array&&c.length==3)return c;if(a=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(c))return[parseInt(a[1],10),parseInt(a[2],10),parseInt(a[3],10)];if(a=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(c))return[parseFloat(a[1])*2.55,parseFloat(a[2])*2.55,parseFloat(a[3])*2.55];if(a=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(c))return[parseInt(a[1], +16),parseInt(a[2],16),parseInt(a[3],16)];if(a=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(c))return[parseInt(a[1]+a[1],16),parseInt(a[2]+a[2],16),parseInt(a[3]+a[3],16)];if(/rgba\(0, 0, 0, 0\)/.exec(c))return n.transparent;return n[f.trim(c).toLowerCase()]}function s(c,a){var b;do{b=f.curCSS(c,a);if(b!=""&&b!="transparent"||f.nodeName(c,"body"))break;a="backgroundColor"}while(c=c.parentNode);return m(b)}function o(){var c=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle, +a={},b,d;if(c&&c.length&&c[0]&&c[c[0]])for(var e=c.length;e--;){b=c[e];if(typeof c[b]=="string"){d=b.replace(/\-(\w)/g,function(g,h){return h.toUpperCase()});a[d]=c[b]}}else for(b in c)if(typeof c[b]==="string")a[b]=c[b];return a}function p(c){var a,b;for(a in c){b=c[a];if(b==null||f.isFunction(b)||a in t||/scrollbar/.test(a)||!/color/i.test(a)&&isNaN(parseFloat(b)))delete c[a]}return c}function u(c,a){var b={_:0},d;for(d in a)if(c[d]!=a[d])b[d]=a[d];return b}function k(c,a,b,d){if(typeof c=="object"){d= +a;b=null;a=c;c=a.effect}if(f.isFunction(a)){d=a;b=null;a={}}if(typeof a=="number"||f.fx.speeds[a]){d=b;b=a;a={}}if(f.isFunction(b)){d=b;b=null}a=a||{};b=b||a.duration;b=f.fx.off?0:typeof b=="number"?b:b in f.fx.speeds?f.fx.speeds[b]:f.fx.speeds._default;d=d||a.complete;return[c,a,b,d]}function l(c){if(!c||typeof c==="number"||f.fx.speeds[c])return true;if(typeof c==="string"&&!f.effects[c])return true;return false}f.effects={};f.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor", +"borderTopColor","borderColor","color","outlineColor"],function(c,a){f.fx.step[a]=function(b){if(!b.colorInit){b.start=s(b.elem,a);b.end=m(b.end);b.colorInit=true}b.elem.style[a]="rgb("+Math.max(Math.min(parseInt(b.pos*(b.end[0]-b.start[0])+b.start[0],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[1]-b.start[1])+b.start[1],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[2]-b.start[2])+b.start[2],10),255),0)+")"}});var n={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0, +0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211, +211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},q=["add","remove","toggle"],t={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};f.effects.animateClass=function(c,a,b, +d){if(f.isFunction(b)){d=b;b=null}return this.queue(function(){var e=f(this),g=e.attr("style")||" ",h=p(o.call(this)),r,v=e.attr("class");f.each(q,function(w,i){c[i]&&e[i+"Class"](c[i])});r=p(o.call(this));e.attr("class",v);e.animate(u(h,r),{queue:false,duration:a,easing:b,complete:function(){f.each(q,function(w,i){c[i]&&e[i+"Class"](c[i])});if(typeof e.attr("style")=="object"){e.attr("style").cssText="";e.attr("style").cssText=g}else e.attr("style",g);d&&d.apply(this,arguments);f.dequeue(this)}})})}; +f.fn.extend({_addClass:f.fn.addClass,addClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{add:c},a,b,d]):this._addClass(c)},_removeClass:f.fn.removeClass,removeClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{remove:c},a,b,d]):this._removeClass(c)},_toggleClass:f.fn.toggleClass,toggleClass:function(c,a,b,d,e){return typeof a=="boolean"||a===j?b?f.effects.animateClass.apply(this,[a?{add:c}:{remove:c},b,d,e]):this._toggleClass(c,a):f.effects.animateClass.apply(this, +[{toggle:c},a,b,d])},switchClass:function(c,a,b,d,e){return f.effects.animateClass.apply(this,[{add:a,remove:c},b,d,e])}});f.extend(f.effects,{version:"1.8.14",save:function(c,a){for(var b=0;b<a.length;b++)a[b]!==null&&c.data("ec.storage."+a[b],c[0].style[a[b]])},restore:function(c,a){for(var b=0;b<a.length;b++)a[b]!==null&&c.css(a[b],c.data("ec.storage."+a[b]))},setMode:function(c,a){if(a=="toggle")a=c.is(":hidden")?"show":"hide";return a},getBaseline:function(c,a){var b;switch(c[0]){case "top":b= +0;break;case "middle":b=0.5;break;case "bottom":b=1;break;default:b=c[0]/a.height}switch(c[1]){case "left":c=0;break;case "center":c=0.5;break;case "right":c=1;break;default:c=c[1]/a.width}return{x:c,y:b}},createWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent();var a={width:c.outerWidth(true),height:c.outerHeight(true),"float":c.css("float")},b=f("<div></div>").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0}); +c.wrap(b);b=c.parent();if(c.css("position")=="static"){b.css({position:"relative"});c.css({position:"relative"})}else{f.extend(a,{position:c.css("position"),zIndex:c.css("z-index")});f.each(["top","left","bottom","right"],function(d,e){a[e]=c.css(e);if(isNaN(parseInt(a[e],10)))a[e]="auto"});c.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})}return b.css(a).show()},removeWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent().replaceWith(c);return c},setTransition:function(c, +a,b,d){d=d||{};f.each(a,function(e,g){unit=c.cssUnit(g);if(unit[0]>0)d[g]=unit[0]*b+unit[1]});return d}});f.fn.extend({effect:function(c){var a=k.apply(this,arguments),b={options:a[1],duration:a[2],callback:a[3]};a=b.options.mode;var d=f.effects[c];if(f.fx.off||!d)return a?this[a](b.duration,b.callback):this.each(function(){b.callback&&b.callback.call(this)});return d.call(this,b)},_show:f.fn.show,show:function(c){if(l(c))return this._show.apply(this,arguments);else{var a=k.apply(this,arguments); +a[1].mode="show";return this.effect.apply(this,a)}},_hide:f.fn.hide,hide:function(c){if(l(c))return this._hide.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="hide";return this.effect.apply(this,a)}},__toggle:f.fn.toggle,toggle:function(c){if(l(c)||typeof c==="boolean"||f.isFunction(c))return this.__toggle.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="toggle";return this.effect.apply(this,a)}},cssUnit:function(c){var a=this.css(c),b=[];f.each(["em","px","%", +"pt"],function(d,e){if(a.indexOf(e)>0)b=[parseFloat(a),e]});return b}});f.easing.jswing=f.easing.swing;f.extend(f.easing,{def:"easeOutQuad",swing:function(c,a,b,d,e){return f.easing[f.easing.def](c,a,b,d,e)},easeInQuad:function(c,a,b,d,e){return d*(a/=e)*a+b},easeOutQuad:function(c,a,b,d,e){return-d*(a/=e)*(a-2)+b},easeInOutQuad:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a+b;return-d/2*(--a*(a-2)-1)+b},easeInCubic:function(c,a,b,d,e){return d*(a/=e)*a*a+b},easeOutCubic:function(c,a,b,d,e){return d* +((a=a/e-1)*a*a+1)+b},easeInOutCubic:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a+b;return d/2*((a-=2)*a*a+2)+b},easeInQuart:function(c,a,b,d,e){return d*(a/=e)*a*a*a+b},easeOutQuart:function(c,a,b,d,e){return-d*((a=a/e-1)*a*a*a-1)+b},easeInOutQuart:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a+b;return-d/2*((a-=2)*a*a*a-2)+b},easeInQuint:function(c,a,b,d,e){return d*(a/=e)*a*a*a*a+b},easeOutQuint:function(c,a,b,d,e){return d*((a=a/e-1)*a*a*a*a+1)+b},easeInOutQuint:function(c,a,b,d,e){if((a/= +e/2)<1)return d/2*a*a*a*a*a+b;return d/2*((a-=2)*a*a*a*a+2)+b},easeInSine:function(c,a,b,d,e){return-d*Math.cos(a/e*(Math.PI/2))+d+b},easeOutSine:function(c,a,b,d,e){return d*Math.sin(a/e*(Math.PI/2))+b},easeInOutSine:function(c,a,b,d,e){return-d/2*(Math.cos(Math.PI*a/e)-1)+b},easeInExpo:function(c,a,b,d,e){return a==0?b:d*Math.pow(2,10*(a/e-1))+b},easeOutExpo:function(c,a,b,d,e){return a==e?b+d:d*(-Math.pow(2,-10*a/e)+1)+b},easeInOutExpo:function(c,a,b,d,e){if(a==0)return b;if(a==e)return b+d;if((a/= +e/2)<1)return d/2*Math.pow(2,10*(a-1))+b;return d/2*(-Math.pow(2,-10*--a)+2)+b},easeInCirc:function(c,a,b,d,e){return-d*(Math.sqrt(1-(a/=e)*a)-1)+b},easeOutCirc:function(c,a,b,d,e){return d*Math.sqrt(1-(a=a/e-1)*a)+b},easeInOutCirc:function(c,a,b,d,e){if((a/=e/2)<1)return-d/2*(Math.sqrt(1-a*a)-1)+b;return d/2*(Math.sqrt(1-(a-=2)*a)+1)+b},easeInElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/ +h);return-(h*Math.pow(2,10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g))+b},easeOutElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/h);return h*Math.pow(2,-10*a)*Math.sin((a*e-c)*2*Math.PI/g)+d+b},easeInOutElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e/2)==2)return b+d;g||(g=e*0.3*1.5);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/h);if(a<1)return-0.5* +h*Math.pow(2,10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g)+b;return h*Math.pow(2,-10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g)*0.5+d+b},easeInBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;return d*(a/=e)*a*((g+1)*a-g)+b},easeOutBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;return d*((a=a/e-1)*a*((g+1)*a+g)+1)+b},easeInOutBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;if((a/=e/2)<1)return d/2*a*a*(((g*=1.525)+1)*a-g)+b;return d/2*((a-=2)*a*(((g*=1.525)+1)*a+g)+2)+b},easeInBounce:function(c,a,b,d,e){return d-f.easing.easeOutBounce(c, +e-a,0,d,e)+b},easeOutBounce:function(c,a,b,d,e){return(a/=e)<1/2.75?d*7.5625*a*a+b:a<2/2.75?d*(7.5625*(a-=1.5/2.75)*a+0.75)+b:a<2.5/2.75?d*(7.5625*(a-=2.25/2.75)*a+0.9375)+b:d*(7.5625*(a-=2.625/2.75)*a+0.984375)+b},easeInOutBounce:function(c,a,b,d,e){if(a<e/2)return f.easing.easeInBounce(c,a*2,0,d,e)*0.5+b;return f.easing.easeOutBounce(c,a*2-e,0,d,e)*0.5+d*0.5+b}})}(jQuery); +;/* + * jQuery UI Effects Blind 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Blind + * + * Depends: + * jquery.effects.core.js + */ +(function(b){b.effects.blind=function(c){return this.queue(function(){var a=b(this),g=["position","top","bottom","left","right"],f=b.effects.setMode(a,c.options.mode||"hide"),d=c.options.direction||"vertical";b.effects.save(a,g);a.show();var e=b.effects.createWrapper(a).css({overflow:"hidden"}),h=d=="vertical"?"height":"width";d=d=="vertical"?e.height():e.width();f=="show"&&e.css(h,0);var i={};i[h]=f=="show"?d:0;e.animate(i,c.duration,c.options.easing,function(){f=="hide"&&a.hide();b.effects.restore(a, +g);b.effects.removeWrapper(a);c.callback&&c.callback.apply(a[0],arguments);a.dequeue()})})}})(jQuery); +;/* + * jQuery UI Effects Bounce 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Bounce + * + * Depends: + * jquery.effects.core.js + */ +(function(e){e.effects.bounce=function(b){return this.queue(function(){var a=e(this),l=["position","top","bottom","left","right"],h=e.effects.setMode(a,b.options.mode||"effect"),d=b.options.direction||"up",c=b.options.distance||20,m=b.options.times||5,i=b.duration||250;/show|hide/.test(h)&&l.push("opacity");e.effects.save(a,l);a.show();e.effects.createWrapper(a);var f=d=="up"||d=="down"?"top":"left";d=d=="up"||d=="left"?"pos":"neg";c=b.options.distance||(f=="top"?a.outerHeight({margin:true})/3:a.outerWidth({margin:true})/ +3);if(h=="show")a.css("opacity",0).css(f,d=="pos"?-c:c);if(h=="hide")c/=m*2;h!="hide"&&m--;if(h=="show"){var g={opacity:1};g[f]=(d=="pos"?"+=":"-=")+c;a.animate(g,i/2,b.options.easing);c/=2;m--}for(g=0;g<m;g++){var j={},k={};j[f]=(d=="pos"?"-=":"+=")+c;k[f]=(d=="pos"?"+=":"-=")+c;a.animate(j,i/2,b.options.easing).animate(k,i/2,b.options.easing);c=h=="hide"?c*2:c/2}if(h=="hide"){g={opacity:0};g[f]=(d=="pos"?"-=":"+=")+c;a.animate(g,i/2,b.options.easing,function(){a.hide();e.effects.restore(a,l);e.effects.removeWrapper(a); +b.callback&&b.callback.apply(this,arguments)})}else{j={};k={};j[f]=(d=="pos"?"-=":"+=")+c;k[f]=(d=="pos"?"+=":"-=")+c;a.animate(j,i/2,b.options.easing).animate(k,i/2,b.options.easing,function(){e.effects.restore(a,l);e.effects.removeWrapper(a);b.callback&&b.callback.apply(this,arguments)})}a.queue("fx",function(){a.dequeue()});a.dequeue()})}})(jQuery); +;/* + * jQuery UI Effects Clip 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Clip + * + * Depends: + * jquery.effects.core.js + */ +(function(b){b.effects.clip=function(e){return this.queue(function(){var a=b(this),i=["position","top","bottom","left","right","height","width"],f=b.effects.setMode(a,e.options.mode||"hide"),c=e.options.direction||"vertical";b.effects.save(a,i);a.show();var d=b.effects.createWrapper(a).css({overflow:"hidden"});d=a[0].tagName=="IMG"?d:a;var g={size:c=="vertical"?"height":"width",position:c=="vertical"?"top":"left"};c=c=="vertical"?d.height():d.width();if(f=="show"){d.css(g.size,0);d.css(g.position, +c/2)}var h={};h[g.size]=f=="show"?c:0;h[g.position]=f=="show"?0:c/2;d.animate(h,{queue:false,duration:e.duration,easing:e.options.easing,complete:function(){f=="hide"&&a.hide();b.effects.restore(a,i);b.effects.removeWrapper(a);e.callback&&e.callback.apply(a[0],arguments);a.dequeue()}})})}})(jQuery); +;/* + * jQuery UI Effects Drop 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Drop + * + * Depends: + * jquery.effects.core.js + */ +(function(c){c.effects.drop=function(d){return this.queue(function(){var a=c(this),h=["position","top","bottom","left","right","opacity"],e=c.effects.setMode(a,d.options.mode||"hide"),b=d.options.direction||"left";c.effects.save(a,h);a.show();c.effects.createWrapper(a);var f=b=="up"||b=="down"?"top":"left";b=b=="up"||b=="left"?"pos":"neg";var g=d.options.distance||(f=="top"?a.outerHeight({margin:true})/2:a.outerWidth({margin:true})/2);if(e=="show")a.css("opacity",0).css(f,b=="pos"?-g:g);var i={opacity:e== +"show"?1:0};i[f]=(e=="show"?b=="pos"?"+=":"-=":b=="pos"?"-=":"+=")+g;a.animate(i,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){e=="hide"&&a.hide();c.effects.restore(a,h);c.effects.removeWrapper(a);d.callback&&d.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); +;/* + * jQuery UI Effects Explode 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Explode + * + * Depends: + * jquery.effects.core.js + */ +(function(j){j.effects.explode=function(a){return this.queue(function(){var c=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3,d=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3;a.options.mode=a.options.mode=="toggle"?j(this).is(":visible")?"hide":"show":a.options.mode;var b=j(this).show().css("visibility","hidden"),g=b.offset();g.top-=parseInt(b.css("marginTop"),10)||0;g.left-=parseInt(b.css("marginLeft"),10)||0;for(var h=b.outerWidth(true),i=b.outerHeight(true),e=0;e<c;e++)for(var f= +0;f<d;f++)b.clone().appendTo("body").wrap("<div></div>").css({position:"absolute",visibility:"visible",left:-f*(h/d),top:-e*(i/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:h/d,height:i/c,left:g.left+f*(h/d)+(a.options.mode=="show"?(f-Math.floor(d/2))*(h/d):0),top:g.top+e*(i/c)+(a.options.mode=="show"?(e-Math.floor(c/2))*(i/c):0),opacity:a.options.mode=="show"?0:1}).animate({left:g.left+f*(h/d)+(a.options.mode=="show"?0:(f-Math.floor(d/2))*(h/d)),top:g.top+ +e*(i/c)+(a.options.mode=="show"?0:(e-Math.floor(c/2))*(i/c)),opacity:a.options.mode=="show"?1:0},a.duration||500);setTimeout(function(){a.options.mode=="show"?b.css({visibility:"visible"}):b.css({visibility:"visible"}).hide();a.callback&&a.callback.apply(b[0]);b.dequeue();j("div.ui-effects-explode").remove()},a.duration||500)})}})(jQuery); +;/* + * jQuery UI Effects Fade 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fade + * + * Depends: + * jquery.effects.core.js + */ +(function(b){b.effects.fade=function(a){return this.queue(function(){var c=b(this),d=b.effects.setMode(c,a.options.mode||"hide");c.animate({opacity:d},{queue:false,duration:a.duration,easing:a.options.easing,complete:function(){a.callback&&a.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery); +;/* + * jQuery UI Effects Fold 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fold + * + * Depends: + * jquery.effects.core.js + */ +(function(c){c.effects.fold=function(a){return this.queue(function(){var b=c(this),j=["position","top","bottom","left","right"],d=c.effects.setMode(b,a.options.mode||"hide"),g=a.options.size||15,h=!!a.options.horizFirst,k=a.duration?a.duration/2:c.fx.speeds._default/2;c.effects.save(b,j);b.show();var e=c.effects.createWrapper(b).css({overflow:"hidden"}),f=d=="show"!=h,l=f?["width","height"]:["height","width"];f=f?[e.width(),e.height()]:[e.height(),e.width()];var i=/([0-9]+)%/.exec(g);if(i)g=parseInt(i[1], +10)/100*f[d=="hide"?0:1];if(d=="show")e.css(h?{height:0,width:g}:{height:g,width:0});h={};i={};h[l[0]]=d=="show"?f[0]:g;i[l[1]]=d=="show"?f[1]:0;e.animate(h,k,a.options.easing).animate(i,k,a.options.easing,function(){d=="hide"&&b.hide();c.effects.restore(b,j);c.effects.removeWrapper(b);a.callback&&a.callback.apply(b[0],arguments);b.dequeue()})})}})(jQuery); +;/* + * jQuery UI Effects Highlight 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Highlight + * + * Depends: + * jquery.effects.core.js + */ +(function(b){b.effects.highlight=function(c){return this.queue(function(){var a=b(this),e=["backgroundImage","backgroundColor","opacity"],d=b.effects.setMode(a,c.options.mode||"show"),f={backgroundColor:a.css("backgroundColor")};if(d=="hide")f.opacity=0;b.effects.save(a,e);a.show().css({backgroundImage:"none",backgroundColor:c.options.color||"#ffff99"}).animate(f,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){d=="hide"&&a.hide();b.effects.restore(a,e);d=="show"&&!b.support.opacity&& +this.style.removeAttribute("filter");c.callback&&c.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); +;/* + * jQuery UI Effects Pulsate 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Pulsate + * + * Depends: + * jquery.effects.core.js + */ +(function(d){d.effects.pulsate=function(a){return this.queue(function(){var b=d(this),c=d.effects.setMode(b,a.options.mode||"show");times=(a.options.times||5)*2-1;duration=a.duration?a.duration/2:d.fx.speeds._default/2;isVisible=b.is(":visible");animateTo=0;if(!isVisible){b.css("opacity",0).show();animateTo=1}if(c=="hide"&&isVisible||c=="show"&&!isVisible)times--;for(c=0;c<times;c++){b.animate({opacity:animateTo},duration,a.options.easing);animateTo=(animateTo+1)%2}b.animate({opacity:animateTo},duration, +a.options.easing,function(){animateTo==0&&b.hide();a.callback&&a.callback.apply(this,arguments)});b.queue("fx",function(){b.dequeue()}).dequeue()})}})(jQuery); +;/* + * jQuery UI Effects Scale 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Scale + * + * Depends: + * jquery.effects.core.js + */ +(function(c){c.effects.puff=function(b){return this.queue(function(){var a=c(this),e=c.effects.setMode(a,b.options.mode||"hide"),g=parseInt(b.options.percent,10)||150,h=g/100,i={height:a.height(),width:a.width()};c.extend(b.options,{fade:true,mode:e,percent:e=="hide"?g:100,from:e=="hide"?i:{height:i.height*h,width:i.width*h}});a.effect("scale",b.options,b.duration,b.callback);a.dequeue()})};c.effects.scale=function(b){return this.queue(function(){var a=c(this),e=c.extend(true,{},b.options),g=c.effects.setMode(a, +b.options.mode||"effect"),h=parseInt(b.options.percent,10)||(parseInt(b.options.percent,10)==0?0:g=="hide"?0:100),i=b.options.direction||"both",f=b.options.origin;if(g!="effect"){e.origin=f||["middle","center"];e.restore=true}f={height:a.height(),width:a.width()};a.from=b.options.from||(g=="show"?{height:0,width:0}:f);h={y:i!="horizontal"?h/100:1,x:i!="vertical"?h/100:1};a.to={height:f.height*h.y,width:f.width*h.x};if(b.options.fade){if(g=="show"){a.from.opacity=0;a.to.opacity=1}if(g=="hide"){a.from.opacity= +1;a.to.opacity=0}}e.from=a.from;e.to=a.to;e.mode=g;a.effect("size",e,b.duration,b.callback);a.dequeue()})};c.effects.size=function(b){return this.queue(function(){var a=c(this),e=["position","top","bottom","left","right","width","height","overflow","opacity"],g=["position","top","bottom","left","right","overflow","opacity"],h=["width","height","overflow"],i=["fontSize"],f=["borderTopWidth","borderBottomWidth","paddingTop","paddingBottom"],k=["borderLeftWidth","borderRightWidth","paddingLeft","paddingRight"], +p=c.effects.setMode(a,b.options.mode||"effect"),n=b.options.restore||false,m=b.options.scale||"both",l=b.options.origin,j={height:a.height(),width:a.width()};a.from=b.options.from||j;a.to=b.options.to||j;if(l){l=c.effects.getBaseline(l,j);a.from.top=(j.height-a.from.height)*l.y;a.from.left=(j.width-a.from.width)*l.x;a.to.top=(j.height-a.to.height)*l.y;a.to.left=(j.width-a.to.width)*l.x}var d={from:{y:a.from.height/j.height,x:a.from.width/j.width},to:{y:a.to.height/j.height,x:a.to.width/j.width}}; +if(m=="box"||m=="both"){if(d.from.y!=d.to.y){e=e.concat(f);a.from=c.effects.setTransition(a,f,d.from.y,a.from);a.to=c.effects.setTransition(a,f,d.to.y,a.to)}if(d.from.x!=d.to.x){e=e.concat(k);a.from=c.effects.setTransition(a,k,d.from.x,a.from);a.to=c.effects.setTransition(a,k,d.to.x,a.to)}}if(m=="content"||m=="both")if(d.from.y!=d.to.y){e=e.concat(i);a.from=c.effects.setTransition(a,i,d.from.y,a.from);a.to=c.effects.setTransition(a,i,d.to.y,a.to)}c.effects.save(a,n?e:g);a.show();c.effects.createWrapper(a); +a.css("overflow","hidden").css(a.from);if(m=="content"||m=="both"){f=f.concat(["marginTop","marginBottom"]).concat(i);k=k.concat(["marginLeft","marginRight"]);h=e.concat(f).concat(k);a.find("*[width]").each(function(){child=c(this);n&&c.effects.save(child,h);var o={height:child.height(),width:child.width()};child.from={height:o.height*d.from.y,width:o.width*d.from.x};child.to={height:o.height*d.to.y,width:o.width*d.to.x};if(d.from.y!=d.to.y){child.from=c.effects.setTransition(child,f,d.from.y,child.from); +child.to=c.effects.setTransition(child,f,d.to.y,child.to)}if(d.from.x!=d.to.x){child.from=c.effects.setTransition(child,k,d.from.x,child.from);child.to=c.effects.setTransition(child,k,d.to.x,child.to)}child.css(child.from);child.animate(child.to,b.duration,b.options.easing,function(){n&&c.effects.restore(child,h)})})}a.animate(a.to,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){a.to.opacity===0&&a.css("opacity",a.from.opacity);p=="hide"&&a.hide();c.effects.restore(a, +n?e:g);c.effects.removeWrapper(a);b.callback&&b.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); +;/* + * jQuery UI Effects Shake 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Shake + * + * Depends: + * jquery.effects.core.js + */ +(function(d){d.effects.shake=function(a){return this.queue(function(){var b=d(this),j=["position","top","bottom","left","right"];d.effects.setMode(b,a.options.mode||"effect");var c=a.options.direction||"left",e=a.options.distance||20,l=a.options.times||3,f=a.duration||a.options.duration||140;d.effects.save(b,j);b.show();d.effects.createWrapper(b);var g=c=="up"||c=="down"?"top":"left",h=c=="up"||c=="left"?"pos":"neg";c={};var i={},k={};c[g]=(h=="pos"?"-=":"+=")+e;i[g]=(h=="pos"?"+=":"-=")+e*2;k[g]= +(h=="pos"?"-=":"+=")+e*2;b.animate(c,f,a.options.easing);for(e=1;e<l;e++)b.animate(i,f,a.options.easing).animate(k,f,a.options.easing);b.animate(i,f,a.options.easing).animate(c,f/2,a.options.easing,function(){d.effects.restore(b,j);d.effects.removeWrapper(b);a.callback&&a.callback.apply(this,arguments)});b.queue("fx",function(){b.dequeue()});b.dequeue()})}})(jQuery); +;/* + * jQuery UI Effects Slide 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Slide + * + * Depends: + * jquery.effects.core.js + */ +(function(c){c.effects.slide=function(d){return this.queue(function(){var a=c(this),h=["position","top","bottom","left","right"],f=c.effects.setMode(a,d.options.mode||"show"),b=d.options.direction||"left";c.effects.save(a,h);a.show();c.effects.createWrapper(a).css({overflow:"hidden"});var g=b=="up"||b=="down"?"top":"left";b=b=="up"||b=="left"?"pos":"neg";var e=d.options.distance||(g=="top"?a.outerHeight({margin:true}):a.outerWidth({margin:true}));if(f=="show")a.css(g,b=="pos"?isNaN(e)?"-"+e:-e:e); +var i={};i[g]=(f=="show"?b=="pos"?"+=":"-=":b=="pos"?"-=":"+=")+e;a.animate(i,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){f=="hide"&&a.hide();c.effects.restore(a,h);c.effects.removeWrapper(a);d.callback&&d.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); +;/* + * jQuery UI Effects Transfer 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Transfer + * + * Depends: + * jquery.effects.core.js + */ +(function(e){e.effects.transfer=function(a){return this.queue(function(){var b=e(this),c=e(a.options.to),d=c.offset();c={top:d.top,left:d.left,height:c.innerHeight(),width:c.innerWidth()};d=b.offset();var f=e('<div class="ui-effects-transfer"></div>').appendTo(document.body).addClass(a.options.className).css({top:d.top,left:d.left,height:b.innerHeight(),width:b.innerWidth(),position:"absolute"}).animate(c,a.duration,a.options.easing,function(){f.remove();a.callback&&a.callback.apply(b[0],arguments); +b.dequeue()})})}})(jQuery); +;
\ No newline at end of file diff --git a/plugins/jqueryui/themes/default/images/buttongradient.png b/plugins/jqueryui/themes/default/images/buttongradient.png Binary files differnew file mode 100644 index 000000000..0595474c7 --- /dev/null +++ b/plugins/jqueryui/themes/default/images/buttongradient.png diff --git a/plugins/jqueryui/themes/default/images/listheader.png b/plugins/jqueryui/themes/default/images/listheader.png Binary files differnew file mode 100644 index 000000000..670df0c4a --- /dev/null +++ b/plugins/jqueryui/themes/default/images/listheader.png diff --git a/plugins/jqueryui/themes/default/images/ui-bg_flat_0_aaaaaa_40x100.png b/plugins/jqueryui/themes/default/images/ui-bg_flat_0_aaaaaa_40x100.png Binary files differnew file mode 100755 index 000000000..5b5dab2ab --- /dev/null +++ b/plugins/jqueryui/themes/default/images/ui-bg_flat_0_aaaaaa_40x100.png diff --git a/plugins/jqueryui/themes/default/images/ui-bg_flat_75_ffffff_40x100.png b/plugins/jqueryui/themes/default/images/ui-bg_flat_75_ffffff_40x100.png Binary files differnew file mode 100755 index 000000000..ac8b229af --- /dev/null +++ b/plugins/jqueryui/themes/default/images/ui-bg_flat_75_ffffff_40x100.png diff --git a/plugins/jqueryui/themes/default/images/ui-bg_flat_90_cc3333_40x100.png b/plugins/jqueryui/themes/default/images/ui-bg_flat_90_cc3333_40x100.png Binary files differnew file mode 100755 index 000000000..6a5d37d65 --- /dev/null +++ b/plugins/jqueryui/themes/default/images/ui-bg_flat_90_cc3333_40x100.png diff --git a/plugins/jqueryui/themes/default/images/ui-bg_glass_95_fef1ec_1x400.png b/plugins/jqueryui/themes/default/images/ui-bg_glass_95_fef1ec_1x400.png Binary files differnew file mode 100755 index 000000000..4443fdc1a --- /dev/null +++ b/plugins/jqueryui/themes/default/images/ui-bg_glass_95_fef1ec_1x400.png diff --git a/plugins/jqueryui/themes/default/images/ui-bg_highlight-hard_90_a3a3a3_1x100.png b/plugins/jqueryui/themes/default/images/ui-bg_highlight-hard_90_a3a3a3_1x100.png Binary files differnew file mode 100755 index 000000000..b3533aafe --- /dev/null +++ b/plugins/jqueryui/themes/default/images/ui-bg_highlight-hard_90_a3a3a3_1x100.png diff --git a/plugins/jqueryui/themes/default/images/ui-bg_highlight-hard_90_e6e6e7_1x100.png b/plugins/jqueryui/themes/default/images/ui-bg_highlight-hard_90_e6e6e7_1x100.png Binary files differnew file mode 100755 index 000000000..d0a127f4d --- /dev/null +++ b/plugins/jqueryui/themes/default/images/ui-bg_highlight-hard_90_e6e6e7_1x100.png diff --git a/plugins/jqueryui/themes/default/images/ui-bg_highlight-hard_90_f4f4f4_1x100.png b/plugins/jqueryui/themes/default/images/ui-bg_highlight-hard_90_f4f4f4_1x100.png Binary files differnew file mode 100755 index 000000000..ecc0ac16a --- /dev/null +++ b/plugins/jqueryui/themes/default/images/ui-bg_highlight-hard_90_f4f4f4_1x100.png diff --git a/plugins/jqueryui/themes/default/images/ui-icons_000000_256x240.png b/plugins/jqueryui/themes/default/images/ui-icons_000000_256x240.png Binary files differnew file mode 100755 index 000000000..7c211aa08 --- /dev/null +++ b/plugins/jqueryui/themes/default/images/ui-icons_000000_256x240.png diff --git a/plugins/jqueryui/themes/default/images/ui-icons_333333_256x240.png b/plugins/jqueryui/themes/default/images/ui-icons_333333_256x240.png Binary files differnew file mode 100755 index 000000000..fe079a595 --- /dev/null +++ b/plugins/jqueryui/themes/default/images/ui-icons_333333_256x240.png diff --git a/plugins/jqueryui/themes/default/images/ui-icons_666666_256x240.png b/plugins/jqueryui/themes/default/images/ui-icons_666666_256x240.png Binary files differnew file mode 100755 index 000000000..f87de1ca1 --- /dev/null +++ b/plugins/jqueryui/themes/default/images/ui-icons_666666_256x240.png diff --git a/plugins/jqueryui/themes/default/images/ui-icons_cc3333_256x240.png b/plugins/jqueryui/themes/default/images/ui-icons_cc3333_256x240.png Binary files differnew file mode 100755 index 000000000..b2fe02927 --- /dev/null +++ b/plugins/jqueryui/themes/default/images/ui-icons_cc3333_256x240.png diff --git a/plugins/jqueryui/themes/default/images/ui-icons_dddddd_256x240.png b/plugins/jqueryui/themes/default/images/ui-icons_dddddd_256x240.png Binary files differnew file mode 100755 index 000000000..91aada0ab --- /dev/null +++ b/plugins/jqueryui/themes/default/images/ui-icons_dddddd_256x240.png diff --git a/plugins/jqueryui/themes/default/jquery-ui-1.8.14.custom.css b/plugins/jqueryui/themes/default/jquery-ui-1.8.14.custom.css new file mode 100755 index 000000000..dbc78fd3b --- /dev/null +++ b/plugins/jqueryui/themes/default/jquery-ui-1.8.14.custom.css @@ -0,0 +1,580 @@ +/* + * jQuery UI CSS Framework 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + */ + +/* Layout helpers +----------------------------------*/ +.ui-helper-hidden { display: none; } +.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); } +.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } +.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } +.ui-helper-clearfix { display: inline-block; } +/* required comment for clearfix to work in Opera \*/ +* html .ui-helper-clearfix { height:1%; } +.ui-helper-clearfix { display:block; } +/* end clearfix */ +.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } + + +/* Interaction Cues +----------------------------------*/ +.ui-state-disabled { cursor: default !important; } + + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } + + +/* Misc visuals +----------------------------------*/ + +/* Overlays */ +.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } + + +/* + * jQuery UI CSS Framework 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + * + * To view and modify this theme, visit http://jqueryui.com/themeroller/?ctl=themeroller&ffDefault=Lucida%20Grande,%20Verdana,%20Arial,%20Helvetica,%20sans-serif&fwDefault=normal&fsDefault=1em&cornerRadius=0&bgColorHeader=f4f4f4&bgTextureHeader=04_highlight_hard.png&bgImgOpacityHeader=90&borderColorHeader=999999&fcHeader=333333&iconColorHeader=333333&bgColorContent=ffffff&bgTextureContent=01_flat.png&bgImgOpacityContent=75&borderColorContent=aaaaaa&fcContent=000000&iconColorContent=000000&bgColorDefault=e6e6e7&bgTextureDefault=04_highlight_hard.png&bgImgOpacityDefault=90&borderColorDefault=aaaaaa&fcDefault=000000&iconColorDefault=666666&bgColorHover=e6e6e7&bgTextureHover=04_highlight_hard.png&bgImgOpacityHover=90&borderColorHover=999999&fcHover=000000&iconColorHover=333333&bgColorActive=a3a3a3&bgTextureActive=04_highlight_hard.png&bgImgOpacityActive=90&borderColorActive=a4a4a4&fcActive=000000&iconColorActive=333333&bgColorHighlight=cc3333&bgTextureHighlight=01_flat.png&bgImgOpacityHighlight=90&borderColorHighlight=cc3333&fcHighlight=ffffff&iconColorHighlight=dddddd&bgColorError=fef1ec&bgTextureError=02_glass.png&bgImgOpacityError=95&borderColorError=cc3333&fcError=cc3333&iconColorError=cc3333&bgColorOverlay=aaaaaa&bgTextureOverlay=01_flat.png&bgImgOpacityOverlay=0&opacityOverlay=30&bgColorShadow=aaaaaa&bgTextureShadow=01_flat.png&bgImgOpacityShadow=0&opacityShadow=35&thicknessShadow=6px&offsetTopShadow=-6px&offsetLeftShadow=-6px&cornerRadiusShadow=6px + */ + + +/* Component containers +----------------------------------*/ +.ui-widget { font-family: Lucida Grande, Verdana, Arial, Helvetica, sans-serif; font-size: 1em; } +.ui-widget .ui-widget { font-size: 1em; } +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Lucida Grande, Verdana, Arial, Helvetica, sans-serif; font-size: 1em; } +.ui-widget-content { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x; color: #000000; } +.ui-widget-content a { color: #000000; } +.ui-widget-header { border: 1px solid #999999; border-width: 0 0 1px 0; background: #f4f4f4 url(images/listheader.png) 50% 50% repeat; color: #333333; font-weight: bold; margin: -0.2em -0.2em 0 -0.2em; } +.ui-widget-header a { color: #333333; } + +/* Interaction states +----------------------------------*/ +.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #aaaaaa; background: #e6e6e7 url(images/ui-bg_highlight-hard_90_e6e6e7_1x100.png) 50% 50% repeat-x; font-weight: normal; color: #000000; } +.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #000000; text-decoration: none; } +.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #999999; background: #e6e6e7 url(images/ui-bg_highlight-hard_90_e6e6e7_1x100.png) 50% 50% repeat-x; font-weight: normal; color: #000000; } +.ui-state-hover a, .ui-state-hover a:hover { color: #000000; text-decoration: none; } +.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #a4a4a4; background: #a3a3a3 url(images/ui-bg_highlight-hard_90_a3a3a3_1x100.png) 50% 50% repeat-x; font-weight: normal; color: #000000; } +.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #000000; text-decoration: none; } +.ui-state-focus, .ui-widget-content .ui-state-focus { border: 1px solid #c33; color: #a00; } +.ui-tabs-nav .ui-state-focus { border: 1px solid #a4a4a4; color: #000000; } +.ui-widget :active { outline: none; } + +/* Interaction Cues +----------------------------------*/ +.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #cc3333; background: #cc3333 url(images/ui-bg_flat_90_cc3333_40x100.png) 50% 50% repeat-x; color: #ffffff; } +.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #ffffff; } +.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cc3333; background: #fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x; color: #cc3333; } +.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cc3333; } +.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cc3333; } +.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; } +.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .6; filter:Alpha(Opacity=60); font-weight: normal; } +.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_000000_256x240.png); } +.ui-widget-content .ui-icon {background-image: url(images/ui-icons_000000_256x240.png); } +.ui-widget-header .ui-icon {background-image: url(images/ui-icons_333333_256x240.png); } +.ui-state-default .ui-icon { background-image: url(images/ui-icons_666666_256x240.png); } +.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_333333_256x240.png); } +.ui-state-active .ui-icon {background-image: url(images/ui-icons_333333_256x240.png); } +.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_dddddd_256x240.png); } +.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cc3333_256x240.png); } + +/* positioning */ +.ui-icon-carat-1-n { background-position: 0 0; } +.ui-icon-carat-1-ne { background-position: -16px 0; } +.ui-icon-carat-1-e { background-position: -32px 0; } +.ui-icon-carat-1-se { background-position: -48px 0; } +.ui-icon-carat-1-s { background-position: -64px 0; } +.ui-icon-carat-1-sw { background-position: -80px 0; } +.ui-icon-carat-1-w { background-position: -96px 0; } +.ui-icon-carat-1-nw { background-position: -112px 0; } +.ui-icon-carat-2-n-s { background-position: -128px 0; } +.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-off { background-position: -96px -144px; } +.ui-icon-radio-on { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-start { background-position: -80px -160px; } +/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */ +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-all, .ui-corner-top, .ui-corner-left, .ui-corner-tl { -moz-border-radius-topleft: 0; -webkit-border-top-left-radius: 0; -khtml-border-top-left-radius: 0; border-top-left-radius: 0; } +.ui-corner-all, .ui-corner-top, .ui-corner-right, .ui-corner-tr { -moz-border-radius-topright: 0; -webkit-border-top-right-radius: 0; -khtml-border-top-right-radius: 0; border-top-right-radius: 0; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-left, .ui-corner-bl { -moz-border-radius-bottomleft: 0; -webkit-border-bottom-left-radius: 0; -khtml-border-bottom-left-radius: 0; border-bottom-left-radius: 0; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-right, .ui-corner-br { -moz-border-radius-bottomright: 0; -webkit-border-bottom-right-radius: 0; -khtml-border-bottom-right-radius: 0; border-bottom-right-radius: 0; } + +/* Overlays */ +.ui-widget-overlay { background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); } +.ui-widget-shadow { margin: -6px 0 0 -6px; padding: 6px; background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .35;filter:Alpha(Opacity=35); -moz-border-radius: 6px; -khtml-border-radius: 6px; -webkit-border-radius: 6px; border-radius: 6px; }/* + * jQuery UI Resizable 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Resizable#theming + */ +.ui-resizable { position: relative;} +.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block; } +.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; } +.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; } +.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; } +.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; } +.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; } +.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; } +.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; } +.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; } +.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/* + * jQuery UI Selectable 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectable#theming + */ +.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; } +/* + * jQuery UI Accordion 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Accordion#theming + */ +/* IE/Win - Fix animation bug - #4615 */ +.ui-accordion { width: 100%; } +.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; } +.ui-accordion .ui-accordion-li-fix { display: inline; } +.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; } +.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; } +.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; } +.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; } +.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; } +.ui-accordion .ui-accordion-content-active { display: block; } +/* + * jQuery UI Autocomplete 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete#theming + */ +.ui-autocomplete { position: absolute; cursor: default; } + +/* workarounds */ +* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */ + +#ui-active-menuitem { background:#c33; border-color:#a22; color:#fff; } + +/* + * jQuery UI Menu 1.8.14 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Menu#theming + */ +.ui-menu { + list-style:none; + padding: 2px; + margin: 0; + display:block; + float: left; + box-shadow: 1px 1px 18px #999; + -moz-box-shadow: 1px 1px 12px #999; + -webkit-box-shadow: #999 1px 1px 12px; +} +.ui-menu .ui-menu { + margin-top: -3px; +} +.ui-menu .ui-menu-item { + margin:0; + padding: 0; + zoom: 1; + float: left; + clear: left; + width: 100%; +} +.ui-menu .ui-menu-item a { + text-decoration:none; + display:block; + padding:.2em .4em; + line-height:1.5; + zoom:1; +} +.ui-menu .ui-menu-item a.ui-state-hover, +.ui-menu .ui-menu-item a.ui-state-active { + font-weight: normal; + margin: -1px; +} +/* + * jQuery UI Button 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Button#theming + */ +.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: default; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */ +.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */ +button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */ +.ui-button-icons-only { width: 3.4em; } +button.ui-button-icons-only { width: 3.7em; } +button.ui-button-text-only, a.ui-button-text-only { background-image: url(images/buttongradient.png) !important; } + +/*button text element */ +.ui-button .ui-button-text { display: block; line-height: 1.4; } +.ui-button-text-only .ui-button-text { padding: .3em 1em; } +.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; } +.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; } +.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; } +.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; } +/* no icon support for input elements, provide padding by default */ +input.ui-button { padding: .4em 1em; } + +/*button icon element(s) */ +.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; } +.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; } +.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; } +.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } +.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } + +/*button sets*/ +.ui-buttonset { margin-right: 7px; } +.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; } + +/* workarounds */ +button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */ +/* + * jQuery UI Dialog 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog#theming + */ +.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; box-shadow: 1px 1px 18px #999; -moz-box-shadow: 1px 1px 12px #999; -webkit-box-shadow: #999 1px 1px 12px; } +.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; } +.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; } +.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } +.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } +.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } +.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } +.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } +.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; } +.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: default; } +.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } +.ui-draggable .ui-dialog-titlebar { cursor: move; } +/* + * jQuery UI Slider 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Slider#theming + */ +.ui-slider { position: relative; text-align: left; } +.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } +.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; } + +.ui-slider-horizontal { height: .8em; } +.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } +.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } +.ui-slider-horizontal .ui-slider-range-min { left: 0; } +.ui-slider-horizontal .ui-slider-range-max { right: 0; } + +.ui-slider-vertical { width: .8em; height: 100px; } +.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } +.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } +.ui-slider-vertical .ui-slider-range-min { bottom: 0; } +.ui-slider-vertical .ui-slider-range-max { top: 0; }/* + * jQuery UI Tabs 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs#theming + */ +.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ +.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; } +.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 0 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; -moz-border-radius-topleft: 2px; -webkit-border-top-left-radius: 2px; border-top-left-radius: 2px; -moz-border-radius-topright: 2px; -webkit-border-top-right-radius: 2px; border-top-right-radius: 2px; } +.ui-tabs .ui-tabs-nav li a { float: left; padding: .3em 1em; text-decoration: none; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; } +.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ +.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; } +.ui-tabs .ui-tabs-hide { display: none !important; } + +.ui-dialog .ui-tabs .ui-tabs-nav li.ui-tabs-selected { background:#fff; } + +/* + * jQuery UI Datepicker 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Datepicker#theming + */ +.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; box-shadow: 1px 1px 18px #999; -moz-box-shadow: 1px 1px 12px #999; -webkit-box-shadow: #999 1px 1px 12px; } +.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; } +.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; } +.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; } +.ui-datepicker .ui-datepicker-prev { left:2px; } +.ui-datepicker .ui-datepicker-next { right:2px; } +.ui-datepicker .ui-datepicker-prev-hover { left:1px; } +.ui-datepicker .ui-datepicker-next-hover { right:1px; } +.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; } +.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; } +.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; } +.ui-datepicker select.ui-datepicker-month-year {width: 100%;} +.ui-datepicker select.ui-datepicker-month, +.ui-datepicker select.ui-datepicker-year { width: 49%;} +.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; } +.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; } +.ui-datepicker td { border: 0; padding: 1px; } +.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; } +.ui-datepicker td.ui-datepicker-current-day .ui-state-active { background:#c33; border-color:#a22; color:#fff; } +.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; } +.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: default; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } +.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; } + +/* with multiple calendars */ +.ui-datepicker.ui-datepicker-multi { width:auto; } +.ui-datepicker-multi .ui-datepicker-group { float:left; } +.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; } +.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; } +.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; } +.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; } +.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; } +.ui-datepicker-row-break { clear:both; width:100%; font-size:0em; } + +/* RTL support */ +.ui-datepicker-rtl { direction: rtl; } +.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; } +.ui-datepicker-rtl .ui-datepicker-group { float:right; } +.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; } +.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; } + +/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */ +.ui-datepicker-cover { + display: none; /*sorry for IE5*/ + display/**/: block; /*sorry for IE5*/ + position: absolute; /*must have*/ + z-index: -1; /*must have*/ + filter: mask(); /*must have*/ + top: -4px; /*must have*/ + left: -4px; /*must have*/ + width: 200px; /*must have*/ + height: 200px; /*must have*/ +}/* + * jQuery UI Progressbar 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar#theming + */ +.ui-progressbar { height:2em; text-align: left; } +.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }
\ No newline at end of file diff --git a/plugins/jqueryui/themes/default/roundcube-custom.diff b/plugins/jqueryui/themes/default/roundcube-custom.diff new file mode 100644 index 000000000..cd1e300ae --- /dev/null +++ b/plugins/jqueryui/themes/default/roundcube-custom.diff @@ -0,0 +1,124 @@ +--- jquery-ui-1.8.14.custom.css.orig 2011-07-20 13:59:40.000000000 +0200 ++++ jquery-ui-1.8.14.custom.css 2011-07-24 16:23:47.000000000 +0200 +@@ -61,7 +61,7 @@ + .ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Lucida Grande, Verdana, Arial, Helvetica, sans-serif; font-size: 1em; } + .ui-widget-content { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x; color: #000000; } + .ui-widget-content a { color: #000000; } +-.ui-widget-header { border: 1px solid #999999; background: #f4f4f4 url(images/ui-bg_highlight-hard_90_f4f4f4_1x100.png) 50% 50% repeat-x; color: #333333; font-weight: bold; } ++.ui-widget-header { border: 1px solid #999999; border-width: 0 0 1px 0; background: #f4f4f4 url(images/listheader.png) 50% 50% repeat; color: #333333; font-weight: bold; margin: -0.2em -0.2em 0 -0.2em; } + .ui-widget-header a { color: #333333; } + + /* Interaction states +@@ -72,6 +72,8 @@ + .ui-state-hover a, .ui-state-hover a:hover { color: #000000; text-decoration: none; } + .ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #a4a4a4; background: #a3a3a3 url(images/ui-bg_highlight-hard_90_a3a3a3_1x100.png) 50% 50% repeat-x; font-weight: normal; color: #000000; } + .ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #000000; text-decoration: none; } ++.ui-state-focus, .ui-widget-content .ui-state-focus { border: 1px solid #c33; color: #a00; } ++.ui-tabs-nav .ui-state-focus { border: 1px solid #a4a4a4; color: #000000; } + .ui-widget :active { outline: none; } + + /* Interaction Cues +@@ -82,7 +84,7 @@ + .ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cc3333; } + .ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cc3333; } + .ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; } +-.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } ++.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .6; filter:Alpha(Opacity=60); font-weight: normal; } + .ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } + + /* Icons +@@ -349,6 +351,8 @@ + /* workarounds */ + * html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */ + ++#ui-active-menuitem { background:#c33; border-color:#a22; color:#fff; } ++ + /* + * jQuery UI Menu 1.8.14 + * +@@ -364,6 +368,9 @@ + margin: 0; + display:block; + float: left; ++ box-shadow: 1px 1px 18px #999; ++ -moz-box-shadow: 1px 1px 12px #999; ++ -webkit-box-shadow: #999 1px 1px 12px; + } + .ui-menu .ui-menu { + margin-top: -3px; +@@ -397,15 +404,16 @@ + * + * http://docs.jquery.com/UI/Button#theming + */ +-.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */ ++.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: default; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */ + .ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */ + button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */ + .ui-button-icons-only { width: 3.4em; } + button.ui-button-icons-only { width: 3.7em; } ++button.ui-button-text-only, a.ui-button-text-only { background-image: url(images/buttongradient.png) !important; } + + /*button text element */ + .ui-button .ui-button-text { display: block; line-height: 1.4; } +-.ui-button-text-only .ui-button-text { padding: .4em 1em; } ++.ui-button-text-only .ui-button-text { padding: .3em 1em; } + .ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; } + .ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; } + .ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; } +@@ -435,7 +443,7 @@ + * + * http://docs.jquery.com/UI/Dialog#theming + */ +-.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; } ++.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; box-shadow: 1px 1px 18px #999; -moz-box-shadow: 1px 1px 12px #999; -webkit-box-shadow: #999 1px 1px 12px; } + .ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; } + .ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; } + .ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } +@@ -444,7 +452,7 @@ + .ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } + .ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } + .ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; } +-.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; } ++.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: default; } + .ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } + .ui-draggable .ui-dialog-titlebar { cursor: move; } + /* +@@ -481,13 +489,16 @@ + */ + .ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ + .ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; } +-.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; } +-.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; } ++.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 0 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; -moz-border-radius-topleft: 2px; -webkit-border-top-left-radius: 2px; border-top-left-radius: 2px; -moz-border-radius-topright: 2px; -webkit-border-top-right-radius: 2px; border-top-right-radius: 2px; } ++.ui-tabs .ui-tabs-nav li a { float: left; padding: .3em 1em; text-decoration: none; } + .ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; } + .ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; } + .ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ + .ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; } + .ui-tabs .ui-tabs-hide { display: none !important; } ++ ++.ui-dialog .ui-tabs .ui-tabs-nav li.ui-tabs-selected { background:#fff; } ++ + /* + * jQuery UI Datepicker 1.8.14 + * +@@ -497,7 +508,7 @@ + * + * http://docs.jquery.com/UI/Datepicker#theming + */ +-.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; } ++.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; box-shadow: 1px 1px 18px #999; -moz-box-shadow: 1px 1px 12px #999; -webkit-box-shadow: #999 1px 1px 12px; } + .ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; } + .ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; } + .ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; } +@@ -515,8 +526,9 @@ + .ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; } + .ui-datepicker td { border: 0; padding: 1px; } + .ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; } ++.ui-datepicker td.ui-datepicker-current-day .ui-state-active { background:#c33; border-color:#a22; color:#fff; } + .ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; } +-.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } ++.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: default; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } + .ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; } + + /* with multiple calendars */ diff --git a/plugins/jqueryui/themes/redmond/images/ui-bg_flat_0_aaaaaa_40x100.png b/plugins/jqueryui/themes/redmond/images/ui-bg_flat_0_aaaaaa_40x100.png Binary files differnew file mode 100755 index 000000000..5b5dab2ab --- /dev/null +++ b/plugins/jqueryui/themes/redmond/images/ui-bg_flat_0_aaaaaa_40x100.png diff --git a/plugins/jqueryui/themes/redmond/images/ui-bg_flat_55_fbec88_40x100.png b/plugins/jqueryui/themes/redmond/images/ui-bg_flat_55_fbec88_40x100.png Binary files differnew file mode 100755 index 000000000..47acaadd7 --- /dev/null +++ b/plugins/jqueryui/themes/redmond/images/ui-bg_flat_55_fbec88_40x100.png diff --git a/plugins/jqueryui/themes/redmond/images/ui-bg_glass_75_d0e5f5_1x400.png b/plugins/jqueryui/themes/redmond/images/ui-bg_glass_75_d0e5f5_1x400.png Binary files differnew file mode 100755 index 000000000..9fb564f8d --- /dev/null +++ b/plugins/jqueryui/themes/redmond/images/ui-bg_glass_75_d0e5f5_1x400.png diff --git a/plugins/jqueryui/themes/redmond/images/ui-bg_glass_85_dfeffc_1x400.png b/plugins/jqueryui/themes/redmond/images/ui-bg_glass_85_dfeffc_1x400.png Binary files differnew file mode 100755 index 000000000..014951529 --- /dev/null +++ b/plugins/jqueryui/themes/redmond/images/ui-bg_glass_85_dfeffc_1x400.png diff --git a/plugins/jqueryui/themes/redmond/images/ui-bg_glass_95_fef1ec_1x400.png b/plugins/jqueryui/themes/redmond/images/ui-bg_glass_95_fef1ec_1x400.png Binary files differnew file mode 100755 index 000000000..4443fdc1a --- /dev/null +++ b/plugins/jqueryui/themes/redmond/images/ui-bg_glass_95_fef1ec_1x400.png diff --git a/plugins/jqueryui/themes/redmond/images/ui-bg_gloss-wave_55_5c9ccc_500x100.png b/plugins/jqueryui/themes/redmond/images/ui-bg_gloss-wave_55_5c9ccc_500x100.png Binary files differnew file mode 100755 index 000000000..81ecc362d --- /dev/null +++ b/plugins/jqueryui/themes/redmond/images/ui-bg_gloss-wave_55_5c9ccc_500x100.png diff --git a/plugins/jqueryui/themes/redmond/images/ui-bg_inset-hard_100_f5f8f9_1x100.png b/plugins/jqueryui/themes/redmond/images/ui-bg_inset-hard_100_f5f8f9_1x100.png Binary files differnew file mode 100755 index 000000000..4f3faf8aa --- /dev/null +++ b/plugins/jqueryui/themes/redmond/images/ui-bg_inset-hard_100_f5f8f9_1x100.png diff --git a/plugins/jqueryui/themes/redmond/images/ui-bg_inset-hard_100_fcfdfd_1x100.png b/plugins/jqueryui/themes/redmond/images/ui-bg_inset-hard_100_fcfdfd_1x100.png Binary files differnew file mode 100755 index 000000000..38c38335d --- /dev/null +++ b/plugins/jqueryui/themes/redmond/images/ui-bg_inset-hard_100_fcfdfd_1x100.png diff --git a/plugins/jqueryui/themes/redmond/images/ui-icons_217bc0_256x240.png b/plugins/jqueryui/themes/redmond/images/ui-icons_217bc0_256x240.png Binary files differnew file mode 100755 index 000000000..6f4bd87c0 --- /dev/null +++ b/plugins/jqueryui/themes/redmond/images/ui-icons_217bc0_256x240.png diff --git a/plugins/jqueryui/themes/redmond/images/ui-icons_2e83ff_256x240.png b/plugins/jqueryui/themes/redmond/images/ui-icons_2e83ff_256x240.png Binary files differnew file mode 100755 index 000000000..09d1cdc85 --- /dev/null +++ b/plugins/jqueryui/themes/redmond/images/ui-icons_2e83ff_256x240.png diff --git a/plugins/jqueryui/themes/redmond/images/ui-icons_469bdd_256x240.png b/plugins/jqueryui/themes/redmond/images/ui-icons_469bdd_256x240.png Binary files differnew file mode 100755 index 000000000..bd2cf079a --- /dev/null +++ b/plugins/jqueryui/themes/redmond/images/ui-icons_469bdd_256x240.png diff --git a/plugins/jqueryui/themes/redmond/images/ui-icons_6da8d5_256x240.png b/plugins/jqueryui/themes/redmond/images/ui-icons_6da8d5_256x240.png Binary files differnew file mode 100755 index 000000000..3d6f567f4 --- /dev/null +++ b/plugins/jqueryui/themes/redmond/images/ui-icons_6da8d5_256x240.png diff --git a/plugins/jqueryui/themes/redmond/images/ui-icons_cd0a0a_256x240.png b/plugins/jqueryui/themes/redmond/images/ui-icons_cd0a0a_256x240.png Binary files differnew file mode 100755 index 000000000..2ab019b73 --- /dev/null +++ b/plugins/jqueryui/themes/redmond/images/ui-icons_cd0a0a_256x240.png diff --git a/plugins/jqueryui/themes/redmond/images/ui-icons_d8e7f3_256x240.png b/plugins/jqueryui/themes/redmond/images/ui-icons_d8e7f3_256x240.png Binary files differnew file mode 100755 index 000000000..ad2dc6f9d --- /dev/null +++ b/plugins/jqueryui/themes/redmond/images/ui-icons_d8e7f3_256x240.png diff --git a/plugins/jqueryui/themes/redmond/images/ui-icons_f9bd01_256x240.png b/plugins/jqueryui/themes/redmond/images/ui-icons_f9bd01_256x240.png Binary files differnew file mode 100755 index 000000000..78625024d --- /dev/null +++ b/plugins/jqueryui/themes/redmond/images/ui-icons_f9bd01_256x240.png diff --git a/plugins/jqueryui/themes/redmond/jquery-ui-1.8.14.custom.css b/plugins/jqueryui/themes/redmond/jquery-ui-1.8.14.custom.css new file mode 100755 index 000000000..49dc0abfe --- /dev/null +++ b/plugins/jqueryui/themes/redmond/jquery-ui-1.8.14.custom.css @@ -0,0 +1,568 @@ +/* + * jQuery UI CSS Framework 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + */ + +/* Layout helpers +----------------------------------*/ +.ui-helper-hidden { display: none; } +.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); } +.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } +.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } +.ui-helper-clearfix { display: inline-block; } +/* required comment for clearfix to work in Opera \*/ +* html .ui-helper-clearfix { height:1%; } +.ui-helper-clearfix { display:block; } +/* end clearfix */ +.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } + + +/* Interaction Cues +----------------------------------*/ +.ui-state-disabled { cursor: default !important; } + + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } + + +/* Misc visuals +----------------------------------*/ + +/* Overlays */ +.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } + + +/* + * jQuery UI CSS Framework 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + * + * To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Lucida%20Grande,%20Lucida%20Sans,%20Arial,%20sans-serif&fwDefault=bold&fsDefault=1.1em&cornerRadius=5px&bgColorHeader=5c9ccc&bgTextureHeader=12_gloss_wave.png&bgImgOpacityHeader=55&borderColorHeader=4297d7&fcHeader=ffffff&iconColorHeader=d8e7f3&bgColorContent=fcfdfd&bgTextureContent=06_inset_hard.png&bgImgOpacityContent=100&borderColorContent=a6c9e2&fcContent=222222&iconColorContent=469bdd&bgColorDefault=dfeffc&bgTextureDefault=02_glass.png&bgImgOpacityDefault=85&borderColorDefault=c5dbec&fcDefault=2e6e9e&iconColorDefault=6da8d5&bgColorHover=d0e5f5&bgTextureHover=02_glass.png&bgImgOpacityHover=75&borderColorHover=79b7e7&fcHover=1d5987&iconColorHover=217bc0&bgColorActive=f5f8f9&bgTextureActive=06_inset_hard.png&bgImgOpacityActive=100&borderColorActive=79b7e7&fcActive=e17009&iconColorActive=f9bd01&bgColorHighlight=fbec88&bgTextureHighlight=01_flat.png&bgImgOpacityHighlight=55&borderColorHighlight=fad42e&fcHighlight=363636&iconColorHighlight=2e83ff&bgColorError=fef1ec&bgTextureError=02_glass.png&bgImgOpacityError=95&borderColorError=cd0a0a&fcError=cd0a0a&iconColorError=cd0a0a&bgColorOverlay=aaaaaa&bgTextureOverlay=01_flat.png&bgImgOpacityOverlay=0&opacityOverlay=30&bgColorShadow=aaaaaa&bgTextureShadow=01_flat.png&bgImgOpacityShadow=0&opacityShadow=30&thicknessShadow=8px&offsetTopShadow=-8px&offsetLeftShadow=-8px&cornerRadiusShadow=8px + */ + + +/* Component containers +----------------------------------*/ +.ui-widget { font-family: Lucida Grande, Lucida Sans, Arial, sans-serif; font-size: 1.1em; } +.ui-widget .ui-widget { font-size: 1em; } +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Lucida Grande, Lucida Sans, Arial, sans-serif; font-size: 1em; } +.ui-widget-content { border: 1px solid #a6c9e2; background: #fcfdfd url(images/ui-bg_inset-hard_100_fcfdfd_1x100.png) 50% bottom repeat-x; color: #222222; } +.ui-widget-content a { color: #222222; } +.ui-widget-header { border: 1px solid #4297d7; background: #5c9ccc url(images/ui-bg_gloss-wave_55_5c9ccc_500x100.png) 50% 50% repeat-x; color: #ffffff; font-weight: bold; } +.ui-widget-header a { color: #ffffff; } + +/* Interaction states +----------------------------------*/ +.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #c5dbec; background: #dfeffc url(images/ui-bg_glass_85_dfeffc_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #2e6e9e; } +.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #2e6e9e; text-decoration: none; } +.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #79b7e7; background: #d0e5f5 url(images/ui-bg_glass_75_d0e5f5_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #1d5987; } +.ui-state-hover a, .ui-state-hover a:hover { color: #1d5987; text-decoration: none; } +.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #79b7e7; background: #f5f8f9 url(images/ui-bg_inset-hard_100_f5f8f9_1x100.png) 50% 50% repeat-x; font-weight: bold; color: #e17009; } +.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #e17009; text-decoration: none; } +.ui-widget :active { outline: none; } + +/* Interaction Cues +----------------------------------*/ +.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fad42e; background: #fbec88 url(images/ui-bg_flat_55_fbec88_40x100.png) 50% 50% repeat-x; color: #363636; } +.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; } +.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x; color: #cd0a0a; } +.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd0a0a; } +.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd0a0a; } +.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; } +.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } +.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_469bdd_256x240.png); } +.ui-widget-content .ui-icon {background-image: url(images/ui-icons_469bdd_256x240.png); } +.ui-widget-header .ui-icon {background-image: url(images/ui-icons_d8e7f3_256x240.png); } +.ui-state-default .ui-icon { background-image: url(images/ui-icons_6da8d5_256x240.png); } +.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_217bc0_256x240.png); } +.ui-state-active .ui-icon {background-image: url(images/ui-icons_f9bd01_256x240.png); } +.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png); } +.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png); } + +/* positioning */ +.ui-icon-carat-1-n { background-position: 0 0; } +.ui-icon-carat-1-ne { background-position: -16px 0; } +.ui-icon-carat-1-e { background-position: -32px 0; } +.ui-icon-carat-1-se { background-position: -48px 0; } +.ui-icon-carat-1-s { background-position: -64px 0; } +.ui-icon-carat-1-sw { background-position: -80px 0; } +.ui-icon-carat-1-w { background-position: -96px 0; } +.ui-icon-carat-1-nw { background-position: -112px 0; } +.ui-icon-carat-2-n-s { background-position: -128px 0; } +.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-off { background-position: -96px -144px; } +.ui-icon-radio-on { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-start { background-position: -80px -160px; } +/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */ +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-all, .ui-corner-top, .ui-corner-left, .ui-corner-tl { -moz-border-radius-topleft: 5px; -webkit-border-top-left-radius: 5px; -khtml-border-top-left-radius: 5px; border-top-left-radius: 5px; } +.ui-corner-all, .ui-corner-top, .ui-corner-right, .ui-corner-tr { -moz-border-radius-topright: 5px; -webkit-border-top-right-radius: 5px; -khtml-border-top-right-radius: 5px; border-top-right-radius: 5px; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-left, .ui-corner-bl { -moz-border-radius-bottomleft: 5px; -webkit-border-bottom-left-radius: 5px; -khtml-border-bottom-left-radius: 5px; border-bottom-left-radius: 5px; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-right, .ui-corner-br { -moz-border-radius-bottomright: 5px; -webkit-border-bottom-right-radius: 5px; -khtml-border-bottom-right-radius: 5px; border-bottom-right-radius: 5px; } + +/* Overlays */ +.ui-widget-overlay { background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); } +.ui-widget-shadow { margin: -8px 0 0 -8px; padding: 8px; background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); -moz-border-radius: 8px; -khtml-border-radius: 8px; -webkit-border-radius: 8px; border-radius: 8px; }/* + * jQuery UI Resizable 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Resizable#theming + */ +.ui-resizable { position: relative;} +.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block; } +.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; } +.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; } +.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; } +.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; } +.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; } +.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; } +.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; } +.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; } +.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/* + * jQuery UI Selectable 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectable#theming + */ +.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; } +/* + * jQuery UI Accordion 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Accordion#theming + */ +/* IE/Win - Fix animation bug - #4615 */ +.ui-accordion { width: 100%; } +.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; } +.ui-accordion .ui-accordion-li-fix { display: inline; } +.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; } +.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; } +.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; } +.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; } +.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; } +.ui-accordion .ui-accordion-content-active { display: block; } +/* + * jQuery UI Autocomplete 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete#theming + */ +.ui-autocomplete { position: absolute; cursor: default; } + +/* workarounds */ +* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */ + +/* + * jQuery UI Menu 1.8.14 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Menu#theming + */ +.ui-menu { + list-style:none; + padding: 2px; + margin: 0; + display:block; + float: left; +} +.ui-menu .ui-menu { + margin-top: -3px; +} +.ui-menu .ui-menu-item { + margin:0; + padding: 0; + zoom: 1; + float: left; + clear: left; + width: 100%; +} +.ui-menu .ui-menu-item a { + text-decoration:none; + display:block; + padding:.2em .4em; + line-height:1.5; + zoom:1; +} +.ui-menu .ui-menu-item a.ui-state-hover, +.ui-menu .ui-menu-item a.ui-state-active { + font-weight: normal; + margin: -1px; +} +/* + * jQuery UI Button 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Button#theming + */ +.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */ +.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */ +button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */ +.ui-button-icons-only { width: 3.4em; } +button.ui-button-icons-only { width: 3.7em; } + +/*button text element */ +.ui-button .ui-button-text { display: block; line-height: 1.4; } +.ui-button-text-only .ui-button-text { padding: .4em 1em; } +.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; } +.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; } +.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; } +.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; } +/* no icon support for input elements, provide padding by default */ +input.ui-button { padding: .4em 1em; } + +/*button icon element(s) */ +.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; } +.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; } +.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; } +.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } +.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } + +/*button sets*/ +.ui-buttonset { margin-right: 7px; } +.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; } + +/* workarounds */ +button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */ +/* + * jQuery UI Dialog 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog#theming + */ +.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; } +.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; } +.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; } +.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } +.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } +.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } +.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } +.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } +.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; } +.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; } +.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } +.ui-draggable .ui-dialog-titlebar { cursor: move; } +/* + * jQuery UI Slider 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Slider#theming + */ +.ui-slider { position: relative; text-align: left; } +.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } +.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; } + +.ui-slider-horizontal { height: .8em; } +.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } +.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } +.ui-slider-horizontal .ui-slider-range-min { left: 0; } +.ui-slider-horizontal .ui-slider-range-max { right: 0; } + +.ui-slider-vertical { width: .8em; height: 100px; } +.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } +.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } +.ui-slider-vertical .ui-slider-range-min { bottom: 0; } +.ui-slider-vertical .ui-slider-range-max { top: 0; }/* + * jQuery UI Tabs 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs#theming + */ +.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ +.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; } +.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; } +.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; } +.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ +.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; } +.ui-tabs .ui-tabs-hide { display: none !important; } +/* + * jQuery UI Datepicker 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Datepicker#theming + */ +.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; } +.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; } +.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; } +.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; } +.ui-datepicker .ui-datepicker-prev { left:2px; } +.ui-datepicker .ui-datepicker-next { right:2px; } +.ui-datepicker .ui-datepicker-prev-hover { left:1px; } +.ui-datepicker .ui-datepicker-next-hover { right:1px; } +.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; } +.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; } +.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; } +.ui-datepicker select.ui-datepicker-month-year {width: 100%;} +.ui-datepicker select.ui-datepicker-month, +.ui-datepicker select.ui-datepicker-year { width: 49%;} +.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; } +.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; } +.ui-datepicker td { border: 0; padding: 1px; } +.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; } +.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; } +.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } +.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; } + +/* with multiple calendars */ +.ui-datepicker.ui-datepicker-multi { width:auto; } +.ui-datepicker-multi .ui-datepicker-group { float:left; } +.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; } +.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; } +.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; } +.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; } +.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; } +.ui-datepicker-row-break { clear:both; width:100%; font-size:0em; } + +/* RTL support */ +.ui-datepicker-rtl { direction: rtl; } +.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; } +.ui-datepicker-rtl .ui-datepicker-group { float:right; } +.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; } +.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; } + +/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */ +.ui-datepicker-cover { + display: none; /*sorry for IE5*/ + display/**/: block; /*sorry for IE5*/ + position: absolute; /*must have*/ + z-index: -1; /*must have*/ + filter: mask(); /*must have*/ + top: -4px; /*must have*/ + left: -4px; /*must have*/ + width: 200px; /*must have*/ + height: 200px; /*must have*/ +}/* + * jQuery UI Progressbar 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar#theming + */ +.ui-progressbar { height:2em; text-align: left; } +.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }
\ No newline at end of file diff --git a/plugins/managesieve/Changelog b/plugins/managesieve/Changelog new file mode 100644 index 000000000..185510410 --- /dev/null +++ b/plugins/managesieve/Changelog @@ -0,0 +1,217 @@ +- Fixed sorting of scripts, scripts including aware of the sort order + +* version 5.0-beta [2011-10-17] +----------------------------------------------------------- +- Added possibility to create a filter based on selected message "in-place" +- Fixed import from Horde-INGO (#1488064) +- Add managesieve_script_name option for default name of the script (#1487956) +- Fixed handling of enabled magic_quotes_gpc setting +- Fixed PHP warning on connection error when submitting filter form +- Fixed bug where new action row with flags wasn't handled properly +- Added managesieve_connect hook for plugins +- Fixed doubled Filter tab on page refresh +- Added filters set selector in filter form when invoked in mail task +- Improved script parser, added support for include and variables extensions +- Added Kolab's KEP:14 support (http://wiki.kolab.org/User:Greve/Drafts/KEP:14) +- Use smaller action/rule buttons +- UI redesign: added possibility to move filter to any place using drag&drop + (instead of up/down buttons), added filter sets list object, added more + 'loading' messages +- Added option to hide some scripts (managesieve_filename_exceptions) + +* version 4.3 [2011-07-28] +----------------------------------------------------------- +- Fixed handling of error in Net_Sieve::listScripts() +- Fixed handling of REFERRAL responses (http://pear.php.net/bugs/bug.php?id=17107) +- Fixed bug where wrong folders hierarchy was displayed on folders listing + +* version 4.2 [2011-05-24] +----------------------------------------------------------- +- Moved elsif replacement code to handle only imports from other formats +- Fixed mod_mailbox() usage for newer Roundcube versions +- Fixed regex extension (error: regex require missing) + +* version 4.1 [2011-03-07] +----------------------------------------------------------- +- Fix fileinto target is always INBOX (#1487776) +- Fix escaping of backslash character in quoted strings (#1487780) +- Fix handling of non-safe characters (double-quote, backslash) + or UTF-8 characters (dovecot's implementation bug workaround) + in script names +- Fix saving of a script using flags extension on servers with imap4flags support (#1487825) + +* version 4.0 [2011-02-10] +----------------------------------------------------------- +- Fix STARTTLS for timsieved < 2.3.10 +- Added :regex and :matches support (#1487746) +- Added setflag/addflag/removeflag support (#1487449) +- Added support for vacation :subject field (#1487120) +- rcube_sieve_script class moved to separate file +- Moved javascript code from skin templates into managesieve.js file + +* version 3.0 [2011-02-01] +----------------------------------------------------------- +- Added support for SASL proxy authentication (#1486691) +- Fixed parsing of scripts with \r\n line separator +- Apply forgotten changes for form errors handling +- Fix multi-line strings parsing (#1487685) +- Added tests for script parser +- Rewritten script parser +- Fix double request when clicking on Filters tab using Firefox + +* version 2.10 [2010-10-10] +----------------------------------------------------------- +- Fixed import from Avelsieve +- Use localized size units (#1486976) +- Added support for relational operators and i;ascii-numeric comparator +- Added popups with form errors + +* version 2.9 [2010-08-02] +----------------------------------------------------------- +- Fixed vacation parameters parsing (#1486883) + +* version 2.8 [2010-07-08] +----------------------------------------------------------- +- Added managesieve_auth_type option (#1486731) + +* version 2.7 [2010-07-06] +----------------------------------------------------------- +- Update Net_Sieve to version 1.3.0 (fixes LOGIN athentication) +- Added support for copying and copy sending of messages (COPY extension) + +* version 2.6 [2010-06-03] +----------------------------------------------------------- +- Support %n and %d variables in managesieve_host option + +* version 2.5 [2010-05-04] +----------------------------------------------------------- +- Fix filters set label after activation +- Fix filters set activation, add possibility to deactivate sets (#1486699) +- Fix download button state when sets list is empty +- Fix errors when sets list is empty + +* version 2.4 [2010-04-01] +----------------------------------------------------------- +- Fixed bug in DIGEST-MD5 authentication (http://pear.php.net/bugs/bug.php?id=17285) +- Fixed disabling rules with many tests +- Small css unification with core +- Scripts import/export + +* version 2.3 [2010-03-18] +----------------------------------------------------------- +- Added import from Horde-INGO +- Support for more than one match using if+stop instead of if+elsif structures (#1486078) +- Support for selectively disabling rules within a single sieve script (#1485882) +- Added vertical splitter + +* version 2.2 [2010-02-06] +----------------------------------------------------------- +- Fix handling of "<>" characters in filter names (#1486477) + +* version 2.1 [2010-01-12] +----------------------------------------------------------- +- Fix "require" structure generation when many modules are used +- Fix problem with '<' and '>' characters in header tests + +* version 2.0 [2009-11-02] +----------------------------------------------------------- +- Added 'managesieve_debug' option +- Added multi-script support +- Small css improvements + sprite image buttons +- PEAR::NetSieve 1.2.0b1 + +* version 1.7 [2009-09-20] +----------------------------------------------------------- +- Support multiple managesieve hosts using %h variable + in managesieve_host option +- Fix first rule deleting (#1486140) + +* version 1.6 [2009-09-08] +----------------------------------------------------------- +- Fix warning when importing squirrelmail rules +- Fix handling of "true" as "anyof (true)" test + +* version 1.5 [2009-09-04] +----------------------------------------------------------- +- Added es_ES, ua_UA localizations +- Added 'managesieve_mbox_encoding' option + +* version 1.4 [2009-07-29] +----------------------------------------------------------- +- Updated PEAR::Net_Sieve to 1.1.7 + +* version 1.3 [2009-07-24] +----------------------------------------------------------- +- support more languages +- support config.inc.php file + +* version 1.2 [2009-06-28] +----------------------------------------------------------- +- Support IMAP namespaces in fileinto (#1485943) +- Added it_IT localization + +* version 1.1 [2009-05-27] +----------------------------------------------------------- +- Added new icons +- Added support for headers lists (coma-separated) in rules +- Added de_CH localization + +* version 1.0 [2009-05-21] +----------------------------------------------------------- +- Rewritten using plugin API +- Added hu_HU localization (Tamas Tevesz) + +* version beta7 (svn-r2300) [2009-03-01] +----------------------------------------------------------- +- Added SquirrelMail script auto-import (Jonathan Ernst) +- Added 'vacation' support (Jonathan Ernst & alec) +- Added 'stop' support (Jonathan Ernst) +- Added option for extensions disabling (Jonathan Ernst & alec) +- Added fi_FI, nl_NL, bg_BG localization +- Small style fixes + +* version 0.2-stable1 (svn-r2205) [2009-01-03] +----------------------------------------------------------- +- Fix moving down filter row +- Fixes for compressed js files in stable release package +- Created patch for svn version r2205 + +* version 0.2-stable [2008-12-31] +----------------------------------------------------------- +- Added ru_RU, fr_FR, zh_CN translation +- Fixes for Roundcube 0.2-stable + +* version rc0.2beta [2008-09-21] +----------------------------------------------------------- +- Small css fixes for IE +- Fixes for Roundcube 0.2-beta + +* version beta6 [2008-08-08] +----------------------------------------------------------- +- Added de_DE translation +- Fix for Roundcube r1634 + +* version beta5 [2008-06-10] +----------------------------------------------------------- +- Fixed 'exists' operators +- Fixed 'not*' operators for custom headers +- Fixed filters deleting + +* version beta4 [2008-06-09] +----------------------------------------------------------- +- Fix for Roundcube r1490 + +* version beta3 [2008-05-22] +----------------------------------------------------------- +- Fixed textarea error class setting +- Added pagetitle setting +- Added option 'managesieve_replace_delimiter' +- Fixed errors on IE (still need some css fixes) + +* version beta2 [2008-05-20] +----------------------------------------------------------- +- Use 'if' only for first filter and 'elsif' for the rest + +* version beta1 [2008-05-15] +----------------------------------------------------------- +- Initial version for Roundcube r1388. diff --git a/plugins/managesieve/config.inc.php.dist b/plugins/managesieve/config.inc.php.dist new file mode 100644 index 000000000..cb9b2a97f --- /dev/null +++ b/plugins/managesieve/config.inc.php.dist @@ -0,0 +1,67 @@ +<?php + +// managesieve server port +$rcmail_config['managesieve_port'] = 2000; + +// managesieve server address, default is localhost. +// Replacement variables supported in host name: +// %h - user's IMAP hostname +// %n - http hostname ($_SERVER['SERVER_NAME']) +// %d - domain (http hostname without the first part) +// For example %n = mail.domain.tld, %d = domain.tld +$rcmail_config['managesieve_host'] = 'localhost'; + +// authentication method. Can be CRAM-MD5, DIGEST-MD5, PLAIN, LOGIN, EXTERNAL +// or none. Optional, defaults to best method supported by server. +$rcmail_config['managesieve_auth_type'] = null; + +// Optional managesieve authentication identifier to be used as authorization proxy. +// Authenticate as a different user but act on behalf of the logged in user. +// Works with PLAIN and DIGEST-MD5 auth. +$rcmail_config['managesieve_auth_cid'] = null; + +// Optional managesieve authentication password to be used for imap_auth_cid +$rcmail_config['managesieve_auth_pw'] = null; + +// use or not TLS for managesieve server connection +// it's because I've problems with TLS and dovecot's managesieve plugin +// and it's not needed on localhost +$rcmail_config['managesieve_usetls'] = false; + +// default contents of filters script (eg. default spam filter) +$rcmail_config['managesieve_default'] = '/etc/dovecot/sieve/global'; + +// The name of the script which will be used when there's no user script +$rcmail_config['managesieve_script_name'] = 'managesieve'; + +// Sieve RFC says that we should use UTF-8 endcoding for mailbox names, +// but some implementations does not covert UTF-8 to modified UTF-7. +// Defaults to UTF7-IMAP +$rcmail_config['managesieve_mbox_encoding'] = 'UTF-8'; + +// I need this because my dovecot (with listescape plugin) uses +// ':' delimiter, but creates folders with dot delimiter +$rcmail_config['managesieve_replace_delimiter'] = ''; + +// disabled sieve extensions (body, copy, date, editheader, encoded-character, +// envelope, environment, ereject, fileinto, ihave, imap4flags, index, +// mailbox, mboxmetadata, regex, reject, relational, servermetadata, +// spamtest, spamtestplus, subaddress, vacation, variables, virustest, etc. +// Note: not all extensions are implemented +$rcmail_config['managesieve_disabled_extensions'] = array(); + +// Enables debugging of conversation with sieve server. Logs it into <log_dir>/sieve +$rcmail_config['managesieve_debug'] = false; + +// Enables features described in http://wiki.kolab.org/KEP:14 +$rcmail_config['managesieve_kolab_master'] = false; + +// Script name extension used for scripts including. Dovecot uses '.sieve', +// Cyrus uses '.siv'. Doesn't matter if you have managesieve_kolab_master disabled. +$rcmail_config['managesieve_filename_extension'] = '.sieve'; + +// List of reserved script names (without extension). +// Scripts listed here will be not presented to the user. +$rcmail_config['managesieve_filename_exceptions'] = array(); + +?> diff --git a/plugins/managesieve/lib/Net/Sieve.php b/plugins/managesieve/lib/Net/Sieve.php new file mode 100644 index 000000000..a8e36d8d7 --- /dev/null +++ b/plugins/managesieve/lib/Net/Sieve.php @@ -0,0 +1,1274 @@ +<?php +/** + * This file contains the Net_Sieve class. + * + * PHP version 4 + * + * +-----------------------------------------------------------------------+ + * | All rights reserved. | + * | | + * | Redistribution and use in source and binary forms, with or without | + * | modification, are permitted provided that the following conditions | + * | are met: | + * | | + * | o Redistributions of source code must retain the above copyright | + * | notice, this list of conditions and the following disclaimer. | + * | o Redistributions in binary form must reproduce the above copyright | + * | notice, this list of conditions and the following disclaimer in the | + * | documentation and/or other materials provided with the distribution.| + * | | + * | THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS | + * | "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT | + * | LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR | + * | A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT | + * | OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, | + * | SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT | + * | LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, | + * | DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY | + * | THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT | + * | (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE | + * | OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. | + * +-----------------------------------------------------------------------+ + * + * @category Networking + * @package Net_Sieve + * @author Richard Heyes <richard@phpguru.org> + * @author Damian Fernandez Sosa <damlists@cnba.uba.ar> + * @author Anish Mistry <amistry@am-productions.biz> + * @author Jan Schneider <jan@horde.org> + * @copyright 2002-2003 Richard Heyes + * @copyright 2006-2008 Anish Mistry + * @license http://www.opensource.org/licenses/bsd-license.php BSD + * @version SVN: $Id: Sieve.php 300898 2010-07-01 09:49:02Z yunosh $ + * @link http://pear.php.net/package/Net_Sieve + */ + +require_once 'PEAR.php'; +require_once 'Net/Socket.php'; + +/** + * TODO + * + * o supportsAuthMech() + */ + +/** + * Disconnected state + * @const NET_SIEVE_STATE_DISCONNECTED + */ +define('NET_SIEVE_STATE_DISCONNECTED', 1, true); + +/** + * Authorisation state + * @const NET_SIEVE_STATE_AUTHORISATION + */ +define('NET_SIEVE_STATE_AUTHORISATION', 2, true); + +/** + * Transaction state + * @const NET_SIEVE_STATE_TRANSACTION + */ +define('NET_SIEVE_STATE_TRANSACTION', 3, true); + + +/** + * A class for talking to the timsieved server which comes with Cyrus IMAP. + * + * @category Networking + * @package Net_Sieve + * @author Richard Heyes <richard@phpguru.org> + * @author Damian Fernandez Sosa <damlists@cnba.uba.ar> + * @author Anish Mistry <amistry@am-productions.biz> + * @author Jan Schneider <jan@horde.org> + * @copyright 2002-2003 Richard Heyes + * @copyright 2006-2008 Anish Mistry + * @license http://www.opensource.org/licenses/bsd-license.php BSD + * @version Release: 1.3.0 + * @link http://pear.php.net/package/Net_Sieve + * @link http://www.ietf.org/rfc/rfc3028.txt RFC 3028 (Sieve: A Mail + * Filtering Language) + * @link http://tools.ietf.org/html/draft-ietf-sieve-managesieve A + * Protocol for Remotely Managing Sieve Scripts + */ +class Net_Sieve +{ + /** + * The authentication methods this class supports. + * + * Can be overwritten if having problems with certain methods. + * + * @var array + */ + var $supportedAuthMethods = array('DIGEST-MD5', 'CRAM-MD5', 'EXTERNAL', + 'PLAIN' , 'LOGIN'); + + /** + * SASL authentication methods that require Auth_SASL. + * + * @var array + */ + var $supportedSASLAuthMethods = array('DIGEST-MD5', 'CRAM-MD5'); + + /** + * The socket handle. + * + * @var resource + */ + var $_sock; + + /** + * Parameters and connection information. + * + * @var array + */ + var $_data; + + /** + * Current state of the connection. + * + * One of the NET_SIEVE_STATE_* constants. + * + * @var integer + */ + var $_state; + + /** + * Constructor error. + * + * @var PEAR_Error + */ + var $_error; + + /** + * Whether to enable debugging. + * + * @var boolean + */ + var $_debug = false; + + /** + * Debug output handler. + * + * This has to be a valid callback. + * + * @var string|array + */ + var $_debug_handler = null; + + /** + * Whether to pick up an already established connection. + * + * @var boolean + */ + var $_bypassAuth = false; + + /** + * Whether to use TLS if available. + * + * @var boolean + */ + var $_useTLS = true; + + /** + * Additional options for stream_context_create(). + * + * @var array + */ + var $_options = null; + + /** + * Maximum number of referral loops + * + * @var array + */ + var $_maxReferralCount = 15; + + /** + * Constructor. + * + * Sets up the object, connects to the server and logs in. Stores any + * generated error in $this->_error, which can be retrieved using the + * getError() method. + * + * @param string $user Login username. + * @param string $pass Login password. + * @param string $host Hostname of server. + * @param string $port Port of server. + * @param string $logintype Type of login to perform (see + * $supportedAuthMethods). + * @param string $euser Effective user. If authenticating as an + * administrator, login as this user. + * @param boolean $debug Whether to enable debugging (@see setDebug()). + * @param string $bypassAuth Skip the authentication phase. Useful if the + * socket is already open. + * @param boolean $useTLS Use TLS if available. + * @param array $options Additional options for + * stream_context_create(). + * @param mixed $handler A callback handler for the debug output. + */ + function Net_Sieve($user = null, $pass = null, $host = 'localhost', + $port = 2000, $logintype = '', $euser = '', + $debug = false, $bypassAuth = false, $useTLS = true, + $options = null, $handler = null) + { + $this->_state = NET_SIEVE_STATE_DISCONNECTED; + $this->_data['user'] = $user; + $this->_data['pass'] = $pass; + $this->_data['host'] = $host; + $this->_data['port'] = $port; + $this->_data['logintype'] = $logintype; + $this->_data['euser'] = $euser; + $this->_sock = new Net_Socket(); + $this->_bypassAuth = $bypassAuth; + $this->_useTLS = $useTLS; + $this->_options = $options; + $this->setDebug($debug, $handler); + + /* Try to include the Auth_SASL package. If the package is not + * available, we disable the authentication methods that depend upon + * it. */ + if ((@include_once 'Auth/SASL.php') === false) { + $this->_debug('Auth_SASL not present'); + foreach ($this->supportedSASLAuthMethods as $SASLMethod) { + $pos = array_search($SASLMethod, $this->supportedAuthMethods); + $this->_debug('Disabling method ' . $SASLMethod); + unset($this->supportedAuthMethods[$pos]); + } + } + + if (strlen($user) && strlen($pass)) { + $this->_error = $this->_handleConnectAndLogin(); + } + } + + /** + * Returns any error that may have been generated in the constructor. + * + * @return boolean|PEAR_Error False if no error, PEAR_Error otherwise. + */ + function getError() + { + return PEAR::isError($this->_error) ? $this->_error : false; + } + + /** + * Sets the debug state and handler function. + * + * @param boolean $debug Whether to enable debugging. + * @param string $handler A custom debug handler. Must be a valid callback. + * + * @return void + */ + function setDebug($debug = true, $handler = null) + { + $this->_debug = $debug; + $this->_debug_handler = $handler; + } + + /** + * Connects to the server and logs in. + * + * @return boolean True on success, PEAR_Error on failure. + */ + function _handleConnectAndLogin() + { + if (PEAR::isError($res = $this->connect($this->_data['host'], $this->_data['port'], $this->_options, $this->_useTLS))) { + return $res; + } + if ($this->_bypassAuth === false) { + if (PEAR::isError($res = $this->login($this->_data['user'], $this->_data['pass'], $this->_data['logintype'], $this->_data['euser'], $this->_bypassAuth))) { + return $res; + } + } + return true; + } + + /** + * Handles connecting to the server and checks the response validity. + * + * @param string $host Hostname of server. + * @param string $port Port of server. + * @param array $options List of options to pass to + * stream_context_create(). + * @param boolean $useTLS Use TLS if available. + * + * @return boolean True on success, PEAR_Error otherwise. + */ + function connect($host, $port, $options = null, $useTLS = true) + { + $this->_data['host'] = $host; + $this->_data['port'] = $port; + $this->_useTLS = $useTLS; + if (!empty($options) && is_array($options)) { + $this->_options = array_merge($this->_options, $options); + } + + if (NET_SIEVE_STATE_DISCONNECTED != $this->_state) { + return PEAR::raiseError('Not currently in DISCONNECTED state', 1); + } + + if (PEAR::isError($res = $this->_sock->connect($host, $port, false, 5, $options))) { + return $res; + } + + if ($this->_bypassAuth) { + $this->_state = NET_SIEVE_STATE_TRANSACTION; + } else { + $this->_state = NET_SIEVE_STATE_AUTHORISATION; + if (PEAR::isError($res = $this->_doCmd())) { + return $res; + } + } + + // Explicitly ask for the capabilities in case the connection is + // picked up from an existing connection. + if (PEAR::isError($res = $this->_cmdCapability())) { + return PEAR::raiseError( + 'Failed to connect, server said: ' . $res->getMessage(), 2 + ); + } + + // Check if we can enable TLS via STARTTLS. + if ($useTLS && !empty($this->_capability['starttls']) + && function_exists('stream_socket_enable_crypto') + ) { + if (PEAR::isError($res = $this->_startTLS())) { + return $res; + } + } + + return true; + } + + /** + * Disconnect from the Sieve server. + * + * @param boolean $sendLogoutCMD Whether to send LOGOUT command before + * disconnecting. + * + * @return boolean True on success, PEAR_Error otherwise. + */ + function disconnect($sendLogoutCMD = true) + { + return $this->_cmdLogout($sendLogoutCMD); + } + + /** + * Logs into server. + * + * @param string $user Login username. + * @param string $pass Login password. + * @param string $logintype Type of login method to use. + * @param string $euser Effective UID (perform on behalf of $euser). + * @param boolean $bypassAuth Do not perform authentication. + * + * @return boolean True on success, PEAR_Error otherwise. + */ + function login($user, $pass, $logintype = null, $euser = '', $bypassAuth = false) + { + $this->_data['user'] = $user; + $this->_data['pass'] = $pass; + $this->_data['logintype'] = $logintype; + $this->_data['euser'] = $euser; + $this->_bypassAuth = $bypassAuth; + + if (NET_SIEVE_STATE_AUTHORISATION != $this->_state) { + return PEAR::raiseError('Not currently in AUTHORISATION state', 1); + } + + if (!$bypassAuth ) { + if (PEAR::isError($res = $this->_cmdAuthenticate($user, $pass, $logintype, $euser))) { + return $res; + } + } + $this->_state = NET_SIEVE_STATE_TRANSACTION; + + return true; + } + + /** + * Returns an indexed array of scripts currently on the server. + * + * @return array Indexed array of scriptnames. + */ + function listScripts() + { + if (is_array($scripts = $this->_cmdListScripts())) { + $this->_active = $scripts[1]; + return $scripts[0]; + } else { + return $scripts; + } + } + + /** + * Returns the active script. + * + * @return string The active scriptname. + */ + function getActive() + { + if (!empty($this->_active)) { + return $this->_active; + } + if (is_array($scripts = $this->_cmdListScripts())) { + $this->_active = $scripts[1]; + return $scripts[1]; + } + } + + /** + * Sets the active script. + * + * @param string $scriptname The name of the script to be set as active. + * + * @return boolean True on success, PEAR_Error on failure. + */ + function setActive($scriptname) + { + return $this->_cmdSetActive($scriptname); + } + + /** + * Retrieves a script. + * + * @param string $scriptname The name of the script to be retrieved. + * + * @return string The script on success, PEAR_Error on failure. + */ + function getScript($scriptname) + { + return $this->_cmdGetScript($scriptname); + } + + /** + * Adds a script to the server. + * + * @param string $scriptname Name of the script. + * @param string $script The script content. + * @param boolean $makeactive Whether to make this the active script. + * + * @return boolean True on success, PEAR_Error on failure. + */ + function installScript($scriptname, $script, $makeactive = false) + { + if (PEAR::isError($res = $this->_cmdPutScript($scriptname, $script))) { + return $res; + } + if ($makeactive) { + return $this->_cmdSetActive($scriptname); + } + return true; + } + + /** + * Removes a script from the server. + * + * @param string $scriptname Name of the script. + * + * @return boolean True on success, PEAR_Error on failure. + */ + function removeScript($scriptname) + { + return $this->_cmdDeleteScript($scriptname); + } + + /** + * Checks if the server has space to store the script by the server. + * + * @param string $scriptname The name of the script to mark as active. + * @param integer $size The size of the script. + * + * @return boolean|PEAR_Error True if there is space, PEAR_Error otherwise. + * + * @todo Rename to hasSpace() + */ + function haveSpace($scriptname, $size) + { + if (NET_SIEVE_STATE_TRANSACTION != $this->_state) { + return PEAR::raiseError('Not currently in TRANSACTION state', 1); + } + + $command = sprintf('HAVESPACE %s %d', $this->_escape($scriptname), $size); + if (PEAR::isError($res = $this->_doCmd($command))) { + return $res; + } + return true; + } + + /** + * Returns the list of extensions the server supports. + * + * @return array List of extensions or PEAR_Error on failure. + */ + function getExtensions() + { + if (NET_SIEVE_STATE_DISCONNECTED == $this->_state) { + return PEAR::raiseError('Not currently connected', 7); + } + return $this->_capability['extensions']; + } + + /** + * Returns whether the server supports an extension. + * + * @param string $extension The extension to check. + * + * @return boolean Whether the extension is supported or PEAR_Error on + * failure. + */ + function hasExtension($extension) + { + if (NET_SIEVE_STATE_DISCONNECTED == $this->_state) { + return PEAR::raiseError('Not currently connected', 7); + } + + $extension = trim($this->_toUpper($extension)); + if (is_array($this->_capability['extensions'])) { + foreach ($this->_capability['extensions'] as $ext) { + if ($ext == $extension) { + return true; + } + } + } + + return false; + } + + /** + * Returns the list of authentication methods the server supports. + * + * @return array List of authentication methods or PEAR_Error on failure. + */ + function getAuthMechs() + { + if (NET_SIEVE_STATE_DISCONNECTED == $this->_state) { + return PEAR::raiseError('Not currently connected', 7); + } + return $this->_capability['sasl']; + } + + /** + * Returns whether the server supports an authentication method. + * + * @param string $method The method to check. + * + * @return boolean Whether the method is supported or PEAR_Error on + * failure. + */ + function hasAuthMech($method) + { + if (NET_SIEVE_STATE_DISCONNECTED == $this->_state) { + return PEAR::raiseError('Not currently connected', 7); + } + + $method = trim($this->_toUpper($method)); + if (is_array($this->_capability['sasl'])) { + foreach ($this->_capability['sasl'] as $sasl) { + if ($sasl == $method) { + return true; + } + } + } + + return false; + } + + /** + * Handles the authentication using any known method. + * + * @param string $uid The userid to authenticate as. + * @param string $pwd The password to authenticate with. + * @param string $userMethod The method to use. If empty, the class chooses + * the best (strongest) available method. + * @param string $euser The effective uid to authenticate as. + * + * @return void + */ + function _cmdAuthenticate($uid, $pwd, $userMethod = null, $euser = '') + { + if (PEAR::isError($method = $this->_getBestAuthMethod($userMethod))) { + return $method; + } + switch ($method) { + case 'DIGEST-MD5': + return $this->_authDigestMD5($uid, $pwd, $euser); + case 'CRAM-MD5': + $result = $this->_authCRAMMD5($uid, $pwd, $euser); + break; + case 'LOGIN': + $result = $this->_authLOGIN($uid, $pwd, $euser); + break; + case 'PLAIN': + $result = $this->_authPLAIN($uid, $pwd, $euser); + break; + case 'EXTERNAL': + $result = $this->_authEXTERNAL($uid, $pwd, $euser); + break; + default : + $result = PEAR::raiseError( + $method . ' is not a supported authentication method' + ); + break; + } + + if (PEAR::isError($res = $this->_doCmd())) { + return $res; + } + + return $result; + } + + /** + * Authenticates the user using the PLAIN method. + * + * @param string $user The userid to authenticate as. + * @param string $pass The password to authenticate with. + * @param string $euser The effective uid to authenticate as. + * + * @return void + */ + function _authPLAIN($user, $pass, $euser) + { + return $this->_sendCmd( + sprintf( + 'AUTHENTICATE "PLAIN" "%s"', + base64_encode($euser . chr(0) . $user . chr(0) . $pass) + ) + ); + } + + /** + * Authenticates the user using the LOGIN method. + * + * @param string $user The userid to authenticate as. + * @param string $pass The password to authenticate with. + * @param string $euser The effective uid to authenticate as. + * + * @return void + */ + function _authLOGIN($user, $pass, $euser) + { + if (PEAR::isError($result = $this->_sendCmd('AUTHENTICATE "LOGIN"'))) { + return $result; + } + if (PEAR::isError($result = $this->_doCmd('"' . base64_encode($user) . '"', true))) { + return $result; + } + return $this->_doCmd('"' . base64_encode($pass) . '"', true); + } + + /** + * Authenticates the user using the CRAM-MD5 method. + * + * @param string $user The userid to authenticate as. + * @param string $pass The password to authenticate with. + * @param string $euser The effective uid to authenticate as. + * + * @return void + */ + function _authCRAMMD5($user, $pass, $euser) + { + if (PEAR::isError($challenge = $this->_doCmd('AUTHENTICATE "CRAM-MD5"', true))) { + return $challenge; + } + + $challenge = base64_decode(trim($challenge)); + $cram = Auth_SASL::factory('crammd5'); + if (PEAR::isError($response = $cram->getResponse($user, $pass, $challenge))) { + return $response; + } + + return $this->_sendStringResponse(base64_encode($response)); + } + + /** + * Authenticates the user using the DIGEST-MD5 method. + * + * @param string $user The userid to authenticate as. + * @param string $pass The password to authenticate with. + * @param string $euser The effective uid to authenticate as. + * + * @return void + */ + function _authDigestMD5($user, $pass, $euser) + { + if (PEAR::isError($challenge = $this->_doCmd('AUTHENTICATE "DIGEST-MD5"', true))) { + return $challenge; + } + + $challenge = base64_decode(trim($challenge)); + $digest = Auth_SASL::factory('digestmd5'); + // @todo Really 'localhost'? + if (PEAR::isError($response = $digest->getResponse($user, $pass, $challenge, 'localhost', 'sieve', $euser))) { + return $response; + } + + if (PEAR::isError($result = $this->_sendStringResponse(base64_encode($response)))) { + return $result; + } + if (PEAR::isError($result = $this->_doCmd('', true))) { + return $result; + } + if ($this->_toUpper(substr($result, 0, 2)) == 'OK') { + return; + } + + /* We don't use the protocol's third step because SIEVE doesn't allow + * subsequent authentication, so we just silently ignore it. */ + if (PEAR::isError($result = $this->_sendStringResponse(''))) { + return $result; + } + + return $this->_doCmd(); + } + + /** + * Authenticates the user using the EXTERNAL method. + * + * @param string $user The userid to authenticate as. + * @param string $pass The password to authenticate with. + * @param string $euser The effective uid to authenticate as. + * + * @return void + * + * @since 1.1.7 + */ + function _authEXTERNAL($user, $pass, $euser) + { + $cmd = sprintf( + 'AUTHENTICATE "EXTERNAL" "%s"', + base64_encode(strlen($euser) ? $euser : $user) + ); + return $this->_sendCmd($cmd); + } + + /** + * Removes a script from the server. + * + * @param string $scriptname Name of the script to delete. + * + * @return boolean True on success, PEAR_Error otherwise. + */ + function _cmdDeleteScript($scriptname) + { + if (NET_SIEVE_STATE_TRANSACTION != $this->_state) { + return PEAR::raiseError('Not currently in AUTHORISATION state', 1); + } + + $command = sprintf('DELETESCRIPT %s', $this->_escape($scriptname)); + if (PEAR::isError($res = $this->_doCmd($command))) { + return $res; + } + return true; + } + + /** + * Retrieves the contents of the named script. + * + * @param string $scriptname Name of the script to retrieve. + * + * @return string The script if successful, PEAR_Error otherwise. + */ + function _cmdGetScript($scriptname) + { + if (NET_SIEVE_STATE_TRANSACTION != $this->_state) { + return PEAR::raiseError('Not currently in AUTHORISATION state', 1); + } + + $command = sprintf('GETSCRIPT %s', $this->_escape($scriptname)); + if (PEAR::isError($res = $this->_doCmd($command))) { + return $res; + } + + return preg_replace('/^{[0-9]+}\r\n/', '', $res); + } + + /** + * Sets the active script, i.e. the one that gets run on new mail by the + * server. + * + * @param string $scriptname The name of the script to mark as active. + * + * @return boolean True on success, PEAR_Error otherwise. + */ + function _cmdSetActive($scriptname) + { + if (NET_SIEVE_STATE_TRANSACTION != $this->_state) { + return PEAR::raiseError('Not currently in AUTHORISATION state', 1); + } + + $command = sprintf('SETACTIVE %s', $this->_escape($scriptname)); + if (PEAR::isError($res = $this->_doCmd($command))) { + return $res; + } + + $this->_activeScript = $scriptname; + return true; + } + + /** + * Returns the list of scripts on the server. + * + * @return array An array with the list of scripts in the first element + * and the active script in the second element on success, + * PEAR_Error otherwise. + */ + function _cmdListScripts() + { + if (NET_SIEVE_STATE_TRANSACTION != $this->_state) { + return PEAR::raiseError('Not currently in AUTHORISATION state', 1); + } + + if (PEAR::isError($res = $this->_doCmd('LISTSCRIPTS'))) { + return $res; + } + + $scripts = array(); + $activescript = null; + $res = explode("\r\n", $res); + foreach ($res as $value) { + if (preg_match('/^"(.*)"( ACTIVE)?$/i', $value, $matches)) { + $script_name = stripslashes($matches[1]); + $scripts[] = $script_name; + if (!empty($matches[2])) { + $activescript = $script_name; + } + } + } + + return array($scripts, $activescript); + } + + /** + * Adds a script to the server. + * + * @param string $scriptname Name of the new script. + * @param string $scriptdata The new script. + * + * @return boolean True on success, PEAR_Error otherwise. + */ + function _cmdPutScript($scriptname, $scriptdata) + { + if (NET_SIEVE_STATE_TRANSACTION != $this->_state) { + return PEAR::raiseError('Not currently in AUTHORISATION state', 1); + } + + $stringLength = $this->_getLineLength($scriptdata); + $command = sprintf("PUTSCRIPT %s {%d+}\r\n%s", + $this->_escape($scriptname), $stringLength, $scriptdata); + + if (PEAR::isError($res = $this->_doCmd($command))) { + return $res; + } + + return true; + } + + /** + * Logs out of the server and terminates the connection. + * + * @param boolean $sendLogoutCMD Whether to send LOGOUT command before + * disconnecting. + * + * @return boolean True on success, PEAR_Error otherwise. + */ + function _cmdLogout($sendLogoutCMD = true) + { + if (NET_SIEVE_STATE_DISCONNECTED == $this->_state) { + return PEAR::raiseError('Not currently connected', 1); + } + + if ($sendLogoutCMD) { + if (PEAR::isError($res = $this->_doCmd('LOGOUT'))) { + return $res; + } + } + + $this->_sock->disconnect(); + $this->_state = NET_SIEVE_STATE_DISCONNECTED; + + return true; + } + + /** + * Sends the CAPABILITY command + * + * @return boolean True on success, PEAR_Error otherwise. + */ + function _cmdCapability() + { + if (NET_SIEVE_STATE_DISCONNECTED == $this->_state) { + return PEAR::raiseError('Not currently connected', 1); + } + if (PEAR::isError($res = $this->_doCmd('CAPABILITY'))) { + return $res; + } + $this->_parseCapability($res); + return true; + } + + /** + * Parses the response from the CAPABILITY command and stores the result + * in $_capability. + * + * @param string $data The response from the capability command. + * + * @return void + */ + function _parseCapability($data) + { + // Clear the cached capabilities. + $this->_capability = array('sasl' => array(), + 'extensions' => array()); + + $data = preg_split('/\r?\n/', $this->_toUpper($data), -1, PREG_SPLIT_NO_EMPTY); + + for ($i = 0; $i < count($data); $i++) { + if (!preg_match('/^"([A-Z]+)"( "(.*)")?$/', $data[$i], $matches)) { + continue; + } + switch ($matches[1]) { + case 'IMPLEMENTATION': + $this->_capability['implementation'] = $matches[3]; + break; + + case 'SASL': + $this->_capability['sasl'] = preg_split('/\s+/', $matches[3]); + break; + + case 'SIEVE': + $this->_capability['extensions'] = preg_split('/\s+/', $matches[3]); + break; + + case 'STARTTLS': + $this->_capability['starttls'] = true; + break; + } + } + } + + /** + * Sends a command to the server + * + * @param string $cmd The command to send. + * + * @return void + */ + function _sendCmd($cmd) + { + $status = $this->_sock->getStatus(); + if (PEAR::isError($status) || $status['eof']) { + return PEAR::raiseError('Failed to write to socket: connection lost'); + } + if (PEAR::isError($error = $this->_sock->write($cmd . "\r\n"))) { + return PEAR::raiseError( + 'Failed to write to socket: ' . $error->getMessage() + ); + } + $this->_debug("C: $cmd"); + } + + /** + * Sends a string response to the server. + * + * @param string $str The string to send. + * + * @return void + */ + function _sendStringResponse($str) + { + return $this->_sendCmd('{' . $this->_getLineLength($str) . "+}\r\n" . $str); + } + + /** + * Receives a single line from the server. + * + * @return string The server response line. + */ + function _recvLn() + { + if (PEAR::isError($lastline = $this->_sock->gets(8192))) { + return PEAR::raiseError( + 'Failed to read from socket: ' . $lastline->getMessage() + ); + } + + $lastline = rtrim($lastline); + $this->_debug("S: $lastline"); + + if ($lastline === '') { + return PEAR::raiseError('Failed to read from socket'); + } + + return $lastline; + } + + /** + * Receives x bytes from the server. + * + * @param int $length Number of bytes to read + * + * @return string The server response. + */ + function _recvBytes($length) + { + $response = ''; + $response_length = 0; + + while ($response_length < $length) { + $response .= $this->_sock->read($length - $response_length); + $response_length = $this->_getLineLength($response); + } + + $this->_debug("S: " . rtrim($response)); + + return $response; + } + + /** + * Send a command and retrieves a response from the server. + * + * @param string $cmd The command to send. + * @param boolean $auth Whether this is an authentication command. + * + * @return string|PEAR_Error Reponse string if an OK response, PEAR_Error + * if a NO response. + */ + function _doCmd($cmd = '', $auth = false) + { + $referralCount = 0; + while ($referralCount < $this->_maxReferralCount) { + if (strlen($cmd)) { + if (PEAR::isError($error = $this->_sendCmd($cmd))) { + return $error; + } + } + + $response = ''; + while (true) { + if (PEAR::isError($line = $this->_recvLn())) { + return $line; + } + $uc_line = $this->_toUpper($line); + + if ('OK' == substr($uc_line, 0, 2)) { + $response .= $line; + return rtrim($response); + } + + if ('NO' == substr($uc_line, 0, 2)) { + // Check for string literal error message. + if (preg_match('/{([0-9]+)}$/i', $line, $matches)) { + $line = substr($line, 0, -(strlen($matches[1])+2)) + . str_replace( + "\r\n", ' ', $this->_recvBytes($matches[1] + 2) + ); + } + return PEAR::raiseError(trim($response . substr($line, 2)), 3); + } + + if ('BYE' == substr($uc_line, 0, 3)) { + if (PEAR::isError($error = $this->disconnect(false))) { + return PEAR::raiseError( + 'Cannot handle BYE, the error was: ' + . $error->getMessage(), + 4 + ); + } + // Check for referral, then follow it. Otherwise, carp an + // error. + if (preg_match('/^bye \(referral "(sieve:\/\/)?([^"]+)/i', $line, $matches)) { + // Replace the old host with the referral host + // preserving any protocol prefix. + $this->_data['host'] = preg_replace( + '/\w+(?!(\w|\:\/\/)).*/', $matches[2], + $this->_data['host'] + ); + if (PEAR::isError($error = $this->_handleConnectAndLogin())) { + return PEAR::raiseError( + 'Cannot follow referral to ' + . $this->_data['host'] . ', the error was: ' + . $error->getMessage(), + 5 + ); + } + break; + } + return PEAR::raiseError(trim($response . $line), 6); + } + + if (preg_match('/^{([0-9]+)}/i', $line, $matches)) { + // Matches literal string responses. + $line = $this->_recvBytes($matches[1] + 2); + + if (!$auth) { + // Receive the pending OK only if we aren't + // authenticating since string responses during + // authentication don't need an OK. + $this->_recvLn(); + } + return $line; + } + + if ($auth) { + // String responses during authentication don't need an + // OK. + $response .= $line; + return rtrim($response); + } + + $response .= $line . "\r\n"; + $referralCount++; + } + } + + return PEAR::raiseError('Max referral count (' . $referralCount . ') reached. Cyrus murder loop error?', 7); + } + + /** + * Returns the name of the best authentication method that the server + * has advertised. + * + * @param string $userMethod Only consider this method as available. + * + * @return string The name of the best supported authentication method or + * a PEAR_Error object on failure. + */ + function _getBestAuthMethod($userMethod = null) + { + if (!isset($this->_capability['sasl'])) { + return PEAR::raiseError('This server doesn\'t support any authentication methods. SASL problem?'); + } + if (!$this->_capability['sasl']) { + return PEAR::raiseError('This server doesn\'t support any authentication methods.'); + } + + if ($userMethod) { + if (in_array($userMethod, $this->_capability['sasl'])) { + return $userMethod; + } + return PEAR::raiseError( + sprintf('No supported authentication method found. The server supports these methods: %s, but we want to use: %s', + implode(', ', $this->_capability['sasl']), + $userMethod)); + } + + foreach ($this->supportedAuthMethods as $method) { + if (in_array($method, $this->_capability['sasl'])) { + return $method; + } + } + + return PEAR::raiseError( + sprintf('No supported authentication method found. The server supports these methods: %s, but we only support: %s', + implode(', ', $this->_capability['sasl']), + implode(', ', $this->supportedAuthMethods))); + } + + /** + * Starts a TLS connection. + * + * @return boolean True on success, PEAR_Error on failure. + */ + function _startTLS() + { + if (PEAR::isError($res = $this->_doCmd('STARTTLS'))) { + return $res; + } + + if (!stream_socket_enable_crypto($this->_sock->fp, true, STREAM_CRYPTO_METHOD_TLS_CLIENT)) { + return PEAR::raiseError('Failed to establish TLS connection', 2); + } + + $this->_debug('STARTTLS negotiation successful'); + + // The server should be sending a CAPABILITY response after + // negotiating TLS. Read it, and ignore if it doesn't. + // Doesn't work with older timsieved versions + $regexp = '/^CYRUS TIMSIEVED V([0-9.]+)/'; + if (!preg_match($regexp, $this->_capability['implementation'], $matches) + || version_compare($matches[1], '2.3.10', '>=') + ) { + $this->_doCmd(); + } + + // RFC says we need to query the server capabilities again now that we + // are under encryption. + if (PEAR::isError($res = $this->_cmdCapability())) { + return PEAR::raiseError( + 'Failed to connect, server said: ' . $res->getMessage(), 2 + ); + } + + return true; + } + + /** + * Returns the length of a string. + * + * @param string $string A string. + * + * @return integer The length of the string. + */ + function _getLineLength($string) + { + if (extension_loaded('mbstring')) { + return mb_strlen($string, 'latin1'); + } else { + return strlen($string); + } + } + + /** + * Locale independant strtoupper() implementation. + * + * @param string $string The string to convert to lowercase. + * + * @return string The lowercased string, based on ASCII encoding. + */ + function _toUpper($string) + { + $language = setlocale(LC_CTYPE, 0); + setlocale(LC_CTYPE, 'C'); + $string = strtoupper($string); + setlocale(LC_CTYPE, $language); + return $string; + } + + /** + * Convert string into RFC's quoted-string or literal-c2s form + * + * @param string $string The string to convert. + * + * @return string Result string + */ + function _escape($string) + { + // Some implementations doesn't allow UTF-8 characters in quoted-string + // It's safe to use literal-c2s + if (preg_match('/[^\x01-\x09\x0B-\x0C\x0E-\x7F]/', $string)) { + return sprintf("{%d+}\r\n%s", $this->_getLineLength($string), $string); + } + + return '"' . addcslashes($string, '\\"') . '"'; + } + + /** + * Write debug text to the current debug output handler. + * + * @param string $message Debug message text. + * + * @return void + */ + function _debug($message) + { + if ($this->_debug) { + if ($this->_debug_handler) { + call_user_func_array($this->_debug_handler, array(&$this, $message)); + } else { + echo "$message\n"; + } + } + } +} diff --git a/plugins/managesieve/lib/rcube_sieve.php b/plugins/managesieve/lib/rcube_sieve.php new file mode 100644 index 000000000..7b7ea6eb6 --- /dev/null +++ b/plugins/managesieve/lib/rcube_sieve.php @@ -0,0 +1,378 @@ +<?php + +/** + * Classes for managesieve operations (using PEAR::Net_Sieve) + * + * Copyright (C) 2008-2011, The Roundcube Dev Team + * Copyright (C) 2011, Kolab Systems AG + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License version 2 + * as published by the Free Software Foundation. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License along + * with this program; if not, write to the Free Software Foundation, Inc., + * 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. + * + * $Id$ + * + */ + +// Managesieve Protocol: RFC5804 + +define('SIEVE_ERROR_CONNECTION', 1); +define('SIEVE_ERROR_LOGIN', 2); +define('SIEVE_ERROR_NOT_EXISTS', 3); // script not exists +define('SIEVE_ERROR_INSTALL', 4); // script installation +define('SIEVE_ERROR_ACTIVATE', 5); // script activation +define('SIEVE_ERROR_DELETE', 6); // script deletion +define('SIEVE_ERROR_INTERNAL', 7); // internal error +define('SIEVE_ERROR_DEACTIVATE', 8); // script activation +define('SIEVE_ERROR_OTHER', 255); // other/unknown error + + +class rcube_sieve +{ + private $sieve; // Net_Sieve object + private $error = false; // error flag + private $list = array(); // scripts list + + public $script; // rcube_sieve_script object + public $current; // name of currently loaded script + private $disabled; // array of disabled extensions + private $exts; // array of supported extensions + + + /** + * Object constructor + * + * @param string Username (for managesieve login) + * @param string Password (for managesieve login) + * @param string Managesieve server hostname/address + * @param string Managesieve server port number + * @param string Managesieve authentication method + * @param boolean Enable/disable TLS use + * @param array Disabled extensions + * @param boolean Enable/disable debugging + * @param string Proxy authentication identifier + * @param string Proxy authentication password + */ + public function __construct($username, $password='', $host='localhost', $port=2000, + $auth_type=null, $usetls=true, $disabled=array(), $debug=false, + $auth_cid=null, $auth_pw=null) + { + $this->sieve = new Net_Sieve(); + + if ($debug) { + $this->sieve->setDebug(true, array($this, 'debug_handler')); + } + + if (PEAR::isError($this->sieve->connect($host, $port, null, $usetls))) { + return $this->_set_error(SIEVE_ERROR_CONNECTION); + } + + if (!empty($auth_cid)) { + $authz = $username; + $username = $auth_cid; + $password = $auth_pw; + } + + if (PEAR::isError($this->sieve->login($username, $password, + $auth_type ? strtoupper($auth_type) : null, $authz)) + ) { + return $this->_set_error(SIEVE_ERROR_LOGIN); + } + + $this->exts = $this->get_extensions(); + $this->disabled = $disabled; + } + + public function __destruct() { + $this->sieve->disconnect(); + } + + /** + * Getter for error code + */ + public function error() + { + return $this->error ? $this->error : false; + } + + /** + * Saves current script into server + */ + public function save($name = null) + { + if (!$this->sieve) + return $this->_set_error(SIEVE_ERROR_INTERNAL); + + if (!$this->script) + return $this->_set_error(SIEVE_ERROR_INTERNAL); + + if (!$name) + $name = $this->current; + + $script = $this->script->as_text(); + + if (!$script) + $script = '/* empty script */'; + + if (PEAR::isError($this->sieve->installScript($name, $script))) + return $this->_set_error(SIEVE_ERROR_INSTALL); + + return true; + } + + /** + * Saves text script into server + */ + public function save_script($name, $content = null) + { + if (!$this->sieve) + return $this->_set_error(SIEVE_ERROR_INTERNAL); + + if (!$content) + $content = '/* empty script */'; + + if (PEAR::isError($this->sieve->installScript($name, $content))) + return $this->_set_error(SIEVE_ERROR_INSTALL); + + return true; + } + + /** + * Activates specified script + */ + public function activate($name = null) + { + if (!$this->sieve) + return $this->_set_error(SIEVE_ERROR_INTERNAL); + + if (!$name) + $name = $this->current; + + if (PEAR::isError($this->sieve->setActive($name))) + return $this->_set_error(SIEVE_ERROR_ACTIVATE); + + return true; + } + + /** + * De-activates specified script + */ + public function deactivate() + { + if (!$this->sieve) + return $this->_set_error(SIEVE_ERROR_INTERNAL); + + if (PEAR::isError($this->sieve->setActive(''))) + return $this->_set_error(SIEVE_ERROR_DEACTIVATE); + + return true; + } + + /** + * Removes specified script + */ + public function remove($name = null) + { + if (!$this->sieve) + return $this->_set_error(SIEVE_ERROR_INTERNAL); + + if (!$name) + $name = $this->current; + + // script must be deactivated first + if ($name == $this->sieve->getActive()) + if (PEAR::isError($this->sieve->setActive(''))) + return $this->_set_error(SIEVE_ERROR_DELETE); + + if (PEAR::isError($this->sieve->removeScript($name))) + return $this->_set_error(SIEVE_ERROR_DELETE); + + if ($name == $this->current) + $this->current = null; + + return true; + } + + /** + * Gets list of supported by server Sieve extensions + */ + public function get_extensions() + { + if ($this->exts) + return $this->exts; + + if (!$this->sieve) + return $this->_set_error(SIEVE_ERROR_INTERNAL); + + $ext = $this->sieve->getExtensions(); + // we're working on lower-cased names + $ext = array_map('strtolower', (array) $ext); + + if ($this->script) { + $supported = $this->script->get_extensions(); + foreach ($ext as $idx => $ext_name) + if (!in_array($ext_name, $supported)) + unset($ext[$idx]); + } + + return array_values($ext); + } + + /** + * Gets list of scripts from server + */ + public function get_scripts() + { + if (!$this->list) { + + if (!$this->sieve) + return $this->_set_error(SIEVE_ERROR_INTERNAL); + + $list = $this->sieve->listScripts(); + + if (PEAR::isError($list)) + return $this->_set_error(SIEVE_ERROR_OTHER); + + $this->list = $list; + } + + return $this->list; + } + + /** + * Returns active script name + */ + public function get_active() + { + if (!$this->sieve) + return $this->_set_error(SIEVE_ERROR_INTERNAL); + + return $this->sieve->getActive(); + } + + /** + * Loads script by name + */ + public function load($name) + { + if (!$this->sieve) + return $this->_set_error(SIEVE_ERROR_INTERNAL); + + if ($this->current == $name) + return true; + + $script = $this->sieve->getScript($name); + + if (PEAR::isError($script)) + return $this->_set_error(SIEVE_ERROR_OTHER); + + // try to parse from Roundcube format + $this->script = $this->_parse($script); + + $this->current = $name; + + return true; + } + + /** + * Loads script from text content + */ + public function load_script($script) + { + if (!$this->sieve) + return $this->_set_error(SIEVE_ERROR_INTERNAL); + + // try to parse from Roundcube format + $this->script = $this->_parse($script); + } + + /** + * Creates rcube_sieve_script object from text script + */ + private function _parse($txt) + { + // parse + $script = new rcube_sieve_script($txt, $this->disabled, $this->exts); + + // fix/convert to Roundcube format + if (!empty($script->content)) { + // replace all elsif with if+stop, we support only ifs + foreach ($script->content as $idx => $rule) { + if (empty($rule['type']) || !preg_match('/^(if|elsif|else)$/', $rule['type'])) { + continue; + } + + $script->content[$idx]['type'] = 'if'; + + // 'stop' not found? + foreach ($rule['actions'] as $action) { + if (preg_match('/^(stop|vacation)$/', $action['type'])) { + continue 2; + } + } + if (empty($script->content[$idx+1]) || $script->content[$idx+1]['type'] != 'if') { + $script->content[$idx]['actions'][] = array('type' => 'stop'); + } + } + } + + return $script; + } + + /** + * Gets specified script as text + */ + public function get_script($name) + { + if (!$this->sieve) + return $this->_set_error(SIEVE_ERROR_INTERNAL); + + $content = $this->sieve->getScript($name); + + if (PEAR::isError($content)) + return $this->_set_error(SIEVE_ERROR_OTHER); + + return $content; + } + + /** + * Creates empty script or copy of other script + */ + public function copy($name, $copy) + { + if (!$this->sieve) + return $this->_set_error(SIEVE_ERROR_INTERNAL); + + if ($copy) { + $content = $this->sieve->getScript($copy); + + if (PEAR::isError($content)) + return $this->_set_error(SIEVE_ERROR_OTHER); + } + + return $this->save_script($name, $content); + } + + private function _set_error($error) + { + $this->error = $error; + return false; + } + + /** + * This is our own debug handler for connection + */ + public function debug_handler(&$sieve, $message) + { + write_log('sieve', preg_replace('/\r\n$/', '', $message)); + } +} diff --git a/plugins/managesieve/lib/rcube_sieve_script.php b/plugins/managesieve/lib/rcube_sieve_script.php new file mode 100644 index 000000000..3c6993dcc --- /dev/null +++ b/plugins/managesieve/lib/rcube_sieve_script.php @@ -0,0 +1,940 @@ +<?php + +/** + * Class for operations on Sieve scripts + * + * Copyright (C) 2008-2011, The Roundcube Dev Team + * Copyright (C) 2011, Kolab Systems AG + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License version 2 + * as published by the Free Software Foundation. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License along + * with this program; if not, write to the Free Software Foundation, Inc., + * 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. + * + * $Id$ + * + */ + +class rcube_sieve_script +{ + public $content = array(); // script rules array + + private $vars = array(); // "global" variables + private $prefix = ''; // script header (comments) + private $capabilities = array(); // Sieve extensions supported by server + private $supported = array( // Sieve extensions supported by class + 'fileinto', // RFC3028 + 'reject', // RFC5429 + 'ereject', // RFC5429 + 'copy', // RFC3894 + 'vacation', // RFC5230 + 'relational', // RFC3431 + 'regex', // draft-ietf-sieve-regex-01 + 'imapflags', // draft-melnikov-sieve-imapflags-06 + 'imap4flags', // RFC5232 + 'include', // draft-ietf-sieve-include-12 + 'variables', // RFC5229 + // TODO: body, notify + ); + + /** + * Object constructor + * + * @param string Script's text content + * @param array List of disabled extensions + * @param array List of capabilities supported by server + */ + public function __construct($script, $disabled=array(), $capabilities=array()) + { + if (!empty($disabled)) { + // we're working on lower-cased names + $disabled = array_map('strtolower', (array) $disabled); + foreach ($disabled as $ext) { + if (($idx = array_search($ext, $this->supported)) !== false) { + unset($this->supported[$idx]); + } + } + } + + $this->capabilities = array_map('strtolower', (array) $capabilities); + + // Parse text content of the script + $this->_parse_text($script); + } + + /** + * Adds rule to the script (at the end) + * + * @param string Rule name + * @param array Rule content (as array) + * + * @return int The index of the new rule + */ + public function add_rule($content) + { + // TODO: check this->supported + array_push($this->content, $content); + return sizeof($this->content)-1; + } + + public function delete_rule($index) + { + if(isset($this->content[$index])) { + unset($this->content[$index]); + return true; + } + return false; + } + + public function size() + { + return sizeof($this->content); + } + + public function update_rule($index, $content) + { + // TODO: check this->supported + if ($this->content[$index]) { + $this->content[$index] = $content; + return $index; + } + return false; + } + + /** + * Sets "global" variable + * + * @param string $name Variable name + * @param string $value Variable value + * @param array $mods Variable modifiers + */ + public function set_var($name, $value, $mods = array()) + { + // Check if variable exists + for ($i=0, $len=count($this->vars); $i<$len; $i++) { + if ($this->vars[$i]['name'] == $name) { + break; + } + } + + $var = array_merge($mods, array('name' => $name, 'value' => $value)); + $this->vars[$i] = $var; + } + + /** + * Unsets "global" variable + * + * @param string $name Variable name + */ + public function unset_var($name) + { + // Check if variable exists + foreach ($this->vars as $idx => $var) { + if ($var['name'] == $name) { + unset($this->vars[$idx]); + break; + } + } + } + + /** + * Gets the value of "global" variable + * + * @param string $name Variable name + * + * @return string Variable value + */ + public function get_var($name) + { + // Check if variable exists + for ($i=0, $len=count($this->vars); $i<$len; $i++) { + if ($this->vars[$i]['name'] == $name) { + return $this->vars[$i]['name']; + } + } + } + + /** + * Sets script header content + * + * @param string $text Header content + */ + public function set_prefix($text) + { + $this->prefix = $text; + } + + /** + * Returns script as text + */ + public function as_text() + { + $output = ''; + $exts = array(); + $idx = 0; + + if (!empty($this->vars)) { + if (in_array('variables', (array)$this->capabilities)) { + $has_vars = true; + array_push($exts, 'variables'); + } + foreach ($this->vars as $var) { + if (empty($has_vars)) { + // 'variables' extension not supported, put vars in comments + $output .= sprintf("# %s %s\n", $var['name'], $var['value']); + } + else { + $output .= 'set '; + foreach (array_diff(array_keys($var), array('name', 'value')) as $opt) { + $output .= ":$opt "; + } + $output .= self::escape_string($var['name']) . ' ' . self::escape_string($var['value']) . ";\n"; + } + } + } + + // rules + foreach ($this->content as $rule) { + $extension = ''; + $script = ''; + $tests = array(); + $i = 0; + + // header + if (!empty($rule['name']) && strlen($rule['name'])) { + $script .= '# rule:[' . $rule['name'] . "]\n"; + } + + // constraints expressions + if (!empty($rule['tests'])) { + foreach ($rule['tests'] as $test) { + $tests[$i] = ''; + switch ($test['test']) { + case 'size': + $tests[$i] .= ($test['not'] ? 'not ' : ''); + $tests[$i] .= 'size :' . ($test['type']=='under' ? 'under ' : 'over ') . $test['arg']; + break; + case 'true': + $tests[$i] .= ($test['not'] ? 'false' : 'true'); + break; + case 'exists': + $tests[$i] .= ($test['not'] ? 'not ' : ''); + $tests[$i] .= 'exists ' . self::escape_string($test['arg']); + break; + case 'header': + $tests[$i] .= ($test['not'] ? 'not ' : ''); + + // relational operator + comparator + if (preg_match('/^(value|count)-([gteqnl]{2})/', $test['type'], $m)) { + array_push($exts, 'relational'); + array_push($exts, 'comparator-i;ascii-numeric'); + + $tests[$i] .= 'header :' . $m[1] . ' "' . $m[2] . '" :comparator "i;ascii-numeric"'; + } + else { + if ($test['type'] == 'regex') { + array_push($exts, 'regex'); + } + + $tests[$i] .= 'header :' . $test['type']; + } + + $tests[$i] .= ' ' . self::escape_string($test['arg1']); + $tests[$i] .= ' ' . self::escape_string($test['arg2']); + break; + } + $i++; + } + } + + // disabled rule: if false #.... + if (!empty($tests)) { + $script .= 'if ' . ($rule['disabled'] ? 'false # ' : ''); + + if (count($tests) > 1) { + $tests_str = implode(', ', $tests); + } + else { + $tests_str = $tests[0]; + } + + if ($rule['join'] || count($tests) > 1) { + $script .= sprintf('%s (%s)', $rule['join'] ? 'allof' : 'anyof', $tests_str); + } + else { + $script .= $tests_str; + } + $script .= "\n{\n"; + } + + // action(s) + if (!empty($rule['actions'])) { + foreach ($rule['actions'] as $action) { + $action_script = ''; + + switch ($action['type']) { + + case 'fileinto': + array_push($exts, 'fileinto'); + $action_script .= 'fileinto '; + if ($action['copy']) { + $action_script .= ':copy '; + array_push($exts, 'copy'); + } + $action_script .= self::escape_string($action['target']); + break; + + case 'redirect': + $action_script .= 'redirect '; + if ($action['copy']) { + $action_script .= ':copy '; + array_push($exts, 'copy'); + } + $action_script .= self::escape_string($action['target']); + break; + + case 'reject': + case 'ereject': + array_push($exts, $action['type']); + $action_script .= $action['type'].' ' + . self::escape_string($action['target']); + break; + + case 'addflag': + case 'setflag': + case 'removeflag': + if (is_array($this->capabilities) && in_array('imap4flags', $this->capabilities)) + array_push($exts, 'imap4flags'); + else + array_push($exts, 'imapflags'); + + $action_script .= $action['type'].' ' + . self::escape_string($action['target']); + break; + + case 'keep': + case 'discard': + case 'stop': + $action_script .= $action['type']; + break; + + case 'include': + array_push($exts, 'include'); + $action_script .= 'include '; + foreach (array_diff(array_keys($action), array('target', 'type')) as $opt) { + $action_script .= ":$opt "; + } + $action_script .= self::escape_string($action['target']); + break; + + case 'set': + array_push($exts, 'variables'); + $action_script .= 'set '; + foreach (array_diff(array_keys($action), array('name', 'value', 'type')) as $opt) { + $action_script .= ":$opt "; + } + $action_script .= self::escape_string($action['name']) . ' ' . self::escape_string($action['value']); + break; + + case 'vacation': + array_push($exts, 'vacation'); + $action_script .= 'vacation'; + if (!empty($action['days'])) + $action_script .= " :days " . $action['days']; + if (!empty($action['addresses'])) + $action_script .= " :addresses " . self::escape_string($action['addresses']); + if (!empty($action['subject'])) + $action_script .= " :subject " . self::escape_string($action['subject']); + if (!empty($action['handle'])) + $action_script .= " :handle " . self::escape_string($action['handle']); + if (!empty($action['from'])) + $action_script .= " :from " . self::escape_string($action['from']); + if (!empty($action['mime'])) + $action_script .= " :mime"; + $action_script .= " " . self::escape_string($action['reason']); + break; + } + + if ($action_script) { + $script .= !empty($tests) ? "\t" : ''; + $script .= $action_script . ";\n"; + } + } + } + + if ($script) { + $output .= $script . (!empty($tests) ? "}\n" : ''); + $idx++; + } + } + + // requires + if (!empty($exts)) + $output = 'require ["' . implode('","', array_unique($exts)) . "\"];\n" . $output; + + if (!empty($this->prefix)) { + $output = $this->prefix . "\n\n" . $output; + } + + return $output; + } + + /** + * Returns script object + * + */ + public function as_array() + { + return $this->content; + } + + /** + * Returns array of supported extensions + * + */ + public function get_extensions() + { + return array_values($this->supported); + } + + /** + * Converts text script to rules array + * + * @param string Text script + */ + private function _parse_text($script) + { + $prefix = ''; + $options = array(); + + while ($script) { + $script = trim($script); + $rule = array(); + + // Comments + while (!empty($script) && $script[0] == '#') { + $endl = strpos($script, "\n"); + $line = $endl ? substr($script, 0, $endl) : $script; + + // Roundcube format + if (preg_match('/^# rule:\[(.*)\]/', $line, $matches)) { + $rulename = $matches[1]; + } + // KEP:14 variables + else if (preg_match('/^# (EDITOR|EDITOR_VERSION) (.+)$/', $line, $matches)) { + $this->set_var($matches[1], $matches[2]); + } + // Horde-Ingo format + else if (!empty($options['format']) && $options['format'] == 'INGO' + && preg_match('/^# (.*)/', $line, $matches) + ) { + $rulename = $matches[1]; + } + else if (empty($options['prefix'])) { + $prefix .= $line . "\n"; + } + + $script = ltrim(substr($script, strlen($line) + 1)); + } + + // handle script header + if (empty($options['prefix'])) { + $options['prefix'] = true; + if ($prefix && strpos($prefix, 'Generated by Ingo')) { + $options['format'] = 'INGO'; + } + } + + // Control structures/blocks + if (preg_match('/^(if|else|elsif)/i', $script)) { + $rule = $this->_tokenize_rule($script); + if (strlen($rulename) && !empty($rule)) { + $rule['name'] = $rulename; + } + } + // Simple commands + else { + $rule = $this->_parse_actions($script, ';'); + if (!empty($rule[0]) && is_array($rule)) { + // set "global" variables + if ($rule[0]['type'] == 'set') { + unset($rule[0]['type']); + $this->vars[] = $rule[0]; + } + else { + $rule = array('actions' => $rule); + } + } + } + + $rulename = ''; + + if (!empty($rule)) { + $this->content[] = $rule; + } + } + + if (!empty($prefix)) { + $this->prefix = trim($prefix); + } + } + + /** + * Convert text script fragment to rule object + * + * @param string Text rule + * + * @return array Rule data + */ + private function _tokenize_rule(&$content) + { + $cond = strtolower(self::tokenize($content, 1)); + + if ($cond != 'if' && $cond != 'elsif' && $cond != 'else') { + return null; + } + + $disabled = false; + $join = false; + + // disabled rule (false + comment): if false # ..... + if (preg_match('/^\s*false\s+#/i', $content)) { + $content = preg_replace('/^\s*false\s+#\s*/i', '', $content); + $disabled = true; + } + + while (strlen($content)) { + $tokens = self::tokenize($content, true); + $separator = array_pop($tokens); + + if (!empty($tokens)) { + $token = array_shift($tokens); + } + else { + $token = $separator; + } + + $token = strtolower($token); + + if ($token == 'not') { + $not = true; + $token = strtolower(array_shift($tokens)); + } + else { + $not = false; + } + + switch ($token) { + case 'allof': + $join = true; + break; + case 'anyof': + break; + + case 'size': + $size = array('test' => 'size', 'not' => $not); + for ($i=0, $len=count($tokens); $i<$len; $i++) { + if (!is_array($tokens[$i]) + && preg_match('/^:(under|over)$/i', $tokens[$i]) + ) { + $size['type'] = strtolower(substr($tokens[$i], 1)); + } + else { + $size['arg'] = $tokens[$i]; + } + } + + $tests[] = $size; + break; + + case 'header': + $header = array('test' => 'header', 'not' => $not, 'arg1' => '', 'arg2' => ''); + for ($i=0, $len=count($tokens); $i<$len; $i++) { + if (!is_array($tokens[$i]) && preg_match('/^:comparator$/i', $tokens[$i])) { + $i++; + } + else if (!is_array($tokens[$i]) && preg_match('/^:(count|value)$/i', $tokens[$i])) { + $header['type'] = strtolower(substr($tokens[$i], 1)) . '-' . $tokens[++$i]; + } + else if (!is_array($tokens[$i]) && preg_match('/^:(is|contains|matches|regex)$/i', $tokens[$i])) { + $header['type'] = strtolower(substr($tokens[$i], 1)); + } + else { + $header['arg1'] = $header['arg2']; + $header['arg2'] = $tokens[$i]; + } + } + + $tests[] = $header; + break; + + case 'exists': + $tests[] = array('test' => 'exists', 'not' => $not, + 'arg' => array_pop($tokens)); + break; + + case 'true': + $tests[] = array('test' => 'true', 'not' => $not); + break; + + case 'false': + $tests[] = array('test' => 'true', 'not' => !$not); + break; + } + + // goto actions... + if ($separator == '{') { + break; + } + } + + // ...and actions block + if ($tests) { + $actions = $this->_parse_actions($content); + } + + if ($tests && $actions) { + $result = array( + 'type' => $cond, + 'tests' => $tests, + 'actions' => $actions, + 'join' => $join, + 'disabled' => $disabled, + ); + } + + return $result; + } + + /** + * Parse body of actions section + * + * @param string $content Text body + * @param string $end End of text separator + * + * @return array Array of parsed action type/target pairs + */ + private function _parse_actions(&$content, $end = '}') + { + $result = null; + + while (strlen($content)) { + $tokens = self::tokenize($content, true); + $separator = array_pop($tokens); + + if (!empty($tokens)) { + $token = array_shift($tokens); + } + else { + $token = $separator; + } + + switch ($token) { + case 'discard': + case 'keep': + case 'stop': + $result[] = array('type' => $token); + break; + + case 'fileinto': + case 'redirect': + $copy = false; + $target = ''; + + for ($i=0, $len=count($tokens); $i<$len; $i++) { + if (strtolower($tokens[$i]) == ':copy') { + $copy = true; + } + else { + $target = $tokens[$i]; + } + } + + $result[] = array('type' => $token, 'copy' => $copy, + 'target' => $target); + break; + + case 'reject': + case 'ereject': + $result[] = array('type' => $token, 'target' => array_pop($tokens)); + break; + + case 'vacation': + $vacation = array('type' => 'vacation', 'reason' => array_pop($tokens)); + + for ($i=0, $len=count($tokens); $i<$len; $i++) { + $tok = strtolower($tokens[$i]); + if ($tok == ':days') { + $vacation['days'] = $tokens[++$i]; + } + else if ($tok == ':subject') { + $vacation['subject'] = $tokens[++$i]; + } + else if ($tok == ':addresses') { + $vacation['addresses'] = $tokens[++$i]; + } + else if ($tok == ':handle') { + $vacation['handle'] = $tokens[++$i]; + } + else if ($tok == ':from') { + $vacation['from'] = $tokens[++$i]; + } + else if ($tok == ':mime') { + $vacation['mime'] = true; + } + } + + $result[] = $vacation; + break; + + case 'setflag': + case 'addflag': + case 'removeflag': + $result[] = array('type' => $token, + // Flags list: last token (skip optional variable) + 'target' => $tokens[count($tokens)-1] + ); + break; + + case 'include': + $include = array('type' => 'include', 'target' => array_pop($tokens)); + + // Parameters: :once, :optional, :global, :personal + for ($i=0, $len=count($tokens); $i<$len; $i++) { + $tok = strtolower($tokens[$i]); + if ($tok[0] == ':') { + $include[substr($tok, 1)] = true; + } + } + + $result[] = $include; + break; + + case 'set': + $set = array('type' => 'set', 'value' => array_pop($tokens), 'name' => array_pop($tokens)); + + // Parameters: :lower :upper :lowerfirst :upperfirst :quotewildcard :length + for ($i=0, $len=count($tokens); $i<$len; $i++) { + $tok = strtolower($tokens[$i]); + if ($tok[0] == ':') { + $set[substr($tok, 1)] = true; + } + } + + $result[] = $set; + break; + + case 'require': + // skip, will be build according to used commands + // $result[] = array('type' => 'require', 'target' => $tokens); + break; + + } + + if ($separator == $end) + break; + } + + return $result; + } + + /** + * Escape special chars into quoted string value or multi-line string + * or list of strings + * + * @param string $str Text or array (list) of strings + * + * @return string Result text + */ + static function escape_string($str) + { + if (is_array($str) && count($str) > 1) { + foreach($str as $idx => $val) + $str[$idx] = self::escape_string($val); + + return '[' . implode(',', $str) . ']'; + } + else if (is_array($str)) { + $str = array_pop($str); + } + + // multi-line string + if (preg_match('/[\r\n\0]/', $str) || strlen($str) > 1024) { + return sprintf("text:\n%s\n.\n", self::escape_multiline_string($str)); + } + // quoted-string + else { + return '"' . addcslashes($str, '\\"') . '"'; + } + } + + /** + * Escape special chars in multi-line string value + * + * @param string $str Text + * + * @return string Text + */ + static function escape_multiline_string($str) + { + $str = preg_split('/(\r?\n)/', $str, -1, PREG_SPLIT_DELIM_CAPTURE); + + foreach ($str as $idx => $line) { + // dot-stuffing + if (isset($line[0]) && $line[0] == '.') { + $str[$idx] = '.' . $line; + } + } + + return implode($str); + } + + /** + * Splits script into string tokens + * + * @param string &$str The script + * @param mixed $num Number of tokens to return, 0 for all + * or True for all tokens until separator is found. + * Separator will be returned as last token. + * @param int $in_list Enable to call recursively inside a list + * + * @return mixed Tokens array or string if $num=1 + */ + static function tokenize(&$str, $num=0, $in_list=false) + { + $result = array(); + + // remove spaces from the beginning of the string + while (($str = ltrim($str)) !== '' + && (!$num || $num === true || count($result) < $num) + ) { + switch ($str[0]) { + + // Quoted string + case '"': + $len = strlen($str); + + for ($pos=1; $pos<$len; $pos++) { + if ($str[$pos] == '"') { + break; + } + if ($str[$pos] == "\\") { + if ($str[$pos + 1] == '"' || $str[$pos + 1] == "\\") { + $pos++; + } + } + } + if ($str[$pos] != '"') { + // error + } + // we need to strip slashes for a quoted string + $result[] = stripslashes(substr($str, 1, $pos - 1)); + $str = substr($str, $pos + 1); + break; + + // Parenthesized list + case '[': + $str = substr($str, 1); + $result[] = self::tokenize($str, 0, true); + break; + case ']': + $str = substr($str, 1); + return $result; + break; + + // list/test separator + case ',': + // command separator + case ';': + // block/tests-list + case '(': + case ')': + case '{': + case '}': + $sep = $str[0]; + $str = substr($str, 1); + if ($num === true) { + $result[] = $sep; + break 2; + } + break; + + // bracket-comment + case '/': + if ($str[1] == '*') { + if ($end_pos = strpos($str, '*/')) { + $str = substr($str, $end_pos + 2); + } + else { + // error + $str = ''; + } + } + break; + + // hash-comment + case '#': + if ($lf_pos = strpos($str, "\n")) { + $str = substr($str, $lf_pos); + break; + } + else { + $str = ''; + } + + // String atom + default: + // empty or one character + if ($str === '' || $str === null) { + break 2; + } + if (strlen($str) < 2) { + $result[] = $str; + $str = ''; + break; + } + + // tag/identifier/number + if (preg_match('/^([a-z0-9:_]+)/i', $str, $m)) { + $str = substr($str, strlen($m[1])); + + if ($m[1] != 'text:') { + $result[] = $m[1]; + } + // multiline string + else { + // possible hash-comment after "text:" + if (preg_match('/^( |\t)*(#[^\n]+)?\n/', $str, $m)) { + $str = substr($str, strlen($m[0])); + } + // get text until alone dot in a line + if (preg_match('/^(.*)\r?\n\.\r?\n/sU', $str, $m)) { + $text = $m[1]; + // remove dot-stuffing + $text = str_replace("\n..", "\n.", $text); + $str = substr($str, strlen($m[0])); + } + else { + $text = ''; + } + + $result[] = $text; + } + } + + break; + } + } + + return $num === 1 ? (isset($result[0]) ? $result[0] : null) : $result; + } + +} diff --git a/plugins/managesieve/localization/bg_BG.inc b/plugins/managesieve/localization/bg_BG.inc new file mode 100644 index 000000000..90f34bf8e --- /dev/null +++ b/plugins/managesieve/localization/bg_BG.inc @@ -0,0 +1,50 @@ +<?php + +$labels = array(); +$labels['filters'] = 'Филтри'; +$labels['managefilters'] = 'Управление на филтри за входяща поща'; +$labels['filtername'] = 'Име на филтър'; +$labels['newfilter'] = 'Нов филтър'; +$labels['filteradd'] = 'Добавяне на филтър'; +$labels['filterdel'] = 'Изтриване на филтър'; +$labels['moveup'] = 'Преместване нагоре'; +$labels['movedown'] = 'Преместване надолу'; +$labels['filterallof'] = 'съвпадение на всички следващи правила'; +$labels['filteranyof'] = 'съвпадение на някое от следните правила'; +$labels['filterany'] = 'всички съобщения'; +$labels['filtercontains'] = 'съдържа'; +$labels['filternotcontains'] = 'не съдържа'; +$labels['filteris'] = 'е равно на'; +$labels['filterisnot'] = 'не е равно на'; +$labels['filterexists'] = 'съществува'; +$labels['filternotexists'] = 'не съществува'; +$labels['filterunder'] = 'под'; +$labels['filterover'] = 'над'; +$labels['addrule'] = 'Добавяне на правило'; +$labels['delrule'] = 'Изтриване на правило'; +$labels['messagemoveto'] = 'Преместване на съобщението в'; +$labels['messageredirect'] = 'Пренасочване на съобщението до'; +$labels['messagereply'] = 'Отговор със съобщение'; +$labels['messagedelete'] = 'Изтриване на съобщение'; +$labels['messagediscard'] = 'Отхвърляне със съобщение'; +$labels['messagesrules'] = 'За входящата поща:'; +$labels['messagesactions'] = '...изпълнение на следните действия'; +$labels['add'] = 'Добавяне'; +$labels['del'] = 'Изтриване'; +$labels['sender'] = 'Подател'; +$labels['recipient'] = 'Получател'; + +$messages = array(); +$messages['filterunknownerror'] = 'Неизвестна грешка на сървъра'; +$messages['filterconnerror'] = 'Невъзможност за свързване с managesieve сървъра '; +$messages['filterdeleteerror'] = 'Невъзможност за изтриване на филтър. Сървър грешка'; +$messages['filterdeleted'] = 'Филтърът е изтрит успешно'; +$messages['filterdeleteconfirm'] = 'Наистина ли искате да изтриете избрания филтър?'; +$messages['filtersaved'] = 'Филтърът е записан успешно'; +$messages['filtersaveerror'] = 'Филтърът не може да бъде записан. Сървър грешка.'; +$messages['ruledeleteconfirm'] = 'Сигурни ли сте, че искате да изтриете избраното правило?'; +$messages['actiondeleteconfirm'] = 'Сигурни ли сте, че искате да изтриете избраното действие?'; +$messages['forbiddenchars'] = 'Забранени символи в полето'; +$messages['cannotbeempty'] = 'Полето не може да бъде празно'; + +?> diff --git a/plugins/managesieve/localization/cs_CZ.inc b/plugins/managesieve/localization/cs_CZ.inc new file mode 100644 index 000000000..033a1a0e3 --- /dev/null +++ b/plugins/managesieve/localization/cs_CZ.inc @@ -0,0 +1,61 @@ +<?php + +/** + * Czech translation for Roundcube managesieve plugin + * + * @version 1.0 (2009-09-29) + * @author Daniel Kolar <kolar@g2n.cz> + * + */ + +$labels['filters'] = 'Filtry'; +$labels['managefilters'] = 'Nastavení filtrů'; +$labels['filtername'] = 'Název filtru'; +$labels['newfilter'] = 'Nový filtr'; +$labels['filteradd'] = 'Přidej filtr'; +$labels['filterdel'] = 'Smaž filtr'; +$labels['moveup'] = 'Posunout nahoru'; +$labels['movedown'] = 'Posunout dolů'; +$labels['filterallof'] = 'Odpovídají všechny pravidla'; +$labels['filteranyof'] = 'Odpovídá kterékoliv pravidlo'; +$labels['filterany'] = 'Všechny zprávy'; +$labels['filtercontains'] = 'obsahuje'; +$labels['filternotcontains'] = 'neobsahuje'; +$labels['filteris'] = 'odpovídá'; +$labels['filterisnot'] = 'neodpovídá'; +$labels['filterexists'] = 'existuje'; +$labels['filternotexists'] = 'neexistuje'; +$labels['filterunder'] = 'pod'; +$labels['filterover'] = 'nad'; +$labels['addrule'] = 'Přidej pravidlo'; +$labels['delrule'] = 'Smaž pravidlo'; +$labels['messagemoveto'] = 'Přesuň zprávu do'; +$labels['messageredirect'] = 'Přeposlat zprávu na'; +$labels['messagereply'] = 'Odpovědět se zprávou'; +$labels['messagedelete'] = 'Smazat zprávu'; +$labels['messagediscard'] = 'Smazat se zprávou'; +$labels['messagesrules'] = 'Pravidla pro příchozí zprávu:'; +$labels['messagesactions'] = '...vykonej následující akce:'; +$labels['add'] = 'Přidej'; +$labels['del'] = 'Smaž'; +$labels['sender'] = 'Odesílatel'; +$labels['recipient'] = 'Příjemce'; +$labels['vacationaddresses'] = 'Seznam příjemců, kterým nebude zpráva odeslána (oddělené čárkou):'; +$labels['vacationdays'] = 'Počet dnů mezi automatickými odpověďmi:'; +$labels['vacationreason'] = 'Zpráva (Důvod nepřítomnosti):'; +$labels['rulestop'] = 'Zastavit pravidla'; + +$messages = array(); +$messages['filterunknownerror'] = 'Neznámá chyba serveru'; +$messages['filterconnerror'] = 'Nebylo možné se připojit k sieve serveru'; +$messages['filterdeleteerror'] = 'Nebylo možné smazat filtr. Server nahlásil chybu'; +$messages['filterdeleted'] = 'Filtr byl smazán'; +$messages['filterdeleteconfirm'] = 'Opravdu chcete smazat vybraný filtr?'; +$messages['filtersaved'] = 'Filtr byl uložen'; +$messages['filtersaveerror'] = 'Nebylo možné uložit filtr. Server nahlásil chybu.'; +$messages['ruledeleteconfirm'] = 'Jste si jisti, že chcete smazat vybrané pravidlo?'; +$messages['actiondeleteconfirm'] = 'Jste si jisti, že chcete smazat vybranou akci?'; +$messages['forbiddenchars'] = 'Zakázané znaky v poli'; +$messages['cannotbeempty'] = 'Pole nemůže být prázdné'; + +?> diff --git a/plugins/managesieve/localization/de_CH.inc b/plugins/managesieve/localization/de_CH.inc new file mode 100644 index 000000000..c0fe389f5 --- /dev/null +++ b/plugins/managesieve/localization/de_CH.inc @@ -0,0 +1,52 @@ +<?php + +$labels['filters'] = 'Filter'; +$labels['managefilters'] = 'Verwalte eingehende Nachrichtenfilter'; +$labels['filtername'] = 'Filtername'; +$labels['newfilter'] = 'Neuer Filter'; +$labels['filteradd'] = 'Filter hinzufügen'; +$labels['filterdel'] = 'Filter löschen'; +$labels['moveup'] = 'Nach oben'; +$labels['movedown'] = 'Nach unten'; +$labels['filterallof'] = 'UND (alle Regeln müssen zutreffen)'; +$labels['filteranyof'] = 'ODER (eine der Regeln muss zutreffen'; +$labels['filterany'] = 'Für alle Nachrichten'; +$labels['filtercontains'] = 'enthält'; +$labels['filternotcontains'] = 'enthält nicht'; +$labels['filteris'] = 'ist gleich'; +$labels['filterisnot'] = 'ist ungleich'; +$labels['filterexists'] = 'ist vorhanden'; +$labels['filternotexists'] = 'nicht vorhanden'; +$labels['filterunder'] = 'unter'; +$labels['filterover'] = 'über'; +$labels['addrule'] = 'Regel hinzufügen'; +$labels['delrule'] = 'Regel löschen'; +$labels['messagemoveto'] = 'Verschiebe Nachricht nach'; +$labels['messageredirect'] = 'Leite Nachricht um nach'; +$labels['messagereply'] = 'Antworte mit Nachricht'; +$labels['messagedelete'] = 'Nachricht löschen'; +$labels['messagediscard'] = 'Discard with message'; +$labels['messagesrules'] = 'Für eingehende Nachrichten:'; +$labels['messagesactions'] = 'Führe folgende Aktionen aus:'; +$labels['add'] = 'Hinzufügen'; +$labels['del'] = 'Löschen'; +$labels['sender'] = 'Absender'; +$labels['recipient'] = 'Empfänger'; +$labels['vacationaddresses'] = 'Zusätzliche Liste von Empfängern (Komma getrennt):'; +$labels['vacationdays'] = 'Antwort wird erneut gesendet nach (in Tagen):'; +$labels['vacationreason'] = 'Inhalt der Nachricht (Abwesenheitsgrund):'; +$labels['rulestop'] = 'Regelauswertung anhalten'; + +$messages['filterunknownerror'] = 'Unbekannter Serverfehler'; +$messages['filterconnerror'] = 'Kann nicht zum Sieve-Server verbinden'; +$messages['filterdeleteerror'] = 'Fehler beim des löschen Filters. Serverfehler'; +$messages['filterdeleted'] = 'Filter erfolgreich gelöscht'; +$messages['filterdeleteconfirm'] = 'Möchten Sie den Filter löschen ?'; +$messages['filtersaved'] = 'Filter gespeichert'; +$messages['filtersaveerror'] = 'Serverfehler, konnte den Filter nicht speichern.'; +$messages['ruledeleteconfirm'] = 'Sicher, dass Sie die Regel löschen wollen?'; +$messages['actiondeleteconfirm'] = 'Sicher, dass Sie die ausgewaehlte Aktion löschen wollen?'; +$messages['forbiddenchars'] = 'Unerlaubte Zeichen im Feld'; +$messages['cannotbeempty'] = 'Feld darf nicht leer sein'; + +?> diff --git a/plugins/managesieve/localization/de_DE.inc b/plugins/managesieve/localization/de_DE.inc new file mode 100644 index 000000000..e71d7e00d --- /dev/null +++ b/plugins/managesieve/localization/de_DE.inc @@ -0,0 +1,92 @@ +<?php + +$labels['filters'] = 'Filter'; +$labels['managefilters'] = 'Posteingangs-Filter verwalten'; +$labels['filtername'] = 'Filtername'; +$labels['newfilter'] = 'Filter anlegen'; +$labels['filteradd'] = 'Filter hinzufügen'; +$labels['filterdel'] = 'Filter löschen'; +$labels['moveup'] = 'Nach oben'; +$labels['movedown'] = 'Nach unten'; +$labels['filterallof'] = 'trifft auf alle folgenden Regeln zu'; +$labels['filteranyof'] = 'trifft auf eine der folgenden Regeln zu'; +$labels['filterany'] = 'alle Nachrichten'; +$labels['filtercontains'] = 'enthält'; +$labels['filternotcontains'] = 'enthält nicht'; +$labels['filteris'] = 'ist gleich'; +$labels['filterisnot'] = 'ist ungleich'; +$labels['filterexists'] = 'existiert'; +$labels['filternotexists'] = 'existiert nicht'; +$labels['filterunder'] = 'unter'; +$labels['filterover'] = 'über'; +$labels['addrule'] = 'Regel hinzufügen'; +$labels['delrule'] = 'Regel löschen'; +$labels['messagemoveto'] = 'Verschiebe Nachricht nach'; +$labels['messageredirect'] = 'Leite Nachricht um an'; +$labels['messagecopyto'] = 'Kopiere Nachricht nach'; +$labels['messagesendcopy'] = 'Sende Kopie an'; +$labels['messagereply'] = 'Antworte mit Nachricht'; +$labels['messagedelete'] = 'Lösche Nachricht'; +$labels['messagediscard'] = 'Weise ab mit Nachricht'; +$labels['messagesrules'] = 'Für eingehende Nachrichten:'; +$labels['messagesactions'] = '...führende folgende Aktionen aus:'; +$labels['add'] = 'Hinzufügen'; +$labels['del'] = 'Löschen'; +$labels['sender'] = 'Absender'; +$labels['recipient'] = 'Empfänger'; +$labels['vacationaddresses'] = 'Zusätzliche Liste von E-Mail Empfängern (Komma getrennt):'; +$labels['vacationdays'] = 'Wie oft sollen Nachrichten gesendet werden (in Tagen):'; +$labels['vacationreason'] = 'Nachrichteninhalt (Abwesenheitsgrund):'; +$labels['rulestop'] = 'Regelauswertung anhalten'; +$labels['filterset'] = 'Filtersätze'; +$labels['filtersetadd'] = 'Filtersatz anlegen'; +$labels['filtersetdel'] = 'Aktuellen Filtersatz löschen'; +$labels['filtersetact'] = 'Aktuellen Filtersatz aktivieren'; +$labels['filtersetdeact'] = 'Aktuellen Filtersatz deaktivieren'; +$labels['filtersetget'] = 'Filtersatz im Textformat herunterladen'; +$labels['filterdef'] = 'Filterdefinition'; +$labels['filtersetname'] = 'Filtersatzname'; +$labels['newfilterset'] = 'Neuer Filtersatz'; +$labels['active'] = 'aktiv'; +$labels['none'] = 'keine'; +$labels['fromset'] = 'aus Filtersatz'; +$labels['fromfile'] = 'aus Datei'; +$labels['filterdisabled'] = 'Filter deaktiviert'; +$labels['countisgreaterthan'] = 'Anzahl ist größer als'; +$labels['countisgreaterthanequal'] = 'Anzahl ist gleich oder größer als'; +$labels['countislessthan'] = 'Anzahl ist kleiner als'; +$labels['countislessthanequal'] = 'Anzahl ist gleich oder kleiner als'; +$labels['countequals'] = 'Anzahl ist gleich'; +$labels['countnotequals'] = 'Anzahl ist ungleich'; +$labels['valueisgreaterthan'] = 'Wert ist größer als'; +$labels['valueisgreaterthanequal'] = 'Wert ist gleich oder größer als'; +$labels['valueislessthan'] = 'Wert ist kleiner'; +$labels['valueislessthanequal'] = 'Wert ist gleich oder kleiner als'; +$labels['valueequals'] = 'Wert ist gleich'; +$labels['valuenotequals'] = 'Wert ist ungleich'; + +$messages = array(); +$messages['filterunknownerror'] = 'Unbekannter Serverfehler'; +$messages['filterconnerror'] = 'Kann keine Verbindung mit Managesieve-Server herstellen'; +$messages['filterdeleteerror'] = 'Fehler beim Löschen des Filters. Serverfehler'; +$messages['filterdeleted'] = 'Filter erfolgreich gelöscht'; +$messages['filtersaved'] = 'Filter erfolgreich gespeichert'; +$messages['filtersaveerror'] = 'Fehler beim Speichern des Filters. Serverfehler'; +$messages['filterdeleteconfirm'] = 'Möchten Sie den ausgewählten Filter wirklich löschen?'; +$messages['ruledeleteconfirm'] = 'Sind Sie sicher, dass Sie die ausgewählte Regel löschen möchten?'; +$messages['actiondeleteconfirm'] = 'Sind Sie sicher, dass Sie die ausgewählte Aktion löschen möchten?'; +$messages['forbiddenchars'] = 'Unzulässige Zeichen im Eingabefeld'; +$messages['cannotbeempty'] = 'Eingabefeld darf nicht leer sein'; +$messages['setactivateerror'] = 'Kann ausgewählten Filtersatz nicht aktivieren. Serverfehler'; +$messages['setdeactivateerror'] = 'Kann ausgewählten Filtersatz nicht deaktivieren. Serverfehler'; +$messages['setdeleteerror'] = 'Kann ausgewählten Filtersatz nicht löschen. Serverfehler'; +$messages['setactivated'] = 'Filtersatz wurde erfolgreich aktiviert'; +$messages['setdeactivated'] = 'Filtersatz wurde erfolgreich deaktiviert'; +$messages['setdeleted'] = 'Filtersatz wurde erfolgreich gelöscht'; +$messages['setdeleteconfirm'] = 'Sind Sie sicher, dass Sie den ausgewählten Filtersatz löschen möchten?'; +$messages['setcreateerror'] = 'Kann Filtersatz nicht erstellen. Serverfehler'; +$messages['setcreated'] = 'Filtersatz wurde erfolgreich erstellt'; +$messages['emptyname'] = 'Kann Filtersatz nicht erstellen. Kein Name vergeben'; +$messages['nametoolong'] = 'Kann Filtersatz nicht erstellen. Name zu lang' + +?> diff --git a/plugins/managesieve/localization/el_GR.inc b/plugins/managesieve/localization/el_GR.inc new file mode 100644 index 000000000..a1a5eeca3 --- /dev/null +++ b/plugins/managesieve/localization/el_GR.inc @@ -0,0 +1,56 @@ +<?php + +// Antonis Kanouras (2009-10-22) + +$labels = array(); +$labels['filters'] = 'Φίλτρα'; +$labels['managefilters'] = 'Διαχείριση φίλτρων εισερχόμενων'; +$labels['filtername'] = 'Ονομασία φίλτρου'; +$labels['newfilter'] = 'Δημιουργία φίλτρου'; +$labels['filteradd'] = 'Προσθήκη φίλτρου'; +$labels['filterdel'] = 'Διαγραφή φίλτρου'; +$labels['moveup'] = 'Μετακίνηση πάνω'; +$labels['movedown'] = 'Μετακίνηση κάτω'; +$labels['filterallof'] = 'ταιριάζουν με όλους τους παρακάτω κανόνες'; +$labels['filteranyof'] = 'ταιριάζουν με οποιονδήποτε από τους παρακάτω κανόνες'; +$labels['filterany'] = 'όλα τα μηνύματα'; +$labels['filtercontains'] = 'περιέχει'; +$labels['filternotcontains'] = 'δεν περιέχει'; +$labels['filteris'] = 'είναι ίσο με'; +$labels['filterisnot'] = 'δεν είναι ίσο με'; +$labels['filterexists'] = 'υπάρχει'; +$labels['filternotexists'] = 'δεν υπάρχει'; +$labels['filterunder'] = 'κάτω'; +$labels['filterover'] = 'πάνω'; +$labels['addrule'] = 'Προσθήκη κανόνα'; +$labels['delrule'] = 'Διαγραφή κανόνα'; +$labels['messagemoveto'] = 'Μετακίνηση μηνύματος στο'; +$labels['messageredirect'] = 'Προώθηση μηνύματος στο'; +$labels['messagereply'] = 'Απάντηση με μήνυμα'; +$labels['messagedelete'] = 'Διαγραφή μηνύματος'; +$labels['messagediscard'] = 'Απόρριψη με μήνυμα'; +$labels['messagesrules'] = 'Για εισερχόμενα μηνύματα που:'; +$labels['messagesactions'] = '...εκτέλεση των παρακάτω ενεργειών:'; +$labels['add'] = 'Προσθήκη'; +$labels['del'] = 'Διαγραφή'; +$labels['sender'] = 'Αποστολέας'; +$labels['recipient'] = 'Παραλήπτης'; +$labels['vacationaddresses'] = 'Πρόσθετη λίστα email παραληπτών (διαχωρισμένη με κόμματα):'; +$labels['vacationdays'] = 'Συχνότητα αποστολής μηνυμάτων (σε ημέρες):'; +$labels['vacationreason'] = 'Σώμα μηνύματος (λόγος απουσίας):'; +$labels['rulestop'] = 'Παύση επαλήθευσης κανόνων'; + +$messages = array(); +$messages['filterunknownerror'] = 'Άγνωστο σφάλμα διακομιστή'; +$messages['filterconnerror'] = 'Αδυναμία σύνδεσης στον διακομιστή managesieve'; +$messages['filterdeleteerror'] = 'Αδυναμία διαγραφής φίλτρου. Προέκυψε σφάλμα στον διακομιστή'; +$messages['filterdeleted'] = 'Το φίλτρο διαγράφηκε επιτυχώς'; +$messages['filterconfirmdelete'] = 'Θέλετε όντως να διαγράψετε το επιλεγμένο φίλτρο;'; +$messages['filtersaved'] = 'Το φίλτρο αποθηκεύτηκε επιτυχώς'; +$messages['filtersaveerror'] = 'Αδυναμία αποθήκευσης φίλτρου. Προέκυψε σφάλμα στον διακομιστή'; +$messages['ruledeleteconfirm'] = 'Θέλετε όντως να διαγράψετε τον επιλεγμένο κανόνα;'; +$messages['actiondeleteconfirm'] = 'Θέλετε όντως να διαγράψετε την επιλεγμένη ενέργεια;'; +$messages['forbiddenchars'] = 'Μη επιτρεπτοί χαρακτήρες στο πεδίο'; +$messages['cannotbeempty'] = 'Το πεδίο δεν μπορεί να είναι κενό'; + +?> diff --git a/plugins/managesieve/localization/en_GB.inc b/plugins/managesieve/localization/en_GB.inc new file mode 100644 index 000000000..c62979cc5 --- /dev/null +++ b/plugins/managesieve/localization/en_GB.inc @@ -0,0 +1,53 @@ +<?php + +$labels['filters'] = 'Filters'; +$labels['managefilters'] = 'Manage incoming mail filters'; +$labels['filtername'] = 'Filter name'; +$labels['newfilter'] = 'New filter'; +$labels['filteradd'] = 'Add filter'; +$labels['filterdel'] = 'Delete filter'; +$labels['moveup'] = 'Move up'; +$labels['movedown'] = 'Move down'; +$labels['filterallof'] = 'matching all of the following rules'; +$labels['filteranyof'] = 'matching any of the following rules'; +$labels['filterany'] = 'all messages'; +$labels['filtercontains'] = 'contains'; +$labels['filternotcontains'] = 'not contains'; +$labels['filteris'] = 'is equal to'; +$labels['filterisnot'] = 'is not equal to'; +$labels['filterexists'] = 'exists'; +$labels['filternotexists'] = 'not exists'; +$labels['filterunder'] = 'under'; +$labels['filterover'] = 'over'; +$labels['addrule'] = 'Add rule'; +$labels['delrule'] = 'Delete rule'; +$labels['messagemoveto'] = 'Move message to'; +$labels['messageredirect'] = 'Redirect message to'; +$labels['messagereply'] = 'Reply with message'; +$labels['messagedelete'] = 'Delete message'; +$labels['messagediscard'] = 'Discard with message'; +$labels['messagesrules'] = 'For incoming mail:'; +$labels['messagesactions'] = '...execute the following actions:'; +$labels['add'] = 'Add'; +$labels['del'] = 'Delete'; +$labels['sender'] = 'Sender'; +$labels['recipient'] = 'Recipient'; +$labels['vacationaddresses'] = 'Additional list of recipient e-mails (comma separated):'; +$labels['vacationdays'] = 'How often send messages (in days):'; +$labels['vacationreason'] = 'Message body (vacation reason):'; +$labels['rulestop'] = 'Stop evaluating rules'; + +$messages = array(); +$messages['filterunknownerror'] = 'Unknown server error'; +$messages['filterconnerror'] = 'Unable to connect to managesieve server'; +$messages['filterdeleteerror'] = 'Unable to delete filter. Server error occured'; +$messages['filterdeleted'] = 'Filter deleted successfully'; +$messages['filterdeleteconfirm'] = 'Do you really want to delete selected filter?'; +$messages['filtersaved'] = 'Filter saved successfully'; +$messages['filtersaveerror'] = 'Unable to save filter. Server error occured.'; +$messages['ruledeleteconfirm'] = 'Are you sure, you want to delete selected rule?'; +$messages['actiondeleteconfirm'] = 'Are you sure, you want to delete selected action?'; +$messages['forbiddenchars'] = 'Forbidden characters in field'; +$messages['cannotbeempty'] = 'Field cannot be empty'; + +?> diff --git a/plugins/managesieve/localization/en_US.inc b/plugins/managesieve/localization/en_US.inc new file mode 100644 index 000000000..24cd72a86 --- /dev/null +++ b/plugins/managesieve/localization/en_US.inc @@ -0,0 +1,119 @@ +<?php + +$labels['filters'] = 'Filters'; +$labels['managefilters'] = 'Manage incoming mail filters'; +$labels['filtername'] = 'Filter name'; +$labels['newfilter'] = 'New filter'; +$labels['filteradd'] = 'Add filter'; +$labels['filterdel'] = 'Delete filter'; +$labels['moveup'] = 'Move up'; +$labels['movedown'] = 'Move down'; +$labels['filterallof'] = 'matching all of the following rules'; +$labels['filteranyof'] = 'matching any of the following rules'; +$labels['filterany'] = 'all messages'; +$labels['filtercontains'] = 'contains'; +$labels['filternotcontains'] = 'not contains'; +$labels['filteris'] = 'is equal to'; +$labels['filterisnot'] = 'is not equal to'; +$labels['filterexists'] = 'exists'; +$labels['filternotexists'] = 'not exists'; +$labels['filtermatches'] = 'matches expression'; +$labels['filternotmatches'] = 'not matches expression'; +$labels['filterregex'] = 'matches regular expression'; +$labels['filternotregex'] = 'not matches regular expression'; +$labels['filterunder'] = 'under'; +$labels['filterover'] = 'over'; +$labels['addrule'] = 'Add rule'; +$labels['delrule'] = 'Delete rule'; +$labels['messagemoveto'] = 'Move message to'; +$labels['messageredirect'] = 'Redirect message to'; +$labels['messagecopyto'] = 'Copy message to'; +$labels['messagesendcopy'] = 'Send message copy to'; +$labels['messagereply'] = 'Reply with message'; +$labels['messagedelete'] = 'Delete message'; +$labels['messagediscard'] = 'Discard with message'; +$labels['messagesrules'] = 'For incoming mail:'; +$labels['messagesactions'] = '...execute the following actions:'; +$labels['add'] = 'Add'; +$labels['del'] = 'Delete'; +$labels['sender'] = 'Sender'; +$labels['recipient'] = 'Recipient'; +$labels['vacationaddresses'] = 'Additional list of recipient e-mails (comma separated):'; +$labels['vacationdays'] = 'How often send messages (in days):'; +$labels['vacationreason'] = 'Message body (vacation reason):'; +$labels['vacationsubject'] = 'Message subject:'; +$labels['rulestop'] = 'Stop evaluating rules'; +$labels['enable'] = 'Enable/Disable'; +$labels['filterset'] = 'Filters set'; +$labels['filtersets'] = 'Filter sets'; +$labels['filtersetadd'] = 'Add filters set'; +$labels['filtersetdel'] = 'Delete current filters set'; +$labels['filtersetact'] = 'Activate current filters set'; +$labels['filtersetdeact'] = 'Deactivate current filters set'; +$labels['filterdef'] = 'Filter definition'; +$labels['filtersetname'] = 'Filters set name'; +$labels['newfilterset'] = 'New filters set'; +$labels['active'] = 'active'; +$labels['none'] = 'none'; +$labels['fromset'] = 'from set'; +$labels['fromfile'] = 'from file'; +$labels['filterdisabled'] = 'Filter disabled'; +$labels['countisgreaterthan'] = 'count is greater than'; +$labels['countisgreaterthanequal'] = 'count is greater than or equal to'; +$labels['countislessthan'] = 'count is less than'; +$labels['countislessthanequal'] = 'count is less than or equal to'; +$labels['countequals'] = 'count is equal to'; +$labels['countnotequals'] = 'count does not equal'; +$labels['valueisgreaterthan'] = 'value is greater than'; +$labels['valueisgreaterthanequal'] = 'value is greater than or equal to'; +$labels['valueislessthan'] = 'value is less than'; +$labels['valueislessthanequal'] = 'value is less than or equal to'; +$labels['valueequals'] = 'value is equal to'; +$labels['valuenotequals'] = 'value does not equal'; +$labels['setflags'] = 'Set flags to the message'; +$labels['addflags'] = 'Add flags to the message'; +$labels['removeflags'] = 'Remove flags from the message'; +$labels['flagread'] = 'Read'; +$labels['flagdeleted'] = 'Deleted'; +$labels['flaganswered'] = 'Answered'; +$labels['flagflagged'] = 'Flagged'; +$labels['flagdraft'] = 'Draft'; +$labels['filtercreate'] = 'Create filter'; +$labels['usedata'] = 'Use following data in the filter:'; +$labels['nextstep'] = 'Next Step'; +$labels['...'] = '...'; + +$messages = array(); +$messages['filterunknownerror'] = 'Unknown server error.'; +$messages['filterconnerror'] = 'Unable to connect to server.'; +$messages['filterdeleteerror'] = 'Unable to delete filter. Server error occured.'; +$messages['filterdeleted'] = 'Filter deleted successfully.'; +$messages['filtersaved'] = 'Filter saved successfully.'; +$messages['filtersaveerror'] = 'Unable to save filter. Server error occured.'; +$messages['filterdeleteconfirm'] = 'Do you really want to delete selected filter?'; +$messages['ruledeleteconfirm'] = 'Are you sure, you want to delete selected rule?'; +$messages['actiondeleteconfirm'] = 'Are you sure, you want to delete selected action?'; +$messages['forbiddenchars'] = 'Forbidden characters in field.'; +$messages['cannotbeempty'] = 'Field cannot be empty.'; +$messages['ruleexist'] = 'Filter with specified name already exists.'; +$messages['setactivateerror'] = 'Unable to activate selected filters set. Server error occured.'; +$messages['setdeactivateerror'] = 'Unable to deactivate selected filters set. Server error occured.'; +$messages['setdeleteerror'] = 'Unable to delete selected filters set. Server error occured.'; +$messages['setactivated'] = 'Filters set activated successfully.'; +$messages['setdeactivated'] = 'Filters set deactivated successfully.'; +$messages['setdeleted'] = 'Filters set deleted successfully.'; +$messages['setdeleteconfirm'] = 'Are you sure, you want to delete selected filters set?'; +$messages['setcreateerror'] = 'Unable to create filters set. Server error occured.'; +$messages['setcreated'] = 'Filters set created successfully.'; +$messages['activateerror'] = 'Unable to enable selected filter(s). Server error occured.'; +$messages['deactivateerror'] = 'Unable to disable selected filter(s). Server error occured.'; +$messages['activated'] = 'Filter(s) disabled successfully.'; +$messages['deactivated'] = 'Filter(s) enabled successfully.'; +$messages['moved'] = 'Filter moved successfully.'; +$messages['moveerror'] = 'Unable to move selected filter. Server error occured.'; +$messages['nametoolong'] = 'Name too long.'; +$messages['namereserved'] = 'Reserved name.'; +$messages['setexist'] = 'Set already exists.'; +$messages['nodata'] = 'At least one position must be selected!'; + +?> diff --git a/plugins/managesieve/localization/es_AR.inc b/plugins/managesieve/localization/es_AR.inc new file mode 100644 index 000000000..93fd1e9f4 --- /dev/null +++ b/plugins/managesieve/localization/es_AR.inc @@ -0,0 +1,81 @@ +<?php + +$labels = array(); +$labels['filters'] = 'Filtros'; +$labels['managefilters'] = 'Administrar filtros de correo entrante'; +$labels['filtername'] = 'Nombre del filtro'; +$labels['newfilter'] = 'Nuevo filtro'; +$labels['filteradd'] = 'Agregar filtro'; +$labels['filterdel'] = 'Eliminar filtro'; +$labels['moveup'] = 'Mover arriba'; +$labels['movedown'] = 'Mover abajo'; +$labels['filterallof'] = 'coinidir con todas las reglas siguientes'; +$labels['filteranyof'] = 'coincidir con alguna de las reglas siguientes'; +$labels['filterany'] = 'todos los mensajes'; +$labels['filtercontains'] = 'contiene'; +$labels['filternotcontains'] = 'no contiene'; +$labels['filteris'] = 'es igual a'; +$labels['filterisnot'] = 'no es igual a'; +$labels['filterexists'] = 'existe'; +$labels['filternotexists'] = 'no existe'; +$labels['filterunder'] = 'bajo'; +$labels['filterover'] = 'sobre'; +$labels['addrule'] = 'Agregar regla'; +$labels['delrule'] = 'Eliminar regla'; +$labels['messagemoveto'] = 'Mover mensaje a'; +$labels['messageredirect'] = 'Redirigir mensaje a'; +$labels['messagecopyto'] = 'Copiar mensaje a'; +$labels['messagesendcopy'] = 'Enviar copia del mensaje a'; +$labels['messagereply'] = 'Responder con un mensaje'; +$labels['messagedelete'] = 'Eliminar mensaje'; +$labels['messagediscard'] = 'Descartar con un mensaje'; +$labels['messagesrules'] = 'Para el correo entrante:'; +$labels['messagesactions'] = '... ejecutar las siguientes acciones:'; +$labels['add'] = 'Agregar'; +$labels['del'] = 'Eliminar'; +$labels['sender'] = 'Remitente'; +$labels['recipient'] = 'Destinatario'; +$labels['vacationaddresses'] = 'Lista de direcciones de correo de destinatarios adicionales (separados por comas):'; +$labels['vacationdays'] = 'Cada cuanto enviar mensajes (en días):'; +$labels['vacationreason'] = 'Cuerpo del mensaje (razón de vacaciones):'; +$labels['rulestop'] = 'Parar de evaluar reglas'; +$labels['filterset'] = 'Conjunto de filtros'; +$labels['filtersetadd'] = 'Agregar conjunto de filtros'; +$labels['filtersetdel'] = 'Eliminar conjunto de filtros'; +$labels['filtersetact'] = 'Activar conjunto de filtros'; +$labels['filtersetdeact'] = 'Deactivar conjunto de filtros'; +$labels['filtersetget'] = 'Descargar conjunto de filtros en archivo de texto'; +$labels['filterdef'] = 'Definicion del conjunto de filtros'; +$labels['filtersetname'] = 'Nombre del conjunto de filtros'; +$labels['newfilterset'] = 'Nuevo conjunto de filtros'; +$labels['active'] = 'Activar'; +$labels['none'] = 'none'; +$labels['fromset'] = 'desde conjunto'; +$labels['fromfile'] = 'desde archivo'; +$labels['filterdisabled'] = 'Filtro deshabilitado'; + +$messages = array(); +$messages['filterunknownerror'] = 'Error desconocido de servidor'; +$messages['filterconnerror'] = 'Imposible conectar con el servidor managesieve'; +$messages['filterdeleteerror'] = 'Imposible borrar filtro. Ha ocurrido un error en el servidor'; +$messages['filterdeleted'] = 'Filtro borrado satisfactoriamente'; +$messages['filterdeleteconfirm'] = '¿Realmente desea borrar el filtro seleccionado?'; +$messages['filtersaved'] = 'Filtro guardado satisfactoriamente'; +$messages['filtersaveerror'] = 'Imposible guardar ell filtro. Ha ocurrido un error en el servidor'; +$messages['ruledeleteconfirm'] = '¿Está seguro de que desea borrar la regla seleccionada?'; +$messages['actiondeleteconfirm'] = '¿Está seguro de que desea borrar la acción seleccionada?'; +$messages['forbiddenchars'] = 'Caracteres prohibidos en el campo'; +$messages['cannotbeempty'] = 'El campo no puede estar vacío'; +$messages['setactivateerror'] = 'Imposible activar el conjunto de filtros. Error en el servidor.'; +$messages['setdeactivateerror'] = 'Imposible desactivar el conjunto de filtros. Error en el servidor.'; +$messages['setdeleteerror'] = 'Imposible eliminar el conjunto de filtros. Error en el servidor.'; +$messages['setactivated'] = 'Conjunto de filtros activados correctamente'; +$messages['setdeactivated'] = 'Conjunto de filtros desactivados correctamente'; +$messages['setdeleted'] = 'Conjunto de filtros eliminados correctamente'; +$messages['setdeleteconfirm'] = '¿Esta seguro, que quiere eliminar el conjunto de filtros seleccionado?'; +$messages['setcreateerror'] = 'Imposible crear el conjunto de filtros. Error en el servidor.'; +$messages['setcreated'] = 'Conjunto de filtros creados correctamente'; +$messages['emptyname'] = 'Imposible crear el conjunto de filtros. Nombre del conjunto de filtros vacio'; +$messages['nametoolong'] = 'Imposible crear el conjunto de filtros. Nombre del conjunto de filtros muy largo'; + +?> diff --git a/plugins/managesieve/localization/es_ES.inc b/plugins/managesieve/localization/es_ES.inc new file mode 100644 index 000000000..1dad18d99 --- /dev/null +++ b/plugins/managesieve/localization/es_ES.inc @@ -0,0 +1,81 @@ +<?php + +$labels = array(); +$labels['filters'] = 'Filtros'; +$labels['managefilters'] = 'Administrar filtros de correo entrante'; +$labels['filtername'] = 'Nombre del filtro'; +$labels['newfilter'] = 'Nuevo filtro'; +$labels['filteradd'] = 'Agregar filtro'; +$labels['filterdel'] = 'Eliminar filtro'; +$labels['moveup'] = 'Mover arriba'; +$labels['movedown'] = 'Mover abajo'; +$labels['filterallof'] = 'coincidir con todas las reglas siguientes'; +$labels['filteranyof'] = 'coincidir con alguna de las reglas siguientes'; +$labels['filterany'] = 'todos los mensajes'; +$labels['filtercontains'] = 'contiene'; +$labels['filternotcontains'] = 'no contiene'; +$labels['filteris'] = 'es igual a'; +$labels['filterisnot'] = 'no es igual a'; +$labels['filterexists'] = 'existe'; +$labels['filternotexists'] = 'no existe'; +$labels['filterunder'] = 'bajo'; +$labels['filterover'] = 'sobre'; +$labels['addrule'] = 'Agregar regla'; +$labels['delrule'] = 'Eliminar regla'; +$labels['messagemoveto'] = 'Mover mensaje a'; +$labels['messageredirect'] = 'Redirigir mensaje a'; +$labels['messagecopyto'] = 'Copiar mensaje a'; +$labels['messagesendcopy'] = 'Enviar copia del mensaje a'; +$labels['messagereply'] = 'Responder con un mensaje'; +$labels['messagedelete'] = 'Eliminar mensaje'; +$labels['messagediscard'] = 'Descartar con un mensaje'; +$labels['messagesrules'] = 'Para el correo entrante:'; +$labels['messagesactions'] = '... ejecutar las siguientes acciones:'; +$labels['add'] = 'Agregar'; +$labels['del'] = 'Eliminar'; +$labels['sender'] = 'Remitente'; +$labels['recipient'] = 'Destinatario'; +$labels['vacationaddresses'] = 'Lista de direcciones de correo de destinatarios adicionales (separados por comas):'; +$labels['vacationdays'] = 'Cada cuanto enviar mensajes (en días):'; +$labels['vacationreason'] = 'Cuerpo del mensaje (razón de vacaciones):'; +$labels['rulestop'] = 'Parar de evaluar reglas'; +$labels['filterset'] = 'Conjunto de filtros'; +$labels['filtersetadd'] = 'Agregar conjunto de filtros'; +$labels['filtersetdel'] = 'Eliminar conjunto de filtros actual'; +$labels['filtersetact'] = 'Activar conjunto de filtros actual'; +$labels['filtersetdeact'] = 'Desactivar conjunto de filtros actual'; +$labels['filtersetget'] = 'Descargar conjunto de filtros en formato de texto'; +$labels['filterdef'] = 'Definición de filtros'; +$labels['filtersetname'] = 'Nombre del conjunto de filtros'; +$labels['newfilterset'] = 'Nuevo conjunto de filtros'; +$labels['active'] = 'activo'; +$labels['none'] = 'ninguno'; +$labels['fromset'] = 'de conjunto '; +$labels['fromfile'] = 'de archivo'; +$labels['filterdisabled'] = 'Filtro desactivado'; + +$messages = array(); +$messages['filterunknownerror'] = 'Error desconocido de servidor'; +$messages['filterconnerror'] = 'Imposible conectar con el servidor managesieve'; +$messages['filterdeleteerror'] = 'Imposible borrar filtro. Ha ocurrido un error en el servidor'; +$messages['filterdeleted'] = 'Filtro borrado satisfactoriamente'; +$messages['filtersaved'] = 'Filtro guardado satisfactoriamente'; +$messages['filtersaveerror'] = 'Imposible guardar el filtro. Ha ocurrido un error en el servidor'; +$messages['filterdeleteconfirm'] = '¿Realmente desea borrar el filtro seleccionado?'; +$messages['ruledeleteconfirm'] = '¿Está seguro de que desea borrar la regla seleccionada?'; +$messages['actiondeleteconfirm'] = '¿Está seguro de que desea borrar la acción seleccionada?'; +$messages['forbiddenchars'] = 'Caracteres prohibidos en el campo'; +$messages['cannotbeempty'] = 'El campo no puede estar vacío'; +$messages['setactivateerror'] = 'Imposible activar el conjunto de filtros seleccionado. Ha ocurrido un error en el servidor'; +$messages['setdeactivateerror'] = 'Imposible desactivar el conjunto de filtros seleccionado. Ha ocurrido un error en el servidor'; +$messages['setdeleteerror'] = 'Imposible borrar el conjunto de filtros seleccionado. Ha ocurrido un error en el servidor'; +$messages['setactivated'] = 'Conjunto de filtros activado satisfactoriamente'; +$messages['setdeactivated'] = 'Conjunto de filtros desactivado satisfactoriamente'; +$messages['setdeleted'] = 'Conjunto de filtros borrado satisfactoriamente'; +$messages['setdeleteconfirm'] = '¿Está seguro de que desea borrar el conjunto de filtros seleccionado?'; +$messages['setcreateerror'] = 'Imposible crear el conjunto de filtros. Ha ocurrido un error en el servidor'; +$messages['setcreated'] = 'Conjunto de filtros creado satisfactoriamente'; +$messages['emptyname'] = 'Imposible crear el conjunto de filtros. Sin nombre'; +$messages['nametoolong'] = 'Imposible crear el conjunto de filtros. Nombre demasiado largo' + +?> diff --git a/plugins/managesieve/localization/et_EE.inc b/plugins/managesieve/localization/et_EE.inc new file mode 100644 index 000000000..7f891883b --- /dev/null +++ b/plugins/managesieve/localization/et_EE.inc @@ -0,0 +1,53 @@ +<?php + +$labels['filters'] = 'Filtrid'; +$labels['managefilters'] = 'Halda sisenevate kirjade filtreid'; +$labels['filtername'] = 'Filtri nimi'; +$labels['newfilter'] = 'Uus filter'; +$labels['filteradd'] = 'Lisa filter'; +$labels['filterdel'] = 'Kustuta filter'; +$labels['moveup'] = 'Liiguta üles'; +$labels['movedown'] = 'Liiguta alla'; +$labels['filterallof'] = 'vastab kõikidele järgnevatele reeglitele'; +$labels['filteranyof'] = 'vastab mõnele järgnevatest reeglitest'; +$labels['filterany'] = 'kõik kirjad'; +$labels['filtercontains'] = 'sisaldab'; +$labels['filternotcontains'] = 'ei sisalda'; +$labels['filteris'] = 'on võrdne kui'; +$labels['filterisnot'] = 'ei ole võrdne kui'; +$labels['filterexists'] = 'on olemas'; +$labels['filternotexists'] = 'pole olemas'; +$labels['filterunder'] = 'alt'; +$labels['filterover'] = 'üle'; +$labels['addrule'] = 'Lisa reegel'; +$labels['delrule'] = 'Kustuta reegel'; +$labels['messagemoveto'] = 'Liiguta kiri'; +$labels['messageredirect'] = 'Suuna kiri ümber'; +$labels['messagereply'] = 'Vasta kirjaga'; +$labels['messagedelete'] = 'Kustuta kiri'; +$labels['messagediscard'] = 'Viska ära teatega'; +$labels['messagesrules'] = 'Siseneva kirja puhul, mis:'; +$labels['messagesactions'] = '...käivita järgnevad tegevused:'; +$labels['add'] = 'Lisa'; +$labels['del'] = 'Kustuta'; +$labels['sender'] = 'Saatja'; +$labels['recipient'] = 'Saaja'; +$labels['vacationaddresses'] = 'Lisanimekiri saaja e-posti aadressidest (komadega eraldatud):'; +$labels['vacationdays'] = 'Kui tihti kirju saata (päevades):'; +$labels['vacationreason'] = 'Kirja sisu (puhkuse põhjus):'; +$labels['rulestop'] = 'Peata reeglite otsimine'; + +$messages = array(); +$messages['filterunknownerror'] = 'Tundmatu serveri tõrge'; +$messages['filterconnerror'] = 'Managesieve serveriga ühendumine nurjus'; +$messages['filterdeleteerror'] = 'Filtri kustutamine nurjus. Ilmnes serveri tõrge.'; +$messages['filterdeleted'] = 'Filter edukalt kustutatud'; +$messages['filterdeleteconfirm'] = 'Soovid valitud filtri kustutada?'; +$messages['filtersaved'] = 'Filter edukalt salvestatud'; +$messages['filtersaveerror'] = 'Filtri salvestamine nurjus. Ilmnes serveri tõrge.'; +$messages['ruledeleteconfirm'] = 'Soovid valitud reegli kustutada?'; +$messages['actiondeleteconfirm'] = 'Soovid valitud tegevuse kustutada?'; +$messages['forbiddenchars'] = 'Väljal on lubamatu märk'; +$messages['cannotbeempty'] = 'Väli ei või tühi olla'; + +?> diff --git a/plugins/managesieve/localization/fi_FI.inc b/plugins/managesieve/localization/fi_FI.inc new file mode 100644 index 000000000..70d3ccebb --- /dev/null +++ b/plugins/managesieve/localization/fi_FI.inc @@ -0,0 +1,68 @@ +<?php + +$labels = array(); +$labels['filters'] = 'Suodattimet'; +$labels['managefilters'] = 'Muokkaa saapuvan sähköpostin suodattimia'; +$labels['filtername'] = 'Suodattimen nimi'; +$labels['newfilter'] = 'Uusi suodatin'; +$labels['filteradd'] = 'Lisää suodatin'; +$labels['filterdel'] = 'Poista suodatin'; +$labels['moveup'] = 'Siirrä ylös'; +$labels['movedown'] = 'Siirrä alas'; +$labels['filterallof'] = 'Täsmää kaikkien sääntöjen mukaan'; +$labels['filteranyof'] = 'Täsmää minkä tahansa sääntöjen mukaan'; +$labels['filterany'] = 'Kaikki viestit'; +$labels['filtercontains'] = 'Sisältää'; +$labels['filternotcontains'] = 'Ei Sisällä'; +$labels['filteris'] = 'on samanlainen kuin'; +$labels['filterisnot'] = 'ei ole samanlainen kuin'; +$labels['filterexists'] = 'on olemassa'; +$labels['filternotexists'] = 'ei ole olemassa'; +$labels['filterunder'] = 'alla'; +$labels['filterover'] = 'yli'; +$labels['addrule'] = 'Lisää sääntö'; +$labels['delrule'] = 'Poista sääntö'; +$labels['messagemoveto'] = 'Siirrä viesti'; +$labels['messageredirect'] = 'Uudelleen ohjaa viesti'; +$labels['messagereply'] = 'Vastaa viestin kanssa'; +$labels['messagedelete'] = 'Poista viesti'; +$labels['messagediscard'] = 'Hylkää viesti'; +$labels['messagesrules'] = 'Saapuva sähköposti'; +$labels['messagesactions'] = 'Suorita seuraavat tapahtumat'; +$labels['add'] = 'Lisää'; +$labels['del'] = 'Poista'; +$labels['sender'] = 'Lähettäjä'; +$labels['recipient'] = 'Vastaanottaja'; +$labels['vacationaddresses'] = 'Lähetä viesti myös seuraaviin osotteisiin (erottele pilkulla):'; +$labels['vacationdays'] = 'Kuinka monen päivän välein lähetetään uusi vastaus:'; +$labels['vacationreason'] = 'Viesti:'; +$labels['rulestop'] = 'Viimeinen sääntö'; +$labels['filterset'] = 'Suodatinlista'; +$labels['filtersetadd'] = 'Lisää suodatinlista'; +$labels['filtersetdel'] = 'Poista valittu suodatinlista'; +$labels['filtersetact'] = 'Aktivoi valittu suodatinlista'; +$labels['filtersetget'] = 'Lataa valittu suodatinlista tekstimuodossa'; +$labels['filterdef'] = 'Suodatinmääritykset'; +$labels['filtersetname'] = 'Suodatinlistan nimi'; +$labels['newfilterset'] = 'Uusi suodatinlista'; +$labels['active'] = 'aktiivinen'; +$labels['none'] = 'ei mitään'; +$labels['fromset'] = 'listasta'; +$labels['fromfile'] = 'tiedostosta'; +$labels['filterdisabled'] = 'Suodatin on poistettu käytöstä'; + +$messages = array(); +$messages['filterunknownerror'] = 'Tuntematon palvelin virhe'; +$messages['filterconnerror'] = 'Yhdistäminen palvelimeen epäonnistui'; +$messages['filterdeleteerror'] = 'Suodattimen poistaminen epäonnistui. Palvelin virhe'; +$messages['filterdeleted'] = 'Suodatin poistettu'; +$messages['filterdeleteconfirm'] = 'Haluatko varmasti poistaa valitut suodattimet?'; +$messages['filtersaved'] = 'Suodatin tallennettu'; +$messages['filtersaveerror'] = 'Suodattimen tallennus epäonnistui. Palvelin virhe'; +$messages['ruledeleteconfirm'] = 'Haluatko poistaa valitut säännöt?'; +$messages['actiondeleteconfirm'] = 'Haluatko poistaa valitut tapahtumat?'; +$messages['forbiddenchars'] = 'Sisältää kiellettyjä kirjaimia'; +$messages['cannotbeempty'] = 'Kenttä ei voi olla tyhjä'; + + +?> diff --git a/plugins/managesieve/localization/fr_FR.inc b/plugins/managesieve/localization/fr_FR.inc new file mode 100644 index 000000000..a2a83c21c --- /dev/null +++ b/plugins/managesieve/localization/fr_FR.inc @@ -0,0 +1,63 @@ +<?php + +$labels['filters'] = 'Filtres'; +$labels['managefilters'] = 'Gestion des filtres sur les mails entrants'; +$labels['filtername'] = 'Nom du filtre'; +$labels['newfilter'] = 'Nouveau filtre'; +$labels['filteradd'] = 'Ajouter un filtre'; +$labels['filterdel'] = 'Supprimer un filtre'; +$labels['moveup'] = 'Monter'; +$labels['movedown'] = 'Descendre'; +$labels['filterallof'] = 'valident toutes les conditions suivantes'; +$labels['filteranyof'] = 'valident au moins une des conditions suivantes'; +$labels['filterany'] = 'tous les messages'; +$labels['filtercontains'] = 'contient'; +$labels['filternotcontains'] = 'ne contient pas'; +$labels['filteris'] = 'est '; +$labels['filterisnot'] = 'n\'est pas'; +$labels['filterexists'] = 'existe'; +$labels['filternotexists'] = 'n\'existe pas'; +$labels['filterunder'] = 'est plus petit que'; +$labels['filterover'] = 'est plus grand que'; +$labels['addrule'] = 'Ajouter une règle'; +$labels['delrule'] = 'Supprimer une règle'; +$labels['messagemoveto'] = 'Déplacer le message vers'; +$labels['messageredirect'] = 'Transférer le message à'; +$labels['messagereply'] = 'Répondre avec le message'; +$labels['messagedelete'] = 'Supprimer le message'; +$labels['messagediscard'] = 'Rejeter avec le message'; +$labels['messagecopyto'] = 'Copier le message vers'; +$labels['messagesendcopy'] = 'Envoyer une copie du message à'; +$labels['messagesrules'] = 'Pour les mails entrants:'; +$labels['messagesactions'] = '...exécuter les actions suivantes:'; +$labels['add'] = 'Ajouter'; +$labels['del'] = 'Supprimer'; +$labels['sender'] = 'Expéditeur'; +$labels['recipient'] = 'Destinataire'; +$labels['vacationaddresses'] = 'Liste des destinataires (séparés par une virgule) :'; +$labels['vacationdays'] = 'Ne pas renvoyer un message avant (jours) :'; +$labels['vacationreason'] = 'Corps du message (raison de l\'absence) :'; +$labels['rulestop'] = 'Arrêter d\'évaluer les prochaines règles'; +$labels['setflags'] = 'Mettre les flags au message'; +$labels['addflags'] = 'Ajouter les flags au message'; +$labels['removeflags'] = 'Supprimer les flags du message'; +$labels['flagread'] = 'Lu'; +$labels['flagdeleted'] = 'Suprimé'; +$labels['flaganswered'] = 'répondu'; +$labels['flagflagged'] = 'Favori'; +$labels['flagdraft'] = 'Brouillon'; + +$messages = array(); +$messages['filterunknownerror'] = 'Erreur du serveur inconnue'; +$messages['filterconnerror'] = 'Connexion au serveur Managesieve impossible'; +$messages['filterdeleteerror'] = 'Suppression du filtre impossible. Le serveur à produit une erreur'; +$messages['filterdeleted'] = 'Le filtre a bien été supprimé'; +$messages['filterdeleteconfirm'] = 'Voulez-vous vraiment supprimer le filtre sélectionné?'; +$messages['filtersaved'] = 'Le filtre a bien été enregistré'; +$messages['filtersaveerror'] = 'Enregistrement du filtre impossibe. Le serveur à produit une erreur'; +$messages['ruledeleteconfirm'] = 'Voulez-vous vraiment supprimer la règle sélectionnée?'; +$messages['actiondeleteconfirm'] = 'Voulez-vous vraiment supprimer l\'action sélectionnée?'; +$messages['forbiddenchars'] = 'Caractères interdits dans le champ'; +$messages['cannotbeempty'] = 'Le champ ne peut pas être vide'; + +?> diff --git a/plugins/managesieve/localization/gl_ES.inc b/plugins/managesieve/localization/gl_ES.inc new file mode 100644 index 000000000..a03d9dec4 --- /dev/null +++ b/plugins/managesieve/localization/gl_ES.inc @@ -0,0 +1,81 @@ +<?php + +$labels = array(); +$labels['filters'] = 'Filtros'; +$labels['managefilters'] = 'Xestionar os filtros de correo entrante'; +$labels['filtername'] = 'Nome do filtro'; +$labels['newfilter'] = 'Novo filtro'; +$labels['filteradd'] = 'Engadir filtro'; +$labels['filterdel'] = 'Eliminar filtro'; +$labels['moveup'] = 'Mover arriba'; +$labels['movedown'] = 'Mover abaixo'; +$labels['filterallof'] = 'coincidir con tódalas regras siguientes'; +$labels['filteranyof'] = 'coincidir con algunha das regras seguintes'; +$labels['filterany'] = 'tódalas mensaxes'; +$labels['filtercontains'] = 'contén'; +$labels['filternotcontains'] = 'non contén'; +$labels['filteris'] = 'é igual a'; +$labels['filterisnot'] = 'non é igual a'; +$labels['filterexists'] = 'existe'; +$labels['filternotexists'] = 'non existe'; +$labels['filterunder'] = 'baixo'; +$labels['filterover'] = 'sobre'; +$labels['addrule'] = 'Engadir regra'; +$labels['delrule'] = 'Eliminar regra'; +$labels['messagemoveto'] = 'Mover a mensaxe a'; +$labels['messageredirect'] = 'Redirixir a mensaxe a'; +$labels['messagecopyto'] = 'Copiar a mensaxe a'; +$labels['messagesendcopy'] = 'Enviar copia da mensaxe a'; +$labels['messagereply'] = 'Respostar con unha mensaxe'; +$labels['messagedelete'] = 'Eliminar a mensaxe'; +$labels['messagediscard'] = 'Descartar con unha mensaxe'; +$labels['messagesrules'] = 'Para o correo entrante:'; +$labels['messagesactions'] = '... executar as seguintes accións:'; +$labels['add'] = 'Engadir'; +$labels['del'] = 'Eliminar'; +$labels['sender'] = 'Remitente'; +$labels['recipient'] = 'Destinatario'; +$labels['vacationaddresses'] = 'Lista de enderezos de correo de destinatarios adicionais (separados por comas):'; +$labels['vacationdays'] = 'Cada canto enviar mensaxes (en días):'; +$labels['vacationreason'] = 'Corpo da mensaxe (razón de vacacións):'; +$labels['rulestop'] = 'Parar de avaliar regras'; +$labels['filterset'] = 'Conxunto de filtros'; +$labels['filtersetadd'] = 'Engadir un conxunto de filtros'; +$labels['filtersetdel'] = 'Eliminar o conxunto de filtros actual'; +$labels['filtersetact'] = 'Activar o conxunto de filtros actual'; +$labels['filtersetdeact'] = 'Desactivar o conxunto de filtros actual'; +$labels['filtersetget'] = 'Descargar o conxunto de filtros en formato de texto'; +$labels['filterdef'] = 'Definición de filtros'; +$labels['filtersetname'] = 'Nome do conxunto de filtros'; +$labels['newfilterset'] = 'Novo conxunto de filtros'; +$labels['active'] = 'activo'; +$labels['none'] = 'ningún'; +$labels['fromset'] = 'de conxunto '; +$labels['fromfile'] = 'de arquivo'; +$labels['filterdisabled'] = 'Filtro desactivado'; + +$messages = array(); +$messages['filterunknownerror'] = 'Erro descoñecido servidor'; +$messages['filterconnerror'] = 'Imposible conectar co servidor managesieve'; +$messages['filterdeleteerror'] = 'Imposible eliminar filtro. Ocurriu un erro no servidor'; +$messages['filterdeleted'] = 'Filtro borrado con éxito'; +$messages['filtersaved'] = 'Filtro gardado con éxito'; +$messages['filtersaveerror'] = 'Imposible gardar o filtro. Ocurriu un erro no servidor'; +$messages['filterdeleteconfirm'] = 'Realmente desexa eliminar o filtro seleccionado?'; +$messages['ruledeleteconfirm'] = 'Está seguro de que desexa eliminar a regra seleccionada?'; +$messages['actiondeleteconfirm'] = 'Está seguro de que desexa eliminar a acción seleccionada?'; +$messages['forbiddenchars'] = 'Caracteres non permitidos no campo'; +$messages['cannotbeempty'] = 'O campo non pode estar baleiro'; +$messages['setactivateerror'] = 'Imposible activar o conxunto de filtros seleccionado. Ocurriu un erro no servidor'; +$messages['setdeactivateerror'] = 'Imposible desactivar o conxunto de filtros seleccionado. Ocurriu un error no servidor'; +$messages['setdeleteerror'] = 'Imposible eliminar o conxunto de filtros seleccionado. Ocurriu un error no servidor'; +$messages['setactivated'] = 'O conxunto de filtros activouse con éxito'; +$messages['setdeactivated'] = 'O conxunto de filtros desactivouse con éxito'; +$messages['setdeleted'] = 'O Conxunto de filtros borrouse con éxito'; +$messages['setdeleteconfirm'] = 'Está seguro de que desexa eliminar o conxunto de filtros seleccionado?'; +$messages['setcreateerror'] = 'Imposible crear o conxunto de filtros. Ocurriu un error no servidor'; +$messages['setcreated'] = 'Conxunto de filtros creado con éxito'; +$messages['emptyname'] = 'Imposible crear o conxunto de filtros. Sen nome'; +$messages['nametoolong'] = 'Imposible crear o conxunto de filtros. O nome é longo de máis' + +?> diff --git a/plugins/managesieve/localization/hr_HR.inc b/plugins/managesieve/localization/hr_HR.inc new file mode 100644 index 000000000..3b8eb50b4 --- /dev/null +++ b/plugins/managesieve/localization/hr_HR.inc @@ -0,0 +1,105 @@ +<?php + +$labels['filters'] = 'Filteri'; +$labels['managefilters'] = 'Uredi filtere za pristiglu poštu'; +$labels['filtername'] = 'Naziv filtera'; +$labels['newfilter'] = 'Novi filter'; +$labels['filteradd'] = 'Dodaj filter'; +$labels['filterdel'] = 'Obriši filter'; +$labels['moveup'] = 'Pomakni gore'; +$labels['movedown'] = 'Pomakni dolje'; +$labels['filterallof'] = 'koje odgovaraju svim sljedećim pravilima'; +$labels['filteranyof'] = 'koje odgovaraju bilo kojem od sljedećih pravila'; +$labels['filterany'] = 'sve poruke'; +$labels['filtercontains'] = 'sadrži'; +$labels['filternotcontains'] = 'ne sadrži'; +$labels['filteris'] = 'jednako je'; +$labels['filterisnot'] = 'nije jednako'; +$labels['filterexists'] = 'postoji'; +$labels['filternotexists'] = 'ne postoji'; +$labels['filtermatches'] = 'odgovara izrazu'; +$labels['filternotmatches'] = 'ne odgovara izrazu'; +$labels['filterregex'] = 'odgovara regularnom izrazu'; +$labels['filternotregex'] = 'ne odgovara regularnom izrazu'; +$labels['filterunder'] = 'ispod'; +$labels['filterover'] = 'iznad'; +$labels['addrule'] = 'Dodaj pravilo'; +$labels['delrule'] = 'Obriši pravilo'; +$labels['messagemoveto'] = 'Premjesti poruku u'; +$labels['messageredirect'] = 'Preusmjeri poruku na'; +$labels['messagecopyto'] = 'Kopiraju poruku u'; +$labels['messagesendcopy'] = 'Pošalji kopiju poruke na'; +$labels['messagereply'] = 'Odgovori sa porukom'; +$labels['messagedelete'] = 'Obriši poruku'; +$labels['messagediscard'] = 'Otkaži sa porukom'; +$labels['messagesrules'] = 'Za pristigle poruke:'; +$labels['messagesactions'] = '...primijeni sljedeće akcije:'; +$labels['add'] = 'Dodaj'; +$labels['del'] = 'Obriši'; +$labels['sender'] = 'Pošiljatelj'; +$labels['recipient'] = 'Primatelj'; +$labels['vacationaddresses'] = 'Dodatna lista primatelja (odvojenih zarezom):'; +$labels['vacationdays'] = 'Koliko često slati poruku (u danima):'; +$labels['vacationreason'] = 'Tijelo poruke (razlog odmora):'; +$labels['vacationsubject'] = 'Naslov poruke:'; +$labels['rulestop'] = 'Prekini izvođenje filtera'; +$labels['filterset'] = 'Grupa filtera'; +$labels['filtersetadd'] = 'Dodaj grupu filtera'; +$labels['filtersetdel'] = 'Obriši odabranu grupu filtera'; +$labels['filtersetact'] = 'Aktiviraj odabranu grupu filtera'; +$labels['filtersetdeact'] = 'Deaktiviraj odabranu grupu filtera'; +$labels['filtersetget'] = 'Preuzmi grupu filtera u tekstualnom formatu'; +$labels['filterdef'] = 'Definicije filtera'; +$labels['filtersetname'] = 'Naziv grupe filtera'; +$labels['newfilterset'] = 'Nova grupa filtera'; +$labels['active'] = 'aktivan'; +$labels['none'] = 'nijedan'; +$labels['fromset'] = 'iz grupe'; +$labels['fromfile'] = 'iz datoteke'; +$labels['filterdisabled'] = 'Deaktiviraj filter'; +$labels['countisgreaterthan'] = 'brojač je veći od'; +$labels['countisgreaterthanequal'] = 'brojač je veći ili jednak od'; +$labels['countislessthan'] = 'brojač je manji od'; +$labels['countislessthanequal'] = 'brojač je manji ili jednak od'; +$labels['countequals'] = 'brojač je jednak'; +$labels['countnotequals'] = 'brojač nije jednak'; +$labels['valueisgreaterthan'] = 'vrijednost je veća od'; +$labels['valueisgreaterthanequal'] = 'vrijednost je veća ili jednaka od'; +$labels['valueislessthan'] = 'vrijednost je manja od'; +$labels['valueislessthanequal'] = 'vrijednost je manja ili jednaka od'; +$labels['valueequals'] = 'vrijednost je jednaka'; +$labels['valuenotequals'] = 'vrijednost nije jednaka'; +$labels['setflags'] = 'Postavi oznake na poruku'; +$labels['addflags'] = 'Dodaj oznake na poruku'; +$labels['removeflags'] = 'Ukloni oznake sa poruke'; +$labels['flagread'] = 'Pročitana'; +$labels['flagdeleted'] = 'Obrisana'; +$labels['flaganswered'] = 'Odgovorena'; +$labels['flagflagged'] = 'Označena'; +$labels['flagdraft'] = 'Predložak'; + +$messages = array(); +$messages['filterunknownerror'] = 'Nepoznata greška na poslužitelju'; +$messages['filterconnerror'] = 'Nemoguće spajanje na poslužitelj (managesieve)'; +$messages['filterdeleteerror'] = 'Nemoguće brisanje filtera. Greška na poslužitelju'; +$messages['filterdeleted'] = 'Filter je uspješno obrisan'; +$messages['filtersaved'] = 'Filter je uspješno spremljen'; +$messages['filtersaveerror'] = 'Nemoguće spremiti filter. Greška na poslužitelju'; +$messages['filterdeleteconfirm'] = 'Sigurno želite obrisati odabrani filter?'; +$messages['ruledeleteconfirm'] = 'Jeste li sigurni da želite obrisati odabrana pravila?'; +$messages['actiondeleteconfirm'] = 'Jeste li sigurni da želite obrisati odabrane akcije?'; +$messages['forbiddenchars'] = 'Nedozvoljeni znakovi u polju'; +$messages['cannotbeempty'] = 'Polje nesmije biti prazno'; +$messages['setactivateerror'] = 'Nemoguće aktivirati odabranu grupu filtera. Greška na poslužitelju'; +$messages['setdeactivateerror'] = 'Nemoguće deaktivirati odabranu grupu filtera. Greška na poslužitelju'; +$messages['setdeleteerror'] = 'Nemoguće obrisati odabranu grupu filtera. Greška na poslužitelju'; +$messages['setactivated'] = 'Grupa filtera je uspješno aktivirana'; +$messages['setdeactivated'] = 'Grupa filtera je uspješno deaktivirana'; +$messages['setdeleted'] = 'Grupa filtera je uspješno obrisana'; +$messages['setdeleteconfirm'] = 'Jeste li sigurni da želite obrisati odabranu grupu filtera?'; +$messages['setcreateerror'] = 'Nemoguće stvoriti grupu filtera. Greška na poslužitelju'; +$messages['setcreated'] = 'Grupa filtera je uspješno stvorena'; +$messages['emptyname'] = 'Nemoguće napraviti grupu filtera. Naziv je prazan'; +$messages['nametoolong'] = 'Nemoguće napraviti grupu filtera. Naziv je predugačak' + +?> diff --git a/plugins/managesieve/localization/hu_HU.inc b/plugins/managesieve/localization/hu_HU.inc new file mode 100644 index 000000000..47a84f1a6 --- /dev/null +++ b/plugins/managesieve/localization/hu_HU.inc @@ -0,0 +1,54 @@ +<?php + +$labels = array(); +$labels['filters'] = 'Üzenetszűrők'; +$labels['managefilters'] = 'Bejövő üzenetek szűrői'; +$labels['filtername'] = 'Szűrő neve'; +$labels['newfilter'] = 'Új szűrő'; +$labels['filteradd'] = 'Szűrő hozzáadása'; +$labels['filterdel'] = 'Szűrő törlése'; +$labels['moveup'] = 'Mozgatás felfelé'; +$labels['movedown'] = 'Mozgatás lefelé'; +$labels['filterallof'] = 'A következők mind illeszkedjenek'; +$labels['filteranyof'] = 'A következők bármelyike illeszkedjen'; +$labels['filterany'] = 'Minden üzenet illeszkedjen'; +$labels['filtercontains'] = 'tartalmazza'; +$labels['filternotcontains'] = 'nem tartalmazza'; +$labels['filteris'] = 'megegyezik'; +$labels['filterisnot'] = 'nem egyezik meg'; +$labels['filterexists'] = 'létezik'; +$labels['filternotexists'] = 'nem létezik'; +$labels['filterunder'] = 'alatta'; +$labels['filterover'] = 'felette'; +$labels['addrule'] = 'Szabály hozzáadása'; +$labels['delrule'] = 'Szabály törlése'; +$labels['messagemoveto'] = 'Üzenet áthelyezése ide:'; +$labels['messageredirect'] = 'Üzenet továbbítása ide:'; +$labels['messagereply'] = 'Válaszüzenet küldése (autoreply)'; +$labels['messagedelete'] = 'Üzenet törlése'; +$labels['messagediscard'] = 'Válaszüzenet küldése, a levél törlése'; +$labels['messagesrules'] = 'Az adott tulajdonságú beérkezett üzenetekre:'; +$labels['messagesactions'] = '... a következő műveletek végrehajtása:'; +$labels['add'] = 'Hozzáadás'; +$labels['del'] = 'Törlés'; +$labels['sender'] = 'Feladó'; +$labels['recipient'] = 'Címzett'; +$labels['vacationaddresses'] = 'További címzettek (vesszővel elválasztva):'; +$labels['vacationdays'] = 'Válaszüzenet küldése ennyi naponként:'; +$labels['vacationreason'] = 'Levél szövege (automatikus válasz):'; +$labels['rulestop'] = 'Műveletek végrehajtásának befejezése'; + +$messages = array(); +$messages['filterunknownerror'] = 'Ismeretlen szerverhiba'; +$messages['filterconnerror'] = 'Nem tudok a szűrőszerverhez kapcsolódni'; +$messages['filterdeleteerror'] = 'A szűrőt nem lehet törölni, szerverhiba történt'; +$messages['filterdeleted'] = 'A szűrő törlése sikeres'; +$messages['filterdeleteconfirm'] = 'Biztosan törli ezt a szűrőt?'; +$messages['filtersaved'] = 'A szűrő mentése sikeres'; +$messages['filtersaveerror'] = 'A szűrő mentése sikertelen, szerverhiba történt'; +$messages['ruledeleteconfirm'] = 'Biztosan törli ezt a szabályt?'; +$messages['actiondeleteconfirm'] = 'Biztosan törli ezt a műveletet?'; +$messages['forbiddenchars'] = 'Érvénytelen karakter a mezőben'; +$messages['cannotbeempty'] = 'A mező nem lehet üres'; + +?> diff --git a/plugins/managesieve/localization/it_IT.inc b/plugins/managesieve/localization/it_IT.inc new file mode 100644 index 000000000..2debf3033 --- /dev/null +++ b/plugins/managesieve/localization/it_IT.inc @@ -0,0 +1,79 @@ +<?php + +$labels = array(); +$labels['filters'] = 'Filtri'; +$labels['managefilters'] = 'Gestione dei filtri per la posta in arrivo'; +$labels['filtername'] = 'Nome del filtro'; +$labels['newfilter'] = 'Nuovo filtro'; +$labels['filteradd'] = 'Aggiungi filtro'; +$labels['filterdel'] = 'Elimina filtro'; +$labels['moveup'] = 'Sposta sopra'; +$labels['movedown'] = 'Sposta sotto'; +$labels['filterallof'] = 'che soddisfa tutte le regole seguenti'; +$labels['filteranyof'] = 'che soddisfa una qualsiasi delle regole seguenti'; +$labels['filterany'] = 'tutti i messaggi'; +$labels['filtercontains'] = 'contiene'; +$labels['filternotcontains'] = 'non contiene'; +$labels['filteris'] = 'è uguale a'; +$labels['filterisnot'] = 'è diverso da'; +$labels['filterexists'] = 'esiste'; +$labels['filternotexists'] = 'non esiste'; +$labels['filterunder'] = 'sotto'; +$labels['filterover'] = 'sopra'; +$labels['addrule'] = 'Aggiungi regola'; +$labels['delrule'] = 'Elimina regola'; +$labels['messagemoveto'] = 'Sposta il messaggio in'; +$labels['messageredirect'] = 'Inoltra il messaggio a'; +$labels['messagereply'] = 'Rispondi con il messaggio'; +$labels['messagedelete'] = 'Elimina il messaggio'; +$labels['messagediscard'] = 'Rifiuta con messaggio'; +$labels['messagesrules'] = 'Per la posta in arrivo'; +$labels['messagesactions'] = '...esegui le seguenti azioni:'; +$labels['add'] = 'Aggiungi'; +$labels['del'] = 'Elimina'; +$labels['sender'] = 'Mittente'; +$labels['recipient'] = 'Destinatario'; +$labels['vacationaddresses'] = 'Lista di indirizzi e-mail di destinatari addizionali (separati da virgola):'; +$labels['vacationdays'] = 'Ogni quanti giorni ribadire il messaggio allo stesso mittente'; +$labels['vacationreason'] = 'Corpo del messaggio (dettagli relativi all\'assenza):'; +$labels['rulestop'] = 'Non valutare le regole successive'; +$labels['filterset'] = 'Gruppi di filtri'; +$labels['filtersetadd'] = 'Aggiungi gruppo'; +$labels['filtersetdel'] = 'Cancella gruppo selezionato'; +$labels['filtersetact'] = 'Attiva gruppo selezionato'; +$labels['filtersetdeact'] = 'Disattiva gruppo selezionato'; +$labels['filtersetget'] = 'Scarica filtri come testo'; +$labels['filterdef'] = 'Definizione del filtro'; +$labels['filtersetname'] = 'Nome del Gruppo di filtri'; +$labels['newfilterset'] = 'Nuovo gruppo di filri'; +$labels['active'] = 'attivo'; +$labels['none'] = 'nessuno'; +$labels['fromset'] = 'dal set'; +$labels['fromfile'] = 'dal file'; +$labels['filterdisabled'] = 'Filtro disabilitato'; + +$messages = array(); +$messages['filterunknownerror'] = 'Errore sconosciuto del server'; +$messages['filterconnerror'] = 'Collegamento al server managesieve fallito'; +$messages['filterdeleteerror'] = 'Eliminazione del filtro fallita. Si è verificato un errore nel server'; +$messages['filterdeleted'] = 'Filtro eliminato con successo'; +$messages['filterdeleteconfirm'] = 'Vuoi veramente eliminare il filtro selezionato?'; +$messages['filtersaved'] = 'Filtro salvato con successo'; +$messages['filtersaveerror'] = 'Salvataggio del filtro fallito. Si è verificato un errore nel server'; +$messages['ruledeleteconfirm'] = 'Sei sicuro di voler eliminare la regola selezionata?'; +$messages['actiondeleteconfirm'] = 'Sei sicuro di voler eliminare l\'azione selezionata?'; +$messages['forbiddenchars'] = 'Caratteri non consentiti nel campo'; +$messages['cannotbeempty'] = 'Il campo non può essere vuoto'; +$messages['setactivateerror'] = 'Impossibile attivare il filtro. Errore del server'; +$messages['setdeactivateerror'] = 'Impossibile disattivare il filtro. Errore del server'; +$messages['setdeleteerror'] = 'Impossibile cancellare il filtro. Errore del server'; +$messages['setactivated'] = 'Filtro attivato'; +$messages['setdeactivated'] = 'Filtro disattivato'; +$messages['setdeleted'] = 'Filtro cancellato'; +$messages['setdeleteconfirm'] = 'Sei sicuro di voler cancellare il gruppo di filtri'; +$messages['setcreateerror'] = 'Impossibile creare il gruppo. Errore del server'; +$messages['setcreated'] = 'Gruppo di filtri creato'; +$messages['emptyname'] = 'Impossibile creare il gruppo: Inserire un nome'; +$messages['nametoolong'] = 'Impossibile creare il gruppo: Nome troppo lungo'; + +?> diff --git a/plugins/managesieve/localization/ja_JP.inc b/plugins/managesieve/localization/ja_JP.inc new file mode 100644 index 000000000..a489054ad --- /dev/null +++ b/plugins/managesieve/localization/ja_JP.inc @@ -0,0 +1,82 @@ +<?php + +// EN-Revision: 3891 + +$labels['filters'] = 'フィルター'; +$labels['managefilters'] = '受信メールのフィルターの管理'; +$labels['filtername'] = 'フィルターの名前'; +$labels['newfilter'] = '新規フィルター'; +$labels['filteradd'] = 'フィルターの追加'; +$labels['filterdel'] = 'フィルターの削除'; +$labels['moveup'] = '上に移動'; +$labels['movedown'] = '下に移動'; +$labels['filterallof'] = '次のルールすべてに一致'; +$labels['filteranyof'] = '次のルールのどれかに一致'; +$labels['filterany'] = '全メッセージ'; +$labels['filtercontains'] = '含む'; +$labels['filternotcontains'] = '含まない'; +$labels['filteris'] = '次と一致する'; +$labels['filterisnot'] = '次と一致しない'; +$labels['filterexists'] = '存在する'; +$labels['filternotexists'] = '存在しない'; +$labels['filterunder'] = 'より上'; +$labels['filterover'] = 'より下'; +$labels['addrule'] = 'ルールの追加'; +$labels['delrule'] = 'ルールの削除'; +$labels['messagemoveto'] = '次にメッセージを移動する'; +$labels['messageredirect'] = '次のメールアドレスに転送 (リダイレクト)'; +$labels['messagecopyto'] = '次にメッセージをコピーする'; +$labels['messagesendcopy'] = '次にメッセージのコピーを送信する'; +$labels['messagereply'] = 'メッセージに返信する'; +$labels['messagedelete'] = 'メッセージを削除する'; +$labels['messagediscard'] = 'メッセージを破棄する'; +$labels['messagesrules'] = '受信メールへの処理:'; +$labels['messagesactions'] = '…次の操作の実行:'; +$labels['add'] = '追加'; +$labels['del'] = '削除'; +$labels['sender'] = '送信者'; +$labels['recipient'] = '受信者'; +$labels['vacationaddresses'] = '電子メール受信者の一覧を追加する (カンマ区切り):'; +$labels['vacationdays'] = 'どれ位頻繁にメッセージの送信をするか (1 日あたり):'; +$labels['vacationreason'] = 'メッセージ本文 (vacation reason):'; +$labels['rulestop'] = 'ルール評価の停止'; +$labels['filterset'] = 'フィルター セット'; +$labels['filtersetadd'] = 'フィルター セットの追加'; +$labels['filtersetdel'] = '現在のルールセット の削除'; +$labels['filtersetact'] = '現在のフィルター セットを有効にする'; +$labels['filtersetdeact'] = '現在のフィルター セットを無効にする'; +$labels['filtersetget'] = 'テキスト形式でフィルター セットをダウンロードする'; +$labels['filterdef'] = 'フィルターの定義'; +$labels['filtersetname'] = 'フィルター セットの名前'; +$labels['newfilterset'] = '新規フィルター セット'; +$labels['active'] = '有効'; +$labels['none'] = 'なし'; +$labels['fromset'] = 'セットから'; +$labels['fromfile'] = 'ファイルから'; +$labels['filterdisabled'] = 'フィルターを無効にしました。'; + +$messages = array(); +$messages['filterunknownerror'] = '不明なサーバーのエラーです'; +$messages['filterconnerror'] = 'managesieve サーバーに接続できません。'; +$messages['filterdeleteerror'] = 'フィルターを削除できませんでした。サーバーでエラーが発生しました。'; +$messages['filterdeleted'] = 'フィルターの削除に成功しました。'; +$messages['filtersaved'] = 'フィルターの保存に成功しました。'; +$messages['filtersaveerror'] = 'フィルターの保存に失敗しました。サーバーでエラーが発生しました。'; +$messages['filterdeleteconfirm'] = '本当に選択したフィルターを削除しますか?'; +$messages['ruledeleteconfirm'] = '本当に選択したルールを削除しますか?'; +$messages['actiondeleteconfirm'] = '本当に選択した操作を削除しますか?'; +$messages['forbiddenchars'] = '項目に禁止文字があります。'; +$messages['cannotbeempty'] = '空にできませんでした'; +$messages['setactivateerror'] = '選択したフィルター セットの有効化に失敗しました。サーバーでエラーが発生しました。'; +$messages['setdeactivateerror'] = '選択したフィルター セットの無効化に失敗しました。サーバーでエラーが発生しました。'; +$messages['setdeleteerror'] = '選択したフィルター セットの削除に失敗しました。サーバーでエラーが発生しました。'; +$messages['setactivated'] = 'フィルターセットの有効化に成功しました。'; +$messages['setdeactivated'] = 'フィルターセットの無効化に成功しました。'; +$messages['setdeleted'] = 'フィルターセットの削除に成功しました。'; +$messages['setdeleteconfirm'] = '本当に選択したフィルター セットを削除しますか?'; +$messages['setcreateerror'] = 'フィルター セットの作成に失敗しました。サーバーでエラーが発生しました。'; +$messages['setcreated'] = 'フィルター セットの作成に成功しました。'; +$messages['emptyname'] = 'フィルター セットの作成に失敗しました。名前が空です。'; +$messages['nametoolong'] = 'フィルター セットの作成に失敗しました。名前が長すぎます。'; + +?> diff --git a/plugins/managesieve/localization/lv_LV.inc b/plugins/managesieve/localization/lv_LV.inc new file mode 100644 index 000000000..b394588e9 --- /dev/null +++ b/plugins/managesieve/localization/lv_LV.inc @@ -0,0 +1,92 @@ +<?php + +$labels['filters'] = 'Vēstuļu filtri'; +$labels['managefilters'] = 'Rediģēt ienākošo vēstuļu filtrus'; +$labels['filtername'] = 'Filtra nosaukums'; +$labels['newfilter'] = 'Jauns filtrs'; +$labels['filteradd'] = 'Pievienot filtru'; +$labels['filterdel'] = 'Izdzēst filtru'; +$labels['moveup'] = 'Pārvietot augšup'; +$labels['movedown'] = 'Pārvietot lejup'; +$labels['filterallof'] = 'jāatbilst visiem no sekojošiem nosacījumiem'; +$labels['filteranyof'] = 'jāatbilst jebkuram no sekojošiem nosacījumiem'; +$labels['filterany'] = 'visām vēstulēm'; +$labels['filtercontains'] = 'satur'; +$labels['filternotcontains'] = 'nesatur'; +$labels['filteris'] = 'ir vienāds ar'; +$labels['filterisnot'] = 'nav vienāds ar'; +$labels['filterexists'] = 'eksistē'; +$labels['filternotexists'] = 'neeksistē'; +$labels['filterunder'] = 'zem'; +$labels['filterover'] = 'virs'; +$labels['addrule'] = 'Pievienot nosacījumu'; +$labels['delrule'] = 'Izdzēst nosacījumu'; +$labels['messagemoveto'] = 'Pārvietot vēstuli uz'; +$labels['messageredirect'] = 'Pāradresēt vēstuli uz'; +$labels['messagecopyto'] = 'Pārkopēt vēstuli uz'; +$labels['messagesendcopy'] = 'Pārsūtīt vēstules kopiju uz'; +$labels['messagereply'] = 'Automātiski atbildēt'; +$labels['messagedelete'] = 'Izdzēst vēstuli'; +$labels['messagediscard'] = 'Izdzēst vēstuli un atbildēt'; +$labels['messagesrules'] = 'Ienākošajām vēstulēm:'; +$labels['messagesactions'] = 'Izpildīt sekojošās darbības:'; +$labels['add'] = 'Pievienot'; +$labels['del'] = 'Dzēst'; +$labels['sender'] = 'Sūtītājs'; +$labels['recipient'] = 'Saņēmējs'; +$labels['vacationaddresses'] = 'Ievadiet savu(s) e-pastu(s) caur komatu:'; +$labels['vacationdays'] = 'Cik dienu laikā vienam un tam pašam sūtītājam neatbildēt atkārtoti (piem., 7):'; +$labels['vacationreason'] = 'Atvaļinājuma vēstules teksts:'; +$labels['rulestop'] = 'Apturēt nosacījumu pārbaudi'; +$labels['filterset'] = 'Filtru kopa'; +$labels['filtersetadd'] = 'Pievienot filtru kopu'; +$labels['filtersetdel'] = 'Izdzēst pašreizējo filtru kopu'; +$labels['filtersetact'] = 'Aktivizēt pašreizējo filtru kopu'; +$labels['filtersetdeact'] = 'Deaktivizēt pašreizējo filtru kopu'; +$labels['filtersetget'] = 'Lejupielādēt filtru kopu teksta formātā'; +$labels['filterdef'] = 'Filtra apraksts'; +$labels['filtersetname'] = 'Filtru kopas nosaukums'; +$labels['newfilterset'] = 'Jauna filtru kopa'; +$labels['active'] = 'aktīvs'; +$labels['none'] = 'nav'; +$labels['fromset'] = 'no kopas'; +$labels['fromfile'] = 'no faila'; +$labels['filterdisabled'] = 'Filtrs atslēgts'; +$labels['countisgreaterthan'] = 'skaits ir lielāks nekā'; +$labels['countisgreaterthanequal'] = 'skaits ir vienāds vai lielāks nekā'; +$labels['countislessthan'] = 'skaits ir mazāks nekā'; +$labels['countislessthanequal'] = 'skaits ir vienāds vai mazāks nekā'; +$labels['countequals'] = 'skaits ir vienāds ar'; +$labels['countnotequals'] = 'skaits nav vienāds ar'; +$labels['valueisgreaterthan'] = 'vērtība ir lielāka nekā'; +$labels['valueisgreaterthanequal'] = 'vērtība ir vienāda vai lielāka nekā'; +$labels['valueislessthan'] = 'vērtība ir mazāka nekā'; +$labels['valueislessthanequal'] = 'vērtība ir vienāda vai mazāka nekā'; +$labels['valueequals'] = 'vērtība ir vienāda ar'; +$labels['valuenotequals'] = 'vērtība nav vienāda ar'; + +$messages = array(); +$messages['filterunknownerror'] = 'Nezināma servera kļūda'; +$messages['filterconnerror'] = 'Neizdevās pieslēgties ManageSieve serverim'; +$messages['filterdeleteerror'] = 'Neizdevās dzēst filtru. Servera iekšējā kļūda'; +$messages['filterdeleted'] = 'Filtrs veiksmīgi izdzēsts'; +$messages['filtersaved'] = 'Filtrs veiksmīgi saglabāts'; +$messages['filtersaveerror'] = 'Neizdevās saglabāt filtru. Servera iekšējā kļūda'; +$messages['filterdeleteconfirm'] = 'Vai tiešām vēlaties dzēst atzīmēto filtru?'; +$messages['ruledeleteconfirm'] = 'Vai tiešām vēlaties dzēst atzīmēto nosacījumu?'; +$messages['actiondeleteconfirm'] = 'Vai tiešām vēlaties dzēst atzīmēto darbību?'; +$messages['forbiddenchars'] = 'Lauks satur aizliegtus simbolus'; +$messages['cannotbeempty'] = 'Lauks nedrīkst būt tukšs'; +$messages['setactivateerror'] = 'Neizdevās aktivizēt atzīmēto filtru kopu. Servera iekšējā kļūda'; +$messages['setdeactivateerror'] = 'Neizdevās deaktivizēt atzīmēto filtru kopu. Servera iekšējā kļūda'; +$messages['setdeleteerror'] = 'Neizdevās izdzēst atzīmēto filtru kopu. Servera iekšējā kļūda'; +$messages['setactivated'] = 'Filtru kopa veiksmīgi aktivizēta'; +$messages['setdeactivated'] = 'Filtru kopa veiksmīgi deaktivizēta'; +$messages['setdeleted'] = 'Filtru kopa veiksmīgi izdzēsta'; +$messages['setdeleteconfirm'] = 'Vai tiešām vēlaties dzēst atzīmēto filtru kopu?'; +$messages['setcreateerror'] = 'Neizdevās izveidot filtru kopu. Servera iekšējā kļūda'; +$messages['setcreated'] = 'Filtru kopa veiksmīgi izveidota'; +$messages['emptyname'] = 'Neizdevās izveidot filtru kopu. Nav ievadīts kopas nosaukums'; +$messages['nametoolong'] = 'Neizdevās izveidot filtru kopu. Pārāk garš kopas nosaukums' + +?> diff --git a/plugins/managesieve/localization/nb_NO.inc b/plugins/managesieve/localization/nb_NO.inc new file mode 100644 index 000000000..a0ed1f3d7 --- /dev/null +++ b/plugins/managesieve/localization/nb_NO.inc @@ -0,0 +1,54 @@ +<?php + +$labels = array(); +$labels['filters'] = 'Filtre'; +$labels['managefilters'] = 'Rediger filter for innkommende e-post'; +$labels['filtername'] = 'Filternavn'; +$labels['newfilter'] = 'Nytt filter'; +$labels['filteradd'] = 'Legg til filter'; +$labels['filterdel'] = 'Slett filter'; +$labels['moveup'] = 'Flytt opp'; +$labels['movedown'] = 'Flytt ned'; +$labels['filterallof'] = 'som treffer alle følgende regler'; +$labels['filteranyof'] = 'som treffer en av følgende regler'; +$labels['filterany'] = 'og alle meldinger'; +$labels['filtercontains'] = 'inneholder'; +$labels['filternotcontains'] = 'ikke innehold'; +$labels['filteris'] = 'er'; +$labels['filterisnot'] = 'ikke er'; +$labels['filterexists'] = 'eksisterer'; +$labels['filternotexists'] = 'ikke eksisterer'; +$labels['filterunder'] = 'under'; +$labels['filterover'] = 'over'; +$labels['addrule'] = 'Legg til regel'; +$labels['delrule'] = 'Slett regel'; +$labels['messagemoveto'] = 'Flytt meldingen til'; +$labels['messageredirect'] = 'Videresend meldingen til'; +$labels['messagereply'] = 'Svar med melding'; +$labels['messagedelete'] = 'Slett melding'; +$labels['messagediscard'] = 'Avvis med melding'; +$labels['messagesrules'] = 'For innkommende e-post'; +$labels['messagesactions'] = '...gjør følgende'; +$labels['add'] = 'Legg til'; +$labels['del'] = 'Slett'; +$labels['sender'] = 'Avsender'; +$labels['recipient'] = 'Mottaker'; +$labels['vacationaddresses'] = 'Liste med mottakeradresser (adskilt med komma):'; +$labels['vacationdays'] = 'Periode mellom meldinger (i dager):'; +$labels['vacationreason'] = 'Innhold (begrunnelse for fravær)'; +$labels['rulestop'] = 'Stopp evaluering av regler'; + +$messages = array(); +$messages['filterunknownerror'] = 'Ukjent problem med tjener'; +$messages['filterconnerror'] = 'Kunne ikke koble til MANAGESIEVE-tjener'; +$messages['filterdeleteerror'] = 'Kunne ikke slette filter. Det dukket opp en feil på tjeneren.'; +$messages['filterdeleted'] = 'Filteret er blitt slettet'; +$messages['filterconfirmdelete'] = 'Er du sikker på at du vil slette følgende filter?'; +$messages['filtersaved'] = 'Filter er blitt lagret'; +$messages['filtersaveerror'] = 'Kunne ikke lagre filteret. Det dukket opp en feil på tjeneren.'; +$messages['ruledeleteconfirm'] = 'Er du sikker på at du vil slette valgte regel?'; +$messages['actiondeleteconfirm'] = 'Er du sikker på at du vil slette valgte hendelse?'; +$messages['forbiddenchars'] = 'Ugyldige tegn i felt'; +$messages['cannotbeempty'] = 'Feltet kan ikke stå tomt'; + +?> diff --git a/plugins/managesieve/localization/nl_NL.inc b/plugins/managesieve/localization/nl_NL.inc new file mode 100644 index 000000000..8ee317216 --- /dev/null +++ b/plugins/managesieve/localization/nl_NL.inc @@ -0,0 +1,49 @@ +<?php + +$labels['filters'] = 'Filters'; +$labels['managefilters'] = 'Beheer inkomende mail filters'; +$labels['filtername'] = 'Filternaam'; +$labels['newfilter'] = 'Nieuw filter'; +$labels['filteradd'] = 'Filter toevoegen'; +$labels['filterdel'] = 'Filter verwijderen'; +$labels['moveup'] = 'Omhoog'; +$labels['movedown'] = 'Omlaag'; +$labels['filterallof'] = 'die voldoen aan alle volgende regels'; +$labels['filteranyof'] = 'die voldoen aan een van de volgende regels'; +$labels['filterany'] = 'alle berichten'; +$labels['filtercontains'] = 'bevat'; +$labels['filternotcontains'] = 'bevat niet'; +$labels['filteris'] = 'is gelijk aan'; +$labels['filterisnot'] = 'is niet gelijk aan'; +$labels['filterexists'] = 'bestaat'; +$labels['filternotexists'] = 'bestaat niet'; +$labels['filterunder'] = 'onder'; +$labels['filterover'] = 'over'; +$labels['addrule'] = 'Regel toevoegen'; +$labels['delrule'] = 'Regel verwijderen'; +$labels['messagemoveto'] = 'Verplaats bericht naar'; +$labels['messageredirect'] = 'Redirect bericht naar'; +$labels['messagereply'] = 'Beantwoord met bericht'; +$labels['messagedelete'] = 'Verwijder bericht'; +$labels['messagediscard'] = 'Wijs af met bericht'; +$labels['messagesrules'] = 'Voor binnenkomende e-mail'; +$labels['messagesactions'] = '...voer de volgende acties uit'; +$labels['add'] = 'Toevoegen'; +$labels['del'] = 'Verwijderen'; +$labels['sender'] = 'Afzender'; +$labels['recipient'] = 'Ontvanger'; + +$messages = array(); +$messages['filterunknownerror'] = 'Onbekende fout'; +$messages['filterconnerror'] = 'Kan geen verbinding maken met de managesieve server'; +$messages['filterdeleteerror'] = 'Kan filter niet verwijderen. Er is een fout opgetreden'; +$messages['filterdeleted'] = 'Filter succesvol verwijderd'; +$messages['filterdeleteconfirm'] = 'Weet je zeker dat je het geselecteerde filter wilt verwijderen?'; +$messages['filtersaved'] = 'Filter succesvol opgeslagen'; +$messages['filtersaveerror'] = 'Kan filter niet opslaan. Er is een fout opgetreden.'; +$messages['ruledeleteconfirm'] = 'Weet je zeker dat je de geselecteerde regel wilt verwijderen?'; +$messages['actiondeleteconfirm'] = 'Weet je zeker dat je de geselecteerde actie wilt verwijderen?'; +$messages['forbiddenchars'] = 'Verboden karakters in het veld'; +$messages['cannotbeempty'] = 'Veld mag niet leeg zijn'; + +?> diff --git a/plugins/managesieve/localization/pl_PL.inc b/plugins/managesieve/localization/pl_PL.inc new file mode 100644 index 000000000..eaa09e198 --- /dev/null +++ b/plugins/managesieve/localization/pl_PL.inc @@ -0,0 +1,118 @@ +<?php + +$labels = array(); +$labels['filters'] = 'Filtry'; +$labels['managefilters'] = 'Zarządzaj filtrami wiadomości przychodzących'; +$labels['filtername'] = 'Nazwa filtru'; +$labels['newfilter'] = 'Nowy filtr'; +$labels['filteradd'] = 'Dodaj filtr'; +$labels['filterdel'] = 'Usuń filtr'; +$labels['enable'] = 'Włącz/Wyłącz'; +$labels['filtersets'] = 'Zbiory fitrów'; +$labels['filterallof'] = 'spełniających wszystkie poniższe kryteria'; +$labels['filteranyof'] = 'spełniających dowolne z poniższych kryteriów'; +$labels['filterany'] = 'wszystkich'; +$labels['filtercontains'] = 'zawiera'; +$labels['filternotcontains'] = 'nie zawiera'; +$labels['filteris'] = 'jest równe'; +$labels['filterisnot'] = 'nie jest równe'; +$labels['filterexists'] = 'istnieje'; +$labels['filternotexists'] = 'nie istnieje'; +$labels['filtermatches'] = 'pasuje do wyrażenia'; +$labels['filternotmatches'] = 'nie pasuje do wyrażenia'; +$labels['filterregex'] = 'pasuje do wyrażenia regularnego'; +$labels['filternotregex'] = 'nie pasuje do wyrażenia regularnego'; +$labels['filterunder'] = 'poniżej'; +$labels['filterover'] = 'ponad'; +$labels['addrule'] = 'Dodaj regułę'; +$labels['delrule'] = 'Usuń regułę'; +$labels['messagemoveto'] = 'Przenieś wiadomość do'; +$labels['messageredirect'] = 'Przekaż wiadomość na konto'; +$labels['messagereply'] = 'Odpowiedz wiadomością o treści'; +$labels['messagecopyto'] = 'Skopiuj wiadomość do'; +$labels['messagesendcopy'] = 'Wyślij kopię do'; +$labels['messagedelete'] = 'Usuń wiadomość'; +$labels['messagediscard'] = 'Odrzuć z komunikatem'; +$labels['messagesrules'] = 'W stosunku do przychodzących wiadomości:'; +$labels['messagesactions'] = '...wykonaj następujące czynności:'; +$labels['add'] = 'Dodaj'; +$labels['del'] = 'Usuń'; +$labels['sender'] = 'Nadawca'; +$labels['recipient'] = 'Odbiorca'; +$labels['rulestop'] = 'Przerwij przetwarzanie reguł'; +$labels['vacationdays'] = 'Częstotliwość wysyłania wiadomości (w dniach):'; +$labels['vacationaddresses'] = 'Lista dodatkowych adresów odbiorców (oddzielonych przecinkami):'; +$labels['vacationreason'] = 'Treść (przyczyna nieobecności):'; +$labels['vacationsubject'] = 'Temat wiadomości:'; +$labels['filterset'] = 'Zbiór filtrów'; +$labels['filtersetadd'] = 'Dodaj zbiór filtrów'; +$labels['filtersetdel'] = 'Usuń bieżący zbiór filtrów'; +$labels['filtersetact'] = 'Aktywuj bieżący zbiór filtrów'; +$labels['filtersetdeact'] = 'Deaktywuj bieżący zbiór filtrów'; +$labels['filterdef'] = 'Definicja filtra'; +$labels['filtersetname'] = 'Nazwa zbioru'; +$labels['newfilterset'] = 'Nowy zbiór filtrów'; +$labels['active'] = 'aktywny'; +$labels['none'] = 'brak'; +$labels['fromset'] = 'ze zbioru'; +$labels['fromfile'] = 'z pliku'; +$labels['filterdisabled'] = 'Filtr wyłączony'; +$labels['countisgreaterthan'] = 'ilość jest większa od'; +$labels['countisgreaterthanequal'] = 'ilość jest równa lub większa od'; +$labels['countislessthan'] = 'ilość jest mniejsza od'; +$labels['countislessthanequal'] = 'ilość jest równa lub mniejsza od'; +$labels['countequals'] = 'ilość jest równa'; +$labels['countnotequals'] = 'ilość jest różna od'; +$labels['valueisgreaterthan'] = 'wartość jest większa od'; +$labels['valueisgreaterthanequal'] = 'wartość jest równa lub większa od'; +$labels['valueislessthan'] = 'wartość jest mniejsza od'; +$labels['valueislessthanequal'] = 'wartość jest równa lub mniejsza od'; +$labels['valueequals'] = 'wartość jest równa'; +$labels['valuenotequals'] = 'wartość jest różna od'; +$labels['setflags'] = 'Ustaw flagi wiadomości'; +$labels['addflags'] = 'Dodaj flagi do wiadomości'; +$labels['removeflags'] = 'Usuń flagi wiadomości'; +$labels['flagread'] = 'Przeczytana'; +$labels['flagdeleted'] = 'Usunięta'; +$labels['flaganswered'] = 'Z odpowiedzią'; +$labels['flagflagged'] = 'Oflagowana'; +$labels['flagdraft'] = 'Szkic'; +$labels['filtercreate'] = 'Utwóż filtr'; +$labels['usedata'] = 'Użyj następujących danych do utworzenia filtra:'; +$labels['nextstep'] = 'Następny krok'; +$labels['...'] = '...'; + +$messages = array(); +$messages['filterunknownerror'] = 'Nieznany błąd serwera.'; +$messages['filterconnerror'] = 'Nie można nawiązać połączenia z serwerem.'; +$messages['filterdeleteerror'] = 'Nie można usunąć filtra. Błąd serwera.'; +$messages['filterdeleted'] = 'Filtr został usunięty pomyślnie.'; +$messages['filterdeleteconfirm'] = 'Czy na pewno chcesz usunąć wybrany filtr?'; +$messages['filtersaved'] = 'Filtr został zapisany pomyślnie.'; +$messages['filtersaveerror'] = 'Nie można zapisać filtra. Wystąpił błąd serwera.'; +$messages['ruledeleteconfirm'] = 'Czy na pewno chcesz usunąć wybraną regułę?'; +$messages['actiondeleteconfirm'] = 'Czy na pewno usunąć wybraną akcję?'; +$messages['forbiddenchars'] = 'Pole zawiera niedozwolone znaki.'; +$messages['cannotbeempty'] = 'Pole nie może być puste.'; +$messages['setactivateerror'] = 'Nie można aktywować wybranego zbioru filtrów. Błąd serwera.'; +$messages['setdeactivateerror'] = 'Nie można deaktywować wybranego zbioru filtrów. Błąd serwera.'; +$messages['setdeleteerror'] = 'Nie można usunąć wybranego zbioru filtrów. Błąd serwera.'; +$messages['setactivated'] = 'Zbiór filtrów został aktywowany pomyślnie.'; +$messages['setdeactivated'] = 'Zbiór filtrów został deaktywowany pomyślnie.'; +$messages['setdeleted'] = 'Zbiór filtrów został usunięty pomyślnie.'; +$messages['setdeleteconfirm'] = 'Czy na pewno chcesz usunąć wybrany zbiór filtrów?'; +$messages['setcreateerror'] = 'Nie można utworzyć zbioru filtrów. Błąd serwera.'; +$messages['setcreated'] = 'Zbiór filtrów został utworzony pomyślnie.'; +$messages['nodata'] = 'Należy wybrać co najmniej jedną pozycję!'; +$messages['ruleexist'] = 'Filtr o podanej nazwie już istnieje.'; +$messages['activateerror'] = 'Nie można włączyć wybranych filtrów. Błąd serwera.'; +$messages['deactivateerror'] = 'Nie można wyłączyć wybranych filtrów. Błąd serwera.'; +$messages['activated'] = 'Filtr(y) wyłączono pomyślnie.'; +$messages['deactivated'] = 'Filtr(y) włączono pomyślnie.'; +$messages['moved'] = 'Filter został przeniesiony pomyślnie.'; +$messages['moveerror'] = 'Nie można przenieść wybranego filtra. Błąd serwera.'; +$messages['nametoolong'] = 'Zbyt długa nazwa.'; +$messages['namereserved'] = 'Nazwa zarezerwowana.'; +$messages['setexist'] = 'Zbiór już istnieje.'; + +?> diff --git a/plugins/managesieve/localization/pt_BR.inc b/plugins/managesieve/localization/pt_BR.inc new file mode 100644 index 000000000..b48774e97 --- /dev/null +++ b/plugins/managesieve/localization/pt_BR.inc @@ -0,0 +1,53 @@ +<?php + +$labels['filters'] = 'Filtros'; +$labels['managefilters'] = 'Gerenciar filtros de entrada de e-mail'; +$labels['filtername'] = 'Nome do filtro'; +$labels['newfilter'] = 'Novo filtro'; +$labels['filteradd'] = 'Adicionar filtro'; +$labels['filterdel'] = 'Excluir filtro'; +$labels['moveup'] = 'Mover para cima'; +$labels['movedown'] = 'Mover para baixo'; +$labels['filterallof'] = 'casando todas as seguintes regras'; +$labels['filteranyof'] = 'casando qualquer das seguintes regras'; +$labels['filterany'] = 'todas as mensagens'; +$labels['filtercontains'] = 'contem'; +$labels['filternotcontains'] = 'não contem'; +$labels['filteris'] = 'é igual a'; +$labels['filterisnot'] = 'não é igual a'; +$labels['filterexists'] = 'existe'; +$labels['filternotexists'] = 'não existe'; +$labels['filterunder'] = 'inferior a'; +$labels['filterover'] = 'superior a'; +$labels['addrule'] = 'Adicionar regra'; +$labels['delrule'] = 'Excluir regra'; +$labels['messagemoveto'] = 'Mover mensagem para'; +$labels['messageredirect'] = 'Redirecionar mensagem para'; +$labels['messagereply'] = 'Responder com mensagem'; +$labels['messagedelete'] = 'Excluir mensagem'; +$labels['messagediscard'] = 'Descartar com mensagem'; +$labels['messagesrules'] = 'Para e-mails recebidos:'; +$labels['messagesactions'] = '...execute as seguintes ações:'; +$labels['add'] = 'Adicionar'; +$labels['del'] = 'Excluir'; +$labels['sender'] = 'Remetente'; +$labels['recipient'] = 'Destinatário'; +$labels['vacationaddresses'] = 'Lista adicional de e-mails de remetente (separado por vírgula):'; +$labels['vacationdays'] = 'Enviar mensagens com que frequência (em dias):'; +$labels['vacationreason'] = 'Corpo da mensagem (motivo de férias):'; +$labels['rulestop'] = 'Parar de avaliar regras'; + +$messages = array(); +$messages['filterunknownerror'] = 'Erro desconhecido de servidor'; +$messages['filterconnerror'] = 'Não foi possível conectar ao servidor managesieve'; +$messages['filterdeleteerror'] = 'Não foi possível excluir filtro. Occorreu um erro de servidor'; +$messages['filterdeleted'] = 'Filtro excluído com sucesso'; +$messages['filterdeleteconfirm'] = 'Deseja realmente excluir o filtro selecionado?'; +$messages['filtersaved'] = 'Filtro gravado com sucesso'; +$messages['filtersaveerror'] = 'Não foi possível gravar filtro. Occoreu um erro de servidor.'; +$messages['ruledeleteconfirm'] = 'Deseja realmente excluir a regra selecionada?'; +$messages['actiondeleteconfirm'] = 'Deseja realmente excluir a ação selecionada?'; +$messages['forbiddenchars'] = 'Caracteres não permitidos no campo'; +$messages['cannotbeempty'] = 'Campo não pode ficar em branco'; + +?> diff --git a/plugins/managesieve/localization/pt_PT.inc b/plugins/managesieve/localization/pt_PT.inc new file mode 100644 index 000000000..592916fc0 --- /dev/null +++ b/plugins/managesieve/localization/pt_PT.inc @@ -0,0 +1,185 @@ +<?php +/* Author: Ling Fude */ + +$labels = array(); +$labels['filters'] = 'Filtros'; +$labels['managefilters'] = 'Gerir filtros'; +$labels['filtername'] = 'Nome do filtro'; +$labels['disablerule'] = 'Desactivar regra'; +$labels['disabled'] = 'Desactivado'; +$labels['newfilter'] = 'Novo filtro'; +$labels['moveup'] = 'Mover para cima'; +$labels['movedown'] = 'Mover para baixo'; +$labels['filterallof'] = 'corresponde a todas as seguintes regras'; +$labels['filteranyof'] = 'corresponde a uma das seguintes regras'; +$labels['filterany'] = 'todas as mensagens'; +$labels['filtercontains'] = 'contém'; +$labels['filternotcontains'] = 'não contém'; +$labels['filteris'] = 'é igual a'; +$labels['filterisnot'] = 'é diferente de'; +$labels['filterexists'] = 'existe'; +$labels['filternotexists'] = 'não existe'; +$labels['filterregex'] = 'corresponde à expressão'; +$labels['filternotregex'] = 'não corresponde à expressão'; +$labels['filterunder'] = 'é inferior a'; +$labels['filterover'] = 'é superior a'; +$labels['filterbefore'] = 'é antes'; +$labels['filterafter'] = 'é depois'; +$labels['filteradvoptions'] = 'mais opções...'; +$labels['spamtest'] = 'Probabilidade de Spam'; +$labels['operator'] = 'Operador'; +$labels['comparator'] = 'Comparador'; +$labels['isgreaterthan'] = 'é maior que'; +$labels['isgreaterthanequal'] = 'é maior ou igual a'; +$labels['islessthan'] = 'é menor que'; +$labels['islessthanequal'] = 'é menor ou igual a'; +$labels['equals'] = 'é igual a'; +$labels['notequals'] = 'é diferente de'; +$labels['countisgreaterthan'] = 'contagem é maior que'; +$labels['countisgreaterthanequal'] = 'contagem é maior ou igual a'; +$labels['countislessthan'] = 'contagem é menor que'; +$labels['countislessthanequal'] = 'contagem é menor ou igual a'; +$labels['countequals'] = 'contagem é igual a'; +$labels['countnotequals'] = 'contagem é diferente de'; +$labels['valueisgreaterthan'] = 'valor é maior que'; +$labels['valueisgreaterthanequal'] = 'valor é maior ou igual a'; +$labels['valueislessthan'] = 'valor é menor que'; +$labels['valueislessthanequal'] = 'valor é menor ou igual a'; +$labels['valueequals'] = 'valor é igual a'; +$labels['valuenotequals'] = 'valor diferente de'; +$labels['userpart'] = 'parte do utilizador igual a'; +$labels['notuserpart'] = 'parte do utilizador diferente de'; +$labels['detailpart'] = 'parte do detalhe igual a'; +$labels['notdetailpart'] = 'parte do detalhe diferente de'; +$labels['domainpart'] = 'parte do domínio igual a'; +$labels['notdomainpart'] = 'parte do domínio diferente de'; +$labels['teststring'] = 'Texto de teste'; +$labels['messagemoveto'] = 'Mover mensagem para'; +$labels['messageredirect'] = 'Redirecionar mensagem para'; +$labels['messageimapflags'] = 'Marcar mensagem como'; +$labels['messagereject'] = 'Rejeitar com a mensagem'; +$labels['messagevacation'] = 'Mensagem Fora do Escritório'; +$labels['messagekeep'] = 'Manter mensagem'; +$labels['messagediscard'] = 'Rejeitar mensagem'; +$labels['messagenotify'] = 'Enviar notificação'; +$labels['messagestop'] = 'Parar o processamento de filtros'; +$labels['messagehelp'] = 'O que é isto?'; +$labels['sieveorigsubj'] = 'Acrescentar assunto original à resposta'; +$labels['sievevachandle'] = 'Manusear'; +$labels['method'] = 'Método'; +$labels['options'] = 'Opções'; +$labels['messagesrules'] = 'Regras para Filtros'; +$labels['messagesactions'] = 'Acções para Filtros'; +$labels['sieveto'] = 'Alias'; +$labels['sievefrom'] = 'De'; +$labels['flag'] = 'Importância'; +$labels['importancen'] = 'Nenhum'; +$labels['importance1'] = 'Alta'; +$labels['importance2'] = 'Normal'; +$labels['importance3'] = 'Baixa'; +$labels['flagread'] = 'Lida'; +$labels['flagdeleted'] = 'Eliminada'; +$labels['flaganswered'] = 'Respondida'; +$labels['flagdraft'] = 'Rascunho'; +$labels['flagflagged'] = 'Marcada'; +$labels['addsieverule'] = 'Adicionar outra regra, depois desta'; +$labels['addsieveact'] = 'Adicionar outra acção, depois desta'; +$labels['deletesieverule'] = 'Eliminar esta regra'; +$labels['deletesieveact'] = 'Eliminar esta acção'; +$labels['envelopefrom'] = 'Envelope De'; +$labels['envelopeto'] = 'Envelope Para'; +$labels['otherheader'] = 'Outro cabeçalho'; +$labels['days'] = 'Periodo'; +$labels['message'] = 'Mensagem'; +$labels['sieveruleheaders'] = 'Ver exemplos de outros cabecalhos'; +$labels['examplefilters'] = 'Exemplo de Filtros'; +$labels['importfilters'] = 'Importar Filtros'; +$labels['usedefaultfilter'] = 'Usar filtros predefinidos'; +$labels['importfilter'] = 'Importar filtros'; +$labels['moreactions'] = 'Mais opções...'; +$labels['adveditor'] = 'Editor avançado'; +$labels['stdeditor'] = 'Editor padrão'; +$labels['messageredirectcopy'] = 'Enviar cópia para'; +$labels['messagecopyto'] = 'Copiar mensagem para'; +$labels['body'] = 'Corpo'; +$labels['auto'] = 'Auto'; +$labels['raw'] = 'Raw'; +$labels['text'] = 'Texto'; +$labels['other'] = 'Outro'; +$labels['bodycontentpart'] = 'Parte Conteúdo'; +$labels['spamnotchecked'] = 'não verificado'; +$labels['spamlevelisgreaterthanequal'] = 'é maior ou igual a'; +$labels['spamlevelislessthanequal'] = 'é menor ou igual a'; +$labels['spamlevelequals'] = 'é igual a'; +$labels['i;ascii-casemap'] = 'correspondência de texto indeferente a maiúsculas e minúsculas'; +$labels['i;octet'] = 'correspondência exacta do texto'; +$labels['i;ascii-numeric'] = 'correspondência numérica'; +$labels['selectruleset'] = 'Seleccionar conjunto de regras'; +$labels['activeruleset'] = '%s (activo)'; +$labels['activateruleset'] = 'Activar este conjunto de regras'; +$labels['newruleset'] = 'Criar um no grupo de regras'; +$labels['delruleset'] = 'Eliminar este conjunto de regras'; +$labels['renameruleset'] = 'Renomear este conjunto de regras'; +$labels['copy'] = 'Copiar'; +$labels['copyexistingfilter'] = 'Copiar filtros existentes'; +$labels['copytoruleset'] = 'Copiar o filtro para outro conjunto de regras'; +$labels['copyfromruleset'] = 'Copiar filtros de um conjunto regras existente'; +$labels['time'] = 'Tempo'; +$labels['weekday'] = 'dia da semana'; + +$messages = array(); +$messages['nosieverules'] = 'Nenhum filtro encontrado.'; +$messages['filterdeleteconfirm'] = 'Tem a certeza que pretende eliminar este filtro?'; +$messages['ruledeleteconfirm'] = 'Tem a certeza que pretende eliminar esta regra?'; +$messages['actiondeleteconfirm'] = 'Tem a certeza que pretende eliminar esta acção?'; +$messages['filterunknownerror'] = 'Erro de servidor desconhecido'; +$messages['filterconnerror'] = 'Não é possível ligar ao servidor Sieve'; +$messages['filterdeleteerror'] = 'Não foi possível eliminar o filtro. Erro no servidor'; +$messages['filterdeleted'] = 'Filtro eliminado com sucesso'; +$messages['filtersaved'] = 'Filtro guardado com sucesso'; +$messages['filtersaveerror'] = 'Não foi possível guardar o filtro. Erro no servidor'; +$messages['vacdaysexp'] = 'O período é o número de dias durante o qual a mensagem não será reenviado para o mesmo remetente, não importa quantas vezes ele entre contacto consigo.<br/><br/>Por exemplo: Se o João lhe enviar e-mails na segunda-feira e o período está definido para 7 dias, o João irá receber uma mensagem de Fora do Escritório na segunda-feira, mas não irá receber mais nenhuma até à segunda-feira seguinte, não importa quantos e-mails ele lhe envie durante a semana.'; +$messages['vachandleexp'] = 'Um identificador pode ser usado para ligar as diferentes mensagens de Fora do Escritório em conjunto, uma vez que uma mensagem foi enviada outra mensagem com o mesmo identificador será reenviado no mesmo período.'; +$messages['vactoexp'] = 'Lista de endereços de destinatários adicionais que estão incluídos na resposta automática. Se um destinatário de e-mail não é o seu endereço principal e não está nesta lista, nenhuma mensagem será enviada.'; +$messages['vactoexp_adv'] = 'Separar múltiplos endereços com virgula (,). Exemplo: test1@example.com,test2@example.com,test3@example.com'; +$messages['vactoexp_err'] = 'Erro: Múltiplos endereços devem ser separados por virgula (,).'; +$messages['norulename'] = 'Por favor, indique um nome para este filtro'; +$messages['ruleexists'] = 'Já existe um filtro com este nome. Por favor, indique outro'; +$messages['noheader'] = 'Por favor, indique o nome do cabeçalho para testar'; +$messages['headerbadchars'] = 'Erro: O cabeçalho contém caracteres proibidos'; +$messages['noheadervalue'] = 'Por favor indique um valor para testar o cabeçalho contra'; +$messages['sizewrongformat'] = 'Erro: O tamanho da mensagem deve ser numérico'; +$messages['noredirect'] = 'Indique um endereço de e-mail para redirecionar as mensagens'; +$messages['redirectaddresserror'] = 'Erro: O endereço de e-mail parece ser inválido'; +$messages['noreject'] = 'Indique uma mensagem para enviar juntamente com o e-mail rejeitado'; +$messages['vacnodays'] = 'Por favor insira um número de dias para o período em que a mensagem não será reenviado para a mesma pessoa'; +$messages['vacdayswrongformat'] = 'Erro: O período deve ser um número maior ou igual a 1'; +$messages['vacnomsg'] = 'Insira o texto para a sua mensagem'; +$messages['notifynomethod'] = 'Por favor, indique um método pelo qual a notificação deve ser enviada'; +$messages['notifynomsg'] = 'Insira o texto para a sua mensagem'; +$messages['sieveruleexp'] = 'Por favor, defina uma ou mais regras sobre as quais cada mensagem será testada. Os filtros são executados na ordem em que aparecem à esquerda do ecrã, se for encontrada uma correspondência mais nenhum filtro será testado.'; +$messages['sieveruleexp_stop'] = 'Por favor, defina uma ou mais regras sobre as quais cada mensagem será testada. Os filtros são executados na ordem em que aparecem à esquerda do ecrã até uma acção de \'Stop\' ser encontrada.'; +$messages['sieveactexp'] = 'Por favor, seleccione uma das opções abaixo. Essas acções serão realizadas para qualquer mensagem correspondente à(s) regra(s) acima.'; +$messages['sieveheadershlp'] = 'Abaixo estão alguns exemplos de outros cabeçalhos que podem ser testados pelos filtros. Selecione um cabeçalho para adicioná-lo à regra, ou introduza um personalizado na caixa acima.'; +$messages['movingfilter'] = 'A mover filtro...'; +$messages['noexistingfilters'] = 'Não foi detectado nenhum filtro existente!'; +$messages['importdefault'] = '<b>Usar filtros predefinidos:</b> Há um conjunto de filtros predefinidos disponíveis. Gostaria de usar esses filtros?'; +$messages['importother'] = '<b>Importação de filtros:</b>Foi encontrado outro conjunto de filtros de %s. Gostaria de importar esses filtros para o seu conjunto actual?'; +$messages['switchtoadveditor'] = 'Mudando para o editor avançado permite editar o ficheiro Sieve directamente. Quaisquer alterações aqui efectuadas podem ser ilegíveis no editor normal e podem ser perdidas quando os filtros são guardados usando o editor normal. Deseja continuar?'; +$messages['filterimported'] = 'Filtro importado com sucesso'; +$messages['filterimporterror'] = 'Não foi possível importar o filtro. Ocorreu um erro no servidor.'; +$messages['notifyinvalidmethod'] = 'O método parece não estar escrito num formato válido, ele deve ser um URL. Por exemplo: "mailto: alert@example.com».'; +$messages['nobodycontentpart'] = 'Por favor, indique uma parte de conteúdo para testar'; +$messages['badoperator'] = 'O operador seleccionado não pode ser usado nesta regra'; +$messages['filteractionerror'] = 'A acção solicitada não é suportada pelo servidor'; +$messages['filtermissingerror'] = 'Não foi possível encontrar a regra solicitada'; +$messages['contentpartexp'] = 'O tipo de MIME ou parte específica da mensagem que deve ser testado. Por exemplo: `text/html`, `audio/mp3` or `image`.'; +$messages['delrulesetconf'] = 'Tem certeza que quer eliminar este conjunto de regras?'; +$messages['rulesetexists'] = 'Um conjunto de regras com este nome já existe. Por favor, indique outro nome'; +$messages['copyexisting'] = '<b>Copiar conjunto de regras existente:</b>Gostaria de copiar os filtros de um conjunto de de regras existente para o seu conjunto actual?'; +$messages['filtercopied'] = 'Filtro copiado com sucesso'; +$messages['nosieverulesets'] = 'Nenhum conjunto de regras encontrado.'; +$messages['baddateformat'] = 'Erro: Indique a data no formato AAAA-MM-DD'; +$messages['badtimeformat'] = 'Erro: Indique a hora no formato HH:MM:SS'; + +?>
\ No newline at end of file diff --git a/plugins/managesieve/localization/ru_RU.inc b/plugins/managesieve/localization/ru_RU.inc new file mode 100644 index 000000000..68aa411a8 --- /dev/null +++ b/plugins/managesieve/localization/ru_RU.inc @@ -0,0 +1,117 @@ +<?php +/* + ++-----------------------------------------------------------------------+ +| plugins/managesieve/localization/ru_RU.inc | +| | +| Russian translation for roundcube/managesieve plugin | +| Copyright (C) 2008-2011 | +| Licensed under the GNU GPL | +| | ++-----------------------------------------------------------------------+ +| Author: Sergey Dukachev <iam@dukess.ru> | +| Updates: Sergey Dukachev <iam@dukess.ru> | ++-----------------------------------------------------------------------+ + +@version 2011-05-11 + +*/ + +$labels['filters'] = 'Фильтры'; +$labels['managefilters'] = 'Управление фильтрами для входящей почты'; +$labels['filtername'] = 'Название фильтра'; +$labels['newfilter'] = 'Новый фильтр'; +$labels['filteradd'] = 'Добавить фильтр'; +$labels['filterdel'] = 'Удалить фильтр'; +$labels['moveup'] = 'Сдвинуть вверх'; +$labels['movedown'] = 'Сдвинуть вниз'; +$labels['filterallof'] = 'соответствует всем указанным правилам'; +$labels['filteranyof'] = 'соответствует любому из указанных правил'; +$labels['filterany'] = 'все сообщения'; +$labels['filtercontains'] = 'содержит'; +$labels['filternotcontains'] = 'не содержит'; +$labels['filteris'] = 'соответствует'; +$labels['filterisnot'] = 'не соответствует'; +$labels['filterexists'] = 'существует'; +$labels['filternotexists'] = 'не существует'; +$labels['filterunder'] = 'под'; +$labels['filterover'] = 'на'; +$labels['addrule'] = 'Добавить правило'; +$labels['delrule'] = 'Удалить правило'; +$labels['messagemoveto'] = 'Переместить сообщение в'; +$labels['messageredirect'] = 'Перенаправить сообщение на'; +$labels['messagecopyto'] = 'Скопировать сообщение в'; +$labels['messagesendcopy'] = 'Отправить копию сообщения на'; +$labels['messagereply'] = 'Ответить с сообщением'; +$labels['messagedelete'] = 'Удалить сообщение'; +$labels['messagediscard'] = 'Отбросить с сообщением'; +$labels['messagesrules'] = 'Для входящей почты:'; +$labels['messagesactions'] = '...выполнить следующие действия:'; +$labels['add'] = 'Добавить'; +$labels['del'] = 'Удалить'; +$labels['sender'] = 'Отправитель'; +$labels['recipient'] = 'Получатель'; +$labels['vacationaddresses'] = 'Список дополнительных адресов получателя (разделённых запятыми):'; +$labels['vacationdays'] = 'Как часто отправлять сообщения (в днях):'; +$labels['vacationreason'] = 'Текст сообщения (причина отсутствия):'; +$labels['rulestop'] = 'Закончить выполнение'; +$labels['filterset'] = 'Набор фильтров'; +$labels['filtersetadd'] = 'Добавить набор фильтров'; +$labels['filtersetdel'] = 'Удалить текущий набор фильтров'; +$labels['filtersetact'] = 'Включить текущий набор фильтров'; +$labels['filtersetdeact'] = 'Отключить текущий набор фильтров'; +$labels['filtersetget'] = 'Скачать набор фильтров в виде текста'; +$labels['filterdef'] = 'Описание фильтра'; +$labels['filtersetname'] = 'Название набора фильтров'; +$labels['newfilterset'] = 'Новый набор фильтров'; +$labels['active'] = 'используется'; +$labels['none'] = 'пустой'; +$labels['fromset'] = 'из набора'; +$labels['fromfile'] = 'из файла'; +$labels['filterdisabled'] = 'Отключить фильтр'; +$labels['countisgreaterthan'] = 'количество больше, чем'; +$labels['countisgreaterthanequal'] = 'количество больше или равно'; +$labels['countislessthan'] = 'количество меньше, чем'; +$labels['countislessthanequal'] = 'количество меньше или равно'; +$labels['countequals'] = 'количество равно'; +$labels['countnotequals'] = 'количество не равно'; +$labels['valueisgreaterthan'] = 'значение больше, чем'; +$labels['valueisgreaterthanequal'] = 'значение больше или равно'; +$labels['valueislessthan'] = 'значение меньше, чем'; +$labels['valueislessthanequal'] = 'значение меньше или равно'; +$labels['valueequals'] = 'значение равно'; +$labels['valuenotequals'] = 'значение не равно'; +$labels['setflags'] = 'Установить флаг на сообщение'; +$labels['addflags'] = 'Добавить флаг к сообщению'; +$labels['removeflags'] = 'Убрать флаги из сообщения'; +$labels['flagread'] = 'Прочитано'; +$labels['flagdeleted'] = 'Удалено'; +$labels['flaganswered'] = 'Отвечено'; +$labels['flagflagged'] = 'Помечено'; +$labels['flagdraft'] = 'Черновик'; + +$messages = array(); +$messages['filterunknownerror'] = 'Неизвестная ошибка сервера'; +$messages['filterconnerror'] = 'Невозможно подсоединится к серверу фильтров'; +$messages['filterdeleteerror'] = 'Невозможно удалить фильтр. Ошибка сервера'; +$messages['filterdeleted'] = 'Фильтр успешно удалён'; +$messages['filterdeleteconfirm'] = 'Вы действительно хотите удалить фильтр?'; +$messages['filtersaved'] = 'Фильтр успешно сохранён'; +$messages['filtersaveerror'] = 'Невозможно сохранить фильтр. Ошибка сервера'; +$messages['ruledeleteconfirm'] = 'Вы уверенны, что хотите удалить это правило?'; +$messages['actiondeleteconfirm'] = 'Вы уверенны, что хотите удалить это действие?'; +$messages['forbiddenchars'] = 'Недопустимые символы в поле'; +$messages['cannotbeempty'] = 'Поле не может быть пустым'; +$messages['setactivateerror'] = 'Невозможно включить выбранный набор фильтров. Ошибка сервера'; +$messages['setdeactivateerror'] = 'Невозможно отключить выбранный набор фильтров. Ошибка сервера'; +$messages['setdeleteerror'] = 'Невозможно удалить выбранный набор фильтров. Ошибка сервера'; +$messages['setactivated'] = 'Набор фильтров успешно включён'; +$messages['setdeactivated'] = 'Набор фильтров успешно отключён'; +$messages['setdeleted'] = 'Набор фильтров успешно удалён'; +$messages['setdeleteconfirm'] = 'Вы уверены в том, что хотите удалить выбранный набор фильтров?'; +$messages['setcreateerror'] = 'Невозможно создать набор фильтров. Ошибка сервера'; +$messages['setcreated'] = 'Набор фильтров успешно создан'; +$messages['emptyname'] = 'Невозможно создать набор фильтров. Название не задано'; +$messages['nametoolong'] = 'Невозможно создать набор фильтров. Название слишком длинное' + +?> diff --git a/plugins/managesieve/localization/sk_SK.inc b/plugins/managesieve/localization/sk_SK.inc new file mode 100644 index 000000000..89c6a2b49 --- /dev/null +++ b/plugins/managesieve/localization/sk_SK.inc @@ -0,0 +1,85 @@ +<?php + +/* + * Slovak translation for roundcube/managesieve plugin + * + * @version 1.0 + * (c) 27.06.2010 by Juraj LUTTER <juraj@lutter.sk> + */ + +$labels['filters'] = 'Filtre'; +$labels['managefilters'] = 'Správa filtrov príchádzajúcej pošty'; +$labels['filtername'] = 'Názov filtra'; +$labels['newfilter'] = 'Nový filter'; +$labels['filteradd'] = 'Pridaj filter'; +$labels['filterdel'] = 'Zmaž filter'; +$labels['moveup'] = 'Presuň vyššie'; +$labels['movedown'] = 'Presuň nižšie'; +$labels['filterallof'] = 'vyhovujúcu VŠETKÝM nasledujúcim pravidlám'; +$labels['filteranyof'] = 'vyhovujúcu ĽUBOVOĽNÉMU z nasledujúcich pravidiel'; +$labels['filterany'] = 'všetky správy'; +$labels['filtercontains'] = 'obsahuje'; +$labels['filternotcontains'] = 'neobsahuje'; +$labels['filteris'] = 'je'; +$labels['filterisnot'] = 'nie je'; +$labels['filterexists'] = 'existuje'; +$labels['filternotexists'] = 'neexistuje'; +$labels['filterunder'] = 'pod'; +$labels['filterover'] = 'nad'; +$labels['addrule'] = 'Pridaj pravidlo'; +$labels['delrule'] = 'Zmaž pravidlo'; +$labels['messagemoveto'] = 'Presuň správu do'; +$labels['messageredirect'] = 'Presmeruj správu na'; +$labels['messagereply'] = 'Pošli automatickú odpoveď'; +$labels['messagedelete'] = 'Zmaž správu'; +$labels['messagediscard'] = 'Zmaž a pošli správu na'; +$labels['messagesrules'] = 'Pre prichádzajúcu poštu'; +$labels['messagesactions'] = 'vykonaj nasledovné akcie'; +$labels['add'] = 'Pridaj'; +$labels['del'] = 'Zmaž'; +$labels['sender'] = 'Odosielateľ'; +$labels['recipient'] = 'Adresát'; +$labels['vacationaddresses'] = 'Dodatoční príjemcovia správy (oddelení čiarkami):'; +$labels['vacationdays'] = 'Počet dní medzi odoslaním správy:'; +$labels['vacationreason'] = 'Dôvod neprítomnosti:'; +$labels['rulestop'] = 'Koniec pravidiel'; +$labels['filterset'] = 'Sada filtrov'; +$labels['filtersetadd'] = 'Pridaj sadu filtrov'; +$labels['filtersetdel'] = 'Zmaž túto sadu filtrov'; +$labels['filtersetact'] = 'Aktivuj túto sadu filtrov'; +$labels['filtersetdeact'] = 'Deaktivuj túto sadu filtrov'; +$labels['filtersetget'] = 'Stiahni definíciu filtrov v textovom súbore'; +$labels['filterdef'] = 'Definícia filtra'; +$labels['filtersetname'] = 'Názov sady filtrov'; +$labels['newfilterset'] = 'Nová sada filtrov'; +$labels['active'] = 'aktívna'; +$labels['none'] = 'žiadne'; +$labels['fromset'] = 'zo sady'; +$labels['fromfile'] = 'zo súboru'; +$labels['filterdisabled'] = 'Filter zakázaný'; + +$messages = array(); +$messages['filterunknownerror'] = 'Neznáma chyba serveru'; +$messages['filterconnerror'] = 'Nepodarilo sa pripojiť k managesieve serveru'; +$messages['filterdeleteerror'] = 'Nepodarilo sa zmazať filter, server ohlásil chybu'; +$messages['filterdeleted'] = 'Filter bol zmazaný'; +$messages['filtersaved'] = 'Filter bol uložený'; +$messages['filtersaveerror'] = 'Nepodarilo sa uložiť filter, server ohlásil chybu'; +$messages['filterdeleteconfirm'] = 'Naozaj si prajete zmazať tento filter?'; +$messages['ruledeleteconfirm'] = 'Naozaj si prajete zamzať toto pravidlo?'; +$messages['actiondeleteconfirm'] = 'Naozaj si prajete zmazať túto akciu?'; +$messages['forbiddenchars'] = 'Pole obsahuje nepovolené znaky'; +$messages['cannotbeempty'] = 'Pole nemôže byť prázdne'; +$messages['setactivateerror'] = 'Nepodarilo sa aktivovať zvolenú sadu filtrov, server ohlásil chybu'; +$messages['setdeactivateerror'] = 'Nepodarilo sa deaktivovať zvolenú sadu filtrov, server ohlásil chybu'; +$messages['setdeleteerror'] = 'Nepodarilo sa zmazať zvolenú sadu filtrov, server ohlásil chybu'; +$messages['setactivated'] = 'Sada filtrov bola aktivovaná'; +$messages['setdeactivated'] = 'Sada filtrov bola deaktivovaná'; +$messages['setdeleted'] = 'Sada filtrov bola zmazaná'; +$messages['setdeleteconfirm'] = 'Naozaj si prajete zmazať túto sadu filtrov?'; +$messages['setcreateerror'] = 'Nepodarilo sa vytvoriť sadu filtrov, server ohlásil chybu'; +$messages['setcreated'] = 'Sada filtrov bola vytvorená'; +$messages['emptyname'] = 'Názov sady filtrov nemôže byť prázdny'; +$messages['nametoolong'] = 'Názov sady filtrov je príliš dlhý' + +?> diff --git a/plugins/managesieve/localization/sl_SI.inc b/plugins/managesieve/localization/sl_SI.inc new file mode 100644 index 000000000..ab9ccad66 --- /dev/null +++ b/plugins/managesieve/localization/sl_SI.inc @@ -0,0 +1,53 @@ +<?php + +$labels['filters'] = 'Pravila'; +$labels['managefilters'] = 'Uredi sporočilna pravila'; +$labels['filtername'] = 'Ime pravila'; +$labels['newfilter'] = 'Novo pravilo'; +$labels['filteradd'] = 'Dodaj pravilo'; +$labels['filterdel'] = 'Izbriši pravilo'; +$labels['moveup'] = 'Pomakni se više'; +$labels['movedown'] = 'Pomakni se niže'; +$labels['filterallof'] = 'izpolnjeni morajo biti vsi pogoji'; +$labels['filteranyof'] = 'izpolnjen mora biti vsaj eden od navedenih pogojev'; +$labels['filterany'] = 'pogoj velja za vsa sporočila'; +$labels['filtercontains'] = 'vsebuje'; +$labels['filternotcontains'] = 'ne vsebuje'; +$labels['filteris'] = 'je enak/a'; +$labels['filterisnot'] = 'ni enak/a'; +$labels['filterexists'] = 'obstaja'; +$labels['filternotexists'] = 'ne obstaja'; +$labels['filterunder'] = 'pod'; +$labels['filterover'] = 'nad'; +$labels['addrule'] = 'Dodaj pravilo'; +$labels['delrule'] = 'Izbriši pravilo'; +$labels['messagemoveto'] = 'Premakni sporočilo v'; +$labels['messageredirect'] = 'Preusmeri sporočilo v'; +$labels['messagereply'] = 'Odgovori s sporočilom'; +$labels['messagedelete'] = 'Izbriši sporočilo'; +$labels['messagediscard'] = 'Zavrži s sporočilom'; +$labels['messagesrules'] = 'Določi pravila za dohodno pošto:'; +$labels['messagesactions'] = '...izvrši naslednja dejanja:'; +$labels['add'] = 'Dodaj'; +$labels['del'] = 'Izbriši'; +$labels['sender'] = 'Pošiljatelj'; +$labels['recipient'] = 'Prejemnik'; +$labels['vacationaddresses'] = 'Dodaten seznam naslovov prejemnikov (ločenih z vejico):'; +$labels['vacationdays'] = 'Kako pogosto naj bodo sporočila poslana (v dnevih):'; +$labels['vacationreason'] = 'Vsebina sporočila (vzrok za odsotnost):'; +$labels['rulestop'] = 'Prekini z izvajanjem pravil'; + +$messages = array(); +$messages['filterunknownerror'] = 'Prišlo je do neznane napake.'; +$messages['filterconnerror'] = 'Povezave s strežnikom (managesieve) ni bilo mogoče vzpostaviti'; +$messages['filterdeleteerror'] = 'Pravila ni bilo mogoče izbrisati. Prišlo je do napake.'; +$messages['filterdeleted'] = 'Pravilo je bilo uspešno izbrisano.'; +$messages['filterdeleteconfirm'] = 'Ste prepričani, da želite izbrisati izbrano pravilo?'; +$messages['filtersaved'] = 'Pravilo je bilo uspešno shranjeno'; +$messages['filtersaveerror'] = 'Pravilo ni bilo shranjeno. Prišlo je do napake.'; +$messages['ruledeleteconfirm'] = 'Ste prepričani, da želite izbrisati izbrano pravilo?'; +$messages['actiondeleteconfirm'] = 'Ste prepričani, da želite izbrisati izbrano dejanje?'; +$messages['forbiddenchars'] = 'V polju so neveljavni znaki'; +$messages['cannotbeempty'] = 'Polje ne sme biti prazno'; + +?> diff --git a/plugins/managesieve/localization/sv_SE.inc b/plugins/managesieve/localization/sv_SE.inc new file mode 100644 index 000000000..883525b71 --- /dev/null +++ b/plugins/managesieve/localization/sv_SE.inc @@ -0,0 +1,93 @@ +<?php + +$labels = array(); +$labels['filters'] = 'Filter'; +$labels['managefilters'] = 'Administrera filter'; +$labels['filtername'] = 'Filternamn'; +$labels['newfilter'] = 'Nytt filter'; +$labels['filteradd'] = 'Lägg till filter'; +$labels['filterdel'] = 'Ta bort filter'; +$labels['moveup'] = 'Flytta upp filter'; +$labels['movedown'] = 'Flytta ner filter'; +$labels['filterallof'] = 'Filtrera på alla följande regler'; +$labels['filteranyof'] = 'Filtrera på någon av följande regler'; +$labels['filterany'] = 'Filtrera alla meddelanden'; +$labels['filtercontains'] = 'innehåller'; +$labels['filternotcontains'] = 'inte innehåller'; +$labels['filteris'] = 'är lika med'; +$labels['filterisnot'] = 'är inte lika med'; +$labels['filterexists'] = 'finns'; +$labels['filternotexists'] = 'inte finns'; +$labels['filterunder'] = 'under'; +$labels['filterover'] = 'över'; +$labels['addrule'] = 'Lägg till regel'; +$labels['delrule'] = 'Ta bort regel'; +$labels['messagemoveto'] = 'Flytta meddelande till'; +$labels['messageredirect'] = 'Ändra mottagare till'; +$labels['messagecopyto'] = 'Kopiera meddelande till'; +$labels['messagesendcopy'] = 'Skicka kopia av meddelande till'; +$labels['messagereply'] = 'Besvara meddelande'; +$labels['messagedelete'] = 'Ta bort meddelande'; +$labels['messagediscard'] = 'Avböj med felmeddelande'; +$labels['messagesrules'] = 'För inkommande meddelande'; +$labels['messagesactions'] = 'Utför följande åtgärd'; +$labels['add'] = 'Lägg till'; +$labels['del'] = 'Ta bort'; +$labels['sender'] = 'Avsändare'; +$labels['recipient'] = 'Mottagare'; +$labels['vacationaddresses'] = 'Ytterligare mottagaradresser (avdelade med kommatecken)'; +$labels['vacationdays'] = 'Antal dagar mellan auto-svar:'; +$labels['vacationreason'] = 'Meddelande i auto-svar:'; +$labels['rulestop'] = 'Avsluta filtrering'; +$labels['filterset'] = 'Filtergrupp'; +$labels['filtersetadd'] = 'Lägg till filtergrupp'; +$labels['filtersetdel'] = 'Ta bort filtergrupp'; +$labels['filtersetact'] = 'Aktivera filtergrupp'; +$labels['filtersetdeact'] = 'Deaktivera filtergrupp'; +$labels['filtersetget'] = 'Exportera filtergrupp i textformat'; +$labels['filterdef'] = 'Filterdefinition'; +$labels['filtersetname'] = 'Filtergruppsnamn'; +$labels['newfilterset'] = 'Ny filtergrupp'; +$labels['active'] = 'aktiv'; +$labels['none'] = 'ingen'; +$labels['fromset'] = 'från grupp'; +$labels['fromfile'] = 'från fil'; +$labels['filterdisabled'] = 'Filter deaktiverat'; +$labels['countisgreaterthan'] = 'antal är större än'; +$labels['countisgreaterthanequal'] = 'antal är större än eller lika med'; +$labels['countislessthan'] = 'antal är mindre än'; +$labels['countislessthanequal'] = 'antal är mindre än eller lika med'; +$labels['countequals'] = 'antal är lika med'; +$labels['countnotequals'] = 'antal är inte lika med'; +$labels['valueisgreaterthan'] = 'värde är större än'; +$labels['valueisgreaterthanequal'] = 'värde är större än eller lika med'; +$labels['valueislessthan'] = 'värde är mindre än'; +$labels['valueislessthanequal'] = 'värde är mindre än eller lika med'; +$labels['valueequals'] = 'värde är lika med'; +$labels['valuenotequals'] = 'värde är inte lika med'; + +$messages = array(); +$messages['filterunknownerror'] = 'Okänt serverfel'; +$messages['filterconnerror'] = 'Anslutning till serverns filtertjänst misslyckades'; +$messages['filterdeleteerror'] = 'Filtret kunde inte tas bort på grund av serverfel'; +$messages['filterdeleted'] = 'Filtret är borttaget'; +$messages['filtersaved'] = 'Filtret har sparats'; +$messages['filtersaveerror'] = 'Filtret kunde inte sparas på grund av serverfel'; +$messages['filterdeleteconfirm'] = 'Vill du ta bort det markerade filtret?'; +$messages['ruledeleteconfirm'] = 'Vill du ta bort filterregeln?'; +$messages['actiondeleteconfirm'] = 'Vill du ta bort filteråtgärden?'; +$messages['forbiddenchars'] = 'Otillåtet tecken i fältet'; +$messages['cannotbeempty'] = 'Fältet kan inte lämnas tomt'; +$messages['setactivateerror'] = 'Filtergruppen kunde inte aktiveras på grund av serverfel'; +$messages['setdeactivateerror'] = 'Filtergruppen kunde inte deaktiveras på grund av serverfel'; +$messages['setdeleteerror'] = 'Filtergruppen kunde inte tas bort på grund av serverfel'; +$messages['setactivated'] = 'Filtergruppen är aktiverad'; +$messages['setdeactivated'] = 'Filtergruppen är deaktiverad'; +$messages['setdeleted'] = 'Filtergruppen är borttagen'; +$messages['setdeleteconfirm'] = 'Vill du ta bort filtergruppen?'; +$messages['setcreateerror'] = 'Filtergruppen kunde inte läggas till på grund av serverfel'; +$messages['setcreated'] = 'Filtergruppen har lagts till'; +$messages['emptyname'] = 'Filtergruppen kan inte läggas till utan namn'; +$messages['nametoolong'] = 'Filtergruppen kan inte läggas till med för långt namn'; + +?> diff --git a/plugins/managesieve/localization/uk_UA.inc b/plugins/managesieve/localization/uk_UA.inc new file mode 100644 index 000000000..9a62af975 --- /dev/null +++ b/plugins/managesieve/localization/uk_UA.inc @@ -0,0 +1,76 @@ +<?php + +$labels = array(); +$labels['filters'] = 'Фільтри'; +$labels['managefilters'] = 'Керування фільтрами вхідної пошти'; +$labels['filtername'] = 'Назва фільтру'; +$labels['newfilter'] = 'Новий фільтр'; +$labels['filteradd'] = 'Додати фільтр'; +$labels['filterdel'] = 'Видалити фільтр'; +$labels['moveup'] = 'Пересунути вгору'; +$labels['movedown'] = 'Пересунути вниз'; +$labels['filterallof'] = 'задовольняє усім наступним умовам'; +$labels['filteranyof'] = 'задовольняє будь-якій з умов'; +$labels['filterany'] = 'всі повідомлення'; +$labels['filtercontains'] = 'містить'; +$labels['filternotcontains'] = 'не містить'; +$labels['filteris'] = 'ідентичний до'; +$labels['filterisnot'] = 'не ідентичний до'; +$labels['filterexists'] = 'існує'; +$labels['filternotexists'] = 'не існує'; +$labels['filterunder'] = 'менше, ніж'; +$labels['filterover'] = 'більше, ніж'; +$labels['addrule'] = 'Додати правило'; +$labels['delrule'] = 'Видалити правило'; +$labels['messagemoveto'] = 'Пересунути повідомлення до'; +$labels['messageredirect'] = 'Перенаправити повідомлення до'; +$labels['messagereply'] = 'Автовідповідач'; +$labels['messagedelete'] = 'Видалити повідомлення'; +$labels['messagediscard'] = 'Відхилити з повідомленням'; +$labels['messagesrules'] = 'Для вхідної пошти'; +$labels['messagesactions'] = '... виконати дію:'; +$labels['add'] = 'Додати'; +$labels['del'] = 'Видалити'; +$labels['sender'] = 'Відправник'; +$labels['recipient'] = 'Отримувач'; +$labels['vacationaddresses'] = 'Додатковий список адрес отримувачів (розділених комою)'; +$labels['vacationdays'] = 'Як часто повторювати (у днях):'; +$labels['vacationreason'] = 'Текст повідомлення:'; +$labels['rulestop'] = 'Зупинити перевірку правил'; +$labels['filterset'] = 'Набір фільтрів'; +$labels['filtersetadd'] = 'Додати набір фільтрів'; +$labels['filtersetdel'] = 'Видалити поточний набір'; +$labels['filtersetact'] = 'Активувати поточний набір'; +$labels['filtersetget'] = 'Зберегти набір у текстовому форматі'; +$labels['filterdef'] = 'Параметри фільтру'; +$labels['filtersetname'] = 'Назва набору фільтрів'; +$labels['newfilterset'] = 'Новий набір фільтрів'; +$labels['active'] = 'активний'; +$labels['none'] = 'нічого'; +$labels['fromset'] = 'з набору'; +$labels['fromfile'] = 'з файлу'; +$labels['filterdisabled'] = 'Фільтр вимкнено'; + +$messages = array(); +$messages['filterunknownerror'] = 'Невідома помилка сервера'; +$messages['filterconnerror'] = 'Неможливо з\'єднатися з сервером'; +$messages['filterdeleteerror'] = 'Неможливо видалити фільтр. Помилка сервера'; +$messages['filterdeleted'] = 'Фільтр успішно видалено'; +$messages['filtersaved'] = 'Фільтр успішно збережено'; +$messages['filtersaveerror'] = 'Неможливо зберегти фільтр. Помилка сервера'; +$messages['filterdeleteconfirm'] = 'Ви дійсно хочете видалити обраний фільтр?'; +$messages['ruledeleteconfirm'] = 'Ви дійсно хочете видалити обране правило?'; +$messages['actiondeleteconfirm'] = 'Ви дійсно хочете видалити обрану дію?'; +$messages['forbiddenchars'] = 'Введено заборонений символ'; +$messages['cannotbeempty'] = 'Поле не може бути пустим'; +$messages['setactivateerror'] = 'Неможливо активувати обраний набір. Помилка сервера'; +$messages['setdeleteerror'] = 'Неможливо видалити обраний набір. Помилка сервера'; +$messages['setactivated'] = 'Набір фільтрів активовано успішно'; +$messages['setdeleted'] = 'Набір фільтрів видалено успішно'; +$messages['setdeleteconfirm'] = 'Ви впевнені, що хочете видалити обраний набір?'; +$messages['setcreateerror'] = 'Не вдалося створити набір. Помилка сервера'; +$messages['setcreated'] = 'Набір фільтрів створено успішно'; +$messages['emptyname'] = 'Не вдалося створити набір. Введіть назву набору'; +$messages['nametoolong'] = 'Не вдалося створити набір. Занадто довга назва' + +?> diff --git a/plugins/managesieve/localization/zh_CN.inc b/plugins/managesieve/localization/zh_CN.inc new file mode 100644 index 000000000..a31a67d33 --- /dev/null +++ b/plugins/managesieve/localization/zh_CN.inc @@ -0,0 +1,49 @@ +<?php + +$labels['filters'] = '过滤器'; +$labels['managefilters'] = '管理邮件过滤器'; +$labels['filtername'] = '过滤器名称'; +$labels['newfilter'] = '新建过滤器'; +$labels['filteradd'] = '添加过滤器'; +$labels['filterdel'] = '删除过滤器'; +$labels['moveup'] = '上移'; +$labels['movedown'] = '下移'; +$labels['filterallof'] = '匹配所有规则'; +$labels['filteranyof'] = '匹配任意一条规则'; +$labels['filterany'] = '所有邮件'; +$labels['filtercontains'] = '包含'; +$labels['filternotcontains'] = '不包含'; +$labels['filteris'] = '等于'; +$labels['filterisnot'] = '不等于'; +$labels['filterexists'] = '存在'; +$labels['filternotexists'] = '不存在'; +$labels['filterunder'] = '小于'; +$labels['filterover'] = '大于'; +$labels['addrule'] = '添加规则'; +$labels['delrule'] = '删除规则'; +$labels['messagemoveto'] = '将邮件移动到'; +$labels['messageredirect'] = '将邮件转发到'; +$labels['messagereply'] = '回复以下信息'; +$labels['messagedelete'] = '删除邮件'; +$labels['messagediscard'] = '丢弃邮件并回复以下信息'; +$labels['messagesrules'] = '对收取的邮件应用规则：'; +$labels['messagesactions'] = '...执行以下动作：'; +$labels['add'] = '添加'; +$labels['del'] = '删除'; +$labels['sender'] = '发件人'; +$labels['recipient'] = '收件人'; + +$messages = array(); +$messages['filterunknownerror'] = '未知的服务器错误'; +$messages['filterconnerror'] = '无法连接到 managesieve 服务器'; +$messages['filterdeleteerror'] = '无法删除过滤器。服务器错误'; +$messages['filterdeleted'] = '过滤器已成功删除'; +$messages['filterdeleteconfirm'] = '您确定要删除所选择的过滤器吗？'; +$messages['filtersaved'] = '过滤器已成功保存。'; +$messages['filtersaveerror'] = '无法保存过滤器。服务器错误'; +$messages['ruledeleteconfirm'] = '您确定要删除所选择的规则吗？'; +$messages['actiondeleteconfirm'] = '您确定要删除所选择的动作吗？'; +$messages['forbiddenchars'] = '内容中包含禁用的字符'; +$messages['cannotbeempty'] = '内容不能为空'; + +?> diff --git a/plugins/managesieve/localization/zh_TW.inc b/plugins/managesieve/localization/zh_TW.inc new file mode 100644 index 000000000..8ab37d264 --- /dev/null +++ b/plugins/managesieve/localization/zh_TW.inc @@ -0,0 +1,78 @@ +<?php + +$labels['filters'] = '篩選器'; +$labels['managefilters'] = '設定篩選器'; +$labels['filtername'] = '篩選器名稱'; +$labels['newfilter'] = '建立新篩選器'; +$labels['filteradd'] = '增加篩選器'; +$labels['filterdel'] = '刪除篩選器'; +$labels['moveup'] = '上移'; +$labels['movedown'] = '下移'; +$labels['filterallof'] = '符合所有規則'; +$labels['filteranyof'] = '符合任一條規則'; +$labels['filterany'] = '所有信件'; +$labels['filtercontains'] = '包含'; +$labels['filternotcontains'] = '不包含'; +$labels['filteris'] = '等於'; +$labels['filterisnot'] = '不等於'; +$labels['filterexists'] = '存在'; +$labels['filternotexists'] = '不存在'; +$labels['filterunder'] = '小於'; +$labels['filterover'] = '大於'; +$labels['addrule'] = '新增規則'; +$labels['delrule'] = '刪除規則'; +$labels['messagemoveto'] = '將信件移至'; +$labels['messageredirect'] = '將信件轉寄至'; +$labels['messagereply'] = '以下列內容回覆'; +$labels['messagedelete'] = '刪除信件'; +$labels['messagediscard'] = '刪除信件並以下列內容回覆'; +$labels['messagesrules'] = '對新收到的信件：'; +$labels['messagesactions'] = '執行下列動作：'; +$labels['add'] = '新增'; +$labels['del'] = '刪除'; +$labels['sender'] = '寄件者'; +$labels['recipient'] = '收件者'; +$labels['vacationaddresses'] = '其他收件者（用半形逗號隔開）：'; +$labels['vacationdays'] = '多久回覆一次（單位：天）：'; +$labels['vacationreason'] = '信件內容（休假原因）：'; +$labels['rulestop'] = '停止評估規則'; +$labels['filterset'] = '篩選器集合'; +$labels['filtersetadd'] = '加入篩選器集合'; +$labels['filtersetdel'] = '刪除目前的篩選器集合'; +$labels['filtersetact'] = '啟用目前的篩選器集合'; +$labels['filtersetdeact'] = '停用目前的篩選器集合'; +$labels['filtersetget'] = '以純文字下載篩選器集合'; +$labels['filterdef'] = '篩選器定義'; +$labels['filtersetname'] = '篩選器集合名稱'; +$labels['newfilterset'] = '建立篩選器集合'; +$labels['active'] = '啟用'; +$labels['none'] = '無'; +$labels['fromset'] = '從集合'; +$labels['fromfile'] = '重檔案'; +$labels['filterdisabled'] = '篩選器已停用'; + +$messages = array(); +$messages['filterunknownerror'] = '未知的伺服器錯誤'; +$messages['filterconnerror'] = '無法與伺服器連線'; +$messages['filterdeleteerror'] = '無法刪除篩選器。發生伺服器錯誤'; +$messages['filterdeleted'] = '成功刪除篩選器'; +$messages['filterconfirmdelete'] = '您確定要刪除選擇的篩選器嗎？'; +$messages['filtersaved'] = '成功儲存篩選器。'; +$messages['filtersaveerror'] = '無法儲存篩選器。發生伺服器錯誤'; +$messages['ruledeleteconfirm'] = '您確定要刪除選的規則嗎？'; +$messages['actiondeleteconfirm'] = '您確定要刪除選擇的動作嗎？'; +$messages['forbiddenchars'] = '內容包含禁用字元'; +$messages['cannotbeempty'] = '內容不能為空白'; +$messages['setactivateerror'] = '無法啟用選擇的篩選器集合。 伺服器發生錯誤'; +$messages['setdeactivateerror'] = '無法停用選擇的篩選器集合。 伺服器發生錯誤'; +$messages['setdeleteerror'] = '無法刪除選擇的篩選器集合。 伺服器發生錯誤'; +$messages['setactivated'] = '篩選器集合成功啟用'; +$messages['setdeactivated'] = '篩選器集合成功停用'; +$messages['setdeleted'] = '篩選器集合成功刪除'; +$messages['setdeleteconfirm'] = '你確定要刪除選擇的篩選器集合嗎？'; +$messages['setcreateerror'] = '無法建立篩選器集合。 伺服器發生錯誤'; +$messages['setcreated'] = '篩選器集合成功建立'; +$messages['emptyname'] = '無法建立篩選器集合。 集合名稱空白'; +$messages['nametoolong'] = '無法建立篩選器集合。 名稱太長' + +?> diff --git a/plugins/managesieve/managesieve.js b/plugins/managesieve/managesieve.js new file mode 100644 index 000000000..5f9c67004 --- /dev/null +++ b/plugins/managesieve/managesieve.js @@ -0,0 +1,731 @@ +/* (Manage)Sieve Filters */ + +if (window.rcmail) { + rcmail.addEventListener('init', function(evt) { + // add managesieve-create command to message_commands array, + // so it's state will be updated on message selection/unselection + if (rcmail.env.task == 'mail') { + if (rcmail.env.action != 'show') + rcmail.env.message_commands.push('managesieve-create'); + else + rcmail.enable_command('managesieve-create', true); + } + else { + var tab = $('<span>').attr('id', 'settingstabpluginmanagesieve').addClass('tablink'), + button = $('<a>').attr('href', rcmail.env.comm_path+'&_action=plugin.managesieve') + .attr('title', rcmail.gettext('managesieve.managefilters')) + .html(rcmail.gettext('managesieve.filters')) + .appendTo(tab); + + // add tab + rcmail.add_element(tab, 'tabs'); + } + + if (rcmail.env.task == 'mail' || rcmail.env.action.indexOf('plugin.managesieve') != -1) { + // Create layer for form tips + if (!rcmail.env.framed) { + rcmail.env.ms_tip_layer = $('<div id="managesieve-tip" class="popupmenu"></div>'); + rcmail.env.ms_tip_layer.appendTo(document.body); + } + } + + // register commands + rcmail.register_command('plugin.managesieve-save', function() { rcmail.managesieve_save() }); + rcmail.register_command('plugin.managesieve-act', function() { rcmail.managesieve_act() }); + rcmail.register_command('plugin.managesieve-add', function() { rcmail.managesieve_add() }); + rcmail.register_command('plugin.managesieve-del', function() { rcmail.managesieve_del() }); + rcmail.register_command('plugin.managesieve-move', function() { rcmail.managesieve_move() }); + rcmail.register_command('plugin.managesieve-setadd', function() { rcmail.managesieve_setadd() }); + rcmail.register_command('plugin.managesieve-setdel', function() { rcmail.managesieve_setdel() }); + rcmail.register_command('plugin.managesieve-setact', function() { rcmail.managesieve_setact() }); + rcmail.register_command('plugin.managesieve-setget', function() { rcmail.managesieve_setget() }); + + if (rcmail.env.action == 'plugin.managesieve' || rcmail.env.action == 'plugin.managesieve-save') { + if (rcmail.gui_objects.sieveform) { + rcmail.enable_command('plugin.managesieve-save', true); + + // small resize for header element + $('select[name="_header[]"]', rcmail.gui_objects.sieveform).each(function() { + if (this.value == '...') this.style.width = '40px'; + }); + + // resize dialog window + if (rcmail.env.action == 'plugin.managesieve' && rcmail.env.task == 'mail') { + parent.rcmail.managesieve_dialog_resize(rcmail.gui_objects.sieveform); + } + + $('input[type="text"]:first', rcmail.gui_objects.sieveform).focus(); + } + else { + rcmail.enable_command('plugin.managesieve-add', 'plugin.managesieve-setadd', !rcmail.env.sieveconnerror); + } + + var i, p = rcmail, setcnt, set = rcmail.env.currentset; + + if (rcmail.gui_objects.filterslist) { + rcmail.filters_list = new rcube_list_widget(rcmail.gui_objects.filterslist, + {multiselect:false, draggable:true, keyboard:false}); + rcmail.filters_list.addEventListener('select', function(o){ p.managesieve_select(o); }); + rcmail.filters_list.addEventListener('dragstart', function(o){ p.managesieve_dragstart(o); }); + rcmail.filters_list.addEventListener('dragend', function(e){ p.managesieve_dragend(e); }); + rcmail.filters_list.row_init = function (row) { + row.obj.onmouseover = function() { p.managesieve_focus_filter(row); }; + row.obj.onmouseout = function() { p.managesieve_unfocus_filter(row); }; + }; + rcmail.filters_list.init(); + rcmail.filters_list.focus(); + } + + if (rcmail.gui_objects.filtersetslist) { + rcmail.filtersets_list = new rcube_list_widget(rcmail.gui_objects.filtersetslist, {multiselect:false, draggable:false, keyboard:false}); + rcmail.filtersets_list.addEventListener('select', function(o){ p.managesieve_setselect(o); }); + rcmail.filtersets_list.init(); + rcmail.filtersets_list.focus(); + + if (set != null) { + set = rcmail.managesieve_setid(set); + rcmail.filtersets_list.shift_start = set; + rcmail.filtersets_list.highlight_row(set, false); + } + + setcnt = rcmail.filtersets_list.rowcount; + rcmail.enable_command('plugin.managesieve-set', true); + rcmail.enable_command('plugin.managesieve-setact', 'plugin.managesieve-setget', setcnt); + rcmail.enable_command('plugin.managesieve-setdel', setcnt > 1); + } + } + if (rcmail.gui_objects.sieveform && rcmail.env.rule_disabled) + $('#disabled').attr('checked', true); + }); +}; + +/*********************************************************/ +/********* Managesieve UI methods *********/ +/*********************************************************/ + +rcube_webmail.prototype.managesieve_add = function() +{ + this.load_managesieveframe(); + this.filters_list.clear_selection(); +}; + +rcube_webmail.prototype.managesieve_del = function() +{ + var id = this.filters_list.get_single_selection(); + if (confirm(this.get_label('managesieve.filterdeleteconfirm'))) { + var lock = this.set_busy(true, 'loading'); + this.http_post('plugin.managesieve', + '_act=delete&_fid='+this.filters_list.rows[id].uid, lock); + } +}; + +rcube_webmail.prototype.managesieve_act = function() +{ + var id = this.filters_list.get_single_selection(), + lock = this.set_busy(true, 'loading'); + + this.http_post('plugin.managesieve', + '_act=act&_fid='+this.filters_list.rows[id].uid, lock); +}; + +// Filter selection +rcube_webmail.prototype.managesieve_select = function(list) +{ + var id = list.get_single_selection(); + if (id != null) + this.load_managesieveframe(list.rows[id].uid); +}; + +// Set selection +rcube_webmail.prototype.managesieve_setselect = function(list) +{ + this.show_contentframe(false); + this.filters_list.clear(true); + this.enable_command('plugin.managesieve-setdel', list.rowcount > 1); + this.enable_command( 'plugin.managesieve-setact', 'plugin.managesieve-setget', true); + + var id = list.get_single_selection(); + if (id != null) + this.managesieve_list(this.env.filtersets[id]); +}; + +rcube_webmail.prototype.managesieve_rowid = function(id) +{ + var i, rows = this.filters_list.rows; + + for (i=0; i<rows.length; i++) + if (rows[i] != null && rows[i].uid == id) + return i; +}; + +// Returns set's identifier +rcube_webmail.prototype.managesieve_setid = function(name) +{ + for (var i in this.env.filtersets) + if (this.env.filtersets[i] == name) + return i; +}; + +// Filters listing request +rcube_webmail.prototype.managesieve_list = function(script) +{ + var lock = this.set_busy(true, 'loading'); + + this.http_post('plugin.managesieve', '_act=list&_set='+urlencode(script), lock); +}; + +// Script download request +rcube_webmail.prototype.managesieve_setget = function() +{ + var id = this.filtersets_list.get_single_selection(), + script = this.env.filtersets[id]; + + location.href = this.env.comm_path+'&_action=plugin.managesieve&_act=setget&_set='+urlencode(script); +}; + +// Set activate/deactivate request +rcube_webmail.prototype.managesieve_setact = function() +{ + var id = this.filtersets_list.get_single_selection(), + lock = this.set_busy(true, 'loading'), + script = this.env.filtersets[id], + action = $('#rcmrow'+id).hasClass('disabled') ? 'setact' : 'deact'; + + this.http_post('plugin.managesieve', '_act='+action+'&_set='+urlencode(script), lock); +}; + +// Set delete request +rcube_webmail.prototype.managesieve_setdel = function() +{ + if (!confirm(this.get_label('managesieve.setdeleteconfirm'))) + return false; + + var id = this.filtersets_list.get_single_selection(), + lock = this.set_busy(true, 'loading'), + script = this.env.filtersets[id]; + + this.http_post('plugin.managesieve', '_act=setdel&_set='+urlencode(script), lock); +}; + +// Set add request +rcube_webmail.prototype.managesieve_setadd = function() +{ + this.filters_list.clear_selection(); + this.enable_command('plugin.managesieve-act', 'plugin.managesieve-del', false); + + if (this.env.contentframe && window.frames && window.frames[this.env.contentframe]) { + var lock = this.set_busy(true, 'loading'); + target = window.frames[this.env.contentframe]; + target.location.href = this.env.comm_path+'&_action=plugin.managesieve&_framed=1&_newset=1&_unlock='+lock; + } +}; + +rcube_webmail.prototype.managesieve_updatelist = function(action, o) +{ + this.set_busy(true); + + switch (action) { + + // Delete filter row + case 'del': + var i, list = this.filters_list, rows = list.rows; + + list.remove_row(this.managesieve_rowid(o.id)); + list.clear_selection(); + this.show_contentframe(false); + this.enable_command('plugin.managesieve-del', 'plugin.managesieve-act', false); + + // re-numbering filters + for (i=0; i<rows.length; i++) { + if (rows[i] != null && rows[i].uid > o.id) + rows[i].uid = rows[i].uid-1; + } + + break; + + // Update filter row + case 'update': + var i, row = $('#rcmrow'+o.id); + + if (o.name) + $('td', row).html(o.name); + if (o.disabled) + row.addClass('disabled'); + else + row.removeClass('disabled'); + + $('#disabled', $('iframe').contents()).prop('checked', o.disabled); + + break; + + // Add filter row to the list + case 'add': + var list = this.filters_list, + row = $('<tr><td class="name"></td></tr>'); + + $('td', row).html(o.name); + row.attr('id', 'rcmrow'+o.id); + if (o.disabled) + row.addClass('disabled'); + + list.insert_row(row.get(0)); + list.highlight_row(o.id); + + this.enable_command('plugin.managesieve-del', 'plugin.managesieve-act', true); + + break; + + // Filling rules list + case 'list': + var i, tr, td, el, list = this.filters_list; + + if (o.clear) + list.clear(); + + for (i in o.list) { + el = o.list[i]; + tr = document.createElement('TR'); + td = document.createElement('TD'); + + td.innerHTML = el.name; + td.className = 'name'; + tr.id = 'rcmrow' + el.id; + if (el.class) + tr.className = el.class + tr.appendChild(td); + + list.insert_row(tr); + } + + if (o.set) + list.highlight_row(o.set); + else + this.enable_command('plugin.managesieve-del', 'plugin.managesieve-act', false); + + break; + + // Sactivate/deactivate set + case 'setact': + var id = this.managesieve_setid(o.name), row = $('#rcmrow' + id); + if (o.active) { + if (o.all) + $('tr', this.gui_objects.filtersetslist).addClass('disabled'); + row.removeClass('disabled'); + } + else + row.addClass('disabled'); + + break; + + // Delete set row + case 'setdel': + var id = this.managesieve_setid(o.name); + + this.filtersets_list.remove_row(id); + this.filters_list.clear(); + this.show_contentframe(false); + this.enable_command('plugin.managesieve-setdel', 'plugin.managesieve-setact', 'plugin.managesieve-setget', false); + + delete this.env.filtersets[id]; + + break; + + // Create set row + case 'setadd': + var id = 'S' + new Date().getTime(), + list = this.filtersets_list, + row = $('<tr class="disabled"><td class="name"></td></tr>'); + + $('td', row).html(o.name); + row.attr('id', 'rcmrow'+id); + + this.env.filtersets[id] = o.name; + list.insert_row(row.get(0)); + + // move row into its position on the list + if (o.index != list.rowcount-1) { + row.detach(); + var elem = $('tr:visible', list.list).get(o.index); + row.insertBefore(elem); + } + + list.select(id); + + break; + } + + this.set_busy(false); +}; + +// load filter frame +rcube_webmail.prototype.load_managesieveframe = function(id) +{ + var has_id = typeof(id) != 'undefined' && id != null; + this.enable_command('plugin.managesieve-act', 'plugin.managesieve-del', has_id); + + if (this.env.contentframe && window.frames && window.frames[this.env.contentframe]) { + target = window.frames[this.env.contentframe]; + var msgid = this.set_busy(true, 'loading'); + target.location.href = this.env.comm_path+'&_action=plugin.managesieve&_framed=1' + +(id ? '&_fid='+id : '')+'&_unlock='+msgid; + } +}; + +// load filter frame +rcube_webmail.prototype.managesieve_dragstart = function(list) +{ + var id = this.filters_list.get_single_selection(); + + this.drag_active = true; + this.drag_filter = id; +}; + +rcube_webmail.prototype.managesieve_dragend = function(e) +{ + if (this.drag_active) { + if (this.drag_filter_target) { + var lock = this.set_busy(true, 'loading'); + + this.show_contentframe(false); + this.http_post('plugin.managesieve', '_act=move&_fid='+this.drag_filter + +'&_to='+this.drag_filter_target, lock); + } + this.drag_active = false; + } +}; + +rcube_webmail.prototype.managesieve_focus_filter = function(row) +{ + var id = row.id.replace(/^rcmrow/, ''); + if (this.drag_active && id != this.drag_filter) { + this.drag_filter_target = id; + $(row.obj).addClass(id < this.drag_filter ? 'filtermoveup' : 'filtermovedown'); + } +}; + +rcube_webmail.prototype.managesieve_unfocus_filter = function(row) +{ + if (this.drag_active) { + $(row.obj).removeClass('filtermoveup filtermovedown'); + this.drag_filter_target = null; + } +}; + +/*********************************************************/ +/********* Filter Form methods *********/ +/*********************************************************/ + +// Form submition +rcube_webmail.prototype.managesieve_save = function() +{ + if (parent.rcmail && parent.rcmail.filters_list && this.gui_objects.sieveform.name != 'filtersetform') { + var id = parent.rcmail.filters_list.get_single_selection(); + if (id != null) + this.gui_objects.sieveform.elements['_fid'].value = parent.rcmail.filters_list.rows[id].uid; + } + this.gui_objects.sieveform.submit(); +}; + +// Operations on filters form +rcube_webmail.prototype.managesieve_ruleadd = function(id) +{ + this.http_post('plugin.managesieve', '_act=ruleadd&_rid='+id); +}; + +rcube_webmail.prototype.managesieve_rulefill = function(content, id, after) +{ + if (content != '') { + // create new element + var div = document.getElementById('rules'), + row = document.createElement('div'); + + this.managesieve_insertrow(div, row, after); + // fill row after inserting (for IE) + row.setAttribute('id', 'rulerow'+id); + row.className = 'rulerow'; + row.innerHTML = content; + + this.managesieve_formbuttons(div); + } +}; + +rcube_webmail.prototype.managesieve_ruledel = function(id) +{ + if ($('#ruledel'+id).hasClass('disabled')) + return; + + if (confirm(this.get_label('managesieve.ruledeleteconfirm'))) { + var row = document.getElementById('rulerow'+id); + row.parentNode.removeChild(row); + this.managesieve_formbuttons(document.getElementById('rules')); + } +}; + +rcube_webmail.prototype.managesieve_actionadd = function(id) +{ + this.http_post('plugin.managesieve', '_act=actionadd&_aid='+id); +}; + +rcube_webmail.prototype.managesieve_actionfill = function(content, id, after) +{ + if (content != '') { + var div = document.getElementById('actions'), + row = document.createElement('div'); + + this.managesieve_insertrow(div, row, after); + // fill row after inserting (for IE) + row.className = 'actionrow'; + row.setAttribute('id', 'actionrow'+id); + row.innerHTML = content; + + this.managesieve_formbuttons(div); + } +}; + +rcube_webmail.prototype.managesieve_actiondel = function(id) +{ + if ($('#actiondel'+id).hasClass('disabled')) + return; + + if (confirm(this.get_label('managesieve.actiondeleteconfirm'))) { + var row = document.getElementById('actionrow'+id); + row.parentNode.removeChild(row); + this.managesieve_formbuttons(document.getElementById('actions')); + } +}; + +// insert rule/action row in specified place on the list +rcube_webmail.prototype.managesieve_insertrow = function(div, row, after) +{ + for (var i=0; i<div.childNodes.length; i++) { + if (div.childNodes[i].id == (div.id == 'rules' ? 'rulerow' : 'actionrow') + after) + break; + } + + if (div.childNodes[i+1]) + div.insertBefore(row, div.childNodes[i+1]); + else + div.appendChild(row); +}; + +// update Delete buttons status +rcube_webmail.prototype.managesieve_formbuttons = function(div) +{ + var i, button, buttons = []; + + // count and get buttons + for (i=0; i<div.childNodes.length; i++) { + if (div.id == 'rules' && div.childNodes[i].id) { + if (/rulerow/.test(div.childNodes[i].id)) + buttons.push('ruledel' + div.childNodes[i].id.replace(/rulerow/, '')); + } + else if (div.childNodes[i].id) { + if (/actionrow/.test(div.childNodes[i].id)) + buttons.push( 'actiondel' + div.childNodes[i].id.replace(/actionrow/, '')); + } + } + + for (i=0; i<buttons.length; i++) { + button = document.getElementById(buttons[i]); + if (i>0 || buttons.length>1) { + $(button).removeClass('disabled'); + } + else { + $(button).addClass('disabled'); + } + } +}; + +function rule_header_select(id) +{ + var obj = document.getElementById('header' + id), + size = document.getElementById('rule_size' + id), + op = document.getElementById('rule_op' + id), + target = document.getElementById('rule_target' + id), + header = document.getElementById('custom_header' + id); + + if (obj.value == 'size') { + size.style.display = 'inline'; + op.style.display = 'none'; + target.style.display = 'none'; + header.style.display = 'none'; + } + else { + header.style.display = obj.value != '...' ? 'none' : 'inline'; + size.style.display = 'none'; + op.style.display = 'inline'; + rule_op_select(id); + } + + obj.style.width = obj.value == '...' ? '40px' : ''; +}; + +function rule_op_select(id) +{ + var obj = document.getElementById('rule_op' + id), + target = document.getElementById('rule_target' + id); + + target.style.display = obj.value == 'exists' || obj.value == 'notexists' ? 'none' : 'inline'; +}; + +function rule_join_radio(value) +{ + $('#rules').css('display', value == 'any' ? 'none' : 'block'); +}; + +function action_type_select(id) +{ + var obj = document.getElementById('action_type' + id), + enabled = {}, + elems = { + mailbox: document.getElementById('action_mailbox' + id), + target: document.getElementById('action_target' + id), + target_area: document.getElementById('action_target_area' + id), + flags: document.getElementById('action_flags' + id), + vacation: document.getElementById('action_vacation' + id) + }; + + if (obj.value == 'fileinto' || obj.value == 'fileinto_copy') { + enabled.mailbox = 1; + } + else if (obj.value == 'redirect' || obj.value == 'redirect_copy') { + enabled.target = 1; + } + else if (obj.value.match(/^reject|ereject$/)) { + enabled.target_area = 1; + } + else if (obj.value.match(/^(add|set|remove)flag$/)) { + enabled.flags = 1; + } + else if (obj.value == 'vacation') { + enabled.vacation = 1; + } + + for (var x in elems) { + elems[x].style.display = !enabled[x] ? 'none' : 'inline'; + } +}; + +// Register onmouse(leave/enter) events for tips on specified form element +rcube_webmail.prototype.managesieve_tip_register = function(tips) +{ + var n, framed = parent.rcmail, + tip = framed ? parent.rcmail.env.ms_tip_layer : rcmail.env.ms_tip_layer; + + for (var n in tips) { + $('#'+tips[n][0]) + .bind('mouseenter', {str: tips[n][1]}, + function(e) { + var offset = $(this).offset(), + left = offset.left, + top = offset.top - 12; + + if (framed) { + offset = $((rcmail.env.task == 'mail' ? '#sievefilterform > iframe' : '#filter-box'), parent.document).offset(); + top += offset.top; + left += offset.left; + } + + tip.html(e.data.str) + top -= tip.height(); + + tip.css({left: left, top: top}).show(); + }) + .bind('mouseleave', function(e) { tip.hide(); }); + } +}; + +/*********************************************************/ +/********* Mail UI methods *********/ +/*********************************************************/ + +rcube_webmail.prototype.managesieve_create = function() +{ + if (!rcmail.env.sieve_headers || !rcmail.env.sieve_headers.length) + return; + + var i, html, buttons = {}, dialog = $("#sievefilterform"); + + // create dialog window + if (!dialog.length) { + dialog = $('<div id="sievefilterform"></div>'); + $('body').append(dialog); + } + + // build dialog window content + html = '<fieldset><legend>'+this.gettext('managesieve.usedata')+'</legend><ul>'; + for (i in rcmail.env.sieve_headers) + html += '<li><input type="checkbox" name="headers[]" id="sievehdr'+i+'" value="'+i+'" checked="checked" />' + +'<label for="sievehdr'+i+'">'+rcmail.env.sieve_headers[i][0]+':</label> '+rcmail.env.sieve_headers[i][1]+'</li>'; + html += '</ul></fieldset>'; + + dialog.html(html); + + // [Next Step] button action + buttons[this.gettext('managesieve.nextstep')] = function () { + // check if there's at least one checkbox checked + var hdrs = $('input[name="headers[]"]:checked', dialog); + if (!hdrs.length) { + alert(rcmail.gettext('managesieve.nodata')); + return; + } + + // build frame URL + var url = rcmail.get_task_url('mail'); + url = rcmail.add_url(url, '_action', 'plugin.managesieve'); + url = rcmail.add_url(url, '_framed', 1); + + hdrs.map(function() { + var val = rcmail.env.sieve_headers[this.value]; + url = rcmail.add_url(url, 'r['+this.value+']', val[0]+':'+val[1]); + }); + + // load form in the iframe + var frame = $('<iframe>').attr({src: url, frameborder: 0}) + frame.height(dialog.height()); // temp. + dialog.empty().append(frame); + dialog.dialog('dialog').resize(); + + // Change [Next Step] button with [Save] button + buttons = {}; + buttons[rcmail.gettext('save')] = function() { + var win = $('iframe', dialog).get(0).contentWindow; + win.rcmail.managesieve_save(); + }; + dialog.dialog('option', 'buttons', buttons); + }; + + // show dialog window + dialog.dialog({ + modal: false, + resizable: !bw.ie6, + closeOnEscape: (!bw.ie6 && !bw.ie7), // disable for performance reasons + title: this.gettext('managesieve.newfilter'), + close: function() { rcmail.managesieve_dialog_close(); }, + buttons: buttons, + minWidth: 600, + minHeight: 300 + }).show(); + + this.env.managesieve_dialog = dialog; +} + +rcube_webmail.prototype.managesieve_dialog_close = function() +{ + var dialog = this.env.managesieve_dialog; + + // BUG(?): if we don't remove the iframe first, it will be reloaded + dialog.html(''); + dialog.dialog('destroy').hide(); +} + +rcube_webmail.prototype.managesieve_dialog_resize = function(o) +{ + var dialog = this.env.managesieve_dialog, + win = $(window), form = $(o); + width = form.width(), height = form.height(), + w = win.width(), h = win.height(); + + dialog.dialog('option', { height: Math.min(h-20, height+120), width: Math.min(w-20, width+65) }) + .dialog('option', 'position', ['center', 'center']); // only works in a separate call (!?) +} diff --git a/plugins/managesieve/managesieve.php b/plugins/managesieve/managesieve.php new file mode 100644 index 000000000..0787c7642 --- /dev/null +++ b/plugins/managesieve/managesieve.php @@ -0,0 +1,1731 @@ +<?php + +/** + * Managesieve (Sieve Filters) + * + * Plugin that adds a possibility to manage Sieve filters in Thunderbird's style. + * It's clickable interface which operates on text scripts and communicates + * with server using managesieve protocol. Adds Filters tab in Settings. + * + * @version 5.0 + * @author Aleksander Machniak <alec@alec.pl> + * + * Configuration (see config.inc.php.dist) + * + * Copyright (C) 2008-2011, The Roundcube Dev Team + * Copyright (C) 2011, Kolab Systems AG + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License version 2 + * as published by the Free Software Foundation. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License along + * with this program; if not, write to the Free Software Foundation, Inc., + * 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. + * + * $Id$ + */ + +class managesieve extends rcube_plugin +{ + public $task = 'mail|settings'; + + private $rc; + private $sieve; + private $errors; + private $form; + private $tips = array(); + private $script = array(); + private $exts = array(); + private $list; + private $active = array(); + private $headers = array( + 'subject' => 'Subject', + 'sender' => 'From', + 'recipient' => 'To', + ); + + const VERSION = '5.0'; + const PROGNAME = 'Roundcube (Managesieve)'; + + + function init() + { + $this->rc = rcmail::get_instance(); + + // register actions + $this->register_action('plugin.managesieve', array($this, 'managesieve_actions')); + $this->register_action('plugin.managesieve-save', array($this, 'managesieve_save')); + + if ($this->rc->task == 'settings') { + $this->init_ui(); + } + else if ($this->rc->task == 'mail') { + // register message hook + $this->add_hook('message_headers_output', array($this, 'mail_headers')); + + // inject Create Filter popup stuff + if (empty($this->rc->action) || $this->rc->action == 'show') { + $this->mail_task_handler(); + } + } + } + + /** + * Initializes plugin's UI (localization, js script) + */ + private function init_ui() + { + if ($this->ui_initialized) + return; + + // load localization + $this->add_texts('localization/', array('filters','managefilters')); + $this->include_script('managesieve.js'); + + $this->ui_initialized = true; + } + + /** + * Add UI elements to the 'mailbox view' and 'show message' UI. + */ + function mail_task_handler() + { + // use jQuery for popup window + $this->require_plugin('jqueryui'); + + // include js script and localization + $this->init_ui(); + + // include styles + $skin = $this->rc->config->get('skin'); + if (!file_exists($this->home."/skins/$skin/managesieve_mail.css")) + $skin = 'default'; + $this->include_stylesheet("skins/$skin/managesieve_mail.css"); + + // add 'Create filter' item to message menu + $this->api->add_content(html::tag('li', null, + $this->api->output->button(array( + 'command' => 'managesieve-create', + 'label' => 'managesieve.filtercreate', + 'type' => 'link', + 'classact' => 'filterlink active', + 'class' => 'filterlink', + ))), 'messagemenu'); + + // register some labels/messages + $this->rc->output->add_label('managesieve.newfilter', 'managesieve.usedata', + 'managesieve.nodata', 'managesieve.nextstep', 'save'); + + $this->rc->session->remove('managesieve_current'); + } + + /** + * Get message headers for popup window + */ + function mail_headers($args) + { + $headers = $args['headers']; + $ret = array(); + + if ($headers->subject) + $ret[] = array('Subject', $this->rc->imap->decode_header($headers->subject)); + + // @TODO: List-Id, others? + foreach (array('From', 'To') as $h) { + $hl = strtolower($h); + if ($headers->$hl) { + $list = $this->rc->imap->decode_address_list($headers->$hl); + foreach ($list as $item) { + if ($item['mailto']) { + $ret[] = array($h, $item['mailto']); + } + } + } + } + + if ($this->rc->action == 'preview') + $this->rc->output->command('parent.set_env', array('sieve_headers' => $ret)); + else + $this->rc->output->set_env('sieve_headers', $ret); + + + return $args; + } + + /** + * Loads configuration, initializes plugin (including sieve connection) + */ + function managesieve_start() + { + $this->load_config(); + + // register UI objects + $this->rc->output->add_handlers(array( + 'filterslist' => array($this, 'filters_list'), + 'filtersetslist' => array($this, 'filtersets_list'), + 'filterframe' => array($this, 'filter_frame'), + 'filterform' => array($this, 'filter_form'), + 'filtersetform' => array($this, 'filterset_form'), + )); + + // Add include path for internal classes + $include_path = $this->home . '/lib' . PATH_SEPARATOR; + $include_path .= ini_get('include_path'); + set_include_path($include_path); + + $host = rcube_parse_host($this->rc->config->get('managesieve_host', 'localhost')); + $port = $this->rc->config->get('managesieve_port', 2000); + + $host = rcube_idn_to_ascii($host); + + $plugin = $this->rc->plugins->exec_hook('managesieve_connect', array( + 'user' => $_SESSION['username'], + 'password' => $this->rc->decrypt($_SESSION['password']), + 'host' => $host, + 'port' => $port, + 'auth_type' => $this->rc->config->get('managesieve_auth_type'), + 'usetls' => $this->rc->config->get('managesieve_usetls', false), + 'disabled' => $this->rc->config->get('managesieve_disabled_extensions'), + 'debug' => $this->rc->config->get('managesieve_debug', false), + 'auth_cid' => $this->rc->config->get('managesieve_auth_cid'), + 'auth_pw' => $this->rc->config->get('managesieve_auth_pw'), + )); + + // try to connect to managesieve server and to fetch the script + $this->sieve = new rcube_sieve( + $plugin['user'], + $plugin['password'], + $plugin['host'], + $plugin['port'], + $plugin['auth_type'], + $plugin['usetls'], + $plugin['disabled'], + $plugin['debug'], + $plugin['auth_cid'], + $plugin['auth_pw'] + ); + + if (!($error = $this->sieve->error())) { + // Get list of scripts + $list = $this->list_scripts(); + + if (!empty($_GET['_set']) || !empty($_POST['_set'])) { + $script_name = get_input_value('_set', RCUBE_INPUT_GPC, true); + } + else if (!empty($_SESSION['managesieve_current'])) { + $script_name = $_SESSION['managesieve_current']; + } + else { + // get (first) active script + if (!empty($this->active[0])) { + $script_name = $this->active[0]; + } + else if ($list) { + $script_name = $list[0]; + } + // create a new (initial) script + else { + // if script not exists build default script contents + $script_file = $this->rc->config->get('managesieve_default'); + $script_name = $this->rc->config->get('managesieve_script_name'); + + if (empty($script_name)) + $script_name = 'roundcube'; + + if ($script_file && is_readable($script_file)) + $content = file_get_contents($script_file); + + // add script and set it active + if ($this->sieve->save_script($script_name, $content)) { + $this->activate_script($script_name); + $this->list[] = $script_name; + } + } + } + + if ($script_name) { + $this->sieve->load($script_name); + } + + $error = $this->sieve->error(); + } + + // finally set script objects + if ($error) { + switch ($error) { + case SIEVE_ERROR_CONNECTION: + case SIEVE_ERROR_LOGIN: + $this->rc->output->show_message('managesieve.filterconnerror', 'error'); + break; + default: + $this->rc->output->show_message('managesieve.filterunknownerror', 'error'); + break; + } + + raise_error(array('code' => 403, 'type' => 'php', + 'file' => __FILE__, 'line' => __LINE__, + 'message' => "Unable to connect to managesieve on $host:$port"), true, false); + + // to disable 'Add filter' button set env variable + $this->rc->output->set_env('filterconnerror', true); + $this->script = array(); + } + else { + $this->exts = $this->sieve->get_extensions(); + $this->script = $this->sieve->script->as_array(); + $this->rc->output->set_env('currentset', $this->sieve->current); + $_SESSION['managesieve_current'] = $this->sieve->current; + } + + return $error; + } + + function managesieve_actions() + { + $this->init_ui(); + + $error = $this->managesieve_start(); + + // Handle user requests + if ($action = get_input_value('_act', RCUBE_INPUT_GPC)) { + $fid = (int) get_input_value('_fid', RCUBE_INPUT_POST); + + if ($action == 'delete' && !$error) { + if (isset($this->script[$fid])) { + if ($this->sieve->script->delete_rule($fid)) + $result = $this->save_script(); + + if ($result === true) { + $this->rc->output->show_message('managesieve.filterdeleted', 'confirmation'); + $this->rc->output->command('managesieve_updatelist', 'del', array('id' => $fid)); + } else { + $this->rc->output->show_message('managesieve.filterdeleteerror', 'error'); + } + } + } + else if ($action == 'move' && !$error) { + if (isset($this->script[$fid])) { + $to = (int) get_input_value('_to', RCUBE_INPUT_POST); + $rule = $this->script[$fid]; + + // remove rule + unset($this->script[$fid]); + $this->script = array_values($this->script); + + // add at target position + if ($to >= count($this->script)) { + $this->script[] = $rule; + } + else { + $script = array(); + foreach ($this->script as $idx => $r) { + if ($idx == $to) + $script[] = $rule; + $script[] = $r; + } + $this->script = $script; + } + + $this->sieve->script->content = $this->script; + $result = $this->save_script(); + + if ($result === true) { + $result = $this->list_rules(); + + $this->rc->output->show_message('managesieve.moved', 'confirmation'); + $this->rc->output->command('managesieve_updatelist', 'list', + array('list' => $result, 'clear' => true, 'set' => $to)); + } else { + $this->rc->output->show_message('managesieve.moveerror', 'error'); + } + } + } + else if ($action == 'act' && !$error) { + if (isset($this->script[$fid])) { + $rule = $this->script[$fid]; + $disabled = $rule['disabled'] ? true : false; + $rule['disabled'] = !$disabled; + $result = $this->sieve->script->update_rule($fid, $rule); + + if ($result !== false) + $result = $this->save_script(); + + if ($result === true) { + if ($rule['disabled']) + $this->rc->output->show_message('managesieve.deactivated', 'confirmation'); + else + $this->rc->output->show_message('managesieve.activated', 'confirmation'); + $this->rc->output->command('managesieve_updatelist', 'update', + array('id' => $fid, 'disabled' => $rule['disabled'])); + } else { + if ($rule['disabled']) + $this->rc->output->show_message('managesieve.deactivateerror', 'error'); + else + $this->rc->output->show_message('managesieve.activateerror', 'error'); + } + } + } + else if ($action == 'setact' && !$error) { + $script_name = get_input_value('_set', RCUBE_INPUT_GPC, true); + $result = $this->activate_script($script_name); + $kep14 = $this->rc->config->get('managesieve_kolab_master'); + + if ($result === true) { + $this->rc->output->set_env('active_sets', $this->active); + $this->rc->output->show_message('managesieve.setactivated', 'confirmation'); + $this->rc->output->command('managesieve_updatelist', 'setact', + array('name' => $script_name, 'active' => true, 'all' => !$kep14)); + } else { + $this->rc->output->show_message('managesieve.setactivateerror', 'error'); + } + } + else if ($action == 'deact' && !$error) { + $script_name = get_input_value('_set', RCUBE_INPUT_GPC, true); + $result = $this->deactivate_script($script_name); + + if ($result === true) { + $this->rc->output->set_env('active_sets', $this->active); + $this->rc->output->show_message('managesieve.setdeactivated', 'confirmation'); + $this->rc->output->command('managesieve_updatelist', 'setact', + array('name' => $script_name, 'active' => false)); + } else { + $this->rc->output->show_message('managesieve.setdeactivateerror', 'error'); + } + } + else if ($action == 'setdel' && !$error) { + $script_name = get_input_value('_set', RCUBE_INPUT_GPC, true); + $result = $this->remove_script($script_name); + + if ($result === true) { + $this->rc->output->show_message('managesieve.setdeleted', 'confirmation'); + $this->rc->output->command('managesieve_updatelist', 'setdel', + array('name' => $script_name)); + $this->rc->session->remove('managesieve_current'); + } else { + $this->rc->output->show_message('managesieve.setdeleteerror', 'error'); + } + } + else if ($action == 'setget') { + $script_name = get_input_value('_set', RCUBE_INPUT_GPC, true); + $script = $this->sieve->get_script($script_name); + + if (PEAR::isError($script)) + exit; + + $browser = new rcube_browser; + + // send download headers + header("Content-Type: application/octet-stream"); + header("Content-Length: ".strlen($script)); + + if ($browser->ie) + header("Content-Type: application/force-download"); + if ($browser->ie && $browser->ver < 7) + $filename = rawurlencode(abbreviate_string($script_name, 55)); + else if ($browser->ie) + $filename = rawurlencode($script_name); + else + $filename = addcslashes($script_name, '\\"'); + + header("Content-Disposition: attachment; filename=\"$filename.txt\""); + echo $script; + exit; + } + else if ($action == 'list') { + $result = $this->list_rules(); + + $this->rc->output->command('managesieve_updatelist', 'list', array('list' => $result)); + } + else if ($action == 'ruleadd') { + $rid = get_input_value('_rid', RCUBE_INPUT_GPC); + $id = $this->genid(); + $content = $this->rule_div($fid, $id, false); + + $this->rc->output->command('managesieve_rulefill', $content, $id, $rid); + } + else if ($action == 'actionadd') { + $aid = get_input_value('_aid', RCUBE_INPUT_GPC); + $id = $this->genid(); + $content = $this->action_div($fid, $id, false); + + $this->rc->output->command('managesieve_actionfill', $content, $id, $aid); + } + + $this->rc->output->send(); + } + else if ($this->rc->task == 'mail') { + // Initialize the form + $rules = get_input_value('r', RCUBE_INPUT_GET); + if (!empty($rules)) { + $i = 0; + foreach ($rules as $rule) { + list($header, $value) = explode(':', $rule, 2); + $tests[$i] = array( + 'type' => 'contains', + 'test' => 'header', + 'arg1' => $header, + 'arg2' => $value, + ); + $i++; + } + + $this->form = array( + 'join' => count($tests) > 1 ? 'allof' : 'anyof', + 'name' => '', + 'tests' => $tests, + 'actions' => array( + 0 => array('type' => 'fileinto'), + 1 => array('type' => 'stop'), + ), + ); + } + } + + $this->managesieve_send(); + } + + function managesieve_save() + { + // load localization + $this->add_texts('localization/', array('filters','managefilters')); + + // include main js script + if ($this->api->output->type == 'html') { + $this->include_script('managesieve.js'); + } + + // Init plugin and handle managesieve connection + $error = $this->managesieve_start(); + + // filters set add action + if (!empty($_POST['_newset'])) { + + $name = get_input_value('_name', RCUBE_INPUT_POST, true); + $copy = get_input_value('_copy', RCUBE_INPUT_POST, true); + $from = get_input_value('_from', RCUBE_INPUT_POST); + $exceptions = $this->rc->config->get('managesieve_filename_exceptions'); + $kolab = $this->rc->config->get('managesieve_kolab_master'); + $name_uc = mb_strtolower($name); + $list = $this->list_scripts(); + + if (!$name) { + $this->errors['name'] = $this->gettext('cannotbeempty'); + } + else if (mb_strlen($name) > 128) { + $this->errors['name'] = $this->gettext('nametoolong'); + } + else if (!empty($exceptions) && in_array($name, (array)$exceptions)) { + $this->errors['name'] = $this->gettext('namereserved'); + } + else if (!empty($kolab) && in_array($name_uc, array('MASTER', 'USER', 'MANAGEMENT'))) { + $this->errors['name'] = $this->gettext('namereserved'); + } + else if (in_array($name, $list)) { + $this->errors['name'] = $this->gettext('setexist'); + } + else if ($from == 'file') { + // from file + if (is_uploaded_file($_FILES['_file']['tmp_name'])) { + $file = file_get_contents($_FILES['_file']['tmp_name']); + $file = preg_replace('/\r/', '', $file); + // for security don't save script directly + // check syntax before, like this... + $this->sieve->load_script($file); + if (!$this->save_script($name)) { + $this->errors['file'] = $this->gettext('setcreateerror'); + } + } + else { // upload failed + $err = $_FILES['_file']['error']; + + if ($err == UPLOAD_ERR_INI_SIZE || $err == UPLOAD_ERR_FORM_SIZE) { + $msg = rcube_label(array('name' => 'filesizeerror', + 'vars' => array('size' => + show_bytes(parse_bytes(ini_get('upload_max_filesize')))))); + } + else { + $this->errors['file'] = $this->gettext('fileuploaderror'); + } + } + } + else if (!$this->sieve->copy($name, $from == 'set' ? $copy : '')) { + $error = 'managesieve.setcreateerror'; + } + + if (!$error && empty($this->errors)) { + // Find position of the new script on the list + $list[] = $name; + asort($list, SORT_LOCALE_STRING); + $list = array_values($list); + $index = array_search($name, $list); + + $this->rc->output->show_message('managesieve.setcreated', 'confirmation'); + $this->rc->output->command('parent.managesieve_updatelist', 'setadd', + array('name' => $name, 'index' => $index)); + } else if ($msg) { + $this->rc->output->command('display_message', $msg, 'error'); + } else if ($error) { + $this->rc->output->show_message($error, 'error'); + } + } + // filter add/edit action + else if (isset($_POST['_name'])) { + $name = trim(get_input_value('_name', RCUBE_INPUT_POST, true)); + $fid = trim(get_input_value('_fid', RCUBE_INPUT_POST)); + $join = trim(get_input_value('_join', RCUBE_INPUT_POST)); + + // and arrays + $headers = get_input_value('_header', RCUBE_INPUT_POST); + $cust_headers = get_input_value('_custom_header', RCUBE_INPUT_POST); + $ops = get_input_value('_rule_op', RCUBE_INPUT_POST); + $sizeops = get_input_value('_rule_size_op', RCUBE_INPUT_POST); + $sizeitems = get_input_value('_rule_size_item', RCUBE_INPUT_POST); + $sizetargets = get_input_value('_rule_size_target', RCUBE_INPUT_POST); + $targets = get_input_value('_rule_target', RCUBE_INPUT_POST, true); + $act_types = get_input_value('_action_type', RCUBE_INPUT_POST, true); + $mailboxes = get_input_value('_action_mailbox', RCUBE_INPUT_POST, true); + $act_targets = get_input_value('_action_target', RCUBE_INPUT_POST, true); + $area_targets = get_input_value('_action_target_area', RCUBE_INPUT_POST, true); + $reasons = get_input_value('_action_reason', RCUBE_INPUT_POST, true); + $addresses = get_input_value('_action_addresses', RCUBE_INPUT_POST, true); + $days = get_input_value('_action_days', RCUBE_INPUT_POST); + $subject = get_input_value('_action_subject', RCUBE_INPUT_POST, true); + $flags = get_input_value('_action_flags', RCUBE_INPUT_POST); + + // we need a "hack" for radiobuttons + foreach ($sizeitems as $item) + $items[] = $item; + + $this->form['disabled'] = $_POST['_disabled'] ? true : false; + $this->form['join'] = $join=='allof' ? true : false; + $this->form['name'] = $name; + $this->form['tests'] = array(); + $this->form['actions'] = array(); + + if ($name == '') + $this->errors['name'] = $this->gettext('cannotbeempty'); + else { + foreach($this->script as $idx => $rule) + if($rule['name'] == $name && $idx != $fid) { + $this->errors['name'] = $this->gettext('ruleexist'); + break; + } + } + + $i = 0; + // rules + if ($join == 'any') { + $this->form['tests'][0]['test'] = 'true'; + } + else { + foreach ($headers as $idx => $header) { + $header = $this->strip_value($header); + $target = $this->strip_value($targets[$idx], true); + $op = $this->strip_value($ops[$idx]); + + // normal header + if (in_array($header, $this->headers)) { + if (preg_match('/^not/', $op)) + $this->form['tests'][$i]['not'] = true; + $type = preg_replace('/^not/', '', $op); + + if ($type == 'exists') { + $this->form['tests'][$i]['test'] = 'exists'; + $this->form['tests'][$i]['arg'] = $header; + } + else { + $this->form['tests'][$i]['type'] = $type; + $this->form['tests'][$i]['test'] = 'header'; + $this->form['tests'][$i]['arg1'] = $header; + $this->form['tests'][$i]['arg2'] = $target; + + if ($target == '') + $this->errors['tests'][$i]['target'] = $this->gettext('cannotbeempty'); + else if (preg_match('/^(value|count)-/', $type) && !preg_match('/[0-9]+/', $target)) + $this->errors['tests'][$i]['target'] = $this->gettext('forbiddenchars'); + } + } + else + switch ($header) { + case 'size': + $sizeop = $this->strip_value($sizeops[$idx]); + $sizeitem = $this->strip_value($items[$idx]); + $sizetarget = $this->strip_value($sizetargets[$idx]); + + $this->form['tests'][$i]['test'] = 'size'; + $this->form['tests'][$i]['type'] = $sizeop; + $this->form['tests'][$i]['arg'] = $sizetarget.$sizeitem; + + if ($sizetarget == '') + $this->errors['tests'][$i]['sizetarget'] = $this->gettext('cannotbeempty'); + else if (!preg_match('/^[0-9]+(K|M|G)*$/i', $sizetarget)) + $this->errors['tests'][$i]['sizetarget'] = $this->gettext('forbiddenchars'); + break; + case '...': + $cust_header = $headers = $this->strip_value($cust_headers[$idx]); + + if (preg_match('/^not/', $op)) + $this->form['tests'][$i]['not'] = true; + $type = preg_replace('/^not/', '', $op); + + if ($cust_header == '') + $this->errors['tests'][$i]['header'] = $this->gettext('cannotbeempty'); + else { + $headers = preg_split('/[\s,]+/', $cust_header, -1, PREG_SPLIT_NO_EMPTY); + + if (!count($headers)) + $this->errors['tests'][$i]['header'] = $this->gettext('cannotbeempty'); + else { + foreach ($headers as $hr) + if (!preg_match('/^[a-z0-9-]+$/i', $hr)) + $this->errors['tests'][$i]['header'] = $this->gettext('forbiddenchars'); + } + } + + if (empty($this->errors['tests'][$i]['header'])) + $cust_header = (is_array($headers) && count($headers) == 1) ? $headers[0] : $headers; + + if ($type == 'exists') { + $this->form['tests'][$i]['test'] = 'exists'; + $this->form['tests'][$i]['arg'] = $cust_header; + } + else { + $this->form['tests'][$i]['test'] = 'header'; + $this->form['tests'][$i]['type'] = $type; + $this->form['tests'][$i]['arg1'] = $cust_header; + $this->form['tests'][$i]['arg2'] = $target; + + if ($target == '') + $this->errors['tests'][$i]['target'] = $this->gettext('cannotbeempty'); + else if (preg_match('/^(value|count)-/', $type) && !preg_match('/[0-9]+/', $target)) + $this->errors['tests'][$i]['target'] = $this->gettext('forbiddenchars'); + } + break; + } + $i++; + } + } + + $i = 0; + // actions + foreach($act_types as $idx => $type) { + $type = $this->strip_value($type); + $target = $this->strip_value($act_targets[$idx]); + + switch ($type) { + + case 'fileinto': + case 'fileinto_copy': + $mailbox = $this->strip_value($mailboxes[$idx]); + $this->form['actions'][$i]['target'] = $this->mod_mailbox($mailbox, 'in'); + if ($type == 'fileinto_copy') { + $type = 'fileinto'; + $this->form['actions'][$i]['copy'] = true; + } + break; + + case 'reject': + case 'ereject': + $target = $this->strip_value($area_targets[$idx]); + $this->form['actions'][$i]['target'] = str_replace("\r\n", "\n", $target); + + // if ($target == '') +// $this->errors['actions'][$i]['targetarea'] = $this->gettext('cannotbeempty'); + break; + + case 'redirect': + case 'redirect_copy': + $this->form['actions'][$i]['target'] = $target; + + if ($this->form['actions'][$i]['target'] == '') + $this->errors['actions'][$i]['target'] = $this->gettext('cannotbeempty'); + else if (!check_email($this->form['actions'][$i]['target'])) + $this->errors['actions'][$i]['target'] = $this->gettext('noemailwarning'); + + if ($type == 'redirect_copy') { + $type = 'redirect'; + $this->form['actions'][$i]['copy'] = true; + } + break; + + case 'addflag': + case 'setflag': + case 'removeflag': + $_target = array(); + if (empty($flags[$idx])) { + $this->errors['actions'][$i]['target'] = $this->gettext('noflagset'); + } + else { + foreach ($flags[$idx] as $flag) { + $_target[] = $this->strip_value($flag); + } + } + $this->form['actions'][$i]['target'] = $_target; + break; + + case 'vacation': + $reason = $this->strip_value($reasons[$idx]); + $this->form['actions'][$i]['reason'] = str_replace("\r\n", "\n", $reason); + $this->form['actions'][$i]['days'] = $days[$idx]; + $this->form['actions'][$i]['subject'] = $subject[$idx]; + $this->form['actions'][$i]['addresses'] = explode(',', $addresses[$idx]); +// @TODO: vacation :mime, :from, :handle + + if ($this->form['actions'][$i]['addresses']) { + foreach($this->form['actions'][$i]['addresses'] as $aidx => $address) { + $address = trim($address); + if (!$address) + unset($this->form['actions'][$i]['addresses'][$aidx]); + else if(!check_email($address)) { + $this->errors['actions'][$i]['addresses'] = $this->gettext('noemailwarning'); + break; + } else + $this->form['actions'][$i]['addresses'][$aidx] = $address; + } + } + + if ($this->form['actions'][$i]['reason'] == '') + $this->errors['actions'][$i]['reason'] = $this->gettext('cannotbeempty'); + if ($this->form['actions'][$i]['days'] && !preg_match('/^[0-9]+$/', $this->form['actions'][$i]['days'])) + $this->errors['actions'][$i]['days'] = $this->gettext('forbiddenchars'); + break; + } + + $this->form['actions'][$i]['type'] = $type; + $i++; + } + + if (!$this->errors && !$error) { + // zapis skryptu + if (!isset($this->script[$fid])) { + $fid = $this->sieve->script->add_rule($this->form); + $new = true; + } else + $fid = $this->sieve->script->update_rule($fid, $this->form); + + if ($fid !== false) + $save = $this->save_script(); + + if ($save && $fid !== false) { + $this->rc->output->show_message('managesieve.filtersaved', 'confirmation'); + if ($this->rc->task != 'mail') { + $this->rc->output->command('parent.managesieve_updatelist', + isset($new) ? 'add' : 'update', + array( + 'name' => Q($this->form['name']), + 'id' => $fid, + 'disabled' => $this->form['disabled'] + )); + } + else { + $this->rc->output->command('managesieve_dialog_close'); + $this->rc->output->send('iframe'); + } + } + else { + $this->rc->output->show_message('managesieve.filtersaveerror', 'error'); +// $this->rc->output->send(); + } + } + } + + $this->managesieve_send(); + } + + private function managesieve_send() + { + // Handle form action + if (isset($_GET['_framed']) || isset($_POST['_framed'])) { + if (isset($_GET['_newset']) || isset($_POST['_newset'])) { + $this->rc->output->send('managesieve.setedit'); + } + else { + $this->rc->output->send('managesieve.filteredit'); + } + } else { + $this->rc->output->set_pagetitle($this->gettext('filters')); + $this->rc->output->send('managesieve.managesieve'); + } + } + + // return the filters list as HTML table + function filters_list($attrib) + { + // add id to message list table if not specified + if (!strlen($attrib['id'])) + $attrib['id'] = 'rcmfilterslist'; + + // define list of cols to be displayed + $a_show_cols = array('name'); + + $result = $this->list_rules(); + + // create XHTML table + $out = rcube_table_output($attrib, $result, $a_show_cols, 'id'); + + // set client env + $this->rc->output->add_gui_object('filterslist', $attrib['id']); + $this->rc->output->include_script('list.js'); + + // add some labels to client + $this->rc->output->add_label('managesieve.filterdeleteconfirm'); + + return $out; + } + + // return the filters list as <SELECT> + function filtersets_list($attrib, $no_env = false) + { + // add id to message list table if not specified + if (!strlen($attrib['id'])) + $attrib['id'] = 'rcmfiltersetslist'; + + $list = $this->list_scripts(); + + if ($list) { + asort($list, SORT_LOCALE_STRING); + } + + if (!empty($attrib['type']) && $attrib['type'] == 'list') { + // define list of cols to be displayed + $a_show_cols = array('name'); + + if ($list) { + foreach ($list as $idx => $set) { + $scripts['S'.$idx] = $set; + $result[] = array( + 'name' => Q($set), + 'id' => 'S'.$idx, + 'class' => !in_array($set, $this->active) ? 'disabled' : '', + ); + } + } + + // create XHTML table + $out = rcube_table_output($attrib, $result, $a_show_cols, 'id'); + + $this->rc->output->set_env('filtersets', $scripts); + $this->rc->output->include_script('list.js'); + } + else { + $select = new html_select(array('name' => '_set', 'id' => $attrib['id'], + 'onchange' => $this->rc->task != 'mail' ? 'rcmail.managesieve_set()' : '')); + + if ($list) { + foreach ($list as $set) + $select->add($set, $set); + } + + $out = $select->show($this->sieve->current); + } + + // set client env + if (!$no_env) { + $this->rc->output->add_gui_object('filtersetslist', $attrib['id']); + $this->rc->output->add_label('managesieve.setdeleteconfirm'); + } + + return $out; + } + + function filter_frame($attrib) + { + if (!$attrib['id']) + $attrib['id'] = 'rcmfilterframe'; + + $attrib['name'] = $attrib['id']; + + $this->rc->output->set_env('contentframe', $attrib['name']); + $this->rc->output->set_env('blankpage', $attrib['src'] ? + $this->rc->output->abs_url($attrib['src']) : 'program/blank.gif'); + + return html::tag('iframe', $attrib); + } + + function filterset_form($attrib) + { + if (!$attrib['id']) + $attrib['id'] = 'rcmfiltersetform'; + + $out = '<form name="filtersetform" action="./" method="post" enctype="multipart/form-data">'."\n"; + + $hiddenfields = new html_hiddenfield(array('name' => '_task', 'value' => $this->rc->task)); + $hiddenfields->add(array('name' => '_action', 'value' => 'plugin.managesieve-save')); + $hiddenfields->add(array('name' => '_framed', 'value' => ($_POST['_framed'] || $_GET['_framed'] ? 1 : 0))); + $hiddenfields->add(array('name' => '_newset', 'value' => 1)); + + $out .= $hiddenfields->show(); + + $name = get_input_value('_name', RCUBE_INPUT_POST); + $copy = get_input_value('_copy', RCUBE_INPUT_POST); + $selected = get_input_value('_from', RCUBE_INPUT_POST); + + // filter set name input + $input_name = new html_inputfield(array('name' => '_name', 'id' => '_name', 'size' => 30, + 'class' => ($this->errors['name'] ? 'error' : ''))); + + $out .= sprintf('<label for="%s"><b>%s:</b></label> %s<br /><br />', + '_name', Q($this->gettext('filtersetname')), $input_name->show($name)); + + $out .="\n<fieldset class=\"itemlist\"><legend>" . $this->gettext('filters') . ":</legend>\n"; + $out .= '<input type="radio" id="from_none" name="_from" value="none"' + .(!$selected || $selected=='none' ? ' checked="checked"' : '').'></input>'; + $out .= sprintf('<label for="%s">%s</label> ', 'from_none', Q($this->gettext('none'))); + + // filters set list + $list = $this->list_scripts(); + $select = new html_select(array('name' => '_copy', 'id' => '_copy')); + + if (is_array($list)) { + asort($list, SORT_LOCALE_STRING); + + if (!$copy) + $copy = $_SESSION['managesieve_current']; + + foreach ($list as $set) { + $select->add($set, $set); + } + + $out .= '<br /><input type="radio" id="from_set" name="_from" value="set"' + .($selected=='set' ? ' checked="checked"' : '').'></input>'; + $out .= sprintf('<label for="%s">%s:</label> ', 'from_set', Q($this->gettext('fromset'))); + $out .= $select->show($copy); + } + + // script upload box + $upload = new html_inputfield(array('name' => '_file', 'id' => '_file', 'size' => 30, + 'type' => 'file', 'class' => ($this->errors['file'] ? 'error' : ''))); + + $out .= '<br /><input type="radio" id="from_file" name="_from" value="file"' + .($selected=='file' ? ' checked="checked"' : '').'></input>'; + $out .= sprintf('<label for="%s">%s:</label> ', 'from_file', Q($this->gettext('fromfile'))); + $out .= $upload->show(); + $out .= '</fieldset>'; + + $this->rc->output->add_gui_object('sieveform', 'filtersetform'); + + if ($this->errors['name']) + $this->add_tip('_name', $this->errors['name'], true); + if ($this->errors['file']) + $this->add_tip('_file', $this->errors['file'], true); + + $this->print_tips(); + + return $out; + } + + + function filter_form($attrib) + { + if (!$attrib['id']) + $attrib['id'] = 'rcmfilterform'; + + $fid = get_input_value('_fid', RCUBE_INPUT_GPC); + $scr = isset($this->form) ? $this->form : $this->script[$fid]; + + $hiddenfields = new html_hiddenfield(array('name' => '_task', 'value' => $this->rc->task)); + $hiddenfields->add(array('name' => '_action', 'value' => 'plugin.managesieve-save')); + $hiddenfields->add(array('name' => '_framed', 'value' => ($_POST['_framed'] || $_GET['_framed'] ? 1 : 0))); + $hiddenfields->add(array('name' => '_fid', 'value' => $fid)); + + $out = '<form name="filterform" action="./" method="post">'."\n"; + $out .= $hiddenfields->show(); + + // 'any' flag + if (sizeof($scr['tests']) == 1 && $scr['tests'][0]['test'] == 'true' && !$scr['tests'][0]['not']) + $any = true; + + // filter name input + $field_id = '_name'; + $input_name = new html_inputfield(array('name' => '_name', 'id' => $field_id, 'size' => 30, + 'class' => ($this->errors['name'] ? 'error' : ''))); + + if ($this->errors['name']) + $this->add_tip($field_id, $this->errors['name'], true); + + if (isset($scr)) + $input_name = $input_name->show($scr['name']); + else + $input_name = $input_name->show(); + + $out .= sprintf("\n<label for=\"%s\"><b>%s:</b></label> %s\n", + $field_id, Q($this->gettext('filtername')), $input_name); + + // filter set selector + if ($this->rc->task == 'mail') { + $out .= sprintf("\n <label for=\"%s\"><b>%s:</b></label> %s\n", + $field_id, Q($this->gettext('filterset')), + $this->filtersets_list(array('id' => 'sievescriptname'), true)); + } + + $out .= '<br /><br /><fieldset><legend>' . Q($this->gettext('messagesrules')) . "</legend>\n"; + + // any, allof, anyof radio buttons + $field_id = '_allof'; + $input_join = new html_radiobutton(array('name' => '_join', 'id' => $field_id, 'value' => 'allof', + 'onclick' => 'rule_join_radio(\'allof\')', 'class' => 'radio')); + + if (isset($scr) && !$any) + $input_join = $input_join->show($scr['join'] ? 'allof' : ''); + else + $input_join = $input_join->show(); + + $out .= sprintf("%s<label for=\"%s\">%s</label> \n", + $input_join, $field_id, Q($this->gettext('filterallof'))); + + $field_id = '_anyof'; + $input_join = new html_radiobutton(array('name' => '_join', 'id' => $field_id, 'value' => 'anyof', + 'onclick' => 'rule_join_radio(\'anyof\')', 'class' => 'radio')); + + if (isset($scr) && !$any) + $input_join = $input_join->show($scr['join'] ? '' : 'anyof'); + else + $input_join = $input_join->show('anyof'); // default + + $out .= sprintf("%s<label for=\"%s\">%s</label>\n", + $input_join, $field_id, Q($this->gettext('filteranyof'))); + + $field_id = '_any'; + $input_join = new html_radiobutton(array('name' => '_join', 'id' => $field_id, 'value' => 'any', + 'onclick' => 'rule_join_radio(\'any\')', 'class' => 'radio')); + + $input_join = $input_join->show($any ? 'any' : ''); + + $out .= sprintf("%s<label for=\"%s\">%s</label>\n", + $input_join, $field_id, Q($this->gettext('filterany'))); + + $rows_num = isset($scr) ? sizeof($scr['tests']) : 1; + + $out .= '<div id="rules"'.($any ? ' style="display: none"' : '').'>'; + for ($x=0; $x<$rows_num; $x++) + $out .= $this->rule_div($fid, $x); + $out .= "</div>\n"; + + $out .= "</fieldset>\n"; + + // actions + $out .= '<fieldset><legend>' . Q($this->gettext('messagesactions')) . "</legend>\n"; + + $rows_num = isset($scr) ? sizeof($scr['actions']) : 1; + + $out .= '<div id="actions">'; + for ($x=0; $x<$rows_num; $x++) + $out .= $this->action_div($fid, $x); + $out .= "</div>\n"; + + $out .= "</fieldset>\n"; + + $this->print_tips(); + + if ($scr['disabled']) { + $this->rc->output->set_env('rule_disabled', true); + } + $this->rc->output->add_label( + 'managesieve.ruledeleteconfirm', + 'managesieve.actiondeleteconfirm' + ); + $this->rc->output->add_gui_object('sieveform', 'filterform'); + + return $out; + } + + function rule_div($fid, $id, $div=true) + { + $rule = isset($this->form) ? $this->form['tests'][$id] : $this->script[$fid]['tests'][$id]; + $rows_num = isset($this->form) ? sizeof($this->form['tests']) : sizeof($this->script[$fid]['tests']); + + $out = $div ? '<div class="rulerow" id="rulerow' .$id .'">'."\n" : ''; + + $out .= '<table><tr><td class="rowactions">'; + + // headers select + $select_header = new html_select(array('name' => "_header[]", 'id' => 'header'.$id, + 'onchange' => 'rule_header_select(' .$id .')')); + foreach($this->headers as $name => $val) + $select_header->add(Q($this->gettext($name)), Q($val)); + $select_header->add(Q($this->gettext('size')), 'size'); + $select_header->add(Q($this->gettext('...')), '...'); + + // TODO: list arguments + + if ((isset($rule['test']) && $rule['test'] == 'header') + && !is_array($rule['arg1']) && in_array($rule['arg1'], $this->headers)) + $out .= $select_header->show($rule['arg1']); + else if ((isset($rule['test']) && $rule['test'] == 'exists') + && !is_array($rule['arg']) && in_array($rule['arg'], $this->headers)) + $out .= $select_header->show($rule['arg']); + else if (isset($rule['test']) && $rule['test'] == 'size') + $out .= $select_header->show('size'); + else if (isset($rule['test']) && $rule['test'] != 'true') + $out .= $select_header->show('...'); + else + $out .= $select_header->show(); + + $out .= '</td><td class="rowtargets">'; + + if ((isset($rule['test']) && $rule['test'] == 'header') + && (is_array($rule['arg1']) || !in_array($rule['arg1'], $this->headers))) + $custom = is_array($rule['arg1']) ? implode(', ', $rule['arg1']) : $rule['arg1']; + else if ((isset($rule['test']) && $rule['test'] == 'exists') + && (is_array($rule['arg']) || !in_array($rule['arg'], $this->headers))) + $custom = is_array($rule['arg']) ? implode(', ', $rule['arg']) : $rule['arg']; + + $out .= '<div id="custom_header' .$id. '" style="display:' .(isset($custom) ? 'inline' : 'none'). '"> + <input type="text" name="_custom_header[]" id="custom_header_i'.$id.'" ' + . $this->error_class($id, 'test', 'header', 'custom_header_i') + .' value="' .Q($custom). '" size="15" /> </div>' . "\n"; + + // matching type select (operator) + $select_op = new html_select(array('name' => "_rule_op[]", 'id' => 'rule_op'.$id, + 'style' => 'display:' .($rule['test']!='size' ? 'inline' : 'none'), + 'class' => 'operator_selector', + 'onchange' => 'rule_op_select('.$id.')')); + $select_op->add(Q($this->gettext('filtercontains')), 'contains'); + $select_op->add(Q($this->gettext('filternotcontains')), 'notcontains'); + $select_op->add(Q($this->gettext('filteris')), 'is'); + $select_op->add(Q($this->gettext('filterisnot')), 'notis'); + $select_op->add(Q($this->gettext('filterexists')), 'exists'); + $select_op->add(Q($this->gettext('filternotexists')), 'notexists'); + $select_op->add(Q($this->gettext('filtermatches')), 'matches'); + $select_op->add(Q($this->gettext('filternotmatches')), 'notmatches'); + if (in_array('regex', $this->exts)) { + $select_op->add(Q($this->gettext('filterregex')), 'regex'); + $select_op->add(Q($this->gettext('filternotregex')), 'notregex'); + } + if (in_array('relational', $this->exts)) { + $select_op->add(Q($this->gettext('countisgreaterthan')), 'count-gt'); + $select_op->add(Q($this->gettext('countisgreaterthanequal')), 'count-ge'); + $select_op->add(Q($this->gettext('countislessthan')), 'count-lt'); + $select_op->add(Q($this->gettext('countislessthanequal')), 'count-le'); + $select_op->add(Q($this->gettext('countequals')), 'count-eq'); + $select_op->add(Q($this->gettext('countnotequals')), 'count-ne'); + $select_op->add(Q($this->gettext('valueisgreaterthan')), 'value-gt'); + $select_op->add(Q($this->gettext('valueisgreaterthanequal')), 'value-ge'); + $select_op->add(Q($this->gettext('valueislessthan')), 'value-lt'); + $select_op->add(Q($this->gettext('valueislessthanequal')), 'value-le'); + $select_op->add(Q($this->gettext('valueequals')), 'value-eq'); + $select_op->add(Q($this->gettext('valuenotequals')), 'value-ne'); + } + + // target input (TODO: lists) + + if ($rule['test'] == 'header') { + $out .= $select_op->show(($rule['not'] ? 'not' : '').$rule['type']); + $target = $rule['arg2']; + } + else if ($rule['test'] == 'size') { + $out .= $select_op->show(); + if (preg_match('/^([0-9]+)(K|M|G)*$/', $rule['arg'], $matches)) { + $sizetarget = $matches[1]; + $sizeitem = $matches[2]; + } + } + else { + $out .= $select_op->show(($rule['not'] ? 'not' : '').$rule['test']); + $target = ''; + } + + $out .= '<input type="text" name="_rule_target[]" id="rule_target' .$id. '" + value="' .Q($target). '" size="20" ' . $this->error_class($id, 'test', 'target', 'rule_target') + . ' style="display:' . ($rule['test']!='size' && $rule['test'] != 'exists' ? 'inline' : 'none') . '" />'."\n"; + + $select_size_op = new html_select(array('name' => "_rule_size_op[]", 'id' => 'rule_size_op'.$id)); + $select_size_op->add(Q($this->gettext('filterunder')), 'under'); + $select_size_op->add(Q($this->gettext('filterover')), 'over'); + + $out .= '<div id="rule_size' .$id. '" style="display:' . ($rule['test']=='size' ? 'inline' : 'none') .'">'; + $out .= $select_size_op->show($rule['test']=='size' ? $rule['type'] : ''); + $out .= '<input type="text" name="_rule_size_target[]" id="rule_size_i'.$id.'" value="'.$sizetarget.'" size="10" ' + . $this->error_class($id, 'test', 'sizetarget', 'rule_size_i') .' /> + <input type="radio" name="_rule_size_item['.$id.']" value=""' + . (!$sizeitem ? ' checked="checked"' : '') .' class="radio" />'.rcube_label('B').' + <input type="radio" name="_rule_size_item['.$id.']" value="K"' + . ($sizeitem=='K' ? ' checked="checked"' : '') .' class="radio" />'.rcube_label('KB').' + <input type="radio" name="_rule_size_item['.$id.']" value="M"' + . ($sizeitem=='M' ? ' checked="checked"' : '') .' class="radio" />'.rcube_label('MB').' + <input type="radio" name="_rule_size_item['.$id.']" value="G"' + . ($sizeitem=='G' ? ' checked="checked"' : '') .' class="radio" />'.rcube_label('GB'); + $out .= '</div>'; + $out .= '</td>'; + + // add/del buttons + $out .= '<td class="rowbuttons">'; + $out .= '<a href="#" id="ruleadd' . $id .'" title="'. Q($this->gettext('add')). '" + onclick="rcmail.managesieve_ruleadd(' . $id .')" class="button add"></a>'; + $out .= '<a href="#" id="ruledel' . $id .'" title="'. Q($this->gettext('del')). '" + onclick="rcmail.managesieve_ruledel(' . $id .')" class="button del' . ($rows_num<2 ? ' disabled' : '') .'"></a>'; + $out .= '</td></tr></table>'; + + $out .= $div ? "</div>\n" : ''; + + return $out; + } + + function action_div($fid, $id, $div=true) + { + $action = isset($this->form) ? $this->form['actions'][$id] : $this->script[$fid]['actions'][$id]; + $rows_num = isset($this->form) ? sizeof($this->form['actions']) : sizeof($this->script[$fid]['actions']); + + $out = $div ? '<div class="actionrow" id="actionrow' .$id .'">'."\n" : ''; + + $out .= '<table><tr><td class="rowactions">'; + + // action select + $select_action = new html_select(array('name' => "_action_type[$id]", 'id' => 'action_type'.$id, + 'onchange' => 'action_type_select(' .$id .')')); + if (in_array('fileinto', $this->exts)) + $select_action->add(Q($this->gettext('messagemoveto')), 'fileinto'); + if (in_array('fileinto', $this->exts) && in_array('copy', $this->exts)) + $select_action->add(Q($this->gettext('messagecopyto')), 'fileinto_copy'); + $select_action->add(Q($this->gettext('messageredirect')), 'redirect'); + if (in_array('copy', $this->exts)) + $select_action->add(Q($this->gettext('messagesendcopy')), 'redirect_copy'); + if (in_array('reject', $this->exts)) + $select_action->add(Q($this->gettext('messagediscard')), 'reject'); + else if (in_array('ereject', $this->exts)) + $select_action->add(Q($this->gettext('messagediscard')), 'ereject'); + if (in_array('vacation', $this->exts)) + $select_action->add(Q($this->gettext('messagereply')), 'vacation'); + $select_action->add(Q($this->gettext('messagedelete')), 'discard'); + if (in_array('imapflags', $this->exts) || in_array('imap4flags', $this->exts)) { + $select_action->add(Q($this->gettext('setflags')), 'setflag'); + $select_action->add(Q($this->gettext('addflags')), 'addflag'); + $select_action->add(Q($this->gettext('removeflags')), 'removeflag'); + } + $select_action->add(Q($this->gettext('rulestop')), 'stop'); + + $select_type = $action['type']; + if (in_array($action['type'], array('fileinto', 'redirect')) && $action['copy']) { + $select_type .= '_copy'; + } + + $out .= $select_action->show($select_type); + $out .= '</td>'; + + // actions target inputs + $out .= '<td class="rowtargets">'; + // shared targets + $out .= '<input type="text" name="_action_target['.$id.']" id="action_target' .$id. '" ' + .'value="' .($action['type']=='redirect' ? Q($action['target'], 'strict', false) : ''). '" size="35" ' + .'style="display:' .($action['type']=='redirect' ? 'inline' : 'none') .'" ' + . $this->error_class($id, 'action', 'target', 'action_target') .' />'; + $out .= '<textarea name="_action_target_area['.$id.']" id="action_target_area' .$id. '" ' + .'rows="3" cols="35" '. $this->error_class($id, 'action', 'targetarea', 'action_target_area') + .'style="display:' .(in_array($action['type'], array('reject', 'ereject')) ? 'inline' : 'none') .'">' + . (in_array($action['type'], array('reject', 'ereject')) ? Q($action['target'], 'strict', false) : '') + . "</textarea>\n"; + + // vacation + $out .= '<div id="action_vacation' .$id.'" style="display:' .($action['type']=='vacation' ? 'inline' : 'none') .'">'; + $out .= '<span class="label">'. Q($this->gettext('vacationreason')) .'</span><br />' + .'<textarea name="_action_reason['.$id.']" id="action_reason' .$id. '" ' + .'rows="3" cols="35" '. $this->error_class($id, 'action', 'reason', 'action_reason') . '>' + . Q($action['reason'], 'strict', false) . "</textarea>\n"; + $out .= '<br /><span class="label">' .Q($this->gettext('vacationsubject')) . '</span><br />' + .'<input type="text" name="_action_subject['.$id.']" id="action_subject'.$id.'" ' + .'value="' . (is_array($action['subject']) ? Q(implode(', ', $action['subject']), 'strict', false) : $action['subject']) . '" size="35" ' + . $this->error_class($id, 'action', 'subject', 'action_subject') .' />'; + $out .= '<br /><span class="label">' .Q($this->gettext('vacationaddresses')) . '</span><br />' + .'<input type="text" name="_action_addresses['.$id.']" id="action_addr'.$id.'" ' + .'value="' . (is_array($action['addresses']) ? Q(implode(', ', $action['addresses']), 'strict', false) : $action['addresses']) . '" size="35" ' + . $this->error_class($id, 'action', 'addresses', 'action_addr') .' />'; + $out .= '<br /><span class="label">' . Q($this->gettext('vacationdays')) . '</span><br />' + .'<input type="text" name="_action_days['.$id.']" id="action_days'.$id.'" ' + .'value="' .Q($action['days'], 'strict', false) . '" size="2" ' + . $this->error_class($id, 'action', 'days', 'action_days') .' />'; + $out .= '</div>'; + + // flags + $flags = array( + 'read' => '\\Seen', + 'answered' => '\\Answered', + 'flagged' => '\\Flagged', + 'deleted' => '\\Deleted', + 'draft' => '\\Draft', + ); + $flags_target = (array)$action['target']; + + $out .= '<div id="action_flags' .$id.'" style="display:' + . (preg_match('/^(set|add|remove)flag$/', $action['type']) ? 'inline' : 'none') . '"' + . $this->error_class($id, 'action', 'flags', 'action_flags') . '>'; + foreach ($flags as $fidx => $flag) { + $out .= '<input type="checkbox" name="_action_flags[' .$id .'][]" value="' . $flag . '"' + . (in_array_nocase($flag, $flags_target) ? 'checked="checked"' : '') . ' />' + . Q($this->gettext('flag'.$fidx)) .'<br>'; + } + $out .= '</div>'; + + // mailbox select + if ($action['type'] == 'fileinto') + $mailbox = $this->mod_mailbox($action['target'], 'out'); + else + $mailbox = ''; + + $this->rc->imap_connect(); + $select = rcmail_mailbox_select(array( + 'realnames' => false, + 'maxlength' => 100, + 'id' => 'action_mailbox' . $id, + 'name' => "_action_mailbox[$id]", + 'style' => 'display:'.(!isset($action) || $action['type']=='fileinto' ? 'inline' : 'none') + )); + $out .= $select->show($mailbox); + $out .= '</td>'; + + // add/del buttons + $out .= '<td class="rowbuttons">'; + $out .= '<a href="#" id="actionadd' . $id .'" title="'. Q($this->gettext('add')). '" + onclick="rcmail.managesieve_actionadd(' . $id .')" class="button add"></a>'; + $out .= '<a href="#" id="actiondel' . $id .'" title="'. Q($this->gettext('del')). '" + onclick="rcmail.managesieve_actiondel(' . $id .')" class="button del' . ($rows_num<2 ? ' disabled' : '') .'"></a>'; + $out .= '</td>'; + + $out .= '</tr></table>'; + + $out .= $div ? "</div>\n" : ''; + + return $out; + } + + private function genid() + { + $result = intval(rcube_timer()); + return $result; + } + + private function strip_value($str, $allow_html=false) + { + if (!$allow_html) + $str = strip_tags($str); + + return trim($str); + } + + private function error_class($id, $type, $target, $elem_prefix='') + { + // TODO: tooltips + if (($type == 'test' && ($str = $this->errors['tests'][$id][$target])) || + ($type == 'action' && ($str = $this->errors['actions'][$id][$target])) + ) { + $this->add_tip($elem_prefix.$id, $str, true); + return ' class="error"'; + } + + return ''; + } + + private function add_tip($id, $str, $error=false) + { + if ($error) + $str = html::span('sieve error', $str); + + $this->tips[] = array($id, $str); + } + + private function print_tips() + { + if (empty($this->tips)) + return; + + $script = JS_OBJECT_NAME.'.managesieve_tip_register('.json_encode($this->tips).');'; + $this->rc->output->add_script($script, 'foot'); + } + + /** + * Converts mailbox name from/to UTF7-IMAP from/to internal Sieve encoding + * with delimiter replacement. + * + * @param string $mailbox Mailbox name + * @param string $mode Conversion direction ('in'|'out') + * + * @return string Mailbox name + */ + private function mod_mailbox($mailbox, $mode = 'out') + { + $delimiter = $_SESSION['imap_delimiter']; + $replace_delimiter = $this->rc->config->get('managesieve_replace_delimiter'); + $mbox_encoding = $this->rc->config->get('managesieve_mbox_encoding', 'UTF7-IMAP'); + + if ($mode == 'out') { + $mailbox = rcube_charset_convert($mailbox, $mbox_encoding, 'UTF7-IMAP'); + if ($replace_delimiter && $replace_delimiter != $delimiter) + $mailbox = str_replace($replace_delimiter, $delimiter, $mailbox); + } + else { + $mailbox = rcube_charset_convert($mailbox, 'UTF7-IMAP', $mbox_encoding); + if ($replace_delimiter && $replace_delimiter != $delimiter) + $mailbox = str_replace($delimiter, $replace_delimiter, $mailbox); + } + + return $mailbox; + } + + /** + * List sieve scripts + * + * @return array Scripts list + */ + public function list_scripts() + { + if ($this->list !== null) { + return $this->list; + } + + $this->list = $this->sieve->get_scripts(); + + // Handle active script(s) and list of scripts according to Kolab's KEP:14 + if ($this->rc->config->get('managesieve_kolab_master')) { + + // Skip protected names + foreach ((array)$this->list as $idx => $name) { + $_name = strtoupper($name); + if ($_name == 'MASTER') + $master_script = $name; + else if ($_name == 'MANAGEMENT') + $management_script = $name; + else if($_name == 'USER') + $user_script = $name; + else + continue; + + unset($this->list[$idx]); + } + + // get active script(s), read USER script + if ($user_script) { + $extension = $this->rc->config->get('managesieve_filename_extension', '.sieve'); + $filename_regex = '/'.preg_quote($extension, '/').'$/'; + $_SESSION['managesieve_user_script'] = $user_script; + + $this->sieve->load($user_script); + + foreach ($this->sieve->script->as_array() as $rules) { + foreach ($rules['actions'] as $action) { + if ($action['type'] == 'include' && empty($action['global'])) { + $name = preg_replace($filename_regex, '', $action['target']); + $this->active[] = $name; + } + } + } + } + // create USER script if it doesn't exist + else { + $content = "# USER Management Script\n" + ."#\n" + ."# This script includes the various active sieve scripts\n" + ."# it is AUTOMATICALLY GENERATED. DO NOT EDIT MANUALLY!\n" + ."#\n" + ."# For more information, see http://wiki.kolab.org/KEP:14#USER\n" + ."#\n"; + if ($this->sieve->save_script('USER', $content)) { + $_SESSION['managesieve_user_script'] = 'USER'; + if (empty($this->master_file)) + $this->sieve->activate('USER'); + } + } + } + else if (!empty($this->list)) { + // Get active script name + if ($active = $this->sieve->get_active()) { + $this->active = array($active); + } + } + + return $this->list; + } + + /** + * Removes sieve script + * + * @param string $name Script name + * + * @return bool True on success, False on failure + */ + public function remove_script($name) + { + $result = $this->sieve->remove($name); + + // Kolab's KEP:14 + if ($result && $this->rc->config->get('managesieve_kolab_master')) { + $this->deactivate_script($name); + } + + return $result; + } + + /** + * Activates sieve script + * + * @param string $name Script name + * + * @return bool True on success, False on failure + */ + public function activate_script($name) + { + // Kolab's KEP:14 + if ($this->rc->config->get('managesieve_kolab_master')) { + $extension = $this->rc->config->get('managesieve_filename_extension', '.sieve'); + $user_script = $_SESSION['managesieve_user_script']; + + // if the script is not active... + if ($user_script && ($key = array_search($name, $this->active)) === false) { + // ...rewrite USER file adding appropriate include command + if ($this->sieve->load($user_script)) { + $script = $this->sieve->script->as_array(); + $list = array(); + $regexp = '/' . preg_quote($extension, '/') . '$/'; + + // Create new include entry + $rule = array( + 'actions' => array( + 0 => array( + 'target' => $name.$extension, + 'type' => 'include', + 'personal' => true, + ))); + + // get all active scripts for sorting + foreach ($script as $rid => $rules) { + foreach ($rules['actions'] as $aid => $action) { + if ($action['type'] == 'include' && empty($action['global'])) { + $target = $extension ? preg_replace($regexp, '', $action['target']) : $action['target']; + $list[] = $target; + } + } + } + $list[] = $name; + + // Sort and find current script position + asort($list, SORT_LOCALE_STRING); + $list = array_values($list); + $index = array_search($name, $list); + + // add rule at the end of the script + if ($index === false || $index == count($list)-1) { + $this->sieve->script->add_rule($rule); + } + // add rule at index position + else { + $script2 = array(); + foreach ($script as $rid => $rules) { + if ($rid == $index) { + $script2[] = $rule; + } + $script2[] = $rules; + } + $this->sieve->script->content = $script2; + } + + $result = $this->sieve->save(); + if ($result) { + $this->active[] = $name; + } + } + } + } + else { + $result = $this->sieve->activate($name); + if ($result) + $this->active = array($name); + } + + return $result; + } + + /** + * Deactivates sieve script + * + * @param string $name Script name + * + * @return bool True on success, False on failure + */ + public function deactivate_script($name) + { + // Kolab's KEP:14 + if ($this->rc->config->get('managesieve_kolab_master')) { + $extension = $this->rc->config->get('managesieve_filename_extension', '.sieve'); + $user_script = $_SESSION['managesieve_user_script']; + + // if the script is active... + if ($user_script && ($key = array_search($name, $this->active)) !== false) { + // ...rewrite USER file removing appropriate include command + if ($this->sieve->load($user_script)) { + $script = $this->sieve->script->as_array(); + $name = $name.$extension; + + foreach ($script as $rid => $rules) { + foreach ($rules['actions'] as $aid => $action) { + if ($action['type'] == 'include' && empty($action['global']) + && $action['target'] == $name + ) { + break 2; + } + } + } + + // Entry found + if ($rid < count($script)) { + $this->sieve->script->delete_rule($rid); + $result = $this->sieve->save(); + if ($result) { + unset($this->active[$key]); + } + } + } + } + } + else { + $result = $this->sieve->deactivate(); + if ($result) + $this->active = array(); + } + + return $result; + } + + /** + * Saves current script (adding some variables) + */ + public function save_script($name = null) + { + // Kolab's KEP:14 + if ($this->rc->config->get('managesieve_kolab_master')) { + $this->sieve->script->set_var('EDITOR', self::PROGNAME); + $this->sieve->script->set_var('EDITOR_VERSION', self::VERSION); + } + + return $this->sieve->save($name); + } + + /** + * Returns list of rules from the current script + * + * @return array List of rules + */ + public function list_rules() + { + $result = array(); + $i = 1; + + foreach ($this->script as $idx => $filter) { + if ($filter['type'] != 'if') { + continue; + } + $fname = $filter['name'] ? $filter['name'] : "#$i"; + $result[] = array( + 'id' => $idx, + 'name' => Q($fname), + 'class' => $filter['disabled'] ? 'disabled' : '', + ); + $i++; + } + + return $result; + } +} diff --git a/plugins/managesieve/skins/default/images/add.png b/plugins/managesieve/skins/default/images/add.png Binary files differnew file mode 100644 index 000000000..97a6422fb --- /dev/null +++ b/plugins/managesieve/skins/default/images/add.png diff --git a/plugins/managesieve/skins/default/images/del.png b/plugins/managesieve/skins/default/images/del.png Binary files differnew file mode 100644 index 000000000..518905bc4 --- /dev/null +++ b/plugins/managesieve/skins/default/images/del.png diff --git a/plugins/managesieve/skins/default/images/filter.png b/plugins/managesieve/skins/default/images/filter.png Binary files differnew file mode 100644 index 000000000..a79ba1083 --- /dev/null +++ b/plugins/managesieve/skins/default/images/filter.png diff --git a/plugins/managesieve/skins/default/images/toolbar.png b/plugins/managesieve/skins/default/images/toolbar.png Binary files differnew file mode 100644 index 000000000..473dbc8df --- /dev/null +++ b/plugins/managesieve/skins/default/images/toolbar.png diff --git a/plugins/managesieve/skins/default/managesieve.css b/plugins/managesieve/skins/default/managesieve.css new file mode 100644 index 000000000..cef26d4f3 --- /dev/null +++ b/plugins/managesieve/skins/default/managesieve.css @@ -0,0 +1,283 @@ +#filtersetslistbox +{ + position: absolute; + top: 0; + bottom: 0; + left: 0; + width: 195px; + border: 1px solid #999999; + background-color: #F9F9F9; + overflow: hidden; + /* css hack for IE */ + height: expression(parseInt(this.parentNode.offsetHeight)+'px'); +} + +#filtersscreen +{ + position: absolute; + top: 0; + right: 0; + bottom: 0; + left: 205px; + /* css hack for IE */ + height: expression(parseInt(this.parentNode.offsetHeight)+'px'); +} + +#filterslistbox +{ + position: absolute; + left: 0; + top: 0; + bottom: 0; + border: 1px solid #999999; + overflow: auto; + /* css hack for IE */ + height: expression(parseInt(this.parentNode.offsetHeight)+'px'); +} + +#filterslist, +#filtersetslist +{ + width: 100%; + table-layout: fixed; +} + +#filterslist tbody td, +#filtersetslist tbody td +{ + cursor: default; + text-overflow: ellipsis; + -o-text-overflow: ellipsis; +} + +#filterslist tbody tr.disabled td, +#filtersetslist tbody tr.disabled td +{ + color: #999999; +} + +#filtersetslist tbody td +{ + font-weight: bold; +} +/* +#filtersetslist tr.selected +{ + background-color: #929292; + border-bottom: 1px solid #898989; + color: #FFF; + font-weight: bold; +} +*/ + +#filterslist tbody tr.filtermoveup td +{ + border-top: 2px dotted #555; + padding-top: 0px; +} + +#filterslist tbody tr.filtermovedown td +{ + border-bottom: 2px dotted #555; + padding-bottom: 1px; +} + +#filter-box +{ + position: absolute; + top: 0; + right: 0; + bottom: 0; + border: 1px solid #999999; + overflow: hidden; + /* css hack for IE */ + width: expression((parseInt(this.parentNode.offsetWidth)-20-parseInt(document.getElementById('filterslistbox').offsetWidth))+'px'); + height: expression(parseInt(this.parentNode.offsetHeight)+'px'); +} + +#filter-frame +{ + border: none; +} + +body.iframe +{ + min-width: 620px; + width: expression(Math.max(620, document.documentElement.clientWidth)+'px'); + background-color: #F2F2F2; +} + +#filter-form +{ + min-width: 550px; + white-space: nowrap; + padding: 20px 10px 10px 10px; +} + +legend, label +{ + color: #666666; +} + +#rules, #actions +{ + margin-top: 5px; + padding: 0; + border-collapse: collapse; +} + +div.rulerow, div.actionrow +{ + width: auto; + padding: 2px; + white-space: nowrap; + border: 1px solid #F2F2F2; +} + +div.rulerow:hover, div.actionrow:hover +{ + padding: 2px; + white-space: nowrap; + background: #F9F9F9; + border: 1px solid silver; +} + +div.rulerow table, div.actionrow table +{ + padding: 0px; + width: 100%; + min-width: 620px; +} + +td.rowbuttons +{ + text-align: right; + white-space: nowrap; + width: 1%; +} + +td.rowactions +{ + white-space: nowrap; + width: 1%; +} + +td.rowtargets +{ + white-space: nowrap; + width: 98%; + padding-left: 3px; +} + +input.disabled, input.disabled:hover +{ + color: #999999; +} + +input.error, textarea.error +{ + background-color: #FFFF88; +} + +input.box, +input.radio +{ + border: 0; +} + +select.operator_selector +{ + width: 200px; +} + +span.label +{ + color: #666666; + font-size: 10px; + white-space: nowrap; +} + +#footer +{ + padding-top: 5px; + width: 100%; +} + +#footer .footerleft +{ + padding-left: 2px; + white-space: nowrap; + float: left; +} + +#footer .footerright +{ + padding-right: 2px; + white-space: nowrap; + text-align: right; + float: right; +} + +.itemlist +{ + line-height: 25px; +} + +.itemlist input +{ + vertical-align: middle; +} + +span.sieve.error +{ + color: red; +} + +#managesieve-tip +{ + width: 200px; +} + +a.button.add +{ + background: url(images/add.png) no-repeat; + width: 30px; + height: 20px; + margin-right: 4px; + display: inline-block; +} + +a.button.del +{ + background: url(images/del.png) no-repeat; + width: 30px; + height: 20px; + display: inline-block; +} + +a.button.disabled +{ + opacity: 0.35; + filter: alpha(opacity=35); + cursor: default; +} + +#filter-form select, +#filter-form input, +#filter-form textarea +{ + font-size: 11px; +} + +/* fixes for popup window */ + +body.iframe.mail +{ + margin: 0; + padding: 0; +} + +body.iframe.mail #filter-form +{ + padding: 10px 5px 5px 5px; +} diff --git a/plugins/managesieve/skins/default/managesieve_mail.css b/plugins/managesieve/skins/default/managesieve_mail.css new file mode 100644 index 000000000..7fefaedf1 --- /dev/null +++ b/plugins/managesieve/skins/default/managesieve_mail.css @@ -0,0 +1,63 @@ +#messagemenu li a.filterlink { + background-image: url(images/filter.png); + background-position: 7px 0; +} + +#sievefilterform { + top: 0; + bottom: 0; + left: 0; + right: 0; + background-color: #F2F2F2; + border: 1px solid #999999; + padding: 0; + margin: 5px; +} + +#sievefilterform iframe { + top: 0; + bottom: 0; + left: 0; + right: 0; + width: 100%; + min-height: 100%; /* Chrome 14 bug */ + background-color: #F2F2F2; + border: 0; + padding: 0; + margin: 0; +} + +#sievefilterform ul { + list-style: none; + padding: 0; + margin: 0; + margin-top: 5px; +} + +#sievefilterform fieldset { + margin: 5px; +} + +#sievefilterform ul li { + margin-bottom: 5px; + white-space: nowrap; +} + +#sievefilterform ul li input { + margin-right: 5px; +} + +#sievefilterform label { + font-weight: bold; +} + +#managesieve-tip +{ + width: 200px; + z-index: 100000; +} + +span.sieve.error +{ + color: red; +} diff --git a/plugins/managesieve/skins/default/templates/filteredit.html b/plugins/managesieve/skins/default/templates/filteredit.html new file mode 100644 index 000000000..6ecb03cae --- /dev/null +++ b/plugins/managesieve/skins/default/templates/filteredit.html @@ -0,0 +1,33 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<title><roundcube:object name="pagetitle" /></title> +<roundcube:include file="/includes/links.html" /> +<link rel="stylesheet" type="text/css" href="/this/managesieve.css" /> +</head> +<body class="iframe<roundcube:exp expression="env:task != 'mail' ? '' : ' mail'" />"> + +<roundcube:if condition="env:task != 'mail'" /> +<div id="filter-title" class="boxtitle"><roundcube:label name="managesieve.filterdef" /></div> +<roundcube:endif /> + +<div id="filter-form" class="boxcontent"> +<roundcube:object name="filterform" /> + +<roundcube:if condition="env:task != 'mail'" /> +<div id="footer"> +<div class="footerleft"> +<roundcube:button command="plugin.managesieve-save" type="input" class="button mainaction" label="save" /> +</div> +<div class="footerright"> +<label for="disabled"><roundcube:label name="managesieve.filterdisabled" /></label> +<input type="checkbox" id="disabled" name="_disabled" value="1" /> +</div> +</div> +<roundcube:endif /> + +</form> +</div> + +</body> +</html> diff --git a/plugins/managesieve/skins/default/templates/managesieve.html b/plugins/managesieve/skins/default/templates/managesieve.html new file mode 100644 index 000000000..71eebe105 --- /dev/null +++ b/plugins/managesieve/skins/default/templates/managesieve.html @@ -0,0 +1,87 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<title><roundcube:object name="pagetitle" /></title> +<roundcube:include file="/includes/links.html" /> +<link rel="stylesheet" type="text/css" href="/this/managesieve.css" /> +<script type="text/javascript" src="/functions.js"></script> +<script type="text/javascript" src="/splitter.js"></script> + +<style type="text/css"> +#filterslistbox { width: <roundcube:exp expression="!empty(cookie:sieveviewsplitter) ? cookie:sieveviewsplitter-5 : 210" />px; } +#filter-box { left: <roundcube:exp expression="!empty(cookie:sieveviewsplitter) ? cookie:sieveviewsplitter+5 : 220" />px; +<roundcube:exp expression="browser:ie ? ('width:expression((parseInt(this.parentNode.offsetWidth)-'.(!empty(cookie:sieveviewsplitter) ? cookie:sieveviewsplitter+5 : 220).')+\\'px\\');') : ''" /> +} +#filtersetslistbox { width: <roundcube:exp expression="!empty(cookie:sieveviewsplitter2) ? cookie:sieveviewsplitter2-5 : 175" />px; } +#filtersscreen { left: <roundcube:exp expression="!empty(cookie:sieveviewsplitter2) ? cookie:sieveviewsplitter2+5 : 185" />px; +<roundcube:exp expression="browser:ie ? ('width:expression((parseInt(this.parentNode.offsetWidth)-'.(!empty(cookie:sieveviewsplitter2) ? cookie:sieveviewsplitter2+5 : 185).')+\\'px\\');') : ''" /> +} +</style> + +</head> +<body onload="rcube_init_mail_ui()"> + +<roundcube:include file="/includes/taskbar.html" /> +<roundcube:include file="/includes/header.html" /> +<roundcube:include file="/includes/settingstabs.html" /> + +<div id="mainscreen"> + +<div id="filtersetslistbox"> +<div id="filtersetslist-title" class="boxtitle"><roundcube:label name="managesieve.filtersets" /></div> +<div class="boxlistcontent"> + <roundcube:object name="filtersetslist" id="filtersetslist" class="records-table" cellspacing="0" summary="Filters list" type="list" noheader="true" /> +</div> +<div class="boxfooter"> + <roundcube:button command="plugin.managesieve-setadd" type="link" title="managesieve.filtersetadd" class="buttonPas addfilterset" classAct="button addfilterset" content=" " /> + <roundcube:button name="filtersetmenulink" id="filtersetmenulink" type="link" title="moreactions" class="button groupactions" onclick="rcmail_ui.show_popup('filtersetmenu', undefined, {above:1});return false" content=" " /> +</div> +</div> + +<div id="filtersscreen"> +<div id="filterslistbox"> +<div class="boxtitle"><roundcube:label name="managesieve.filters" /></div> +<div class="boxlistcontent"> + <roundcube:object name="filterslist" id="filterslist" class="records-table" cellspacing="0" summary="Filters list" noheader="true" /> +</div> +<div class="boxfooter"> + <roundcube:button command="plugin.managesieve-add" type="link" title="managesieve.filteradd" class="buttonPas addfilter" classAct="button addfilter" content=" " /> + <roundcube:button name="filtermenulink" id="filtermenulink" type="link" title="moreactions" class="button groupactions" onclick="rcmail_ui.show_popup('filtermenu', undefined, {above:1});return false" content=" " /> +</div> +</div> + +<script type="text/javascript"> + var sieveviewsplit2 = new rcube_splitter({id:'sieveviewsplitter2', p1: 'filtersetslistbox', p2: 'filtersscreen', orientation: 'v', relative: true, start: 200}); + rcmail.add_onload('sieveviewsplit2.init()'); + + var sieveviewsplit = new rcube_splitter({id:'sieveviewsplitter', p1: 'filterslistbox', p2: 'filter-box', orientation: 'v', relative: true, start: 215}); + rcmail.add_onload('sieveviewsplit.init()'); +</script> + +<div id="filter-box"> + <roundcube:object name="filterframe" id="filter-frame" width="100%" height="100%" frameborder="0" src="/watermark.html" /> +</div> + +</div> +</div> +</div> + +<div id="filtersetmenu" class="popupmenu"> + <ul> + <li><roundcube:button command="plugin.managesieve-setact" label="managesieve.enable" classAct="active" /></li> + <li><roundcube:button command="plugin.managesieve-setdel" label="delete" classAct="active" /></li> + <li class="separator_above"><roundcube:button command="plugin.managesieve-setget" label="download" classAct="active" /></li> + <roundcube:container name="filtersetoptions" id="filtersetmenu" /> + </ul> +</div> + +<div id="filtermenu" class="popupmenu"> + <ul> + <li><roundcube:button command="plugin.managesieve-act" label="managesieve.enable" classAct="active" /></li> + <li><roundcube:button command="plugin.managesieve-del" label="delete" classAct="active" /></li> + <roundcube:container name="filteroptions" id="filtermenu" /> + </ul> +</div> + +</body> +</html> diff --git a/plugins/managesieve/skins/default/templates/setedit.html b/plugins/managesieve/skins/default/templates/setedit.html new file mode 100644 index 000000000..26f7fece6 --- /dev/null +++ b/plugins/managesieve/skins/default/templates/setedit.html @@ -0,0 +1,24 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<title><roundcube:object name="pagetitle" /></title> +<roundcube:include file="/includes/links.html" /> +<link rel="stylesheet" type="text/css" href="/this/managesieve.css" /> +</head> +<body class="iframe"> + +<div id="filter-title" class="boxtitle"><roundcube:label name="managesieve.newfilterset" /></div> + +<div id="filter-form" class="boxcontent"> +<roundcube:object name="filtersetform" /> + +<p> +<roundcube:button command="plugin.managesieve-save" type="input" class="button mainaction" label="save" /> +</p> + +</form> +</div> + + +</body> +</html> diff --git a/plugins/managesieve/tests/Makefile b/plugins/managesieve/tests/Makefile new file mode 100644 index 000000000..072be2f2c --- /dev/null +++ b/plugins/managesieve/tests/Makefile @@ -0,0 +1,7 @@ + +clean: + rm -f *.log *.php *.diff *.exp *.out + + +test: + pear run-tests *.phpt diff --git a/plugins/managesieve/tests/parser.phpt b/plugins/managesieve/tests/parser.phpt new file mode 100644 index 000000000..d70353459 --- /dev/null +++ b/plugins/managesieve/tests/parser.phpt @@ -0,0 +1,114 @@ +--TEST-- +Main test of script parser +--SKIPIF-- +--FILE-- +<?php +include '../lib/rcube_sieve_script.php'; + +$txt = ' +require ["fileinto","vacation","reject","relational","comparator-i;ascii-numeric","imapflags"]; +# rule:[spam] +if anyof (header :contains "X-DSPAM-Result" "Spam") +{ + fileinto "Spam"; + stop; +} +# rule:[test1] +if anyof (header :contains ["From","To"] "test@domain.tld") +{ + discard; + stop; +} +# rule:[test2] +if anyof (not header :contains ["Subject"] "[test]", header :contains "Subject" "[test2]") +{ + fileinto "test"; + stop; +} +# rule:[test-vacation] +if anyof (header :contains "Subject" "vacation") +{ + vacation :days 1 text: +# test +test test /* test */ +test +. +; + stop; +} +# rule:[comments] +if anyof (true) /* comment + * "comment" #comment */ { + /* comment */ stop; +# comment +} +# rule:[reject] +if size :over 5000K { + reject "Message over 5MB size limit. Please contact me before sending this."; +} +# rule:[redirect] +if header :value "ge" :comparator "i;ascii-numeric" + ["X-Spam-score"] ["14"] {redirect "test@test.tld";} +# rule:[imapflags] +if header :matches "Subject" "^Test$" { + setflag "\\\\Seen"; + addflag ["\\\\Answered","\\\\Deleted"]; +} +'; + +$s = new rcube_sieve_script($txt); +echo $s->as_text(); + +?> +--EXPECT-- +require ["fileinto","vacation","reject","relational","comparator-i;ascii-numeric","imapflags"]; +# rule:[spam] +if header :contains "X-DSPAM-Result" "Spam" +{ + fileinto "Spam"; + stop; +} +# rule:[test1] +if header :contains ["From","To"] "test@domain.tld" +{ + discard; + stop; +} +# rule:[test2] +if anyof (not header :contains "Subject" "[test]", header :contains "Subject" "[test2]") +{ + fileinto "test"; + stop; +} +# rule:[test-vacation] +if header :contains "Subject" "vacation" +{ + vacation :days 1 text: +# test +test test /* test */ +test +. +; + stop; +} +# rule:[comments] +if true +{ + stop; +} +# rule:[reject] +if size :over 5000K +{ + reject "Message over 5MB size limit. Please contact me before sending this."; +} +# rule:[redirect] +if header :value "ge" :comparator "i;ascii-numeric" "X-Spam-score" "14" +{ + redirect "test@test.tld"; +} +# rule:[imapflags] +if header :matches "Subject" "^Test$" +{ + setflag "\\Seen"; + addflag ["\\Answered","\\Deleted"]; +} diff --git a/plugins/managesieve/tests/parser_kep14.phpt b/plugins/managesieve/tests/parser_kep14.phpt new file mode 100644 index 000000000..06beaeda1 --- /dev/null +++ b/plugins/managesieve/tests/parser_kep14.phpt @@ -0,0 +1,19 @@ +--TEST-- +Test of Kolab's KEP:14 implementation +--SKIPIF-- +--FILE-- +<?php +include '../lib/rcube_sieve_script.php'; + +$txt = ' +# EDITOR Roundcube +# EDITOR_VERSION 123 +'; + +$s = new rcube_sieve_script($txt, array()); +echo $s->as_text(); + +?> +--EXPECT-- +# EDITOR Roundcube +# EDITOR_VERSION 123 diff --git a/plugins/managesieve/tests/tokenize.phpt b/plugins/managesieve/tests/tokenize.phpt new file mode 100644 index 000000000..f988653ee --- /dev/null +++ b/plugins/managesieve/tests/tokenize.phpt @@ -0,0 +1,66 @@ +--TEST-- +Script parsing: tokenizer +--SKIPIF-- +--FILE-- +<?php +include '../lib/rcube_sieve_script.php'; + +$txt[1] = array(1, 'text: #test +This is test ; message; +Multi line +. +; +'); +$txt[2] = array(0, '["test1","test2"]'); +$txt[3] = array(1, '["test"]'); +$txt[4] = array(1, '"te\\"st"'); +$txt[5] = array(0, 'test #comment'); +$txt[6] = array(0, 'text: +test +. +text: +test +. +'); +$txt[7] = array(1, '"\\a\\\\\\"a"'); + +foreach ($txt as $idx => $t) { + echo "[$idx]---------------\n"; + var_dump(rcube_sieve_script::tokenize($t[1], $t[0])); +} +?> +--EXPECT-- +[1]--------------- +string(34) "This is test ; message; +Multi line" +[2]--------------- +array(1) { + [0]=> + array(2) { + [0]=> + string(5) "test1" + [1]=> + string(5) "test2" + } +} +[3]--------------- +array(1) { + [0]=> + string(4) "test" +} +[4]--------------- +string(5) "te"st" +[5]--------------- +array(1) { + [0]=> + string(4) "test" +} +[6]--------------- +array(2) { + [0]=> + string(4) "test" + [1]=> + string(4) "test" +} +[7]--------------- +string(4) "a\"a" diff --git a/plugins/markasjunk/localization/cs_CZ.inc b/plugins/markasjunk/localization/cs_CZ.inc new file mode 100644 index 000000000..18509cf51 --- /dev/null +++ b/plugins/markasjunk/localization/cs_CZ.inc @@ -0,0 +1,24 @@ +<?php + +/* + ++-----------------------------------------------------------------------+ +| language/cs_CZ/labels.inc | +| | +| Language file of the Roundcube markasjunk plugin | +| Copyright (C) 2005-2009, The Roundcube Dev Team | +| Licensed under the GNU GPL | +| | ++-----------------------------------------------------------------------+ +| Author: Milan Kozak <hodza@hodza.net> | ++-----------------------------------------------------------------------+ + +@version $Id: labels.inc 2993 2009-09-26 18:32:07Z alec $ + +*/ + +$labels = array(); +$labels['buttontitle'] = 'Označit jako Spam'; +$labels['reportedasjunk'] = 'Úspěšně nahlášeno jako Spam'; + +?>
\ No newline at end of file diff --git a/plugins/markasjunk/localization/da_DK.inc b/plugins/markasjunk/localization/da_DK.inc new file mode 100644 index 000000000..e351b0f61 --- /dev/null +++ b/plugins/markasjunk/localization/da_DK.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['buttontitle'] = 'Marker som junk mail'; +$labels['reportedasjunk'] = 'Successfuldt rapporteret som junk mail'; + +?> diff --git a/plugins/markasjunk/localization/de_DE.inc b/plugins/markasjunk/localization/de_DE.inc new file mode 100644 index 000000000..f21edf7cd --- /dev/null +++ b/plugins/markasjunk/localization/de_DE.inc @@ -0,0 +1,6 @@ +<?php +// translation done by Ulli Heist - http://heist.hobby-site.org/ +$labels = array(); +$labels['buttontitle'] = 'als SPAM markieren'; +$labels['reportedasjunk'] = 'Erfolgreich als SPAM gemeldet'; +?>
\ No newline at end of file diff --git a/plugins/markasjunk/localization/en_US.inc b/plugins/markasjunk/localization/en_US.inc new file mode 100644 index 000000000..6f63e161a --- /dev/null +++ b/plugins/markasjunk/localization/en_US.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['buttontitle'] = 'Mark as Junk'; +$labels['reportedasjunk'] = 'Successfully reported as Junk'; + +?>
\ No newline at end of file diff --git a/plugins/markasjunk/localization/es_AR.inc b/plugins/markasjunk/localization/es_AR.inc new file mode 100644 index 000000000..decdde2a8 --- /dev/null +++ b/plugins/markasjunk/localization/es_AR.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['buttontitle'] = 'Marcar como SPAM'; +$labels['reportedasjunk'] = 'Mensaje reportado como SPAM'; + +?> diff --git a/plugins/markasjunk/localization/es_ES.inc b/plugins/markasjunk/localization/es_ES.inc new file mode 100644 index 000000000..8e5ca492d --- /dev/null +++ b/plugins/markasjunk/localization/es_ES.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['buttontitle'] = 'Marcar como SPAM'; +$labels['reportedasjunk'] = 'Mensaje informado como SPAM'; + +?> diff --git a/plugins/markasjunk/localization/et_EE.inc b/plugins/markasjunk/localization/et_EE.inc new file mode 100644 index 000000000..daf140512 --- /dev/null +++ b/plugins/markasjunk/localization/et_EE.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['buttontitle'] = 'Märgista Rämpsuks'; +$labels['reportedasjunk'] = 'Edukalt Rämpsuks märgitud'; + +?> diff --git a/plugins/markasjunk/localization/gl_ES.inc b/plugins/markasjunk/localization/gl_ES.inc new file mode 100644 index 000000000..b1f49a23e --- /dev/null +++ b/plugins/markasjunk/localization/gl_ES.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['buttontitle'] = 'Marcar como correo lixo'; +$labels['reportedasjunk'] = 'Mensaxe marcada como correo lixo'; + +?> diff --git a/plugins/markasjunk/localization/it_IT.inc b/plugins/markasjunk/localization/it_IT.inc new file mode 100644 index 000000000..cc44fae21 --- /dev/null +++ b/plugins/markasjunk/localization/it_IT.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['buttontitle'] = 'Marca come Spam'; +$labels['reportedasjunk'] = 'Messaggio marcato come Spam'; + +?>
\ No newline at end of file diff --git a/plugins/markasjunk/localization/ja_JP.inc b/plugins/markasjunk/localization/ja_JP.inc new file mode 100644 index 000000000..bd5b8b203 --- /dev/null +++ b/plugins/markasjunk/localization/ja_JP.inc @@ -0,0 +1,9 @@ +<?php + +// EN-Revision: 3891 + +$labels = array(); +$labels['buttontitle'] = '迷惑メールとして設定'; +$labels['reportedasjunk'] = '迷惑メールとして報告することに成功しました。'; + +?>
\ No newline at end of file diff --git a/plugins/markasjunk/localization/pl_PL.inc b/plugins/markasjunk/localization/pl_PL.inc new file mode 100644 index 000000000..a98f0aab3 --- /dev/null +++ b/plugins/markasjunk/localization/pl_PL.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['buttontitle'] = 'Oznacz jako SPAM'; +$labels['reportedasjunk'] = 'Pomyślnie oznaczono jako SPAM'; + +?> diff --git a/plugins/markasjunk/localization/ru_RU.inc b/plugins/markasjunk/localization/ru_RU.inc new file mode 100644 index 000000000..32d00c2df --- /dev/null +++ b/plugins/markasjunk/localization/ru_RU.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['buttontitle'] = 'Переместить в "СПАМ"'; +$labels['reportedasjunk'] = 'Перемещено в "СПАМ"'; + +?> diff --git a/plugins/markasjunk/localization/sk_SK.inc b/plugins/markasjunk/localization/sk_SK.inc new file mode 100644 index 000000000..b56ac46af --- /dev/null +++ b/plugins/markasjunk/localization/sk_SK.inc @@ -0,0 +1,15 @@ +<?php + +/** + * Slovak translation for Roundcube markasjunk plugin + * + * @version 1.0 (2010-10-18) + * @author panda <admin@whistler.sk> + * + */ + +$labels = array(); +$labels['buttontitle'] = 'Označiť ako Spam'; +$labels['reportedasjunk'] = 'Úspešne nahlásené ako Spam'; + +?> diff --git a/plugins/markasjunk/localization/sv_SE.inc b/plugins/markasjunk/localization/sv_SE.inc new file mode 100644 index 000000000..f4c5959b9 --- /dev/null +++ b/plugins/markasjunk/localization/sv_SE.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['buttontitle'] = 'Märk som skräp'; +$labels['reportedasjunk'] = 'Framgångsrikt rapporterat som skräp'; + +?>
\ No newline at end of file diff --git a/plugins/markasjunk/localization/zh_TW.inc b/plugins/markasjunk/localization/zh_TW.inc new file mode 100644 index 000000000..7b0b22162 --- /dev/null +++ b/plugins/markasjunk/localization/zh_TW.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['buttontitle'] = '標示為垃圾信'; +$labels['reportedasjunk'] = '成功回報垃圾信'; + +?> diff --git a/plugins/markasjunk/markasjunk.js b/plugins/markasjunk/markasjunk.js new file mode 100644 index 000000000..0e30fb8f2 --- /dev/null +++ b/plugins/markasjunk/markasjunk.js @@ -0,0 +1,28 @@ +/* Mark-as-Junk plugin script */ + +function rcmail_markasjunk(prop) +{ + if (!rcmail.env.uid && (!rcmail.message_list || !rcmail.message_list.get_selection().length)) + return; + + var uids = rcmail.env.uid ? rcmail.env.uid : rcmail.message_list.get_selection().join(','), + lock = rcmail.set_busy(true, 'loading'); + + rcmail.http_post('plugin.markasjunk', '_uid='+uids+'&_mbox='+urlencode(rcmail.env.mailbox), lock); +} + +// callback for app-onload event +if (window.rcmail) { + rcmail.addEventListener('init', function(evt) { + + // register command (directly enable in message view mode) + rcmail.register_command('plugin.markasjunk', rcmail_markasjunk, rcmail.env.uid); + + // add event-listener to message list + if (rcmail.message_list) + rcmail.message_list.addEventListener('select', function(list){ + rcmail.enable_command('plugin.markasjunk', list.get_selection().length > 0); + }); + }) +} + diff --git a/plugins/markasjunk/markasjunk.php b/plugins/markasjunk/markasjunk.php new file mode 100644 index 000000000..697d880ca --- /dev/null +++ b/plugins/markasjunk/markasjunk.php @@ -0,0 +1,58 @@ +<?php + +/** + * Mark as Junk + * + * Sample plugin that adds a new button to the mailbox toolbar + * to mark the selected messages as Junk and move them to the Junk folder + * + * @version @package_version@ + * @author Thomas Bruederli + */ +class markasjunk extends rcube_plugin +{ + public $task = 'mail'; + + function init() + { + $rcmail = rcmail::get_instance(); + + $this->register_action('plugin.markasjunk', array($this, 'request_action')); + + if ($rcmail->action == '' || $rcmail->action == 'show') { + $skin_path = $this->local_skin_path(); + $this->include_script('markasjunk.js'); + $this->add_texts('localization', true); + $this->add_button(array( + 'command' => 'plugin.markasjunk', + 'imagepas' => $skin_path.'/junk_pas.png', + 'imageact' => $skin_path.'/junk_act.png', + 'width' => 32, + 'height' => 32, + 'title' => 'markasjunk.buttontitle'), 'toolbar'); + } + } + + function request_action() + { + $this->add_texts('localization'); + + $GLOBALS['IMAP_FLAGS']['JUNK'] = 'Junk'; + $GLOBALS['IMAP_FLAGS']['NONJUNK'] = 'NonJunk'; + + $uids = get_input_value('_uid', RCUBE_INPUT_POST); + $mbox = get_input_value('_mbox', RCUBE_INPUT_POST); + + $rcmail = rcmail::get_instance(); + $rcmail->imap->unset_flag($uids, 'NONJUNK'); + $rcmail->imap->set_flag($uids, 'JUNK'); + + if (($junk_mbox = $rcmail->config->get('junk_mbox')) && $mbox != $junk_mbox) { + $rcmail->output->command('move_messages', $junk_mbox); + } + + $rcmail->output->command('display_message', $this->gettext('reportedasjunk'), 'confirmation'); + $rcmail->output->send(); + } + +} diff --git a/plugins/markasjunk/package.xml b/plugins/markasjunk/package.xml new file mode 100644 index 000000000..d76bd0c28 --- /dev/null +++ b/plugins/markasjunk/package.xml @@ -0,0 +1,67 @@ +<?xml version="1.0" encoding="UTF-8"?> +<package xmlns="http://pear.php.net/dtd/package-2.0" xmlns:tasks="http://pear.php.net/dtd/tasks-1.0" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" packagerversion="1.9.0" version="2.0" xsi:schemaLocation="http://pear.php.net/dtd/tasks-1.0 + http://pear.php.net/dtd/tasks-1.0.xsd + http://pear.php.net/dtd/package-2.0 + http://pear.php.net/dtd/package-2.0.xsd"> + <name>markasjunk</name> + <channel>pear.roundcube.net</channel> + <summary>Mark messages as Junk</summary> + <description>Adds a new button to the mailbox toolbar to mark the selected messages as Junk and move them to the configured Junk folder.</description> + <lead> + <name>Thomas Bruederli</name> + <user>thomasb</user> + <email>roundcube@gmail.com</email> + <active>yes</active> + </lead> + <date>2010-03-29</date> + <time>13:20:00</time> + <version> + <release>1.0</release> + <api>1.0</api> + </version> + <stability> + <release>stable</release> + <api>stable</api> + </stability> + <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license> + <notes>-</notes> + <contents> + <dir baseinstalldir="/" name="/"> + <file name="markasjunk.php" role="php"> + <tasks:replace from="@name@" to="name" type="package-info"/> + <tasks:replace from="@package_version@" to="version" type="package-info"/> + </file> + <file name="markasjunk.js" role="data"> + <tasks:replace from="@name@" to="name" type="package-info"/> + <tasks:replace from="@package_version@" to="version" type="package-info"/> + </file> + <file name="localization/cs_CZ.inc" role="data"></file> + <file name="localization/da_DK.inc" role="data"></file> + <file name="localization/de_DE.inc" role="data"></file> + <file name="localization/en_US.inc" role="data"></file> + <file name="localization/es_AR.inc" role="data"></file> + <file name="localization/es_ES.inc" role="data"></file> + <file name="localization/et_EE.inc" role="data"></file> + <file name="localization/gl_ES.inc" role="data"></file> + <file name="localization/ja_JP.inc" role="data"></file> + <file name="localization/pl_PL.inc" role="data"></file> + <file name="localization/ru_RU.inc" role="data"></file> + <file name="localization/sv_SE.inc" role="data"></file> + <file name="localization/zh_TW.inc" role="data"></file> + <file name="skins/default/junk_act.png" role="data"></file> + <file name="skins/default/junk_pas.png" role="data"></file> + </dir> + <!-- / --> + </contents> + <dependencies> + <required> + <php> + <min>5.2.1</min> + </php> + <pearinstaller> + <min>1.7.0</min> + </pearinstaller> + </required> + </dependencies> + <phprelease/> +</package> diff --git a/plugins/markasjunk/skins/default/junk_act.png b/plugins/markasjunk/skins/default/junk_act.png Binary files differnew file mode 100644 index 000000000..b5a84f604 --- /dev/null +++ b/plugins/markasjunk/skins/default/junk_act.png diff --git a/plugins/markasjunk/skins/default/junk_pas.png b/plugins/markasjunk/skins/default/junk_pas.png Binary files differnew file mode 100644 index 000000000..b88a561a4 --- /dev/null +++ b/plugins/markasjunk/skins/default/junk_pas.png diff --git a/plugins/new_user_dialog/localization/bg_BG.inc b/plugins/new_user_dialog/localization/bg_BG.inc new file mode 100644 index 000000000..9dc04529f --- /dev/null +++ b/plugins/new_user_dialog/localization/bg_BG.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['identitydialogtitle'] = 'Моля попълнете Вашите данни.'; +$labels['identitydialoghint'] = 'Това съобщение се появява само при първото влизане.'; + +?>
\ No newline at end of file diff --git a/plugins/new_user_dialog/localization/cs_CZ.inc b/plugins/new_user_dialog/localization/cs_CZ.inc new file mode 100644 index 000000000..fe05e6aae --- /dev/null +++ b/plugins/new_user_dialog/localization/cs_CZ.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['identitydialogtitle'] = 'Prosím doplňte své jméno a e-mail'; +$labels['identitydialoghint'] = 'Tento dialog se objeví pouze při prvním přihlášení.'; + +?> diff --git a/plugins/new_user_dialog/localization/de_CH.inc b/plugins/new_user_dialog/localization/de_CH.inc new file mode 100644 index 000000000..d2a1310d0 --- /dev/null +++ b/plugins/new_user_dialog/localization/de_CH.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['identitydialogtitle'] = 'Bitte vervollständigen Sie Ihre Absender-Informationen'; +$labels['identitydialoghint'] = 'Dieser Dialog erscheint nur einmal beim ersten Login.'; + +?>
\ No newline at end of file diff --git a/plugins/new_user_dialog/localization/de_DE.inc b/plugins/new_user_dialog/localization/de_DE.inc new file mode 100644 index 000000000..d2a1310d0 --- /dev/null +++ b/plugins/new_user_dialog/localization/de_DE.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['identitydialogtitle'] = 'Bitte vervollständigen Sie Ihre Absender-Informationen'; +$labels['identitydialoghint'] = 'Dieser Dialog erscheint nur einmal beim ersten Login.'; + +?>
\ No newline at end of file diff --git a/plugins/new_user_dialog/localization/en_US.inc b/plugins/new_user_dialog/localization/en_US.inc new file mode 100644 index 000000000..d9f531ba7 --- /dev/null +++ b/plugins/new_user_dialog/localization/en_US.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['identitydialogtitle'] = 'Please complete your sender identity'; +$labels['identitydialoghint'] = 'This box only appears once at the first login.'; + +?>
\ No newline at end of file diff --git a/plugins/new_user_dialog/localization/es_ES.inc b/plugins/new_user_dialog/localization/es_ES.inc new file mode 100644 index 000000000..2d2ccfe0a --- /dev/null +++ b/plugins/new_user_dialog/localization/es_ES.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['identitydialogtitle'] = 'Por favor, complete sus datos personales'; +$labels['identitydialoghint'] = 'Este diálogo sólo aparecerá la primera vez que se conecte al correo.'; + +?> diff --git a/plugins/new_user_dialog/localization/et_EE.inc b/plugins/new_user_dialog/localization/et_EE.inc new file mode 100644 index 000000000..7c6b3f20d --- /dev/null +++ b/plugins/new_user_dialog/localization/et_EE.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['identitydialogtitle'] = 'Palun täida oma saatja identiteet'; +$labels['identitydialoghint'] = 'See kast ilmub ainult esimesel sisselogimisel.'; + +?> diff --git a/plugins/new_user_dialog/localization/gl_ES.inc b/plugins/new_user_dialog/localization/gl_ES.inc new file mode 100644 index 000000000..e29993539 --- /dev/null +++ b/plugins/new_user_dialog/localization/gl_ES.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['identitydialogtitle'] = 'Por favor, complete os seus datos persoais'; +$labels['identitydialoghint'] = 'Este diálogo só aparecerá a primera vez que se conecte ao correo.'; + +?> diff --git a/plugins/new_user_dialog/localization/it_IT.inc b/plugins/new_user_dialog/localization/it_IT.inc new file mode 100644 index 000000000..6c834a9c8 --- /dev/null +++ b/plugins/new_user_dialog/localization/it_IT.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['identitydialogtitle'] = 'Per favore completa le informazioni riguardo la tua identità'; +$labels['identitydialoghint'] = 'Questa finestra comparirà una volta sola al primo accesso'; + +?> diff --git a/plugins/new_user_dialog/localization/ja_JP.inc b/plugins/new_user_dialog/localization/ja_JP.inc new file mode 100644 index 000000000..55f47914a --- /dev/null +++ b/plugins/new_user_dialog/localization/ja_JP.inc @@ -0,0 +1,9 @@ +<?php + +// EN-Revision: 3891 + +$labels = array(); +$labels['identitydialogtitle'] = '送信者情報の入力を完了してください。'; +$labels['identitydialoghint'] = 'このボックスには最初のログイン時に一度だけ表示されます。'; + +?>
\ No newline at end of file diff --git a/plugins/new_user_dialog/localization/nl_NL.inc b/plugins/new_user_dialog/localization/nl_NL.inc new file mode 100644 index 000000000..3cc9cec68 --- /dev/null +++ b/plugins/new_user_dialog/localization/nl_NL.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['identitydialogtitle'] = 'Vul uw correcte identiteitgegevens in a.u.b.'; +$labels['identitydialoghint'] = 'Dit scherm verschijnt enkel bij uw eerste login.'; + +?> diff --git a/plugins/new_user_dialog/localization/pl_PL.inc b/plugins/new_user_dialog/localization/pl_PL.inc new file mode 100644 index 000000000..a385836a4 --- /dev/null +++ b/plugins/new_user_dialog/localization/pl_PL.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['identitydialogtitle'] = 'Uzupełnij tożsamość nadawcy'; +$labels['identitydialoghint'] = 'To okno pojawia się tylko przy pierwszym logowaniu.'; + +?> diff --git a/plugins/new_user_dialog/localization/pt_BR.inc b/plugins/new_user_dialog/localization/pt_BR.inc new file mode 100644 index 000000000..64e3e6a80 --- /dev/null +++ b/plugins/new_user_dialog/localization/pt_BR.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['identitydialogtitle'] = 'Por favor complete a sua identidade'; +$labels['identitydialoghint'] = 'Esta caixa aparece apenas uma vez no primeiro login.'; + +?> diff --git a/plugins/new_user_dialog/localization/pt_PT.inc b/plugins/new_user_dialog/localization/pt_PT.inc new file mode 100644 index 000000000..64e3e6a80 --- /dev/null +++ b/plugins/new_user_dialog/localization/pt_PT.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['identitydialogtitle'] = 'Por favor complete a sua identidade'; +$labels['identitydialoghint'] = 'Esta caixa aparece apenas uma vez no primeiro login.'; + +?> diff --git a/plugins/new_user_dialog/localization/ru_RU.inc b/plugins/new_user_dialog/localization/ru_RU.inc new file mode 100644 index 000000000..d1eb28e71 --- /dev/null +++ b/plugins/new_user_dialog/localization/ru_RU.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['identitydialogtitle'] = 'Пожалуйста, укажите Ваше имя.'; +$labels['identitydialoghint'] = 'Данное сообщение отображается только при первом входе.'; + +?> diff --git a/plugins/new_user_dialog/localization/sk_SK.inc b/plugins/new_user_dialog/localization/sk_SK.inc new file mode 100644 index 000000000..b7b841c4d --- /dev/null +++ b/plugins/new_user_dialog/localization/sk_SK.inc @@ -0,0 +1,16 @@ +<?php +/* + * + * Slovak translation for Roundcube new_user_dialog plugin + * + * @version 1.0 (2010-09-13) + * @author panda <admin@whistler.sk> + * +*/ + + +$labels = array(); +$labels['identitydialogtitle'] = 'Doplňte prosím Vašu identifikáciu odosielateľa'; +$labels['identitydialoghint'] = 'Toto okno sa objaví len pri prvom prihlásení.'; + +?> diff --git a/plugins/new_user_dialog/localization/sl_SI.inc b/plugins/new_user_dialog/localization/sl_SI.inc new file mode 100644 index 000000000..57f563806 --- /dev/null +++ b/plugins/new_user_dialog/localization/sl_SI.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['identitydialogtitle'] = 'Izberite identiteto za pošiljanje'; +$labels['identitydialoghint'] = 'To okno se prikaže le ob prvi prijavi v spletno pošto.'; + +?> diff --git a/plugins/new_user_dialog/localization/sv_SE.inc b/plugins/new_user_dialog/localization/sv_SE.inc new file mode 100644 index 000000000..b3e665ef1 --- /dev/null +++ b/plugins/new_user_dialog/localization/sv_SE.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['identitydialogtitle'] = 'Vänligen fyll i namn och avsändaradress under personliga inställningar'; +$labels['identitydialoghint'] = 'Informationen visas endast vid första inloggningen.'; + +?>
\ No newline at end of file diff --git a/plugins/new_user_dialog/localization/zh_TW.inc b/plugins/new_user_dialog/localization/zh_TW.inc new file mode 100644 index 000000000..87261f9cd --- /dev/null +++ b/plugins/new_user_dialog/localization/zh_TW.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['identitydialogtitle'] = '請完成您的身份資訊'; +$labels['identitydialoghint'] = '此視窗只會於第一次登入時出現。'; + +?> diff --git a/plugins/new_user_dialog/new_user_dialog.php b/plugins/new_user_dialog/new_user_dialog.php new file mode 100644 index 000000000..9d7cbcba5 --- /dev/null +++ b/plugins/new_user_dialog/new_user_dialog.php @@ -0,0 +1,144 @@ +<?php + +/** + * Present identities settings dialog to new users + * + * When a new user is created, this plugin checks the default identity + * and sets a session flag in case it is incomplete. An overlay box will appear + * on the screen until the user has reviewed/completed his identity. + * + * @version @package_version@ + * @author Thomas Bruederli + */ +class new_user_dialog extends rcube_plugin +{ + public $task = 'login|mail'; + + function init() + { + $this->add_hook('identity_create', array($this, 'create_identity')); + $this->register_action('plugin.newusersave', array($this, 'save_data')); + + // register additional hooks if session flag is set + if ($_SESSION['plugin.newuserdialog']) { + $this->add_hook('render_page', array($this, 'render_page')); + } + } + + /** + * Check newly created identity at first login + */ + function create_identity($p) + { + // set session flag when a new user was created and the default identity seems to be incomplete + if ($p['login'] && !$p['complete']) + $_SESSION['plugin.newuserdialog'] = true; + } + + /** + * Callback function when HTML page is rendered + * We'll add an overlay box here. + */ + function render_page($p) + { + if ($_SESSION['plugin.newuserdialog'] && $p['template'] == 'mail') { + $this->add_texts('localization'); + + $rcmail = rcmail::get_instance(); + $identity = $rcmail->user->get_identity(); + $identities_level = intval($rcmail->config->get('identities_level', 0)); + + // compose user-identity dialog + $table = new html_table(array('cols' => 2)); + + $table->add('title', $this->gettext('name')); + $table->add(null, html::tag('input', array( + 'type' => 'text', + 'name' => '_name', + 'value' => $identity['name'] + ))); + + $table->add('title', $this->gettext('email')); + $table->add(null, html::tag('input', array( + 'type' => 'text', + 'name' => '_email', + 'value' => rcube_idn_to_utf8($identity['email']), + 'disabled' => ($identities_level == 1 || $identities_level == 3) + ))); + + $table->add('title', $this->gettext('organization')); + $table->add(null, html::tag('input', array( + 'type' => 'text', + 'name' => '_organization', + 'value' => $identity['organization'] + ))); + + $table->add('title', $this->gettext('signature')); + $table->add(null, html::tag('textarea', array( + 'name' => '_signature', + 'rows' => '3', + ),$identity['signature'] + )); + + // add overlay input box to html page + $rcmail->output->add_footer(html::div(array('id' => 'newuseroverlay'), + html::tag('form', array( + 'action' => $rcmail->url('plugin.newusersave'), + 'method' => 'post'), + html::tag('h3', null, Q($this->gettext('identitydialogtitle'))) . + html::p('hint', Q($this->gettext('identitydialoghint'))) . + $table->show() . + html::p(array('class' => 'formbuttons'), + html::tag('input', array('type' => 'submit', + 'class' => 'button mainaction', 'value' => $this->gettext('save')))) + ) + )); + + // disable keyboard events for messages list (#1486726) + $rcmail->output->add_script( + "rcmail.message_list.key_press = function(){}; + rcmail.message_list.key_down = function(){}; + $('input[name=_name]').focus(); + ", 'docready'); + + $this->include_stylesheet('newuserdialog.css'); + } + } + + /** + * Handler for submitted form + * + * Check fields and save to default identity if valid. + * Afterwards the session flag is removed and we're done. + */ + function save_data() + { + $rcmail = rcmail::get_instance(); + $identity = $rcmail->user->get_identity(); + $identities_level = intval($rcmail->config->get('identities_level', 0)); + + $save_data = array( + 'name' => get_input_value('_name', RCUBE_INPUT_POST), + 'email' => get_input_value('_email', RCUBE_INPUT_POST), + 'organization' => get_input_value('_organization', RCUBE_INPUT_POST), + 'signature' => get_input_value('_signature', RCUBE_INPUT_POST), + ); + + // don't let the user alter the e-mail address if disabled by config + if ($identities_level == 1 || $identities_level == 3) + $save_data['email'] = $identity['email']; + else + $save_data['email'] = rcube_idn_to_ascii($save_data['email']); + + // save data if not empty + if (!empty($save_data['name']) && !empty($save_data['email'])) { + $rcmail->user->update_identity($identity['identity_id'], $save_data); + $rcmail->session->remove('plugin.newuserdialog'); + } + + $rcmail->output->redirect(''); + } + +} + +?> diff --git a/plugins/new_user_dialog/newuserdialog.css b/plugins/new_user_dialog/newuserdialog.css new file mode 100644 index 000000000..1c3e652b6 --- /dev/null +++ b/plugins/new_user_dialog/newuserdialog.css @@ -0,0 +1,60 @@ +/** Styles for the new-user-dialog overlay box */ + +#newuseroverlay { + position: absolute; + top: 0; + left: 0; + right: 0; + bottom: 0; + z-index: 10000; + background: rgba(0,0,0,0.5) !important; + background: #333; + + /** IE hacks */ + filter: alpha(opacity=90); + -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=90)"; + width: expression(document.documentElement.clientWidth+'px'); + height: expression(document.documentElement.clientHeight+'px'); +} + +#newuseroverlay h3 { + color: #333; + font-size: normal; + margin-top: 0.5em; + margin-bottom: 0; +} + +#newuseroverlay p.hint { + margin-top: 0.5em; + font-style: italic; +} + +#newuseroverlay form { + width: 32em; + margin: 8em auto; + padding: 1em 2em; + background: #F6F6F6; + border: 2px solid #555; + border-radius: 6px; + -moz-border-radius: 6px; + -webkit-border-radius: 6px; +} + +#newuseroverlay table td.title +{ + color: #666; + text-align: right; + padding-right: 1em; + white-space: nowrap; +} + +#newuseroverlay table td input, +#newuseroverlay table td textarea +{ + width: 20em; +} + +#newuseroverlay .formbuttons { + margin-top: 1.5em; + text-align: center; +}
\ No newline at end of file diff --git a/plugins/new_user_dialog/package.xml b/plugins/new_user_dialog/package.xml new file mode 100644 index 000000000..52874701f --- /dev/null +++ b/plugins/new_user_dialog/package.xml @@ -0,0 +1,139 @@ +<?xml version="1.0" encoding="UTF-8"?> +<package xmlns="http://pear.php.net/dtd/package-2.0" xmlns:tasks="http://pear.php.net/dtd/tasks-1.0" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" packagerversion="1.9.0" version="2.0" xsi:schemaLocation="http://pear.php.net/dtd/tasks-1.0 + http://pear.php.net/dtd/tasks-1.0.xsd + http://pear.php.net/dtd/package-2.0 + http://pear.php.net/dtd/package-2.0.xsd"> + <name>new_user_dialog</name> + <channel>pear.roundcube.net</channel> + <summary>Present identities settings dialog to new users</summary> + <description>When a new user is created, this plugin checks the default identity and sets a session flag in case it is incomplete. An overlay box will appear on the screen until the user has reviewed/completed his identity.</description> + <lead> + <name>Thomas Bruederli</name> + <user>thomasb</user> + <email>roundcube@gmail.com</email> + <active>yes</active> + </lead> + <date>2011-05-12</date> + <time>10:00</time> + <version> + <release>1.4</release> + <api>1.0</api> + </version> + <stability> + <release>stable</release> + <api>stable</api> + </stability> + <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license> + <notes> +- Fixed IDNA encoding/decoding of e-mail addresses (#1487909) + </notes> + <contents> + <dir baseinstalldir="/" name="/"> + <file name="new_user_dialog.php" role="php"> + <tasks:replace from="@name@" to="name" type="package-info"/> + <tasks:replace from="@package_version@" to="version" type="package-info"/> + </file> + <file name="newuserdialog.css" role="data"> + <tasks:replace from="@name@" to="name" type="package-info"/> + <tasks:replace from="@package_version@" to="version" type="package-info"/> + </file> + <dir name="localization"> + <file name="en_US.inc" role="data" /> + <file name="cs_CZ.inc" role="data" /> + <file name="de_CH.inc" role="data" /> + <file name="de_DE.inc" role="data" /> + <file name="es_ES.inc" role="data" /> + <file name="et_EE.inc" role="data" /> + <file name="gl_ES.inc" role="data" /> + <file name="it_IT.inc" role="data" /> + <file name="ja_JP.inc" role="data" /> + <file name="nl_NL.inc" role="data" /> + <file name="pl_PL.inc" role="data" /> + <file name="pt_BR.inc" role="data" /> + <file name="pt_PT.inc" role="data" /> + <file name="ru_RU.inc" role="data" /> + <file name="sl_SI.inc" role="data" /> + <file name="sv_DE.inc" role="data" /> + <file name="zh_TW.inc" role="data" /> + </dir> + </dir> + <!-- / --> + </contents> + <dependencies> + <required> + <php> + <min>5.2.1</min> + </php> + <pearinstaller> + <min>1.7.0</min> + </pearinstaller> + </required> + </dependencies> + <phprelease/> + <changelog> + <release> + <date>2010-03-29</date> + <time>13:20:00</time> + <version> + <release>1.0</release> + <api>1.0</api> + </version> + <stability> + <release>stable</release> + <api>stable</api> + </stability> + <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license> + <notes></notes> + </release> + <release> + <date>2010-05-13</date> + <time>19:35:00</time> + <version> + <release>1.1</release> + <api>1.0</api> + </version> + <stability> + <release>stable</release> + <api>stable</api> + </stability> + <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license> + <notes> +- Fix space bar and backspace buttons not working (#1486726) + </notes> + </release> + <release> + <date>2010-05-27</date> + <time>12:00:00</time> + <version> + <release>1.2</release> + <api>1.0</api> + </version> + <stability> + <release>stable</release> + <api>stable</api> + </stability> + <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license> + <notes> +- Add overlay box only to mail task main template +- Fix possible error on form submission (#1486103) + </notes> + </release> + <release> + <date>2010-12-02</date> + <time>12:00:00</time> + <version> + <release>1.3</release> + <api>1.0</api> + </version> + <stability> + <release>stable</release> + <api>stable</api> + </stability> + <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license> + <notes> +- Added setting of focus on name input +- Added gl_ES translation + </notes> + </release> + </changelog> +</package> diff --git a/plugins/new_user_identity/new_user_identity.php b/plugins/new_user_identity/new_user_identity.php new file mode 100644 index 000000000..32c2c9d03 --- /dev/null +++ b/plugins/new_user_identity/new_user_identity.php @@ -0,0 +1,89 @@ +<?php +/** + * New user identity + * + * Populates a new user's default identity from LDAP on their first visit. + * + * This plugin requires that a working public_ldap directory be configured. + * + * @version 1.05 + * @author Kris Steinhoff + * + * Example configuration: + * + * // The id of the address book to use to automatically set a new + * // user's full name in their new identity. (This should be an + * // string, which refers to the $rcmail_config['ldap_public'] array.) + * $rcmail_config['new_user_identity_addressbook'] = 'People'; + * + * // When automatically setting a new users's full name in their + * // new identity, match the user's login name against this field. + * $rcmail_config['new_user_identity_match'] = 'uid'; + * + * // Use this field (from fieldmap configuration) to fill alias col of + * // the new user record. + * $rcmail_config['new_user_identity_alias'] = 'alias'; + */ +class new_user_identity extends rcube_plugin +{ + public $task = 'login'; + + private $ldap; + + function init() + { + $this->add_hook('user_create', array($this, 'lookup_user_name')); + } + + function lookup_user_name($args) + { + $rcmail = rcmail::get_instance(); + + if ($this->init_ldap($args['host'])) { + $results = $this->ldap->search('*', $args['user'], TRUE); + if (count($results->records) == 1) { + $args['user_name'] = $results->records[0]['name']; + if (!$args['user_email'] && strpos($results->records[0]['email'], '@')) { + $args['user_email'] = rcube_idn_to_ascii($results->records[0]['email']); + } + if (($alias_col = $rcmail->config->get('new_user_identity_alias')) && $results->records[0][$alias_col]) { + $args['alias'] = $results->records[0][$alias_col]; + } + } + } + return $args; + } + + private function init_ldap($host) + { + if ($this->ldap) + return $this->ldap->ready; + + $rcmail = rcmail::get_instance(); + + $addressbook = $rcmail->config->get('new_user_identity_addressbook'); + $ldap_config = (array)$rcmail->config->get('ldap_public'); + $match = $rcmail->config->get('new_user_identity_match'); + + if (empty($addressbook) || empty($match) || empty($ldap_config[$addressbook])) { + return false; + } + + $this->ldap = new new_user_identity_ldap_backend( + $ldap_config[$addressbook], + $rcmail->config->get('ldap_debug'), + $rcmail->config->mail_domain($host), + $match); + + return $this->ldap->ready; + } +} + +class new_user_identity_ldap_backend extends rcube_ldap +{ + function __construct($p, $debug, $mail_domain, $search) + { + parent::__construct($p, $debug, $mail_domain); + $this->prop['search_fields'] = (array)$search; + } +} diff --git a/plugins/newmail_notifier/config.inc.php.dist b/plugins/newmail_notifier/config.inc.php.dist new file mode 100644 index 000000000..067fe19f1 --- /dev/null +++ b/plugins/newmail_notifier/config.inc.php.dist @@ -0,0 +1,12 @@ +<?php + +// Enables basic notification +$rcmail_config['newmail_notifier_basic'] = false; + +// Enables sound notification +$rcmail_config['newmail_notifier_sound'] = false; + +// Enables desktop notification +$rcmail_config['newmail_notifier_desktop'] = false; + +?> diff --git a/plugins/newmail_notifier/favicon.ico b/plugins/newmail_notifier/favicon.ico Binary files differnew file mode 100644 index 000000000..86e10c1c7 --- /dev/null +++ b/plugins/newmail_notifier/favicon.ico diff --git a/plugins/newmail_notifier/localization/de_CH.inc b/plugins/newmail_notifier/localization/de_CH.inc new file mode 100644 index 000000000..55cfd7136 --- /dev/null +++ b/plugins/newmail_notifier/localization/de_CH.inc @@ -0,0 +1,13 @@ +<?php + +$labels['basic'] = 'Anzeige im Browser bei neuer Nachricht'; +$labels['sound'] = 'Akustische Meldung bei neuer Nachricht'; +$labels['desktop'] = 'Desktop-Benachrichtigung bei neuer Nachricht'; +$labels['test'] = 'Test'; +$labels['title'] = 'Neue E-Mail!'; +$labels['body'] = 'Sie haben eine neue Nachricht'; +$labels['testbody'] = 'Dies ist eine Testbenachrichtigung'; +$labels['desktopdisabled'] = 'Desktop-Benachrichtigungen sind deaktiviert.'; +$labels['desktopunsupported'] = 'Ihr Browser unterstützt keine Desktop-Benachrichtigungen.'; + +?> diff --git a/plugins/newmail_notifier/localization/de_DE.inc b/plugins/newmail_notifier/localization/de_DE.inc new file mode 100644 index 000000000..65381ca35 --- /dev/null +++ b/plugins/newmail_notifier/localization/de_DE.inc @@ -0,0 +1,13 @@ +<?php + +$labels['basic'] = 'Benachrichtigung im Browser bei neuer Nachricht'; +$labels['sound'] = 'Akustische Meldung bei neuer Nachricht'; +$labels['desktop'] = 'Desktop-Benachrichtigung bei neuer Nachricht'; +$labels['test'] = 'Test'; +$labels['title'] = 'Neue E-Mail!'; +$labels['body'] = 'Sie haben eine neue Nachricht'; +$labels['testbody'] = 'Dies ist eine Testbenachrichtigung'; +$labels['desktopdisabled'] = 'Desktop-Benachrichtigungen sind deaktiviert.'; +$labels['desktopunsupported'] = 'Ihr Browser unterstützt keine Desktop-Benachrichtigungen.'; + +?> diff --git a/plugins/newmail_notifier/localization/en_US.inc b/plugins/newmail_notifier/localization/en_US.inc new file mode 100644 index 000000000..3017c43dc --- /dev/null +++ b/plugins/newmail_notifier/localization/en_US.inc @@ -0,0 +1,13 @@ +<?php + +$labels['basic'] = 'Display browser notifications on new message'; +$labels['desktop'] = 'Display desktop notifications on new message'; +$labels['sound'] = 'Play the sound on new message'; +$labels['test'] = 'Test'; +$labels['title'] = 'New Email!'; +$labels['body'] = 'You\'ve received a new message.'; +$labels['testbody'] = 'This is a test notification.'; +$labels['desktopdisabled'] = 'Desktop notifications are disabled in your browser.'; +$labels['desktopunsupported'] = 'Your browser does not support desktop notifications.'; + +?> diff --git a/plugins/newmail_notifier/localization/pl_PL.inc b/plugins/newmail_notifier/localization/pl_PL.inc new file mode 100644 index 000000000..d95e658af --- /dev/null +++ b/plugins/newmail_notifier/localization/pl_PL.inc @@ -0,0 +1,13 @@ +<?php + +$labels['basic'] = 'Wyświetlaj powiadomienia o nadejściu nowej wiadomości w przeglądarce'; +$labels['sound'] = 'Odtwarzaj dźwięk o nadejściu nowej wiadomości'; +$labels['desktop'] = 'Wyświetlaj powiadomienia o nadejściu nowej wiadomości na pulpicie'; +$labels['test'] = 'Testuj powiadomienie'; +$labels['title'] = 'Nowa wiadomość!'; +$labels['body'] = 'Nadeszła nowa wiadomość.'; +$labels['testbody'] = 'To jest testowe powiadomienie.'; +$labels['desktopdisabled'] = 'Powiadomienia na pulpicie zostały zablokowane w twojej przeglądarce.'; +$labels['desktopunsupported'] = 'Twoja przeglądarka nie obsługuje powiadomień na pulpicie.'; + +?> diff --git a/plugins/newmail_notifier/localization/pt_BR.inc b/plugins/newmail_notifier/localization/pt_BR.inc new file mode 100644 index 000000000..66f8e936e --- /dev/null +++ b/plugins/newmail_notifier/localization/pt_BR.inc @@ -0,0 +1,13 @@ +<?php + +$labels['basic'] = 'Exibir notificação quando uma nova mensagem chegar'; +$labels['desktop'] = 'Exibir notificação no desktop quando uma nova mensagem chegar'; +$labels['sound'] = 'Alerta sonoro quando uma nova mensagem chegar'; +$labels['test'] = 'Testar'; +$labels['title'] = 'Novo Email!'; +$labels['body'] = 'Você recebeu uma nova mensagem.'; +$labels['testbody'] = 'Essa é uma notificação de teste.'; +$labels['desktopdisabled'] = 'As notificações no desktop estão desabilitadas no seu navegador.'; +$labels['desktopunsupported'] = 'Seu navegador não suporta notificações no desktop'; + +?> diff --git a/plugins/newmail_notifier/localization/ru_RU.inc b/plugins/newmail_notifier/localization/ru_RU.inc new file mode 100644 index 000000000..65abb7437 --- /dev/null +++ b/plugins/newmail_notifier/localization/ru_RU.inc @@ -0,0 +1,21 @@ +<?php + +/* ++-----------------------------------------------------------------------+ +| language/ru_RU/labels.inc | +| | +| Language file of the RoundCube Webmail client | +| Copyright (C) 2008-2011, RoundQube Dev. - Switzerland | +| Licensed under the GNU GPL | +| | ++-----------------------------------------------------------------------+ +| Author: Doubrovine S. | ++-----------------------------------------------------------------------+ + +*/ + +$labels = array(); +$labels['basic'] = 'Визуальное уведомление по приходу нового сообщения'; +$labels['sound'] = 'Звуковое уведомление по приходу нового сообщения'; + +?>
\ No newline at end of file diff --git a/plugins/newmail_notifier/mail.png b/plugins/newmail_notifier/mail.png Binary files differnew file mode 100644 index 000000000..79f3a5311 --- /dev/null +++ b/plugins/newmail_notifier/mail.png diff --git a/plugins/newmail_notifier/newmail_notifier.js b/plugins/newmail_notifier/newmail_notifier.js new file mode 100644 index 000000000..16e3edd42 --- /dev/null +++ b/plugins/newmail_notifier/newmail_notifier.js @@ -0,0 +1,120 @@ +/** + * New Mail Notifier plugin script + * + * @version 0.3 + * @author Aleksander Machniak <alec@alec.pl> + */ + +if (window.rcmail && rcmail.env.task == 'mail') { + rcmail.addEventListener('plugin.newmail_notifier', newmail_notifier_run); + rcmail.addEventListener('actionbefore', newmail_notifier_stop); + rcmail.addEventListener('init', function() { + // bind to messages list select event, so favicon will be reverted on message preview too + if (rcmail.message_list) + rcmail.message_list.addEventListener('select', newmail_notifier_stop); + }); +} + +// Executes notification methods +function newmail_notifier_run(prop) +{ + if (prop.basic) + newmail_notifier_basic(); + if (prop.sound) + newmail_notifier_sound(); + if (prop.desktop) + newmail_notifier_desktop(rcmail.gettext('body', 'newmail_notifier')); +} + +// Stops notification +function newmail_notifier_stop(prop) +{ + // revert original favicon + if (rcmail.env.favicon_href && (!prop || prop.action != 'check-recent')) { + $('<link rel="shortcut icon" href="'+rcmail.env.favicon_href+'"/>').replaceAll('link[rel="shortcut icon"]'); + rcmail.env.favicon_href = null; + } +} + +// Basic notification: window.focus and favicon change +function newmail_notifier_basic() +{ + var w = rcmail.is_framed() ? window.parent : window; + + w.focus(); + + // we cannot simply change a href attribute, we must to replace the link element (at least in FF) + var link = $('<link rel="shortcut icon" href="plugins/newmail_notifier/favicon.ico"/>'), + oldlink = $('link[rel="shortcut icon"]', w.document); + + rcmail.env.favicon_href = oldlink.attr('href'); + link.replaceAll(oldlink); +} + +// Sound notification +function newmail_notifier_sound() +{ + var elem, src = 'plugins/newmail_notifier/sound.wav'; + + // HTML5 + try { + elem = $('<audio src="' + src + '" />'); + elem.get(0).play(); + } + // old method + catch (e) { + elem = $('<embed id="sound" src="' + src + '" hidden=true autostart=true loop=false />'); + elem.appendTo($('body')); + window.setTimeout("$('#sound').remove()", 5000); + } +} + +// Desktop notification (need Chrome or Firefox with a plugin) +function newmail_notifier_desktop(body) +{ + var dn = window.webkitNotifications; + + if (dn && !dn.checkPermission()) { + if (rcmail.newmail_popup) + rcmail.newmail_popup.cancel(); + var popup = window.webkitNotifications.createNotification('plugins/newmail_notifier/mail.png', + rcmail.gettext('title', 'newmail_notifier'), body); + popup.onclick = function() { + this.cancel(); + } + popup.show(); + setTimeout(function() { popup.cancel(); }, 10000); // close after 10 seconds + rcmail.newmail_popup = popup; + return true; + } + + return false; +} + +function newmail_notifier_test_desktop() +{ + var dn = window.webkitNotifications, + txt = rcmail.gettext('testbody', 'newmail_notifier'); + + if (dn) { + if (!dn.checkPermission()) + newmail_notifier_desktop(txt); + else + dn.requestPermission(function() { + if (!newmail_notifier_desktop(txt)) + rcmail.display_message(rcmail.gettext('desktopdisabled', 'newmail_notifier'), 'error'); + }); + } + else + rcmail.display_message(rcmail.gettext('desktopunsupported', 'newmail_notifier'), 'error'); +} + +function newmail_notifier_test_basic() +{ + newmail_notifier_basic(); +} + +function newmail_notifier_test_sound() +{ + newmail_notifier_sound(); +} diff --git a/plugins/newmail_notifier/newmail_notifier.php b/plugins/newmail_notifier/newmail_notifier.php new file mode 100644 index 000000000..1f1df9e75 --- /dev/null +++ b/plugins/newmail_notifier/newmail_notifier.php @@ -0,0 +1,155 @@ +<?php + +/** + * New Mail Notifier plugin + * + * Supports two methods of notification: + * 1. Basic - focus browser window and change favicon + * 2. Sound - play wav file + * 3. Desktop - display desktop notification (using webkitNotifications feature, + * supported by Chrome and Firefox with 'HTML5 Notifications' plugin) + * + * @version 0.3 + * @author Aleksander Machniak <alec@alec.pl> + * + * + * Copyright (C) 2011, Kolab Systems AG + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License version 2 + * as published by the Free Software Foundation. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License along + * with this program; if not, write to the Free Software Foundation, Inc., + * 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. + */ + +class newmail_notifier extends rcube_plugin +{ + public $task = 'mail|settings'; + + private $rc; + private $notified; + + /** + * Plugin initialization + */ + function init() + { + $this->rc = rcmail::get_instance(); + + // Preferences hooks + if ($this->rc->task == 'settings') { + $this->add_hook('preferences_list', array($this, 'prefs_list')); + $this->add_hook('preferences_save', array($this, 'prefs_save')); + } + else { // if ($this->rc->task == 'mail') { + $this->add_hook('new_messages', array($this, 'notify')); + // add script when not in ajax and not in frame + if (is_a($this->rc->output, 'rcube_template') && empty($_REQUEST['_framed'])) { + $this->add_texts('localization/'); + $this->rc->output->add_label('newmail_notifier.title', 'newmail_notifier.body'); + $this->include_script('newmail_notifier.js'); + } + } + } + + /** + * Handler for user preferences form (preferences_list hook) + */ + function prefs_list($args) + { + if ($args['section'] != 'mailbox') { + return $args; + } + + // Load configuration + $this->load_config(); + + // Load localization and configuration + $this->add_texts('localization/'); + + if (!empty($_REQUEST['_framed'])) { + $this->rc->output->add_label('newmail_notifier.title', 'newmail_notifier.testbody', + 'newmail_notifier.desktopunsupported', 'newmail_notifier.desktopenabled', 'newmail_notifier.desktopdisabled'); + $this->include_script('newmail_notifier.js'); + } + + // Check that configuration is not disabled + $dont_override = (array) $this->rc->config->get('dont_override', array()); + + foreach (array('basic', 'desktop', 'sound') as $type) { + $key = 'newmail_notifier_' . $type; + if (!in_array($key, $dont_override)) { + $field_id = '_' . $key; + $input = new html_checkbox(array('name' => $field_id, 'id' => $field_id, 'value' => 1)); + $content = $input->show($this->rc->config->get($key)) + . ' ' . html::a(array('href' => '#', 'onclick' => 'newmail_notifier_test_'.$type.'()'), + $this->gettext('test')); + + $args['blocks']['new_message']['options'][$key] = array( + 'title' => html::label($field_id, Q($this->gettext($type))), + 'content' => $content + ); + } + } + + return $args; + } + + /** + * Handler for user preferences save (preferences_save hook) + */ + function prefs_save($args) + { + if ($args['section'] != 'mailbox') { + return $args; + } + + // Load configuration + $this->load_config(); + + // Check that configuration is not disabled + $dont_override = (array) $this->rc->config->get('dont_override', array()); + + foreach (array('basic', 'desktop', 'sound') as $type) { + $key = 'newmail_notifier_' . $type; + if (!in_array($key, $dont_override)) { + $args['prefs'][$key] = get_input_value('_'.$key, RCUBE_INPUT_POST) ? true : false; + } + } + + return $args; + } + + /** + * Handler for new message action (new_messages hook) + */ + function notify($args) + { + if ($this->notified) { + return $args; + } + + $this->notified = true; + + // Load configuration + $this->load_config(); + + $basic = $this->rc->config->get('newmail_notifier_basic'); + $sound = $this->rc->config->get('newmail_notifier_sound'); + $desktop = $this->rc->config->get('newmail_notifier_desktop'); + + if ($basic || $sound || $desktop) { + $this->rc->output->command('plugin.newmail_notifier', + array('basic' => $basic, 'sound' => $sound, 'desktop' => $desktop)); + } + + return $args; + } +} diff --git a/plugins/newmail_notifier/sound.wav b/plugins/newmail_notifier/sound.wav Binary files differnew file mode 100644 index 000000000..72d3dd857 --- /dev/null +++ b/plugins/newmail_notifier/sound.wav diff --git a/plugins/password/README b/plugins/password/README new file mode 100644 index 000000000..d9280fb03 --- /dev/null +++ b/plugins/password/README @@ -0,0 +1,264 @@ + ----------------------------------------------------------------------- + Password Plugin for Roundcube + ----------------------------------------------------------------------- + + Plugin that adds a possibility to change user password using many + methods (drivers) via Settings/Password tab. + + ----------------------------------------------------------------------- + This program is free software; you can redistribute it and/or modify + it under the terms of the GNU General Public License version 2 + as published by the Free Software Foundation. + + This program is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + GNU General Public License for more details. + + You should have received a copy of the GNU General Public License along + with this program; if not, write to the Free Software Foundation, Inc., + 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. + + @version @package_version@ + @author Aleksander 'A.L.E.C' Machniak <alec@alec.pl> + @author <see driver files for driver authors> + ----------------------------------------------------------------------- + + 1. Configuration + 2. Drivers + 2.1. Database (sql) + 2.2. Cyrus/SASL (sasl) + 2.3. Poppassd/Courierpassd (poppassd) + 2.4. LDAP (ldap) + 2.5. DirectAdmin Control Panel (directadmin) + 2.6. cPanel (cpanel) + 2.7. XIMSS/Communigate (ximms) + 2.8. Virtualmin (virtualmin) + 2.9. hMailServer (hmail) + 2.10. PAM (pam) + 2.11. Chpasswd (chpasswd) + 2.12. LDAP - no PEAR (ldap_simple) + 2.13. XMail (xmail) + 3. Driver API + + + 1. Configuration + ---------------- + + Copy config.inc.php.dist to config.inc.php and set the options as described + within the file. + + + 2. Drivers + ---------- + + Password plugin supports many password change mechanisms which are + handled by included drivers. Just pass driver name in 'password_driver' option. + + + 2.1. Database (sql) + ------------------- + + You can specify which database to connect by 'password_db_dsn' option and + what SQL query to execute by 'password_query'. See main.inc.php.dist file for + more info. + + Example implementations of an update_passwd function: + + - This is for use with LMS (http://lms.org.pl) database and postgres: + + CREATE OR REPLACE FUNCTION update_passwd(hash text, account text) RETURNS integer AS $$ + DECLARE + res integer; + BEGIN + UPDATE passwd SET password = hash + WHERE login = split_part(account, '@', 1) + AND domainid = (SELECT id FROM domains WHERE name = split_part(account, '@', 2)) + RETURNING id INTO res; + RETURN res; + END; + $$ LANGUAGE plpgsql SECURITY DEFINER; + + - This is for use with a SELECT update_passwd(%o,%c,%u) query + Updates the password only when the old password matches the MD5 password + in the database + + CREATE FUNCTION update_password (oldpass text, cryptpass text, user text) RETURNS text + MODIFIES SQL DATA + BEGIN + DECLARE currentsalt varchar(20); + DECLARE error text; + SET error = 'incorrect current password'; + SELECT substring_index(substr(user.password,4),_latin1'$',1) INTO currentsalt FROM users WHERE username=user; + SELECT '' INTO error FROM users WHERE username=user AND password=ENCRYPT(oldpass,currentsalt); + UPDATE users SET password=cryptpass WHERE username=user AND password=ENCRYPT(oldpass,currentsalt); + RETURN error; + END + + Example SQL UPDATEs: + + - Plain text passwords: + UPDATE users SET password=%p WHERE username=%u AND password=%o AND domain=%h LIMIT 1 + + - Crypt text passwords: + UPDATE users SET password=%c WHERE username=%u LIMIT 1 + + - Use a MYSQL crypt function (*nix only) with random 8 character salt + UPDATE users SET password=ENCRYPT(%p,concat(_utf8'$1$',right(md5(rand()),8),_utf8'$')) WHERE username=%u LIMIT 1 + + - MD5 stored passwords: + UPDATE users SET password=MD5(%p) WHERE username=%u AND password=MD5(%o) LIMIT 1 + + + 2.2. Cyrus/SASL (sasl) + ---------------------- + + Cyrus SASL database authentication allows your Cyrus+Roundcube + installation to host mail users without requiring a Unix Shell account! + + This driver only covers the "sasldb" case when using Cyrus SASL. Kerberos + and PAM authentication mechanisms will require other techniques to enable + user password manipulations. + + Cyrus SASL includes a shell utility called "saslpasswd" for manipulating + user passwords in the "sasldb" database. This plugin attempts to use + this utility to perform password manipulations required by your webmail + users without any administrative interaction. Unfortunately, this + scheme requires that the "saslpasswd" utility be run as the "cyrus" + user - kind of a security problem since we have chosen to SUID a small + script which will allow this to happen. + + This driver is based on the Squirrelmail Change SASL Password Plugin. + See http://www.squirrelmail.org/plugin_view.php?id=107 for details. + + Installation: + + Change into the drivers directory. Edit the chgsaslpasswd.c file as is + documented within it. + + Compile the wrapper program: + gcc -o chgsaslpasswd chgsaslpasswd.c + + Chown the compiled chgsaslpasswd binary to the cyrus user and group + that your browser runs as, then chmod them to 4550. + + For example, if your cyrus user is 'cyrus' and the apache server group is + 'nobody' (I've been told Redhat runs Apache as user 'apache'): + + chown cyrus:nobody chgsaslpasswd + chmod 4550 chgsaslpasswd + + Stephen Carr has suggested users should try to run the scripts on a test + account as the cyrus user eg; + + su cyrus -c "./chgsaslpasswd -p test_account" + + This will allow you to make sure that the script will work for your setup. + Should the script not work, make sure that: + 1) the user the script runs as has access to the saslpasswd|saslpasswd2 + file and proper permissions + 2) make sure the user in the chgsaslpasswd.c file is set correctly. + This could save you some headaches if you are the paranoid type. + + + 2.3. Poppassd/Courierpassd (poppassd) + ------------------------------------- + + You can specify which host to connect to via 'password_pop_host' and + what port via 'password_pop_port'. See config.inc.php.dist file for more info. + + + 2.4. LDAP (ldap) + ---------------- + + See config.inc.php.dist file. Requires PEAR::Net_LDAP2 package. + + + 2.5. DirectAdmin Control Panel (directadmin) + -------------------------------------------- + + You can specify which host to connect to via 'password_directadmin_host' (don't + forget to use tcp:// or ssl://) and what port via 'password_direactadmin_port'. + The password enforcement with plenty customization can be done directly by + DirectAdmin, please see http://www.directadmin.com/features.php?id=910 + See config.inc.php.dist file for more info. + + + 2.6. cPanel (cpanel) + -------------------- + + You can specify parameters for HTTP connection to cPanel's admin + interface. See config.inc.php.dist file for more info. + + + 2.7. XIMSS/Communigate (ximms) + ------------------------------ + + You can specify which host and port to connect to via 'password_ximss_host' + and 'password_ximss_port'. See config.inc.php.dist file for more info. + + + 2.8. Virtualmin (virtualmin) + ---------------------------- + + As in sasl driver this one allows to change password using shell + utility called "virtualmin". See drivers/chgvirtualminpasswd.c for + installation instructions. See also config.inc.php.dist file. + + + 2.9. hMailServer (hmail) + ------------------------ + + Requires PHP COM (Windows only). For access to hMail server on remote host + you'll need to define 'hmailserver_remote_dcom' and 'hmailserver_server'. + See config.inc.php.dist file for more info. + + + 2.10. PAM (pam) + --------------- + + This driver is for changing passwords of shell users authenticated with PAM. + Requires PECL's PAM exitension to be installed (http://pecl.php.net/package/PAM). + + + 2.11. Chpasswd (chpasswd) + ------------------------- + + Driver that adds functionality to change the systems user password via + the 'chpasswd' command. See config.inc.php.dist file. + + Attached wrapper script (chpass-wrapper.py) restricts password changes + to uids >= 1000 and can deny requests based on a blacklist. + + + 2.12. LDAP - no PEAR (ldap_simple) + ----------------------------------- + + It's rewritten ldap driver that doesn't require the Net_LDAP2 PEAR extension. + It uses directly PHP's ldap module functions instead (as Roundcube does). + + This driver is fully compatible with the ldap driver, but + does not require (or uses) the + $rcmail_config['password_ldap_force_replace'] variable. + Other advantages: + * Connects only once with the LDAP server when using the search user. + * Does not read the DN, but only replaces the password within (that is + why the 'force replace' is always used). + + + 2.13. XMail (xmail) + ----------------------------------- + + Driver for XMail (www.xmailserver.org). See config.inc.php.dist file + for configuration description. + + + 3. Driver API + ------------- + + Driver file (<driver_name>.php) must define 'password_save' function with + two arguments. First - current password, second - new password. Function + should return PASSWORD_SUCCESS on success or any of PASSWORD_CONNECT_ERROR, + PASSWORD_CRYPT_ERROR, PASSWORD_ERROR when driver was unable to change password. + Extended result (as a hash-array with 'message' and 'code' items) can be returned + too. See existing drivers in drivers/ directory for examples. diff --git a/plugins/password/config.inc.php.dist b/plugins/password/config.inc.php.dist new file mode 100644 index 000000000..94af6d776 --- /dev/null +++ b/plugins/password/config.inc.php.dist @@ -0,0 +1,303 @@ +<?php + +// Password Plugin options +// ----------------------- +// A driver to use for password change. Default: "sql". +// See README file for list of supported driver names. +$rcmail_config['password_driver'] = 'sql'; + +// Determine whether current password is required to change password. +// Default: false. +$rcmail_config['password_confirm_current'] = true; + +// Require the new password to be a certain length. +// set to blank to allow passwords of any length +$rcmail_config['password_minimum_length'] = 0; + +// Require the new password to contain a letter and punctuation character +// Change to false to remove this check. +$rcmail_config['password_require_nonalpha'] = false; + +// Enables logging of password changes into logs/password +$rcmail_config['password_log'] = false; + + +// SQL Driver options +// ------------------ +// PEAR database DSN for performing the query. By default +// Roundcube DB settings are used. +$rcmail_config['password_db_dsn'] = ''; + +// The SQL query used to change the password. +// The query can contain the following macros that will be expanded as follows: +// %p is replaced with the plaintext new password +// %c is replaced with the crypt version of the new password, MD5 if available +// otherwise DES. +// %D is replaced with the dovecotpw-crypted version of the new password +// %o is replaced with the password before the change +// %n is replaced with the hashed version of the new password +// %q is replaced with the hashed password before the change +// %h is replaced with the imap host (from the session info) +// %u is replaced with the username (from the session info) +// %l is replaced with the local part of the username +// (in case the username is an email address) +// %d is replaced with the domain part of the username +// (in case the username is an email address) +// Escaping of macros is handled by this module. +// Default: "SELECT update_passwd(%c, %u)" +$rcmail_config['password_query'] = 'SELECT update_passwd(%c, %u)'; + +// Path for dovecotpw (if not in $PATH) +// $rcmail_config['password_dovecotpw'] = '/usr/local/sbin/dovecotpw'; + +// Dovecot method (dovecotpw -s 'method') +$rcmail_config['password_dovecotpw_method'] = 'CRAM-MD5'; + +// Enables use of password with crypt method prefix in %D, e.g. {MD5}$1$LUiMYWqx$fEkg/ggr/L6Mb2X7be4i1/ +$rcmail_config['password_dovecotpw_with_method'] = false; + +// Using a password hash for %n and %q variables. +// Determine which hashing algorithm should be used to generate +// the hashed new and current password for using them within the +// SQL query. Requires PHP's 'hash' extension. +$rcmail_config['password_hash_algorithm'] = 'sha1'; + +// You can also decide whether the hash should be provided +// as hex string or in base64 encoded format. +$rcmail_config['password_hash_base64'] = false; + + +// Poppassd Driver options +// ----------------------- +// The host which changes the password +$rcmail_config['password_pop_host'] = 'localhost'; + +// TCP port used for poppassd connections +$rcmail_config['password_pop_port'] = 106; + + +// SASL Driver options +// ------------------- +// Additional arguments for the saslpasswd2 call +$rcmail_config['password_saslpasswd_args'] = ''; + + +// LDAP and LDAP_SIMPLE Driver options +// ----------------------------------- +// LDAP server name to connect to. +// You can provide one or several hosts in an array in which case the hosts are tried from left to right. +// Exemple: array('ldap1.exemple.com', 'ldap2.exemple.com'); +// Default: 'localhost' +$rcmail_config['password_ldap_host'] = 'localhost'; + +// LDAP server port to connect to +// Default: '389' +$rcmail_config['password_ldap_port'] = '389'; + +// TLS is started after connecting +// Using TLS for password modification is recommanded. +// Default: false +$rcmail_config['password_ldap_starttls'] = false; + +// LDAP version +// Default: '3' +$rcmail_config['password_ldap_version'] = '3'; + +// LDAP base name (root directory) +// Exemple: 'dc=exemple,dc=com' +$rcmail_config['password_ldap_basedn'] = 'dc=exemple,dc=com'; + +// LDAP connection method +// There is two connection method for changing a user's LDAP password. +// 'user': use user credential (recommanded, require password_confirm_current=true) +// 'admin': use admin credential (this mode require password_ldap_adminDN and password_ldap_adminPW) +// Default: 'user' +$rcmail_config['password_ldap_method'] = 'user'; + +// LDAP Admin DN +// Used only in admin connection mode +// Default: null +$rcmail_config['password_ldap_adminDN'] = null; + +// LDAP Admin Password +// Used only in admin connection mode +// Default: null +$rcmail_config['password_ldap_adminPW'] = null; + +// LDAP user DN mask +// The user's DN is mandatory and as we only have his login, +// we need to re-create his DN using a mask +// '%login' will be replaced by the current roundcube user's login +// '%name' will be replaced by the current roundcube user's name part +// '%domain' will be replaced by the current roundcube user's domain part +// '%dc' will be replaced by domain name hierarchal string e.g. "dc=test,dc=domain,dc=com" +// Exemple: 'uid=%login,ou=people,dc=exemple,dc=com' +$rcmail_config['password_ldap_userDN_mask'] = 'uid=%login,ou=people,dc=exemple,dc=com'; + +// LDAP search DN +// The DN roundcube should bind with to find out user's DN +// based on his login. Note that you should comment out the default +// password_ldap_userDN_mask setting for this to take effect. +// Use this if you cannot specify a general template for user DN with +// password_ldap_userDN_mask. You need to perform a search based on +// users login to find his DN instead. A common reason might be that +// your users are placed under different ou's like engineering or +// sales which cannot be derived from their login only. +$rcmail_config['password_ldap_searchDN'] = 'cn=roundcube,ou=services,dc=example,dc=com'; + +// LDAP search password +// If password_ldap_searchDN is set, the password to use for +// binding to search for user's DN. Note that you should comment out the default +// password_ldap_userDN_mask setting for this to take effect. +// Warning: Be sure to set approperiate permissions on this file so this password +// is only accesible to roundcube and don't forget to restrict roundcube's access to +// your directory as much as possible using ACLs. Should this password be compromised +// you want to minimize the damage. +$rcmail_config['password_ldap_searchPW'] = 'secret'; + +// LDAP search base +// If password_ldap_searchDN is set, the base to search in using the filter below. +// Note that you should comment out the default password_ldap_userDN_mask setting +// for this to take effect. +$rcmail_config['password_ldap_search_base'] = 'ou=people,dc=example,dc=com'; + +// LDAP search filter +// If password_ldap_searchDN is set, the filter to use when +// searching for user's DN. Note that you should comment out the default +// password_ldap_userDN_mask setting for this to take effect. +// '%login' will be replaced by the current roundcube user's login +// '%name' will be replaced by the current roundcube user's name part +// '%domain' will be replaced by the current roundcube user's domain part +// '%dc' will be replaced by domain name hierarchal string e.g. "dc=test,dc=domain,dc=com" +// Example: '(uid=%login)' +// Example: '(&(objectClass=posixAccount)(uid=%login))' +$rcmail_config['password_ldap_search_filter'] = '(uid=%login)'; + +// LDAP password hash type +// Standard LDAP encryption type which must be one of: crypt, +// ext_des, md5crypt, blowfish, md5, sha, smd5, ssha, or clear. +// Please note that most encodage types require external libraries +// to be included in your PHP installation, see function hashPassword in drivers/ldap.php for more info. +// Default: 'crypt' +$rcmail_config['password_ldap_encodage'] = 'crypt'; + +// LDAP password attribute +// Name of the ldap's attribute used for storing user password +// Default: 'userPassword' +$rcmail_config['password_ldap_pwattr'] = 'userPassword'; + +// LDAP password force replace +// Force LDAP replace in cases where ACL allows only replace not read +// See http://pear.php.net/package/Net_LDAP2/docs/latest/Net_LDAP2/Net_LDAP2_Entry.html#methodreplace +// Default: true +$rcmail_config['password_ldap_force_replace'] = true; + +// LDAP Password Last Change Date +// Some places use an attribute to store the date of the last password change +// The date is meassured in "days since epoch" (an integer value) +// Whenever the password is changed, the attribute will be updated if set (e.g. shadowLastChange) +$rcmail_config['password_ldap_lchattr'] = ''; + +// LDAP Samba password attribute, e.g. sambaNTPassword +// Name of the LDAP's Samba attribute used for storing user password +$rcmail_config['password_ldap_samba_pwattr'] = ''; + +// LDAP Samba Password Last Change Date attribute, e.g. sambaPwdLastSet +// Some places use an attribute to store the date of the last password change +// The date is meassured in "seconds since epoch" (an integer value) +// Whenever the password is changed, the attribute will be updated if set +$rcmail_config['password_ldap_samba_lchattr'] = ''; + + +// DirectAdmin Driver options +// -------------------------- +// The host which changes the password +// Use 'ssl://host' instead of 'tcp://host' when running DirectAdmin over SSL. +// The host can contain the following macros that will be expanded as follows: +// %h is replaced with the imap host (from the session info) +// %d is replaced with the domain part of the username (if the username is an email) +$rcmail_config['password_directadmin_host'] = 'tcp://localhost'; + +// TCP port used for DirectAdmin connections +$rcmail_config['password_directadmin_port'] = 2222; + + +// vpopmaild Driver options +// ----------------------- +// The host which changes the password +$rcmail_config['password_vpopmaild_host'] = 'localhost'; + +// TCP port used for vpopmaild connections +$rcmail_config['password_vpopmaild_port'] = 89; + + +// cPanel Driver options +// -------------------------- +// The cPanel Host name +$rcmail_config['password_cpanel_host'] = 'host.domain.com'; + +// The cPanel admin username +$rcmail_config['password_cpanel_username'] = 'username'; + +// The cPanel admin password +$rcmail_config['password_cpanel_password'] = 'password'; + +// The cPanel port to use +$rcmail_config['password_cpanel_port'] = 2082; + +// Using ssl for cPanel connections? +$rcmail_config['password_cpanel_ssl'] = true; + +// The cPanel theme in use +$rcmail_config['password_cpanel_theme'] = 'x'; + + +// XIMSS (Communigate server) Driver options +// ----------------------------------------- +// Host name of the Communigate server +$rcmail_config['password_ximss_host'] = 'mail.example.com'; + +// XIMSS port on Communigate server +$rcmail_config['password_ximss_port'] = 11024; + + +// chpasswd Driver options +// --------------------- +// Command to use +$rcmail_config['password_chpasswd_cmd'] = 'sudo /usr/sbin/chpasswd 2> /dev/null'; + + +// XMail Driver options +// --------------------- +$rcmail_config['xmail_host'] = 'localhost'; +$rcmail_config['xmail_user'] = 'YourXmailControlUser'; +$rcmail_config['xmail_pass'] = 'YourXmailControlPass'; +$rcmail_config['xmail_port'] = 6017; + + +// hMail Driver options +// ----------------------- +// Remote hMailServer configuration +// true: HMailserver is on a remote box (php.ini: com.allow_dcom = true) +// false: Hmailserver is on same box as PHP +$rcmail_config['hmailserver_remote_dcom'] = false; +// Windows credentials +$rcmail_config['hmailserver_server'] = array( + 'Server' => 'localhost', // hostname or ip address + 'Username' => 'administrator', // windows username + 'Password' => 'password' // windows user password +); + + +// Virtualmin Driver options +// ------------------------- +// Username format: +// 0: username@domain +// 1: username%domain +// 2: username.domain +// 3: domain.username +// 4: username-domain +// 5: domain-username +// 6: username_domain +// 7: domain_username +$rcmail_config['password_virtualmin_format'] = 0; diff --git a/plugins/password/drivers/chgsaslpasswd.c b/plugins/password/drivers/chgsaslpasswd.c new file mode 100644 index 000000000..bcdcb2e0d --- /dev/null +++ b/plugins/password/drivers/chgsaslpasswd.c @@ -0,0 +1,29 @@ +#include <stdio.h> +#include <unistd.h> + +// set the UID this script will run as (cyrus user) +#define UID 96 +// set the path to saslpasswd or saslpasswd2 +#define CMD "/usr/sbin/saslpasswd2" + +/* INSTALLING: + gcc -o chgsaslpasswd chgsaslpasswd.c + chown cyrus.apache chgsaslpasswd + strip chgsaslpasswd + chmod 4550 chgsaslpasswd +*/ + +main(int argc, char *argv[]) +{ + int rc,cc; + + cc = setuid(UID); + rc = execvp(CMD, argv); + if ((rc != 0) || (cc != 0)) + { + fprintf(stderr, "__ %s: failed %d %d\n", argv[0], rc, cc); + return 1; + } + + return 0; +} diff --git a/plugins/password/drivers/chgvirtualminpasswd.c b/plugins/password/drivers/chgvirtualminpasswd.c new file mode 100644 index 000000000..4e2299c66 --- /dev/null +++ b/plugins/password/drivers/chgvirtualminpasswd.c @@ -0,0 +1,28 @@ +#include <stdio.h> +#include <unistd.h> + +// set the UID this script will run as (root user) +#define UID 0 +#define CMD "/usr/sbin/virtualmin" + +/* INSTALLING: + gcc -o chgvirtualminpasswd chgvirtualminpasswd.c + chown root.apache chgvirtualminpasswd + strip chgvirtualminpasswd + chmod 4550 chgvirtualminpasswd +*/ + +main(int argc, char *argv[]) +{ + int rc,cc; + + cc = setuid(UID); + rc = execvp(CMD, argv); + if ((rc != 0) || (cc != 0)) + { + fprintf(stderr, "__ %s: failed %d %d\n", argv[0], rc, cc); + return 1; + } + + return 0; +} diff --git a/plugins/password/drivers/chpass-wrapper.py b/plugins/password/drivers/chpass-wrapper.py new file mode 100644 index 000000000..61bba849e --- /dev/null +++ b/plugins/password/drivers/chpass-wrapper.py @@ -0,0 +1,32 @@ +#!/usr/bin/env python + +import sys +import pwd +import subprocess + +BLACKLIST = ( + # add blacklisted users here + #'user1', +) + +try: + username, password = sys.stdin.readline().split(':', 1) +except ValueError, e: + sys.exit('Malformed input') + +try: + user = pwd.getpwnam(username) +except KeyError, e: + sys.exit('No such user: %s' % username) + +if user.pw_uid < 1000: + sys.exit('Changing the password for user id < 1000 is forbidden') + +if username in BLACKLIST: + sys.exit('Changing password for user %s is forbidden (user blacklisted)' % + username) + +handle = subprocess.Popen('/usr/sbin/chpasswd', stdin = subprocess.PIPE) +handle.communicate('%s:%s' % (username, password)) + +sys.exit(handle.returncode) diff --git a/plugins/password/drivers/chpasswd.php b/plugins/password/drivers/chpasswd.php new file mode 100644 index 000000000..28c3e5d7a --- /dev/null +++ b/plugins/password/drivers/chpasswd.php @@ -0,0 +1,36 @@ +<?php + +/** + * chpasswd Driver + * + * Driver that adds functionality to change the systems user password via + * the 'chpasswd' command. + * + * For installation instructions please read the README file. + * + * @version 1.0 + * @author Alex Cartwright <acartwright@mutinydesign.co.uk) + */ + +function password_save($currpass, $newpass) +{ + $cmd = rcmail::get_instance()->config->get('password_chpasswd_cmd'); + $username = $_SESSION['username']; + + $handle = popen($cmd, "w"); + fwrite($handle, "$username:$newpass\n"); + + if (pclose($handle) == 0) { + return PASSWORD_SUCCESS; + } + else { + raise_error(array( + 'code' => 600, + 'type' => 'php', + 'file' => __FILE__, 'line' => __LINE__, + 'message' => "Password plugin: Unable to execute $cmd" + ), true, false); + } + + return PASSWORD_ERROR; +} diff --git a/plugins/password/drivers/cpanel.php b/plugins/password/drivers/cpanel.php new file mode 100644 index 000000000..82bfe74d2 --- /dev/null +++ b/plugins/password/drivers/cpanel.php @@ -0,0 +1,121 @@ +<?php + +/** + * cPanel Password Driver + * + * Driver that adds functionality to change the users cPanel password. + * The cPanel PHP API code has been taken from: http://www.phpclasses.org/browse/package/3534.html + * + * This driver has been tested with Hostmonster hosting and seems to work fine. + + * + * @version 1.0 + * @author Fulvio Venturelli <fulvio@venturelli.org> + */ + +class HTTP +{ + function HTTP($host, $username, $password, $port, $ssl, $theme) + { + $this->ssl = $ssl ? 'ssl://' : ''; + $this->username = $username; + $this->password = $password; + $this->theme = $theme; + $this->auth = base64_encode($username . ':' . $password); + $this->port = $port; + $this->host = $host; + $this->path = '/frontend/' . $theme . '/'; + } + + function getData($url, $data = '') + { + $url = $this->path . $url; + if(is_array($data)) + { + $url = $url . '?'; + foreach($data as $key=>$value) + { + $url .= urlencode($key) . '=' . urlencode($value) . '&'; + } + $url = substr($url, 0, -1); + } + $response = ''; + $fp = fsockopen($this->ssl . $this->host, $this->port); + if(!$fp) + { + return false; + } + $out = 'GET ' . $url . ' HTTP/1.0' . "\r\n"; + $out .= 'Authorization: Basic ' . $this->auth . "\r\n"; + $out .= 'Connection: Close' . "\r\n\r\n"; + fwrite($fp, $out); + while (!feof($fp)) + { + $response .= @fgets($fp); + } + fclose($fp); + return $response; + } +} + + +class emailAccount +{ + function emailAccount($host, $username, $password, $port, $ssl, $theme, $address) + { + $this->HTTP = new HTTP($host, $username, $password, $port, $ssl, $theme); + if(strpos($address, '@')) + { + list($this->email, $this->domain) = explode('@', $address); + } + else + { + list($this->email, $this->domain) = array($address, ''); + } + } + + /* + * Change email account password + * + * Returns true on success or false on failure. + * @param string $password email account password + * @return bool + */ + function setPassword($password) + { + $data['email'] = $this->email; + $data['domain'] = $this->domain; + $data['password'] = $password; + $response = $this->HTTP->getData('mail/dopasswdpop.html', $data); + if(strpos($response, 'success') && !strpos($response, 'failure')) + { + return true; + } + return false; + } +} + + +function password_save($curpas, $newpass) +{ + $rcmail = rcmail::get_instance(); + + // Create a cPanel email object + $cPanel = new emailAccount($rcmail->config->get('password_cpanel_host'), + $rcmail->config->get('password_cpanel_username'), + $rcmail->config->get('password_cpanel_password'), + $rcmail->config->get('password_cpanel_port'), + $rcmail->config->get('password_cpanel_ssl'), + $rcmail->config->get('password_cpanel_theme'), + $_SESSION['username'] ); + + if ($cPanel->setPassword($newpass)){ + return PASSWORD_SUCCESS; + } + else + { + return PASSWORD_ERROR; + } +} + +?> diff --git a/plugins/password/drivers/directadmin.php b/plugins/password/drivers/directadmin.php new file mode 100644 index 000000000..3b6ae9f03 --- /dev/null +++ b/plugins/password/drivers/directadmin.php @@ -0,0 +1,489 @@ +<?php + +/** + * DirectAdmin Password Driver + * + * Driver to change passwords via DirectAdmin Control Panel + * + * @version 1.2 + * @author Victor Benincasa <vbenincasa@gmail.com> + * + */ + + +function password_save($curpass, $passwd){ + + $rcmail = rcmail::get_instance(); + $Socket = new HTTPSocket; + + $da_user = $_SESSION['username']; + $da_curpass = $curpass; + $da_newpass = $passwd; + $da_host = $rcmail->config->get('password_directadmin_host'); + $da_port = $rcmail->config->get('password_directadmin_port'); + + if(strpos($da_user, '@') === false) return array('code' => PASSWORD_ERROR, 'message' => 'Change the SYSTEM user password through control panel!'); + + $da_host = str_replace('%h', $_SESSION['imap_host'], $da_host); + $da_host = str_replace('%d', $rcmail->user->get_username('domain'), $da_host); + + $Socket->connect($da_host,$da_port); + $Socket->set_method('POST'); + $Socket->query('/CMD_CHANGE_EMAIL_PASSWORD', + array( + 'email' => $da_user, + 'oldpassword' => $da_curpass, + 'password1' => $da_newpass, + 'password2' => $da_newpass, + 'api' => '1' + )); + $response = $Socket->fetch_parsed_body(); + + //DEBUG + //console("Password Plugin: [USER: $da_user] [HOST: $da_host] - Response: [SOCKET: ".$Socket->result_status_code."] [DA ERROR: ".strip_tags($response['error'])."] [TEXT: ".$response[text]."]"); + + if($Socket->result_status_code != 200) + return array('code' => PASSWORD_CONNECT_ERROR, 'message' => $Socket->error[0]); + elseif($response['error'] == 1) + return array('code' => PASSWORD_ERROR, 'message' => strip_tags($response['text'])); + else + return PASSWORD_SUCCESS; + +} + + +/** + * Socket communication class. + * + * Originally designed for use with DirectAdmin's API, this class will fill any HTTP socket need. + * + * Very, very basic usage: + * $Socket = new HTTPSocket; + * echo $Socket->get('http://user:pass@somesite.com/somedir/some.file?query=string&this=that'); + * + * @author Phi1 'l0rdphi1' Stier <l0rdphi1@liquenox.net> + * @package HTTPSocket + * @version 2.7 (Updated by Victor Benincasa <vbenincasa@gmail.com>) + */ +class HTTPSocket { + + var $version = '2.7'; + + /* all vars are private except $error, $query_cache, and $doFollowLocationHeader */ + + var $method = 'GET'; + + var $remote_host; + var $remote_port; + var $remote_uname; + var $remote_passwd; + + var $result; + var $result_header; + var $result_body; + var $result_status_code; + + var $lastTransferSpeed; + + var $bind_host; + + var $error = array(); + var $warn = array(); + var $query_cache = array(); + + var $doFollowLocationHeader = TRUE; + var $redirectURL; + + var $extra_headers = array(); + + /** + * Create server "connection". + * + */ + function connect($host, $port = '' ) + { + if (!is_numeric($port)) + { + $port = 80; + } + + $this->remote_host = $host; + $this->remote_port = $port; + } + + function bind( $ip = '' ) + { + if ( $ip == '' ) + { + $ip = $_SERVER['SERVER_ADDR']; + } + + $this->bind_host = $ip; + } + + /** + * Change the method being used to communicate. + * + * @param string|null request method. supports GET, POST, and HEAD. default is GET + */ + function set_method( $method = 'GET' ) + { + $this->method = strtoupper($method); + } + + /** + * Specify a username and password. + * + * @param string|null username. defualt is null + * @param string|null password. defualt is null + */ + function set_login( $uname = '', $passwd = '' ) + { + if ( strlen($uname) > 0 ) + { + $this->remote_uname = $uname; + } + + if ( strlen($passwd) > 0 ) + { + $this->remote_passwd = $passwd; + } + + } + + /** + * Query the server + * + * @param string containing properly formatted server API. See DA API docs and examples. Http:// URLs O.K. too. + * @param string|array query to pass to url + * @param int if connection KB/s drops below value here, will drop connection + */ + function query( $request, $content = '', $doSpeedCheck = 0 ) + { + $this->error = $this->warn = array(); + $this->result_status_code = NULL; + + // is our request a http:// ... ? + if (preg_match('!^http://!i',$request)) + { + $location = parse_url($request); + $this->connect($location['host'],$location['port']); + $this->set_login($location['user'],$location['pass']); + + $request = $location['path']; + $content = $location['query']; + + if ( strlen($request) < 1 ) + { + $request = '/'; + } + + } + + $array_headers = array( + 'User-Agent' => "HTTPSocket/$this->version", + 'Host' => ( $this->remote_port == 80 ? $this->remote_host : "$this->remote_host:$this->remote_port" ), + 'Accept' => '*/*', + 'Connection' => 'Close' ); + + foreach ( $this->extra_headers as $key => $value ) + { + $array_headers[$key] = $value; + } + + $this->result = $this->result_header = $this->result_body = ''; + + // was content sent as an array? if so, turn it into a string + if (is_array($content)) + { + $pairs = array(); + + foreach ( $content as $key => $value ) + { + $pairs[] = "$key=".urlencode($value); + } + + $content = join('&',$pairs); + unset($pairs); + } + + $OK = TRUE; + + // instance connection + if ($this->bind_host) + { + $socket = socket_create(AF_INET, SOCK_STREAM, SOL_TCP); + socket_bind($socket,$this->bind_host); + + if (!@socket_connect($socket,$this->remote_host,$this->remote_port)) + { + $OK = FALSE; + } + + } + else + { + $socket = @fsockopen( $this->remote_host, $this->remote_port, $sock_errno, $sock_errstr, 10 ); + } + + if ( !$socket || !$OK ) + { + $this->error[] = "Can't create socket connection to $this->remote_host:$this->remote_port."; + return 0; + } + + // if we have a username and password, add the header + if ( isset($this->remote_uname) && isset($this->remote_passwd) ) + { + $array_headers['Authorization'] = 'Basic '.base64_encode("$this->remote_uname:$this->remote_passwd"); + } + + // for DA skins: if $this->remote_passwd is NULL, try to use the login key system + if ( isset($this->remote_uname) && $this->remote_passwd == NULL ) + { + $array_headers['Cookie'] = "session={$_SERVER['SESSION_ID']}; key={$_SERVER['SESSION_KEY']}"; + } + + // if method is POST, add content length & type headers + if ( $this->method == 'POST' ) + { + $array_headers['Content-type'] = 'application/x-www-form-urlencoded'; + $array_headers['Content-length'] = strlen($content); + } + // else method is GET or HEAD. we don't support anything else right now. + else + { + if ($content) + { + $request .= "?$content"; + } + } + + // prepare query + $query = "$this->method $request HTTP/1.0\r\n"; + foreach ( $array_headers as $key => $value ) + { + $query .= "$key: $value\r\n"; + } + $query .= "\r\n"; + + // if POST we need to append our content + if ( $this->method == 'POST' && $content ) + { + $query .= "$content\r\n\r\n"; + } + + // query connection + if ($this->bind_host) + { + socket_write($socket,$query); + + // now load results + while ( $out = socket_read($socket,2048) ) + { + $this->result .= $out; + } + } + else + { + fwrite( $socket, $query, strlen($query) ); + + // now load results + $this->lastTransferSpeed = 0; + $status = socket_get_status($socket); + $startTime = time(); + $length = 0; + $prevSecond = 0; + while ( !feof($socket) && !$status['timed_out'] ) + { + $chunk = fgets($socket,1024); + $length += strlen($chunk); + $this->result .= $chunk; + + $elapsedTime = time() - $startTime; + + if ( $elapsedTime > 0 ) + { + $this->lastTransferSpeed = ($length/1024)/$elapsedTime; + } + + if ( $doSpeedCheck > 0 && $elapsedTime > 5 && $this->lastTransferSpeed < $doSpeedCheck ) + { + $this->warn[] = "kB/s for last 5 seconds is below 50 kB/s (~".( ($length/1024)/$elapsedTime )."), dropping connection..."; + $this->result_status_code = 503; + break; + } + + } + + if ( $this->lastTransferSpeed == 0 ) + { + $this->lastTransferSpeed = $length/1024; + } + + } + + list($this->result_header,$this->result_body) = preg_split("/\r\n\r\n/",$this->result,2); + + if ($this->bind_host) + { + socket_close($socket); + } + else + { + fclose($socket); + } + + $this->query_cache[] = $query; + + + $headers = $this->fetch_header(); + + // what return status did we get? + if (!$this->result_status_code) + { + preg_match("#HTTP/1\.. (\d+)#",$headers[0],$matches); + $this->result_status_code = $matches[1]; + } + + // did we get the full file? + if ( !empty($headers['content-length']) && $headers['content-length'] != strlen($this->result_body) ) + { + $this->result_status_code = 206; + } + + // now, if we're being passed a location header, should we follow it? + if ($this->doFollowLocationHeader) + { + if ($headers['location']) + { + $this->redirectURL = $headers['location']; + $this->query($headers['location']); + } + } + + } + + function getTransferSpeed() + { + return $this->lastTransferSpeed; + } + + /** + * The quick way to get a URL's content :) + * + * @param string URL + * @param boolean return as array? (like PHP's file() command) + * @return string result body + */ + function get($location, $asArray = FALSE ) + { + $this->query($location); + + if ( $this->get_status_code() == 200 ) + { + if ($asArray) + { + return preg_split("/\n/",$this->fetch_body()); + } + + return $this->fetch_body(); + } + + return FALSE; + } + + /** + * Returns the last status code. + * 200 = OK; + * 403 = FORBIDDEN; + * etc. + * + * @return int status code + */ + function get_status_code() + { + return $this->result_status_code; + } + + /** + * Adds a header, sent with the next query. + * + * @param string header name + * @param string header value + */ + function add_header($key,$value) + { + $this->extra_headers[$key] = $value; + } + + /** + * Clears any extra headers. + * + */ + function clear_headers() + { + $this->extra_headers = array(); + } + + /** + * Return the result of a query. + * + * @return string result + */ + function fetch_result() + { + return $this->result; + } + + /** + * Return the header of result (stuff before body). + * + * @param string (optional) header to return + * @return array result header + */ + function fetch_header( $header = '' ) + { + $array_headers = preg_split("/\r\n/",$this->result_header); + + $array_return = array( 0 => $array_headers[0] ); + unset($array_headers[0]); + + foreach ( $array_headers as $pair ) + { + list($key,$value) = preg_split("/: /",$pair,2); + $array_return[strtolower($key)] = $value; + } + + if ( $header != '' ) + { + return $array_return[strtolower($header)]; + } + + return $array_return; + } + + /** + * Return the body of result (stuff after header). + * + * @return string result body + */ + function fetch_body() + { + return $this->result_body; + } + + /** + * Return parsed body in array format. + * + * @return array result parsed + */ + function fetch_parsed_body() + { + parse_str($this->result_body,$x); + return $x; + } + +} + +?> diff --git a/plugins/password/drivers/hmail.php b/plugins/password/drivers/hmail.php new file mode 100644 index 000000000..39a87ab34 --- /dev/null +++ b/plugins/password/drivers/hmail.php @@ -0,0 +1,61 @@ +<?php + +/** + * hMailserver password driver + * + * @version 1.3 - 05.11.2010 + * @author Roland 'rosali' Liebl <myroundcube@mail4us.net> + * + */ + +function password_save($curpass, $passwd) +{ + $rcmail = rcmail::get_instance(); + + if ($curpass == '' || $passwd == '') + return PASSWORD_ERROR; + + try { + $remote = $rcmail->config->get('hmailserver_remote_dcom', false); + if ($remote) + $obApp = new COM("hMailServer.Application", $rcmail->config->get('hmailserver_server')); + else + $obApp = new COM("hMailServer.Application"); + } + catch (Exception $e) { + write_log('errors', "Plugin password (hmail driver): " . trim(strip_tags($e->getMessage()))); + write_log('errors', "Plugin password (hmail driver): This problem is often caused by DCOM permissions not being set."); + return PASSWORD_ERROR; + } + + $username = $rcmail->user->data['username']; + if (strstr($username,'@')){ + $temparr = explode('@', $username); + $domain = $temparr[1]; + } + else { + $domain = $rcmail->config->get('username_domain',false); + if (!$domain) { + write_log('errors','Plugin password (hmail driver): $rcmail_config[\'username_domain\'] is not defined.'); + write_log('errors','Plugin password (hmail driver): Hint: Use hmail_login plugin (http://myroundcube.googlecode.com'); + return PASSWORD_ERROR; + } + $username = $username . "@" . $domain; + } + + $obApp->Authenticate($username, $curpass); + try { + $obDomain = $obApp->Domains->ItemByName($domain); + $obAccount = $obDomain->Accounts->ItemByAddress($username); + $obAccount->Password = $passwd; + $obAccount->Save(); + return PASSWORD_SUCCESS; + } + catch (Exception $e) { + write_log('errors', "Plugin password (hmail driver): " . trim(strip_tags($e->getMessage()))); + write_log('errors', "Plugin password (hmail driver): This problem is often caused by DCOM permissions not being set."); + return PASSWORD_ERROR; + } +} + +?> diff --git a/plugins/password/drivers/ldap.php b/plugins/password/drivers/ldap.php new file mode 100644 index 000000000..3ea30a69c --- /dev/null +++ b/plugins/password/drivers/ldap.php @@ -0,0 +1,317 @@ +<?php + +/** + * LDAP Password Driver + * + * Driver for passwords stored in LDAP + * This driver use the PEAR Net_LDAP2 class (http://pear.php.net/package/Net_LDAP2). + * + * @version 1.1 (2010-04-07) + * @author Edouard MOREAU <edouard.moreau@ensma.fr> + * + * function hashPassword based on code from the phpLDAPadmin development team (http://phpldapadmin.sourceforge.net/). + * function randomSalt based on code from the phpLDAPadmin development team (http://phpldapadmin.sourceforge.net/). + * + */ + +function password_save($curpass, $passwd) +{ + $rcmail = rcmail::get_instance(); + require_once ('Net/LDAP2.php'); + + // Building user DN + if ($userDN = $rcmail->config->get('password_ldap_userDN_mask')) { + $userDN = substitute_vars($userDN); + } else { + $userDN = search_userdn($rcmail); + } + + if (empty($userDN)) { + return PASSWORD_CONNECT_ERROR; + } + + // Connection Method + switch($rcmail->config->get('password_ldap_method')) { + case 'admin': + $binddn = $rcmail->config->get('password_ldap_adminDN'); + $bindpw = $rcmail->config->get('password_ldap_adminPW'); + break; + case 'user': + default: + $binddn = $userDN; + $bindpw = $curpass; + break; + } + + // Configuration array + $ldapConfig = array ( + 'binddn' => $binddn, + 'bindpw' => $bindpw, + 'basedn' => $rcmail->config->get('password_ldap_basedn'), + 'host' => $rcmail->config->get('password_ldap_host'), + 'port' => $rcmail->config->get('password_ldap_port'), + 'starttls' => $rcmail->config->get('password_ldap_starttls'), + 'version' => $rcmail->config->get('password_ldap_version'), + ); + + // Connecting using the configuration array + $ldap = Net_LDAP2::connect($ldapConfig); + + // Checking for connection error + if (PEAR::isError($ldap)) { + return PASSWORD_CONNECT_ERROR; + } + + $crypted_pass = hashPassword($passwd, $rcmail->config->get('password_ldap_encodage')); + $force = $rcmail->config->get('password_ldap_force_replace'); + $pwattr = $rcmail->config->get('password_ldap_pwattr'); + $lchattr = $rcmail->config->get('password_ldap_lchattr'); + $smbpwattr = $rcmail->config->get('password_ldap_samba_pwattr'); + $smblchattr = $rcmail->config->get('password_ldap_samba_lchattr'); + $samba = $rcmail->config->get('password_ldap_samba'); + + // Support password_ldap_samba option for backward compat. + if ($samba && !$smbpwattr) { + $smbpwattr = 'sambaNTPassword'; + $smblchattr = 'sambaPwdLastSet'; + } + + // Crypt new password + if (!$crypted_pass) { + return PASSWORD_CRYPT_ERROR; + } + + // Crypt new samba password + if ($smbpwattr && !($samba_pass = hashPassword($passwd, 'samba'))) { + return PASSWORD_CRYPT_ERROR; + } + + // Writing new crypted password to LDAP + $userEntry = $ldap->getEntry($userDN); + if (Net_LDAP2::isError($userEntry)) { + return PASSWORD_CONNECT_ERROR; + } + + if (!$userEntry->replace(array($pwattr => $crypted_pass), $force)) { + return PASSWORD_CONNECT_ERROR; + } + + // Updating PasswordLastChange Attribute if desired + if ($lchattr) { + $current_day = (int)(time() / 86400); + if (!$userEntry->replace(array($lchattr => $current_day), $force)) { + return PASSWORD_CONNECT_ERROR; + } + } + + // Update Samba password and last change fields + if ($smbpwattr) { + $userEntry->replace(array($smbpwattr => $samba_pass), $force); + } + // Update Samba password last change field + if ($smblchattr) { + $userEntry->replace(array($smblchattr => time()), $force); + } + + if (Net_LDAP2::isError($userEntry->update())) { + return PASSWORD_CONNECT_ERROR; + } + + // All done, no error + return PASSWORD_SUCCESS; +} + +/** + * Bind with searchDN and searchPW and search for the user's DN. + * Use search_base and search_filter defined in config file. + * Return the found DN. + */ +function search_userdn($rcmail) +{ + $ldapConfig = array ( + 'binddn' => $rcmail->config->get('password_ldap_searchDN'), + 'bindpw' => $rcmail->config->get('password_ldap_searchPW'), + 'basedn' => $rcmail->config->get('password_ldap_basedn'), + 'host' => $rcmail->config->get('password_ldap_host'), + 'port' => $rcmail->config->get('password_ldap_port'), + 'starttls' => $rcmail->config->get('password_ldap_starttls'), + 'version' => $rcmail->config->get('password_ldap_version'), + ); + + $ldap = Net_LDAP2::connect($ldapConfig); + + if (PEAR::isError($ldap)) { + return ''; + } + + $base = $rcmail->config->get('password_ldap_search_base'); + $filter = substitute_vars($rcmail->config->get('password_ldap_search_filter')); + $options = array ( + 'scope' => 'sub', + 'attributes' => array(), + ); + + $result = $ldap->search($base, $filter, $options); + $ldap->done(); + if (PEAR::isError($result) || ($result->count() != 1)) { + return ''; + } + + return $result->current()->dn(); +} + +/** + * Substitute %login, %name, %domain, %dc in $str. + * See plugin config for details. + */ +function substitute_vars($str) +{ + $rcmail = rcmail::get_instance(); + $domain = $rcmail->user->get_username('domain'); + $dc = 'dc='.strtr($domain, array('.' => ',dc=')); // hierarchal domain string + + $str = str_replace(array( + '%login', + '%name', + '%domain', + '%dc', + ), array( + $_SESSION['username'], + $rcmail->user->get_username('local'), + $domain, + $dc, + ), $str + ); + + return $str; +} + + +/** + * Code originaly from the phpLDAPadmin development team + * http://phpldapadmin.sourceforge.net/ + * + * Hashes a password and returns the hash based on the specified enc_type. + * + * @param string $passwordClear The password to hash in clear text. + * @param string $encodageType Standard LDAP encryption type which must be one of + * crypt, ext_des, md5crypt, blowfish, md5, sha, smd5, ssha, or clear. + * @return string The hashed password. + * + */ + +function hashPassword( $passwordClear, $encodageType ) +{ + $encodageType = strtolower( $encodageType ); + switch( $encodageType ) { + case 'crypt': + $cryptedPassword = '{CRYPT}' . crypt($passwordClear,randomSalt(2)); + break; + + case 'ext_des': + // extended des crypt. see OpenBSD crypt man page. + if ( ! defined( 'CRYPT_EXT_DES' ) || CRYPT_EXT_DES == 0 ) { + // Your system crypt library does not support extended DES encryption. + return FALSE; + } + $cryptedPassword = '{CRYPT}' . crypt( $passwordClear, '_' . randomSalt(8) ); + break; + + case 'md5crypt': + if( ! defined( 'CRYPT_MD5' ) || CRYPT_MD5 == 0 ) { + // Your system crypt library does not support md5crypt encryption. + return FALSE; + } + $cryptedPassword = '{CRYPT}' . crypt( $passwordClear , '$1$' . randomSalt(9) ); + break; + + case 'blowfish': + if( ! defined( 'CRYPT_BLOWFISH' ) || CRYPT_BLOWFISH == 0 ) { + // Your system crypt library does not support blowfish encryption. + return FALSE; + } + // hardcoded to second blowfish version and set number of rounds + $cryptedPassword = '{CRYPT}' . crypt( $passwordClear , '$2a$12$' . randomSalt(13) ); + break; + + case 'md5': + $cryptedPassword = '{MD5}' . base64_encode( pack( 'H*' , md5( $passwordClear) ) ); + break; + + case 'sha': + if( function_exists('sha1') ) { + // use php 4.3.0+ sha1 function, if it is available. + $cryptedPassword = '{SHA}' . base64_encode( pack( 'H*' , sha1( $passwordClear) ) ); + } elseif( function_exists( 'mhash' ) ) { + $cryptedPassword = '{SHA}' . base64_encode( mhash( MHASH_SHA1, $passwordClear) ); + } else { + return FALSE; //Your PHP install does not have the mhash() function. Cannot do SHA hashes. + } + break; + + case 'ssha': + if( function_exists( 'mhash' ) && function_exists( 'mhash_keygen_s2k' ) ) { + mt_srand( (double) microtime() * 1000000 ); + $salt = mhash_keygen_s2k( MHASH_SHA1, $passwordClear, substr( pack( 'h*', md5( mt_rand() ) ), 0, 8 ), 4 ); + $cryptedPassword = '{SSHA}'.base64_encode( mhash( MHASH_SHA1, $passwordClear.$salt ).$salt ); + } else { + return FALSE; //Your PHP install does not have the mhash() function. Cannot do SHA hashes. + } + break; + + case 'smd5': + if( function_exists( 'mhash' ) && function_exists( 'mhash_keygen_s2k' ) ) { + mt_srand( (double) microtime() * 1000000 ); + $salt = mhash_keygen_s2k( MHASH_MD5, $passwordClear, substr( pack( 'h*', md5( mt_rand() ) ), 0, 8 ), 4 ); + $cryptedPassword = '{SMD5}'.base64_encode( mhash( MHASH_MD5, $passwordClear.$salt ).$salt ); + } else { + return FALSE; //Your PHP install does not have the mhash() function. Cannot do SHA hashes. + } + break; + + case 'samba': + if (function_exists('hash')) { + $cryptedPassword = hash('md4', rcube_charset_convert($passwordClear, RCMAIL_CHARSET, 'UTF-16LE')); + } else { + /* Your PHP install does not have the hash() function */ + return false; + } + break; + + case 'clear': + default: + $cryptedPassword = $passwordClear; + } + + return $cryptedPassword; +} + +/** + * Code originaly from the phpLDAPadmin development team + * http://phpldapadmin.sourceforge.net/ + * + * Used to generate a random salt for crypt-style passwords. Salt strings are used + * to make pre-built hash cracking dictionaries difficult to use as the hash algorithm uses + * not only the user's password but also a randomly generated string. The string is + * stored as the first N characters of the hash for reference of hashing algorithms later. + * + * --- added 20021125 by bayu irawan <bayuir@divnet.telkom.co.id> --- + * --- ammended 20030625 by S C Rigler <srigler@houston.rr.com> --- + * + * @param int $length The length of the salt string to generate. + * @return string The generated salt string. + */ +function randomSalt( $length ) +{ + $possible = '0123456789'. + 'abcdefghijklmnopqrstuvwxyz'. + 'ABCDEFGHIJKLMNOPQRSTUVWXYZ'. + './'; + $str = ''; +// mt_srand((double)microtime() * 1000000); + + while (strlen($str) < $length) + $str .= substr($possible, (rand() % strlen($possible)), 1); + + return $str; +} diff --git a/plugins/password/drivers/ldap_simple.php b/plugins/password/drivers/ldap_simple.php new file mode 100644 index 000000000..482b7e56f --- /dev/null +++ b/plugins/password/drivers/ldap_simple.php @@ -0,0 +1,270 @@ +<?php + +/** + * Simple LDAP Password Driver + * + * Driver for passwords stored in LDAP + * This driver is based on Edouard's LDAP Password Driver, but does not + * require PEAR's Net_LDAP2 to be installed + * + * @version 1.0 (2010-07-31) + * @author Wout Decre <wout@canodus.be> + */ +function password_save($curpass, $passwd) +{ + $rcmail = rcmail::get_instance(); + + // Connect + if (!$ds = ldap_connect($rcmail->config->get('password_ldap_host'), $rcmail->config->get('password_ldap_port'))) { + ldap_unbind($ds); + return PASSWORD_CONNECT_ERROR; + } + + // Set protocol version + if (!ldap_set_option($ds, LDAP_OPT_PROTOCOL_VERSION, $rcmail->config->get('password_ldap_version'))) { + ldap_unbind($ds); + return PASSWORD_CONNECT_ERROR; + } + + // Start TLS + if ($rcmail->config->get('password_ldap_starttls')) { + if (!ldap_start_tls($ds)) { + ldap_unbind($ds); + return PASSWORD_CONNECT_ERROR; + } + } + + // Build user DN + if ($user_dn = $rcmail->config->get('password_ldap_userDN_mask')) { + $user_dn = ldap_simple_substitute_vars($user_dn); + } else { + $user_dn = ldap_simple_search_userdn($rcmail, $ds); + } + + if (empty($user_dn)) { + ldap_unbind($ds); + return PASSWORD_CONNECT_ERROR; + } + + // Connection method + switch ($rcmail->config->get('password_ldap_method')) { + case 'admin': + $binddn = $rcmail->config->get('password_ldap_adminDN'); + $bindpw = $rcmail->config->get('password_ldap_adminPW'); + break; + case 'user': + default: + $binddn = $user_dn; + $bindpw = $curpass; + break; + } + + + $crypted_pass = ldap_simple_hash_password($passwd, $rcmail->config->get('password_ldap_encodage')); + $lchattr = $rcmail->config->get('password_ldap_lchattr'); + $pwattr = $rcmail->config->get('password_ldap_pwattr'); + $smbpwattr = $rcmail->config->get('password_ldap_samba_pwattr'); + $smblchattr = $rcmail->config->get('password_ldap_samba_lchattr'); + $samba = $rcmail->config->get('password_ldap_samba'); + + // Support password_ldap_samba option for backward compat. + if ($samba && !$smbpwattr) { + $smbpwattr = 'sambaNTPassword'; + $smblchattr = 'sambaPwdLastSet'; + } + + // Crypt new password + if (!$crypted_pass) { + return PASSWORD_CRYPT_ERROR; + } + + // Crypt new Samba password + if ($smbpwattr && !($samba_pass = ldap_simple_hash_password($passwd, 'samba'))) { + return PASSWORD_CRYPT_ERROR; + } + + // Bind + if (!ldap_bind($ds, $binddn, $bindpw)) { + ldap_unbind($ds); + return PASSWORD_CONNECT_ERROR; + } + + $entree[$pwattr] = $crypted_pass; + + // Update PasswordLastChange Attribute if desired + if ($lchattr) { + $entree[$lchattr] = (int)(time() / 86400); + } + + // Update Samba password + if ($smbpwattr) { + $entree[$smbpwattr] = $samba_pass; + } + + // Update Samba password last change + if ($smblchattr) { + $entree[$smblchattr] = time(); + } + + if (!ldap_modify($ds, $user_dn, $entree)) { + ldap_unbind($ds); + return PASSWORD_CONNECT_ERROR; + } + + // All done, no error + ldap_unbind($ds); + return PASSWORD_SUCCESS; +} + +/** + * Bind with searchDN and searchPW and search for the user's DN + * Use search_base and search_filter defined in config file + * Return the found DN + */ +function ldap_simple_search_userdn($rcmail, $ds) +{ + /* Bind */ + if (!ldap_bind($ds, $rcmail->config->get('password_ldap_searchDN'), $rcmail->config->get('password_ldap_searchPW'))) { + return false; + } + + /* Search for the DN */ + if (!$sr = ldap_search($ds, $rcmail->config->get('password_ldap_search_base'), ldap_simple_substitute_vars($rcmail->config->get('password_ldap_search_filter')))) { + return false; + } + + /* If no or more entries were found, return false */ + if (ldap_count_entries($ds, $sr) != 1) { + return false; + } + + return ldap_get_dn($ds, ldap_first_entry($ds, $sr)); +} + +/** + * Substitute %login, %name, %domain, %dc in $str + * See plugin config for details + */ +function ldap_simple_substitute_vars($str) +{ + $str = str_replace('%login', $_SESSION['username'], $str); + $str = str_replace('%l', $_SESSION['username'], $str); + + $parts = explode('@', $_SESSION['username']); + + if (count($parts) == 2) { + $dc = 'dc='.strtr($parts[1], array('.' => ',dc=')); // hierarchal domain string + + $str = str_replace('%name', $parts[0], $str); + $str = str_replace('%n', $parts[0], $str); + $str = str_replace('%dc', $dc, $str); + $str = str_replace('%domain', $parts[1], $str); + $str = str_replace('%d', $parts[1], $str); + } + + return $str; +} + +/** + * Code originaly from the phpLDAPadmin development team + * http://phpldapadmin.sourceforge.net/ + * + * Hashes a password and returns the hash based on the specified enc_type + */ +function ldap_simple_hash_password($password_clear, $encodage_type) +{ + $encodage_type = strtolower($encodage_type); + switch ($encodage_type) { + case 'crypt': + $crypted_password = '{CRYPT}' . crypt($password_clear, ldap_simple_random_salt(2)); + break; + case 'ext_des': + /* Extended DES crypt. see OpenBSD crypt man page */ + if (!defined('CRYPT_EXT_DES') || CRYPT_EXT_DES == 0) { + /* Your system crypt library does not support extended DES encryption */ + return false; + } + $crypted_password = '{CRYPT}' . crypt($password_clear, '_' . ldap_simple_random_salt(8)); + break; + case 'md5crypt': + if (!defined('CRYPT_MD5') || CRYPT_MD5 == 0) { + /* Your system crypt library does not support md5crypt encryption */ + return false; + } + $crypted_password = '{CRYPT}' . crypt($password_clear, '$1$' . ldap_simple_random_salt(9)); + break; + case 'blowfish': + if (!defined('CRYPT_BLOWFISH') || CRYPT_BLOWFISH == 0) { + /* Your system crypt library does not support blowfish encryption */ + return false; + } + /* Hardcoded to second blowfish version and set number of rounds */ + $crypted_password = '{CRYPT}' . crypt($password_clear, '$2a$12$' . ldap_simple_random_salt(13)); + break; + case 'md5': + $crypted_password = '{MD5}' . base64_encode(pack('H*', md5($password_clear))); + break; + case 'sha': + if (function_exists('sha1')) { + /* Use PHP 4.3.0+ sha1 function, if it is available */ + $crypted_password = '{SHA}' . base64_encode(pack('H*', sha1($password_clear))); + } else if (function_exists('mhash')) { + $crypted_password = '{SHA}' . base64_encode(mhash(MHASH_SHA1, $password_clear)); + } else { + /* Your PHP install does not have the mhash() function */ + return false; + } + break; + case 'ssha': + if (function_exists('mhash') && function_exists('mhash_keygen_s2k')) { + mt_srand((double) microtime() * 1000000 ); + $salt = mhash_keygen_s2k(MHASH_SHA1, $password_clear, substr(pack('h*', md5(mt_rand())), 0, 8), 4); + $crypted_password = '{SSHA}' . base64_encode(mhash(MHASH_SHA1, $password_clear . $salt) . $salt); + } else { + /* Your PHP install does not have the mhash() function */ + return false; + } + break; + case 'smd5': + if (function_exists('mhash') && function_exists('mhash_keygen_s2k')) { + mt_srand((double) microtime() * 1000000 ); + $salt = mhash_keygen_s2k(MHASH_MD5, $password_clear, substr(pack('h*', md5(mt_rand())), 0, 8), 4); + $crypted_password = '{SMD5}' . base64_encode(mhash(MHASH_MD5, $password_clear . $salt) . $salt); + } else { + /* Your PHP install does not have the mhash() function */ + return false; + } + break; + case 'samba': + if (function_exists('hash')) { + $crypted_password = hash('md4', rcube_charset_convert($password_clear, RCMAIL_CHARSET, 'UTF-16LE')); + } else { + /* Your PHP install does not have the hash() function */ + return false; + } + break; + case 'clear': + default: + $crypted_password = $password_clear; + } + + return $crypted_password; +} + +/** + * Code originaly from the phpLDAPadmin development team + * http://phpldapadmin.sourceforge.net/ + * + * Used to generate a random salt for crypt-style passwords + */ +function ldap_simple_random_salt($length) +{ + $possible = '0123456789' . 'abcdefghijklmnopqrstuvwxyz' . 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' . './'; + $str = ''; + // mt_srand((double)microtime() * 1000000); + while (strlen($str) < $length) { + $str .= substr($possible, (rand() % strlen($possible)), 1); + } + + return $str; +} diff --git a/plugins/password/drivers/pam.php b/plugins/password/drivers/pam.php new file mode 100644 index 000000000..e9363cc5a --- /dev/null +++ b/plugins/password/drivers/pam.php @@ -0,0 +1,41 @@ +<?php + +/** + * PAM Password Driver + * + * @version 1.0 + * @author Aleksander Machniak + */ + +function password_save($currpass, $newpass) +{ + $user = $_SESSION['username']; + + if (extension_loaded('pam')) { + if (pam_auth($user, $currpass, $error, false)) { + if (pam_chpass($user, $currpass, $newpass)) { + return PASSWORD_SUCCESS; + } + } + else { + raise_error(array( + 'code' => 600, + 'type' => 'php', + 'file' => __FILE__, 'line' => __LINE__, + 'message' => "Password plugin: PAM authentication failed for user $user: $error" + ), true, false); + } + } + else { + raise_error(array( + 'code' => 600, + 'type' => 'php', + 'file' => __FILE__, 'line' => __LINE__, + 'message' => "Password plugin: PECL-PAM module not loaded" + ), true, false); + } + + return PASSWORD_ERROR; +} + +?> diff --git a/plugins/password/drivers/poppassd.php b/plugins/password/drivers/poppassd.php new file mode 100644 index 000000000..fc105de47 --- /dev/null +++ b/plugins/password/drivers/poppassd.php @@ -0,0 +1,64 @@ +<?php + +/** + * Poppassd Password Driver + * + * Driver to change passwords via Poppassd/Courierpassd + * + * @version 1.1 + * @author Philip Weir + * + */ + +function format_error_result($code, $line) +{ + if (preg_match('/^\d\d\d\s+(\S.*)\s*$/', $line, $matches)) { + return array('code' => $code, 'message' => $matches[1]); + } else { + return $code; + } +} + +function password_save($curpass, $passwd) +{ + $rcmail = rcmail::get_instance(); +// include('Net/Socket.php'); + $poppassd = new Net_Socket(); + + $result = $poppassd->connect($rcmail->config->get('password_pop_host'), $rcmail->config->get('password_pop_port'), null); + if (PEAR::isError($result)) { + return format_error_result(PASSWORD_CONNECT_ERROR, $result->getMessage()); + } + else { + $result = $poppassd->readLine(); + if(!preg_match('/^2\d\d/', $result)) { + $poppassd->disconnect(); + return format_error_result(PASSWORD_ERROR, $result); + } + else { + $poppassd->writeLine("user ". $_SESSION['username']); + $result = $poppassd->readLine(); + if(!preg_match('/^[23]\d\d/', $result) ) { + $poppassd->disconnect(); + return format_error_result(PASSWORD_CONNECT_ERROR, $result); + } + else { + $poppassd->writeLine("pass ". $curpass); + $result = $poppassd->readLine(); + if(!preg_match('/^[23]\d\d/', $result) ) { + $poppassd->disconnect(); + return format_error_result(PASSWORD_ERROR, $result); + } + else { + $poppassd->writeLine("newpass ". $passwd); + $result = $poppassd->readLine(); + $poppassd->disconnect(); + if (!preg_match('/^2\d\d/', $result)) + return format_error_result(PASSWORD_ERROR, $result); + else + return PASSWORD_SUCCESS; + } + } + } + } +} diff --git a/plugins/password/drivers/sasl.php b/plugins/password/drivers/sasl.php new file mode 100644 index 000000000..f8ac5c606 --- /dev/null +++ b/plugins/password/drivers/sasl.php @@ -0,0 +1,44 @@ +<?php + +/** + * SASL Password Driver + * + * Driver that adds functionality to change the users Cyrus/SASL password. + * The code is derrived from the Squirrelmail "Change SASL Password" Plugin + * by Galen Johnson. + * + * It only works with saslpasswd2 on the same host where Roundcube runs + * and requires shell access and gcc in order to compile the binary. + * + * For installation instructions please read the README file. + * + * @version 1.0 + * @author Thomas Bruederli + */ + +function password_save($currpass, $newpass) +{ + $curdir = realpath(dirname(__FILE__)); + $username = escapeshellcmd($_SESSION['username']); + $args = rcmail::get_instance()->config->get('password_saslpasswd_args', ''); + + if ($fh = popen("$curdir/chgsaslpasswd -p $args $username", 'w')) { + fwrite($fh, $newpass."\n"); + $code = pclose($fh); + + if ($code == 0) + return PASSWORD_SUCCESS; + } + else { + raise_error(array( + 'code' => 600, + 'type' => 'php', + 'file' => __FILE__, 'line' => __LINE__, + 'message' => "Password plugin: Unable to execute $curdir/chgsaslpasswd" + ), true, false); + } + + return PASSWORD_ERROR; +} + +?> diff --git a/plugins/password/drivers/sql.php b/plugins/password/drivers/sql.php new file mode 100644 index 000000000..836a58a44 --- /dev/null +++ b/plugins/password/drivers/sql.php @@ -0,0 +1,152 @@ +<?php + +/** + * SQL Password Driver + * + * Driver for passwords stored in SQL database + * + * @version 1.4 + * @author Aleksander 'A.L.E.C' Machniak <alec@alec.pl> + * + */ + +function password_save($curpass, $passwd) +{ + $rcmail = rcmail::get_instance(); + + if (!($sql = $rcmail->config->get('password_query'))) + $sql = 'SELECT update_passwd(%c, %u)'; + + if ($dsn = $rcmail->config->get('password_db_dsn')) { + // #1486067: enable new_link option + if (is_array($dsn) && empty($dsn['new_link'])) + $dsn['new_link'] = true; + else if (!is_array($dsn) && !preg_match('/\?new_link=true/', $dsn)) + $dsn .= '?new_link=true'; + + $db = new rcube_mdb2($dsn, '', FALSE); + $db->set_debug((bool)$rcmail->config->get('sql_debug')); + $db->db_connect('w'); + } else { + $db = $rcmail->get_dbh(); + } + + if ($err = $db->is_error()) + return PASSWORD_ERROR; + + // crypted password + if (strpos($sql, '%c') !== FALSE) { + $salt = ''; + if (CRYPT_MD5) { + $len = rand(3, CRYPT_SALT_LENGTH); + } else if (CRYPT_STD_DES) { + $len = 2; + } else { + return PASSWORD_CRYPT_ERROR; + } + for ($i = 0; $i < $len ; $i++) { + $salt .= chr(rand(ord('.'), ord('z'))); + } + $sql = str_replace('%c', $db->quote(crypt($passwd, CRYPT_MD5 ? '$1$'.$salt.'$' : $salt)), $sql); + } + + // dovecotpw + if (strpos($sql, '%D') !== FALSE) { + if (!($dovecotpw = $rcmail->config->get('password_dovecotpw'))) + $dovecotpw = 'dovecotpw'; + if (!($method = $rcmail->config->get('password_dovecotpw_method'))) + $method = 'CRAM-MD5'; + + // use common temp dir + $tmp_dir = $rcmail->config->get('temp_dir'); + $tmpfile = tempnam($tmp_dir, 'roundcube-'); + + $pipe = popen("$dovecotpw -s '$method' > '$tmpfile'", "w"); + if (!$pipe) { + unlink($tmpfile); + return PASSWORD_CRYPT_ERROR; + } + else { + fwrite($pipe, $passwd . "\n", 1+strlen($passwd)); usleep(1000); + fwrite($pipe, $passwd . "\n", 1+strlen($passwd)); + pclose($pipe); + $newpass = trim(file_get_contents($tmpfile), "\n"); + if (!preg_match('/^\{' . $method . '\}/', $newpass)) { + return PASSWORD_CRYPT_ERROR; + } + if (!$rcmail->config->get('password_dovecotpw_with_method')) + $newpass = trim(str_replace('{' . $method . '}', '', $newpass)); + unlink($tmpfile); + } + $sql = str_replace('%D', $db->quote($newpass), $sql); + } + + // hashed passwords + if (preg_match('/%[n|q]/', $sql)) { + + if (!extension_loaded('hash')) { + raise_error(array( + 'code' => 600, + 'type' => 'php', + 'file' => __FILE__, 'line' => __LINE__, + 'message' => "Password plugin: 'hash' extension not loaded!" + ), true, false); + + return PASSWORD_ERROR; + } + + if (!($hash_algo = strtolower($rcmail->config->get('password_hash_algorithm')))) + $hash_algo = 'sha1'; + + $hash_passwd = hash($hash_algo, $passwd); + $hash_curpass = hash($hash_algo, $curpass); + + if ($rcmail->config->get('password_hash_base64')) { + $hash_passwd = base64_encode(pack('H*', $hash_passwd)); + $hash_curpass = base64_encode(pack('H*', $hash_curpass)); + } + + $sql = str_replace('%n', $db->quote($hash_passwd, 'text'), $sql); + $sql = str_replace('%q', $db->quote($hash_curpass, 'text'), $sql); + } + + // Handle clear text passwords securely (#1487034) + $sql_vars = array(); + if (preg_match_all('/%[p|o]/', $sql, $m)) { + foreach ($m[0] as $var) { + if ($var == '%p') { + $sql = preg_replace('/%p/', '?', $sql, 1); + $sql_vars[] = (string) $passwd; + } + else { // %o + $sql = preg_replace('/%o/', '?', $sql, 1); + $sql_vars[] = (string) $curpass; + } + } + } + + // at least we should always have the local part + $sql = str_replace('%l', $db->quote($rcmail->user->get_username('local'), 'text'), $sql); + $sql = str_replace('%d', $db->quote($rcmail->user->get_username('domain'), 'text'), $sql); + $sql = str_replace('%u', $db->quote($_SESSION['username'],'text'), $sql); + $sql = str_replace('%h', $db->quote($_SESSION['imap_host'],'text'), $sql); + + $res = $db->query($sql, $sql_vars); + + if (!$db->is_error()) { + if (strtolower(substr(trim($query),0,6))=='select') { + if ($result = $db->fetch_array($res)) + return PASSWORD_SUCCESS; + } else { + // This is the good case: 1 row updated + if ($db->affected_rows($res) == 1) + return PASSWORD_SUCCESS; + // @TODO: Some queries don't affect any rows + // Should we assume a success if there was no error? + } + } + + return PASSWORD_ERROR; +} + +?> diff --git a/plugins/password/drivers/virtualmin.php b/plugins/password/drivers/virtualmin.php new file mode 100644 index 000000000..78ef4e7c3 --- /dev/null +++ b/plugins/password/drivers/virtualmin.php @@ -0,0 +1,75 @@ +<?php + +/** + * Virtualmin Password Driver + * + * Driver that adds functionality to change the users Virtualmin password. + * The code is derrived from the Squirrelmail "Change Cyrus/SASL Password" Plugin + * by Thomas Bruederli. + * + * It only works with virtualmin on the same host where Roundcube runs + * and requires shell access and gcc in order to compile the binary. + * + * @version 2.0 + * @author Martijn de Munnik + */ + +function password_save($currpass, $newpass) +{ + $rcmail = rcmail::get_instance(); + + $format = $rcmail->config->get('password_virtualmin_format', 0); + $username = $_SESSION['username']; + + switch ($format) { + case 1: // username%domain + $domain = substr(strrchr($username, "%"), 1); + break; + case 2: // username.domain (could be bogus) + $pieces = explode(".", $username); + $domain = $pieces[count($pieces)-2]. "." . end($pieces); + break; + case 3: // domain.username (could be bogus) + $pieces = explode(".", $username); + $domain = $pieces[0]. "." . $pieces[1]; + break; + case 4: // username-domain + $domain = substr(strrchr($username, "-"), 1); + break; + case 5: // domain-username + $domain = str_replace(strrchr($username, "-"), "", $username); + break; + case 6: // username_domain + $domain = substr(strrchr($username, "_"), 1); + break; + case 7: // domain_username + $pieces = explode("_", $username); + $domain = $pieces[0]; + break; + default: // username@domain + $domain = substr(strrchr($username, "@"), 1); + } + + $username = escapeshellcmd($username); + $domain = escapeshellcmd($domain); + $newpass = escapeshellcmd($newpass); + $curdir = realpath(dirname(__FILE__)); + + exec("$curdir/chgvirtualminpasswd modify-user --domain $domain --user $username --pass $newpass", $output, $returnvalue); + + if ($returnvalue == 0) { + return PASSWORD_SUCCESS; + } + else { + raise_error(array( + 'code' => 600, + 'type' => 'php', + 'file' => __FILE__, 'line' => __LINE__, + 'message' => "Password plugin: Unable to execute $curdir/chgvirtualminpasswd" + ), true, false); + } + + return PASSWORD_ERROR; +} + +?> diff --git a/plugins/password/drivers/vpopmaild.php b/plugins/password/drivers/vpopmaild.php new file mode 100644 index 000000000..b6fb39343 --- /dev/null +++ b/plugins/password/drivers/vpopmaild.php @@ -0,0 +1,51 @@ +<?php + +/** + * vpopmail Password Driver + * + * Driver to change passwords via vpopmaild + * + * @version 1.1 + * @author Johannes Hessellund + * + */ + +function password_save($curpass, $passwd) +{ + $rcmail = rcmail::get_instance(); +// include('Net/Socket.php'); + $vpopmaild = new Net_Socket(); + + if (PEAR::isError($vpopmaild->connect($rcmail->config->get('password_vpopmaild_host'), + $rcmail->config->get('password_vpopmaild_port'), null))) { + return PASSWORD_CONNECT_ERROR; + } + + $result = $vpopmaild->readLine(); + if(!preg_match('/^\+OK/', $result)) { + $vpopmaild->disconnect(); + return PASSWORD_CONNECT_ERROR; + } + + $vpopmaild->writeLine("slogin ". $_SESSION['username'] . " " . $curpass); + $result = $vpopmaild->readLine(); + if(!preg_match('/^\+OK/', $result) ) { + $vpopmaild->writeLine("quit"); + $vpopmaild->disconnect(); + return PASSWORD_ERROR; + } + + $vpopmaild->writeLine("mod_user ". $_SESSION['username']); + $vpopmaild->writeLine("clear_text_password ". $passwd); + $vpopmaild->writeLine("."); + $result = $vpopmaild->readLine(); + $vpopmaild->writeLine("quit"); + $vpopmaild->disconnect(); + + if (!preg_match('/^\+OK/', $result)) + return PASSWORD_ERROR; + + return PASSWORD_SUCCESS; +} + +?> diff --git a/plugins/password/drivers/ximss.php b/plugins/password/drivers/ximss.php new file mode 100644 index 000000000..94aba1874 --- /dev/null +++ b/plugins/password/drivers/ximss.php @@ -0,0 +1,81 @@ +<?php +/** + * Communigate driver for the Password Plugin for Roundcube + * + * Tested with Communigate Pro 5.1.2 + * + * Configuration options: + * password_ximss_host - Host name of Communigate server + * password_ximss_port - XIMSS port on Communigate server + * + * + * References: + * http://www.communigate.com/WebGuide/XMLAPI.html + * + * @version 1 + * @author Erik Meitner <erik wanderings.us> + */ + +function password_save($pass, $newpass) +{ + + $rcmail = rcmail::get_instance(); + + $sock = stream_socket_client("tcp://".$rcmail->config->get('password_ximss_host').":".$rcmail->config->get('password_ximss_port'), $errno, $errstr, 30) ; + if( $sock === FALSE ) + { + return PASSWORD_CONNECT_ERROR; + } + + // send all requests at once(pipelined) + fwrite( $sock, '<login id="A001" authData="'.$_SESSION['username'].'" password="'.$pass.'" />'."\0"); + fwrite( $sock, '<passwordModify id="A002" oldPassword="'.$pass.'" newPassword="'.$newpass.'" />'."\0"); + fwrite( $sock, '<bye id="A003" />'."\0"); + + //example responses + // <session id="A001" urlID="4815-vN2Txjkggy7gjHRD10jw" userName="user@example.com"/>\0 + // <response id="A001"/>\0 + // <response id="A002"/>\0 + // <response id="A003"/>\0 + // or an error: + // <response id="A001" errorText="incorrect password or account name" errorNum="515"/>\0 + + $responseblob = ''; + while (!feof($sock)) { + $responseblob .= fgets($sock, 1024); + } + + fclose($sock); + + foreach( explode( "\0",$responseblob) as $response ) + { + $resp = simplexml_load_string("<xml>".$response."</xml>"); + + if( $resp->response[0]['id'] == 'A001' ) + { + if( isset( $resp->response[0]['errorNum'] ) ) + { + return PASSWORD_CONNECT_ERROR; + } + } + else if( $resp->response[0]['id'] == 'A002' ) + { + if( isset( $resp->response[0]['errorNum'] )) + { + return PASSWORD_ERROR; + } + } + else if( $resp->response[0]['id'] == 'A003' ) + { + if( isset($resp->response[0]['errorNum'] )) + { + //There was a problem during logout(This is probably harmless) + } + } + } //foreach + + return PASSWORD_SUCCESS; + +} + +?>
\ No newline at end of file diff --git a/plugins/password/drivers/xmail.php b/plugins/password/drivers/xmail.php new file mode 100644 index 000000000..c7f426158 --- /dev/null +++ b/plugins/password/drivers/xmail.php @@ -0,0 +1,101 @@ +<?php +/** + * XMail Password Driver + * + * Driver for XMail password + * + * @version 1.0 + * @author Helio Cavichiolo Jr <helio@hcsistemas.com.br> + * + * Setup xmail_host, xmail_user, xmail_pass and xmail_port into + * config.inc.php of password plugin as follows: + * + * $rcmail_config['xmail_host'] = 'localhost'; + * $rcmail_config['xmail_user'] = 'YourXmailControlUser'; + * $rcmail_config['xmail_pass'] = 'YourXmailControlPass'; + * $rcmail_config['xmail_port'] = 6017; + * + */ + +function password_save($currpass, $newpass) +{ + $rcmail = rcmail::get_instance(); + list($user,$domain) = explode('@', $_SESSION['username']); + + $xmail = new XMail; + + $xmail->hostname = $rcmail->config->get('xmail_host'); + $xmail->username = $rcmail->config->get('xmail_user'); + $xmail->password = $rcmail->config->get('xmail_pass'); + $xmail->port = $rcmail->config->get('xmail_port'); + + if (!$xmail->connect()) { + raise_error(array( + 'code' => 600, + 'type' => 'php', + 'file' => __FILE__, 'line' => __LINE__, + 'message' => "Password plugin: Unable to connect to mail server" + ), true, false); + return PASSWORD_CONNECT_ERROR; + } else if (!$xmail->send("userpasswd\t".$domain."\t".$user."\t".$newpass."\n")) { + $xmail->close(); + raise_error(array( + 'code' => 600, + 'type' => 'php', + 'file' => __FILE__, 'line' => __LINE__, + 'message' => "Password plugin: Unable to change password" + ), true, false); + return PASSWORD_ERROR; + } else { + $xmail->close(); + return PASSWORD_SUCCESS; + } +} + +class XMail { + var $socket; + var $hostname = 'localhost'; + var $username = 'xmail'; + var $password = ''; + var $port = 6017; + + function send($msg) + { + socket_write($this->socket,$msg); + if (substr($in = socket_read($this->socket, 512, PHP_BINARY_READ),0,1) != "+") { + return false; + } + return true; + } + + function connect() + { + $this->socket = socket_create(AF_INET, SOCK_STREAM, 0); + if ($this->socket < 0) + return false; + + $result = socket_connect($this->socket, $this->hostname, $this->port); + if ($result < 0) { + socket_close($this->socket); + return false; + } + + if (substr($in = socket_read($this->socket, 512, PHP_BINARY_READ),0,1) != "+") { + socket_close($this->socket); + return false; + } + + if (!$this->send("$this->username\t$this->password\n")) { + socket_close($this->socket); + return false; + } + return true; + } + + function close() + { + $this->send("quit\n"); + socket_close($this->socket); + } +} + diff --git a/plugins/password/localization/az_AZ.inc b/plugins/password/localization/az_AZ.inc new file mode 100644 index 000000000..62df01ba8 --- /dev/null +++ b/plugins/password/localization/az_AZ.inc @@ -0,0 +1,24 @@ +<?php + +/* Azerbaijani translate for password plugin */ +/* Translated by Nadir Aliyev, nadir at ultel dot net */ + +$labels = array(); +$labels['changepasswd'] = 'Şifrəni dəyiş'; +$labels['curpasswd'] = 'Hal-hazırki şifrə:'; +$labels['newpasswd'] = 'Yeni şifrə:'; +$labels['confpasswd'] = 'Yeni şifrə: (təkrar)'; + +$messages = array(); +$messages['nopassword'] = 'Yeni şifrəni daxil edin.'; +$messages['nocurpassword'] = 'Hal-hazırda istifadə etdiyiniz şifrəni daxil edin.'; +$messages['passwordincorrect'] = 'Yalnış şifrə daxil etdiniz.'; +$messages['passwordinconsistency'] = 'Yeni daxil etdiyiniz şifrələr bir-birinə uyğun deyildir.'; +$messages['crypterror'] = 'Yeni şifrənin saxlanılması mümkün olmadı. Şifrələmə metodu tapılmadı.'; +$messages['connecterror'] = 'Yeni şifrənin saxlanılması mümkün olmadı. Qoşulma səhvi.'; +$messages['internalerror'] = 'Yeni şifrənin saxlanılması mümkün olmadı.'; +$messages['passwordshort'] = 'Yeni şifrə $length simvoldan uzun olmalıdır.'; +$messages['passwordweak'] = 'Şifrədə heç olmasa minimum bir rəqəm və simvol olmalıdır.'; +$messages['passwordforbidden'] = 'Şifrədə icazə verilməyən simvollar vardır.'; + +?> diff --git a/plugins/password/localization/bg_BG.inc b/plugins/password/localization/bg_BG.inc new file mode 100644 index 000000000..b4576a0dc --- /dev/null +++ b/plugins/password/localization/bg_BG.inc @@ -0,0 +1,18 @@ +<?php + +$labels = array(); +$labels['changepasswd'] = 'Смяна на парола'; +$labels['curpasswd'] = 'Текуща парола:'; +$labels['newpasswd'] = 'Нова парола:'; +$labels['confpasswd'] = 'Повторете:'; + +$messages = array(); +$messages['nopassword'] = 'Моля въведете нова парола.'; +$messages['nocurpassword'] = 'Моля въведете текущата .'; +$messages['passwordincorrect'] = 'Невалидна текуща парола.'; +$messages['passwordinconsistency'] = 'Паролите не съвпадат, опитайте пак.'; +$messages['crypterror'] = 'Паролата не може да бъде сменена. Грешка в криптирането.'; +$messages['connecterror'] = 'Паролата не може да бъде сменена. Грешка в свързването.'; +$messages['internalerror'] = 'Паролата не може да бъде сменена.'; + +?> diff --git a/plugins/password/localization/ca_ES.inc b/plugins/password/localization/ca_ES.inc new file mode 100644 index 000000000..18c10c80e --- /dev/null +++ b/plugins/password/localization/ca_ES.inc @@ -0,0 +1,20 @@ +<?php + +$labels = array(); +$labels['changepasswd'] = 'Canviar contrasenya'; +$labels['curpasswd'] = 'Contrasenya actual:'; +$labels['newpasswd'] = 'Nova contrasenya:'; +$labels['confpasswd'] = 'Confirmar nova contrasenya:'; + +$messages = array(); +$messages['nopassword'] = 'Si us plau, introdueix la nova contrasenya.'; +$messages['nocurpassword'] = 'Si us plau, introdueix la contrasenya actual.'; +$messages['passwordincorrect'] = 'Contrasenya actual incorrecte.'; +$messages['passwordinconsistency'] = 'La contrasenya nova no coincideix!.'; +$messages['crypterror'] = 'No es pot desar la nova contrasenya. No existeix la funció d\'encriptació.'; +$messages['connecterror'] = 'No es pot desar la nova contrasenya. Error de connexió.'; +$messages['internalerror'] = 'No es pot desar la nova contrasenya.'; +$messages['passwordshort'] = 'La nova contrasenya ha de tenir com a mínim $length caràcters de llarg.'; +$messages['passwordweak'] = 'La nova contrasenya ha d\'incloure com a mínim un nombre i un caràcter de puntuació.'; + +?> diff --git a/plugins/password/localization/cs_CZ.inc b/plugins/password/localization/cs_CZ.inc new file mode 100644 index 000000000..b4b7b29f9 --- /dev/null +++ b/plugins/password/localization/cs_CZ.inc @@ -0,0 +1,30 @@ +<?php + +/** + * Czech translation for Roundcube password plugin + * + * @version 1.0 (2009-08-29) + * @author Milan Kozak <hodza@hodza.net> + * @author Tomáš Šafařík <safarik@server.cz> + * + */ + +$labels = array(); +$labels['changepasswd'] = 'Změna hesla'; +$labels['curpasswd'] = 'Aktuální heslo:'; +$labels['newpasswd'] = 'Nové heslo:'; +$labels['confpasswd'] = 'Nové heslo (pro kontrolu):'; + +$messages = array(); +$messages['nopassword'] = 'Prosím zadejte nové heslo.'; +$messages['nocurpassword'] = 'Prosím zadejte aktuální heslo.'; +$messages['passwordincorrect'] = 'Zadané aktuální heslo není správné.'; +$messages['passwordinconsistency'] = 'Zadaná hesla se neshodují. Prosím zkuste to znovu.'; +$messages['crypterror'] = 'Heslo se nepodařilo uložit. Chybí šifrovací funkce.'; +$messages['connecterror'] = 'Heslo se nepodařilo uložit. Problém s připojením.'; +$messages['internalerror'] = 'Heslo se nepodařilo uložit.'; +$messages['passwordshort'] = 'Heslo musí mít alespoň $length znaků.'; +$messages['passwordweak'] = 'Heslo musí obsahovat alespoň jedno číslo a jedno interpuknční znaménko.'; +$messages['passwordforbidden'] = 'Heslo obsahuje nepovolené znaky.'; + +?> diff --git a/plugins/password/localization/da_DK.inc b/plugins/password/localization/da_DK.inc new file mode 100644 index 000000000..5d1d0c9cc --- /dev/null +++ b/plugins/password/localization/da_DK.inc @@ -0,0 +1,18 @@ +<?php + +$labels = array(); +$labels['changepasswd'] = 'Skift adgangskode'; +$labels['curpasswd'] = 'Nuværende adgangskode:'; +$labels['newpasswd'] = 'Ny adgangskode:'; +$labels['confpasswd'] = 'Bekræft ny adgangskode:'; + +$messages = array(); +$messages['nopassword'] = 'Indtast venligst en ny adgangskode.'; +$messages['nocurpassword'] = 'Indtast venligst nyværende adgangskode.'; +$messages['passwordincorrect'] = 'Nyværende adgangskode er forkert.'; +$messages['passwordinconsistency'] = 'Adgangskoderne er ikke ens, prøv igen.'; +$messages['crypterror'] = 'Kunne ikke gemme den nye adgangskode. Krypteringsfunktion mangler.'; +$messages['connecterror'] = 'Kunne ikke gemme den nye adgangskode. Fejl ved forbindelsen.'; +$messages['internalerror'] = 'Kunne ikke gemme den nye adgangskode.'; + +?> diff --git a/plugins/password/localization/de_CH.inc b/plugins/password/localization/de_CH.inc new file mode 100644 index 000000000..a28990d67 --- /dev/null +++ b/plugins/password/localization/de_CH.inc @@ -0,0 +1,19 @@ +<?php + +$labels = array(); +$labels['changepasswd'] = 'Passwort ändern'; +$labels['curpasswd'] = 'Aktuelles Passwort'; +$labels['newpasswd'] = 'Neues Passwort'; +$labels['confpasswd'] = 'Passwort Wiederholung'; + +$messages = array(); +$messages['nopassword'] = "Bitte geben Sie ein neues Passwort ein"; +$messages['nocurpassword'] = "Bitte geben Sie Ihr aktuelles Passwort an"; +$messages['passwordincorrect'] = "Das aktuelle Passwort ist nicht korrekt"; +$messages['passwordinconsistency'] = "Das neue Passwort und dessen Wiederholung stimmen nicht überein"; +$messages['crypterror'] = "Neues Passwort nicht gespeichert: Verschlüsselungsfunktion fehlt"; +$messages['connecterror'] = "Neues Passwort nicht gespeichert: Verbindungsfehler"; +$messages['internalerror'] = "Neues Passwort nicht gespeichert"; + + +?>
\ No newline at end of file diff --git a/plugins/password/localization/de_DE.inc b/plugins/password/localization/de_DE.inc new file mode 100644 index 000000000..a28990d67 --- /dev/null +++ b/plugins/password/localization/de_DE.inc @@ -0,0 +1,19 @@ +<?php + +$labels = array(); +$labels['changepasswd'] = 'Passwort ändern'; +$labels['curpasswd'] = 'Aktuelles Passwort'; +$labels['newpasswd'] = 'Neues Passwort'; +$labels['confpasswd'] = 'Passwort Wiederholung'; + +$messages = array(); +$messages['nopassword'] = "Bitte geben Sie ein neues Passwort ein"; +$messages['nocurpassword'] = "Bitte geben Sie Ihr aktuelles Passwort an"; +$messages['passwordincorrect'] = "Das aktuelle Passwort ist nicht korrekt"; +$messages['passwordinconsistency'] = "Das neue Passwort und dessen Wiederholung stimmen nicht überein"; +$messages['crypterror'] = "Neues Passwort nicht gespeichert: Verschlüsselungsfunktion fehlt"; +$messages['connecterror'] = "Neues Passwort nicht gespeichert: Verbindungsfehler"; +$messages['internalerror'] = "Neues Passwort nicht gespeichert"; + + +?>
\ No newline at end of file diff --git a/plugins/password/localization/en_US.inc b/plugins/password/localization/en_US.inc new file mode 100644 index 000000000..1ae2158b0 --- /dev/null +++ b/plugins/password/localization/en_US.inc @@ -0,0 +1,21 @@ +<?php + +$labels = array(); +$labels['changepasswd'] = 'Change Password'; +$labels['curpasswd'] = 'Current Password:'; +$labels['newpasswd'] = 'New Password:'; +$labels['confpasswd'] = 'Confirm New Password:'; + +$messages = array(); +$messages['nopassword'] = 'Please input new password.'; +$messages['nocurpassword'] = 'Please input current password.'; +$messages['passwordincorrect'] = 'Current password incorrect.'; +$messages['passwordinconsistency'] = 'Passwords do not match, please try again.'; +$messages['crypterror'] = 'Could not save new password. Encryption function missing.'; +$messages['connecterror'] = 'Could not save new password. Connection error.'; +$messages['internalerror'] = 'Could not save new password.'; +$messages['passwordshort'] = 'Password must be at least $length characters long.'; +$messages['passwordweak'] = 'Password must include at least one number and one punctuation character.'; +$messages['passwordforbidden'] = 'Password contains forbidden characters.'; + +?> diff --git a/plugins/password/localization/es_AR.inc b/plugins/password/localization/es_AR.inc new file mode 100644 index 000000000..40c74e673 --- /dev/null +++ b/plugins/password/localization/es_AR.inc @@ -0,0 +1,21 @@ +<?php + +$labels = array(); +$labels['changepasswd'] = 'Cambiar Contraseña'; +$labels['curpasswd'] = 'Contraseña Actual:'; +$labels['newpasswd'] = 'Contraseña Nueva:'; +$labels['confpasswd'] = 'Confirmar Contraseña:'; + +$messages = array(); +$messages['nopassword'] = 'Por favor introduce una nueva contraseña.'; +$messages['nocurpassword'] = 'Por favor introduce la contraseña actual.'; +$messages['passwordincorrect'] = 'Contraseña actual incorrecta.'; +$messages['passwordinconsistency'] = 'Las contraseñas no coinciden, por favor inténtalo de nuevo.'; +$messages['crypterror'] = 'No se pudo guardar la contraseña nueva. Falta la función de cifrado.'; +$messages['connecterror'] = 'No se pudo guardar la contraseña nueva. Error de conexión'; +$messages['internalerror'] = 'No se pudo guardar la contraseña nueva.'; +$messages['passwordshort'] = 'Tu contraseña debe tener una longitud mínima de $length.'; +$messages['passwordweak'] = 'Tu nueva contraseña debe incluir al menos un número y un signo de puntuación.'; +$messages['passwordforbidden'] = 'La contraseña contiene caracteres inválidos.'; + +?> diff --git a/plugins/password/localization/es_ES.inc b/plugins/password/localization/es_ES.inc new file mode 100644 index 000000000..32879b4aa --- /dev/null +++ b/plugins/password/localization/es_ES.inc @@ -0,0 +1,21 @@ +<?php + +$labels = array(); +$labels['changepasswd'] = 'Cambiar contraseña'; +$labels['curpasswd'] = 'Contraseña actual:'; +$labels['newpasswd'] = 'Contraseña nueva:'; +$labels['confpasswd'] = 'Confirmar contraseña:'; + +$messages = array(); +$messages['nopassword'] = 'Por favor introduzca una contraseña nueva.'; +$messages['nocurpassword'] = 'Por favor introduzca la contraseña actual.'; +$messages['passwordincorrect'] = 'La contraseña actual es incorrecta.'; +$messages['passwordinconsistency'] = 'Las contraseñas no coinciden. Por favor, inténtelo de nuevo.'; +$messages['crypterror'] = 'No se pudo guardar la contraseña nueva. Falta la función de cifrado.'; +$messages['connecterror'] = 'No se pudo guardar la contraseña nueva. Error de conexión'; +$messages['internalerror'] = 'No se pudo guardar la contraseña nueva.'; +$messages['passwordshort'] = 'La contraseña debe tener por lo menos $length caracteres.'; +$messages['passwordweak'] = 'La contraseña debe incluir al menos un número y un signo de puntuación.'; +$messages['passwordforbidden'] = 'La contraseña introducida contiene caracteres no permitidos.'; + +?> diff --git a/plugins/password/localization/et_EE.inc b/plugins/password/localization/et_EE.inc new file mode 100644 index 000000000..0f351d77b --- /dev/null +++ b/plugins/password/localization/et_EE.inc @@ -0,0 +1,17 @@ +<?php + +$labels = array(); +$labels['changepasswd'] = 'Muuda parooli'; +$labels['curpasswd'] = 'Vana parool:'; +$labels['newpasswd'] = 'Uus parool:'; +$labels['confpasswd'] = 'Uus parool uuesti:'; + +$messages = array(); +$messages['nopassword'] = 'Palun sisesta uus parool.'; +$messages['nocurpassword'] = 'Palun sisesta vana parool.'; +$messages['passwordincorrect'] = 'Vana parool on vale.'; +$messages['passwordinconsistency'] = 'Paroolid ei kattu, palun proovi uuesti.'; +$messages['crypterror'] = 'Serveris ei ole parooli krüpteerimiseks vajalikku funktsiooni.'; +$messages['internalerror'] = 'Uue parooli andmebaasi salvestamine nurjus.'; + +?> diff --git a/plugins/password/localization/fi_FI.inc b/plugins/password/localization/fi_FI.inc new file mode 100644 index 000000000..a2108a524 --- /dev/null +++ b/plugins/password/localization/fi_FI.inc @@ -0,0 +1,22 @@ +<?php + +// Translation by Tapio Salonsaari <take@nerd.fi> + +$labels = array(); +$labels['changepasswd'] = 'Vaihda salasana'; +$labels['curpasswd'] = 'Nykyinen salasana:'; +$labels['newpasswd'] = 'Uusi salasana:'; +$labels['confpasswd'] = 'Uusi salasana uudestaan:'; + +$messages = array(); +$messages['nopassword'] = 'Syötä uusi salasana.'; +$messages['nocurpassword'] = 'Syötä nykyinen salasana.'; +$messages['passwordincorrect'] = 'Syöttämäsi nykyinen salasana on väärin.'; +$messages['passwordinconsistency'] = 'Syöttämäsi salasanat eivät täsmää, yritä uudelleen.'; +$messages['crypterror'] = 'Salasanaa ei voitu vaihtaa. Kryptausfunktio puuttuu.'; +$messages['connecterror'] = 'Salasanaa ei voitu vaihtaa. Yhteysongelma.'; +$messages['internalerror'] = 'Salasanaa ei voitu vaihtaa.'; +$messages['passwordshort'] = 'Salasanan täytyy olla vähintään $length merkkiä pitkä.'; +$messages['passwordweak'] = 'Salasanan täytyy sisältää vähintään yksi numero ja yksi välimerkki.'; + +?> diff --git a/plugins/password/localization/fr_FR.inc b/plugins/password/localization/fr_FR.inc new file mode 100644 index 000000000..8ba37b148 --- /dev/null +++ b/plugins/password/localization/fr_FR.inc @@ -0,0 +1,18 @@ +<?php + +$labels = array(); +$labels['changepasswd'] = 'Changer le mot de passe'; +$labels['curpasswd'] = 'Mot de passe actuel:'; +$labels['newpasswd'] = 'Nouveau mot de passe:'; +$labels['confpasswd'] = 'Confirmez le nouveau mot de passe:'; + +$messages = array(); +$messages['nopassword'] = 'Veuillez saisir le nouveau mot de passe.'; +$messages['nocurpassword'] = 'Veuillez saisir le mot de passe actuel.'; +$messages['passwordincorrect'] = 'Mot de passe actuel incorrect.'; +$messages['passwordinconsistency'] = 'Les nouveaux mots de passe ne correspondent pas, veuillez réessayer.'; +$messages['crypterror'] = 'Impossible d\'enregistrer le nouveau mot de passe. Fonction de cryptage manquante.'; +$messages['connecterror'] = 'Impossible d\'enregistrer le nouveau mot de passe. Erreur de connexion au serveur.'; +$messages['internalerror'] = 'Impossible d\'enregistrer le nouveau mot de passe.'; + +?> diff --git a/plugins/password/localization/gl_ES.inc b/plugins/password/localization/gl_ES.inc new file mode 100644 index 000000000..b7dc7bbee --- /dev/null +++ b/plugins/password/localization/gl_ES.inc @@ -0,0 +1,21 @@ +<?php + +$labels = array(); +$labels['changepasswd'] = 'Cambiar contrasinal'; +$labels['curpasswd'] = 'Contrasinal actual:'; +$labels['newpasswd'] = 'Contrasinal novo:'; +$labels['confpasswd'] = 'Confirmar contrasinal:'; + +$messages = array(); +$messages['nopassword'] = 'Por favor, introduza un contrasinal novo.'; +$messages['nocurpassword'] = 'Por favor, introduza o contrasinal actual.'; +$messages['passwordincorrect'] = 'O contrasinal actual é incorrecto.'; +$messages['passwordinconsistency'] = 'Os contrasinals non coinciden. Por favor, inténteo de novo.'; +$messages['crypterror'] = 'Non foi posible gardar o contrasinal novo. Falta a función de cifrado.'; +$messages['connecterror'] = 'Non foi posible gardar o contrasinal novo. Erro de conexión'; +$messages['internalerror'] = 'Non foi posible gardar o contrasinal novo.'; +$messages['passwordshort'] = 'O contrasinal debe ter polo menos $length caracteres.'; +$messages['passwordweak'] = 'O contrasinal debe incluir polo menos un número e un signo de puntuación.'; +$messages['passwordforbidden'] = 'O contrasinal contén caracteres non permitidos.'; + +?> diff --git a/plugins/password/localization/hr_HR.inc b/plugins/password/localization/hr_HR.inc new file mode 100644 index 000000000..0e35129c0 --- /dev/null +++ b/plugins/password/localization/hr_HR.inc @@ -0,0 +1,21 @@ +<?php + +$labels = array(); +$labels['changepasswd'] = 'Promijeni zaporku'; +$labels['curpasswd'] = 'Važeća zaporka:'; +$labels['newpasswd'] = 'Nova zaporka:'; +$labels['confpasswd'] = 'Potvrda nove zaporke:'; + +$messages = array(); +$messages['nopassword'] = 'Molimo unesite novu zaporku.'; +$messages['nocurpassword'] = 'Molimo unesite trenutnu zaporku.'; +$messages['passwordincorrect'] = 'Trenutna zaporka je nevažeća.'; +$messages['passwordinconsistency'] = 'Zaporke su različite, pokušajte ponovo.'; +$messages['crypterror'] = 'Nemoguće promijeniti zaporku. Nedostaje enkripcijska funkcija.'; +$messages['connecterror'] = 'Nemoguće promijeniti zaporku. Greška prilikom spajanja.'; +$messages['internalerror'] = 'Nemoguće promijeniti zaporku.'; +$messages['passwordshort'] = 'Zaporka mora sadržavati barem $length znakova.'; +$messages['passwordweak'] = 'Zaporka mora sadržavati barem jedanu znamenku i jedan interpunkcijski znak.'; +$messages['passwordforbidden'] = 'Zaporka sadrži nedozvoljene znakove.'; + +?> diff --git a/plugins/password/localization/hu_HU.inc b/plugins/password/localization/hu_HU.inc new file mode 100644 index 000000000..c8c3015a1 --- /dev/null +++ b/plugins/password/localization/hu_HU.inc @@ -0,0 +1,17 @@ +<?php + +$labels = array(); +$labels['changepasswd'] = 'Jelszóváltás'; +$labels['curpasswd'] = 'Jelenlegi jelszó:'; +$labels['newpasswd'] = 'Új jelszó:'; +$labels['confpasswd'] = 'Új jelszó mégegyszer:'; + +$messages = array(); +$messages['nopassword'] = 'Kérjük adja meg az új jelszót.'; +$messages['nocurpassword'] = 'Kérjük adja meg a jelenlegi jelszót.'; +$messages['passwordincorrect'] = 'Érvénytelen a jelenlegi jelszó.'; +$messages['passwordinconsistency'] = 'A két új jelszó nem egyezik.'; +$messages['crypterror'] = 'Hiba történt a kérés feldolgozása során.'; +$messages['internalerror'] = 'Hiba történt a kérés feldolgozása során.'; + +?> diff --git a/plugins/password/localization/it_IT.inc b/plugins/password/localization/it_IT.inc new file mode 100644 index 000000000..13b4885d7 --- /dev/null +++ b/plugins/password/localization/it_IT.inc @@ -0,0 +1,21 @@ +<?php + +$labels = array(); +$labels['changepasswd'] = 'Cambia la Password'; +$labels['curpasswd'] = 'Password corrente:'; +$labels['newpasswd'] = 'Nuova Password:'; +$labels['confpasswd'] = 'Conferma la Nuova Password:'; + +$messages = array(); +$messages['nopassword'] = 'Per favore inserisci la nuova password.'; +$messages['nocurpassword'] = 'Per favore inserisci la password corrente.'; +$messages['passwordincorrect'] = 'Password corrente sbagliata.'; +$messages['passwordinconsistency'] = 'Le password non coincidono, inserirle di nuovo.'; +$messages['crypterror'] = 'Non posso salvare la password, funzione di cifratura assente.'; +$messages['connecterror'] = 'Non posso salvare la password, errore di connessione.'; +$messages['internalerror'] = 'Non posso salvare la password.'; +$messages['passwordshort'] = 'La nuova password deve essere lunga almeno $length caratteri.'; +$messages['passwordweak'] = 'La nuova password deve contenere almeno una cifra e un segno di punteggiatura.'; +$messages['passwordforbidden'] = 'La password scelta contiene dei caratteri non consentiti.'; + +?> diff --git a/plugins/password/localization/ja_JP.inc b/plugins/password/localization/ja_JP.inc new file mode 100644 index 000000000..47cac0430 --- /dev/null +++ b/plugins/password/localization/ja_JP.inc @@ -0,0 +1,23 @@ +<?php + +// EN-Revision: 3891 + +$labels = array(); +$labels['changepasswd'] = 'パスワードの変更'; +$labels['curpasswd'] = '現在のパスワード:'; +$labels['newpasswd'] = '新しいパスワード:'; +$labels['confpasswd'] = '新しいパスワード (確認):'; + +$messages = array(); +$messages['nopassword'] = '新しいパスワードを入力してください。'; +$messages['nocurpassword'] = '現在のパスワードを入力してください。'; +$messages['passwordincorrect'] = '現在のパスワードが間違っています。'; +$messages['passwordinconsistency'] = 'パスワードが一致しません。もう一度やり直してください。'; +$messages['crypterror'] = 'パスワードを保存できませんでした。暗号化関数がみあたりません。'; +$messages['connecterror'] = '新しいパスワードを保存できませんでした。接続エラーです。'; +$messages['internalerror'] = '新しいパスワードを保存できませんでした。'; +$messages['passwordshort'] = 'パスワードは少なくとも $length 文字の長さが必要です。'; +$messages['passwordweak'] = 'パスワードは少なくとも数字を 1 文字と記号が 1 文字含んでなければなりません。'; +$messages['passwordforbidden'] = 'パスワードに禁止された文字が含まれています。'; + +?> diff --git a/plugins/password/localization/lt_LT.inc b/plugins/password/localization/lt_LT.inc new file mode 100644 index 000000000..b4563cc42 --- /dev/null +++ b/plugins/password/localization/lt_LT.inc @@ -0,0 +1,21 @@ +<?php + +$labels = array(); +$labels['changepasswd'] = 'Slaptažodžio keitimas'; +$labels['curpasswd'] = 'Dabartinis slaptažodis:'; +$labels['newpasswd'] = 'Naujasis slaptažodis:'; +$labels['confpasswd'] = 'Pakartokite naująjį slaptažodį:'; + +$messages = array(); +$messages['nopassword'] = 'Prašom įvesti naująjį slaptažodį.'; +$messages['nocurpassword'] = 'Prašom įvesti dabartinį slaptažodį.'; +$messages['passwordincorrect'] = 'Dabartinis slaptažodis neteisingas.'; +$messages['passwordinconsistency'] = 'Slaptažodžiai nesutapo. Bandykite dar kartą.'; +$messages['crypterror'] = 'Nepavyko įrašyti naujojo slaptažodžio. Trūksta šifravimo funkcijos.'; +$messages['connecterror'] = 'Nepavyko įrašyti naujojo slaptažodžio. Prisijungimo klaida.'; +$messages['internalerror'] = 'Nepavyko įrašyti naujojo slaptažodžio.'; +$messages['passwordshort'] = 'Slaptažodis turi būti sudarytas iš bent $length simbolių.'; +$messages['passwordweak'] = 'Slaptažodyje turi būti bent vienas skaitmuo ir vienas skyrybos ženklas.'; +$messages['passwordforbidden'] = 'Slaptažodyje rasta neleistinų simbolių.'; + +?> diff --git a/plugins/password/localization/lv_LV.inc b/plugins/password/localization/lv_LV.inc new file mode 100644 index 000000000..8f5f4c2c2 --- /dev/null +++ b/plugins/password/localization/lv_LV.inc @@ -0,0 +1,20 @@ +<?php + +$labels = array(); +$labels['changepasswd'] = 'Nomainīt paroli'; +$labels['curpasswd'] = 'Pašreizējā parole:'; +$labels['newpasswd'] = 'Jaunā parole:'; +$labels['confpasswd'] = 'Vēlreiz jauno paroli:'; + +$messages = array(); +$messages['nopassword'] = 'Lūdzu, ievadiet jauno paroli.'; +$messages['nocurpassword'] = 'Lūdzu, ievadiet pašreizējo paroli.'; +$messages['passwordincorrect'] = 'Pašreizējā parole nepareiza.'; +$messages['passwordinconsistency'] = 'Paroles nesakrīt. Lūdzu, ievadiet vēlreiz.'; +$messages['crypterror'] = 'Nevarēja saglabāt jauno paroli. Trūkst kriptēšanas funkcija.'; +$messages['connecterror'] = 'Nevarēja saglabāt jauno paroli. Savienojuma kļūda.'; +$messages['internalerror'] = 'Nevarēja saglabāt jauno paroli.'; +$messages['passwordshort'] = 'Jaunajai parolei jābūt vismaz $length simbola garai.'; +$messages['passwordweak'] = 'Jaunajai parolei jāsatur vismaz viens cipars un punktuācijas simbols.'; + +?> diff --git a/plugins/password/localization/nl_NL.inc b/plugins/password/localization/nl_NL.inc new file mode 100644 index 000000000..6d7c401ac --- /dev/null +++ b/plugins/password/localization/nl_NL.inc @@ -0,0 +1,17 @@ +<?php + +$labels = array(); +$labels['changepasswd'] = 'Wijzig Wachtwoord'; +$labels['curpasswd'] = 'Huidig Wachtwoord:'; +$labels['newpasswd'] = 'Nieuw Wachtwoord:'; +$labels['confpasswd'] = 'Bevestig Nieuw Wachtwoord:'; + +$messages = array(); +$messages['nopassword'] = 'Vul een wachtwoord in.'; +$messages['nocurpassword'] = 'vul het huidige wachtwoord in.'; +$messages['passwordincorrect'] = 'Huidig wachtwoord is onjuist.'; +$messages['passwordinconsistency'] = 'Wachtwoorden komen niet overeen, probeer het opnieuw.'; +$messages['crypterror'] = 'De server mist een functie om uw wachtwoord et beveiligen.'; +$messages['internalerror'] = 'Uw wachtwoord kan niet worden opgeslagen.'; + +?> diff --git a/plugins/password/localization/pl_PL.inc b/plugins/password/localization/pl_PL.inc new file mode 100644 index 000000000..687ca9383 --- /dev/null +++ b/plugins/password/localization/pl_PL.inc @@ -0,0 +1,21 @@ +<?php + +$labels = array(); +$labels['changepasswd'] = 'Zmiana hasła'; +$labels['curpasswd'] = 'Aktualne hasło:'; +$labels['newpasswd'] = 'Nowe hasło:'; +$labels['confpasswd'] = 'Potwierdź hasło:'; + +$messages = array(); +$messages['nopassword'] = 'Wprowadź nowe hasło.'; +$messages['nocurpassword'] = 'Wprowadź aktualne hasło.'; +$messages['passwordincorrect'] = 'Błędne aktualne hasło, spróbuj ponownie.'; +$messages['passwordinconsistency'] = 'Hasła nie pasują, spróbuj ponownie.'; +$messages['crypterror'] = 'Nie udało się zapisać nowego hasła. Brak funkcji kodującej.'; +$messages['connecterror'] = 'Nie udało się zapisać nowego hasła. Błąd połączenia.'; +$messages['internalerror'] = 'Nie udało się zapisać nowego hasła.'; +$messages['passwordshort'] = 'Hasło musi posiadać co najmniej $length znaków.'; +$messages['passwordweak'] = 'Hasło musi zawierać co najmniej jedną cyfrę i znak interpunkcyjny.'; +$messages['passwordforbidden'] = 'Hasło zawiera niedozwolone znaki.'; + +?> diff --git a/plugins/password/localization/pt_BR.inc b/plugins/password/localization/pt_BR.inc new file mode 100644 index 000000000..f3626e834 --- /dev/null +++ b/plugins/password/localization/pt_BR.inc @@ -0,0 +1,21 @@ +<?php + +$labels = array(); +$labels['changepasswd'] = 'Alterar senha'; +$labels['curpasswd'] = 'Senha atual:'; +$labels['newpasswd'] = 'Nova senha:'; +$labels['confpasswd'] = 'Confirmar nova senha:'; + +$messages = array(); +$messages['nopassword'] = 'Por favor, informe a nova senha.'; +$messages['nocurpassword'] = 'Por favor, informe a senha atual.'; +$messages['passwordincorrect'] = 'Senha atual incorreta.'; +$messages['passwordinconsistency'] = 'Senhas não combinam, por favor tente novamente.'; +$messages['crypterror'] = 'Não foi possível gravar a nova senha. Função de criptografia ausente.'; +$messages['connecterror'] = 'Não foi possível gravar a nova senha. Erro de conexão.'; +$messages['internalerror'] = 'Não foi possível gravar a nova senha.'; +$messages['passwordshort'] = 'A senha precisa ter ao menos $length caracteres.'; +$messages['passwordweak'] = 'A senha precisa conter ao menos um número e um caractere de pontuação.'; +$messages['passwordforbidden'] = 'A senha contém caracteres proibidos.'; + +?> diff --git a/plugins/password/localization/pt_PT.inc b/plugins/password/localization/pt_PT.inc new file mode 100644 index 000000000..5307ad69f --- /dev/null +++ b/plugins/password/localization/pt_PT.inc @@ -0,0 +1,18 @@ +<?php + +$labels = array(); +$labels['changepasswd'] = 'Alterar password'; +$labels['curpasswd'] = 'Password atual:'; +$labels['newpasswd'] = 'Nova password:'; +$labels['confpasswd'] = 'Confirmar password:'; + +$messages = array(); +$messages['nopassword'] = 'Introduza a nova password.'; +$messages['nocurpassword'] = 'Introduza a password actual.'; +$messages['passwordincorrect'] = 'Password actual errada.'; +$messages['passwordinconsistency'] = 'Password\'s não combinam, tente novamente..'; +$messages['crypterror'] = 'Não foi possível gravar a nova password. Função de criptografica inexistente.'; +$messages['connecterror'] = 'Não foi possível gravar a nova password. Erro de ligação.'; +$messages['internalerror'] = 'Não foi possível gravar a nova password.'; + +?> diff --git a/plugins/password/localization/ru_RU.inc b/plugins/password/localization/ru_RU.inc new file mode 100644 index 000000000..3776b4598 --- /dev/null +++ b/plugins/password/localization/ru_RU.inc @@ -0,0 +1,35 @@ +<?php +/* + ++-----------------------------------------------------------------------+ +| plugins/password/localization/ru_RU.inc | +| | +| Language file of the Roundcube help plugin | +| Copyright (C) 2005-2010, The Roundcube Dev Team | +| Licensed under the GNU GPL | +| | ++-----------------------------------------------------------------------+ +| Author: Sergey Dukachev <iam@dukess.ru> | ++-----------------------------------------------------------------------+ + +*/ + +$labels = array(); +$labels['changepasswd'] = 'Изменить пароль'; +$labels['curpasswd'] = 'Текущий пароль:'; +$labels['newpasswd'] = 'Новый пароль:'; +$labels['confpasswd'] = 'Подтвердите новый пароль:'; + +$messages = array(); +$messages['nopassword'] = 'Пожалуйста, введите новый пароль.'; +$messages['nocurpassword'] = 'Пожалуйста, введите текущий пароль.'; +$messages['passwordincorrect'] = 'Текущий пароль неверен.'; +$messages['passwordinconsistency'] = 'Пароли не совпадают, попробуйте, пожалуйста, ещё.'; +$messages['crypterror'] = 'Не могу сохранить новый пароль. Отсутствует криптографическая функция.'; +$messages['connecterror'] = 'Не могу сохранить новый пароль. Ошибка соединения.'; +$messages['internalerror'] = 'Не могу сохранить новый пароль.'; +$messages['passwordshort'] = 'Пароль должен быть длиной как минимум $length символов.'; +$messages['passwordweak'] = 'Пароль должен включать в себя как минимум одну цифру и один знак пунктуации.'; +$messages['passwordforbidden'] = 'Пароль содержит недопустимые символы.'; + +?> diff --git a/plugins/password/localization/sk_SK.inc b/plugins/password/localization/sk_SK.inc new file mode 100644 index 000000000..6def2f914 --- /dev/null +++ b/plugins/password/localization/sk_SK.inc @@ -0,0 +1,29 @@ +<?php + +/** + * Slovak translation for Roundcube password plugin + * + * @version 1.0 (2010-10-18) + * @author panda <admin@whistler.sk> + * + */ + +$labels = array(); +$labels['changepasswd'] = 'Zmeniť heslo'; +$labels['curpasswd'] = 'Súčasné heslo:'; +$labels['newpasswd'] = 'Nové heslo:'; +$labels['confpasswd'] = 'Potvrď nové heslo:'; + +$messages = array(); +$messages['nopassword'] = 'Prosím zadaj nové heslo.'; +$messages['nocurpassword'] = 'Prosím zadaj súčasné heslo.'; +$messages['passwordincorrect'] = 'Súčasné heslo je nesprávne.'; +$messages['passwordinconsistency'] = 'Heslá nie sú rovnaké, skús znova.'; +$messages['crypterror'] = 'Nemôžem uložiť nové heslo. Chýba šifrovacia funkcia.'; +$messages['connecterror'] = 'Nemôžem uložiť nové heslo. Chyba spojenia.'; +$messages['internalerror'] = 'Nemôžem uložiť nové heslo.'; +$messages['passwordshort'] = 'Heslo musí mať najmenej $length znakov.'; +$messages['passwordweak'] = 'Heslo musí obsahovať aspoň jedno číslo a jedno interpunkčné znamienko.'; +$messages['passwordforbidden'] = 'Heslo obsahuje nepovolené znaky.'; + +?> diff --git a/plugins/password/localization/sl_SI.inc b/plugins/password/localization/sl_SI.inc new file mode 100644 index 000000000..df17583be --- /dev/null +++ b/plugins/password/localization/sl_SI.inc @@ -0,0 +1,18 @@ +<?php + +$labels = array(); +$labels['changepasswd'] = 'Spremeni geslo'; +$labels['curpasswd'] = 'Obstoječe geslo:'; +$labels['newpasswd'] = 'Novo geslo:'; +$labels['confpasswd'] = 'Potrdi novo geslo:'; + +$messages = array(); +$messages['nopassword'] = 'Vnesite novo geslo.'; +$messages['nocurpassword'] = 'Vnesite obstoječe geslo.'; +$messages['passwordincorrect'] = 'Obstoječe geslo ni veljavno.'; +$messages['passwordinconsistency'] = 'Gesli se ne ujemata, poskusite znova.'; +$messages['crypterror'] = 'Novega gesla ni bilo mogoče shraniti. Prišlo je do napake pri šifriranju.'; +$messages['connecterror'] = 'Novega gesla ni bilo mogoče shraniti. Prišlo je do napake v povezavi.'; +$messages['internalerror'] = 'Novega gesla ni bilo mogoče shraniti.'; + +?> diff --git a/plugins/password/localization/sv_SE.inc b/plugins/password/localization/sv_SE.inc new file mode 100644 index 000000000..d649bbd9a --- /dev/null +++ b/plugins/password/localization/sv_SE.inc @@ -0,0 +1,21 @@ +<?php + +$labels = array(); +$labels['changepasswd'] = 'Ändra lösenord'; +$labels['curpasswd'] = 'Nuvarande lösenord:'; +$labels['newpasswd'] = 'Nytt lösenord:'; +$labels['confpasswd'] = 'Bekräfta nytt lösenord:'; + +$messages = array(); +$messages['nopassword'] = 'Vänligen ange nytt lösenord.'; +$messages['nocurpassword'] = 'Vänligen ange nuvarande lösenord.'; +$messages['passwordincorrect'] = 'Felaktigt nuvarande lösenord.'; +$messages['passwordinconsistency'] = 'Nya lösenordet och bekräftelsen överensstämmer inte, försök igen.'; +$messages['crypterror'] = 'Lösenordet kunde inte ändras. Krypteringsfunktionen saknas.'; +$messages['connecterror'] = 'Lösenordet kunde inte ändras. Anslutningen misslyckades.'; +$messages['internalerror'] = 'Lösenordet kunde inte ändras.'; +$messages['passwordshort'] = 'Lösenordet måste vara minst $length tecken långt.'; +$messages['passwordweak'] = 'Lösenordet måste innehålla minst en siffra och ett specialtecken.'; +$messages['passwordforbidden'] = 'Lösenordet innehåller otillåtna tecken.'; + +?>
\ No newline at end of file diff --git a/plugins/password/localization/tr_TR.inc b/plugins/password/localization/tr_TR.inc new file mode 100644 index 000000000..4f2322a2e --- /dev/null +++ b/plugins/password/localization/tr_TR.inc @@ -0,0 +1,21 @@ +<?php + +$labels = array(); +$labels['changepasswd'] = 'Parolayı Değiştir'; +$labels['curpasswd'] = 'Şu anki Parola:'; +$labels['newpasswd'] = 'Yeni Parola:'; +$labels['confpasswd'] = 'Yeni Parolayı Onaylayın:'; + +$messages = array(); +$messages['nopassword'] = 'Lütfen yeni şifreyi girin.'; +$messages['nocurpassword'] = 'Lütfen şu anki şifrenizi girin.'; +$messages['passwordincorrect'] = 'Parolanızı yanlış girdiniz.'; +$messages['passwordinconsistency'] = 'Girdiğiniz parolalar uyuşmuyor. Lütfen tekrar deneyin..'; +$messages['crypterror'] = 'Yeni şifre kaydedilemedi. Gerekli fonksiyon eksik.'; +$messages['connecterror'] = 'Yeni şifre kaydedilemedi. Bağlantı hatası.'; +$messages['internalerror'] = 'Yeni şifre kaydedilemedi.'; +$messages['passwordshort'] = 'Parola en az $length karakterden oluşmalı.'; +$messages['passwordweak'] = 'Parola en az bir sayı ve bir noktalama işareti içermeli.'; +$messages['passwordforbidden'] = 'Parola uygunsuz karakter(ler) içeriyor.'; + +?> diff --git a/plugins/password/localization/zh_TW.inc b/plugins/password/localization/zh_TW.inc new file mode 100644 index 000000000..7d162274a --- /dev/null +++ b/plugins/password/localization/zh_TW.inc @@ -0,0 +1,21 @@ +<?php + +$labels = array(); +$labels['changepasswd'] = '更改密碼'; +$labels['curpasswd'] = '目前的密碼'; +$labels['newpasswd'] = '新密碼'; +$labels['confpasswd'] = '確認新密碼'; + +$messages = array(); +$messages['nopassword'] = '請輸入新密碼'; +$messages['nocurpassword'] = '請輸入目前的密碼'; +$messages['passwordincorrect'] = '目前的密碼錯誤'; +$messages['passwordinconsistency'] = '密碼不相符，請重新輸入'; +$messages['crypterror'] = '無法更新密碼：無加密機制'; +$messages['connecterror'] = '無法更新密碼：連線失敗'; +$messages['internalerror'] = '無法更新密碼'; +$messages['passwordshort'] = '您的密碼至少需 $length 個字元長'; +$messages['passwordweak'] = '您的新密碼至少需含有一個數字與一個標點符號'; +$messages['passwordforbidden'] = '您的密碼含有禁用字元'; + +?> diff --git a/plugins/password/package.xml b/plugins/password/package.xml new file mode 100644 index 000000000..69cef072f --- /dev/null +++ b/plugins/password/package.xml @@ -0,0 +1,268 @@ +<?xml version="1.0" encoding="UTF-8"?> +<package xmlns="http://pear.php.net/dtd/package-2.0" xmlns:tasks="http://pear.php.net/dtd/tasks-1.0" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" packagerversion="1.9.0" version="2.0" xsi:schemaLocation="http://pear.php.net/dtd/tasks-1.0 + http://pear.php.net/dtd/tasks-1.0.xsd + http://pear.php.net/dtd/package-2.0 + http://pear.php.net/dtd/package-2.0.xsd"> + <name>password</name> + <channel>pear.roundcube.net</channel> + <summary>Password Change for Roundcube</summary> + <description>Plugin that adds a possibility to change user password using many + methods (drivers) via Settings/Password tab. + </description> + <lead> + <name>Aleksander Machniak</name> + <user>alec</user> + <email>alec@alec.pl</email> + <active>yes</active> + </lead> + <date></date> + <time></time> + <version> + <release></release> + <api>1.6</api> + </version> + <stability> + <release>stable</release> + <api>stable</api> + </stability> + <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license> + <notes> +- When old and new passwords are the same, do nothing, return success (#1487823) +- Fixed Samba password hashing in 'ldap' driver +- Added 'password_change' hook for plugin actions after successful password change +- Fixed bug where 'doveadm pw' command was used as dovecotpw utility + </notes> + <contents> + <dir baseinstalldir="/" name="/"> + <file name="password.php" role="php"> + <tasks:replace from="@name@" to="name" type="package-info"/> + <tasks:replace from="@package_version@" to="version" type="package-info"/> + </file> + <file name="password.js" role="data"> + <tasks:replace from="@name@" to="name" type="package-info"/> + <tasks:replace from="@package_version@" to="version" type="package-info"/> + </file> + <file name="README" role="data"> + <tasks:replace from="@name@" to="name" type="package-info"/> + <tasks:replace from="@package_version@" to="version" type="package-info"/> + </file> + <file name="localization/az_AZ.inc" role="data"></file> + <file name="localization/bg_BG.inc" role="data"></file> + <file name="localization/ca_ES.inc" role="data"></file> + <file name="localization/cs_CZ.inc" role="data"></file> + <file name="localization/da_DK.inc" role="data"></file> + <file name="localization/de_CH.inc" role="data"></file> + <file name="localization/de_DE.inc" role="data"></file> + <file name="localization/en_US.inc" role="data"></file> + <file name="localization/es_ES.inc" role="data"></file> + <file name="localization/et_EE.inc" role="data"></file> + <file name="localization/fi_FI.inc" role="data"></file> + <file name="localization/fr_FR.inc" role="data"></file> + <file name="localization/gl_ES.inc" role="data"></file> + <file name="localization/hu_HU.inc" role="data"></file> + <file name="localization/it_IT.inc" role="data"></file> + <file name="localization/lt_LT.inc" role="data"></file> + <file name="localization/lv_LV.inc" role="data"></file> + <file name="localization/nl_NL.inc" role="data"></file> + <file name="localization/pl_PL.inc" role="data"></file> + <file name="localization/pt_BR.inc" role="data"></file> + <file name="localization/pt_PT.inc" role="data"></file> + <file name="localization/sl_SI.inc" role="data"></file> + <file name="localization/sv_SE.inc" role="data"></file> + <file name="localization/zh_TW.inc" role="data"></file> + + <file name="drivers/chgsaslpasswd.c" role="data"></file> + <file name="drivers/chgvirtualminpasswd.c" role="data"></file> + <file name="drivers/chpasswd.php" role="php"></file> + <file name="drivers/directadmin.php" role="php"></file> + <file name="drivers/ldap.php" role="php"></file> + <file name="drivers/ldap_simple.php" role="php"></file> + <file name="drivers/poppassd.php" role="php"></file> + <file name="drivers/sql.php" role="php"></file> + <file name="drivers/vpopmaild.php" role="php"></file> + <file name="drivers/cpanel.php" role="php"></file> + <file name="drivers/hmail.php" role="php"></file> + <file name="drivers/pam.php" role="php"></file> + <file name="drivers/sasl.php" role="php"></file> + <file name="drivers/virtualmin.php" role="php"></file> + <file name="drivers/ximss.php" role="php"></file> + <file name="drivers/xmail.php" role="php"></file> + <file name="drivers/chpass-wrapper.py" role="data"></file> + + <file name="config.inc.php.disc" role="data"></file> + </dir> + <!-- / --> + </contents> + <dependencies> + <required> + <php> + <min>5.2.1</min> + </php> + <pearinstaller> + <min>1.7.0</min> + </pearinstaller> + </required> + </dependencies> + <phprelease/> + <changelog> + <release> + <date>2010-04-29</date> + <time>12:00:00</time> + <version> + <release>1.4</release> + <api>1.4</api> + </version> + <stability> + <release>stable</release> + <api>stable</api> + </stability> + <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license> + <notes> +- Use mail_domain value for domain variables when there is no domain in username: + sql and ldap drivers (#1486694) +- Created package.xml + </notes> + </release> + <release> + <date>2010-06-20</date> + <time>12:00:00</time> + <version> + <release>1.5</release> + <api>1.5</api> + </version> + <stability> + <release>stable</release> + <api>stable</api> + </stability> + <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license> + <notes> +- Removed user_login/username_local/username_domain methods, + use rcube_user::get_username instead (#1486707) + </notes> + </release> + <release> + <date>2010-08-01</date> + <time>09:00:00</time> + <version> + <release>1.6</release> + <api>1.5</api> + </version> + <stability> + <release>stable</release> + <api>stable</api> + </stability> + <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license> + <notes> +- Added ldap_simple driver + </notes> + </release> + <release> + <date>2010-09-10</date> + <time>09:00:00</time> + <version> + <release>1.7</release> + <api>1.5</api> + </version> + <stability> + <release>stable</release> + <api>stable</api> + </stability> + <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license> + <notes> +- Added XMail driver +- Improve security of chpasswd driver using popen instead of exec+echo (#1486987) +- Added chpass-wrapper.py script to improve security (#1486987) + </notes> + </release> + <release> + <date>2010-09-29</date> + <time>19:00:00</time> + <version> + <release>1.8</release> + <api>1.6</api> + </version> + <stability> + <release>stable</release> + <api>stable</api> + </stability> + <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license> + <notes> +- Added possibility to display extended error messages (#1486704) +- Added extended error messages in Poppassd driver (#1486704) + </notes> + </release> + <release> + <version> + <release>1.9</release> + <api>1.6</api> + </version> + <stability> + <release>stable</release> + <api>stable</api> + </stability> + <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license> + <notes> +- Added password_ldap_lchattr option (#1486927) + </notes> + </release> + <release> + <date>2010-10-07</date> + <time>09:00:00</time> + <version> + <release>2.0</release> + <api>1.6</api> + </version> + <stability> + <release>stable</release> + <api>stable</api> + </stability> + <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license> + <notes> +- Fixed SQL Injection in SQL driver when using %p or %o variables in query (#1487034) + </notes> + </release> + <release> + <date>2010-11-02</date> + <time>09:00:00</time> + <version> + <release>2.1</release> + <api>1.6</api> + </version> + <stability> + <release>stable</release> + <api>stable</api> + </stability> + <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license> + <notes> +- hMail driver: Add possibility to connect to remote host + </notes> + </release> + <release> + <date>2011-02-15</date> + <time>12:00</time> + <version> + <release>2.2</release> + <api>1.6</api> + </version> + <stability> + <release>stable</release> + <api>stable</api> + </stability> + <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license> + <notes> +- hMail driver: add username_domain detection (#1487100) +- hMail driver: HTML tags in logged messages should be stripped off (#1487099) +- Chpasswd driver: add newline at end of input to chpasswd binary (#1487141) +- Fix usage of configured temp_dir instead of /tmp (#1487447) +- ldap_simple driver: fix parse error +- ldap/ldap_simple drivers: support %dc variable in config +- ldap/ldap_simple drivers: support Samba password change +- Fix extended error messages handling (#1487676) +- Fix double request when clicking on Password tab in Firefox +- Fix deprecated split() usage in xmail and directadmin drivers (#1487769) +- Added option (password_log) for logging password changes +- Virtualmin driver: Add option for setting username format (#1487781) + </notes> + </release> + </changelog> +</package> diff --git a/plugins/password/password.js b/plugins/password/password.js new file mode 100644 index 000000000..26376b36d --- /dev/null +++ b/plugins/password/password.js @@ -0,0 +1,37 @@ +/* + * Password plugin script + * @version @package_version@ + */ + +if (window.rcmail) { + rcmail.addEventListener('init', function(evt) { + // <span id="settingstabdefault" class="tablink"><roundcube:button command="preferences" type="link" label="preferences" title="editpreferences" /></span> + var tab = $('<span>').attr('id', 'settingstabpluginpassword').addClass('tablink'); + var button = $('<a>').attr('href', rcmail.env.comm_path+'&_action=plugin.password') + .html(rcmail.gettext('password')).appendTo(tab); + + // add button and register commands + rcmail.add_element(tab, 'tabs'); + rcmail.register_command('plugin.password-save', function() { + var input_curpasswd = rcube_find_object('_curpasswd'); + var input_newpasswd = rcube_find_object('_newpasswd'); + var input_confpasswd = rcube_find_object('_confpasswd'); + + if (input_curpasswd && input_curpasswd.value=='') { + alert(rcmail.gettext('nocurpassword', 'password')); + input_curpasswd.focus(); + } else if (input_newpasswd && input_newpasswd.value=='') { + alert(rcmail.gettext('nopassword', 'password')); + input_newpasswd.focus(); + } else if (input_confpasswd && input_confpasswd.value=='') { + alert(rcmail.gettext('nopassword', 'password')); + input_confpasswd.focus(); + } else if (input_newpasswd && input_confpasswd && input_newpasswd.value != input_confpasswd.value) { + alert(rcmail.gettext('passwordinconsistency', 'password')); + input_newpasswd.focus(); + } else { + rcmail.gui_objects.passform.submit(); + } + }, true); + }) +} diff --git a/plugins/password/password.php b/plugins/password/password.php new file mode 100644 index 000000000..b1c7863fc --- /dev/null +++ b/plugins/password/password.php @@ -0,0 +1,274 @@ +<?php + +/* + +-------------------------------------------------------------------------+ + | Password Plugin for Roundcube | + | @version @package_version@ | + | | + | Copyright (C) 2009-2010, Roundcube Dev. | + | | + | This program is free software; you can redistribute it and/or modify | + | it under the terms of the GNU General Public License version 2 | + | as published by the Free Software Foundation. | + | | + | This program is distributed in the hope that it will be useful, | + | but WITHOUT ANY WARRANTY; without even the implied warranty of | + | MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the | + | GNU General Public License for more details. | + | | + | You should have received a copy of the GNU General Public License along | + | with this program; if not, write to the Free Software Foundation, Inc., | + | 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. | + | | + +-------------------------------------------------------------------------+ + | Author: Aleksander Machniak <alec@alec.pl> | + +-------------------------------------------------------------------------+ + + $Id: index.php 2645 2009-06-15 07:01:36Z alec $ + +*/ + +define('PASSWORD_CRYPT_ERROR', 1); +define('PASSWORD_ERROR', 2); +define('PASSWORD_CONNECT_ERROR', 3); +define('PASSWORD_SUCCESS', 0); + +/** + * Change password plugin + * + * Plugin that adds functionality to change a users password. + * It provides common functionality and user interface and supports + * several backends to finally update the password. + * + * For installation and configuration instructions please read the README file. + * + * @author Aleksander Machniak + */ +class password extends rcube_plugin +{ + public $task = 'settings'; + public $noframe = true; + public $noajax = true; + + function init() + { + $rcmail = rcmail::get_instance(); + // add Tab label + $rcmail->output->add_label('password'); + $this->register_action('plugin.password', array($this, 'password_init')); + $this->register_action('plugin.password-save', array($this, 'password_save')); + $this->include_script('password.js'); + } + + function password_init() + { + $this->add_texts('localization/'); + $this->register_handler('plugin.body', array($this, 'password_form')); + + $rcmail = rcmail::get_instance(); + $rcmail->output->set_pagetitle($this->gettext('changepasswd')); + $rcmail->output->send('plugin'); + } + + function password_save() + { + $rcmail = rcmail::get_instance(); + $this->load_config(); + + $this->add_texts('localization/'); + $this->register_handler('plugin.body', array($this, 'password_form')); + $rcmail->output->set_pagetitle($this->gettext('changepasswd')); + + $confirm = $rcmail->config->get('password_confirm_current'); + $required_length = intval($rcmail->config->get('password_minimum_length')); + $check_strength = $rcmail->config->get('password_require_nonalpha'); + + if (($confirm && !isset($_POST['_curpasswd'])) || !isset($_POST['_newpasswd'])) { + $rcmail->output->command('display_message', $this->gettext('nopassword'), 'error'); + } + else { + + $charset = strtoupper($rcmail->config->get('password_charset', 'ISO-8859-1')); + $rc_charset = strtoupper($rcmail->output->get_charset()); + + $sespwd = $rcmail->decrypt($_SESSION['password']); + $curpwd = $confirm ? get_input_value('_curpasswd', RCUBE_INPUT_POST, true, $charset) : $sespwd; + $newpwd = get_input_value('_newpasswd', RCUBE_INPUT_POST, true); + $conpwd = get_input_value('_confpasswd', RCUBE_INPUT_POST, true); + + // check allowed characters according to the configured 'password_charset' option + // by converting the password entered by the user to this charset and back to UTF-8 + $orig_pwd = $newpwd; + $chk_pwd = rcube_charset_convert($orig_pwd, $rc_charset, $charset); + $chk_pwd = rcube_charset_convert($chk_pwd, $charset, $rc_charset); + + // WARNING: Default password_charset is ISO-8859-1, so conversion will + // change national characters. This may disable possibility of using + // the same password in other MUA's. + // We're doing this for consistence with Roundcube core + $newpwd = rcube_charset_convert($newpwd, $rc_charset, $charset); + $conpwd = rcube_charset_convert($conpwd, $rc_charset, $charset); + + if ($chk_pwd != $orig_pwd) { + $rcmail->output->command('display_message', $this->gettext('passwordforbidden'), 'error'); + } + // other passwords validity checks + else if ($conpwd != $newpwd) { + $rcmail->output->command('display_message', $this->gettext('passwordinconsistency'), 'error'); + } + else if ($confirm && $sespwd != $curpwd) { + $rcmail->output->command('display_message', $this->gettext('passwordincorrect'), 'error'); + } + else if ($required_length && strlen($newpwd) < $required_length) { + $rcmail->output->command('display_message', $this->gettext( + array('name' => 'passwordshort', 'vars' => array('length' => $required_length))), 'error'); + } + else if ($check_strength && (!preg_match("/[0-9]/", $newpwd) || !preg_match("/[^A-Za-z0-9]/", $newpwd))) { + $rcmail->output->command('display_message', $this->gettext('passwordweak'), 'error'); + } + // password is the same as the old one, do nothing, return success + else if ($sespwd == $newpwd) { + $rcmail->output->command('display_message', $this->gettext('successfullysaved'), 'confirmation'); + } + // try to save the password + else if (!($res = $this->_save($curpwd, $newpwd))) { + $rcmail->output->command('display_message', $this->gettext('successfullysaved'), 'confirmation'); + + // allow additional actions after password change (e.g. reset some backends) + $plugin = $rcmail->plugins->exec_hook('password_change', array( + 'old_pass' => $curpwd, 'new_pass' => $newpwd)); + + // Reset session password + $_SESSION['password'] = $rcmail->encrypt($plugin['new_pass']); + + // Log password change + if ($rcmail->config->get('password_log')) { + write_log('password', sprintf('Password changed for user %s (ID: %d) from %s', + $rcmail->user->get_username(), $rcmail->user->ID, rcmail_remote_ip())); + } + } + else { + $rcmail->output->command('display_message', $res, 'error'); + } + } + + rcmail_overwrite_action('plugin.password'); + $rcmail->output->send('plugin'); + } + + function password_form() + { + $rcmail = rcmail::get_instance(); + $this->load_config(); + + // add some labels to client + $rcmail->output->add_label( + 'password.nopassword', + 'password.nocurpassword', + 'password.passwordinconsistency' + ); + + $rcmail->output->set_env('product_name', $rcmail->config->get('product_name')); + + $table = new html_table(array('cols' => 2)); + + if ($rcmail->config->get('password_confirm_current')) { + // show current password selection + $field_id = 'curpasswd'; + $input_curpasswd = new html_passwordfield(array('name' => '_curpasswd', 'id' => $field_id, + 'size' => 20, 'autocomplete' => 'off')); + + $table->add('title', html::label($field_id, Q($this->gettext('curpasswd')))); + $table->add(null, $input_curpasswd->show()); + } + + // show new password selection + $field_id = 'newpasswd'; + $input_newpasswd = new html_passwordfield(array('name' => '_newpasswd', 'id' => $field_id, + 'size' => 20, 'autocomplete' => 'off')); + + $table->add('title', html::label($field_id, Q($this->gettext('newpasswd')))); + $table->add(null, $input_newpasswd->show()); + + // show confirm password selection + $field_id = 'confpasswd'; + $input_confpasswd = new html_passwordfield(array('name' => '_confpasswd', 'id' => $field_id, + 'size' => 20, 'autocomplete' => 'off')); + + $table->add('title', html::label($field_id, Q($this->gettext('confpasswd')))); + $table->add(null, $input_confpasswd->show()); + + $out = html::div(array('class' => 'box'), + html::div(array('id' => 'prefs-title', 'class' => 'boxtitle'), $this->gettext('changepasswd')) . + html::div(array('class' => 'boxcontent'), $table->show() . + html::p(null, + $rcmail->output->button(array( + 'command' => 'plugin.password-save', + 'type' => 'input', + 'class' => 'button mainaction', + 'label' => 'save' + ))))); + + $rcmail->output->add_gui_object('passform', 'password-form'); + + return $rcmail->output->form_tag(array( + 'id' => 'password-form', + 'name' => 'password-form', + 'method' => 'post', + 'action' => './?_task=settings&_action=plugin.password-save', + ), $out); + } + + private function _save($curpass, $passwd) + { + $config = rcmail::get_instance()->config; + $driver = $this->home.'/drivers/'.$config->get('password_driver', 'sql').'.php'; + + if (!is_readable($driver)) { + raise_error(array( + 'code' => 600, + 'type' => 'php', + 'file' => __FILE__, 'line' => __LINE__, + 'message' => "Password plugin: Unable to open driver file $driver" + ), true, false); + return $this->gettext('internalerror'); + } + + include($driver); + + if (!function_exists('password_save')) { + raise_error(array( + 'code' => 600, + 'type' => 'php', + 'file' => __FILE__, 'line' => __LINE__, + 'message' => "Password plugin: Broken driver: $driver" + ), true, false); + return $this->gettext('internalerror'); + } + + $result = password_save($curpass, $passwd); + + if (is_array($result)) { + $message = $result['message']; + $result = $result['code']; + } + + switch ($result) { + case PASSWORD_SUCCESS: + return; + case PASSWORD_CRYPT_ERROR; + $reason = $this->gettext('crypterror'); + case PASSWORD_CONNECT_ERROR; + $reason = $this->gettext('connecterror'); + case PASSWORD_ERROR: + default: + $reason = $this->gettext('internalerror'); + } + + if ($message) { + $reason .= ' ' . $message; + } + + return $reason; + } +} diff --git a/plugins/redundant_attachments/config.inc.php.dist b/plugins/redundant_attachments/config.inc.php.dist new file mode 100644 index 000000000..6c317ead1 --- /dev/null +++ b/plugins/redundant_attachments/config.inc.php.dist @@ -0,0 +1,13 @@ +<?php + +// By default this plugin stores attachments in filesystem +// and copies them into sql database. +// In environments with replicated database it is possible +// to use memcache as a fallback when write-master is unavailable. +$rcmail_config['redundant_attachments_memcache'] = false; + +// When memcache is used, attachment data expires after +// specied TTL time in seconds (max.2592000). Default is 12 hours. +$rcmail_config['redundant_attachments_memcache_ttl'] = 12 * 60 * 60; + +?> diff --git a/plugins/redundant_attachments/redundant_attachments.php b/plugins/redundant_attachments/redundant_attachments.php new file mode 100644 index 000000000..3c71dcb40 --- /dev/null +++ b/plugins/redundant_attachments/redundant_attachments.php @@ -0,0 +1,232 @@ +<?php +/** + * Redundant attachments + * + * This plugin provides a redundant storage for temporary uploaded + * attachment files. They are stored in both the database backend + * as well as on the local file system. + * + * It provides also memcache store as a fallback (see config file). + * + * This plugin relies on the core filesystem_attachments plugin + * and combines it with the functionality of the database_attachments plugin. + * + * @author Thomas Bruederli <roundcube@gmail.com> + * @author Aleksander Machniak <machniak@kolabsys.com> + * + * Copyright (C) 2011, The Roundcube Dev Team + * Copyright (C) 2011, Kolab Systems AG + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License version 2 + * as published by the Free Software Foundation. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License along + * with this program; if not, write to the Free Software Foundation, Inc., + * 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. + */ + +require_once(INSTALL_PATH . 'plugins/filesystem_attachments/filesystem_attachments.php'); + +class redundant_attachments extends filesystem_attachments +{ + // A prefix for the cache key used in the session and in the key field of the cache table + private $prefix = "ATTACH"; + + // rcube_cache instance for SQL DB + private $cache; + + // rcube_cache instance for memcache + private $mem_cache; + + private $loaded; + + /** + * Default constructor + */ + function init() + { + parent::init(); + } + + /** + * Loads plugin configuration and initializes cache object(s) + */ + private function _load_drivers() + { + if ($this->loaded) { + return; + } + + $rcmail = rcmail::get_instance(); + + // load configuration + $this->load_config(); + + // Init SQL cache (disable cache data serialization) + $this->cache = $rcmail->get_cache($this->prefix, 'db', 0, false); + + // Init memcache (fallback) cache + if ($rcmail->config->get('redundant_attachments_memcache')) { + $ttl = 12 * 60 * 60; // 12 hours + $ttl = (int) $rcmail->config->get('redundant_attachments_memcache_ttl', $ttl); + $this->mem_cache = $rcmail->get_cache($this->prefix, 'memcache', $ttl, false); + } + + $this->loaded = true; + } + + /** + * Helper method to generate a unique key for the given attachment file + */ + private function _key($args) + { + $uname = $args['path'] ? $args['path'] : $args['name']; + return $args['group'] . md5(mktime() . $uname . $_SESSION['user_id']); + } + + /** + * Save a newly uploaded attachment + */ + function upload($args) + { + $args = parent::upload($args); + + $this->_load_drivers(); + + $key = $this->_key($args); + $data = base64_encode(file_get_contents($args['path'])); + + $status = $this->cache->write($key, $data); + + if (!$status && $this->mem_cache) { + $status = $this->mem_cache->write($key, $data); + } + + if ($status) { + $args['id'] = $key; + $args['status'] = true; + } + + return $args; + } + + /** + * Save an attachment from a non-upload source (draft or forward) + */ + function save($args) + { + $args = parent::save($args); + + $this->_load_drivers(); + + if ($args['path']) + $args['data'] = file_get_contents($args['path']); + + $key = $this->_key($args); + $data = base64_encode($args['data']); + + $status = $this->cache->write($key, $data); + + if (!$status && $this->mem_cache) { + $status = $this->mem_cache->write($key, $data); + } + + if ($status) { + $args['id'] = $key; + $args['status'] = true; + } + + return $args; + } + + /** + * Remove an attachment from storage + * This is triggered by the remove attachment button on the compose screen + */ + function remove($args) + { + parent::remove($args); + + $this->_load_drivers(); + + $status = $this->cache->remove($args['id']); + + if (!$status && $this->mem_cache) { + $status = $this->cache->remove($args['id']); + } + + // we cannot trust the result of any of the methods above + // assume true, attachments will be removed on cleanup + $args['status'] = true; + + return $args; + } + + /** + * When composing an html message, image attachments may be shown + * For this plugin, $this->get() will check the file and + * return it's contents + */ + function display($args) + { + return $this->get($args); + } + + /** + * When displaying or sending the attachment the file contents are fetched + * using this method. This is also called by the attachment_display hook. + */ + function get($args) + { + // attempt to get file from local file system + $args = parent::get($args); + + if ($args['path'] && ($args['status'] = file_exists($args['path']))) + return $args; + + $this->_load_drivers(); + + // fetch from database if not found on FS + $data = $this->cache->read($args['id']); + + // fetch from memcache if not found on FS and DB + if (($data === false || $data === null) && $this->mem_cache) { + $data = $this->mem_cache->read($args['id']); + } + + if ($data) { + $args['data'] = base64_decode($data); + $args['status'] = true; + } + + return $args; + } + + /** + * Delete all temp files associated with this user + */ + function cleanup($args) + { + $this->_load_drivers(); + + if ($this->cache) { + $this->cache->remove($args['group'], true); + } + + if ($this->mem_cache) { + $this->mem_cache->remove($args['group'], true); + } + + parent::cleanup($args); + + $args['status'] = true; + + return $args; + } +} diff --git a/plugins/show_additional_headers/show_additional_headers.php b/plugins/show_additional_headers/show_additional_headers.php new file mode 100644 index 000000000..0007ce335 --- /dev/null +++ b/plugins/show_additional_headers/show_additional_headers.php @@ -0,0 +1,52 @@ +<?php + +/** + * Show additional message headers + * + * Proof-of-concept plugin which will fetch additional headers + * and display them in the message view. + * + * Enable the plugin in config/main.inc.php and add your desired headers: + * $rcmail_config['show_additional_headers'] = array('User-Agent'); + * + * @version 1.0 + * @author Thomas Bruederli + * @website http://roundcube.net + */ +class show_additional_headers extends rcube_plugin +{ + public $task = 'mail'; + + function init() + { + $rcmail = rcmail::get_instance(); + if ($rcmail->action == 'show' || $rcmail->action == 'preview') { + $this->add_hook('imap_init', array($this, 'imap_init')); + $this->add_hook('message_headers_output', array($this, 'message_headers')); + } else if ($rcmail->action == '') { + // with enabled_caching we're fetching additional headers before show/preview + $this->add_hook('imap_init', array($this, 'imap_init')); + } + } + + function imap_init($p) + { + $rcmail = rcmail::get_instance(); + if ($add_headers = (array)$rcmail->config->get('show_additional_headers', array())) + $p['fetch_headers'] = trim($p['fetch_headers'].' ' . strtoupper(join(' ', $add_headers))); + + return $p; + } + + function message_headers($p) + { + $rcmail = rcmail::get_instance(); + foreach ((array)$rcmail->config->get('show_additional_headers', array()) as $header) { + $key = strtolower($header); + if ($value = $p['headers']->others[$key]) + $p['output'][$key] = array('title' => $header, 'value' => Q($value)); + } + + return $p; + } +} diff --git a/plugins/squirrelmail_usercopy/config.inc.php.dist b/plugins/squirrelmail_usercopy/config.inc.php.dist new file mode 100644 index 000000000..0dc0abb02 --- /dev/null +++ b/plugins/squirrelmail_usercopy/config.inc.php.dist @@ -0,0 +1,25 @@ +<?php + +// Driver - 'file' or 'sql' +$rcmail_config['squirrelmail_driver'] = 'sql'; + +// full path to the squirrelmail data directory +$rcmail_config['squirrelmail_data_dir'] = ''; +$rcmail_config['squirrelmail_data_dir_hash_level'] = 0; + +// 'mysql://dbuser:dbpass@localhost/database' +$rcmail_config['squirrelmail_dsn'] = 'mysql://user:password@localhost/webmail'; +$rcmail_config['squirrelmail_db_charset'] = 'iso-8859-1'; + +$rcmail_config['squirrelmail_address_table'] = 'address'; +$rcmail_config['squirrelmail_userprefs_table'] = 'userprefs'; + +// identities_level option value for squirrelmail plugin +// With this you can bypass/change identities_level checks +// for operations inside this plugin. See #1486773 +$rcmail_config['squirrelmail_identities_level'] = null; + +// Set to false if you don't want the email address of the default identity +// (squirrelmail preference "email_address") to be saved as alias. +// Recommended: set to false if your squirrelmail config setting $edit_identity has been true. +$rcmail_config['squirrelmail_set_alias'] = true; diff --git a/plugins/squirrelmail_usercopy/squirrelmail_usercopy.php b/plugins/squirrelmail_usercopy/squirrelmail_usercopy.php new file mode 100644 index 000000000..ee6bcc04b --- /dev/null +++ b/plugins/squirrelmail_usercopy/squirrelmail_usercopy.php @@ -0,0 +1,190 @@ +<?php + +/** + * Copy a new users identity and settings from a nearby Squirrelmail installation + * + * @version 1.4 + * @author Thomas Bruederli, Johannes Hessellund, pommi, Thomas Lueder + */ +class squirrelmail_usercopy extends rcube_plugin +{ + public $task = 'login'; + + private $prefs = null; + private $identities_level = 0; + private $abook = array(); + + public function init() + { + $this->add_hook('user_create', array($this, 'create_user')); + $this->add_hook('identity_create', array($this, 'create_identity')); + } + + public function create_user($p) + { + $rcmail = rcmail::get_instance(); + + // Read plugin's config + $this->initialize(); + + // read prefs and add email address + $this->read_squirrel_prefs($p['user']); + if (($this->identities_level == 0 || $this->identities_level == 2) && $rcmail->config->get('squirrelmail_set_alias') && $this->prefs['email_address']) + $p['user_email'] = $this->prefs['email_address']; + return $p; + } + + public function create_identity($p) + { + $rcmail = rcmail::get_instance(); + + // prefs are set in create_user() + if ($this->prefs) { + if ($this->prefs['full_name']) + $p['record']['name'] = $this->prefs['full_name']; + if (($this->identities_level == 0 || $this->identities_level == 2) && $this->prefs['email_address']) + $p['record']['email'] = $this->prefs['email_address']; + if ($this->prefs['___signature___']) + $p['record']['signature'] = $this->prefs['___signature___']; + if ($this->prefs['reply_to']) + $p['record']['reply-to'] = $this->prefs['reply_to']; + if (($this->identities_level == 0 || $this->identities_level == 1) && isset($this->prefs['identities']) && $this->prefs['identities'] > 1) { + for ($i=1; $i < $this->prefs['identities']; $i++) { + unset($ident_data); + $ident_data = array('name' => '', 'email' => ''); // required data + if ($this->prefs['full_name'.$i]) + $ident_data['name'] = $this->prefs['full_name'.$i]; + if ($this->identities_level == 0 && $this->prefs['email_address'.$i]) + $ident_data['email'] = $this->prefs['email_address'.$i]; + else + $ident_data['email'] = $p['record']['email']; + if ($this->prefs['reply_to'.$i]) + $ident_data['reply-to'] = $this->prefs['reply_to'.$i]; + if ($this->prefs['___sig'.$i.'___']) + $ident_data['signature'] = $this->prefs['___sig'.$i.'___']; + // insert identity + $identid = $rcmail->user->insert_identity($ident_data); + } + } + + // copy address book + $contacts = $rcmail->get_address_book(null, true); + if ($contacts && count($this->abook)) { + foreach ($this->abook as $rec) { + // #1487096 handle multi-address and/or too long items + $rec['email'] = array_shift(explode(';', $rec['email'])); + if (check_email(rcube_idn_to_ascii($rec['email']))) { + $rec['email'] = rcube_idn_to_utf8($rec['email']); + $contacts->insert($rec, true); + } + } + } + + // mark identity as complete for following hooks + $p['complete'] = true; + } + + return $p; + } + + private function initialize() + { + $rcmail = rcmail::get_instance(); + + // Load plugin's config file + $this->load_config(); + + // Set identities_level for operations of this plugin + $ilevel = $rcmail->config->get('squirrelmail_identities_level'); + if ($ilevel === null) + $ilevel = $rcmail->config->get('identities_level', 0); + + $this->identities_level = intval($ilevel); + } + + private function read_squirrel_prefs($uname) + { + $rcmail = rcmail::get_instance(); + + /**** File based backend ****/ + if ($rcmail->config->get('squirrelmail_driver') == 'file' && ($srcdir = $rcmail->config->get('squirrelmail_data_dir'))) { + if (($hash_level = $rcmail->config->get('squirrelmail_data_dir_hash_level')) > 0) + $srcdir = slashify($srcdir).chunk_split(substr(base_convert(crc32($uname), 10, 16), 0, $hash_level), 1, '/'); + $prefsfile = slashify($srcdir) . $uname . '.pref'; + $abookfile = slashify($srcdir) . $uname . '.abook'; + $sigfile = slashify($srcdir) . $uname . '.sig'; + $sigbase = slashify($srcdir) . $uname . '.si'; + + if (is_readable($prefsfile)) { + $this->prefs = array(); + foreach (file($prefsfile) as $line) { + list($key, $value) = explode('=', $line); + $this->prefs[$key] = utf8_encode(rtrim($value)); + } + + // also read signature file if exists + if (is_readable($sigfile)) { + $this->prefs['___signature___'] = utf8_encode(file_get_contents($sigfile)); + } + + if (isset($this->prefs['identities']) && $this->prefs['identities'] > 1) { + for ($i=1; $i < $this->prefs['identities']; $i++) { + // read signature file if exists + if (is_readable($sigbase.$i)) { + $this->prefs['___sig'.$i.'___'] = utf8_encode(file_get_contents($sigbase.$i)); + } + } + } + + // parse addres book file + if (filesize($abookfile)) { + foreach(file($abookfile) as $line) { + list($rec['name'], $rec['firstname'], $rec['surname'], $rec['email']) = explode('|', utf8_encode(rtrim($line))); + if ($rec['name'] && $rec['email']) + $this->abook[] = $rec; + } + } + } + } + /**** Database backend ****/ + else if ($rcmail->config->get('squirrelmail_driver') == 'sql') { + $this->prefs = array(); + + /* connect to squirrelmail database */ + $db = new rcube_mdb2($rcmail->config->get('squirrelmail_dsn')); + $db->db_connect('r'); // connect in read mode + + // $db->set_debug(true); + + /* retrieve prefs */ + $userprefs_table = $rcmail->config->get('squirrelmail_userprefs_table'); + $address_table = $rcmail->config->get('squirrelmail_address_table'); + $db_charset = $rcmail->config->get('squirrelmail_db_charset'); + + if ($db_charset) + $db->query('SET NAMES '.$db_charset); + + $sql_result = $db->query('SELECT * FROM '.$userprefs_table.' WHERE user=?', $uname); // ? is replaced with emailaddress + + while ($sql_array = $db->fetch_assoc($sql_result) ) { // fetch one row from result + $this->prefs[$sql_array['prefkey']] = rcube_charset_convert(rtrim($sql_array['prefval']), $db_charset); + } + + /* retrieve address table data */ + $sql_result = $db->query('SELECT * FROM '.$address_table.' WHERE owner=?', $uname); // ? is replaced with emailaddress + + // parse addres book + while ($sql_array = $db->fetch_assoc($sql_result) ) { // fetch one row from result + $rec['name'] = rcube_charset_convert(rtrim($sql_array['nickname']), $db_charset); + $rec['firstname'] = rcube_charset_convert(rtrim($sql_array['firstname']), $db_charset); + $rec['surname'] = rcube_charset_convert(rtrim($sql_array['lastname']), $db_charset); + $rec['email'] = rcube_charset_convert(rtrim($sql_array['email']), $db_charset); + $rec['note'] = rcube_charset_convert(rtrim($sql_array['label']), $db_charset); + + if ($rec['name'] && $rec['email']) + $this->abook[] = $rec; + } + } // end if 'sql'-driver + } + +} diff --git a/plugins/subscriptions_option/localization/cs_CZ.inc b/plugins/subscriptions_option/localization/cs_CZ.inc new file mode 100644 index 000000000..0d9c1fc73 --- /dev/null +++ b/plugins/subscriptions_option/localization/cs_CZ.inc @@ -0,0 +1,23 @@ +<?php + +/* + ++-----------------------------------------------------------------------+ +| language/cs_CZ/labels.inc | +| | +| Language file of the Roundcube subscriptions option plugin | +| Copyright (C) 2005-2009, The Roundcube Dev Team | +| Licensed under the GNU GPL | +| | ++-----------------------------------------------------------------------+ +| Author: Milan Kozak <hodza@hodza.net> | ++-----------------------------------------------------------------------+ + +@version $Id: labels.inc 2993 2009-09-26 18:32:07Z alec $ + +*/ + +$labels = array(); +$labels['useimapsubscriptions'] = 'Používat odebírání IMAP složek'; + +?> diff --git a/plugins/subscriptions_option/localization/de_CH.inc b/plugins/subscriptions_option/localization/de_CH.inc new file mode 100644 index 000000000..b4affe0c8 --- /dev/null +++ b/plugins/subscriptions_option/localization/de_CH.inc @@ -0,0 +1,6 @@ +<?php + +$labels = array(); +$labels['useimapsubscriptions'] = 'Nur abonnierte Ordner anzeigen'; + +?> diff --git a/plugins/subscriptions_option/localization/de_DE.inc b/plugins/subscriptions_option/localization/de_DE.inc new file mode 100644 index 000000000..b4affe0c8 --- /dev/null +++ b/plugins/subscriptions_option/localization/de_DE.inc @@ -0,0 +1,6 @@ +<?php + +$labels = array(); +$labels['useimapsubscriptions'] = 'Nur abonnierte Ordner anzeigen'; + +?> diff --git a/plugins/subscriptions_option/localization/en_US.inc b/plugins/subscriptions_option/localization/en_US.inc new file mode 100644 index 000000000..5a348e0ee --- /dev/null +++ b/plugins/subscriptions_option/localization/en_US.inc @@ -0,0 +1,6 @@ +<?php + +$labels = array(); +$labels['useimapsubscriptions'] = 'Use IMAP Subscriptions'; + +?> diff --git a/plugins/subscriptions_option/localization/es_ES.inc b/plugins/subscriptions_option/localization/es_ES.inc new file mode 100644 index 000000000..ca9a42126 --- /dev/null +++ b/plugins/subscriptions_option/localization/es_ES.inc @@ -0,0 +1,6 @@ +<?php + +$labels = array(); +$labels['useimapsubscriptions'] = 'Usar suscripciones IMAP'; + +?> diff --git a/plugins/subscriptions_option/localization/et_EE.inc b/plugins/subscriptions_option/localization/et_EE.inc new file mode 100644 index 000000000..6c5f6f435 --- /dev/null +++ b/plugins/subscriptions_option/localization/et_EE.inc @@ -0,0 +1,6 @@ +<?php + +$labels = array(); +$labels['useimapsubscriptions'] = 'Kasuta IMAP tellimusi'; + +?> diff --git a/plugins/subscriptions_option/localization/gl_ES.inc b/plugins/subscriptions_option/localization/gl_ES.inc new file mode 100644 index 000000000..d7db28d2e --- /dev/null +++ b/plugins/subscriptions_option/localization/gl_ES.inc @@ -0,0 +1,6 @@ +<?php + +$labels = array(); +$labels['useimapsubscriptions'] = 'Usar suscripcións IMAP'; + +?> diff --git a/plugins/subscriptions_option/localization/ja_JP.inc b/plugins/subscriptions_option/localization/ja_JP.inc new file mode 100644 index 000000000..dacea2956 --- /dev/null +++ b/plugins/subscriptions_option/localization/ja_JP.inc @@ -0,0 +1,8 @@ +<?php + +// EN-Revision: 3891 + +$labels = array(); +$labels['useimapsubscriptions'] = 'IMAP 購読リストを使う'; + +?> diff --git a/plugins/subscriptions_option/localization/pl_PL.inc b/plugins/subscriptions_option/localization/pl_PL.inc new file mode 100644 index 000000000..8544c7d30 --- /dev/null +++ b/plugins/subscriptions_option/localization/pl_PL.inc @@ -0,0 +1,6 @@ +<?php + +$labels = array(); +$labels['useimapsubscriptions'] = 'Używaj subskrypcji IMAP'; + +?> diff --git a/plugins/subscriptions_option/localization/ru_RU.inc b/plugins/subscriptions_option/localization/ru_RU.inc new file mode 100644 index 000000000..5deb84e0d --- /dev/null +++ b/plugins/subscriptions_option/localization/ru_RU.inc @@ -0,0 +1,6 @@ +<?php + +$labels = array(); +$labels['useimapsubscriptions'] = 'Использовать IMAP подписку'; + +?> diff --git a/plugins/subscriptions_option/localization/sv_SE.inc b/plugins/subscriptions_option/localization/sv_SE.inc new file mode 100644 index 000000000..05b7006f4 --- /dev/null +++ b/plugins/subscriptions_option/localization/sv_SE.inc @@ -0,0 +1,6 @@ +<?php + +$labels = array(); +$labels['useimapsubscriptions'] = 'Använd IMAP-prenumerationer'; + +?> diff --git a/plugins/subscriptions_option/localization/zh_TW.inc b/plugins/subscriptions_option/localization/zh_TW.inc new file mode 100644 index 000000000..f310b51b7 --- /dev/null +++ b/plugins/subscriptions_option/localization/zh_TW.inc @@ -0,0 +1,6 @@ +<?php + +$labels = array(); +$labels['useimapsubscriptions'] = '使用IMAP訂閱'; + +?> diff --git a/plugins/subscriptions_option/subscriptions_option.php b/plugins/subscriptions_option/subscriptions_option.php new file mode 100644 index 000000000..c0eb90c22 --- /dev/null +++ b/plugins/subscriptions_option/subscriptions_option.php @@ -0,0 +1,92 @@ +<?php + +/** + * Subscription Options + * + * A plugin which can enable or disable the use of imap subscriptions. + * It includes a toggle on the settings page under "Server Settings". + * The preference can also be locked + * + * Add it to the plugins list in config/main.inc.php to enable the user option + * The user option can be hidden and set globally by adding 'use_subscriptions' + * to the the 'dont_override' configure line: + * $rcmail_config['dont_override'] = array('use_subscriptions'); + * and then set the global preference + * $rcmail_config['use_subscriptions'] = true; // or false + * + * Roundcube caches folder lists. When a user changes this option or visits + * their folder list, this cache is refreshed. If the option is on the + * 'dont_override' list and the global option has changed, don't expect + * to see the change until the folder list cache is refreshed. + * + * @version 1.1 + * @author Ziba Scott + */ +class subscriptions_option extends rcube_plugin +{ + public $task = 'mail|settings'; + + function init() + { + $this->add_texts('localization/', false); + $dont_override = rcmail::get_instance()->config->get('dont_override', array()); + if (!in_array('use_subscriptions', $dont_override)) { + $this->add_hook('preferences_list', array($this, 'settings_blocks')); + $this->add_hook('preferences_save', array($this, 'save_prefs')); + } + $this->add_hook('mailboxes_list', array($this, 'mailboxes_list')); + $this->add_hook('folders_list', array($this, 'folders_list')); + } + + function settings_blocks($args) + { + if ($args['section'] == 'server') { + $use_subscriptions = rcmail::get_instance()->config->get('use_subscriptions'); + $field_id = 'rcmfd_use_subscriptions'; + $checkbox = new html_checkbox(array('name' => '_use_subscriptions', 'id' => $field_id, 'value' => 1)); + + $args['blocks']['main']['options']['use_subscriptions'] = array( + 'title' => html::label($field_id, Q($this->gettext('useimapsubscriptions'))), + 'content' => $checkbox->show($use_subscriptions?1:0), + ); + } + + return $args; + } + + function save_prefs($args) + { + if ($args['section'] == 'server') { + $rcmail = rcmail::get_instance(); + $use_subscriptions = $rcmail->config->get('use_subscriptions'); + + $args['prefs']['use_subscriptions'] = isset($_POST['_use_subscriptions']) ? true : false; + + // if the use_subscriptions preference changes, flush the folder cache + if (($use_subscriptions && !isset($_POST['_use_subscriptions'])) || + (!$use_subscriptions && isset($_POST['_use_subscriptions']))) { + $rcmail->imap_connect(); + $rcmail->imap->clear_cache('mailboxes'); + } + } + return $args; + } + + function mailboxes_list($args) + { + $rcmail = rcmail::get_instance(); + if (!$rcmail->config->get('use_subscriptions', true)) { + $args['folders'] = $rcmail->imap->conn->listMailboxes($args['root'], $args['name']); + } + return $args; + } + + function folders_list($args) + { + $rcmail = rcmail::get_instance(); + if (!$rcmail->config->get('use_subscriptions', true)) { + $args['table']->remove_column('subscribed'); + } + return $args; + } +} diff --git a/plugins/userinfo/localization/cs_CZ.inc b/plugins/userinfo/localization/cs_CZ.inc new file mode 100644 index 000000000..20cd4ae9b --- /dev/null +++ b/plugins/userinfo/localization/cs_CZ.inc @@ -0,0 +1,27 @@ +<?php + +/* + ++-----------------------------------------------------------------------+ +| language/cs_CZ/labels.inc | +| | +| Language file of the Roundcube userinfo plugin | +| Copyright (C) 2005-2009, The Roundcube Dev Team | +| Licensed under the GNU GPL | +| | ++-----------------------------------------------------------------------+ +| Author: Milan Kozak <hodza@hodza.net> | ++-----------------------------------------------------------------------+ + +@version $Id: labels.inc 2993 2009-09-26 18:32:07Z alec $ + +*/ + +$labels = array(); +$labels['infosfor'] = 'Informace pro'; +$labels['userinfo'] = 'Uživatel'; +$labels['created'] = 'Vytvořen'; +$labels['lastlogin'] = 'Naspoledy přihlášen'; +$labels['defaultidentity'] = 'Výchozí identita'; + +?>
\ No newline at end of file diff --git a/plugins/userinfo/localization/da_DK.inc b/plugins/userinfo/localization/da_DK.inc new file mode 100644 index 000000000..0fed30935 --- /dev/null +++ b/plugins/userinfo/localization/da_DK.inc @@ -0,0 +1,9 @@ +<?php + +$labels = array(); +$labels['userinfo'] = 'Bruger info'; +$labels['created'] = 'Oprettet'; +$labels['lastlogin'] = 'Sidste login'; +$labels['defaultidentity'] = 'Standard identitet'; + +?> diff --git a/plugins/userinfo/localization/de_CH.inc b/plugins/userinfo/localization/de_CH.inc new file mode 100644 index 000000000..5f236b66c --- /dev/null +++ b/plugins/userinfo/localization/de_CH.inc @@ -0,0 +1,9 @@ +<?php + +$labels = array(); +$labels['userinfo'] = 'Benutzerinfo'; +$labels['created'] = 'Erstellt'; +$labels['lastlogin'] = 'Letztes Login'; +$labels['defaultidentity'] = 'Standard-Absender'; + +?>
\ No newline at end of file diff --git a/plugins/userinfo/localization/en_US.inc b/plugins/userinfo/localization/en_US.inc new file mode 100644 index 000000000..1a2fd9016 --- /dev/null +++ b/plugins/userinfo/localization/en_US.inc @@ -0,0 +1,9 @@ +<?php + +$labels = array(); +$labels['userinfo'] = 'User info'; +$labels['created'] = 'Created'; +$labels['lastlogin'] = 'Last Login'; +$labels['defaultidentity'] = 'Default Identity'; + +?>
\ No newline at end of file diff --git a/plugins/userinfo/localization/es_ES.inc b/plugins/userinfo/localization/es_ES.inc new file mode 100644 index 000000000..dd6662fc0 --- /dev/null +++ b/plugins/userinfo/localization/es_ES.inc @@ -0,0 +1,9 @@ +<?php + +$labels = array(); +$labels['userinfo'] = 'Información de usuario'; +$labels['created'] = 'Creado'; +$labels['lastlogin'] = 'Última conexión'; +$labels['defaultidentity'] = 'Identidad predeterminada'; + +?>
\ No newline at end of file diff --git a/plugins/userinfo/localization/et_EE.inc b/plugins/userinfo/localization/et_EE.inc new file mode 100644 index 000000000..97830b45c --- /dev/null +++ b/plugins/userinfo/localization/et_EE.inc @@ -0,0 +1,9 @@ +<?php + +$labels = array(); +$labels['userinfo'] = 'Kasutaja info'; +$labels['created'] = 'Loodud'; +$labels['lastlogin'] = 'Viimane logimine'; +$labels['defaultidentity'] = 'Vaikeidentiteet'; + +?> diff --git a/plugins/userinfo/localization/gl_ES.inc b/plugins/userinfo/localization/gl_ES.inc new file mode 100644 index 000000000..bf285d37f --- /dev/null +++ b/plugins/userinfo/localization/gl_ES.inc @@ -0,0 +1,9 @@ +<?php + +$labels = array(); +$labels['userinfo'] = 'Información do usuario'; +$labels['created'] = 'Creado'; +$labels['lastlogin'] = 'Última conexión'; +$labels['defaultidentity'] = 'Identidade predeterminada'; + +?>
\ No newline at end of file diff --git a/plugins/userinfo/localization/ja_JP.inc b/plugins/userinfo/localization/ja_JP.inc new file mode 100644 index 000000000..1fd4eaf51 --- /dev/null +++ b/plugins/userinfo/localization/ja_JP.inc @@ -0,0 +1,11 @@ +<?php + +// EN-Revision: 3891 + +$labels = array(); +$labels['userinfo'] = 'ユーザー情報'; +$labels['created'] = '作成日'; +$labels['lastlogin'] = '最終ログイン'; +$labels['defaultidentity'] = '標準の識別情報'; + +?>
\ No newline at end of file diff --git a/plugins/userinfo/localization/pl_PL.inc b/plugins/userinfo/localization/pl_PL.inc new file mode 100644 index 000000000..6b03c32e7 --- /dev/null +++ b/plugins/userinfo/localization/pl_PL.inc @@ -0,0 +1,9 @@ +<?php + +$labels = array(); +$labels['userinfo'] = 'Informacje'; +$labels['created'] = 'Utworzony'; +$labels['lastlogin'] = 'Ostatnie logowanie'; +$labels['defaultidentity'] = 'Domyślna tożsamość'; + +?> diff --git a/plugins/userinfo/localization/pt_BR.inc b/plugins/userinfo/localization/pt_BR.inc new file mode 100644 index 000000000..4ca54eb94 --- /dev/null +++ b/plugins/userinfo/localization/pt_BR.inc @@ -0,0 +1,9 @@ +<?php + +$labels = array(); +$labels['userinfo'] = 'Info do usuário'; +$labels['created'] = 'Criado'; +$labels['lastlogin'] = 'Último Login'; +$labels['defaultidentity'] = 'Identidade Padrão'; + +?>
\ No newline at end of file diff --git a/plugins/userinfo/localization/pt_PT.inc b/plugins/userinfo/localization/pt_PT.inc new file mode 100644 index 000000000..45009f9f4 --- /dev/null +++ b/plugins/userinfo/localization/pt_PT.inc @@ -0,0 +1,9 @@ +<?php + +$labels = array(); +$labels['userinfo'] = 'Informação do utilizador'; +$labels['created'] = 'Criado'; +$labels['lastlogin'] = 'Último login'; +$labels['defaultidentity'] = 'Identidade pré-definida'; + +?> diff --git a/plugins/userinfo/localization/ru_RU.inc b/plugins/userinfo/localization/ru_RU.inc new file mode 100644 index 000000000..0e7ed4f8a --- /dev/null +++ b/plugins/userinfo/localization/ru_RU.inc @@ -0,0 +1,9 @@ +<?php + +$labels = array(); +$labels['userinfo'] = 'Информация'; +$labels['created'] = 'Создан'; +$labels['lastlogin'] = 'Последний вход'; +$labels['defaultidentity'] = 'Профиль по умолчанию'; + +?> diff --git a/plugins/userinfo/localization/sv_SE.inc b/plugins/userinfo/localization/sv_SE.inc new file mode 100644 index 000000000..a34923a88 --- /dev/null +++ b/plugins/userinfo/localization/sv_SE.inc @@ -0,0 +1,9 @@ +<?php + +$labels = array(); +$labels['userinfo'] = 'Användarinfo'; +$labels['created'] = 'Skapad'; +$labels['lastlogin'] = 'Senast inloggad'; +$labels['defaultidentity'] = 'Standardprofil'; + +?>
\ No newline at end of file diff --git a/plugins/userinfo/localization/zh_TW.inc b/plugins/userinfo/localization/zh_TW.inc new file mode 100644 index 000000000..d3124459e --- /dev/null +++ b/plugins/userinfo/localization/zh_TW.inc @@ -0,0 +1,9 @@ +<?php + +$labels = array(); +$labels['userinfo'] = '使用者資訊'; +$labels['created'] = '建立時間'; +$labels['lastlogin'] = '上次登入'; +$labels['defaultidentity'] = '預設身份'; + +?> diff --git a/plugins/userinfo/userinfo.js b/plugins/userinfo/userinfo.js new file mode 100644 index 000000000..70a5085b3 --- /dev/null +++ b/plugins/userinfo/userinfo.js @@ -0,0 +1,16 @@ +/* Show user-info plugin script */ + +if (window.rcmail) { + rcmail.addEventListener('init', function(evt) { + // <span id="settingstabdefault" class="tablink"><roundcube:button command="preferences" type="link" label="preferences" title="editpreferences" /></span> + var tab = $('<span>').attr('id', 'settingstabpluginuserinfo').addClass('tablink'); + + var button = $('<a>').attr('href', rcmail.env.comm_path+'&_action=plugin.userinfo').html(rcmail.gettext('userinfo', 'userinfo')).appendTo(tab); + button.bind('click', function(e){ return rcmail.command('plugin.userinfo', this) }); + + // add button and register command + rcmail.add_element(tab, 'tabs'); + rcmail.register_command('plugin.userinfo', function(){ rcmail.goto_url('plugin.userinfo') }, true); + }) +} + diff --git a/plugins/userinfo/userinfo.php b/plugins/userinfo/userinfo.php new file mode 100644 index 000000000..efb65f51d --- /dev/null +++ b/plugins/userinfo/userinfo.php @@ -0,0 +1,55 @@ +<?php + +/** + * Sample plugin that adds a new tab to the settings section + * to display some information about the current user + */ +class userinfo extends rcube_plugin +{ + public $task = 'settings'; + public $noajax = true; + public $noframe = true; + + function init() + { + $this->add_texts('localization/', array('userinfo')); + $this->register_action('plugin.userinfo', array($this, 'infostep')); + $this->include_script('userinfo.js'); + } + + function infostep() + { + $this->register_handler('plugin.body', array($this, 'infohtml')); + rcmail::get_instance()->output->send('plugin'); + } + + function infohtml() + { + $rcmail = rcmail::get_instance(); + $user = $rcmail->user; + + $table = new html_table(array('cols' => 2, 'cellpadding' => 3)); + + $table->add('title', 'ID'); + $table->add('', Q($user->ID)); + + $table->add('title', Q($this->gettext('username'))); + $table->add('', Q($user->data['username'])); + + $table->add('title', Q($this->gettext('server'))); + $table->add('', Q($user->data['mail_host'])); + + $table->add('title', Q($this->gettext('created'))); + $table->add('', Q($user->data['created'])); + + $table->add('title', Q($this->gettext('lastlogin'))); + $table->add('', Q($user->data['last_login'])); + + $identity = $user->get_identity(); + $table->add('title', Q($this->gettext('defaultidentity'))); + $table->add('', Q($identity['name'] . ' <' . $identity['email'] . '>')); + + return html::tag('h4', null, Q('Infos for ' . $user->get_username())) . $table->show(); + } + +} diff --git a/plugins/vcard_attachments/localization/cs_CZ.inc b/plugins/vcard_attachments/localization/cs_CZ.inc new file mode 100644 index 000000000..11ae8c98f --- /dev/null +++ b/plugins/vcard_attachments/localization/cs_CZ.inc @@ -0,0 +1,21 @@ +<?php + +/* ++-----------------------------------------------------------------------+ +| language/cs_CZ/labels.inc | +| | +| Language file of the Roundcube Webmail client | +| Copyright (C) 2008-2010, The Roundcube Dev Team | +| Licensed under the GNU GPL | +| | ++-----------------------------------------------------------------------+ +| Author: Ales Pospichal <ales@pospichalales.info> | ++-----------------------------------------------------------------------+ + +*/ + +$labels = array(); +$labels['addvcardmsg'] = 'Přidat vCard do adresáře'; +$labels['vcardsavefailed'] = 'Nelze uložit vCard'; + +?> diff --git a/plugins/vcard_attachments/localization/de_CH.inc b/plugins/vcard_attachments/localization/de_CH.inc new file mode 100644 index 000000000..48bb90013 --- /dev/null +++ b/plugins/vcard_attachments/localization/de_CH.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['addvcardmsg'] = 'Kontakt im Adressbuch speichern'; +$labels['vcardsavefailed'] = 'Der Kontakt konnte nicht gespeichert werden'; + +?>
\ No newline at end of file diff --git a/plugins/vcard_attachments/localization/de_DE.inc b/plugins/vcard_attachments/localization/de_DE.inc new file mode 100644 index 000000000..48bb90013 --- /dev/null +++ b/plugins/vcard_attachments/localization/de_DE.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['addvcardmsg'] = 'Kontakt im Adressbuch speichern'; +$labels['vcardsavefailed'] = 'Der Kontakt konnte nicht gespeichert werden'; + +?>
\ No newline at end of file diff --git a/plugins/vcard_attachments/localization/en_US.inc b/plugins/vcard_attachments/localization/en_US.inc new file mode 100644 index 000000000..bce44d739 --- /dev/null +++ b/plugins/vcard_attachments/localization/en_US.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['addvcardmsg'] = 'Add vCard to addressbook'; +$labels['vcardsavefailed'] = 'Unable to save vCard'; + +?>
\ No newline at end of file diff --git a/plugins/vcard_attachments/localization/es_ES.inc b/plugins/vcard_attachments/localization/es_ES.inc new file mode 100644 index 000000000..0aba6b391 --- /dev/null +++ b/plugins/vcard_attachments/localization/es_ES.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['addvcardmsg'] = 'Añadir la tarjeta a la libreta de direcciones'; +$labels['vcardsavefailed'] = 'No ha sido posible guardar la tarjeta'; + +?>
\ No newline at end of file diff --git a/plugins/vcard_attachments/localization/et_EE.inc b/plugins/vcard_attachments/localization/et_EE.inc new file mode 100644 index 000000000..eb6ce230f --- /dev/null +++ b/plugins/vcard_attachments/localization/et_EE.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['addvcardmsg'] = 'Lisa vCard aadressiraamatusse'; +$labels['vcardsavefailed'] = 'vCard salvestamine nurjus'; + +?> diff --git a/plugins/vcard_attachments/localization/gl_ES.inc b/plugins/vcard_attachments/localization/gl_ES.inc new file mode 100644 index 000000000..4c3574a8f --- /dev/null +++ b/plugins/vcard_attachments/localization/gl_ES.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['addvcardmsg'] = 'Engadir a tarxeta ao caderno de enderezos'; +$labels['vcardsavefailed'] = 'Non foi posible gardar a tarxeta'; + +?>
\ No newline at end of file diff --git a/plugins/vcard_attachments/localization/it_IT.inc b/plugins/vcard_attachments/localization/it_IT.inc new file mode 100644 index 000000000..55cde3961 --- /dev/null +++ b/plugins/vcard_attachments/localization/it_IT.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['addvcardmsg'] = 'Aggiungi vCard alla Agenda'; +$labels['vcardsavefailed'] = 'Abilita a salvare vCard'; + +?> diff --git a/plugins/vcard_attachments/localization/ja_JP.inc b/plugins/vcard_attachments/localization/ja_JP.inc new file mode 100644 index 000000000..0b4d0d91d --- /dev/null +++ b/plugins/vcard_attachments/localization/ja_JP.inc @@ -0,0 +1,9 @@ +<?php + +// EN-Revision: 3891 + +$labels = array(); +$labels['addvardmsg'] = 'アドレス帳に vCard を追加する'; +$labels['vcardsavefailed'] = 'vCard を保存できませんでした。'; + +?>
\ No newline at end of file diff --git a/plugins/vcard_attachments/localization/pl_PL.inc b/plugins/vcard_attachments/localization/pl_PL.inc new file mode 100644 index 000000000..800e35b38 --- /dev/null +++ b/plugins/vcard_attachments/localization/pl_PL.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['addvcardmsg'] = 'Dodaj wizytówkę (vCard) do kontaktów'; +$labels['vcardsavefailed'] = 'Nie można zapisać wizytówki (vCard)'; + +?> diff --git a/plugins/vcard_attachments/localization/pt_BR.inc b/plugins/vcard_attachments/localization/pt_BR.inc new file mode 100644 index 000000000..263f88442 --- /dev/null +++ b/plugins/vcard_attachments/localization/pt_BR.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['addvcardmsg'] = 'Adicionar o vCard ao Catálogo de Endereços'; +$labels['vcardsavefailed'] = 'Impossível salvar o vCard'; + +?>
\ No newline at end of file diff --git a/plugins/vcard_attachments/localization/ru_RU.inc b/plugins/vcard_attachments/localization/ru_RU.inc new file mode 100644 index 000000000..1688c5dc8 --- /dev/null +++ b/plugins/vcard_attachments/localization/ru_RU.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['addvcardmsg'] = 'Добавить в контакты'; +$labels['vcardsavefailed'] = 'Не удалось сохранить vCard'; + +?>
\ No newline at end of file diff --git a/plugins/vcard_attachments/localization/sv_SE.inc b/plugins/vcard_attachments/localization/sv_SE.inc new file mode 100644 index 000000000..4c9faddf9 --- /dev/null +++ b/plugins/vcard_attachments/localization/sv_SE.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['addvcardmsg'] = 'Lägg till vCard i adressbok'; +$labels['vcardsavefailed'] = 'Kunde inte spara vCard'; + +?>
\ No newline at end of file diff --git a/plugins/vcard_attachments/localization/zh_TW.inc b/plugins/vcard_attachments/localization/zh_TW.inc new file mode 100644 index 000000000..361837bfc --- /dev/null +++ b/plugins/vcard_attachments/localization/zh_TW.inc @@ -0,0 +1,7 @@ +<?php + +$labels = array(); +$labels['addvcardmsg'] = '加入 vCard 到通訊錄'; +$labels['vcardsavefailed'] = '無法儲存 vCard'; + +?>
\ No newline at end of file diff --git a/plugins/vcard_attachments/package.xml b/plugins/vcard_attachments/package.xml new file mode 100644 index 000000000..e5eaf7187 --- /dev/null +++ b/plugins/vcard_attachments/package.xml @@ -0,0 +1,100 @@ +<?xml version="1.0" encoding="UTF-8"?> +<package xmlns="http://pear.php.net/dtd/package-2.0" xmlns:tasks="http://pear.php.net/dtd/tasks-1.0" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" packagerversion="1.9.0" version="2.0" xsi:schemaLocation="http://pear.php.net/dtd/tasks-1.0 + http://pear.php.net/dtd/tasks-1.0.xsd + http://pear.php.net/dtd/package-2.0 + http://pear.php.net/dtd/package-2.0.xsd"> + <name>vcard_attachments</name> + <channel>pear.roundcube.net</channel> + <summary>vCard handler for Roundcube</summary> + <description>This plugin detects vCard attachments/bodies and shows a button(s) to add them to address book</description> + <lead> + <name>Thomas Bruederli</name> + <user>thomasb</user> + <email>roundcube@gmail.com</email> + <active>yes</active> + </lead> + <lead> + <name>Aleksander Machniak</name> + <user>alec</user> + <email>alec@alec.pl</email> + <active>yes</active> + </lead> + <date>2010-10-14</date> + <time>19:00</time> + <version> + <release>3.0</release> + <api>3.0</api> + </version> + <stability> + <release>stable</release> + <api>stable</api> + </stability> + <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license> + <notes> +- Exec contact_create hook when adding contact (#1486964) +- Make icons skinable +- Display vcard icon on messages list when message is of type vcard + </notes> + <contents> + <dir baseinstalldir="/" name="/"> + <file name="vcard_attachments.php" role="php"> + <tasks:replace from="@name@" to="name" type="package-info"/> + <tasks:replace from="@package_version@" to="version" type="package-info"/> + </file> + <file name="vcardattach.js" role="data"> + <tasks:replace from="@name@" to="name" type="package-info"/> + <tasks:replace from="@package_version@" to="version" type="package-info"/> + </file> + <file name="localization/cs_CZ.inc" role="data"></file> + <file name="localization/en_US.inc" role="data"></file> + <file name="localization/de_CH.inc" role="data"></file> + <file name="localization/de_DE.inc" role="data"></file> + <file name="localization/es_ES.inc" role="data"></file> + <file name="localization/et_EE.inc" role="data"></file> + <file name="localization/gl_ES.inc" role="data"></file> + <file name="localization/it_IT.inc" role="data"></file> + <file name="localization/ja_JP.inc" role="data"></file> + <file name="localization/es_ES.inc" role="data"></file> + <file name="localization/pl_PL.inc" role="data"></file> + <file name="localization/ru_RU.inc" role="data"></file> + <file name="localization/sv_SE.inc" role="data"></file> + <file name="localization/zh_TW.inc" role="data"></file> + <file name="skins/default/vcard_add_contact.png" role="data"></file> + <file name="skins/default/vcard.png" role="data"></file> + </dir> + <!-- / --> + </contents> + <dependencies> + <required> + <php> + <min>5.2.1</min> + </php> + <pearinstaller> + <min>1.7.0</min> + </pearinstaller> + </required> + </dependencies> + <phprelease/> + <changelog> + <release> + <date>2010-04-28</date> + <time>12:00:00</time> + <version> + <release>2.0</release> + <api>2.0</api> + </version> + <stability> + <release>stable</release> + <api>stable</api> + </stability> + <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license> + <notes> +- Added support for Content-Type: text/directory; profile=vCard +- Added handler for message bodies of type vCard (#1486683) +- Added support for more than one vCard attachment/body +- Added support for more than one contact in one vCard file +- Created package.xml + </notes> + </release> + </changelog> +</package> diff --git a/plugins/vcard_attachments/skins/default/vcard.png b/plugins/vcard_attachments/skins/default/vcard.png Binary files differnew file mode 100644 index 000000000..8bf6b1b72 --- /dev/null +++ b/plugins/vcard_attachments/skins/default/vcard.png diff --git a/plugins/vcard_attachments/skins/default/vcard_add_contact.png b/plugins/vcard_attachments/skins/default/vcard_add_contact.png Binary files differnew file mode 100644 index 000000000..478c1f3f2 --- /dev/null +++ b/plugins/vcard_attachments/skins/default/vcard_add_contact.png diff --git a/plugins/vcard_attachments/vcard_attachments.php b/plugins/vcard_attachments/vcard_attachments.php new file mode 100644 index 000000000..3fb3bf9ad --- /dev/null +++ b/plugins/vcard_attachments/vcard_attachments.php @@ -0,0 +1,184 @@ +<?php + +/** + * Detect VCard attachments and show a button to add them to address book + * + * @version @package_version@ + * @author Thomas Bruederli, Aleksander Machniak + */ +class vcard_attachments extends rcube_plugin +{ + public $task = 'mail'; + + private $message; + private $vcard_parts = array(); + private $vcard_bodies = array(); + + function init() + { + $rcmail = rcmail::get_instance(); + if ($rcmail->action == 'show' || $rcmail->action == 'preview') { + $this->add_hook('message_load', array($this, 'message_load')); + $this->add_hook('template_object_messagebody', array($this, 'html_output')); + } + else if (!$rcmail->output->framed && (!$rcmail->action || $rcmail->action == 'list')) { + $icon = 'plugins/vcard_attachments/' .$this->local_skin_path(). '/vcard.png'; + $rcmail->output->set_env('vcard_icon', $icon); + $this->include_script('vcardattach.js'); + } + + $this->register_action('plugin.savevcard', array($this, 'save_vcard')); + } + + /** + * Check message bodies and attachments for vcards + */ + function message_load($p) + { + $this->message = $p['object']; + + // handle attachments vcard attachments + foreach ((array)$this->message->attachments as $attachment) { + if ($this->is_vcard($attachment)) { + $this->vcard_parts[] = $attachment->mime_id; + } + } + // the same with message bodies + foreach ((array)$this->message->parts as $idx => $part) { + if ($this->is_vcard($part)) { + $this->vcard_parts[] = $part->mime_id; + $this->vcard_bodies[] = $part->mime_id; + } + } + + if ($this->vcard_parts) + $this->add_texts('localization'); + } + + /** + * This callback function adds a box below the message content + * if there is a vcard attachment available + */ + function html_output($p) + { + $attach_script = false; + $icon = 'plugins/vcard_attachments/' .$this->local_skin_path(). '/vcard_add_contact.png'; + + foreach ($this->vcard_parts as $part) { + $vcards = rcube_vcard::import($this->message->get_part_content($part)); + + // successfully parsed vcards? + if (empty($vcards)) + continue; + + // remove part's body + if (in_array($part, $this->vcard_bodies)) + $p['content'] = ''; + + $style = 'margin:0.5em 1em; padding:0.2em 0.5em; border:1px solid #999; ' + .'border-radius:4px; -moz-border-radius:4px; -webkit-border-radius:4px; width: auto'; + + foreach ($vcards as $idx => $vcard) { + $display = $vcard->displayname; + if ($vcard->email[0]) + $display .= ' <'.$vcard->email[0].'>'; + + // add box below messsage body + $p['content'] .= html::p(array('style' => $style), + html::a(array( + 'href' => "#", + 'onclick' => "return plugin_vcard_save_contact('".JQ($part.':'.$idx)."')", + 'title' => $this->gettext('addvcardmsg')), + html::img(array('src' => $icon, 'style' => "vertical-align:middle"))) + . ' ' . html::span(null, Q($display))); + } + + $attach_script = true; + } + + if ($attach_script) + $this->include_script('vcardattach.js'); + + return $p; + } + + /** + * Handler for request action + */ + function save_vcard() + { + $this->add_texts('localization', true); + + $uid = get_input_value('_uid', RCUBE_INPUT_POST); + $mbox = get_input_value('_mbox', RCUBE_INPUT_POST); + $mime_id = get_input_value('_part', RCUBE_INPUT_POST); + + $rcmail = rcmail::get_instance(); + + if ($uid && $mime_id) { + list($mime_id, $index) = explode(':', $mime_id); + $part = $rcmail->imap->get_message_part($uid, $mime_id); + } + + $error_msg = $this->gettext('vcardsavefailed'); + + if ($part && ($vcards = rcube_vcard::import($part)) + && ($vcard = $vcards[$index]) && $vcard->displayname && $vcard->email) { + + $contacts = $rcmail->get_address_book(null, true); + + // check for existing contacts + $existing = $contacts->search('email', $vcard->email[0], true, false); + if ($existing->count) { + $rcmail->output->command('display_message', $this->gettext('contactexists'), 'warning'); + } + else { + // add contact + $contact = array( + 'name' => $vcard->displayname, + 'firstname' => $vcard->firstname, + 'surname' => $vcard->surname, + 'email' => $vcard->email[0], + 'vcard' => $vcard->export(), + ); + + $plugin = $rcmail->plugins->exec_hook('contact_create', array('record' => $contact, 'source' => null)); + $contact = $plugin['record']; + + if (!$plugin['abort'] && ($done = $contacts->insert($contact))) + $rcmail->output->command('display_message', $this->gettext('addedsuccessfully'), 'confirmation'); + else + $rcmail->output->command('display_message', $error_msg, 'error'); + } + } + else + $rcmail->output->command('display_message', $error_msg, 'error'); + + $rcmail->output->send(); + } + + /** + * Checks if specified message part is a vcard data + * + * @param rcube_message_part Part object + * + * @return boolean True if part is of type vcard + */ + function is_vcard($part) + { + return ( + // Content-Type: text/vcard; + $part->mimetype == 'text/vcard' || + // Content-Type: text/x-vcard; + $part->mimetype == 'text/x-vcard' || + // Content-Type: text/directory; profile=vCard; + ($part->mimetype == 'text/directory' && ( + ($part->ctype_parameters['profile'] && + strtolower($part->ctype_parameters['profile']) == 'vcard') + // Content-Type: text/directory; (with filename=*.vcf) + || ($part->filename && preg_match('/\.vcf$/i', $part->filename)) + ) + ) + ); + } +} diff --git a/plugins/vcard_attachments/vcardattach.js b/plugins/vcard_attachments/vcardattach.js new file mode 100644 index 000000000..ef19190e7 --- /dev/null +++ b/plugins/vcard_attachments/vcardattach.js @@ -0,0 +1,23 @@ +/* + * vcard_attachments plugin script + * @version @package_version@ + */ +function plugin_vcard_save_contact(mime_id) +{ + var lock = rcmail.set_busy(true, 'loading'); + rcmail.http_post('plugin.savevcard', '_uid='+rcmail.env.uid+'&_mbox='+urlencode(rcmail.env.mailbox)+'&_part='+urlencode(mime_id), lock); + + return false; +} + +function plugin_vcard_insertrow(data) +{ + var ctype = data.row.ctype; + if (ctype == 'text/vcard' || ctype == 'text/x-vcard' || ctype == 'text/directory') { + $('#rcmrow'+data.uid+' > td.attachment').html('<img src="'+rcmail.env.vcard_icon+'" alt="">'); + } +} + +if (window.rcmail && rcmail.gui_objects.messagelist) { + rcmail.addEventListener('insertrow', function(data, evt) { plugin_vcard_insertrow(data); }); +} diff --git a/plugins/virtuser_file/virtuser_file.php b/plugins/virtuser_file/virtuser_file.php new file mode 100644 index 000000000..9d4efd12b --- /dev/null +++ b/plugins/virtuser_file/virtuser_file.php @@ -0,0 +1,106 @@ +<?php + +/** + * File based User-to-Email and Email-to-User lookup + * + * Add it to the plugins list in config/main.inc.php and set + * path to a virtuser table file to resolve user names and e-mail + * addresses + * $rcmail_config['virtuser_file'] = ''; + * + * @version 1.0 + * @author Aleksander Machniak + */ +class virtuser_file extends rcube_plugin +{ + private $file; + private $app; + + function init() + { + $this->app = rcmail::get_instance(); + $this->file = $this->app->config->get('virtuser_file'); + + if ($this->file) { + $this->add_hook('user2email', array($this, 'user2email')); + $this->add_hook('email2user', array($this, 'email2user')); + } + } + + /** + * User > Email + */ + function user2email($p) + { + $r = $this->findinvirtual('/\s' . preg_quote($p['user'], '/') . '\s*$/'); + $result = array(); + + for ($i=0; $i<count($r); $i++) + { + $arr = preg_split('/\s+/', $r[$i]); + + if (count($arr) > 0 && strpos($arr[0], '@')) { + $result[] = rcube_idn_to_ascii(trim(str_replace('\\@', '@', $arr[0]))); + + if ($p['first']) { + $p['email'] = $result[0]; + break; + } + } + } + + $p['email'] = empty($result) ? NULL : $result; + + return $p; + } + + /** + * Email > User + */ + function email2user($p) + { + $r = $this->findinvirtual('/^' . preg_quote($p['email'], '/') . '\s/'); + + for ($i=0; $i<count($r); $i++) { + $arr = preg_split('/\s+/', trim($r[$i])); + + if (count($arr) > 0) { + $p['user'] = trim($arr[count($arr)-1]); + break; + } + } + + return $p; + } + + /** + * Find matches of the given pattern in virtuser file + * + * @param string Regular expression to search for + * @return array Matching entries + */ + private function findinvirtual($pattern) + { + $result = array(); + $virtual = null; + + if ($this->file) + $virtual = file($this->file); + + if (empty($virtual)) + return $result; + + // check each line for matches + foreach ($virtual as $line) { + $line = trim($line); + if (empty($line) || $line[0]=='#') + continue; + + if (preg_match($pattern, $line)) + $result[] = $line; + } + + return $result; + } + +} diff --git a/plugins/virtuser_query/virtuser_query.php b/plugins/virtuser_query/virtuser_query.php new file mode 100644 index 000000000..e59095f29 --- /dev/null +++ b/plugins/virtuser_query/virtuser_query.php @@ -0,0 +1,117 @@ +<?php + +/** + * DB based User-to-Email and Email-to-User lookup + * + * Add it to the plugins list in config/main.inc.php and set + * SQL queries to resolve usernames, e-mail addresses and hostnames from the database + * %u will be replaced with the current username for login. + * %m will be replaced with the current e-mail address for login. + * + * Queries should select the user's e-mail address, username or the imap hostname as first column + * The email query could optionally select identity data columns in specified order: + * name, organization, reply-to, bcc, signature, html_signature + * + * $rcmail_config['virtuser_query'] = array('email' => '', 'user' => '', 'host' => ''); + * + * @version 1.1 + * @author Aleksander Machniak + * @author Steffen Vogel + */ +class virtuser_query extends rcube_plugin +{ + private $config; + private $app; + + function init() + { + $this->app = rcmail::get_instance(); + $this->config = $this->app->config->get('virtuser_query'); + + if (!empty($this->config)) { + if (is_string($this->config)) { + $this->config = array('email' => $this->config); + } + + if ($this->config['email']) { + $this->add_hook('user2email', array($this, 'user2email')); + } + if ($this->config['user']) { + $this->add_hook('email2user', array($this, 'email2user')); + } + if ($this->config['host']) { + $this->add_hook('authenticate', array($this, 'user2host')); + } + } + } + + /** + * User > Email + */ + function user2email($p) + { + $dbh = $this->app->get_dbh(); + + $sql_result = $dbh->query(preg_replace('/%u/', $dbh->escapeSimple($p['user']), $this->config['email'])); + + while ($sql_arr = $dbh->fetch_array($sql_result)) { + if (strpos($sql_arr[0], '@')) { + if ($p['extended'] && count($sql_arr) > 1) { + $result[] = array( + 'email' => rcube_idn_to_ascii($sql_arr[0]), + 'name' => $sql_arr[1], + 'organization' => $sql_arr[2], + 'reply-to' => rcube_idn_to_ascii($sql_arr[3]), + 'bcc' => rcube_idn_to_ascii($sql_arr[4]), + 'signature' => $sql_arr[5], + 'html_signature' => (int)$sql_arr[6], + ); + } + else { + $result[] = $sql_arr[0]; + } + + if ($p['first']) + break; + } + } + + $p['email'] = $result; + + return $p; + } + + /** + * EMail > User + */ + function email2user($p) + { + $dbh = $this->app->get_dbh(); + + $sql_result = $dbh->query(preg_replace('/%m/', $dbh->escapeSimple($p['email']), $this->config['user'])); + + if ($sql_arr = $dbh->fetch_array($sql_result)) { + $p['user'] = $sql_arr[0]; + } + + return $p; + } + + /** + * User > Host + */ + function user2host($p) + { + $dbh = $this->app->get_dbh(); + + $sql_result = $dbh->query(preg_replace('/%u/', $dbh->escapeSimple($p['user']), $this->config['host'])); + + if ($sql_arr = $dbh->fetch_array($sql_result)) { + $p['host'] = $sql_arr[0]; + } + + return $p; + } + +} + |
