summaryrefslogtreecommitdiff
path: root/plugins
diff options
context:
space:
mode:
Diffstat (limited to 'plugins')
-rw-r--r--plugins/acl/acl.js338
-rw-r--r--plugins/acl/acl.php695
-rw-r--r--plugins/acl/config.inc.php.dist19
-rw-r--r--plugins/acl/localization/en_US.inc83
-rw-r--r--plugins/acl/localization/pl_PL.inc83
-rw-r--r--plugins/acl/skins/default/acl.css94
-rw-r--r--plugins/acl/skins/default/images/enabled.pngbin0 -> 674 bytes
-rw-r--r--plugins/acl/skins/default/images/partial.pngbin0 -> 389 bytes
-rw-r--r--plugins/acl/skins/default/templates/table.html54
-rw-r--r--plugins/additional_message_headers/additional_message_headers.php43
-rw-r--r--plugins/additional_message_headers/config.inc.php.dist14
-rw-r--r--plugins/additional_message_headers/package.xml47
-rw-r--r--plugins/archive/archive.js34
-rw-r--r--plugins/archive/archive.php124
-rw-r--r--plugins/archive/localization/cs_CZ.inc25
-rw-r--r--plugins/archive/localization/de_CH.inc8
-rw-r--r--plugins/archive/localization/de_DE.inc8
-rw-r--r--plugins/archive/localization/en_US.inc8
-rw-r--r--plugins/archive/localization/es_AR.inc10
-rw-r--r--plugins/archive/localization/es_ES.inc10
-rw-r--r--plugins/archive/localization/et_EE.inc8
-rw-r--r--plugins/archive/localization/fr_FR.inc8
-rw-r--r--plugins/archive/localization/gl_ES.inc10
-rw-r--r--plugins/archive/localization/ja_JP.inc10
-rw-r--r--plugins/archive/localization/nl_NL.inc8
-rw-r--r--plugins/archive/localization/pl_PL.inc8
-rw-r--r--plugins/archive/localization/pt_BR.inc8
-rw-r--r--plugins/archive/localization/ru_RU.inc8
-rw-r--r--plugins/archive/localization/sv_SE.inc8
-rw-r--r--plugins/archive/localization/zh_TW.inc8
-rw-r--r--plugins/archive/package.xml64
-rw-r--r--plugins/archive/skins/default/archive_act.pngbin0 -> 3663 bytes
-rw-r--r--plugins/archive/skins/default/archive_pas.pngbin0 -> 977 bytes
-rw-r--r--plugins/archive/skins/default/foldericon.pngbin0 -> 3312 bytes
-rw-r--r--plugins/autologon/autologon.php47
-rw-r--r--plugins/database_attachments/database_attachments.php168
-rw-r--r--plugins/debug_logger/debug_logger.php146
-rw-r--r--plugins/debug_logger/runlog/runlog.php227
-rw-r--r--plugins/emoticons/emoticons.php77
-rw-r--r--plugins/enigma/README35
-rw-r--r--plugins/enigma/config.inc.php14
-rw-r--r--plugins/enigma/enigma.js206
-rw-r--r--plugins/enigma/enigma.php475
-rw-r--r--plugins/enigma/home/.htaccess2
-rw-r--r--plugins/enigma/lib/Crypt/GPG.php2542
-rw-r--r--plugins/enigma/lib/Crypt/GPG/DecryptStatusHandler.php336
-rw-r--r--plugins/enigma/lib/Crypt/GPG/Engine.php1758
-rw-r--r--plugins/enigma/lib/Crypt/GPG/Exceptions.php473
-rw-r--r--plugins/enigma/lib/Crypt/GPG/Key.php223
-rw-r--r--plugins/enigma/lib/Crypt/GPG/Signature.php428
-rw-r--r--plugins/enigma/lib/Crypt/GPG/SubKey.php649
-rw-r--r--plugins/enigma/lib/Crypt/GPG/UserId.php373
-rw-r--r--plugins/enigma/lib/Crypt/GPG/VerifyStatusHandler.php216
-rw-r--r--plugins/enigma/lib/enigma_driver.php106
-rw-r--r--plugins/enigma/lib/enigma_driver_gnupg.php305
-rw-r--r--plugins/enigma/lib/enigma_engine.php547
-rw-r--r--plugins/enigma/lib/enigma_error.php62
-rw-r--r--plugins/enigma/lib/enigma_key.php129
-rw-r--r--plugins/enigma/lib/enigma_signature.php34
-rw-r--r--plugins/enigma/lib/enigma_subkey.php57
-rw-r--r--plugins/enigma/lib/enigma_ui.php459
-rw-r--r--plugins/enigma/lib/enigma_userid.php31
-rw-r--r--plugins/enigma/localization/en_US.inc53
-rw-r--r--plugins/enigma/localization/ja_JP.inc55
-rw-r--r--plugins/enigma/localization/ru_RU.inc65
-rw-r--r--plugins/enigma/skins/default/enigma.css182
-rw-r--r--plugins/enigma/skins/default/enigma.pngbin0 -> 1592 bytes
-rw-r--r--plugins/enigma/skins/default/enigma_error.pngbin0 -> 1960 bytes
-rw-r--r--plugins/enigma/skins/default/key.pngbin0 -> 1743 bytes
-rw-r--r--plugins/enigma/skins/default/key_add.pngbin0 -> 1967 bytes
-rw-r--r--plugins/enigma/skins/default/keys_toolbar.pngbin0 -> 14977 bytes
-rw-r--r--plugins/enigma/skins/default/templates/keyimport.html20
-rw-r--r--plugins/enigma/skins/default/templates/keyinfo.html17
-rw-r--r--plugins/enigma/skins/default/templates/keys.html76
-rw-r--r--plugins/example_addressbook/example_addressbook.php50
-rw-r--r--plugins/example_addressbook/example_addressbook_backend.php116
-rw-r--r--plugins/filesystem_attachments/filesystem_attachments.php161
-rw-r--r--plugins/help/config.inc.php.dist5
-rw-r--r--plugins/help/content/about.html39
-rw-r--r--plugins/help/content/license.html387
-rw-r--r--plugins/help/help.php107
-rw-r--r--plugins/help/localization/cs_CZ.inc25
-rw-r--r--plugins/help/localization/da_DK.inc8
-rw-r--r--plugins/help/localization/de_DE.inc8
-rw-r--r--plugins/help/localization/en_GB.inc8
-rw-r--r--plugins/help/localization/en_US.inc8
-rw-r--r--plugins/help/localization/es_ES.inc8
-rw-r--r--plugins/help/localization/et_EE.inc8
-rw-r--r--plugins/help/localization/gl_ES.inc8
-rw-r--r--plugins/help/localization/hu_HU.inc8
-rw-r--r--plugins/help/localization/ja_JP.inc10
-rw-r--r--plugins/help/localization/pl_PL.inc8
-rw-r--r--plugins/help/localization/pt_BR.inc8
-rw-r--r--plugins/help/localization/ru_RU.inc23
-rw-r--r--plugins/help/localization/sv_SE.inc8
-rw-r--r--plugins/help/localization/zh_TW.inc8
-rw-r--r--plugins/help/skins/default/help.css29
-rw-r--r--plugins/help/skins/default/help.gifbin0 -> 898 bytes
-rw-r--r--plugins/help/skins/default/templates/help.html37
-rw-r--r--plugins/http_authentication/http_authentication.php45
-rw-r--r--plugins/jqueryui/README29
-rw-r--r--plugins/jqueryui/config.inc.php.dist11
-rw-r--r--plugins/jqueryui/jqueryui.php54
-rw-r--r--plugins/jqueryui/js/i18n/jquery-ui-i18n.js1242
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-af.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-ar.js24
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-az.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-bg.js24
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-bs.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-ca.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-cs.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-da.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-de-CH.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-de.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-el.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-en-GB.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-eo.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-es.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-et.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-eu.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-fa.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-fi.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-fo.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-fr-CH.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-fr.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-gl.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-he.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-hr.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-hu.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-hy.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-id.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-is.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-it.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-ja.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-ko.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-kz.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-lt.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-lv.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-ms.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-nl-BE.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-nl.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-no.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-pl.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-pt-BR.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-pt.js22
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-ro.js26
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-ru.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-sk.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-sl.js24
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-sq.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-sr-SR.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-sr.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-sv.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-ta.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-th.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-tr.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-uk.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-vi.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-zh-CN.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-zh-HK.js23
-rw-r--r--plugins/jqueryui/js/i18n/jquery.ui.datepicker-zh-TW.js23
-rwxr-xr-xplugins/jqueryui/js/jquery-ui-1.8.14.custom.min.js789
-rw-r--r--plugins/jqueryui/themes/default/images/buttongradient.pngbin0 -> 193 bytes
-rw-r--r--plugins/jqueryui/themes/default/images/listheader.pngbin0 -> 356 bytes
-rwxr-xr-xplugins/jqueryui/themes/default/images/ui-bg_flat_0_aaaaaa_40x100.pngbin0 -> 180 bytes
-rwxr-xr-xplugins/jqueryui/themes/default/images/ui-bg_flat_75_ffffff_40x100.pngbin0 -> 178 bytes
-rwxr-xr-xplugins/jqueryui/themes/default/images/ui-bg_flat_90_cc3333_40x100.pngbin0 -> 212 bytes
-rwxr-xr-xplugins/jqueryui/themes/default/images/ui-bg_glass_95_fef1ec_1x400.pngbin0 -> 119 bytes
-rwxr-xr-xplugins/jqueryui/themes/default/images/ui-bg_highlight-hard_90_a3a3a3_1x100.pngbin0 -> 114 bytes
-rwxr-xr-xplugins/jqueryui/themes/default/images/ui-bg_highlight-hard_90_e6e6e7_1x100.pngbin0 -> 101 bytes
-rwxr-xr-xplugins/jqueryui/themes/default/images/ui-bg_highlight-hard_90_f4f4f4_1x100.pngbin0 -> 122 bytes
-rwxr-xr-xplugins/jqueryui/themes/default/images/ui-icons_000000_256x240.pngbin0 -> 4369 bytes
-rwxr-xr-xplugins/jqueryui/themes/default/images/ui-icons_333333_256x240.pngbin0 -> 4369 bytes
-rwxr-xr-xplugins/jqueryui/themes/default/images/ui-icons_666666_256x240.pngbin0 -> 4369 bytes
-rwxr-xr-xplugins/jqueryui/themes/default/images/ui-icons_cc3333_256x240.pngbin0 -> 5355 bytes
-rwxr-xr-xplugins/jqueryui/themes/default/images/ui-icons_dddddd_256x240.pngbin0 -> 4369 bytes
-rwxr-xr-xplugins/jqueryui/themes/default/jquery-ui-1.8.14.custom.css580
-rw-r--r--plugins/jqueryui/themes/default/roundcube-custom.diff124
-rwxr-xr-xplugins/jqueryui/themes/redmond/images/ui-bg_flat_0_aaaaaa_40x100.pngbin0 -> 180 bytes
-rwxr-xr-xplugins/jqueryui/themes/redmond/images/ui-bg_flat_55_fbec88_40x100.pngbin0 -> 182 bytes
-rwxr-xr-xplugins/jqueryui/themes/redmond/images/ui-bg_glass_75_d0e5f5_1x400.pngbin0 -> 124 bytes
-rwxr-xr-xplugins/jqueryui/themes/redmond/images/ui-bg_glass_85_dfeffc_1x400.pngbin0 -> 123 bytes
-rwxr-xr-xplugins/jqueryui/themes/redmond/images/ui-bg_glass_95_fef1ec_1x400.pngbin0 -> 119 bytes
-rwxr-xr-xplugins/jqueryui/themes/redmond/images/ui-bg_gloss-wave_55_5c9ccc_500x100.pngbin0 -> 3457 bytes
-rwxr-xr-xplugins/jqueryui/themes/redmond/images/ui-bg_inset-hard_100_f5f8f9_1x100.pngbin0 -> 104 bytes
-rwxr-xr-xplugins/jqueryui/themes/redmond/images/ui-bg_inset-hard_100_fcfdfd_1x100.pngbin0 -> 88 bytes
-rwxr-xr-xplugins/jqueryui/themes/redmond/images/ui-icons_217bc0_256x240.pngbin0 -> 4369 bytes
-rwxr-xr-xplugins/jqueryui/themes/redmond/images/ui-icons_2e83ff_256x240.pngbin0 -> 4369 bytes
-rwxr-xr-xplugins/jqueryui/themes/redmond/images/ui-icons_469bdd_256x240.pngbin0 -> 4369 bytes
-rwxr-xr-xplugins/jqueryui/themes/redmond/images/ui-icons_6da8d5_256x240.pngbin0 -> 5355 bytes
-rwxr-xr-xplugins/jqueryui/themes/redmond/images/ui-icons_cd0a0a_256x240.pngbin0 -> 4369 bytes
-rwxr-xr-xplugins/jqueryui/themes/redmond/images/ui-icons_d8e7f3_256x240.pngbin0 -> 4369 bytes
-rwxr-xr-xplugins/jqueryui/themes/redmond/images/ui-icons_f9bd01_256x240.pngbin0 -> 4369 bytes
-rwxr-xr-xplugins/jqueryui/themes/redmond/jquery-ui-1.8.14.custom.css568
-rw-r--r--plugins/managesieve/Changelog196
-rw-r--r--plugins/managesieve/config.inc.php.dist53
-rw-r--r--plugins/managesieve/lib/Net/Sieve.php1274
-rw-r--r--plugins/managesieve/lib/rcube_sieve.php399
-rw-r--r--plugins/managesieve/lib/rcube_sieve_script.php731
-rw-r--r--plugins/managesieve/localization/bg_BG.inc50
-rw-r--r--plugins/managesieve/localization/cs_CZ.inc61
-rw-r--r--plugins/managesieve/localization/de_CH.inc52
-rw-r--r--plugins/managesieve/localization/de_DE.inc92
-rw-r--r--plugins/managesieve/localization/el_GR.inc56
-rw-r--r--plugins/managesieve/localization/en_GB.inc53
-rw-r--r--plugins/managesieve/localization/en_US.inc105
-rw-r--r--plugins/managesieve/localization/es_AR.inc81
-rw-r--r--plugins/managesieve/localization/es_ES.inc81
-rw-r--r--plugins/managesieve/localization/et_EE.inc53
-rw-r--r--plugins/managesieve/localization/fi_FI.inc68
-rw-r--r--plugins/managesieve/localization/fr_FR.inc63
-rw-r--r--plugins/managesieve/localization/gl_ES.inc81
-rw-r--r--plugins/managesieve/localization/hr_HR.inc105
-rw-r--r--plugins/managesieve/localization/hu_HU.inc54
-rw-r--r--plugins/managesieve/localization/it_IT.inc79
-rw-r--r--plugins/managesieve/localization/ja_JP.inc82
-rw-r--r--plugins/managesieve/localization/nb_NO.inc54
-rw-r--r--plugins/managesieve/localization/nl_NL.inc49
-rw-r--r--plugins/managesieve/localization/pl_PL.inc106
-rw-r--r--plugins/managesieve/localization/pt_BR.inc53
-rw-r--r--plugins/managesieve/localization/pt_PT.inc185
-rw-r--r--plugins/managesieve/localization/ru_RU.inc117
-rw-r--r--plugins/managesieve/localization/sk_SK.inc85
-rw-r--r--plugins/managesieve/localization/sl_SI.inc53
-rw-r--r--plugins/managesieve/localization/sv_SE.inc93
-rw-r--r--plugins/managesieve/localization/uk_UA.inc76
-rw-r--r--plugins/managesieve/localization/zh_CN.inc49
-rw-r--r--plugins/managesieve/localization/zh_TW.inc78
-rw-r--r--plugins/managesieve/managesieve.js581
-rw-r--r--plugins/managesieve/managesieve.php1211
-rw-r--r--plugins/managesieve/skins/default/managesieve.css296
-rw-r--r--plugins/managesieve/skins/default/managesieve_toolbar.pngbin0 -> 12093 bytes
-rw-r--r--plugins/managesieve/skins/default/templates/filteredit.html30
-rw-r--r--plugins/managesieve/skins/default/templates/managesieve.html54
-rw-r--r--plugins/managesieve/skins/default/templates/setedit.html24
-rw-r--r--plugins/managesieve/tests/Makefile7
-rw-r--r--plugins/managesieve/tests/parser.phpt114
-rw-r--r--plugins/managesieve/tests/tokenize.phpt66
-rw-r--r--plugins/markasjunk/localization/cs_CZ.inc24
-rw-r--r--plugins/markasjunk/localization/da_DK.inc7
-rw-r--r--plugins/markasjunk/localization/de_DE.inc6
-rw-r--r--plugins/markasjunk/localization/en_US.inc7
-rw-r--r--plugins/markasjunk/localization/es_AR.inc7
-rw-r--r--plugins/markasjunk/localization/es_ES.inc7
-rw-r--r--plugins/markasjunk/localization/et_EE.inc7
-rw-r--r--plugins/markasjunk/localization/gl_ES.inc7
-rw-r--r--plugins/markasjunk/localization/it_IT.inc7
-rw-r--r--plugins/markasjunk/localization/ja_JP.inc9
-rw-r--r--plugins/markasjunk/localization/pl_PL.inc7
-rw-r--r--plugins/markasjunk/localization/ru_RU.inc7
-rw-r--r--plugins/markasjunk/localization/sk_SK.inc15
-rw-r--r--plugins/markasjunk/localization/sv_SE.inc7
-rw-r--r--plugins/markasjunk/localization/zh_TW.inc7
-rw-r--r--plugins/markasjunk/markasjunk.js28
-rw-r--r--plugins/markasjunk/markasjunk.php58
-rw-r--r--plugins/markasjunk/package.xml67
-rw-r--r--plugins/markasjunk/skins/default/junk_act.pngbin0 -> 1995 bytes
-rw-r--r--plugins/markasjunk/skins/default/junk_pas.pngbin0 -> 1988 bytes
-rw-r--r--plugins/new_user_dialog/localization/cs_CZ.inc7
-rw-r--r--plugins/new_user_dialog/localization/de_CH.inc7
-rw-r--r--plugins/new_user_dialog/localization/de_DE.inc7
-rw-r--r--plugins/new_user_dialog/localization/en_US.inc7
-rw-r--r--plugins/new_user_dialog/localization/es_ES.inc7
-rw-r--r--plugins/new_user_dialog/localization/et_EE.inc7
-rw-r--r--plugins/new_user_dialog/localization/gl_ES.inc7
-rw-r--r--plugins/new_user_dialog/localization/it_IT.inc7
-rw-r--r--plugins/new_user_dialog/localization/ja_JP.inc9
-rw-r--r--plugins/new_user_dialog/localization/nl_NL.inc7
-rw-r--r--plugins/new_user_dialog/localization/pl_PL.inc7
-rw-r--r--plugins/new_user_dialog/localization/pt_BR.inc7
-rw-r--r--plugins/new_user_dialog/localization/pt_PT.inc7
-rw-r--r--plugins/new_user_dialog/localization/ru_RU.inc7
-rw-r--r--plugins/new_user_dialog/localization/sk_SK.inc16
-rw-r--r--plugins/new_user_dialog/localization/sl_SI.inc7
-rw-r--r--plugins/new_user_dialog/localization/sv_SE.inc7
-rw-r--r--plugins/new_user_dialog/localization/zh_TW.inc7
-rw-r--r--plugins/new_user_dialog/new_user_dialog.php128
-rw-r--r--plugins/new_user_dialog/newuserdialog.css59
-rw-r--r--plugins/new_user_dialog/package.xml139
-rw-r--r--plugins/new_user_identity/new_user_identity.php89
-rw-r--r--plugins/newmail_notifier/config.inc.php.dist9
-rw-r--r--plugins/newmail_notifier/favicon.icobin0 -> 1734 bytes
-rw-r--r--plugins/newmail_notifier/localization/en_US.inc6
-rw-r--r--plugins/newmail_notifier/localization/pl_PL.inc6
-rw-r--r--plugins/newmail_notifier/newmail_notifier.js64
-rw-r--r--plugins/newmail_notifier/newmail_notifier.php145
-rw-r--r--plugins/newmail_notifier/sound.wavbin0 -> 10444 bytes
-rw-r--r--plugins/password/README264
-rw-r--r--plugins/password/config.inc.php.dist303
-rw-r--r--plugins/password/drivers/chgsaslpasswd.c29
-rw-r--r--plugins/password/drivers/chgvirtualminpasswd.c28
-rw-r--r--plugins/password/drivers/chpass-wrapper.py32
-rw-r--r--plugins/password/drivers/chpasswd.php36
-rw-r--r--plugins/password/drivers/cpanel.php121
-rw-r--r--plugins/password/drivers/directadmin.php489
-rw-r--r--plugins/password/drivers/hmail.php61
-rw-r--r--plugins/password/drivers/ldap.php317
-rw-r--r--plugins/password/drivers/ldap_simple.php270
-rw-r--r--plugins/password/drivers/pam.php41
-rw-r--r--plugins/password/drivers/poppassd.php64
-rw-r--r--plugins/password/drivers/sasl.php44
-rw-r--r--plugins/password/drivers/sql.php152
-rw-r--r--plugins/password/drivers/virtualmin.php75
-rw-r--r--plugins/password/drivers/vpopmaild.php51
-rw-r--r--plugins/password/drivers/ximss.php81
-rw-r--r--plugins/password/drivers/xmail.php101
-rw-r--r--plugins/password/localization/az_AZ.inc24
-rw-r--r--plugins/password/localization/bg_BG.inc18
-rw-r--r--plugins/password/localization/ca_ES.inc20
-rw-r--r--plugins/password/localization/cs_CZ.inc30
-rw-r--r--plugins/password/localization/da_DK.inc18
-rw-r--r--plugins/password/localization/de_CH.inc19
-rw-r--r--plugins/password/localization/de_DE.inc19
-rw-r--r--plugins/password/localization/en_US.inc21
-rw-r--r--plugins/password/localization/es_AR.inc21
-rw-r--r--plugins/password/localization/es_ES.inc21
-rw-r--r--plugins/password/localization/et_EE.inc17
-rw-r--r--plugins/password/localization/fi_FI.inc22
-rw-r--r--plugins/password/localization/fr_FR.inc18
-rw-r--r--plugins/password/localization/gl_ES.inc21
-rw-r--r--plugins/password/localization/hr_HR.inc21
-rw-r--r--plugins/password/localization/hu_HU.inc17
-rw-r--r--plugins/password/localization/it_IT.inc21
-rw-r--r--plugins/password/localization/ja_JP.inc23
-rw-r--r--plugins/password/localization/lt_LT.inc21
-rw-r--r--plugins/password/localization/lv_LV.inc20
-rw-r--r--plugins/password/localization/nl_NL.inc17
-rw-r--r--plugins/password/localization/pl_PL.inc21
-rw-r--r--plugins/password/localization/pt_BR.inc21
-rw-r--r--plugins/password/localization/pt_PT.inc18
-rw-r--r--plugins/password/localization/ru_RU.inc35
-rw-r--r--plugins/password/localization/sk_SK.inc29
-rw-r--r--plugins/password/localization/sl_SI.inc18
-rw-r--r--plugins/password/localization/sv_SE.inc21
-rw-r--r--plugins/password/localization/tr_TR.inc21
-rw-r--r--plugins/password/localization/zh_TW.inc21
-rw-r--r--plugins/password/package.xml267
-rw-r--r--plugins/password/password.js37
-rw-r--r--plugins/password/password.php274
-rw-r--r--plugins/redundant_attachments/config.inc.php.dist13
-rw-r--r--plugins/redundant_attachments/redundant_attachments.php232
-rw-r--r--plugins/show_additional_headers/show_additional_headers.php52
-rw-r--r--plugins/squirrelmail_usercopy/config.inc.php.dist25
-rw-r--r--plugins/squirrelmail_usercopy/squirrelmail_usercopy.php190
-rw-r--r--plugins/subscriptions_option/localization/cs_CZ.inc23
-rw-r--r--plugins/subscriptions_option/localization/de_CH.inc6
-rw-r--r--plugins/subscriptions_option/localization/de_DE.inc6
-rw-r--r--plugins/subscriptions_option/localization/en_US.inc6
-rw-r--r--plugins/subscriptions_option/localization/es_ES.inc6
-rw-r--r--plugins/subscriptions_option/localization/et_EE.inc6
-rw-r--r--plugins/subscriptions_option/localization/gl_ES.inc6
-rw-r--r--plugins/subscriptions_option/localization/ja_JP.inc8
-rw-r--r--plugins/subscriptions_option/localization/pl_PL.inc6
-rw-r--r--plugins/subscriptions_option/localization/ru_RU.inc6
-rw-r--r--plugins/subscriptions_option/localization/sv_SE.inc6
-rw-r--r--plugins/subscriptions_option/localization/zh_TW.inc6
-rw-r--r--plugins/subscriptions_option/subscriptions_option.php92
-rw-r--r--plugins/userinfo/localization/cs_CZ.inc27
-rw-r--r--plugins/userinfo/localization/da_DK.inc9
-rw-r--r--plugins/userinfo/localization/de_CH.inc9
-rw-r--r--plugins/userinfo/localization/en_US.inc9
-rw-r--r--plugins/userinfo/localization/es_ES.inc9
-rw-r--r--plugins/userinfo/localization/et_EE.inc9
-rw-r--r--plugins/userinfo/localization/gl_ES.inc9
-rw-r--r--plugins/userinfo/localization/ja_JP.inc11
-rw-r--r--plugins/userinfo/localization/pl_PL.inc9
-rw-r--r--plugins/userinfo/localization/pt_BR.inc9
-rw-r--r--plugins/userinfo/localization/pt_PT.inc9
-rw-r--r--plugins/userinfo/localization/ru_RU.inc9
-rw-r--r--plugins/userinfo/localization/sv_SE.inc9
-rw-r--r--plugins/userinfo/localization/zh_TW.inc9
-rw-r--r--plugins/userinfo/userinfo.js16
-rw-r--r--plugins/userinfo/userinfo.php55
-rw-r--r--plugins/vcard_attachments/localization/cs_CZ.inc21
-rw-r--r--plugins/vcard_attachments/localization/de_CH.inc7
-rw-r--r--plugins/vcard_attachments/localization/de_DE.inc7
-rw-r--r--plugins/vcard_attachments/localization/en_US.inc7
-rw-r--r--plugins/vcard_attachments/localization/es_ES.inc7
-rw-r--r--plugins/vcard_attachments/localization/et_EE.inc7
-rw-r--r--plugins/vcard_attachments/localization/gl_ES.inc7
-rw-r--r--plugins/vcard_attachments/localization/it_IT.inc7
-rw-r--r--plugins/vcard_attachments/localization/ja_JP.inc9
-rw-r--r--plugins/vcard_attachments/localization/pl_PL.inc7
-rw-r--r--plugins/vcard_attachments/localization/pt_BR.inc7
-rw-r--r--plugins/vcard_attachments/localization/ru_RU.inc7
-rw-r--r--plugins/vcard_attachments/localization/sv_SE.inc7
-rw-r--r--plugins/vcard_attachments/localization/zh_TW.inc7
-rw-r--r--plugins/vcard_attachments/package.xml100
-rw-r--r--plugins/vcard_attachments/skins/default/vcard.pngbin0 -> 493 bytes
-rw-r--r--plugins/vcard_attachments/skins/default/vcard_add_contact.pngbin0 -> 1361 bytes
-rw-r--r--plugins/vcard_attachments/vcard_attachments.php184
-rw-r--r--plugins/vcard_attachments/vcardattach.js23
-rw-r--r--plugins/virtuser_file/virtuser_file.php106
-rw-r--r--plugins/virtuser_query/virtuser_query.php117
394 files changed, 31924 insertions, 0 deletions
diff --git a/plugins/acl/acl.js b/plugins/acl/acl.js
new file mode 100644
index 000000000..3cca7bf1e
--- /dev/null
+++ b/plugins/acl/acl.js
@@ -0,0 +1,338 @@
+/**
+ * ACL plugin script
+ *
+ * @version 0.5
+ * @author Aleksander Machniak <alec@alec.pl>
+ */
+
+if (window.rcmail) {
+ rcmail.addEventListener('init', function() {
+ if (rcmail.gui_objects.acltable) {
+ rcmail.acl_list_init();
+ // enable autocomplete on user input
+ if (rcmail.env.acl_users_source) {
+ rcmail.init_address_input_events($('#acluser'), {action:'plugin.acl-autocomplete'});
+ // fix inserted value
+ rcmail.addEventListener('autocomplete_insert', function(e) {
+ if (e.field.id != 'acluser')
+ return;
+
+ var value = e.insert;
+ // get UID from the entry value
+ if (value.match(/\s*\(([^)]+)\)[, ]*$/))
+ value = RegExp.$1;
+ e.field.value = value;
+ });
+ }
+ }
+
+ rcmail.enable_command('acl-create', 'acl-save', 'acl-cancel', 'acl-mode-switch', true);
+ rcmail.enable_command('acl-delete', 'acl-edit', false);
+ });
+}
+
+// Display new-entry form
+rcube_webmail.prototype.acl_create = function()
+{
+ this.acl_init_form();
+}
+
+// Display ACL edit form
+rcube_webmail.prototype.acl_edit = function()
+{
+ // @TODO: multi-row edition
+ var id = this.acl_list.get_single_selection();
+ if (id)
+ this.acl_init_form(id);
+}
+
+// ACL entry delete
+rcube_webmail.prototype.acl_delete = function()
+{
+ var users = this.acl_get_usernames();
+
+ if (users && users.length && confirm(this.get_label('acl.deleteconfirm'))) {
+ this.http_request('plugin.acl', '_act=delete&_user='+urlencode(users.join(','))
+ + '&_mbox='+urlencode(this.env.mailbox),
+ this.set_busy(true, 'acl.deleting'));
+ }
+}
+
+// Save ACL data
+rcube_webmail.prototype.acl_save = function()
+{
+ var user = $('#acluser').val(), rights = '', type;
+
+ $(':checkbox', this.env.acl_advanced ? $('#advancedrights') : sim_ul = $('#simplerights')).map(function() {
+ if (this.checked)
+ rights += this.value;
+ });
+
+ if (type = $('input:checked[name=usertype]').val()) {
+ if (type != 'user')
+ user = type;
+ }
+
+ if (!user) {
+ alert(this.get_label('acl.nouser'));
+ return;
+ }
+ if (!rights) {
+ alert(this.get_label('acl.norights'));
+ return;
+ }
+
+ this.http_request('plugin.acl', '_act=save'
+ + '&_user='+urlencode(user)
+ + '&_acl=' +rights
+ + '&_mbox='+urlencode(this.env.mailbox)
+ + (this.acl_id ? '&_old='+this.acl_id : ''),
+ this.set_busy(true, 'acl.saving'));
+}
+
+// Cancel/Hide form
+rcube_webmail.prototype.acl_cancel = function()
+{
+ this.ksearch_blur();
+ this.acl_form.hide();
+}
+
+// Update data after save (and hide form)
+rcube_webmail.prototype.acl_update = function(o)
+{
+ // delete old row
+ if (o.old)
+ this.acl_remove_row(o.old);
+ // make sure the same ID doesn't exist
+ else if (this.env.acl[o.id])
+ this.acl_remove_row(o.id);
+
+ // add new row
+ this.acl_add_row(o, true);
+ // hide autocomplete popup
+ this.ksearch_blur();
+ // hide form
+ this.acl_form.hide();
+}
+
+// Switch table display mode
+rcube_webmail.prototype.acl_mode_switch = function(elem)
+{
+ this.env.acl_advanced = !this.env.acl_advanced;
+ this.enable_command('acl-delete', 'acl-edit', false);
+ this.http_request('plugin.acl', '_act=list'
+ + '&_mode='+(this.env.acl_advanced ? 'advanced' : 'simple')
+ + '&_mbox='+urlencode(this.env.mailbox),
+ this.set_busy(true, 'loading'));
+}
+
+// ACL table initialization
+rcube_webmail.prototype.acl_list_init = function()
+{
+ this.acl_list = new rcube_list_widget(this.gui_objects.acltable,
+ {multiselect:true, draggable:false, keyboard:true, toggleselect:true});
+ this.acl_list.addEventListener('select', function(o) { rcmail.acl_list_select(o); });
+ this.acl_list.addEventListener('dblclick', function(o) { rcmail.acl_list_dblclick(o); });
+ this.acl_list.addEventListener('keypress', function(o) { rcmail.acl_list_keypress(o); });
+ this.acl_list.init();
+}
+
+// ACL table row selection handler
+rcube_webmail.prototype.acl_list_select = function(list)
+{
+ rcmail.enable_command('acl-delete', list.selection.length > 0);
+ rcmail.enable_command('acl-edit', list.selection.length == 1);
+ list.focus();
+}
+
+// ACL table double-click handler
+rcube_webmail.prototype.acl_list_dblclick = function(list)
+{
+ this.acl_edit();
+}
+
+// ACL table keypress handler
+rcube_webmail.prototype.acl_list_keypress = function(list)
+{
+ if (list.key_pressed == list.ENTER_KEY)
+ this.command('acl-edit');
+ else if (list.key_pressed == list.DELETE_KEY || list.key_pressed == list.BACKSPACE_KEY)
+ if (!this.acl_form || !this.acl_form.is(':visible'))
+ this.command('acl-delete');
+}
+
+// Reloads ACL table
+rcube_webmail.prototype.acl_list_update = function(html)
+{
+ $(this.gui_objects.acltable).html(html);
+ this.acl_list_init();
+}
+
+// Returns names of users in selected rows
+rcube_webmail.prototype.acl_get_usernames = function()
+{
+ var users = [], n, len, cell, row,
+ list = this.acl_list,
+ selection = list.get_selection();
+
+ for (n=0, len=selection.length; n<len; n++) {
+ if (this.env.acl_specials.length && $.inArray(selection[n], this.env.acl_specials) >= 0) {
+ users.push(selection[n]);
+ }
+ else {
+ row = list.rows[selection[n]].obj;
+ cell = $('td.user', row);
+ if (cell.length == 1)
+ users.push(cell.text());
+ }
+ }
+
+ return users;
+}
+
+// Removes ACL table row
+rcube_webmail.prototype.acl_remove_row = function(id)
+{
+ this.acl_list.remove_row(id);
+ // we don't need it anymore (remove id conflict)
+ $('#rcmrow'+id).remove();
+ this.env.acl[id] = null;
+}
+
+// Adds ACL table row
+rcube_webmail.prototype.acl_add_row = function(o, sel)
+{
+ var n, len, ids = [], spec = [], id = o.id, list = this.acl_list,
+ items = this.env.acl_advanced ? [] : this.env.acl_items,
+ table = this.gui_objects.acltable,
+ row = $('thead > tr', table).clone();
+
+ // Update new row
+ $('td', row).map(function() {
+ var r, cl = this.className.replace(/^acl/, '');
+
+ if (items && items[cl])
+ cl = items[cl];
+
+ if (cl == 'user')
+ $(this).text(o.username);
+ else
+ $(this).addClass(rcmail.acl_class(o.acl, cl)).text('');
+ });
+
+ row.attr('id', 'rcmrow'+id);
+ row = row.get(0);
+
+ this.env.acl[id] = o.acl;
+
+ // sorting... (create an array of user identifiers, then sort it)
+ for (n in this.env.acl) {
+ if (this.env.acl[n]) {
+ if (this.env.acl_specials.length && $.inArray(n, this.env.acl_specials) >= 0)
+ spec.push(n);
+ else
+ ids.push(n);
+ }
+ }
+ ids.sort();
+ // specials on the top
+ ids = spec.concat(ids);
+
+ // find current id
+ for (n=0, len=ids.length; n<len; n++)
+ if (ids[n] == id)
+ break;
+
+ // add row
+ if (n && n < len) {
+ $('#rcmrow'+ids[n-1]).after(row);
+ list.init_row(row);
+ list.rowcount++;
+ }
+ else
+ list.insert_row(row);
+
+ if (sel)
+ list.select_row(o.id);
+}
+
+// Initializes and shows ACL create/edit form
+rcube_webmail.prototype.acl_init_form = function(id)
+{
+ var ul, row, val = '', type = 'user', li_elements, body = $('body'),
+ adv_ul = $('#advancedrights'), sim_ul = $('#simplerights'),
+ name_input = $('#acluser');
+
+ if (!this.acl_form) {
+ var fn = function () { $('input[value=user]').prop('checked', true); };
+ name_input.click(fn).keypress(fn);
+ }
+
+ this.acl_form = $('#aclform');
+
+ // Hide unused items
+ if (this.env.acl_advanced) {
+ adv_ul.show();
+ sim_ul.hide();
+ ul = adv_ul;
+ }
+ else {
+ sim_ul.show();
+ adv_ul.hide();
+ ul = sim_ul;
+ }
+
+ // initialize form fields
+ li_elements = $(':checkbox', ul);
+ li_elements.attr('checked', false);
+
+ if (id) {
+ row = this.acl_list.rows[id].obj;
+ li_elements.map(function() {
+ var val = this.value, td = $('td.'+this.id, row);
+ if (td && td.hasClass('enabled'))
+ this.checked = true;
+ });
+
+ if (!this.env.acl_specials.length || $.inArray(id, this.env.acl_specials) < 0)
+ val = $('td.user', row).text();
+ else
+ type = id;
+ }
+
+ name_input.val(val);
+ $('input[value='+type+']').prop('checked', true);
+
+ this.acl_id = id;
+
+ // position the form horizontally
+ var bw = body.width(), mw = this.acl_form.width();
+
+ if (bw >= mw)
+ this.acl_form.css({left: parseInt((bw - mw)/2)+'px'});
+
+ // display it
+ this.acl_form.show();
+ if (type == 'user')
+ name_input.focus();
+}
+
+// Returns class name according to ACL comparision result
+rcube_webmail.prototype.acl_class = function(acl1, acl2)
+{
+ var i, len, found = 0;
+
+ acl1 = String(acl1);
+ acl2 = String(acl2);
+
+ for (i=0, len=acl2.length; i<len; i++)
+ if (acl1.indexOf(acl2[i]) > -1)
+ found++;
+
+ if (found == len)
+ return 'enabled';
+ else if (found)
+ return 'partial';
+
+ return 'disabled';
+}
diff --git a/plugins/acl/acl.php b/plugins/acl/acl.php
new file mode 100644
index 000000000..33f84dbc3
--- /dev/null
+++ b/plugins/acl/acl.php
@@ -0,0 +1,695 @@
+<?php
+
+/**
+ * Folders Access Control Lists Management (RFC4314, RFC2086)
+ *
+ * @version 0.5
+ * @author Aleksander Machniak <alec@alec.pl>
+ *
+ *
+ * Copyright (C) 2011, Kolab Systems AG
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2
+ * as published by the Free Software Foundation.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License along
+ * with this program; if not, write to the Free Software Foundation, Inc.,
+ * 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+ */
+
+class acl extends rcube_plugin
+{
+ public $task = 'settings|addressbook';
+
+ private $rc;
+ private $supported = null;
+ private $mbox;
+ private $ldap;
+ private $specials = array('anyone', 'anonymous');
+
+ /**
+ * Plugin initialization
+ */
+ function init()
+ {
+ $this->rc = rcmail::get_instance();
+
+ // Register hooks
+ $this->add_hook('folder_form', array($this, 'folder_form'));
+ // kolab_addressbook plugin
+ $this->add_hook('addressbook_form', array($this, 'folder_form'));
+ // Plugin actions
+ $this->register_action('plugin.acl', array($this, 'acl_actions'));
+ $this->register_action('plugin.acl-autocomplete', array($this, 'acl_autocomplete'));
+ }
+
+ /**
+ * Handler for plugin actions (AJAX)
+ */
+ function acl_actions()
+ {
+ $action = trim(get_input_value('_act', RCUBE_INPUT_GPC));
+
+ // Connect to IMAP
+ $this->rc->imap_init();
+ $this->rc->imap_connect();
+
+ // Load localization and configuration
+ $this->add_texts('localization/');
+ $this->load_config();
+
+ if ($action == 'save') {
+ $this->action_save();
+ }
+ else if ($action == 'delete') {
+ $this->action_delete();
+ }
+ else if ($action == 'list') {
+ $this->action_list();
+ }
+
+ // Only AJAX actions
+ $this->rc->output->send();
+ }
+
+ /**
+ * Handler for user login autocomplete request
+ */
+ function acl_autocomplete()
+ {
+ $this->load_config();
+
+ $search = get_input_value('_search', RCUBE_INPUT_GPC, true);
+ $users = array();
+
+ if ($this->init_ldap()) {
+ $this->ldap->set_pagesize(15);
+ $result = $this->ldap->search('*', $search);
+
+ foreach ($result->records as $record) {
+ $user = $record['uid'];
+
+ if (is_array($user)) {
+ $user = array_filter($user);
+ $user = $user[0];
+ }
+
+ if ($user) {
+ if ($record['name'])
+ $user = $record['name'] . ' (' . $user . ')';
+
+ $users[] = $user;
+ }
+ }
+ }
+
+ sort($users, SORT_LOCALE_STRING);
+
+ $this->rc->output->command('ksearch_query_results', $users, $search);
+ $this->rc->output->send();
+ }
+
+ /**
+ * Handler for 'folder_form' hook
+ *
+ * @param array $args Hook arguments array (form data)
+ *
+ * @return array Hook arguments array
+ */
+ function folder_form($args)
+ {
+ // Edited folder name (empty in create-folder mode)
+ $mbox_imap = $args['options']['name'];
+ if (!strlen($mbox_imap)) {
+ return $args;
+ }
+/*
+ // Do nothing on protected folders (?)
+ if ($args['options']['protected']) {
+ return $args;
+ }
+*/
+ // Namespace root
+ if ($args['options']['is_root']) {
+ return $args;
+ }
+
+ // Get MYRIGHTS
+ if (!($myrights = $args['options']['rights'])) {
+ return $args;
+ }
+
+ // Do nothing if no ACL support
+ if (!$this->rc->imap->get_capability('ACL')) {
+ return $args;
+ }
+
+ // Load localization and include scripts
+ $this->load_config();
+ $this->add_texts('localization/', array('deleteconfirm', 'norights',
+ 'nouser', 'deleting', 'saving'));
+ $this->include_script('acl.js');
+ $this->rc->output->include_script('list.js');
+ $this->include_stylesheet($this->local_skin_path().'/acl.css');
+
+ // add Info fieldset if it doesn't exist
+ if (!isset($args['form']['props']['fieldsets']['info']))
+ $args['form']['props']['fieldsets']['info'] = array(
+ 'name' => rcube_label('info'),
+ 'content' => array());
+
+ // Display folder rights to 'Info' fieldset
+ $args['form']['props']['fieldsets']['info']['content']['myrights'] = array(
+ 'label' => Q($this->gettext('myrights')),
+ 'value' => $this->acl2text($myrights)
+ );
+
+ // Return if not folder admin
+ if (!in_array('a', $myrights)) {
+ return $args;
+ }
+
+ // The 'Sharing' tab
+ $this->mbox = $mbox_imap;
+ $this->rc->output->set_env('acl_users_source', (bool) $this->rc->config->get('acl_users_source'));
+ $this->rc->output->set_env('mailbox', $mbox_imap);
+ $this->rc->output->add_handlers(array(
+ 'acltable' => array($this, 'templ_table'),
+ 'acluser' => array($this, 'templ_user'),
+ 'aclrights' => array($this, 'templ_rights'),
+ ));
+
+ $args['form']['sharing'] = array(
+ 'name' => Q($this->gettext('sharing')),
+ 'content' => $this->rc->output->parse('acl.table', false, false),
+ );
+
+ return $args;
+ }
+
+ /**
+ * Creates ACL rights table
+ *
+ * @param array $attrib Template object attributes
+ *
+ * @return string HTML Content
+ */
+ function templ_table($attrib)
+ {
+ if (empty($attrib['id']))
+ $attrib['id'] = 'acl-table';
+
+ $out = $this->list_rights($attrib);
+
+ $this->rc->output->add_gui_object('acltable', $attrib['id']);
+
+ return $out;
+ }
+
+ /**
+ * Creates ACL rights form (rights list part)
+ *
+ * @param array $attrib Template object attributes
+ *
+ * @return string HTML Content
+ */
+ function templ_rights($attrib)
+ {
+ // Get supported rights
+ $supported = $this->rights_supported();
+
+ // depending on server capability either use 'te' or 'd' for deleting msgs
+ $deleteright = implode(array_intersect(str_split('ted'), $supported));
+
+ $out = '';
+ $ul = '';
+ $input = new html_checkbox();
+
+ // Advanced rights
+ $attrib['id'] = 'advancedrights';
+ foreach ($supported as $val) {
+ $id = "acl$val";
+ $ul .= html::tag('li', null,
+ $input->show('', array(
+ 'name' => "acl[$val]", 'value' => $val, 'id' => $id))
+ . html::label(array('for' => $id, 'title' => $this->gettext('longacl'.$val)),
+ $this->gettext('acl'.$val)));
+ }
+
+ $out = html::tag('ul', $attrib, $ul, html::$common_attrib);
+
+ // Simple rights
+ $ul = '';
+ $attrib['id'] = 'simplerights';
+ $items = array(
+ 'read' => 'lrs',
+ 'write' => 'wi',
+ 'delete' => $deleteright,
+ 'other' => preg_replace('/[lrswi'.$deleteright.']/', '', implode($supported)),
+ );
+
+ foreach ($items as $key => $val) {
+ $id = "acl$key";
+ $ul .= html::tag('li', null,
+ $input->show('', array(
+ 'name' => "acl[$val]", 'value' => $val, 'id' => $id))
+ . html::label(array('for' => $id, 'title' => $this->gettext('longacl'.$key)),
+ $this->gettext('acl'.$key)));
+ }
+
+ $out .= "\n" . html::tag('ul', $attrib, $ul, html::$common_attrib);
+
+ $this->rc->output->set_env('acl_items', $items);
+
+ return $out;
+ }
+
+ /**
+ * Creates ACL rights form (user part)
+ *
+ * @param array $attrib Template object attributes
+ *
+ * @return string HTML Content
+ */
+ function templ_user($attrib)
+ {
+ // Create username input
+ $attrib['name'] = 'acluser';
+
+ $textfield = new html_inputfield($attrib);
+
+ $fields['user'] = html::label(array('for' => 'iduser'), $this->gettext('username'))
+ . ' ' . $textfield->show();
+
+ // Add special entries
+ if (!empty($this->specials)) {
+ foreach ($this->specials as $key) {
+ $fields[$key] = html::label(array('for' => 'id'.$key), $this->gettext($key));
+ }
+ }
+
+ $this->rc->output->set_env('acl_specials', $this->specials);
+
+ // Create list with radio buttons
+ if (count($fields) > 1) {
+ $ul = '';
+ $radio = new html_radiobutton(array('name' => 'usertype'));
+ foreach ($fields as $key => $val) {
+ $ul .= html::tag('li', null, $radio->show($key == 'user' ? 'user' : '',
+ array('value' => $key, 'id' => 'id'.$key))
+ . $val);
+ }
+
+ $out = html::tag('ul', array('id' => 'usertype'), $ul, html::$common_attrib);
+ }
+ // Display text input alone
+ else {
+ $out = $fields['user'];
+ }
+
+ return $out;
+ }
+
+ /**
+ * Creates ACL rights table
+ *
+ * @param array $attrib Template object attributes
+ *
+ * @return string HTML Content
+ */
+ private function list_rights($attrib=array())
+ {
+ // Get ACL for the folder
+ $acl = $this->rc->imap->get_acl($this->mbox);
+
+ if (!is_array($acl)) {
+ $acl = array();
+ }
+
+ // Keep special entries (anyone/anonymous) on top of the list
+ if (!empty($this->specials) && !empty($acl)) {
+ foreach ($this->specials as $key) {
+ if (isset($acl[$key])) {
+ $acl_special[$key] = $acl[$key];
+ unset($acl[$key]);
+ }
+ }
+ }
+
+ // Sort the list by username
+ uksort($acl, 'strnatcasecmp');
+
+ if (!empty($acl_special)) {
+ $acl = array_merge($acl_special, $acl);
+ }
+
+ // Get supported rights and build column names
+ $supported = $this->rights_supported();
+
+ // depending on server capability either use 'te' or 'd' for deleting msgs
+ $deleteright = implode(array_intersect(str_split('ted'), $supported));
+
+ // Use advanced or simple (grouped) rights
+ $advanced = $this->rc->config->get('acl_advanced_mode');
+
+ if ($advanced) {
+ $items = array();
+ foreach ($supported as $sup) {
+ $items[$sup] = $sup;
+ }
+ }
+ else {
+ $items = array(
+ 'read' => 'lrs',
+ 'write' => 'wi',
+ 'delete' => $deleteright,
+ 'other' => preg_replace('/[lrswi'.$deleteright.']/', '', implode($supported)),
+ );
+ }
+
+ // Create the table
+ $attrib['noheader'] = true;
+ $table = new html_table($attrib);
+
+ // Create table header
+ $table->add_header('user', $this->gettext('identifier'));
+ foreach (array_keys($items) as $key) {
+ $table->add_header('acl'.$key, $this->gettext('shortacl'.$key));
+ }
+
+ $i = 1;
+ $js_table = array();
+ foreach ($acl as $user => $rights) {
+ if ($this->rc->imap->conn->user == $user) {
+ continue;
+ }
+
+ // filter out virtual rights (c or d) the server may return
+ $userrights = array_intersect($rights, $supported);
+ $userid = html_identifier($user);
+
+ if (!empty($this->specials) && in_array($user, $this->specials)) {
+ $user = $this->gettext($user);
+ }
+
+ $table->add_row(array('id' => 'rcmrow'.$userid));
+ $table->add('user', Q($user));
+
+ foreach ($items as $key => $right) {
+ $in = $this->acl_compare($userrights, $right);
+ switch ($in) {
+ case 2: $class = 'enabled'; break;
+ case 1: $class = 'partial'; break;
+ default: $class = 'disabled'; break;
+ }
+ $table->add('acl' . $key . ' ' . $class, '');
+ }
+
+ $js_table[$userid] = implode($userrights);
+ }
+
+ $this->rc->output->set_env('acl', $js_table);
+ $this->rc->output->set_env('acl_advanced', $advanced);
+
+ $out = $table->show();
+
+ return $out;
+ }
+
+ /**
+ * Handler for ACL update/create action
+ */
+ private function action_save()
+ {
+ $mbox = trim(get_input_value('_mbox', RCUBE_INPUT_GPC, true, 'UTF7-IMAP'));
+ $user = trim(get_input_value('_user', RCUBE_INPUT_GPC));
+ $acl = trim(get_input_value('_acl', RCUBE_INPUT_GPC));
+ $oldid = trim(get_input_value('_old', RCUBE_INPUT_GPC));
+
+ $acl = array_intersect(str_split($acl), $this->rights_supported());
+
+ if (!empty($this->specials) && in_array($user, $this->specials)) {
+ $username = $this->gettext($user);
+ }
+ else {
+ if (!strpos($user, '@') && ($realm = $this->get_realm())) {
+ $user .= '@' . rcube_idn_to_ascii(preg_replace('/^@/', '', $realm));
+ }
+ $username = $user;
+ }
+
+ if ($acl && $user && $user != $_SESSION['username'] && strlen($mbox)) {
+ $result = $this->rc->imap->set_acl($mbox, $user, $acl);
+ }
+
+ if ($result) {
+ $ret = array('id' => html_identifier($user),
+ 'username' => $username, 'acl' => implode($acl), 'old' => $oldid);
+ $this->rc->output->command('acl_update', $ret);
+ $this->rc->output->show_message($oldid ? 'acl.updatesuccess' : 'acl.createsuccess', 'confirmation');
+ }
+ else {
+ $this->rc->output->show_message($oldid ? 'acl.updateerror' : 'acl.createerror', 'error');
+ }
+ }
+
+ /**
+ * Handler for ACL delete action
+ */
+ private function action_delete()
+ {
+ $mbox = trim(get_input_value('_mbox', RCUBE_INPUT_GPC, true, 'UTF7-IMAP'));
+ $user = trim(get_input_value('_user', RCUBE_INPUT_GPC));
+
+ $user = explode(',', $user);
+
+ foreach ($user as $u) {
+ if ($this->rc->imap->delete_acl($mbox, $u)) {
+ $this->rc->output->command('acl_remove_row', html_identifier($u));
+ }
+ else {
+ $error = true;
+ }
+ }
+
+ if (!$error) {
+ $this->rc->output->show_message('acl.deletesuccess', 'confirmation');
+ }
+ else {
+ $this->rc->output->show_message('acl.deleteerror', 'error');
+ }
+ }
+
+ /**
+ * Handler for ACL list update action (with display mode change)
+ */
+ private function action_list()
+ {
+ if (in_array('acl_advanced_mode', (array)$this->rc->config->get('dont_override'))) {
+ return;
+ }
+
+ $this->mbox = trim(get_input_value('_mbox', RCUBE_INPUT_GPC, true, 'UTF7-IMAP'));
+ $advanced = trim(get_input_value('_mode', RCUBE_INPUT_GPC));
+ $advanced = $advanced == 'advanced' ? true : false;
+
+ // Save state in user preferences
+ $this->rc->user->save_prefs(array('acl_advanced_mode' => $advanced));
+
+ $out = $this->list_rights();
+
+ $out = preg_replace(array('/^<table[^>]+>/', '/<\/table>$/'), '', $out);
+
+ $this->rc->output->command('acl_list_update', $out);
+ }
+
+ /**
+ * Creates <UL> list with descriptive access rights
+ *
+ * @param array $rights MYRIGHTS result
+ *
+ * @return string HTML content
+ */
+ function acl2text($rights)
+ {
+ if (empty($rights)) {
+ return '';
+ }
+
+ $supported = $this->rights_supported();
+ $list = array();
+ $attrib = array(
+ 'name' => 'rcmyrights',
+ 'style' => 'padding: 0 15px;',
+ );
+
+ foreach ($supported as $right) {
+ if (in_array($right, $rights)) {
+ $list[] = html::tag('li', null, Q($this->gettext('acl' . $right)));
+ }
+ }
+
+ if (count($list) == count($supported))
+ return Q($this->gettext('aclfull'));
+
+ return html::tag('ul', $attrib, implode("\n", $list));
+ }
+
+ /**
+ * Compares two ACLs (according to supported rights)
+ *
+ * @param array $acl1 ACL rights array (or string)
+ * @param array $acl2 ACL rights array (or string)
+ *
+ * @param int Comparision result, 2 - full match, 1 - partial match, 0 - no match
+ */
+ function acl_compare($acl1, $acl2)
+ {
+ if (!is_array($acl1)) $acl1 = str_split($acl1);
+ if (!is_array($acl2)) $acl2 = str_split($acl2);
+
+ $rights = $this->rights_supported();
+
+ $acl1 = array_intersect($acl1, $rights);
+ $acl2 = array_intersect($acl2, $rights);
+ $res = array_intersect($acl1, $acl2);
+
+ $cnt1 = count($res);
+ $cnt2 = count($acl2);
+
+ if ($cnt1 == $cnt2)
+ return 2;
+ else if ($cnt1)
+ return 1;
+ else
+ return 0;
+ }
+
+ /**
+ * Get list of supported access rights (according to RIGHTS capability)
+ *
+ * @return array List of supported access rights abbreviations
+ */
+ function rights_supported()
+ {
+ if ($this->supported !== null) {
+ return $this->supported;
+ }
+
+ $capa = $this->rc->imap->get_capability('RIGHTS');
+
+ if (is_array($capa)) {
+ $rights = strtolower($capa[0]);
+ }
+ else {
+ $rights = 'cd';
+ }
+
+ return $this->supported = str_split('lrswi' . $rights . 'pa');
+ }
+
+ /**
+ * Username realm detection.
+ *
+ * @return string Username realm (domain)
+ */
+ private function get_realm()
+ {
+ // When user enters a username without domain part, realm
+ // alows to add it to the username (and display correct username in the table)
+
+ if (isset($_SESSION['acl_username_realm'])) {
+ return $_SESSION['acl_username_realm'];
+ }
+
+ // find realm in username of logged user (?)
+ list($name, $domain) = explode('@', $_SESSION['username']);
+
+ // Use (always existent) ACL entry on the INBOX for the user to determine
+ // whether or not the user ID in ACL entries need to be qualified and how
+ // they would need to be qualified.
+ if (empty($domain)) {
+ $acl = $this->rc->imap->get_acl('INBOX');
+ if (is_array($acl)) {
+ $regexp = '/^' . preg_quote($_SESSION['username'], '/') . '@(.*)$/';
+ $regexp = '/^' . preg_quote('aleksander.machniak', '/') . '@(.*)$/';
+ foreach (array_keys($acl) as $name) {
+ if (preg_match($regexp, $name, $matches)) {
+ $domain = $matches[1];
+ break;
+ }
+ }
+ }
+ }
+
+ return $_SESSION['acl_username_realm'] = $domain;
+ }
+
+ /**
+ * Initializes autocomplete LDAP backend
+ */
+ private function init_ldap()
+ {
+ if ($this->ldap)
+ return $this->ldap->ready;
+
+ // get LDAP config
+ $config = $this->rc->config->get('acl_users_source');
+
+ if (empty($config)) {
+ return false;
+ }
+
+ // not an array, use configured ldap_public source
+ if (!is_array($config)) {
+ $ldap_config = (array) $this->rc->config->get('ldap_public');
+ $config = $ldap_config[$config];
+ }
+
+ $uid_field = $this->rc->config->get('acl_users_field', 'mail');
+ $filter = $this->rc->config->get('acl_users_filter');
+
+ if (empty($uid_field) || empty($config)) {
+ return false;
+ }
+
+ // get name attribute
+ if (!empty($config['fieldmap'])) {
+ $name_field = $config['fieldmap']['name'];
+ }
+ // ... no fieldmap, use the old method
+ if (empty($name_field)) {
+ $name_field = $config['name_field'];
+ }
+
+ // add UID field to fieldmap, so it will be returned in a record with name
+ $config['fieldmap'] = array(
+ 'name' => $name_field,
+ 'uid' => $uid_field,
+ );
+
+ // search in UID and name fields
+ $config['search_fields'] = array_values($config['fieldmap']);
+ $config['required_fields'] = array($uid_field);
+
+ // set search filter
+ if ($filter)
+ $config['filter'] = $filter;
+
+ // disable vlv
+ $config['vlv'] = false;
+
+ // Initialize LDAP connection
+ $this->ldap = new rcube_ldap($config,
+ $this->rc->config->get('ldap_debug'),
+ $this->rc->config->mail_domain($_SESSION['imap_host']));
+
+ return $this->ldap->ready;
+ }
+}
diff --git a/plugins/acl/config.inc.php.dist b/plugins/acl/config.inc.php.dist
new file mode 100644
index 000000000..f957a233a
--- /dev/null
+++ b/plugins/acl/config.inc.php.dist
@@ -0,0 +1,19 @@
+<?php
+
+// Default look of access rights table
+// In advanced mode all access rights are displayed separately
+// In simple mode access rights are grouped into four groups: read, write, delete, full
+$rcmail_config['acl_advanced_mode'] = false;
+
+// LDAP addressbook that would be searched for user names autocomplete.
+// That should be an array refering to the $rcmail_config['ldap_public'] array key
+// or complete addressbook configuration array.
+$rcmail_config['acl_users_source'] = '';
+
+// The LDAP attribute which will be used as ACL user identifier
+$rcmail_config['acl_users_field'] = 'mail';
+
+// The LDAP search filter will be &'d with search queries
+$rcmail_config['acl_users_filter'] = '';
+
+?>
diff --git a/plugins/acl/localization/en_US.inc b/plugins/acl/localization/en_US.inc
new file mode 100644
index 000000000..f5b1ae64d
--- /dev/null
+++ b/plugins/acl/localization/en_US.inc
@@ -0,0 +1,83 @@
+<?php
+
+$labels['sharing'] = 'Sharing';
+$labels['myrights'] = 'Access Rights';
+$labels['username'] = 'User:';
+$labels['advanced'] = 'advanced mode';
+$labels['newuser'] = 'Add entry';
+$labels['actions'] = 'Access right actions...';
+$labels['anyone'] = 'All users (anyone)';
+$labels['anonymous'] = 'Guests (anonymous)';
+$labels['identifier'] = 'Identifier';
+
+$labels['acll'] = 'Lookup';
+$labels['aclr'] = 'Read messages';
+$labels['acls'] = 'Keep Seen state';
+$labels['aclw'] = 'Write flags';
+$labels['acli'] = 'Insert (Copy into)';
+$labels['aclp'] = 'Post';
+$labels['aclc'] = 'Create subfolders';
+$labels['aclk'] = 'Create subfolders';
+$labels['acld'] = 'Delete messages';
+$labels['aclt'] = 'Delete messages';
+$labels['acle'] = 'Expunge';
+$labels['aclx'] = 'Delete folder';
+$labels['acla'] = 'Administer';
+
+$labels['aclfull'] = 'Full control';
+$labels['aclother'] = 'Other';
+$labels['aclread'] = 'Read';
+$labels['aclwrite'] = 'Write';
+$labels['acldelete'] = 'Delete';
+
+$labels['shortacll'] = 'Lookup';
+$labels['shortaclr'] = 'Read';
+$labels['shortacls'] = 'Keep';
+$labels['shortaclw'] = 'Write';
+$labels['shortacli'] = 'Insert';
+$labels['shortaclp'] = 'Post';
+$labels['shortaclc'] = 'Create';
+$labels['shortaclk'] = 'Create';
+$labels['shortacld'] = 'Delete';
+$labels['shortaclt'] = 'Delete';
+$labels['shortacle'] = 'Expunge';
+$labels['shortaclx'] = 'Folder delete';
+$labels['shortacla'] = 'Administer';
+
+$labels['shortaclother'] = 'Other';
+$labels['shortaclread'] = 'Read';
+$labels['shortaclwrite'] = 'Write';
+$labels['shortacldelete'] = 'Delete';
+
+$labels['longacll'] = 'The folder is visible on lists and can be subscribed to';
+$labels['longaclr'] = 'The folder can be opened for reading';
+$labels['longacls'] = 'Messages Seen flag can be changed';
+$labels['longaclw'] = 'Messages flags and keywords can be changed, except Seen and Deleted';
+$labels['longacli'] = 'Messages can be written or copied to the folder';
+$labels['longaclp'] = 'Messages can be posted to this folder';
+$labels['longaclc'] = 'Folders can be created (or renamed) directly under this folder';
+$labels['longaclk'] = 'Folders can be created (or renamed) directly under this folder';
+$labels['longacld'] = 'Messages Delete flag can be changed';
+$labels['longaclt'] = 'Messages Delete flag can be changed';
+$labels['longacle'] = 'Messages can be expunged';
+$labels['longaclx'] = 'The folder can be deleted or renamed';
+$labels['longacla'] = 'The folder access rights can be changed';
+
+$labels['longaclfull'] = 'Full control including folder administration';
+$labels['longaclread'] = 'The folder can be opened for reading';
+$labels['longaclwrite'] = 'Messages can be marked, written or copied to the folder';
+$labels['longacldelete'] = 'Messages can be deleted';
+
+$messages['deleting'] = 'Deleting access rights...';
+$messages['saving'] = 'Saving access rights...';
+$messages['updatesuccess'] = 'Successfully changed access rights';
+$messages['deletesuccess'] = 'Successfully deleted access rights';
+$messages['createsuccess'] = 'Successfully added access rights';
+$messages['updateerror'] = 'Ubable to update access rights';
+$messages['deleteerror'] = 'Unable to delete access rights';
+$messages['createerror'] = 'Unable to add access rights';
+$messages['deleteconfirm'] = 'Are you sure, you want to remove access rights of selected user(s)?';
+$messages['norights'] = 'No rights has been specified!';
+$messages['nouser'] = 'No username has been specified!';
+
+?>
diff --git a/plugins/acl/localization/pl_PL.inc b/plugins/acl/localization/pl_PL.inc
new file mode 100644
index 000000000..0b3689927
--- /dev/null
+++ b/plugins/acl/localization/pl_PL.inc
@@ -0,0 +1,83 @@
+<?php
+
+$labels['sharing'] = 'Udostępnianie';
+$labels['myrights'] = 'Prawa dostępu';
+$labels['username'] = 'Użytkownik:';
+$labels['advanced'] = 'tryb zaawansowany';
+$labels['newuser'] = 'Dodaj rekord';
+$labels['actions'] = 'Akcje na prawach...';
+$labels['anyone'] = 'Wszyscy (anyone)';
+$labels['anonymous'] = 'Goście (anonymous)';
+$labels['identifier'] = 'Identyfikator';
+
+$labels['acll'] = 'Podgląd (Lookup)';
+$labels['aclr'] = 'Odczyt (Read)';
+$labels['acls'] = 'Zmiana stanu wiadomości (Keep)';
+$labels['aclw'] = 'Zmiana flag wiadomości (Write)';
+$labels['acli'] = 'Dodawanie/Kopiowanie do (Insert)';
+$labels['aclp'] = 'Wysyłanie (Post)';
+$labels['aclc'] = 'Tworzenie podfolderów (Create)';
+$labels['aclk'] = 'Tworzenie podfolderów (Create)';
+$labels['acld'] = 'Usuwanie wiadomości (Delete)';
+$labels['aclt'] = 'Usuwanie wiadomości (Delete)';
+$labels['acle'] = 'Porządkowanie folderu (Expunge)';
+$labels['aclx'] = 'Usuwanie folderu (Delete)';
+$labels['acla'] = 'Administracja (Administer)';
+
+$labels['aclfull'] = 'Wszystkie';
+$labels['aclother'] = 'Inne';
+$labels['aclread'] = 'Odczyt';
+$labels['aclwrite'] = 'Zapis';
+$labels['acldelete'] = 'Usuwanie';
+
+$labels['shortacll'] = 'Podgląd';
+$labels['shortaclr'] = 'Odczyt';
+$labels['shortacls'] = 'Zmiana';
+$labels['shortaclw'] = 'Zmiana flag';
+$labels['shortacli'] = 'Dodawanie';
+$labels['shortaclp'] = 'Wysyłanie';
+$labels['shortaclc'] = 'Tworzenie';
+$labels['shortaclk'] = 'Tworzenie';
+$labels['shortacld'] = 'Usuwanie';
+$labels['shortaclt'] = 'Usuwanie';
+$labels['shortacle'] = 'Porządkowanie';
+$labels['shortaclx'] = 'Usuwanie folderu';
+$labels['shortacla'] = 'Administracja';
+
+$labels['shortaclother'] = 'Pozostałe';
+$labels['shortaclread'] = 'Odczyt';
+$labels['shortaclwrite'] = 'Zapis';
+$labels['shortacldelete'] = 'Usuwanie';
+
+$labels['longacll'] = 'Pozwala na subskrybowanie folderu i powoduje, że jest on widoczny na liście';
+$labels['longaclr'] = 'Pozwala na otwarcie folderu w trybie do odczytu';
+$labels['longacls'] = 'Pozwala na zmienę stanu wiadomości';
+$labels['longaclw'] = 'Pozwala zmieniać wszystkie flagi wiadomości, oprócz "Przeczytano" i "Usunięto"';
+$labels['longacli'] = 'Pozwala zapisywać wiadomości i kopiować do folderu';
+$labels['longaclp'] = 'Pozwala wysyłać wiadomości do folderu';
+$labels['longaclc'] = 'Pozwala tworzyć (lub zmieniać nazwę) podfoldery';
+$labels['longaclk'] = 'Pozwala tworzyć (lub zmieniać nazwę) podfoldery';
+$labels['longacld'] = 'Pozwala zmianiać flagę "Usunięto" wiadomości';
+$labels['longaclt'] = 'Pozwala zmianiać flagę "Usunięto" wiadomości';
+$labels['longacle'] = 'Pozwala na usuwanie wiadomości oznaczonych do usunięcia';
+$labels['longaclx'] = 'Pozwala na zmianę nazwy lub usunięcie folderu';
+$labels['longacla'] = 'Pozwala na zmiane praw dostępu do folderu';
+
+$labels['longaclfull'] = 'Pełna kontrola włącznie z administrowaniem folderem';
+$labels['longaclread'] = 'Folder może być otwarty w trybie do odczytu';
+$labels['longaclwrite'] = 'Wiadomości mogą być oznaczane, zapisywane i kopiowane do folderu';
+$labels['longacldelete'] = 'Wiadomości mogą być usuwane';
+
+$messages['deleting'] = 'Usuwanie praw dostępu...';
+$messages['saving'] = 'Zapisywanie praw dostępu...';
+$messages['updatesuccess'] = 'Pomyślnie zmieniono prawa dostępu';
+$messages['deletesuccess'] = 'Pomyślnie usunięto prawa dostępu';
+$messages['createsuccess'] = 'Pomyślnie dodano prawa dostępu';
+$messages['updateerror'] = 'Nie udało się zmienić praw dostępu';
+$messages['deleteerror'] = 'Nie udało się usunąć praw dostępu';
+$messages['createerror'] = 'Nie udało się dodać praw dostępu';
+$messages['deleteconfirm'] = 'Czy na pewno chcesz usunąć prawa wybranym użytkownikom?';
+$messages['norights'] = 'Nie wybrano praw dostępu!';
+$messages['nouser'] = 'Nie podano nazwy użytkownika!';
+
+?>
diff --git a/plugins/acl/skins/default/acl.css b/plugins/acl/skins/default/acl.css
new file mode 100644
index 000000000..cd8f4b72e
--- /dev/null
+++ b/plugins/acl/skins/default/acl.css
@@ -0,0 +1,94 @@
+#aclmanager
+{
+ position: relative;
+ border: 1px solid #999;
+ min-height: 302px;
+}
+
+#aclcontainer
+{
+ overflow-x: auto;
+}
+
+#acltable
+{
+ width: 100%;
+ border-collapse: collapse;
+ background-color: #F9F9F9;
+}
+
+#acltable td
+{
+ width: 1%;
+ white-space: nowrap;
+}
+
+#acltable thead td
+{
+ padding: 0 4px 0 2px;
+}
+
+#acltable tbody td
+{
+ text-align: center;
+ padding: 2px;
+ border-bottom: 1px solid #999999;
+ cursor: default;
+}
+
+#acltable tbody td.user
+{
+ width: 96%;
+ text-align: left;
+ overflow: hidden;
+ text-overflow: ellipsis;
+ -o-text-overflow: ellipsis;
+}
+
+#acltable tbody td.partial
+{
+ background: url(images/partial.png) center no-repeat;
+}
+
+#acltable tbody td.enabled
+{
+ background: url(images/enabled.png) center no-repeat;
+}
+
+#acltable tr.selected td
+{
+ color: #FFFFFF;
+ background-color: #CC3333;
+}
+
+#acladvswitch
+{
+ position: absolute;
+ right: 4px;
+ text-align: right;
+ line-height: 22px;
+}
+
+#acladvswitch input
+{
+ vertical-align: middle;
+}
+
+#acladvswitch span
+{
+ display: block;
+}
+
+#aclform
+{
+ top: 100px;
+ width: 480px;
+ padding: 10px;
+}
+
+#aclform div
+{
+ padding: 0;
+ text-align: center;
+ clear: both;
+}
diff --git a/plugins/acl/skins/default/images/enabled.png b/plugins/acl/skins/default/images/enabled.png
new file mode 100644
index 000000000..98215f68c
--- /dev/null
+++ b/plugins/acl/skins/default/images/enabled.png
Binary files differ
diff --git a/plugins/acl/skins/default/images/partial.png b/plugins/acl/skins/default/images/partial.png
new file mode 100644
index 000000000..12023f057
--- /dev/null
+++ b/plugins/acl/skins/default/images/partial.png
Binary files differ
diff --git a/plugins/acl/skins/default/templates/table.html b/plugins/acl/skins/default/templates/table.html
new file mode 100644
index 000000000..2365ef757
--- /dev/null
+++ b/plugins/acl/skins/default/templates/table.html
@@ -0,0 +1,54 @@
+<!--[if lte IE 6]>
+ <style type="text/css">
+ #aclmanager { height: expression(Math.min(302, parseInt(document.documentElement.clientHeight))+'px'); }
+ </style>
+<![endif]-->
+
+<div id="aclmanager">
+<div id="aclcontainer" class="boxlistcontent" style="top:0">
+ <roundcube:object name="acltable" id="acltable" class="records-table" />
+</div>
+<div class="boxfooter">
+ <roundcube:button command="acl-create" id="aclcreatelink" type="link" title="acl.newuser" class="buttonPas addgroup" classAct="button addgroup" content=" " />
+ <roundcube:button name="aclmenulink" id="aclmenulink" type="link" title="acl.actions" class="button groupactions" onclick="show_aclmenu(); return false" content=" " />
+ <roundcube:if condition="!in_array('acl_advanced_mode', (array)config:dont_override)" />
+ <div id="acladvswitch" class="pagenav">
+ <span><label for="acl-switch"><roundcube:label name="acl.advanced" /></label>
+ <input type="checkbox" id="acl-switch" onclick="rcmail.command('acl-mode-switch')"<roundcube:exp expression="config:acl_advanced_mode == true ? ' checked=checked' : ''" /> />
+ </span>
+ </div>
+ <roundcube:endif />
+</div>
+</div>
+
+<div id="aclmenu" class="popupmenu">
+ <ul>
+ <li><roundcube:button command="acl-edit" label="edit" classAct="active" /></li>
+ <li><roundcube:button command="acl-delete" label="delete" classAct="active" /></li>
+ </ul>
+</div>
+
+<div id="aclform" class="popupmenu">
+ <fieldset class="thinbordered"><legend><roundcube:label name="acl.identifier" /></legend>
+ <roundcube:object name="acluser" class="toolbarmenu" id="acluser" size="35" />
+ </fieldset>
+ <fieldset class="thinbordered"><legend><roundcube:label name="acl.myrights" /></legend>
+ <roundcube:object name="aclrights" class="toolbarmenu" />
+ </fieldset>
+ <div>
+ <roundcube:button command="acl-cancel" type="input" class="button" label="cancel" />
+ <roundcube:button command="acl-save" type="input" class="button mainaction" label="save" />
+ </div>
+</div>
+
+<script type="text/javascript">
+function show_aclmenu()
+{
+ if (!rcmail_ui) {
+ rcube_init_mail_ui();
+ rcmail_ui.popups.aclmenu = {id:'aclmenu', above:1, obj: $('#aclmenu')};
+ }
+
+ rcmail_ui.show_popup('aclmenu');
+}
+</script>
diff --git a/plugins/additional_message_headers/additional_message_headers.php b/plugins/additional_message_headers/additional_message_headers.php
new file mode 100644
index 000000000..80c58d58b
--- /dev/null
+++ b/plugins/additional_message_headers/additional_message_headers.php
@@ -0,0 +1,43 @@
+<?php
+
+/**
+ * Additional Message Headers
+ *
+ * Very simple plugin which will add additional headers
+ * to or remove them from outgoing messages.
+ *
+ * Enable the plugin in config/main.inc.php and add your desired headers:
+ * $rcmail_config['additional_message_headers'] = array('User-Agent');
+ *
+ * @version @package_version@
+ * @author Ziba Scott
+ * @website http://roundcube.net
+ */
+class additional_message_headers extends rcube_plugin
+{
+ public $task = 'mail';
+
+ function init()
+ {
+ $this->add_hook('message_outgoing_headers', array($this, 'message_headers'));
+ }
+
+ function message_headers($args)
+ {
+ $this->load_config();
+
+ // additional email headers
+ $additional_headers = rcmail::get_instance()->config->get('additional_message_headers',array());
+ foreach($additional_headers as $header=>$value){
+ if (null === $value) {
+ unset($args['headers'][$header]);
+ } else {
+ $args['headers'][$header] = $value;
+ }
+ }
+
+ return $args;
+ }
+}
+
+?>
diff --git a/plugins/additional_message_headers/config.inc.php.dist b/plugins/additional_message_headers/config.inc.php.dist
new file mode 100644
index 000000000..83ccd869c
--- /dev/null
+++ b/plugins/additional_message_headers/config.inc.php.dist
@@ -0,0 +1,14 @@
+<?php
+
+// $rcmail_config['additional_message_headers']['X-Remote-Browser'] = $_SERVER['HTTP_USER_AGENT'];
+// $rcmail_config['additional_message_headers']['X-Originating-IP'] = $_SERVER['REMOTE_ADDR'];
+// $rcmail_config['additional_message_headers']['X-RoundCube-Server'] = $_SERVER['SERVER_ADDR'];
+
+// if( isset( $_SERVER['MACHINE_NAME'] )) {
+// $rcmail_config['additional_message_headers']['X-RoundCube-Server'] .= ' (' . $_SERVER['MACHINE_NAME'] . ')';
+// }
+
+// To remove (e.g. X-Sender) message header use null value
+// $rcmail_config['additional_message_headers']['X-Sender'] = null;
+
+?>
diff --git a/plugins/additional_message_headers/package.xml b/plugins/additional_message_headers/package.xml
new file mode 100644
index 000000000..d79dbaef1
--- /dev/null
+++ b/plugins/additional_message_headers/package.xml
@@ -0,0 +1,47 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<package packagerversion="1.9.0" version="2.0" xmlns="http://pear.php.net/dtd/package-2.0" xmlns:tasks="http://pear.php.net/dtd/tasks-1.0" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xsi:schemaLocation="http://pear.php.net/dtd/tasks-1.0
+ http://pear.php.net/dtd/tasks-1.0.xsd
+ http://pear.php.net/dtd/package-2.0
+ http://pear.php.net/dtd/package-2.0.xsd">
+ <name>additional_message_headers</name>
+ <channel>pear.roundcube.net</channel>
+ <summary>Additional message headers for Roundcube</summary>
+ <description>Very simple plugin which will add additional headers to or remove them from outgoing messages.</description>
+ <lead>
+ <name>Ziba Scott</name>
+ <user>ziba</user>
+ <email>email@example.org</email>
+ <active>yes</active>
+ </lead>
+ <date>2010-01-16</date>
+ <time>18:19:33</time>
+ <version>
+ <release>1.1.0</release>
+ <api>1.1.0</api>
+ </version>
+ <stability>
+ <release>stable</release>
+ <api>stable</api>
+ </stability>
+ <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPL v2</license>
+ <notes>-</notes>
+ <contents>
+ <dir baseinstalldir="/" name="/">
+ <file name="additional_message_headers.php" role="php">
+ <tasks:replace from="@name@" to="name" type="package-info" />
+ <tasks:replace from="@package_version@" to="version" type="package-info" />
+ </file>
+ </dir> <!-- / -->
+ </contents>
+ <dependencies>
+ <required>
+ <php>
+ <min>5.2.1</min>
+ </php>
+ <pearinstaller>
+ <min>1.7.0</min>
+ </pearinstaller>
+ </required>
+ </dependencies>
+ <phprelease />
+</package>
diff --git a/plugins/archive/archive.js b/plugins/archive/archive.js
new file mode 100644
index 000000000..a83750819
--- /dev/null
+++ b/plugins/archive/archive.js
@@ -0,0 +1,34 @@
+/*
+ * Archive plugin script
+ * @version @package_version@
+ */
+
+function rcmail_archive(prop)
+{
+ if (!rcmail.env.uid && (!rcmail.message_list || !rcmail.message_list.get_selection().length))
+ return;
+
+ if (rcmail.env.mailbox != rcmail.env.archive_folder)
+ rcmail.command('moveto', rcmail.env.archive_folder);
+}
+
+// callback for app-onload event
+if (window.rcmail) {
+ rcmail.addEventListener('init', function(evt) {
+
+ // register command (directly enable in message view mode)
+ rcmail.register_command('plugin.archive', rcmail_archive, (rcmail.env.uid && rcmail.env.mailbox != rcmail.env.archive_folder));
+
+ // add event-listener to message list
+ if (rcmail.message_list)
+ rcmail.message_list.addEventListener('select', function(list){
+ rcmail.enable_command('plugin.archive', (list.get_selection().length > 0 && rcmail.env.mailbox != rcmail.env.archive_folder));
+ });
+
+ // set css style for archive folder
+ var li;
+ if (rcmail.env.archive_folder && rcmail.env.archive_folder_icon && (li = rcmail.get_folder_li(rcmail.env.archive_folder)))
+ $(li).css('background-image', 'url(' + rcmail.env.archive_folder_icon + ')');
+ })
+}
+
diff --git a/plugins/archive/archive.php b/plugins/archive/archive.php
new file mode 100644
index 000000000..843b61217
--- /dev/null
+++ b/plugins/archive/archive.php
@@ -0,0 +1,124 @@
+<?php
+
+/**
+ * Archive
+ *
+ * Plugin that adds a new button to the mailbox toolbar
+ * to move messages to a (user selectable) archive folder.
+ *
+ * @version @package_version@
+ * @author Andre Rodier, Thomas Bruederli
+ */
+class archive extends rcube_plugin
+{
+ public $task = 'mail|settings';
+
+ function init()
+ {
+ $rcmail = rcmail::get_instance();
+
+ // There is no "Archived flags"
+ // $GLOBALS['IMAP_FLAGS']['ARCHIVED'] = 'Archive';
+ if ($rcmail->task == 'mail' && ($rcmail->action == '' || $rcmail->action == 'show')
+ && ($archive_folder = $rcmail->config->get('archive_mbox'))) {
+ $skin_path = $this->local_skin_path();
+
+ $this->include_script('archive.js');
+ $this->add_texts('localization', true);
+ $this->add_button(
+ array(
+ 'command' => 'plugin.archive',
+ 'imagepas' => $skin_path.'/archive_pas.png',
+ 'imageact' => $skin_path.'/archive_act.png',
+ 'width' => 32,
+ 'height' => 32,
+ 'title' => 'buttontitle',
+ 'domain' => $this->ID,
+ ),
+ 'toolbar');
+
+ // register hook to localize the archive folder
+ $this->add_hook('render_mailboxlist', array($this, 'render_mailboxlist'));
+
+ // set env variable for client
+ $rcmail->output->set_env('archive_folder', $archive_folder);
+ $rcmail->output->set_env('archive_folder_icon', $this->url($skin_path.'/foldericon.png'));
+
+ // add archive folder to the list of default mailboxes
+ if (($default_folders = $rcmail->config->get('default_imap_folders')) && !in_array($archive_folder, $default_folders)) {
+ $default_folders[] = $archive_folder;
+ $rcmail->config->set('default_imap_folders', $default_folders);
+ }
+ }
+ else if ($rcmail->task == 'settings') {
+ $dont_override = $rcmail->config->get('dont_override', array());
+ if (!in_array('archive_mbox', $dont_override)) {
+ $this->add_hook('preferences_list', array($this, 'prefs_table'));
+ $this->add_hook('preferences_save', array($this, 'save_prefs'));
+ }
+ }
+ }
+
+ function render_mailboxlist($p)
+ {
+ $rcmail = rcmail::get_instance();
+ $archive_folder = $rcmail->config->get('archive_mbox');
+
+ // set localized name for the configured archive folder
+ if ($archive_folder) {
+ if (isset($p['list'][$archive_folder]))
+ $p['list'][$archive_folder]['name'] = $this->gettext('archivefolder');
+ else // search in subfolders
+ $this->_mod_folder_name($p['list'], $archive_folder, $this->gettext('archivefolder'));
+ }
+
+ return $p;
+ }
+
+ function _mod_folder_name(&$list, $folder, $new_name)
+ {
+ foreach ($list as $idx => $item) {
+ if ($item['id'] == $folder) {
+ $list[$idx]['name'] = $new_name;
+ return true;
+ } else if (!empty($item['folders']))
+ if ($this->_mod_folder_name($list[$idx]['folders'], $folder, $new_name))
+ return true;
+ }
+ return false;
+ }
+
+ function prefs_table($args)
+ {
+ global $CURR_SECTION;
+
+ if ($args['section'] == 'folders') {
+ $this->add_texts('localization');
+
+ $rcmail = rcmail::get_instance();
+
+ // load folders list when needed
+ if ($CURR_SECTION)
+ $select = rcmail_mailbox_select(array('noselection' => '---', 'realnames' => true,
+ 'maxlength' => 30, 'exceptions' => array('INBOX')));
+ else
+ $select = new html_select();
+
+ $args['blocks']['main']['options']['archive_mbox'] = array(
+ 'title' => $this->gettext('archivefolder'),
+ 'content' => $select->show($rcmail->config->get('archive_mbox'), array('name' => "_archive_mbox"))
+ );
+ }
+
+ return $args;
+ }
+
+ function save_prefs($args)
+ {
+ if ($args['section'] == 'folders') {
+ $args['prefs']['archive_mbox'] = get_input_value('_archive_mbox', RCUBE_INPUT_POST);
+ return $args;
+ }
+ }
+
+}
diff --git a/plugins/archive/localization/cs_CZ.inc b/plugins/archive/localization/cs_CZ.inc
new file mode 100644
index 000000000..bb257bca0
--- /dev/null
+++ b/plugins/archive/localization/cs_CZ.inc
@@ -0,0 +1,25 @@
+<?php
+
+/*
+
++-----------------------------------------------------------------------+
+| language/cs_CZ/labels.inc |
+| |
+| Language file of the Roundcube archive plugin |
+| Copyright (C) 2005-2009, The Roundcube Dev Team |
+| Licensed under the GNU GPL |
+| |
++-----------------------------------------------------------------------+
+| Author: Milan Kozak <hodza@hodza.net> |
++-----------------------------------------------------------------------+
+
+@version $Id: labels.inc 2993 2009-09-26 18:32:07Z alec $
+
+*/
+
+$labels = array();
+$labels['buttontitle'] = 'Archivovat zprávu';
+$labels['archived'] = 'Úspěšně vloženo do archivu';
+$labels['archivefolder'] = 'Archiv';
+
+?>
diff --git a/plugins/archive/localization/de_CH.inc b/plugins/archive/localization/de_CH.inc
new file mode 100644
index 000000000..2ed0f5ac8
--- /dev/null
+++ b/plugins/archive/localization/de_CH.inc
@@ -0,0 +1,8 @@
+<?php
+
+$labels = array();
+$labels['buttontitle'] = 'Nachricht archivieren';
+$labels['archived'] = 'Nachricht erfolgreich archiviert';
+$labels['archivefolder'] = 'Archiv';
+
+?>
diff --git a/plugins/archive/localization/de_DE.inc b/plugins/archive/localization/de_DE.inc
new file mode 100644
index 000000000..2ed0f5ac8
--- /dev/null
+++ b/plugins/archive/localization/de_DE.inc
@@ -0,0 +1,8 @@
+<?php
+
+$labels = array();
+$labels['buttontitle'] = 'Nachricht archivieren';
+$labels['archived'] = 'Nachricht erfolgreich archiviert';
+$labels['archivefolder'] = 'Archiv';
+
+?>
diff --git a/plugins/archive/localization/en_US.inc b/plugins/archive/localization/en_US.inc
new file mode 100644
index 000000000..fce31a0b5
--- /dev/null
+++ b/plugins/archive/localization/en_US.inc
@@ -0,0 +1,8 @@
+<?php
+
+$labels = array();
+$labels['buttontitle'] = 'Archive this message';
+$labels['archived'] = 'Successfully archived';
+$labels['archivefolder'] = 'Archive';
+
+?>
diff --git a/plugins/archive/localization/es_AR.inc b/plugins/archive/localization/es_AR.inc
new file mode 100644
index 000000000..7d021f561
--- /dev/null
+++ b/plugins/archive/localization/es_AR.inc
@@ -0,0 +1,10 @@
+<?php
+
+// MPBAUPGRADE
+
+$labels = array();
+$labels['buttontitle'] = 'Archivar este mensaje';
+$labels['archived'] = 'Mensaje Archivado';
+$labels['archivefolder'] = 'Archivo';
+
+?>
diff --git a/plugins/archive/localization/es_ES.inc b/plugins/archive/localization/es_ES.inc
new file mode 100644
index 000000000..7d021f561
--- /dev/null
+++ b/plugins/archive/localization/es_ES.inc
@@ -0,0 +1,10 @@
+<?php
+
+// MPBAUPGRADE
+
+$labels = array();
+$labels['buttontitle'] = 'Archivar este mensaje';
+$labels['archived'] = 'Mensaje Archivado';
+$labels['archivefolder'] = 'Archivo';
+
+?>
diff --git a/plugins/archive/localization/et_EE.inc b/plugins/archive/localization/et_EE.inc
new file mode 100644
index 000000000..e3968d755
--- /dev/null
+++ b/plugins/archive/localization/et_EE.inc
@@ -0,0 +1,8 @@
+<?php
+
+$labels = array();
+$labels['buttontitle'] = 'Arhiveeri see kiri';
+$labels['archived'] = 'Edukalt arhiveeritud';
+$labels['archivefolder'] = 'Arhiveeri';
+
+?>
diff --git a/plugins/archive/localization/fr_FR.inc b/plugins/archive/localization/fr_FR.inc
new file mode 100644
index 000000000..f44f30f44
--- /dev/null
+++ b/plugins/archive/localization/fr_FR.inc
@@ -0,0 +1,8 @@
+<?php
+
+$labels = array();
+$labels['buttontitle'] = 'Archiver ce message';
+$labels['archived'] = 'Message archiv avec success';
+$labels['archivefolder'] = 'Archive';
+
+?>
diff --git a/plugins/archive/localization/gl_ES.inc b/plugins/archive/localization/gl_ES.inc
new file mode 100644
index 000000000..62a767869
--- /dev/null
+++ b/plugins/archive/localization/gl_ES.inc
@@ -0,0 +1,10 @@
+<?php
+
+// MPBAUPGRADE
+
+$labels = array();
+$labels['buttontitle'] = 'Arquivar esta mensaxe';
+$labels['archived'] = 'Aquivouse a mensaxe';
+$labels['archivefolder'] = 'Arquivo';
+
+?>
diff --git a/plugins/archive/localization/ja_JP.inc b/plugins/archive/localization/ja_JP.inc
new file mode 100644
index 000000000..31fa15267
--- /dev/null
+++ b/plugins/archive/localization/ja_JP.inc
@@ -0,0 +1,10 @@
+<?php
+
+// EN-Revision: 3891
+
+$labels = array();
+$labels['buttontitle'] = 'このメッセージのアーカイブ';
+$labels['archived'] = 'アーカイブに成功しました。';
+$labels['archivefolder'] = 'アーカイブ';
+
+?>
diff --git a/plugins/archive/localization/nl_NL.inc b/plugins/archive/localization/nl_NL.inc
new file mode 100644
index 000000000..0d47f7b9c
--- /dev/null
+++ b/plugins/archive/localization/nl_NL.inc
@@ -0,0 +1,8 @@
+<?php
+
+$labels = array();
+$labels['buttontitle'] = 'Archiveer dit bericht';
+$labels['archived'] = 'Succesvol gearchiveerd';
+$labels['archivefolder'] = 'Archief';
+
+?>
diff --git a/plugins/archive/localization/pl_PL.inc b/plugins/archive/localization/pl_PL.inc
new file mode 100644
index 000000000..2ecc77991
--- /dev/null
+++ b/plugins/archive/localization/pl_PL.inc
@@ -0,0 +1,8 @@
+<?php
+
+$labels = array();
+$labels['buttontitle'] = 'Przenieś do archiwum';
+$labels['archived'] = 'Pomyślnie zarchiwizowano';
+$labels['archivefolder'] = 'Archiwum';
+
+?>
diff --git a/plugins/archive/localization/pt_BR.inc b/plugins/archive/localization/pt_BR.inc
new file mode 100644
index 000000000..224f53caa
--- /dev/null
+++ b/plugins/archive/localization/pt_BR.inc
@@ -0,0 +1,8 @@
+<?php
+
+$labels = array();
+$labels['buttontitle'] = 'Arquivar esta mensagem';
+$labels['archived'] = 'Arquivada com sucesso';
+$labels['archivefolder'] = 'Arquivo';
+
+?>
diff --git a/plugins/archive/localization/ru_RU.inc b/plugins/archive/localization/ru_RU.inc
new file mode 100644
index 000000000..e377ad017
--- /dev/null
+++ b/plugins/archive/localization/ru_RU.inc
@@ -0,0 +1,8 @@
+<?php
+
+$labels = array();
+$labels['buttontitle'] = 'Переместить выбранное в архив';
+$labels['archived'] = 'Перенесено в Архив';
+$labels['archivefolder'] = 'Архив';
+
+?>
diff --git a/plugins/archive/localization/sv_SE.inc b/plugins/archive/localization/sv_SE.inc
new file mode 100644
index 000000000..c55da7aaf
--- /dev/null
+++ b/plugins/archive/localization/sv_SE.inc
@@ -0,0 +1,8 @@
+<?php
+
+$labels = array();
+$labels['buttontitle'] = 'Arkivera meddelande';
+$labels['archived'] = 'Meddelandet är arkiverat';
+$labels['archivefolder'] = 'Arkiv';
+
+?>
diff --git a/plugins/archive/localization/zh_TW.inc b/plugins/archive/localization/zh_TW.inc
new file mode 100644
index 000000000..5cccebbdc
--- /dev/null
+++ b/plugins/archive/localization/zh_TW.inc
@@ -0,0 +1,8 @@
+<?php
+
+$labels = array();
+$labels['buttontitle'] = '封存此信件';
+$labels['archived'] = '已成功封存';
+$labels['archivefolder'] = '封存';
+
+?>
diff --git a/plugins/archive/package.xml b/plugins/archive/package.xml
new file mode 100644
index 000000000..c442a5c4d
--- /dev/null
+++ b/plugins/archive/package.xml
@@ -0,0 +1,64 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<package xmlns="http://pear.php.net/dtd/package-2.0" xmlns:tasks="http://pear.php.net/dtd/tasks-1.0" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" packagerversion="1.9.0" version="2.0" xsi:schemaLocation="http://pear.php.net/dtd/tasks-1.0
+ http://pear.php.net/dtd/tasks-1.0.xsd
+ http://pear.php.net/dtd/package-2.0
+ http://pear.php.net/dtd/package-2.0.xsd">
+ <name>archive</name>
+ <channel>pear.roundcube.net</channel>
+ <summary>Archive feature for Roundcube</summary>
+ <description>This adds a button to move the selected messages to an archive folder. The folder can be selected in the settings panel.</description>
+ <lead>
+ <name>Thomas Bruederli</name>
+ <user>thomasb</user>
+ <email>roundcube@gmail.com</email>
+ <active>yes</active>
+ </lead>
+ <date>2010-02-06</date>
+ <time>12:12:00</time>
+ <version>
+ <release>1.4</release>
+ <api>1.4</api>
+ </version>
+ <stability>
+ <release>stable</release>
+ <api>stable</api>
+ </stability>
+ <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license>
+ <notes>-</notes>
+ <contents>
+ <dir baseinstalldir="/" name="/">
+ <file name="archive.php" role="php">
+ <tasks:replace from="@name@" to="name" type="package-info"/>
+ <tasks:replace from="@package_version@" to="version" type="package-info"/>
+ </file>
+ <file name="archive.js" role="data">
+ <tasks:replace from="@name@" to="name" type="package-info"/>
+ <tasks:replace from="@package_version@" to="version" type="package-info"/>
+ </file>
+ <file name="localization/en_US.inc" role="data"></file>
+ <file name="localization/cs_CZ.inc" role="data"></file>
+ <file name="localization/de_CH.inc" role="data"></file>
+ <file name="localization/de_DE.inc" role="data"></file>
+ <file name="localization/et_EE.inc" role="data"></file>
+ <file name="localization/fr_FR.inc" role="data"></file>
+ <file name="localization/pl_PL.inc" role="data"></file>
+ <file name="localization/ru_RU.inc" role="data"></file>
+ <file name="localization/zh_TW.inc" role="data"></file>
+ <file name="skins/default/archive_act.png" role="data"></file>
+ <file name="skins/default/archive_pas.png" role="data"></file>
+ <file name="skins/default/foldericon.png" role="data"></file>
+ </dir>
+ <!-- / -->
+ </contents>
+ <dependencies>
+ <required>
+ <php>
+ <min>5.2.1</min>
+ </php>
+ <pearinstaller>
+ <min>1.7.0</min>
+ </pearinstaller>
+ </required>
+ </dependencies>
+ <phprelease/>
+</package>
diff --git a/plugins/archive/skins/default/archive_act.png b/plugins/archive/skins/default/archive_act.png
new file mode 100644
index 000000000..2a1735868
--- /dev/null
+++ b/plugins/archive/skins/default/archive_act.png
Binary files differ
diff --git a/plugins/archive/skins/default/archive_pas.png b/plugins/archive/skins/default/archive_pas.png
new file mode 100644
index 000000000..8de208583
--- /dev/null
+++ b/plugins/archive/skins/default/archive_pas.png
Binary files differ
diff --git a/plugins/archive/skins/default/foldericon.png b/plugins/archive/skins/default/foldericon.png
new file mode 100644
index 000000000..ec0853c44
--- /dev/null
+++ b/plugins/archive/skins/default/foldericon.png
Binary files differ
diff --git a/plugins/autologon/autologon.php b/plugins/autologon/autologon.php
new file mode 100644
index 000000000..9601d61a6
--- /dev/null
+++ b/plugins/autologon/autologon.php
@@ -0,0 +1,47 @@
+<?php
+
+/**
+ * Sample plugin to try out some hooks.
+ * This performs an automatic login if accessed from localhost
+ */
+class autologon extends rcube_plugin
+{
+ public $task = 'login';
+
+ function init()
+ {
+ $this->add_hook('startup', array($this, 'startup'));
+ $this->add_hook('authenticate', array($this, 'authenticate'));
+ }
+
+ function startup($args)
+ {
+ $rcmail = rcmail::get_instance();
+
+ // change action to login
+ if (empty($_SESSION['user_id']) && !empty($_GET['_autologin']) && $this->is_localhost())
+ $args['action'] = 'login';
+
+ return $args;
+ }
+
+ function authenticate($args)
+ {
+ if (!empty($_GET['_autologin']) && $this->is_localhost()) {
+ $args['user'] = 'me';
+ $args['pass'] = '******';
+ $args['host'] = 'localhost';
+ $args['cookiecheck'] = false;
+ $args['valid'] = true;
+ }
+
+ return $args;
+ }
+
+ function is_localhost()
+ {
+ return $_SERVER['REMOTE_ADDR'] == '::1' || $_SERVER['REMOTE_ADDR'] == '127.0.0.1';
+ }
+
+}
+
diff --git a/plugins/database_attachments/database_attachments.php b/plugins/database_attachments/database_attachments.php
new file mode 100644
index 000000000..32461cff6
--- /dev/null
+++ b/plugins/database_attachments/database_attachments.php
@@ -0,0 +1,168 @@
+<?php
+/**
+ * Filesystem Attachments
+ *
+ * This plugin which provides database backed storage for temporary
+ * attachment file handling. The primary advantage of this plugin
+ * is its compatibility with round-robin dns multi-server roundcube
+ * installations.
+ *
+ * This plugin relies on the core filesystem_attachments plugin
+ *
+ * @author Ziba Scott <ziba@umich.edu>
+ *
+ */
+require_once('plugins/filesystem_attachments/filesystem_attachments.php');
+class database_attachments extends filesystem_attachments
+{
+
+ // A prefix for the cache key used in the session and in the key field of the cache table
+ private $cache_prefix = "db_attach";
+
+ /**
+ * Helper method to generate a unique key for the given attachment file
+ */
+ private function _key($args)
+ {
+ $uname = $args['path'] ? $args['path'] : $args['name'];
+ return $this->cache_prefix . $args['group'] . md5(mktime() . $uname . $_SESSION['user_id']);
+ }
+
+ /**
+ * Save a newly uploaded attachment
+ */
+ function upload($args)
+ {
+ $args['status'] = false;
+ $rcmail = rcmail::get_instance();
+ $key = $this->_key($args);
+
+ $data = file_get_contents($args['path']);
+
+ if ($data === false)
+ return $args;
+
+ $data = base64_encode($data);
+
+ $status = $rcmail->db->query(
+ "INSERT INTO ".get_table_name('cache')."
+ (created, user_id, cache_key, data)
+ VALUES (".$rcmail->db->now().", ?, ?, ?)",
+ $_SESSION['user_id'],
+ $key,
+ $data);
+
+ if ($status) {
+ $args['id'] = $key;
+ $args['status'] = true;
+ unset($args['path']);
+ }
+
+ return $args;
+ }
+
+ /**
+ * Save an attachment from a non-upload source (draft or forward)
+ */
+ function save($args)
+ {
+ $args['status'] = false;
+ $rcmail = rcmail::get_instance();
+
+ $key = $this->_key($args);
+
+ if ($args['path']) {
+ $args['data'] = file_get_contents($args['path']);
+
+ if ($args['data'] === false)
+ return $args;
+ }
+
+ $data = base64_encode($args['data']);
+
+ $status = $rcmail->db->query(
+ "INSERT INTO ".get_table_name('cache')."
+ (created, user_id, cache_key, data)
+ VALUES (".$rcmail->db->now().", ?, ?, ?)",
+ $_SESSION['user_id'],
+ $key,
+ $data);
+
+ if ($status) {
+ $args['id'] = $key;
+ $args['status'] = true;
+ }
+
+ return $args;
+ }
+
+ /**
+ * Remove an attachment from storage
+ * This is triggered by the remove attachment button on the compose screen
+ */
+ function remove($args)
+ {
+ $args['status'] = false;
+ $rcmail = rcmail::get_instance();
+ $status = $rcmail->db->query(
+ "DELETE FROM ".get_table_name('cache')."
+ WHERE user_id=?
+ AND cache_key=?",
+ $_SESSION['user_id'],
+ $args['id']);
+
+ if ($status) {
+ $args['status'] = true;
+ }
+
+ return $args;
+ }
+
+ /**
+ * When composing an html message, image attachments may be shown
+ * For this plugin, $this->get() will check the file and
+ * return it's contents
+ */
+ function display($args)
+ {
+ return $this->get($args);
+ }
+
+ /**
+ * When displaying or sending the attachment the file contents are fetched
+ * using this method. This is also called by the attachment_display hook.
+ */
+ function get($args)
+ {
+ $rcmail = rcmail::get_instance();
+
+ $sql_result = $rcmail->db->query(
+ "SELECT cache_id, data
+ FROM ".get_table_name('cache')."
+ WHERE user_id=?
+ AND cache_key=?",
+ $_SESSION['user_id'],
+ $args['id']);
+
+ if ($sql_arr = $rcmail->db->fetch_assoc($sql_result)) {
+ $args['data'] = base64_decode($sql_arr['data']);
+ $args['status'] = true;
+ }
+
+ return $args;
+ }
+
+ /**
+ * Delete all temp files associated with this user
+ */
+ function cleanup($args)
+ {
+ $prefix = $this->cache_prefix . $args['group'];
+ $rcmail = rcmail::get_instance();
+ $rcmail->db->query(
+ "DELETE FROM ".get_table_name('cache')."
+ WHERE user_id=?
+ AND cache_key like '{$prefix}%'",
+ $_SESSION['user_id']);
+ }
+}
diff --git a/plugins/debug_logger/debug_logger.php b/plugins/debug_logger/debug_logger.php
new file mode 100644
index 000000000..f04ba6a61
--- /dev/null
+++ b/plugins/debug_logger/debug_logger.php
@@ -0,0 +1,146 @@
+<?php
+
+/**
+ * Debug Logger
+ *
+ * Enhanced logging for debugging purposes. It is not recommened
+ * to be enabled on production systems without testing because of
+ * the somewhat increased memory, cpu and disk i/o overhead.
+ *
+ * Debug Logger listens for existing console("message") calls and
+ * introduces start and end tags as well as free form tagging
+ * which can redirect messages to files. The resulting log files
+ * provide timing and tag quantity results.
+ *
+ * Enable the plugin in config/main.inc.php and add your desired
+ * log types and files.
+ *
+ * @version 1.0
+ * @author Ziba Scott
+ * @website http://roundcube.net
+ *
+ * Example:
+ *
+ * config/main.inc.php:
+ *
+ * // $rcmail_config['debug_logger'][type of logging] = name of file in log_dir
+ * // The 'master' log includes timing information
+ * $rcmail_config['debug_logger']['master'] = 'master';
+ * // If you want sql messages to also go into a separate file
+ * $rcmail_config['debug_logger']['sql'] = 'sql';
+ *
+ * index.php (just after $RCMAIL->plugins->init()):
+ *
+ * console("my test","start");
+ * console("my message");
+ * console("my sql calls","start");
+ * console("cp -r * /dev/null","shell exec");
+ * console("select * from example","sql");
+ * console("select * from example","sql");
+ * console("select * from example","sql");
+ * console("end");
+ * console("end");
+ *
+ *
+ * logs/master (after reloading the main page):
+ *
+ * [17-Feb-2009 16:51:37 -0500] start: Task: mail.
+ * [17-Feb-2009 16:51:37 -0500] start: my test
+ * [17-Feb-2009 16:51:37 -0500] my message
+ * [17-Feb-2009 16:51:37 -0500] shell exec: cp -r * /dev/null
+ * [17-Feb-2009 16:51:37 -0500] start: my sql calls
+ * [17-Feb-2009 16:51:37 -0500] sql: select * from example
+ * [17-Feb-2009 16:51:37 -0500] sql: select * from example
+ * [17-Feb-2009 16:51:37 -0500] sql: select * from example
+ * [17-Feb-2009 16:51:37 -0500] end: my sql calls - 0.0018 seconds shell exec: 1, sql: 3,
+ * [17-Feb-2009 16:51:37 -0500] end: my test - 0.0055 seconds shell exec: 1, sql: 3,
+ * [17-Feb-2009 16:51:38 -0500] end: Task: mail. - 0.8854 seconds shell exec: 1, sql: 3,
+ *
+ * logs/sql (after reloading the main page):
+ *
+ * [17-Feb-2009 16:51:37 -0500] sql: select * from example
+ * [17-Feb-2009 16:51:37 -0500] sql: select * from example
+ * [17-Feb-2009 16:51:37 -0500] sql: select * from example
+ */
+class debug_logger extends rcube_plugin
+{
+ function init()
+ {
+ require_once(dirname(__FILE__).'/runlog/runlog.php');
+ $this->runlog = new runlog();
+
+ if(!rcmail::get_instance()->config->get('log_dir')){
+ rcmail::get_instance()->config->set('log_dir',INSTALL_PATH.'logs');
+ }
+
+ $log_config = rcmail::get_instance()->config->get('debug_logger',array());
+
+ foreach($log_config as $type=>$file){
+ $this->runlog->set_file(rcmail::get_instance()->config->get('log_dir').'/'.$file, $type);
+ }
+
+ $start_string = "";
+ $action = rcmail::get_instance()->action;
+ $task = rcmail::get_instance()->task;
+ if($action){
+ $start_string .= "Action: ".$action.". ";
+ }
+ if($task){
+ $start_string .= "Task: ".$task.". ";
+ }
+ $this->runlog->start($start_string);
+
+ $this->add_hook('console', array($this, 'console'));
+ $this->add_hook('authenticate', array($this, 'authenticate'));
+ }
+
+ function authenticate($args){
+ $this->runlog->note('Authenticating '.$args['user'].'@'.$args['host']);
+ return $args;
+ }
+
+ function console($args){
+ $note = $args[0];
+ $type = $args[1];
+
+
+ if(!isset($args[1])){
+ // This could be extended to detect types based on the
+ // file which called console. For now only rcube_imap.inc is supported
+ $bt = debug_backtrace();
+ $file = $bt[3]['file'];
+ switch(basename($file)){
+ case 'rcube_imap.php':
+ $type = 'imap';
+ break;
+ default:
+ $type = FALSE;
+ break;
+ }
+ }
+ switch($note){
+ case 'end':
+ $type = 'end';
+ break;
+ }
+
+
+ switch($type){
+ case 'start':
+ $this->runlog->start($note);
+ break;
+ case 'end':
+ $this->runlog->end();
+ break;
+ default:
+ $this->runlog->note($note, $type);
+ break;
+ }
+ return $args;
+ }
+
+ function __destruct(){
+ $this->runlog->end();
+ }
+}
+?>
diff --git a/plugins/debug_logger/runlog/runlog.php b/plugins/debug_logger/runlog/runlog.php
new file mode 100644
index 000000000..c9f672615
--- /dev/null
+++ b/plugins/debug_logger/runlog/runlog.php
@@ -0,0 +1,227 @@
+<?php
+
+/**
+ * runlog
+ *
+ * @author Ziba Scott <ziba@umich.edu>
+ */
+class runlog {
+
+ private $start_time = FALSE;
+
+ private $parent_stack = array();
+
+ public $print_to_console = FALSE;
+
+ private $file_handles = array();
+
+ private $indent = 0;
+
+ public $threshold = 0;
+
+ public $tag_count = array();
+
+ public $timestamp = "d-M-Y H:i:s O";
+
+ public $max_line_size = 150;
+
+ private $run_log = array();
+
+ function runlog()
+ {
+ $this->start_time = microtime( TRUE );
+ }
+
+ public function start( $name, $tag = FALSE )
+ {
+ $this->run_log[] = array( 'type' => 'start',
+ 'tag' => $tag,
+ 'index' => count($this->run_log),
+ 'value' => $name,
+ 'time' => microtime( TRUE ),
+ 'parents' => $this->parent_stack,
+ 'ended' => false,
+ );
+ $this->parent_stack[] = $name;
+
+ $this->print_to_console("start: ".$name, $tag, 'start');
+ $this->print_to_file("start: ".$name, $tag, 'start');
+ $this->indent++;
+ }
+
+ public function end()
+ {
+ $name = array_pop( $this->parent_stack );
+ foreach ( $this->run_log as $k => $entry ) {
+ if ( $entry['value'] == $name && $entry['type'] == 'start' && $entry['ended'] == false) {
+ $lastk = $k;
+ }
+ }
+ $start = $this->run_log[$lastk]['time'];
+ $this->run_log[$lastk]['duration'] = microtime( TRUE ) - $start;
+ $this->run_log[$lastk]['ended'] = true;
+
+ $this->run_log[] = array( 'type' => 'end',
+ 'tag' => $this->run_log[$lastk]['tag'],
+ 'index' => $lastk,
+ 'value' => $name,
+ 'time' => microtime( TRUE ),
+ 'duration' => microtime( TRUE ) - $start,
+ 'parents' => $this->parent_stack,
+ );
+ $this->indent--;
+ if($this->run_log[$lastk]['duration'] >= $this->threshold){
+ $tag_report = "";
+ foreach($this->tag_count as $tag=>$count){
+ $tag_report .= "$tag: $count, ";
+ }
+ if(!empty($tag_report)){
+// $tag_report = "\n$tag_report\n";
+ }
+ $end_txt = sprintf("end: $name - %0.4f seconds $tag_report", $this->run_log[$lastk]['duration'] );
+ $this->print_to_console($end_txt, $this->run_log[$lastk]['tag'] , 'end');
+ $this->print_to_file($end_txt, $this->run_log[$lastk]['tag'], 'end');
+ }
+ }
+
+ public function increase_tag_count($tag){
+ if(!isset($this->tag_count[$tag])){
+ $this->tag_count[$tag] = 0;
+ }
+ $this->tag_count[$tag]++;
+ }
+
+ public function get_text(){
+ $text = "";
+ foreach($this->run_log as $entry){
+ $text .= str_repeat(" ",count($entry['parents']));
+ if($entry['tag'] != 'text'){
+ $text .= $entry['tag'].': ';
+ }
+ $text .= $entry['value'];
+
+ if($entry['tag'] == 'end'){
+ $text .= sprintf(" - %0.4f seconds", $entry['duration'] );
+ }
+
+ $text .= "\n";
+ }
+ return $text;
+ }
+
+ public function set_file($filename, $tag = 'master'){
+ if(!isset($this->file_handle[$tag])){
+ $this->file_handles[$tag] = fopen($filename, 'a');
+ if(!$this->file_handles[$tag]){
+ trigger_error('Could not open file for writing: '.$filename);
+ }
+ }
+ }
+
+ public function note( $msg, $tag = FALSE )
+ {
+ if($tag){
+ $this->increase_tag_count($tag);
+ }
+ if ( is_array( $msg )) {
+ $msg = '<pre>' . print_r( $msg, TRUE ) . '</pre>';
+ }
+ $this->debug_messages[] = $msg;
+ $this->run_log[] = array( 'type' => 'note',
+ 'tag' => $tag ? $tag:"text",
+ 'value' => htmlentities($msg),
+ 'time' => microtime( TRUE ),
+ 'parents' => $this->parent_stack,
+ );
+
+ $this->print_to_file($msg, $tag);
+ $this->print_to_console($msg, $tag);
+
+ }
+
+ public function print_to_file($msg, $tag = FALSE, $type = FALSE){
+ if(!$tag){
+ $file_handle_tag = 'master';
+ }
+ else{
+ $file_handle_tag = $tag;
+ }
+ if($file_handle_tag != 'master' && isset($this->file_handles[$file_handle_tag])){
+ $buffer = $this->get_indent();
+ $buffer .= "$msg\n";
+ if(!empty($this->timestamp)){
+ $buffer = sprintf("[%s] %s",date($this->timestamp, mktime()), $buffer);
+ }
+ fwrite($this->file_handles[$file_handle_tag], wordwrap($buffer, $this->max_line_size, "\n "));
+ }
+ if(isset($this->file_handles['master']) && $this->file_handles['master']){
+ $buffer = $this->get_indent();
+ if($tag){
+ $buffer .= "$tag: ";
+ }
+ $msg = str_replace("\n","",$msg);
+ $buffer .= "$msg";
+ if(!empty($this->timestamp)){
+ $buffer = sprintf("[%s] %s",date($this->timestamp, mktime()), $buffer);
+ }
+ if(strlen($buffer) > $this->max_line_size){
+ $buffer = substr($buffer,0,$this->max_line_size - 3)."...";
+ }
+ fwrite($this->file_handles['master'], $buffer."\n");
+ }
+ }
+
+ public function print_to_console($msg, $tag=FALSE){
+ if($this->print_to_console){
+ if(is_array($this->print_to_console)){
+ if(in_array($tag, $this->print_to_console)){
+ echo $this->get_indent();
+ if($tag){
+ echo "$tag: ";
+ }
+ echo "$msg\n";
+ }
+ }
+ else{
+ echo $this->get_indent();
+ if($tag){
+ echo "$tag: ";
+ }
+ echo "$msg\n";
+ }
+ }
+ }
+
+ public function print_totals(){
+ $totals = array();
+ foreach ( $this->run_log as $k => $entry ) {
+ if ( $entry['type'] == 'start' && $entry['ended'] == true) {
+ $totals[$entry['value']]['duration'] += $entry['duration'];
+ $totals[$entry['value']]['count'] += 1;
+ }
+ }
+ if($this->file_handle){
+ foreach($totals as $name=>$details){
+ fwrite($this->file_handle,$name.": ".number_format($details['duration'],4)."sec, ".$details['count']." calls \n");
+ }
+ }
+ }
+
+ private function get_indent(){
+ $buf = "";
+ for($i = 0; $i < $this->indent; $i++){
+ $buf .= " ";
+ }
+ return $buf;
+ }
+
+
+ function __destruct(){
+ foreach($this->file_handles as $handle){
+ fclose($handle);
+ }
+ }
+
+}
+
+?>
diff --git a/plugins/emoticons/emoticons.php b/plugins/emoticons/emoticons.php
new file mode 100644
index 000000000..95f5ecf39
--- /dev/null
+++ b/plugins/emoticons/emoticons.php
@@ -0,0 +1,77 @@
+<?php
+
+/**
+ * Display Emoticons
+ *
+ * Sample plugin to replace emoticons in plain text message body with real icons
+ *
+ * @version 1.3
+ * @author Thomas Bruederli
+ * @author Aleksander Machniak
+ * @website http://roundcube.net
+ */
+class emoticons extends rcube_plugin
+{
+ public $task = 'mail';
+
+ function init()
+ {
+ $this->add_hook('message_part_after', array($this, 'replace'));
+ }
+
+ function replace($args)
+ {
+ // This is a lookbehind assertion which will exclude html entities
+ // E.g. situation when ";)" in "&quot;)" shouldn't be replaced by the icon
+ // It's so long because of assertion format restrictions
+ $entity = '(?<!&'
+ . '[a-zA-Z0-9]{2}' . '|' . '#[0-9]{2}' . '|'
+ . '[a-zA-Z0-9]{3}' . '|' . '#[0-9]{3}' . '|'
+ . '[a-zA-Z0-9]{4}' . '|' . '#[0-9]{4}' . '|'
+ . '[a-zA-Z0-9]{5}' . '|'
+ . '[a-zA-Z0-9]{6}' . '|'
+ . '[a-zA-Z0-9]{7}'
+ . ')';
+
+ // map of emoticon replacements
+ $map = array(
+ '/:\)/' => $this->img_tag('smiley-smile.gif', ':)' ),
+ '/:-\)/' => $this->img_tag('smiley-smile.gif', ':-)' ),
+ '/(?<!mailto):D/' => $this->img_tag('smiley-laughing.gif', ':D' ),
+ '/:-D/' => $this->img_tag('smiley-laughing.gif', ':-D' ),
+ '/:\(/' => $this->img_tag('smiley-frown.gif', ':(' ),
+ '/:-\(/' => $this->img_tag('smiley-frown.gif', ':-(' ),
+ '/'.$entity.';\)/' => $this->img_tag('smiley-wink.gif', ';)' ),
+ '/'.$entity.';-\)/' => $this->img_tag('smiley-wink.gif', ';-)' ),
+ '/8\)/' => $this->img_tag('smiley-cool.gif', '8)' ),
+ '/8-\)/' => $this->img_tag('smiley-cool.gif', '8-)' ),
+ '/(?<!mailto):O/i' => $this->img_tag('smiley-surprised.gif', ':O' ),
+ '/(?<!mailto):-O/i' => $this->img_tag('smiley-surprised.gif', ':-O' ),
+ '/(?<!mailto):P/i' => $this->img_tag('smiley-tongue-out.gif', ':P' ),
+ '/(?<!mailto):-P/i' => $this->img_tag('smiley-tongue-out.gif', ':-P' ),
+ '/(?<!mailto):@/i' => $this->img_tag('smiley-yell.gif', ':@' ),
+ '/(?<!mailto):-@/i' => $this->img_tag('smiley-yell.gif', ':-@' ),
+ '/O:\)/i' => $this->img_tag('smiley-innocent.gif', 'O:)' ),
+ '/O:-\)/i' => $this->img_tag('smiley-innocent.gif', 'O:-)' ),
+ '/(?<!mailto):$/' => $this->img_tag('smiley-embarassed.gif', ':$' ),
+ '/(?<!mailto):-$/' => $this->img_tag('smiley-embarassed.gif', ':-$' ),
+ '/(?<!mailto):\*/i' => $this->img_tag('smiley-kiss.gif', ':*' ),
+ '/(?<!mailto):-\*/i' => $this->img_tag('smiley-kiss.gif', ':-*' ),
+ '/(?<!mailto):S/i' => $this->img_tag('smiley-undecided.gif', ':S' ),
+ '/(?<!mailto):-S/i' => $this->img_tag('smiley-undecided.gif', ':-S' ),
+ );
+
+ if ($args['type'] == 'plain') {
+ $args['body'] = preg_replace(
+ array_keys($map), array_values($map), $args['body']);
+ }
+
+ return $args;
+ }
+
+ private function img_tag($ico, $title)
+ {
+ $path = './program/js/tiny_mce/plugins/emotions/img/';
+ return html::img(array('src' => $path.$ico, 'title' => $title));
+ }
+}
diff --git a/plugins/enigma/README b/plugins/enigma/README
new file mode 100644
index 000000000..afb23224c
--- /dev/null
+++ b/plugins/enigma/README
@@ -0,0 +1,35 @@
+------------------------------------------------------------------
+THIS IS NOT EVEN AN "ALPHA" STATE. USE ONLY FOR DEVELOPMENT!!!!!!!
+------------------------------------------------------------------
+
+WARNING: Don't use with gnupg-2.x!
+
+Enigma Plugin Status:
+
+* DONE:
+
+- PGP signed messages verification
+- Handling of PGP keys files attached to incoming messages
+- PGP encrypted messages decryption (started)
+- PGP keys management UI (started)
+
+* TODO (must have):
+
+- Parsing of decrypted messages into array (see rcube_mime_struct) and then into rcube_message_part structure
+ (create core class rcube_mime_parser or take over PEAR::Mail_mimeDecode package and improve it)
+- Sending encrypted/signed messages (probably some changes in core will be needed)
+- Per-Identity settings (including keys/certs) (+ split Identities details page into tabs)
+- Handling big messages with temp files (including changes in Roundcube core)
+- Performance improvements (some caching, code review)
+- better (and more) icons
+
+* TODO (later):
+
+- Keys generation
+- Certs generation
+- Keys/Certs info in Contacts details page (+ split Contact details page into tabs)
+- Key server support
+- S/MIME signed messages verification
+- S/MIME encrypted messages decryption
+- Handling of S/MIME certs files attached to incoming messages
+- SSL (S/MIME) Certs management
diff --git a/plugins/enigma/config.inc.php b/plugins/enigma/config.inc.php
new file mode 100644
index 000000000..ca841d0ac
--- /dev/null
+++ b/plugins/enigma/config.inc.php
@@ -0,0 +1,14 @@
+<?php
+
+// Enigma Plugin options
+// --------------------
+
+// A driver to use for PGP. Default: "gnupg".
+$rcmail_config['enigma_pgp_driver'] = 'gnupg';
+
+// A driver to use for S/MIME. Default: "phpssl".
+$rcmail_config['enigma_smime_driver'] = 'phpssl';
+
+// Keys directory for all users. Default 'enigma/home'.
+// Must be writeable by PHP process
+$rcmail_config['enigma_pgp_homedir'] = null;
diff --git a/plugins/enigma/enigma.js b/plugins/enigma/enigma.js
new file mode 100644
index 000000000..29c648224
--- /dev/null
+++ b/plugins/enigma/enigma.js
@@ -0,0 +1,206 @@
+/* Enigma Plugin */
+
+if (window.rcmail)
+{
+ rcmail.addEventListener('init', function(evt)
+ {
+ if (rcmail.env.task == 'settings') {
+ rcmail.register_command('plugin.enigma', function() { rcmail.goto_url('plugin.enigma') }, true);
+ rcmail.register_command('plugin.enigma-key-import', function() { rcmail.enigma_key_import() }, true);
+ rcmail.register_command('plugin.enigma-key-export', function() { rcmail.enigma_key_export() }, true);
+
+ if (rcmail.gui_objects.keyslist)
+ {
+ var p = rcmail;
+ rcmail.keys_list = new rcube_list_widget(rcmail.gui_objects.keyslist,
+ {multiselect:false, draggable:false, keyboard:false});
+ rcmail.keys_list.addEventListener('select', function(o){ p.enigma_key_select(o); });
+ rcmail.keys_list.init();
+ rcmail.keys_list.focus();
+
+ rcmail.enigma_list();
+
+ rcmail.register_command('firstpage', function(props) {return rcmail.enigma_list_page('first'); });
+ rcmail.register_command('previouspage', function(props) {return rcmail.enigma_list_page('previous'); });
+ rcmail.register_command('nextpage', function(props) {return rcmail.enigma_list_page('next'); });
+ rcmail.register_command('lastpage', function(props) {return rcmail.enigma_list_page('last'); });
+ }
+
+ if (rcmail.env.action == 'edit-prefs') {
+ rcmail.register_command('search', function(props) {return rcmail.enigma_search(props); }, true);
+ rcmail.register_command('reset-search', function(props) {return rcmail.enigma_search_reset(props); }, true);
+ }
+ else if (rcmail.env.action == 'plugin.enigma') {
+ rcmail.register_command('plugin.enigma-import', function() { rcmail.enigma_import() }, true);
+ rcmail.register_command('plugin.enigma-export', function() { rcmail.enigma_export() }, true);
+ }
+ }
+ });
+}
+
+/*********************************************************/
+/********* Enigma Settings/Keys/Certs UI *********/
+/*********************************************************/
+
+// Display key(s) import form
+rcube_webmail.prototype.enigma_key_import = function()
+{
+ this.enigma_loadframe(null, '&_a=keyimport');
+};
+
+// Submit key(s) form
+rcube_webmail.prototype.enigma_import = function()
+{
+ var form, file;
+ if (form = this.gui_objects.importform) {
+ file = document.getElementById('rcmimportfile');
+ if (file && !file.value) {
+ alert(this.get_label('selectimportfile'));
+ return;
+ }
+ form.submit();
+ this.set_busy(true, 'importwait');
+ this.lock_form(form, true);
+ }
+};
+
+// list row selection handler
+rcube_webmail.prototype.enigma_key_select = function(list)
+{
+ var id;
+ if (id = list.get_single_selection())
+ this.enigma_loadframe(id);
+};
+
+// load key frame
+rcube_webmail.prototype.enigma_loadframe = function(id, url)
+{
+ var frm, win;
+ if (this.env.contentframe && window.frames && (frm = window.frames[this.env.contentframe])) {
+ if (!id && !url && (win = window.frames[this.env.contentframe])) {
+ if (win.location && win.location.href.indexOf(this.env.blankpage)<0)
+ win.location.href = this.env.blankpage;
+ return;
+ }
+ this.set_busy(true);
+ if (!url)
+ url = '&_a=keyinfo&_id='+id;
+ frm.location.href = this.env.comm_path+'&_action=plugin.enigma&_framed=1' + url;
+ }
+};
+
+// Search keys/certs
+rcube_webmail.prototype.enigma_search = function(props)
+{
+ if (!props && this.gui_objects.qsearchbox)
+ props = this.gui_objects.qsearchbox.value;
+
+ if (props || this.env.search_request) {
+ var params = {'_a': 'keysearch', '_q': urlencode(props)},
+ lock = this.set_busy(true, 'searching');
+// if (this.gui_objects.search_filter)
+ // addurl += '&_filter=' + this.gui_objects.search_filter.value;
+ this.env.current_page = 1;
+ this.enigma_loadframe();
+ this.enigma_clear_list();
+ this.http_post('plugin.enigma', params, lock);
+ }
+
+ return false;
+}
+
+// Reset search filter and the list
+rcube_webmail.prototype.enigma_search_reset = function(props)
+{
+ var s = this.env.search_request;
+ this.reset_qsearch();
+
+ if (s) {
+ this.enigma_loadframe();
+ this.enigma_clear_list();
+
+ // refresh the list
+ this.enigma_list();
+ }
+
+ return false;
+}
+
+// Keys/certs listing
+rcube_webmail.prototype.enigma_list = function(page)
+{
+ var params = {'_a': 'keylist'},
+ lock = this.set_busy(true, 'loading');
+
+ this.env.current_page = page ? page : 1;
+
+ if (this.env.search_request)
+ params._q = this.env.search_request;
+ if (page)
+ params._p = page;
+
+ this.enigma_clear_list();
+ this.http_post('plugin.enigma', params, lock);
+}
+
+// Change list page
+rcube_webmail.prototype.enigma_list_page = function(page)
+{
+ if (page == 'next')
+ page = this.env.current_page + 1;
+ else if (page == 'last')
+ page = this.env.pagecount;
+ else if (page == 'prev' && this.env.current_page > 1)
+ page = this.env.current_page - 1;
+ else if (page == 'first' && this.env.current_page > 1)
+ page = 1;
+
+ this.enigma_list(page);
+}
+
+// Remove list rows
+rcube_webmail.prototype.enigma_clear_list = function()
+{
+ this.enigma_loadframe();
+ if (this.keys_list)
+ this.keys_list.clear(true);
+}
+
+// Adds a row to the list
+rcube_webmail.prototype.enigma_add_list_row = function(r)
+{
+ if (!this.gui_objects.keyslist || !this.keys_list)
+ return false;
+
+ var list = this.keys_list,
+ tbody = this.gui_objects.keyslist.tBodies[0],
+ rowcount = tbody.rows.length,
+ even = rowcount%2,
+ css_class = 'message'
+ + (even ? ' even' : ' odd'),
+ // for performance use DOM instead of jQuery here
+ row = document.createElement('tr'),
+ col = document.createElement('td');
+
+ row.id = 'rcmrow' + r.id;
+ row.className = css_class;
+
+ col.innerHTML = r.name;
+ row.appendChild(col);
+ list.insert_row(row);
+}
+
+/*********************************************************/
+/********* Enigma Message methods *********/
+/*********************************************************/
+
+// Import attached keys/certs file
+rcube_webmail.prototype.enigma_import_attachment = function(mime_id)
+{
+ var lock = this.set_busy(true, 'loading');
+ this.http_post('plugin.enigmaimport', '_uid='+this.env.uid+'&_mbox='
+ +urlencode(this.env.mailbox)+'&_part='+urlencode(mime_id), lock);
+
+ return false;
+};
+
diff --git a/plugins/enigma/enigma.php b/plugins/enigma/enigma.php
new file mode 100644
index 000000000..fb7c98635
--- /dev/null
+++ b/plugins/enigma/enigma.php
@@ -0,0 +1,475 @@
+<?php
+/*
+ +-------------------------------------------------------------------------+
+ | Enigma Plugin for Roundcube |
+ | Version 0.1 |
+ | |
+ | This program is free software; you can redistribute it and/or modify |
+ | it under the terms of the GNU General Public License version 2 |
+ | as published by the Free Software Foundation. |
+ | |
+ | This program is distributed in the hope that it will be useful, |
+ | but WITHOUT ANY WARRANTY; without even the implied warranty of |
+ | MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the |
+ | GNU General Public License for more details. |
+ | |
+ | You should have received a copy of the GNU General Public License along |
+ | with this program; if not, write to the Free Software Foundation, Inc., |
+ | 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. |
+ | |
+ +-------------------------------------------------------------------------+
+ | Author: Aleksander Machniak <alec@alec.pl> |
+ +-------------------------------------------------------------------------+
+*/
+
+/*
+ This class contains only hooks and action handlers.
+ Most plugin logic is placed in enigma_engine and enigma_ui classes.
+*/
+
+class enigma extends rcube_plugin
+{
+ public $task = 'mail|settings';
+ public $rc;
+ public $engine;
+
+ private $env_loaded;
+ private $message;
+ private $keys_parts = array();
+ private $keys_bodies = array();
+
+
+ /**
+ * Plugin initialization.
+ */
+ function init()
+ {
+ $rcmail = rcmail::get_instance();
+ $this->rc = $rcmail;
+
+ if ($this->rc->task == 'mail') {
+ // message parse/display hooks
+ $this->add_hook('message_part_structure', array($this, 'parse_structure'));
+ $this->add_hook('message_body_prefix', array($this, 'status_message'));
+
+ // message displaying
+ if ($rcmail->action == 'show' || $rcmail->action == 'preview') {
+ $this->add_hook('message_load', array($this, 'message_load'));
+ $this->add_hook('template_object_messagebody', array($this, 'message_output'));
+ $this->register_action('plugin.enigmaimport', array($this, 'import_file'));
+ }
+ // message composing
+ else if ($rcmail->action == 'compose') {
+ $this->load_ui();
+ $this->ui->init($section);
+ }
+ // message sending (and draft storing)
+ else if ($rcmail->action == 'sendmail') {
+ //$this->add_hook('outgoing_message_body', array($this, 'msg_encode'));
+ //$this->add_hook('outgoing_message_body', array($this, 'msg_sign'));
+ }
+ }
+ else if ($this->rc->task == 'settings') {
+ // add hooks for Enigma settings
+ $this->add_hook('preferences_sections_list', array($this, 'preferences_section'));
+ $this->add_hook('preferences_list', array($this, 'preferences_list'));
+ $this->add_hook('preferences_save', array($this, 'preferences_save'));
+
+ // register handler for keys/certs management
+ $this->register_action('plugin.enigma', array($this, 'preferences_ui'));
+
+ // grab keys/certs management iframe requests
+ $section = get_input_value('_section', RCUBE_INPUT_GET);
+ if ($this->rc->action == 'edit-prefs' && preg_match('/^enigma(certs|keys)/', $section)) {
+ $this->load_ui();
+ $this->ui->init($section);
+ }
+ }
+ }
+
+ /**
+ * Plugin environment initialization.
+ */
+ function load_env()
+ {
+ if ($this->env_loaded)
+ return;
+
+ $this->env_loaded = true;
+
+ // Add include path for Enigma classes and drivers
+ $include_path = $this->home . '/lib' . PATH_SEPARATOR;
+ $include_path .= ini_get('include_path');
+ set_include_path($include_path);
+
+ // load the Enigma plugin configuration
+ $this->load_config();
+
+ // include localization (if wasn't included before)
+ $this->add_texts('localization/');
+ }
+
+ /**
+ * Plugin UI initialization.
+ */
+ function load_ui()
+ {
+ if ($this->ui)
+ return;
+
+ // load config/localization
+ $this->load_env();
+
+ // Load UI
+ $this->ui = new enigma_ui($this, $this->home);
+ }
+
+ /**
+ * Plugin engine initialization.
+ */
+ function load_engine()
+ {
+ if ($this->engine)
+ return;
+
+ // load config/localization
+ $this->load_env();
+
+ $this->engine = new enigma_engine($this);
+ }
+
+ /**
+ * Handler for message_part_structure hook.
+ * Called for every part of the message.
+ *
+ * @param array Original parameters
+ *
+ * @return array Modified parameters
+ */
+ function parse_structure($p)
+ {
+ $struct = $p['structure'];
+
+ if ($p['mimetype'] == 'text/plain' || $p['mimetype'] == 'application/pgp') {
+ $this->parse_plain($p);
+ }
+ else if ($p['mimetype'] == 'multipart/signed') {
+ $this->parse_signed($p);
+ }
+ else if ($p['mimetype'] == 'multipart/encrypted') {
+ $this->parse_encrypted($p);
+ }
+ else if ($p['mimetype'] == 'application/pkcs7-mime') {
+ $this->parse_encrypted($p);
+ }
+
+ return $p;
+ }
+
+ /**
+ * Handler for preferences_sections_list hook.
+ * Adds Enigma settings sections into preferences sections list.
+ *
+ * @param array Original parameters
+ *
+ * @return array Modified parameters
+ */
+ function preferences_section($p)
+ {
+ // add labels
+ $this->add_texts('localization/');
+
+ $p['list']['enigmasettings'] = array(
+ 'id' => 'enigmasettings', 'section' => $this->gettext('enigmasettings'),
+ );
+ $p['list']['enigmacerts'] = array(
+ 'id' => 'enigmacerts', 'section' => $this->gettext('enigmacerts'),
+ );
+ $p['list']['enigmakeys'] = array(
+ 'id' => 'enigmakeys', 'section' => $this->gettext('enigmakeys'),
+ );
+
+ return $p;
+ }
+
+ /**
+ * Handler for preferences_list hook.
+ * Adds options blocks into Enigma settings sections in Preferences.
+ *
+ * @param array Original parameters
+ *
+ * @return array Modified parameters
+ */
+ function preferences_list($p)
+ {
+ if ($p['section'] == 'enigmasettings') {
+ // This makes that section is not removed from the list
+ $p['blocks']['dummy']['options']['dummy'] = array();
+ }
+ else if ($p['section'] == 'enigmacerts') {
+ // This makes that section is not removed from the list
+ $p['blocks']['dummy']['options']['dummy'] = array();
+ }
+ else if ($p['section'] == 'enigmakeys') {
+ // This makes that section is not removed from the list
+ $p['blocks']['dummy']['options']['dummy'] = array();
+ }
+
+ return $p;
+ }
+
+ /**
+ * Handler for preferences_save hook.
+ * Executed on Enigma settings form submit.
+ *
+ * @param array Original parameters
+ *
+ * @return array Modified parameters
+ */
+ function preferences_save($p)
+ {
+ if ($p['section'] == 'enigmasettings') {
+ $a['prefs'] = array(
+// 'dummy' => get_input_value('_dummy', RCUBE_INPUT_POST),
+ );
+ }
+
+ return $p;
+ }
+
+ /**
+ * Handler for keys/certs management UI template.
+ */
+ function preferences_ui()
+ {
+ $this->load_ui();
+ $this->ui->init();
+ }
+
+ /**
+ * Handler for message_body_prefix hook.
+ * Called for every displayed (content) part of the message.
+ * Adds infobox about signature verification and/or decryption
+ * status above the body.
+ *
+ * @param array Original parameters
+ *
+ * @return array Modified parameters
+ */
+ function status_message($p)
+ {
+ $part_id = $p['part']->mime_id;
+
+ // skip: not a message part
+ if ($p['part'] instanceof rcube_message)
+ return $p;
+
+ // skip: message has no signed/encoded content
+ if (!$this->engine)
+ return $p;
+
+ // Decryption status
+ if (isset($this->engine->decryptions[$part_id])) {
+
+ // get decryption status
+ $status = $this->engine->decryptions[$part_id];
+
+ // Load UI and add css script
+ $this->load_ui();
+ $this->ui->add_css();
+
+ // display status info
+ $attrib['id'] = 'enigma-message';
+
+ if ($status instanceof enigma_error) {
+ $attrib['class'] = 'enigmaerror';
+ $code = $status->getCode();
+ if ($code == enigma_error::E_KEYNOTFOUND)
+ $msg = Q(str_replace('$keyid', enigma_key::format_id($status->getData('id')),
+ $this->gettext('decryptnokey')));
+ else if ($code == enigma_error::E_BADPASS)
+ $msg = Q($this->gettext('decryptbadpass'));
+ else
+ $msg = Q($this->gettext('decrypterror'));
+ }
+ else {
+ $attrib['class'] = 'enigmanotice';
+ $msg = Q($this->gettext('decryptok'));
+ }
+
+ $p['prefix'] .= html::div($attrib, $msg);
+ }
+
+ // Signature verification status
+ if (isset($this->engine->signed_parts[$part_id])
+ && ($sig = $this->engine->signatures[$this->engine->signed_parts[$part_id]])
+ ) {
+ // add css script
+ $this->load_ui();
+ $this->ui->add_css();
+
+ // display status info
+ $attrib['id'] = 'enigma-message';
+
+ if ($sig instanceof enigma_signature) {
+ if ($sig->valid) {
+ $attrib['class'] = 'enigmanotice';
+ $sender = ($sig->name ? $sig->name . ' ' : '') . '<' . $sig->email . '>';
+ $msg = Q(str_replace('$sender', $sender, $this->gettext('sigvalid')));
+ }
+ else {
+ $attrib['class'] = 'enigmawarning';
+ $sender = ($sig->name ? $sig->name . ' ' : '') . '<' . $sig->email . '>';
+ $msg = Q(str_replace('$sender', $sender, $this->gettext('siginvalid')));
+ }
+ }
+ else if ($sig->getCode() == enigma_error::E_KEYNOTFOUND) {
+ $attrib['class'] = 'enigmawarning';
+ $msg = Q(str_replace('$keyid', enigma_key::format_id($sig->getData('id')),
+ $this->gettext('signokey')));
+ }
+ else {
+ $attrib['class'] = 'enigmaerror';
+ $msg = Q($this->gettext('sigerror'));
+ }
+/*
+ $msg .= '&nbsp;' . html::a(array('href' => "#sigdetails",
+ 'onclick' => JS_OBJECT_NAME.".command('enigma-sig-details')"),
+ Q($this->gettext('showdetails')));
+*/
+ // test
+// $msg .= '<br /><pre>'.$sig->body.'</pre>';
+
+ $p['prefix'] .= html::div($attrib, $msg);
+
+ // Display each signature message only once
+ unset($this->engine->signatures[$this->engine->signed_parts[$part_id]]);
+ }
+
+ return $p;
+ }
+
+ /**
+ * Handler for plain/text message.
+ *
+ * @param array Reference to hook's parameters (see enigma::parse_structure())
+ */
+ private function parse_plain(&$p)
+ {
+ $this->load_engine();
+ $this->engine->parse_plain($p);
+ }
+
+ /**
+ * Handler for multipart/signed message.
+ * Verifies signature.
+ *
+ * @param array Reference to hook's parameters (see enigma::parse_structure())
+ */
+ private function parse_signed(&$p)
+ {
+ $this->load_engine();
+ $this->engine->parse_signed($p);
+ }
+
+ /**
+ * Handler for multipart/encrypted and application/pkcs7-mime message.
+ *
+ * @param array Reference to hook's parameters (see enigma::parse_structure())
+ */
+ private function parse_encrypted(&$p)
+ {
+ $this->load_engine();
+ $this->engine->parse_encrypted($p);
+ }
+
+ /**
+ * Handler for message_load hook.
+ * Check message bodies and attachments for keys/certs.
+ */
+ function message_load($p)
+ {
+ $this->message = $p['object'];
+
+ // handle attachments vcard attachments
+ foreach ((array)$this->message->attachments as $attachment) {
+ if ($this->is_keys_part($attachment)) {
+ $this->keys_parts[] = $attachment->mime_id;
+ }
+ }
+ // the same with message bodies
+ foreach ((array)$this->message->parts as $idx => $part) {
+ if ($this->is_keys_part($part)) {
+ $this->keys_parts[] = $part->mime_id;
+ $this->keys_bodies[] = $part->mime_id;
+ }
+ }
+ // @TODO: inline PGP keys
+
+ if ($this->keys_parts) {
+ $this->add_texts('localization');
+ }
+ }
+
+ /**
+ * Handler for template_object_messagebody hook.
+ * This callback function adds a box below the message content
+ * if there is a key/cert attachment available
+ */
+ function message_output($p)
+ {
+ $attach_script = false;
+
+ foreach ($this->keys_parts as $part) {
+
+ // remove part's body
+ if (in_array($part, $this->keys_bodies))
+ $p['content'] = '';
+
+ $style = "margin:0 1em; padding:0.2em 0.5em; border:1px solid #999; width: auto"
+ ." border-radius:4px; -moz-border-radius:4px; -webkit-border-radius:4px";
+
+ // add box below messsage body
+ $p['content'] .= html::p(array('style' => $style),
+ html::a(array(
+ 'href' => "#",
+ 'onclick' => "return ".JS_OBJECT_NAME.".enigma_import_attachment('".JQ($part)."')",
+ 'title' => $this->gettext('keyattimport')),
+ html::img(array('src' => $this->url('skins/default/key_add.png'), 'style' => "vertical-align:middle")))
+ . ' ' . html::span(null, $this->gettext('keyattfound')));
+
+ $attach_script = true;
+ }
+
+ if ($attach_script) {
+ $this->include_script('enigma.js');
+ }
+
+ return $p;
+ }
+
+ /**
+ * Handler for attached keys/certs import
+ */
+ function import_file()
+ {
+ $this->load_engine();
+ $this->engine->import_file();
+ }
+
+ /**
+ * Checks if specified message part is a PGP-key or S/MIME cert data
+ *
+ * @param rcube_message_part Part object
+ *
+ * @return boolean True if part is a key/cert
+ */
+ private function is_keys_part($part)
+ {
+ // @TODO: S/MIME
+ return (
+ // Content-Type: application/pgp-keys
+ $part->mimetype == 'application/pgp-keys'
+ );
+ }
+}
diff --git a/plugins/enigma/home/.htaccess b/plugins/enigma/home/.htaccess
new file mode 100644
index 000000000..8e6a345dc
--- /dev/null
+++ b/plugins/enigma/home/.htaccess
@@ -0,0 +1,2 @@
+Order allow,deny
+Deny from all \ No newline at end of file
diff --git a/plugins/enigma/lib/Crypt/GPG.php b/plugins/enigma/lib/Crypt/GPG.php
new file mode 100644
index 000000000..6e8e717e8
--- /dev/null
+++ b/plugins/enigma/lib/Crypt/GPG.php
@@ -0,0 +1,2542 @@
+<?php
+
+/* vim: set expandtab tabstop=4 shiftwidth=4 softtabstop=4: */
+
+/**
+ * Crypt_GPG is a package to use GPG from PHP
+ *
+ * This package provides an object oriented interface to GNU Privacy
+ * Guard (GPG). It requires the GPG executable to be on the system.
+ *
+ * Though GPG can support symmetric-key cryptography, this package is intended
+ * only to facilitate public-key cryptography.
+ *
+ * This file contains the main GPG class. The class in this file lets you
+ * encrypt, decrypt, sign and verify data; import and delete keys; and perform
+ * other useful GPG tasks.
+ *
+ * Example usage:
+ * <code>
+ * <?php
+ * // encrypt some data
+ * $gpg = new Crypt_GPG();
+ * $gpg->addEncryptKey($mySecretKeyId);
+ * $encryptedData = $gpg->encrypt($data);
+ * ?>
+ * </code>
+ *
+ * PHP version 5
+ *
+ * LICENSE:
+ *
+ * This library is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU Lesser General Public License as
+ * published by the Free Software Foundation; either version 2.1 of the
+ * License, or (at your option) any later version.
+ *
+ * This library is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ * Lesser General Public License for more details.
+ *
+ * You should have received a copy of the GNU Lesser General Public
+ * License along with this library; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+ *
+ * @category Encryption
+ * @package Crypt_GPG
+ * @author Nathan Fredrickson <nathan@silverorange.com>
+ * @author Michael Gauthier <mike@silverorange.com>
+ * @copyright 2005-2010 silverorange
+ * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1
+ * @version CVS: $Id: GPG.php 302814 2010-08-26 15:43:07Z gauthierm $
+ * @link http://pear.php.net/package/Crypt_GPG
+ * @link http://pear.php.net/manual/en/package.encryption.crypt-gpg.php
+ * @link http://www.gnupg.org/
+ */
+
+/**
+ * Signature handler class
+ */
+require_once 'Crypt/GPG/VerifyStatusHandler.php';
+
+/**
+ * Decryption handler class
+ */
+require_once 'Crypt/GPG/DecryptStatusHandler.php';
+
+/**
+ * GPG key class
+ */
+require_once 'Crypt/GPG/Key.php';
+
+/**
+ * GPG sub-key class
+ */
+require_once 'Crypt/GPG/SubKey.php';
+
+/**
+ * GPG user id class
+ */
+require_once 'Crypt/GPG/UserId.php';
+
+/**
+ * GPG process and I/O engine class
+ */
+require_once 'Crypt/GPG/Engine.php';
+
+/**
+ * GPG exception classes
+ */
+require_once 'Crypt/GPG/Exceptions.php';
+
+// {{{ class Crypt_GPG
+
+/**
+ * A class to use GPG from PHP
+ *
+ * This class provides an object oriented interface to GNU Privacy Guard (GPG).
+ *
+ * Though GPG can support symmetric-key cryptography, this class is intended
+ * only to facilitate public-key cryptography.
+ *
+ * @category Encryption
+ * @package Crypt_GPG
+ * @author Nathan Fredrickson <nathan@silverorange.com>
+ * @author Michael Gauthier <mike@silverorange.com>
+ * @copyright 2005-2010 silverorange
+ * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1
+ * @link http://pear.php.net/package/Crypt_GPG
+ * @link http://www.gnupg.org/
+ */
+class Crypt_GPG
+{
+ // {{{ class error constants
+
+ /**
+ * Error code returned when there is no error.
+ */
+ const ERROR_NONE = 0;
+
+ /**
+ * Error code returned when an unknown or unhandled error occurs.
+ */
+ const ERROR_UNKNOWN = 1;
+
+ /**
+ * Error code returned when a bad passphrase is used.
+ */
+ const ERROR_BAD_PASSPHRASE = 2;
+
+ /**
+ * Error code returned when a required passphrase is missing.
+ */
+ const ERROR_MISSING_PASSPHRASE = 3;
+
+ /**
+ * Error code returned when a key that is already in the keyring is
+ * imported.
+ */
+ const ERROR_DUPLICATE_KEY = 4;
+
+ /**
+ * Error code returned the required data is missing for an operation.
+ *
+ * This could be missing key data, missing encrypted data or missing
+ * signature data.
+ */
+ const ERROR_NO_DATA = 5;
+
+ /**
+ * Error code returned when an unsigned key is used.
+ */
+ const ERROR_UNSIGNED_KEY = 6;
+
+ /**
+ * Error code returned when a key that is not self-signed is used.
+ */
+ const ERROR_NOT_SELF_SIGNED = 7;
+
+ /**
+ * Error code returned when a public or private key that is not in the
+ * keyring is used.
+ */
+ const ERROR_KEY_NOT_FOUND = 8;
+
+ /**
+ * Error code returned when an attempt to delete public key having a
+ * private key is made.
+ */
+ const ERROR_DELETE_PRIVATE_KEY = 9;
+
+ /**
+ * Error code returned when one or more bad signatures are detected.
+ */
+ const ERROR_BAD_SIGNATURE = 10;
+
+ /**
+ * Error code returned when there is a problem reading GnuPG data files.
+ */
+ const ERROR_FILE_PERMISSIONS = 11;
+
+ // }}}
+ // {{{ class constants for data signing modes
+
+ /**
+ * Signing mode for normal signing of data. The signed message will not
+ * be readable without special software.
+ *
+ * This is the default signing mode.
+ *
+ * @see Crypt_GPG::sign()
+ * @see Crypt_GPG::signFile()
+ */
+ const SIGN_MODE_NORMAL = 1;
+
+ /**
+ * Signing mode for clearsigning data. Clearsigned signatures are ASCII
+ * armored data and are readable without special software. If the signed
+ * message is unencrypted, the message will still be readable. The message
+ * text will be in the original encoding.
+ *
+ * @see Crypt_GPG::sign()
+ * @see Crypt_GPG::signFile()
+ */
+ const SIGN_MODE_CLEAR = 2;
+
+ /**
+ * Signing mode for creating a detached signature. When using detached
+ * signatures, only the signature data is returned. The original message
+ * text may be distributed separately from the signature data. This is
+ * useful for miltipart/signed email messages as per
+ * {@link http://www.ietf.org/rfc/rfc3156.txt RFC 3156}.
+ *
+ * @see Crypt_GPG::sign()
+ * @see Crypt_GPG::signFile()
+ */
+ const SIGN_MODE_DETACHED = 3;
+
+ // }}}
+ // {{{ class constants for fingerprint formats
+
+ /**
+ * No formatting is performed.
+ *
+ * Example: C3BC615AD9C766E5A85C1F2716D27458B1BBA1C4
+ *
+ * @see Crypt_GPG::getFingerprint()
+ */
+ const FORMAT_NONE = 1;
+
+ /**
+ * Fingerprint is formatted in the format used by the GnuPG gpg command's
+ * default output.
+ *
+ * Example: C3BC 615A D9C7 66E5 A85C 1F27 16D2 7458 B1BB A1C4
+ *
+ * @see Crypt_GPG::getFingerprint()
+ */
+ const FORMAT_CANONICAL = 2;
+
+ /**
+ * Fingerprint is formatted in the format used when displaying X.509
+ * certificates
+ *
+ * Example: C3:BC:61:5A:D9:C7:66:E5:A8:5C:1F:27:16:D2:74:58:B1:BB:A1:C4
+ *
+ * @see Crypt_GPG::getFingerprint()
+ */
+ const FORMAT_X509 = 3;
+
+ // }}}
+ // {{{ other class constants
+
+ /**
+ * URI at which package bugs may be reported.
+ */
+ const BUG_URI = 'http://pear.php.net/bugs/report.php?package=Crypt_GPG';
+
+ // }}}
+ // {{{ protected class properties
+
+ /**
+ * Engine used to control the GPG subprocess
+ *
+ * @var Crypt_GPG_Engine
+ *
+ * @see Crypt_GPG::setEngine()
+ */
+ protected $engine = null;
+
+ /**
+ * Keys used to encrypt
+ *
+ * The array is of the form:
+ * <code>
+ * array(
+ * $key_id => array(
+ * 'fingerprint' => $fingerprint,
+ * 'passphrase' => null
+ * )
+ * );
+ * </code>
+ *
+ * @var array
+ * @see Crypt_GPG::addEncryptKey()
+ * @see Crypt_GPG::clearEncryptKeys()
+ */
+ protected $encryptKeys = array();
+
+ /**
+ * Keys used to decrypt
+ *
+ * The array is of the form:
+ * <code>
+ * array(
+ * $key_id => array(
+ * 'fingerprint' => $fingerprint,
+ * 'passphrase' => $passphrase
+ * )
+ * );
+ * </code>
+ *
+ * @var array
+ * @see Crypt_GPG::addSignKey()
+ * @see Crypt_GPG::clearSignKeys()
+ */
+ protected $signKeys = array();
+
+ /**
+ * Keys used to sign
+ *
+ * The array is of the form:
+ * <code>
+ * array(
+ * $key_id => array(
+ * 'fingerprint' => $fingerprint,
+ * 'passphrase' => $passphrase
+ * )
+ * );
+ * </code>
+ *
+ * @var array
+ * @see Crypt_GPG::addDecryptKey()
+ * @see Crypt_GPG::clearDecryptKeys()
+ */
+ protected $decryptKeys = array();
+
+ // }}}
+ // {{{ __construct()
+
+ /**
+ * Creates a new GPG object
+ *
+ * Available options are:
+ *
+ * - <kbd>string homedir</kbd> - the directory where the GPG
+ * keyring files are stored. If not
+ * specified, Crypt_GPG uses the
+ * default of <kbd>~/.gnupg</kbd>.
+ * - <kbd>string publicKeyring</kbd> - the file path of the public
+ * keyring. Use this if the public
+ * keyring is not in the homedir, or
+ * if the keyring is in a directory
+ * not writable by the process
+ * invoking GPG (like Apache). Then
+ * you can specify the path to the
+ * keyring with this option
+ * (/foo/bar/pubring.gpg), and specify
+ * a writable directory (like /tmp)
+ * using the <i>homedir</i> option.
+ * - <kbd>string privateKeyring</kbd> - the file path of the private
+ * keyring. Use this if the private
+ * keyring is not in the homedir, or
+ * if the keyring is in a directory
+ * not writable by the process
+ * invoking GPG (like Apache). Then
+ * you can specify the path to the
+ * keyring with this option
+ * (/foo/bar/secring.gpg), and specify
+ * a writable directory (like /tmp)
+ * using the <i>homedir</i> option.
+ * - <kbd>string trustDb</kbd> - the file path of the web-of-trust
+ * database. Use this if the trust
+ * database is not in the homedir, or
+ * if the database is in a directory
+ * not writable by the process
+ * invoking GPG (like Apache). Then
+ * you can specify the path to the
+ * trust database with this option
+ * (/foo/bar/trustdb.gpg), and specify
+ * a writable directory (like /tmp)
+ * using the <i>homedir</i> option.
+ * - <kbd>string binary</kbd> - the location of the GPG binary. If
+ * not specified, the driver attempts
+ * to auto-detect the GPG binary
+ * location using a list of known
+ * default locations for the current
+ * operating system. The option
+ * <kbd>gpgBinary</kbd> is a
+ * deprecated alias for this option.
+ * - <kbd>boolean debug</kbd> - whether or not to use debug mode.
+ * When debug mode is on, all
+ * communication to and from the GPG
+ * subprocess is logged. This can be
+ *
+ * @param array $options optional. An array of options used to create the
+ * GPG object. All options are optional and are
+ * represented as key-value pairs.
+ *
+ * @throws Crypt_GPG_FileException if the <kbd>homedir</kbd> does not exist
+ * and cannot be created. This can happen if <kbd>homedir</kbd> is
+ * not specified, Crypt_GPG is run as the web user, and the web
+ * user has no home directory. This exception is also thrown if any
+ * of the options <kbd>publicKeyring</kbd>,
+ * <kbd>privateKeyring</kbd> or <kbd>trustDb</kbd> options are
+ * specified but the files do not exist or are are not readable.
+ * This can happen if the user running the Crypt_GPG process (for
+ * example, the Apache user) does not have permission to read the
+ * files.
+ *
+ * @throws PEAR_Exception if the provided <kbd>binary</kbd> is invalid, or
+ * if no <kbd>binary</kbd> is provided and no suitable binary could
+ * be found.
+ */
+ public function __construct(array $options = array())
+ {
+ $this->setEngine(new Crypt_GPG_Engine($options));
+ }
+
+ // }}}
+ // {{{ importKey()
+
+ /**
+ * Imports a public or private key into the keyring
+ *
+ * Keys may be removed from the keyring using
+ * {@link Crypt_GPG::deletePublicKey()} or
+ * {@link Crypt_GPG::deletePrivateKey()}.
+ *
+ * @param string $data the key data to be imported.
+ *
+ * @return array an associative array containing the following elements:
+ * - <kbd>fingerprint</kbd> - the fingerprint of the
+ * imported key,
+ * - <kbd>public_imported</kbd> - the number of public
+ * keys imported,
+ * - <kbd>public_unchanged</kbd> - the number of unchanged
+ * public keys,
+ * - <kbd>private_imported</kbd> - the number of private
+ * keys imported,
+ * - <kbd>private_unchanged</kbd> - the number of unchanged
+ * private keys.
+ *
+ * @throws Crypt_GPG_NoDataException if the key data is missing or if the
+ * data is is not valid key data.
+ *
+ * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs.
+ * Use the <kbd>debug</kbd> option and file a bug report if these
+ * exceptions occur.
+ */
+ public function importKey($data)
+ {
+ return $this->_importKey($data, false);
+ }
+
+ // }}}
+ // {{{ importKeyFile()
+
+ /**
+ * Imports a public or private key file into the keyring
+ *
+ * Keys may be removed from the keyring using
+ * {@link Crypt_GPG::deletePublicKey()} or
+ * {@link Crypt_GPG::deletePrivateKey()}.
+ *
+ * @param string $filename the key file to be imported.
+ *
+ * @return array an associative array containing the following elements:
+ * - <kbd>fingerprint</kbd> - the fingerprint of the
+ * imported key,
+ * - <kbd>public_imported</kbd> - the number of public
+ * keys imported,
+ * - <kbd>public_unchanged</kbd> - the number of unchanged
+ * public keys,
+ * - <kbd>private_imported</kbd> - the number of private
+ * keys imported,
+ * - <kbd>private_unchanged</kbd> - the number of unchanged
+ * private keys.
+ * private keys.
+ *
+ * @throws Crypt_GPG_NoDataException if the key data is missing or if the
+ * data is is not valid key data.
+ *
+ * @throws Crypt_GPG_FileException if the key file is not readable.
+ *
+ * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs.
+ * Use the <kbd>debug</kbd> option and file a bug report if these
+ * exceptions occur.
+ */
+ public function importKeyFile($filename)
+ {
+ return $this->_importKey($filename, true);
+ }
+
+ // }}}
+ // {{{ exportPublicKey()
+
+ /**
+ * Exports a public key from the keyring
+ *
+ * The exported key remains on the keyring. To delete the public key, use
+ * {@link Crypt_GPG::deletePublicKey()}.
+ *
+ * If more than one key fingerprint is available for the specified
+ * <kbd>$keyId</kbd> (for example, if you use a non-unique uid) only the
+ * first public key is exported.
+ *
+ * @param string $keyId either the full uid of the public key, the email
+ * part of the uid of the public key or the key id of
+ * the public key. For example,
+ * "Test User (example) <test@example.com>",
+ * "test@example.com" or a hexadecimal string.
+ * @param boolean $armor optional. If true, ASCII armored data is returned;
+ * otherwise, binary data is returned. Defaults to
+ * true.
+ *
+ * @return string the public key data.
+ *
+ * @throws Crypt_GPG_KeyNotFoundException if a public key with the given
+ * <kbd>$keyId</kbd> is not found.
+ *
+ * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs.
+ * Use the <kbd>debug</kbd> option and file a bug report if these
+ * exceptions occur.
+ */
+ public function exportPublicKey($keyId, $armor = true)
+ {
+ $fingerprint = $this->getFingerprint($keyId);
+
+ if ($fingerprint === null) {
+ throw new Crypt_GPG_KeyNotFoundException(
+ 'Public key not found: ' . $keyId,
+ Crypt_GPG::ERROR_KEY_NOT_FOUND, $keyId);
+ }
+
+ $keyData = '';
+ $operation = '--export ' . escapeshellarg($fingerprint);
+ $arguments = ($armor) ? array('--armor') : array();
+
+ $this->engine->reset();
+ $this->engine->setOutput($keyData);
+ $this->engine->setOperation($operation, $arguments);
+ $this->engine->run();
+
+ $code = $this->engine->getErrorCode();
+
+ if ($code !== Crypt_GPG::ERROR_NONE) {
+ throw new Crypt_GPG_Exception(
+ 'Unknown error exporting public key. Please use the ' .
+ '\'debug\' option when creating the Crypt_GPG object, and ' .
+ 'file a bug report at ' . self::BUG_URI, $code);
+ }
+
+ return $keyData;
+ }
+
+ // }}}
+ // {{{ deletePublicKey()
+
+ /**
+ * Deletes a public key from the keyring
+ *
+ * If more than one key fingerprint is available for the specified
+ * <kbd>$keyId</kbd> (for example, if you use a non-unique uid) only the
+ * first public key is deleted.
+ *
+ * The private key must be deleted first or an exception will be thrown.
+ * See {@link Crypt_GPG::deletePrivateKey()}.
+ *
+ * @param string $keyId either the full uid of the public key, the email
+ * part of the uid of the public key or the key id of
+ * the public key. For example,
+ * "Test User (example) <test@example.com>",
+ * "test@example.com" or a hexadecimal string.
+ *
+ * @return void
+ *
+ * @throws Crypt_GPG_KeyNotFoundException if a public key with the given
+ * <kbd>$keyId</kbd> is not found.
+ *
+ * @throws Crypt_GPG_DeletePrivateKeyException if the specified public key
+ * has an associated private key on the keyring. The private key
+ * must be deleted first.
+ *
+ * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs.
+ * Use the <kbd>debug</kbd> option and file a bug report if these
+ * exceptions occur.
+ */
+ public function deletePublicKey($keyId)
+ {
+ $fingerprint = $this->getFingerprint($keyId);
+
+ if ($fingerprint === null) {
+ throw new Crypt_GPG_KeyNotFoundException(
+ 'Public key not found: ' . $keyId,
+ Crypt_GPG::ERROR_KEY_NOT_FOUND, $keyId);
+ }
+
+ $operation = '--delete-key ' . escapeshellarg($fingerprint);
+ $arguments = array(
+ '--batch',
+ '--yes'
+ );
+
+ $this->engine->reset();
+ $this->engine->setOperation($operation, $arguments);
+ $this->engine->run();
+
+ $code = $this->engine->getErrorCode();
+
+ switch ($code) {
+ case Crypt_GPG::ERROR_NONE:
+ break;
+ case Crypt_GPG::ERROR_DELETE_PRIVATE_KEY:
+ throw new Crypt_GPG_DeletePrivateKeyException(
+ 'Private key must be deleted before public key can be ' .
+ 'deleted.', $code, $keyId);
+ default:
+ throw new Crypt_GPG_Exception(
+ 'Unknown error deleting public key. Please use the ' .
+ '\'debug\' option when creating the Crypt_GPG object, and ' .
+ 'file a bug report at ' . self::BUG_URI, $code);
+ }
+ }
+
+ // }}}
+ // {{{ deletePrivateKey()
+
+ /**
+ * Deletes a private key from the keyring
+ *
+ * If more than one key fingerprint is available for the specified
+ * <kbd>$keyId</kbd> (for example, if you use a non-unique uid) only the
+ * first private key is deleted.
+ *
+ * Calls GPG with the <kbd>--delete-secret-key</kbd> command.
+ *
+ * @param string $keyId either the full uid of the private key, the email
+ * part of the uid of the private key or the key id of
+ * the private key. For example,
+ * "Test User (example) <test@example.com>",
+ * "test@example.com" or a hexadecimal string.
+ *
+ * @return void
+ *
+ * @throws Crypt_GPG_KeyNotFoundException if a private key with the given
+ * <kbd>$keyId</kbd> is not found.
+ *
+ * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs.
+ * Use the <kbd>debug</kbd> option and file a bug report if these
+ * exceptions occur.
+ */
+ public function deletePrivateKey($keyId)
+ {
+ $fingerprint = $this->getFingerprint($keyId);
+
+ if ($fingerprint === null) {
+ throw new Crypt_GPG_KeyNotFoundException(
+ 'Private key not found: ' . $keyId,
+ Crypt_GPG::ERROR_KEY_NOT_FOUND, $keyId);
+ }
+
+ $operation = '--delete-secret-key ' . escapeshellarg($fingerprint);
+ $arguments = array(
+ '--batch',
+ '--yes'
+ );
+
+ $this->engine->reset();
+ $this->engine->setOperation($operation, $arguments);
+ $this->engine->run();
+
+ $code = $this->engine->getErrorCode();
+
+ switch ($code) {
+ case Crypt_GPG::ERROR_NONE:
+ break;
+ case Crypt_GPG::ERROR_KEY_NOT_FOUND:
+ throw new Crypt_GPG_KeyNotFoundException(
+ 'Private key not found: ' . $keyId,
+ $code, $keyId);
+ default:
+ throw new Crypt_GPG_Exception(
+ 'Unknown error deleting private key. Please use the ' .
+ '\'debug\' option when creating the Crypt_GPG object, and ' .
+ 'file a bug report at ' . self::BUG_URI, $code);
+ }
+ }
+
+ // }}}
+ // {{{ getKeys()
+
+ /**
+ * Gets the available keys in the keyring
+ *
+ * Calls GPG with the <kbd>--list-keys</kbd> command and grabs keys. See
+ * the first section of <b>doc/DETAILS</b> in the
+ * {@link http://www.gnupg.org/download/ GPG package} for a detailed
+ * description of how the GPG command output is parsed.
+ *
+ * @param string $keyId optional. Only keys with that match the specified
+ * pattern are returned. The pattern may be part of
+ * a user id, a key id or a key fingerprint. If not
+ * specified, all keys are returned.
+ *
+ * @return array an array of {@link Crypt_GPG_Key} objects. If no keys
+ * match the specified <kbd>$keyId</kbd> an empty array is
+ * returned.
+ *
+ * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs.
+ * Use the <kbd>debug</kbd> option and file a bug report if these
+ * exceptions occur.
+ *
+ * @see Crypt_GPG_Key
+ */
+ public function getKeys($keyId = '')
+ {
+ // get private key fingerprints
+ if ($keyId == '') {
+ $operation = '--list-secret-keys';
+ } else {
+ $operation = '--list-secret-keys ' . escapeshellarg($keyId);
+ }
+
+ // According to The file 'doc/DETAILS' in the GnuPG distribution, using
+ // double '--with-fingerprint' also prints the fingerprint for subkeys.
+ $arguments = array(
+ '--with-colons',
+ '--with-fingerprint',
+ '--with-fingerprint',
+ '--fixed-list-mode'
+ );
+
+ $output = '';
+
+ $this->engine->reset();
+ $this->engine->setOutput($output);
+ $this->engine->setOperation($operation, $arguments);
+ $this->engine->run();
+
+ $code = $this->engine->getErrorCode();
+
+ switch ($code) {
+ case Crypt_GPG::ERROR_NONE:
+ case Crypt_GPG::ERROR_KEY_NOT_FOUND:
+ // ignore not found key errors
+ break;
+ case Crypt_GPG::ERROR_FILE_PERMISSIONS:
+ $filename = $this->engine->getErrorFilename();
+ if ($filename) {
+ throw new Crypt_GPG_FileException(sprintf(
+ 'Error reading GnuPG data file \'%s\'. Check to make ' .
+ 'sure it is readable by the current user.', $filename),
+ $code, $filename);
+ }
+ throw new Crypt_GPG_FileException(
+ 'Error reading GnuPG data file. Check to make GnuPG data ' .
+ 'files are readable by the current user.', $code);
+ default:
+ throw new Crypt_GPG_Exception(
+ 'Unknown error getting keys. Please use the \'debug\' option ' .
+ 'when creating the Crypt_GPG object, and file a bug report ' .
+ 'at ' . self::BUG_URI, $code);
+ }
+
+ $privateKeyFingerprints = array();
+
+ $lines = explode(PHP_EOL, $output);
+ foreach ($lines as $line) {
+ $lineExp = explode(':', $line);
+ if ($lineExp[0] == 'fpr') {
+ $privateKeyFingerprints[] = $lineExp[9];
+ }
+ }
+
+ // get public keys
+ if ($keyId == '') {
+ $operation = '--list-public-keys';
+ } else {
+ $operation = '--list-public-keys ' . escapeshellarg($keyId);
+ }
+
+ $output = '';
+
+ $this->engine->reset();
+ $this->engine->setOutput($output);
+ $this->engine->setOperation($operation, $arguments);
+ $this->engine->run();
+
+ $code = $this->engine->getErrorCode();
+
+ switch ($code) {
+ case Crypt_GPG::ERROR_NONE:
+ case Crypt_GPG::ERROR_KEY_NOT_FOUND:
+ // ignore not found key errors
+ break;
+ case Crypt_GPG::ERROR_FILE_PERMISSIONS:
+ $filename = $this->engine->getErrorFilename();
+ if ($filename) {
+ throw new Crypt_GPG_FileException(sprintf(
+ 'Error reading GnuPG data file \'%s\'. Check to make ' .
+ 'sure it is readable by the current user.', $filename),
+ $code, $filename);
+ }
+ throw new Crypt_GPG_FileException(
+ 'Error reading GnuPG data file. Check to make GnuPG data ' .
+ 'files are readable by the current user.', $code);
+ default:
+ throw new Crypt_GPG_Exception(
+ 'Unknown error getting keys. Please use the \'debug\' option ' .
+ 'when creating the Crypt_GPG object, and file a bug report ' .
+ 'at ' . self::BUG_URI, $code);
+ }
+
+ $keys = array();
+
+ $key = null; // current key
+ $subKey = null; // current sub-key
+
+ $lines = explode(PHP_EOL, $output);
+ foreach ($lines as $line) {
+ $lineExp = explode(':', $line);
+
+ if ($lineExp[0] == 'pub') {
+
+ // new primary key means last key should be added to the array
+ if ($key !== null) {
+ $keys[] = $key;
+ }
+
+ $key = new Crypt_GPG_Key();
+
+ $subKey = Crypt_GPG_SubKey::parse($line);
+ $key->addSubKey($subKey);
+
+ } elseif ($lineExp[0] == 'sub') {
+
+ $subKey = Crypt_GPG_SubKey::parse($line);
+ $key->addSubKey($subKey);
+
+ } elseif ($lineExp[0] == 'fpr') {
+
+ $fingerprint = $lineExp[9];
+
+ // set current sub-key fingerprint
+ $subKey->setFingerprint($fingerprint);
+
+ // if private key exists, set has private to true
+ if (in_array($fingerprint, $privateKeyFingerprints)) {
+ $subKey->setHasPrivate(true);
+ }
+
+ } elseif ($lineExp[0] == 'uid') {
+
+ $string = stripcslashes($lineExp[9]); // as per documentation
+ $userId = new Crypt_GPG_UserId($string);
+
+ if ($lineExp[1] == 'r') {
+ $userId->setRevoked(true);
+ }
+
+ $key->addUserId($userId);
+
+ }
+ }
+
+ // add last key
+ if ($key !== null) {
+ $keys[] = $key;
+ }
+
+ return $keys;
+ }
+
+ // }}}
+ // {{{ getFingerprint()
+
+ /**
+ * Gets a key fingerprint from the keyring
+ *
+ * If more than one key fingerprint is available (for example, if you use
+ * a non-unique user id) only the first key fingerprint is returned.
+ *
+ * Calls the GPG <kbd>--list-keys</kbd> command with the
+ * <kbd>--with-fingerprint</kbd> option to retrieve a public key
+ * fingerprint.
+ *
+ * @param string $keyId either the full user id of the key, the email
+ * part of the user id of the key, or the key id of
+ * the key. For example,
+ * "Test User (example) <test@example.com>",
+ * "test@example.com" or a hexadecimal string.
+ * @param integer $format optional. How the fingerprint should be formatted.
+ * Use {@link Crypt_GPG::FORMAT_X509} for X.509
+ * certificate format,
+ * {@link Crypt_GPG::FORMAT_CANONICAL} for the format
+ * used by GnuPG output and
+ * {@link Crypt_GPG::FORMAT_NONE} for no formatting.
+ * Defaults to <code>Crypt_GPG::FORMAT_NONE</code>.
+ *
+ * @return string the fingerprint of the key, or null if no fingerprint
+ * is found for the given <kbd>$keyId</kbd>.
+ *
+ * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs.
+ * Use the <kbd>debug</kbd> option and file a bug report if these
+ * exceptions occur.
+ */
+ public function getFingerprint($keyId, $format = Crypt_GPG::FORMAT_NONE)
+ {
+ $output = '';
+ $operation = '--list-keys ' . escapeshellarg($keyId);
+ $arguments = array(
+ '--with-colons',
+ '--with-fingerprint'
+ );
+
+ $this->engine->reset();
+ $this->engine->setOutput($output);
+ $this->engine->setOperation($operation, $arguments);
+ $this->engine->run();
+
+ $code = $this->engine->getErrorCode();
+
+ switch ($code) {
+ case Crypt_GPG::ERROR_NONE:
+ case Crypt_GPG::ERROR_KEY_NOT_FOUND:
+ // ignore not found key errors
+ break;
+ default:
+ throw new Crypt_GPG_Exception(
+ 'Unknown error getting key fingerprint. Please use the ' .
+ '\'debug\' option when creating the Crypt_GPG object, and ' .
+ 'file a bug report at ' . self::BUG_URI, $code);
+ }
+
+ $fingerprint = null;
+
+ $lines = explode(PHP_EOL, $output);
+ foreach ($lines as $line) {
+ if (substr($line, 0, 3) == 'fpr') {
+ $lineExp = explode(':', $line);
+ $fingerprint = $lineExp[9];
+
+ switch ($format) {
+ case Crypt_GPG::FORMAT_CANONICAL:
+ $fingerprintExp = str_split($fingerprint, 4);
+ $format = '%s %s %s %s %s %s %s %s %s %s';
+ $fingerprint = vsprintf($format, $fingerprintExp);
+ break;
+
+ case Crypt_GPG::FORMAT_X509:
+ $fingerprintExp = str_split($fingerprint, 2);
+ $fingerprint = implode(':', $fingerprintExp);
+ break;
+ }
+
+ break;
+ }
+ }
+
+ return $fingerprint;
+ }
+
+ // }}}
+ // {{{ encrypt()
+
+ /**
+ * Encrypts string data
+ *
+ * Data is ASCII armored by default but may optionally be returned as
+ * binary.
+ *
+ * @param string $data the data to be encrypted.
+ * @param boolean $armor optional. If true, ASCII armored data is returned;
+ * otherwise, binary data is returned. Defaults to
+ * true.
+ *
+ * @return string the encrypted data.
+ *
+ * @throws Crypt_GPG_KeyNotFoundException if no encryption key is specified.
+ * See {@link Crypt_GPG::addEncryptKey()}.
+ *
+ * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs.
+ * Use the <kbd>debug</kbd> option and file a bug report if these
+ * exceptions occur.
+ *
+ * @sensitive $data
+ */
+ public function encrypt($data, $armor = true)
+ {
+ return $this->_encrypt($data, false, null, $armor);
+ }
+
+ // }}}
+ // {{{ encryptFile()
+
+ /**
+ * Encrypts a file
+ *
+ * Encrypted data is ASCII armored by default but may optionally be saved
+ * as binary.
+ *
+ * @param string $filename the filename of the file to encrypt.
+ * @param string $encryptedFile optional. The filename of the file in
+ * which to store the encrypted data. If null
+ * or unspecified, the encrypted data is
+ * returned as a string.
+ * @param boolean $armor optional. If true, ASCII armored data is
+ * returned; otherwise, binary data is
+ * returned. Defaults to true.
+ *
+ * @return void|string if the <kbd>$encryptedFile</kbd> parameter is null,
+ * a string containing the encrypted data is returned.
+ *
+ * @throws Crypt_GPG_KeyNotFoundException if no encryption key is specified.
+ * See {@link Crypt_GPG::addEncryptKey()}.
+ *
+ * @throws Crypt_GPG_FileException if the output file is not writeable or
+ * if the input file is not readable.
+ *
+ * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs.
+ * Use the <kbd>debug</kbd> option and file a bug report if these
+ * exceptions occur.
+ */
+ public function encryptFile($filename, $encryptedFile = null, $armor = true)
+ {
+ return $this->_encrypt($filename, true, $encryptedFile, $armor);
+ }
+
+ // }}}
+ // {{{ encryptAndSign()
+
+ /**
+ * Encrypts and signs data
+ *
+ * Data is encrypted and signed in a single pass.
+ *
+ * NOTE: Until GnuPG version 1.4.10, it was not possible to verify
+ * encrypted-signed data without decrypting it at the same time. If you try
+ * to use {@link Crypt_GPG::verify()} method on encrypted-signed data with
+ * earlier GnuPG versions, you will get an error. Please use
+ * {@link Crypt_GPG::decryptAndVerify()} to verify encrypted-signed data.
+ *
+ * @param string $data the data to be encrypted and signed.
+ * @param boolean $armor optional. If true, ASCII armored data is returned;
+ * otherwise, binary data is returned. Defaults to
+ * true.
+ *
+ * @return string the encrypted signed data.
+ *
+ * @throws Crypt_GPG_KeyNotFoundException if no encryption key is specified
+ * or if no signing key is specified. See
+ * {@link Crypt_GPG::addEncryptKey()} and
+ * {@link Crypt_GPG::addSignKey()}.
+ *
+ * @throws Crypt_GPG_BadPassphraseException if a specified passphrase is
+ * incorrect or if a required passphrase is not specified.
+ *
+ * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs.
+ * Use the <kbd>debug</kbd> option and file a bug report if these
+ * exceptions occur.
+ *
+ * @see Crypt_GPG::decryptAndVerify()
+ */
+ public function encryptAndSign($data, $armor = true)
+ {
+ return $this->_encryptAndSign($data, false, null, $armor);
+ }
+
+ // }}}
+ // {{{ encryptAndSignFile()
+
+ /**
+ * Encrypts and signs a file
+ *
+ * The file is encrypted and signed in a single pass.
+ *
+ * NOTE: Until GnuPG version 1.4.10, it was not possible to verify
+ * encrypted-signed files without decrypting them at the same time. If you
+ * try to use {@link Crypt_GPG::verify()} method on encrypted-signed files
+ * with earlier GnuPG versions, you will get an error. Please use
+ * {@link Crypt_GPG::decryptAndVerifyFile()} to verify encrypted-signed
+ * files.
+ *
+ * @param string $filename the name of the file containing the data to
+ * be encrypted and signed.
+ * @param string $signedFile optional. The name of the file in which the
+ * encrypted, signed data should be stored. If
+ * null or unspecified, the encrypted, signed
+ * data is returned as a string.
+ * @param boolean $armor optional. If true, ASCII armored data is
+ * returned; otherwise, binary data is returned.
+ * Defaults to true.
+ *
+ * @return void|string if the <kbd>$signedFile</kbd> parameter is null, a
+ * string containing the encrypted, signed data is
+ * returned.
+ *
+ * @throws Crypt_GPG_KeyNotFoundException if no encryption key is specified
+ * or if no signing key is specified. See
+ * {@link Crypt_GPG::addEncryptKey()} and
+ * {@link Crypt_GPG::addSignKey()}.
+ *
+ * @throws Crypt_GPG_BadPassphraseException if a specified passphrase is
+ * incorrect or if a required passphrase is not specified.
+ *
+ * @throws Crypt_GPG_FileException if the output file is not writeable or
+ * if the input file is not readable.
+ *
+ * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs.
+ * Use the <kbd>debug</kbd> option and file a bug report if these
+ * exceptions occur.
+ *
+ * @see Crypt_GPG::decryptAndVerifyFile()
+ */
+ public function encryptAndSignFile($filename, $signedFile = null,
+ $armor = true
+ ) {
+ return $this->_encryptAndSign($filename, true, $signedFile, $armor);
+ }
+
+ // }}}
+ // {{{ decrypt()
+
+ /**
+ * Decrypts string data
+ *
+ * This method assumes the required private key is available in the keyring
+ * and throws an exception if the private key is not available. To add a
+ * private key to the keyring, use the {@link Crypt_GPG::importKey()} or
+ * {@link Crypt_GPG::importKeyFile()} methods.
+ *
+ * @param string $encryptedData the data to be decrypted.
+ *
+ * @return string the decrypted data.
+ *
+ * @throws Crypt_GPG_KeyNotFoundException if the private key needed to
+ * decrypt the data is not in the user's keyring.
+ *
+ * @throws Crypt_GPG_NoDataException if specified data does not contain
+ * GPG encrypted data.
+ *
+ * @throws Crypt_GPG_BadPassphraseException if a required passphrase is
+ * incorrect or if a required passphrase is not specified. See
+ * {@link Crypt_GPG::addDecryptKey()}.
+ *
+ * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs.
+ * Use the <kbd>debug</kbd> option and file a bug report if these
+ * exceptions occur.
+ */
+ public function decrypt($encryptedData)
+ {
+ return $this->_decrypt($encryptedData, false, null);
+ }
+
+ // }}}
+ // {{{ decryptFile()
+
+ /**
+ * Decrypts a file
+ *
+ * This method assumes the required private key is available in the keyring
+ * and throws an exception if the private key is not available. To add a
+ * private key to the keyring, use the {@link Crypt_GPG::importKey()} or
+ * {@link Crypt_GPG::importKeyFile()} methods.
+ *
+ * @param string $encryptedFile the name of the encrypted file data to
+ * decrypt.
+ * @param string $decryptedFile optional. The name of the file to which the
+ * decrypted data should be written. If null
+ * or unspecified, the decrypted data is
+ * returned as a string.
+ *
+ * @return void|string if the <kbd>$decryptedFile</kbd> parameter is null,
+ * a string containing the decrypted data is returned.
+ *
+ * @throws Crypt_GPG_KeyNotFoundException if the private key needed to
+ * decrypt the data is not in the user's keyring.
+ *
+ * @throws Crypt_GPG_NoDataException if specified data does not contain
+ * GPG encrypted data.
+ *
+ * @throws Crypt_GPG_BadPassphraseException if a required passphrase is
+ * incorrect or if a required passphrase is not specified. See
+ * {@link Crypt_GPG::addDecryptKey()}.
+ *
+ * @throws Crypt_GPG_FileException if the output file is not writeable or
+ * if the input file is not readable.
+ *
+ * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs.
+ * Use the <kbd>debug</kbd> option and file a bug report if these
+ * exceptions occur.
+ */
+ public function decryptFile($encryptedFile, $decryptedFile = null)
+ {
+ return $this->_decrypt($encryptedFile, true, $decryptedFile);
+ }
+
+ // }}}
+ // {{{ decryptAndVerify()
+
+ /**
+ * Decrypts and verifies string data
+ *
+ * This method assumes the required private key is available in the keyring
+ * and throws an exception if the private key is not available. To add a
+ * private key to the keyring, use the {@link Crypt_GPG::importKey()} or
+ * {@link Crypt_GPG::importKeyFile()} methods.
+ *
+ * @param string $encryptedData the encrypted, signed data to be decrypted
+ * and verified.
+ *
+ * @return array two element array. The array has an element 'data'
+ * containing the decrypted data and an element
+ * 'signatures' containing an array of
+ * {@link Crypt_GPG_Signature} objects for the signed data.
+ *
+ * @throws Crypt_GPG_KeyNotFoundException if the private key needed to
+ * decrypt the data is not in the user's keyring.
+ *
+ * @throws Crypt_GPG_NoDataException if specified data does not contain
+ * GPG encrypted data.
+ *
+ * @throws Crypt_GPG_BadPassphraseException if a required passphrase is
+ * incorrect or if a required passphrase is not specified. See
+ * {@link Crypt_GPG::addDecryptKey()}.
+ *
+ * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs.
+ * Use the <kbd>debug</kbd> option and file a bug report if these
+ * exceptions occur.
+ */
+ public function decryptAndVerify($encryptedData)
+ {
+ return $this->_decryptAndVerify($encryptedData, false, null);
+ }
+
+ // }}}
+ // {{{ decryptAndVerifyFile()
+
+ /**
+ * Decrypts and verifies a signed, encrypted file
+ *
+ * This method assumes the required private key is available in the keyring
+ * and throws an exception if the private key is not available. To add a
+ * private key to the keyring, use the {@link Crypt_GPG::importKey()} or
+ * {@link Crypt_GPG::importKeyFile()} methods.
+ *
+ * @param string $encryptedFile the name of the signed, encrypted file to
+ * to decrypt and verify.
+ * @param string $decryptedFile optional. The name of the file to which the
+ * decrypted data should be written. If null
+ * or unspecified, the decrypted data is
+ * returned in the results array.
+ *
+ * @return array two element array. The array has an element 'data'
+ * containing the decrypted data and an element
+ * 'signatures' containing an array of
+ * {@link Crypt_GPG_Signature} objects for the signed data.
+ * If the decrypted data is written to a file, the 'data'
+ * element is null.
+ *
+ * @throws Crypt_GPG_KeyNotFoundException if the private key needed to
+ * decrypt the data is not in the user's keyring.
+ *
+ * @throws Crypt_GPG_NoDataException if specified data does not contain
+ * GPG encrypted data.
+ *
+ * @throws Crypt_GPG_BadPassphraseException if a required passphrase is
+ * incorrect or if a required passphrase is not specified. See
+ * {@link Crypt_GPG::addDecryptKey()}.
+ *
+ * @throws Crypt_GPG_FileException if the output file is not writeable or
+ * if the input file is not readable.
+ *
+ * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs.
+ * Use the <kbd>debug</kbd> option and file a bug report if these
+ * exceptions occur.
+ */
+ public function decryptAndVerifyFile($encryptedFile, $decryptedFile = null)
+ {
+ return $this->_decryptAndVerify($encryptedFile, true, $decryptedFile);
+ }
+
+ // }}}
+ // {{{ sign()
+
+ /**
+ * Signs data
+ *
+ * Data may be signed using any one of the three available signing modes:
+ * - {@link Crypt_GPG::SIGN_MODE_NORMAL}
+ * - {@link Crypt_GPG::SIGN_MODE_CLEAR}
+ * - {@link Crypt_GPG::SIGN_MODE_DETACHED}
+ *
+ * @param string $data the data to be signed.
+ * @param boolean $mode optional. The data signing mode to use. Should
+ * be one of {@link Crypt_GPG::SIGN_MODE_NORMAL},
+ * {@link Crypt_GPG::SIGN_MODE_CLEAR} or
+ * {@link Crypt_GPG::SIGN_MODE_DETACHED}. If not
+ * specified, defaults to
+ * <kbd>Crypt_GPG::SIGN_MODE_NORMAL</kbd>.
+ * @param boolean $armor optional. If true, ASCII armored data is
+ * returned; otherwise, binary data is returned.
+ * Defaults to true. This has no effect if the
+ * mode <kbd>Crypt_GPG::SIGN_MODE_CLEAR</kbd> is
+ * used.
+ * @param boolean $textmode optional. If true, line-breaks in signed data
+ * are normalized. Use this option when signing
+ * e-mail, or for greater compatibility between
+ * systems with different line-break formats.
+ * Defaults to false. This has no effect if the
+ * mode <kbd>Crypt_GPG::SIGN_MODE_CLEAR</kbd> is
+ * used as clear-signing always uses textmode.
+ *
+ * @return string the signed data, or the signature data if a detached
+ * signature is requested.
+ *
+ * @throws Crypt_GPG_KeyNotFoundException if no signing key is specified.
+ * See {@link Crypt_GPG::addSignKey()}.
+ *
+ * @throws Crypt_GPG_BadPassphraseException if a specified passphrase is
+ * incorrect or if a required passphrase is not specified.
+ *
+ * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs.
+ * Use the <kbd>debug</kbd> option and file a bug report if these
+ * exceptions occur.
+ */
+ public function sign($data, $mode = Crypt_GPG::SIGN_MODE_NORMAL,
+ $armor = true, $textmode = false
+ ) {
+ return $this->_sign($data, false, null, $mode, $armor, $textmode);
+ }
+
+ // }}}
+ // {{{ signFile()
+
+ /**
+ * Signs a file
+ *
+ * The file may be signed using any one of the three available signing
+ * modes:
+ * - {@link Crypt_GPG::SIGN_MODE_NORMAL}
+ * - {@link Crypt_GPG::SIGN_MODE_CLEAR}
+ * - {@link Crypt_GPG::SIGN_MODE_DETACHED}
+ *
+ * @param string $filename the name of the file containing the data to
+ * be signed.
+ * @param string $signedFile optional. The name of the file in which the
+ * signed data should be stored. If null or
+ * unspecified, the signed data is returned as a
+ * string.
+ * @param boolean $mode optional. The data signing mode to use. Should
+ * be one of {@link Crypt_GPG::SIGN_MODE_NORMAL},
+ * {@link Crypt_GPG::SIGN_MODE_CLEAR} or
+ * {@link Crypt_GPG::SIGN_MODE_DETACHED}. If not
+ * specified, defaults to
+ * <kbd>Crypt_GPG::SIGN_MODE_NORMAL</kbd>.
+ * @param boolean $armor optional. If true, ASCII armored data is
+ * returned; otherwise, binary data is returned.
+ * Defaults to true. This has no effect if the
+ * mode <kbd>Crypt_GPG::SIGN_MODE_CLEAR</kbd> is
+ * used.
+ * @param boolean $textmode optional. If true, line-breaks in signed data
+ * are normalized. Use this option when signing
+ * e-mail, or for greater compatibility between
+ * systems with different line-break formats.
+ * Defaults to false. This has no effect if the
+ * mode <kbd>Crypt_GPG::SIGN_MODE_CLEAR</kbd> is
+ * used as clear-signing always uses textmode.
+ *
+ * @return void|string if the <kbd>$signedFile</kbd> parameter is null, a
+ * string containing the signed data (or the signature
+ * data if a detached signature is requested) is
+ * returned.
+ *
+ * @throws Crypt_GPG_KeyNotFoundException if no signing key is specified.
+ * See {@link Crypt_GPG::addSignKey()}.
+ *
+ * @throws Crypt_GPG_BadPassphraseException if a specified passphrase is
+ * incorrect or if a required passphrase is not specified.
+ *
+ * @throws Crypt_GPG_FileException if the output file is not writeable or
+ * if the input file is not readable.
+ *
+ * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs.
+ * Use the <kbd>debug</kbd> option and file a bug report if these
+ * exceptions occur.
+ */
+ public function signFile($filename, $signedFile = null,
+ $mode = Crypt_GPG::SIGN_MODE_NORMAL, $armor = true, $textmode = false
+ ) {
+ return $this->_sign(
+ $filename,
+ true,
+ $signedFile,
+ $mode,
+ $armor,
+ $textmode
+ );
+ }
+
+ // }}}
+ // {{{ verify()
+
+ /**
+ * Verifies signed data
+ *
+ * The {@link Crypt_GPG::decrypt()} method may be used to get the original
+ * message if the signed data is not clearsigned and does not use a
+ * detached signature.
+ *
+ * @param string $signedData the signed data to be verified.
+ * @param string $signature optional. If verifying data signed using a
+ * detached signature, this must be the detached
+ * signature data. The data that was signed is
+ * specified in <kbd>$signedData</kbd>.
+ *
+ * @return array an array of {@link Crypt_GPG_Signature} objects for the
+ * signed data. For each signature that is valid, the
+ * {@link Crypt_GPG_Signature::isValid()} will return true.
+ *
+ * @throws Crypt_GPG_NoDataException if the provided data is not signed
+ * data.
+ *
+ * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs.
+ * Use the <kbd>debug</kbd> option and file a bug report if these
+ * exceptions occur.
+ *
+ * @see Crypt_GPG_Signature
+ */
+ public function verify($signedData, $signature = '')
+ {
+ return $this->_verify($signedData, false, $signature);
+ }
+
+ // }}}
+ // {{{ verifyFile()
+
+ /**
+ * Verifies a signed file
+ *
+ * The {@link Crypt_GPG::decryptFile()} method may be used to get the
+ * original message if the signed data is not clearsigned and does not use
+ * a detached signature.
+ *
+ * @param string $filename the signed file to be verified.
+ * @param string $signature optional. If verifying a file signed using a
+ * detached signature, this must be the detached
+ * signature data. The file that was signed is
+ * specified in <kbd>$filename</kbd>.
+ *
+ * @return array an array of {@link Crypt_GPG_Signature} objects for the
+ * signed data. For each signature that is valid, the
+ * {@link Crypt_GPG_Signature::isValid()} will return true.
+ *
+ * @throws Crypt_GPG_NoDataException if the provided data is not signed
+ * data.
+ *
+ * @throws Crypt_GPG_FileException if the input file is not readable.
+ *
+ * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs.
+ * Use the <kbd>debug</kbd> option and file a bug report if these
+ * exceptions occur.
+ *
+ * @see Crypt_GPG_Signature
+ */
+ public function verifyFile($filename, $signature = '')
+ {
+ return $this->_verify($filename, true, $signature);
+ }
+
+ // }}}
+ // {{{ addDecryptKey()
+
+ /**
+ * Adds a key to use for decryption
+ *
+ * @param mixed $key the key to use. This may be a key identifier,
+ * user id, fingerprint, {@link Crypt_GPG_Key} or
+ * {@link Crypt_GPG_SubKey}. The key must be able
+ * to encrypt.
+ * @param string $passphrase optional. The passphrase of the key required
+ * for decryption.
+ *
+ * @return void
+ *
+ * @see Crypt_GPG::decrypt()
+ * @see Crypt_GPG::decryptFile()
+ * @see Crypt_GPG::clearDecryptKeys()
+ * @see Crypt_GPG::_addKey()
+ * @see Crypt_GPG_DecryptStatusHandler
+ *
+ * @sensitive $passphrase
+ */
+ public function addDecryptKey($key, $passphrase = null)
+ {
+ $this->_addKey($this->decryptKeys, true, false, $key, $passphrase);
+ }
+
+ // }}}
+ // {{{ addEncryptKey()
+
+ /**
+ * Adds a key to use for encryption
+ *
+ * @param mixed $key the key to use. This may be a key identifier, user id
+ * user id, fingerprint, {@link Crypt_GPG_Key} or
+ * {@link Crypt_GPG_SubKey}. The key must be able to
+ * encrypt.
+ *
+ * @return void
+ *
+ * @see Crypt_GPG::encrypt()
+ * @see Crypt_GPG::encryptFile()
+ * @see Crypt_GPG::clearEncryptKeys()
+ * @see Crypt_GPG::_addKey()
+ */
+ public function addEncryptKey($key)
+ {
+ $this->_addKey($this->encryptKeys, true, false, $key);
+ }
+
+ // }}}
+ // {{{ addSignKey()
+
+ /**
+ * Adds a key to use for signing
+ *
+ * @param mixed $key the key to use. This may be a key identifier,
+ * user id, fingerprint, {@link Crypt_GPG_Key} or
+ * {@link Crypt_GPG_SubKey}. The key must be able
+ * to sign.
+ * @param string $passphrase optional. The passphrase of the key required
+ * for signing.
+ *
+ * @return void
+ *
+ * @see Crypt_GPG::sign()
+ * @see Crypt_GPG::signFile()
+ * @see Crypt_GPG::clearSignKeys()
+ * @see Crypt_GPG::handleSignStatus()
+ * @see Crypt_GPG::_addKey()
+ *
+ * @sensitive $passphrase
+ */
+ public function addSignKey($key, $passphrase = null)
+ {
+ $this->_addKey($this->signKeys, false, true, $key, $passphrase);
+ }
+
+ // }}}
+ // {{{ clearDecryptKeys()
+
+ /**
+ * Clears all decryption keys
+ *
+ * @return void
+ *
+ * @see Crypt_GPG::decrypt()
+ * @see Crypt_GPG::addDecryptKey()
+ */
+ public function clearDecryptKeys()
+ {
+ $this->decryptKeys = array();
+ }
+
+ // }}}
+ // {{{ clearEncryptKeys()
+
+ /**
+ * Clears all encryption keys
+ *
+ * @return void
+ *
+ * @see Crypt_GPG::encrypt()
+ * @see Crypt_GPG::addEncryptKey()
+ */
+ public function clearEncryptKeys()
+ {
+ $this->encryptKeys = array();
+ }
+
+ // }}}
+ // {{{ clearSignKeys()
+
+ /**
+ * Clears all signing keys
+ *
+ * @return void
+ *
+ * @see Crypt_GPG::sign()
+ * @see Crypt_GPG::addSignKey()
+ */
+ public function clearSignKeys()
+ {
+ $this->signKeys = array();
+ }
+
+ // }}}
+ // {{{ handleSignStatus()
+
+ /**
+ * Handles the status output from GPG for the sign operation
+ *
+ * This method is responsible for sending the passphrase commands when
+ * required by the {@link Crypt_GPG::sign()} method. See <b>doc/DETAILS</b>
+ * in the {@link http://www.gnupg.org/download/ GPG distribution} for
+ * detailed information on GPG's status output.
+ *
+ * @param string $line the status line to handle.
+ *
+ * @return void
+ *
+ * @see Crypt_GPG::sign()
+ */
+ public function handleSignStatus($line)
+ {
+ $tokens = explode(' ', $line);
+ switch ($tokens[0]) {
+ case 'NEED_PASSPHRASE':
+ $subKeyId = $tokens[1];
+ if (array_key_exists($subKeyId, $this->signKeys)) {
+ $passphrase = $this->signKeys[$subKeyId]['passphrase'];
+ $this->engine->sendCommand($passphrase);
+ } else {
+ $this->engine->sendCommand('');
+ }
+ break;
+ }
+ }
+
+ // }}}
+ // {{{ handleImportKeyStatus()
+
+ /**
+ * Handles the status output from GPG for the import operation
+ *
+ * This method is responsible for building the result array that is
+ * returned from the {@link Crypt_GPG::importKey()} method. See
+ * <b>doc/DETAILS</b> in the
+ * {@link http://www.gnupg.org/download/ GPG distribution} for detailed
+ * information on GPG's status output.
+ *
+ * @param string $line the status line to handle.
+ * @param array &$result the current result array being processed.
+ *
+ * @return void
+ *
+ * @see Crypt_GPG::importKey()
+ * @see Crypt_GPG::importKeyFile()
+ * @see Crypt_GPG_Engine::addStatusHandler()
+ */
+ public function handleImportKeyStatus($line, array &$result)
+ {
+ $tokens = explode(' ', $line);
+ switch ($tokens[0]) {
+ case 'IMPORT_OK':
+ $result['fingerprint'] = $tokens[2];
+ break;
+
+ case 'IMPORT_RES':
+ $result['public_imported'] = intval($tokens[3]);
+ $result['public_unchanged'] = intval($tokens[5]);
+ $result['private_imported'] = intval($tokens[11]);
+ $result['private_unchanged'] = intval($tokens[12]);
+ break;
+ }
+ }
+
+ // }}}
+ // {{{ setEngine()
+
+ /**
+ * Sets the I/O engine to use for GnuPG operations
+ *
+ * Normally this method does not need to be used. It provides a means for
+ * dependency injection.
+ *
+ * @param Crypt_GPG_Engine $engine the engine to use.
+ *
+ * @return void
+ */
+ public function setEngine(Crypt_GPG_Engine $engine)
+ {
+ $this->engine = $engine;
+ }
+
+ // }}}
+ // {{{ _addKey()
+
+ /**
+ * Adds a key to one of the internal key arrays
+ *
+ * This handles resolving full key objects from the provided
+ * <kbd>$key</kbd> value.
+ *
+ * @param array &$array the array to which the key should be added.
+ * @param boolean $encrypt whether or not the key must be able to
+ * encrypt.
+ * @param boolean $sign whether or not the key must be able to sign.
+ * @param mixed $key the key to add. This may be a key identifier,
+ * user id, fingerprint, {@link Crypt_GPG_Key} or
+ * {@link Crypt_GPG_SubKey}.
+ * @param string $passphrase optional. The passphrase associated with the
+ * key.
+ *
+ * @return void
+ *
+ * @sensitive $passphrase
+ */
+ private function _addKey(array &$array, $encrypt, $sign, $key,
+ $passphrase = null
+ ) {
+ $subKeys = array();
+
+ if (is_scalar($key)) {
+ $keys = $this->getKeys($key);
+ if (count($keys) == 0) {
+ throw new Crypt_GPG_KeyNotFoundException(
+ 'Key "' . $key . '" not found.', 0, $key);
+ }
+ $key = $keys[0];
+ }
+
+ if ($key instanceof Crypt_GPG_Key) {
+ if ($encrypt && !$key->canEncrypt()) {
+ throw new InvalidArgumentException(
+ 'Key "' . $key . '" cannot encrypt.');
+ }
+
+ if ($sign && !$key->canSign()) {
+ throw new InvalidArgumentException(
+ 'Key "' . $key . '" cannot sign.');
+ }
+
+ foreach ($key->getSubKeys() as $subKey) {
+ $canEncrypt = $subKey->canEncrypt();
+ $canSign = $subKey->canSign();
+ if ( ($encrypt && $sign && $canEncrypt && $canSign)
+ || ($encrypt && !$sign && $canEncrypt)
+ || (!$encrypt && $sign && $canSign)
+ ) {
+ // We add all subkeys that meet the requirements because we
+ // were not told which subkey is required.
+ $subKeys[] = $subKey;
+ }
+ }
+ } elseif ($key instanceof Crypt_GPG_SubKey) {
+ $subKeys[] = $key;
+ }
+
+ if (count($subKeys) === 0) {
+ throw new InvalidArgumentException(
+ 'Key "' . $key . '" is not in a recognized format.');
+ }
+
+ foreach ($subKeys as $subKey) {
+ if ($encrypt && !$subKey->canEncrypt()) {
+ throw new InvalidArgumentException(
+ 'Key "' . $key . '" cannot encrypt.');
+ }
+
+ if ($sign && !$subKey->canSign()) {
+ throw new InvalidArgumentException(
+ 'Key "' . $key . '" cannot sign.');
+ }
+
+ $array[$subKey->getId()] = array(
+ 'fingerprint' => $subKey->getFingerprint(),
+ 'passphrase' => $passphrase
+ );
+ }
+ }
+
+ // }}}
+ // {{{ _importKey()
+
+ /**
+ * Imports a public or private key into the keyring
+ *
+ * @param string $key the key to be imported.
+ * @param boolean $isFile whether or not the input is a filename.
+ *
+ * @return array an associative array containing the following elements:
+ * - <kbd>fingerprint</kbd> - the fingerprint of the
+ * imported key,
+ * - <kbd>public_imported</kbd> - the number of public
+ * keys imported,
+ * - <kbd>public_unchanged</kbd> - the number of unchanged
+ * public keys,
+ * - <kbd>private_imported</kbd> - the number of private
+ * keys imported,
+ * - <kbd>private_unchanged</kbd> - the number of unchanged
+ * private keys.
+ *
+ * @throws Crypt_GPG_NoDataException if the key data is missing or if the
+ * data is is not valid key data.
+ *
+ * @throws Crypt_GPG_FileException if the key file is not readable.
+ *
+ * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs.
+ * Use the <kbd>debug</kbd> option and file a bug report if these
+ * exceptions occur.
+ */
+ private function _importKey($key, $isFile)
+ {
+ $result = array();
+
+ if ($isFile) {
+ $input = @fopen($key, 'rb');
+ if ($input === false) {
+ throw new Crypt_GPG_FileException('Could not open key file "' .
+ $key . '" for importing.', 0, $key);
+ }
+ } else {
+ $input = strval($key);
+ if ($input == '') {
+ throw new Crypt_GPG_NoDataException(
+ 'No valid GPG key data found.', Crypt_GPG::ERROR_NO_DATA);
+ }
+ }
+
+ $arguments = array();
+ $version = $this->engine->getVersion();
+
+ if ( version_compare($version, '1.0.5', 'ge')
+ && version_compare($version, '1.0.7', 'lt')
+ ) {
+ $arguments[] = '--allow-secret-key-import';
+ }
+
+ $this->engine->reset();
+ $this->engine->addStatusHandler(
+ array($this, 'handleImportKeyStatus'),
+ array(&$result)
+ );
+
+ $this->engine->setOperation('--import', $arguments);
+ $this->engine->setInput($input);
+ $this->engine->run();
+
+ if ($isFile) {
+ fclose($input);
+ }
+
+ $code = $this->engine->getErrorCode();
+
+ switch ($code) {
+ case Crypt_GPG::ERROR_DUPLICATE_KEY:
+ case Crypt_GPG::ERROR_NONE:
+ // ignore duplicate key import errors
+ break;
+ case Crypt_GPG::ERROR_NO_DATA:
+ throw new Crypt_GPG_NoDataException(
+ 'No valid GPG key data found.', $code);
+ default:
+ throw new Crypt_GPG_Exception(
+ 'Unknown error importing GPG key. Please use the \'debug\' ' .
+ 'option when creating the Crypt_GPG object, and file a bug ' .
+ 'report at ' . self::BUG_URI, $code);
+ }
+
+ return $result;
+ }
+
+ // }}}
+ // {{{ _encrypt()
+
+ /**
+ * Encrypts data
+ *
+ * @param string $data the data to encrypt.
+ * @param boolean $isFile whether or not the data is a filename.
+ * @param string $outputFile the filename of the file in which to store
+ * the encrypted data. If null, the encrypted
+ * data is returned as a string.
+ * @param boolean $armor if true, ASCII armored data is returned;
+ * otherwise, binary data is returned.
+ *
+ * @return void|string if the <kbd>$outputFile</kbd> parameter is null, a
+ * string containing the encrypted data is returned.
+ *
+ * @throws Crypt_GPG_KeyNotFoundException if no encryption key is specified.
+ * See {@link Crypt_GPG::addEncryptKey()}.
+ *
+ * @throws Crypt_GPG_FileException if the output file is not writeable or
+ * if the input file is not readable.
+ *
+ * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs.
+ * Use the <kbd>debug</kbd> option and file a bug report if these
+ * exceptions occur.
+ */
+ private function _encrypt($data, $isFile, $outputFile, $armor)
+ {
+ if (count($this->encryptKeys) === 0) {
+ throw new Crypt_GPG_KeyNotFoundException(
+ 'No encryption keys specified.');
+ }
+
+ if ($isFile) {
+ $input = @fopen($data, 'rb');
+ if ($input === false) {
+ throw new Crypt_GPG_FileException('Could not open input file "' .
+ $data . '" for encryption.', 0, $data);
+ }
+ } else {
+ $input = strval($data);
+ }
+
+ if ($outputFile === null) {
+ $output = '';
+ } else {
+ $output = @fopen($outputFile, 'wb');
+ if ($output === false) {
+ if ($isFile) {
+ fclose($input);
+ }
+ throw new Crypt_GPG_FileException('Could not open output ' .
+ 'file "' . $outputFile . '" for storing encrypted data.',
+ 0, $outputFile);
+ }
+ }
+
+ $arguments = ($armor) ? array('--armor') : array();
+ foreach ($this->encryptKeys as $key) {
+ $arguments[] = '--recipient ' . escapeshellarg($key['fingerprint']);
+ }
+
+ $this->engine->reset();
+ $this->engine->setInput($input);
+ $this->engine->setOutput($output);
+ $this->engine->setOperation('--encrypt', $arguments);
+ $this->engine->run();
+
+ if ($isFile) {
+ fclose($input);
+ }
+
+ if ($outputFile !== null) {
+ fclose($output);
+ }
+
+ $code = $this->engine->getErrorCode();
+
+ if ($code !== Crypt_GPG::ERROR_NONE) {
+ throw new Crypt_GPG_Exception(
+ 'Unknown error encrypting data. Please use the \'debug\' ' .
+ 'option when creating the Crypt_GPG object, and file a bug ' .
+ 'report at ' . self::BUG_URI, $code);
+ }
+
+ if ($outputFile === null) {
+ return $output;
+ }
+ }
+
+ // }}}
+ // {{{ _decrypt()
+
+ /**
+ * Decrypts data
+ *
+ * @param string $data the data to be decrypted.
+ * @param boolean $isFile whether or not the data is a filename.
+ * @param string $outputFile the name of the file to which the decrypted
+ * data should be written. If null, the decrypted
+ * data is returned as a string.
+ *
+ * @return void|string if the <kbd>$outputFile</kbd> parameter is null, a
+ * string containing the decrypted data is returned.
+ *
+ * @throws Crypt_GPG_KeyNotFoundException if the private key needed to
+ * decrypt the data is not in the user's keyring.
+ *
+ * @throws Crypt_GPG_NoDataException if specified data does not contain
+ * GPG encrypted data.
+ *
+ * @throws Crypt_GPG_BadPassphraseException if a required passphrase is
+ * incorrect or if a required passphrase is not specified. See
+ * {@link Crypt_GPG::addDecryptKey()}.
+ *
+ * @throws Crypt_GPG_FileException if the output file is not writeable or
+ * if the input file is not readable.
+ *
+ * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs.
+ * Use the <kbd>debug</kbd> option and file a bug report if these
+ * exceptions occur.
+ */
+ private function _decrypt($data, $isFile, $outputFile)
+ {
+ if ($isFile) {
+ $input = @fopen($data, 'rb');
+ if ($input === false) {
+ throw new Crypt_GPG_FileException('Could not open input file "' .
+ $data . '" for decryption.', 0, $data);
+ }
+ } else {
+ $input = strval($data);
+ if ($input == '') {
+ throw new Crypt_GPG_NoDataException(
+ 'Cannot decrypt data. No PGP encrypted data was found in '.
+ 'the provided data.', Crypt_GPG::ERROR_NO_DATA);
+ }
+ }
+
+ if ($outputFile === null) {
+ $output = '';
+ } else {
+ $output = @fopen($outputFile, 'wb');
+ if ($output === false) {
+ if ($isFile) {
+ fclose($input);
+ }
+ throw new Crypt_GPG_FileException('Could not open output ' .
+ 'file "' . $outputFile . '" for storing decrypted data.',
+ 0, $outputFile);
+ }
+ }
+
+ $handler = new Crypt_GPG_DecryptStatusHandler($this->engine,
+ $this->decryptKeys);
+
+ $this->engine->reset();
+ $this->engine->addStatusHandler(array($handler, 'handle'));
+ $this->engine->setOperation('--decrypt');
+ $this->engine->setInput($input);
+ $this->engine->setOutput($output);
+ $this->engine->run();
+
+ if ($isFile) {
+ fclose($input);
+ }
+
+ if ($outputFile !== null) {
+ fclose($output);
+ }
+
+ // if there was any problem decrypting the data, the handler will
+ // deal with it here.
+ $handler->throwException();
+
+ if ($outputFile === null) {
+ return $output;
+ }
+ }
+
+ // }}}
+ // {{{ _sign()
+
+ /**
+ * Signs data
+ *
+ * @param string $data the data to be signed.
+ * @param boolean $isFile whether or not the data is a filename.
+ * @param string $outputFile the name of the file in which the signed data
+ * should be stored. If null, the signed data is
+ * returned as a string.
+ * @param boolean $mode the data signing mode to use. Should be one of
+ * {@link Crypt_GPG::SIGN_MODE_NORMAL},
+ * {@link Crypt_GPG::SIGN_MODE_CLEAR} or
+ * {@link Crypt_GPG::SIGN_MODE_DETACHED}.
+ * @param boolean $armor if true, ASCII armored data is returned;
+ * otherwise, binary data is returned. This has
+ * no effect if the mode
+ * <kbd>Crypt_GPG::SIGN_MODE_CLEAR</kbd> is
+ * used.
+ * @param boolean $textmode if true, line-breaks in signed data be
+ * normalized. Use this option when signing
+ * e-mail, or for greater compatibility between
+ * systems with different line-break formats.
+ * Defaults to false. This has no effect if the
+ * mode <kbd>Crypt_GPG::SIGN_MODE_CLEAR</kbd> is
+ * used as clear-signing always uses textmode.
+ *
+ * @return void|string if the <kbd>$outputFile</kbd> parameter is null, a
+ * string containing the signed data (or the signature
+ * data if a detached signature is requested) is
+ * returned.
+ *
+ * @throws Crypt_GPG_KeyNotFoundException if no signing key is specified.
+ * See {@link Crypt_GPG::addSignKey()}.
+ *
+ * @throws Crypt_GPG_BadPassphraseException if a specified passphrase is
+ * incorrect or if a required passphrase is not specified.
+ *
+ * @throws Crypt_GPG_FileException if the output file is not writeable or
+ * if the input file is not readable.
+ *
+ * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs.
+ * Use the <kbd>debug</kbd> option and file a bug report if these
+ * exceptions occur.
+ */
+ private function _sign($data, $isFile, $outputFile, $mode, $armor,
+ $textmode
+ ) {
+ if (count($this->signKeys) === 0) {
+ throw new Crypt_GPG_KeyNotFoundException(
+ 'No signing keys specified.');
+ }
+
+ if ($isFile) {
+ $input = @fopen($data, 'rb');
+ if ($input === false) {
+ throw new Crypt_GPG_FileException('Could not open input ' .
+ 'file "' . $data . '" for signing.', 0, $data);
+ }
+ } else {
+ $input = strval($data);
+ }
+
+ if ($outputFile === null) {
+ $output = '';
+ } else {
+ $output = @fopen($outputFile, 'wb');
+ if ($output === false) {
+ if ($isFile) {
+ fclose($input);
+ }
+ throw new Crypt_GPG_FileException('Could not open output ' .
+ 'file "' . $outputFile . '" for storing signed ' .
+ 'data.', 0, $outputFile);
+ }
+ }
+
+ switch ($mode) {
+ case Crypt_GPG::SIGN_MODE_DETACHED:
+ $operation = '--detach-sign';
+ break;
+ case Crypt_GPG::SIGN_MODE_CLEAR:
+ $operation = '--clearsign';
+ break;
+ case Crypt_GPG::SIGN_MODE_NORMAL:
+ default:
+ $operation = '--sign';
+ break;
+ }
+
+ $arguments = array();
+
+ if ($armor) {
+ $arguments[] = '--armor';
+ }
+ if ($textmode) {
+ $arguments[] = '--textmode';
+ }
+
+ foreach ($this->signKeys as $key) {
+ $arguments[] = '--local-user ' .
+ escapeshellarg($key['fingerprint']);
+ }
+
+ $this->engine->reset();
+ $this->engine->addStatusHandler(array($this, 'handleSignStatus'));
+ $this->engine->setInput($input);
+ $this->engine->setOutput($output);
+ $this->engine->setOperation($operation, $arguments);
+ $this->engine->run();
+
+ if ($isFile) {
+ fclose($input);
+ }
+
+ if ($outputFile !== null) {
+ fclose($output);
+ }
+
+ $code = $this->engine->getErrorCode();
+
+ switch ($code) {
+ case Crypt_GPG::ERROR_NONE:
+ break;
+ case Crypt_GPG::ERROR_KEY_NOT_FOUND:
+ throw new Crypt_GPG_KeyNotFoundException(
+ 'Cannot sign data. Private key not found. Import the '.
+ 'private key before trying to sign data.', $code,
+ $this->engine->getErrorKeyId());
+ case Crypt_GPG::ERROR_BAD_PASSPHRASE:
+ throw new Crypt_GPG_BadPassphraseException(
+ 'Cannot sign data. Incorrect passphrase provided.', $code);
+ case Crypt_GPG::ERROR_MISSING_PASSPHRASE:
+ throw new Crypt_GPG_BadPassphraseException(
+ 'Cannot sign data. No passphrase provided.', $code);
+ default:
+ throw new Crypt_GPG_Exception(
+ 'Unknown error signing data. Please use the \'debug\' option ' .
+ 'when creating the Crypt_GPG object, and file a bug report ' .
+ 'at ' . self::BUG_URI, $code);
+ }
+
+ if ($outputFile === null) {
+ return $output;
+ }
+ }
+
+ // }}}
+ // {{{ _encryptAndSign()
+
+ /**
+ * Encrypts and signs data
+ *
+ * @param string $data the data to be encrypted and signed.
+ * @param boolean $isFile whether or not the data is a filename.
+ * @param string $outputFile the name of the file in which the encrypted,
+ * signed data should be stored. If null, the
+ * encrypted, signed data is returned as a
+ * string.
+ * @param boolean $armor if true, ASCII armored data is returned;
+ * otherwise, binary data is returned.
+ *
+ * @return void|string if the <kbd>$outputFile</kbd> parameter is null, a
+ * string containing the encrypted, signed data is
+ * returned.
+ *
+ * @throws Crypt_GPG_KeyNotFoundException if no encryption key is specified
+ * or if no signing key is specified. See
+ * {@link Crypt_GPG::addEncryptKey()} and
+ * {@link Crypt_GPG::addSignKey()}.
+ *
+ * @throws Crypt_GPG_BadPassphraseException if a specified passphrase is
+ * incorrect or if a required passphrase is not specified.
+ *
+ * @throws Crypt_GPG_FileException if the output file is not writeable or
+ * if the input file is not readable.
+ *
+ * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs.
+ * Use the <kbd>debug</kbd> option and file a bug report if these
+ * exceptions occur.
+ */
+ private function _encryptAndSign($data, $isFile, $outputFile, $armor)
+ {
+ if (count($this->signKeys) === 0) {
+ throw new Crypt_GPG_KeyNotFoundException(
+ 'No signing keys specified.');
+ }
+
+ if (count($this->encryptKeys) === 0) {
+ throw new Crypt_GPG_KeyNotFoundException(
+ 'No encryption keys specified.');
+ }
+
+
+ if ($isFile) {
+ $input = @fopen($data, 'rb');
+ if ($input === false) {
+ throw new Crypt_GPG_FileException('Could not open input ' .
+ 'file "' . $data . '" for encrypting and signing.', 0,
+ $data);
+ }
+ } else {
+ $input = strval($data);
+ }
+
+ if ($outputFile === null) {
+ $output = '';
+ } else {
+ $output = @fopen($outputFile, 'wb');
+ if ($output === false) {
+ if ($isFile) {
+ fclose($input);
+ }
+ throw new Crypt_GPG_FileException('Could not open output ' .
+ 'file "' . $outputFile . '" for storing encrypted, ' .
+ 'signed data.', 0, $outputFile);
+ }
+ }
+
+ $arguments = ($armor) ? array('--armor') : array();
+
+ foreach ($this->signKeys as $key) {
+ $arguments[] = '--local-user ' .
+ escapeshellarg($key['fingerprint']);
+ }
+
+ foreach ($this->encryptKeys as $key) {
+ $arguments[] = '--recipient ' . escapeshellarg($key['fingerprint']);
+ }
+
+ $this->engine->reset();
+ $this->engine->addStatusHandler(array($this, 'handleSignStatus'));
+ $this->engine->setInput($input);
+ $this->engine->setOutput($output);
+ $this->engine->setOperation('--encrypt --sign', $arguments);
+ $this->engine->run();
+
+ if ($isFile) {
+ fclose($input);
+ }
+
+ if ($outputFile !== null) {
+ fclose($output);
+ }
+
+ $code = $this->engine->getErrorCode();
+
+ switch ($code) {
+ case Crypt_GPG::ERROR_NONE:
+ break;
+ case Crypt_GPG::ERROR_KEY_NOT_FOUND:
+ throw new Crypt_GPG_KeyNotFoundException(
+ 'Cannot sign encrypted data. Private key not found. Import '.
+ 'the private key before trying to sign the encrypted data.',
+ $code, $this->engine->getErrorKeyId());
+ case Crypt_GPG::ERROR_BAD_PASSPHRASE:
+ throw new Crypt_GPG_BadPassphraseException(
+ 'Cannot sign encrypted data. Incorrect passphrase provided.',
+ $code);
+ case Crypt_GPG::ERROR_MISSING_PASSPHRASE:
+ throw new Crypt_GPG_BadPassphraseException(
+ 'Cannot sign encrypted data. No passphrase provided.', $code);
+ default:
+ throw new Crypt_GPG_Exception(
+ 'Unknown error encrypting and signing data. Please use the ' .
+ '\'debug\' option when creating the Crypt_GPG object, and ' .
+ 'file a bug report at ' . self::BUG_URI, $code);
+ }
+
+ if ($outputFile === null) {
+ return $output;
+ }
+ }
+
+ // }}}
+ // {{{ _verify()
+
+ /**
+ * Verifies data
+ *
+ * @param string $data the signed data to be verified.
+ * @param boolean $isFile whether or not the data is a filename.
+ * @param string $signature if verifying a file signed using a detached
+ * signature, this must be the detached signature
+ * data. Otherwise, specify ''.
+ *
+ * @return array an array of {@link Crypt_GPG_Signature} objects for the
+ * signed data.
+ *
+ * @throws Crypt_GPG_NoDataException if the provided data is not signed
+ * data.
+ *
+ * @throws Crypt_GPG_FileException if the input file is not readable.
+ *
+ * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs.
+ * Use the <kbd>debug</kbd> option and file a bug report if these
+ * exceptions occur.
+ *
+ * @see Crypt_GPG_Signature
+ */
+ private function _verify($data, $isFile, $signature)
+ {
+ if ($signature == '') {
+ $operation = '--verify';
+ $arguments = array();
+ } else {
+ // Signed data goes in FD_MESSAGE, detached signature data goes in
+ // FD_INPUT.
+ $operation = '--verify - "-&' . Crypt_GPG_Engine::FD_MESSAGE. '"';
+ $arguments = array('--enable-special-filenames');
+ }
+
+ $handler = new Crypt_GPG_VerifyStatusHandler();
+
+ if ($isFile) {
+ $input = @fopen($data, 'rb');
+ if ($input === false) {
+ throw new Crypt_GPG_FileException('Could not open input ' .
+ 'file "' . $data . '" for verifying.', 0, $data);
+ }
+ } else {
+ $input = strval($data);
+ if ($input == '') {
+ throw new Crypt_GPG_NoDataException(
+ 'No valid signature data found.', Crypt_GPG::ERROR_NO_DATA);
+ }
+ }
+
+ $this->engine->reset();
+ $this->engine->addStatusHandler(array($handler, 'handle'));
+
+ if ($signature == '') {
+ // signed or clearsigned data
+ $this->engine->setInput($input);
+ } else {
+ // detached signature
+ $this->engine->setInput($signature);
+ $this->engine->setMessage($input);
+ }
+
+ $this->engine->setOperation($operation, $arguments);
+ $this->engine->run();
+
+ if ($isFile) {
+ fclose($input);
+ }
+
+ $code = $this->engine->getErrorCode();
+
+ switch ($code) {
+ case Crypt_GPG::ERROR_NONE:
+ case Crypt_GPG::ERROR_BAD_SIGNATURE:
+ break;
+ case Crypt_GPG::ERROR_NO_DATA:
+ throw new Crypt_GPG_NoDataException(
+ 'No valid signature data found.', $code);
+ case Crypt_GPG::ERROR_KEY_NOT_FOUND:
+ throw new Crypt_GPG_KeyNotFoundException(
+ 'Public key required for data verification not in keyring.',
+ $code, $this->engine->getErrorKeyId());
+ default:
+ throw new Crypt_GPG_Exception(
+ 'Unknown error validating signature details. Please use the ' .
+ '\'debug\' option when creating the Crypt_GPG object, and ' .
+ 'file a bug report at ' . self::BUG_URI, $code);
+ }
+
+ return $handler->getSignatures();
+ }
+
+ // }}}
+ // {{{ _decryptAndVerify()
+
+ /**
+ * Decrypts and verifies encrypted, signed data
+ *
+ * @param string $data the encrypted signed data to be decrypted and
+ * verified.
+ * @param boolean $isFile whether or not the data is a filename.
+ * @param string $outputFile the name of the file to which the decrypted
+ * data should be written. If null, the decrypted
+ * data is returned in the results array.
+ *
+ * @return array two element array. The array has an element 'data'
+ * containing the decrypted data and an element
+ * 'signatures' containing an array of
+ * {@link Crypt_GPG_Signature} objects for the signed data.
+ * If the decrypted data is written to a file, the 'data'
+ * element is null.
+ *
+ * @throws Crypt_GPG_KeyNotFoundException if the private key needed to
+ * decrypt the data is not in the user's keyring or it the public
+ * key needed for verification is not in the user's keyring.
+ *
+ * @throws Crypt_GPG_NoDataException if specified data does not contain
+ * GPG signed, encrypted data.
+ *
+ * @throws Crypt_GPG_BadPassphraseException if a required passphrase is
+ * incorrect or if a required passphrase is not specified. See
+ * {@link Crypt_GPG::addDecryptKey()}.
+ *
+ * @throws Crypt_GPG_FileException if the output file is not writeable or
+ * if the input file is not readable.
+ *
+ * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs.
+ * Use the <kbd>debug</kbd> option and file a bug report if these
+ * exceptions occur.
+ *
+ * @see Crypt_GPG_Signature
+ */
+ private function _decryptAndVerify($data, $isFile, $outputFile)
+ {
+ if ($isFile) {
+ $input = @fopen($data, 'rb');
+ if ($input === false) {
+ throw new Crypt_GPG_FileException('Could not open input ' .
+ 'file "' . $data . '" for decrypting and verifying.', 0,
+ $data);
+ }
+ } else {
+ $input = strval($data);
+ if ($input == '') {
+ throw new Crypt_GPG_NoDataException(
+ 'No valid encrypted signed data found.',
+ Crypt_GPG::ERROR_NO_DATA);
+ }
+ }
+
+ if ($outputFile === null) {
+ $output = '';
+ } else {
+ $output = @fopen($outputFile, 'wb');
+ if ($output === false) {
+ if ($isFile) {
+ fclose($input);
+ }
+ throw new Crypt_GPG_FileException('Could not open output ' .
+ 'file "' . $outputFile . '" for storing decrypted data.',
+ 0, $outputFile);
+ }
+ }
+
+ $verifyHandler = new Crypt_GPG_VerifyStatusHandler();
+
+ $decryptHandler = new Crypt_GPG_DecryptStatusHandler($this->engine,
+ $this->decryptKeys);
+
+ $this->engine->reset();
+ $this->engine->addStatusHandler(array($verifyHandler, 'handle'));
+ $this->engine->addStatusHandler(array($decryptHandler, 'handle'));
+ $this->engine->setInput($input);
+ $this->engine->setOutput($output);
+ $this->engine->setOperation('--decrypt');
+ $this->engine->run();
+
+ if ($isFile) {
+ fclose($input);
+ }
+
+ if ($outputFile !== null) {
+ fclose($output);
+ }
+
+ $return = array(
+ 'data' => null,
+ 'signatures' => $verifyHandler->getSignatures()
+ );
+
+ // if there was any problem decrypting the data, the handler will
+ // deal with it here.
+ try {
+ $decryptHandler->throwException();
+ } catch (Exception $e) {
+ if ($e instanceof Crypt_GPG_KeyNotFoundException) {
+ throw new Crypt_GPG_KeyNotFoundException(
+ 'Public key required for data verification not in ',
+ 'the keyring. Either no suitable private decryption key ' .
+ 'is in the keyring or the public key required for data ' .
+ 'verification is not in the keyring. Import a suitable ' .
+ 'key before trying to decrypt and verify this data.',
+ self::ERROR_KEY_NOT_FOUND, $this->engine->getErrorKeyId());
+ }
+
+ if ($e instanceof Crypt_GPG_NoDataException) {
+ throw new Crypt_GPG_NoDataException(
+ 'Cannot decrypt and verify data. No PGP encrypted data ' .
+ 'was found in the provided data.', self::ERROR_NO_DATA);
+ }
+
+ throw $e;
+ }
+
+ if ($outputFile === null) {
+ $return['data'] = $output;
+ }
+
+ return $return;
+ }
+
+ // }}}
+}
+
+// }}}
+
+?>
diff --git a/plugins/enigma/lib/Crypt/GPG/DecryptStatusHandler.php b/plugins/enigma/lib/Crypt/GPG/DecryptStatusHandler.php
new file mode 100644
index 000000000..40e8d50ed
--- /dev/null
+++ b/plugins/enigma/lib/Crypt/GPG/DecryptStatusHandler.php
@@ -0,0 +1,336 @@
+<?php
+
+/* vim: set expandtab tabstop=4 shiftwidth=4 softtabstop=4: */
+
+/**
+ * Crypt_GPG is a package to use GPG from PHP
+ *
+ * This file contains an object that handles GPG's status output for the
+ * decrypt operation.
+ *
+ * PHP version 5
+ *
+ * LICENSE:
+ *
+ * This library is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU Lesser General Public License as
+ * published by the Free Software Foundation; either version 2.1 of the
+ * License, or (at your option) any later version.
+ *
+ * This library is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ * Lesser General Public License for more details.
+ *
+ * You should have received a copy of the GNU Lesser General Public
+ * License along with this library; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+ *
+ * @category Encryption
+ * @package Crypt_GPG
+ * @author Michael Gauthier <mike@silverorange.com>
+ * @copyright 2008-2009 silverorange
+ * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1
+ * @version CVS: $Id: DecryptStatusHandler.php 302814 2010-08-26 15:43:07Z gauthierm $
+ * @link http://pear.php.net/package/Crypt_GPG
+ * @link http://www.gnupg.org/
+ */
+
+/**
+ * Crypt_GPG base class
+ */
+require_once 'Crypt/GPG.php';
+
+/**
+ * GPG exception classes
+ */
+require_once 'Crypt/GPG/Exceptions.php';
+
+
+/**
+ * Status line handler for the decrypt operation
+ *
+ * This class is used internally by Crypt_GPG and does not need be used
+ * directly. See the {@link Crypt_GPG} class for end-user API.
+ *
+ * This class is responsible for sending the passphrase commands when required
+ * by the {@link Crypt_GPG::decrypt()} method. See <b>doc/DETAILS</b> in the
+ * {@link http://www.gnupg.org/download/ GPG distribution} for detailed
+ * information on GPG's status output for the decrypt operation.
+ *
+ * This class is also responsible for parsing error status and throwing a
+ * meaningful exception in the event that decryption fails.
+ *
+ * @category Encryption
+ * @package Crypt_GPG
+ * @author Michael Gauthier <mike@silverorange.com>
+ * @copyright 2008 silverorange
+ * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1
+ * @link http://pear.php.net/package/Crypt_GPG
+ * @link http://www.gnupg.org/
+ */
+class Crypt_GPG_DecryptStatusHandler
+{
+ // {{{ protected properties
+
+ /**
+ * Keys used to decrypt
+ *
+ * The array is of the form:
+ * <code>
+ * array(
+ * $key_id => array(
+ * 'fingerprint' => $fingerprint,
+ * 'passphrase' => $passphrase
+ * )
+ * );
+ * </code>
+ *
+ * @var array
+ */
+ protected $keys = array();
+
+ /**
+ * Engine used to which passphrases are passed
+ *
+ * @var Crypt_GPG_Engine
+ */
+ protected $engine = null;
+
+ /**
+ * The id of the current sub-key used for decryption
+ *
+ * @var string
+ */
+ protected $currentSubKey = '';
+
+ /**
+ * Whether or not decryption succeeded
+ *
+ * If the message is only signed (compressed) and not encrypted, this is
+ * always true. If the message is encrypted, this flag is set to false
+ * until we know the decryption succeeded.
+ *
+ * @var boolean
+ */
+ protected $decryptionOkay = true;
+
+ /**
+ * Whether or not there was no data for decryption
+ *
+ * @var boolean
+ */
+ protected $noData = false;
+
+ /**
+ * Keys for which the passhprase is missing
+ *
+ * This contains primary user ids indexed by sub-key id and is used to
+ * create helpful exception messages.
+ *
+ * @var array
+ */
+ protected $missingPassphrases = array();
+
+ /**
+ * Keys for which the passhprase is incorrect
+ *
+ * This contains primary user ids indexed by sub-key id and is used to
+ * create helpful exception messages.
+ *
+ * @var array
+ */
+ protected $badPassphrases = array();
+
+ /**
+ * Keys that can be used to decrypt the data but are missing from the
+ * keychain
+ *
+ * This is an array with both the key and value being the sub-key id of
+ * the missing keys.
+ *
+ * @var array
+ */
+ protected $missingKeys = array();
+
+ // }}}
+ // {{{ __construct()
+
+ /**
+ * Creates a new decryption status handler
+ *
+ * @param Crypt_GPG_Engine $engine the GPG engine to which passphrases are
+ * passed.
+ * @param array $keys the decryption keys to use.
+ */
+ public function __construct(Crypt_GPG_Engine $engine, array $keys)
+ {
+ $this->engine = $engine;
+ $this->keys = $keys;
+ }
+
+ // }}}
+ // {{{ handle()
+
+ /**
+ * Handles a status line
+ *
+ * @param string $line the status line to handle.
+ *
+ * @return void
+ */
+ public function handle($line)
+ {
+ $tokens = explode(' ', $line);
+ switch ($tokens[0]) {
+ case 'ENC_TO':
+ // Now we know the message is encrypted. Set flag to check if
+ // decryption succeeded.
+ $this->decryptionOkay = false;
+
+ // this is the new key message
+ $this->currentSubKeyId = $tokens[1];
+ break;
+
+ case 'NEED_PASSPHRASE':
+ // send passphrase to the GPG engine
+ $subKeyId = $tokens[1];
+ if (array_key_exists($subKeyId, $this->keys)) {
+ $passphrase = $this->keys[$subKeyId]['passphrase'];
+ $this->engine->sendCommand($passphrase);
+ } else {
+ $this->engine->sendCommand('');
+ }
+ break;
+
+ case 'USERID_HINT':
+ // remember the user id for pretty exception messages
+ $this->badPassphrases[$tokens[1]]
+ = implode(' ', array_splice($tokens, 2));
+
+ break;
+
+ case 'GOOD_PASSPHRASE':
+ // if we got a good passphrase, remove the key from the list of
+ // bad passphrases.
+ unset($this->badPassphrases[$this->currentSubKeyId]);
+ break;
+
+ case 'MISSING_PASSPHRASE':
+ $this->missingPassphrases[$this->currentSubKeyId]
+ = $this->currentSubKeyId;
+
+ break;
+
+ case 'NO_SECKEY':
+ // note: this message is also received if there are multiple
+ // recipients and a previous key had a correct passphrase.
+ $this->missingKeys[$tokens[1]] = $tokens[1];
+ break;
+
+ case 'NODATA':
+ $this->noData = true;
+ break;
+
+ case 'DECRYPTION_OKAY':
+ // If the message is encrypted, this is the all-clear signal.
+ $this->decryptionOkay = true;
+ break;
+ }
+ }
+
+ // }}}
+ // {{{ throwException()
+
+ /**
+ * Takes the final status of the decrypt operation and throws an
+ * appropriate exception
+ *
+ * If decryption was successful, no exception is thrown.
+ *
+ * @return void
+ *
+ * @throws Crypt_GPG_KeyNotFoundException if the private key needed to
+ * decrypt the data is not in the user's keyring.
+ *
+ * @throws Crypt_GPG_NoDataException if specified data does not contain
+ * GPG encrypted data.
+ *
+ * @throws Crypt_GPG_BadPassphraseException if a required passphrase is
+ * incorrect or if a required passphrase is not specified. See
+ * {@link Crypt_GPG::addDecryptKey()}.
+ *
+ * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs.
+ * Use the <i>debug</i> option and file a bug report if these
+ * exceptions occur.
+ */
+ public function throwException()
+ {
+ $code = Crypt_GPG::ERROR_NONE;
+
+ if (!$this->decryptionOkay) {
+ if (count($this->badPassphrases) > 0) {
+ $code = Crypt_GPG::ERROR_BAD_PASSPHRASE;
+ } elseif (count($this->missingKeys) > 0) {
+ $code = Crypt_GPG::ERROR_KEY_NOT_FOUND;
+ } else {
+ $code = Crypt_GPG::ERROR_UNKNOWN;
+ }
+ } elseif ($this->noData) {
+ $code = Crypt_GPG::ERROR_NO_DATA;
+ }
+
+ switch ($code) {
+ case Crypt_GPG::ERROR_NONE:
+ break;
+
+ case Crypt_GPG::ERROR_KEY_NOT_FOUND:
+ if (count($this->missingKeys) > 0) {
+ $keyId = reset($this->missingKeys);
+ } else {
+ $keyId = '';
+ }
+ throw new Crypt_GPG_KeyNotFoundException(
+ 'Cannot decrypt data. No suitable private key is in the ' .
+ 'keyring. Import a suitable private key before trying to ' .
+ 'decrypt this data.', $code, $keyId);
+
+ case Crypt_GPG::ERROR_BAD_PASSPHRASE:
+ $badPassphrases = array_diff_key(
+ $this->badPassphrases,
+ $this->missingPassphrases
+ );
+
+ $missingPassphrases = array_intersect_key(
+ $this->badPassphrases,
+ $this->missingPassphrases
+ );
+
+ $message = 'Cannot decrypt data.';
+ if (count($badPassphrases) > 0) {
+ $message = ' Incorrect passphrase provided for keys: "' .
+ implode('", "', $badPassphrases) . '".';
+ }
+ if (count($missingPassphrases) > 0) {
+ $message = ' No passphrase provided for keys: "' .
+ implode('", "', $badPassphrases) . '".';
+ }
+
+ throw new Crypt_GPG_BadPassphraseException($message, $code,
+ $badPassphrases, $missingPassphrases);
+
+ case Crypt_GPG::ERROR_NO_DATA:
+ throw new Crypt_GPG_NoDataException(
+ 'Cannot decrypt data. No PGP encrypted data was found in '.
+ 'the provided data.', $code);
+
+ default:
+ throw new Crypt_GPG_Exception(
+ 'Unknown error decrypting data.', $code);
+ }
+ }
+
+ // }}}
+}
+
+?>
diff --git a/plugins/enigma/lib/Crypt/GPG/Engine.php b/plugins/enigma/lib/Crypt/GPG/Engine.php
new file mode 100644
index 000000000..081be8e21
--- /dev/null
+++ b/plugins/enigma/lib/Crypt/GPG/Engine.php
@@ -0,0 +1,1758 @@
+<?php
+
+/* vim: set expandtab tabstop=4 shiftwidth=4 softtabstop=4: */
+
+/**
+ * Crypt_GPG is a package to use GPG from PHP
+ *
+ * This file contains an engine that handles GPG subprocess control and I/O.
+ * PHP's process manipulation functions are used to handle the GPG subprocess.
+ *
+ * PHP version 5
+ *
+ * LICENSE:
+ *
+ * This library is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU Lesser General Public License as
+ * published by the Free Software Foundation; either version 2.1 of the
+ * License, or (at your option) any later version.
+ *
+ * This library is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ * Lesser General Public License for more details.
+ *
+ * You should have received a copy of the GNU Lesser General Public
+ * License along with this library; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+ *
+ * @category Encryption
+ * @package Crypt_GPG
+ * @author Nathan Fredrickson <nathan@silverorange.com>
+ * @author Michael Gauthier <mike@silverorange.com>
+ * @copyright 2005-2010 silverorange
+ * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1
+ * @version CVS: $Id: Engine.php 302822 2010-08-26 17:30:57Z gauthierm $
+ * @link http://pear.php.net/package/Crypt_GPG
+ * @link http://www.gnupg.org/
+ */
+
+/**
+ * Crypt_GPG base class.
+ */
+require_once 'Crypt/GPG.php';
+
+/**
+ * GPG exception classes.
+ */
+require_once 'Crypt/GPG/Exceptions.php';
+
+/**
+ * Standard PEAR exception is used if GPG binary is not found.
+ */
+require_once 'PEAR/Exception.php';
+
+// {{{ class Crypt_GPG_Engine
+
+/**
+ * Native PHP Crypt_GPG I/O engine
+ *
+ * This class is used internally by Crypt_GPG and does not need be used
+ * directly. See the {@link Crypt_GPG} class for end-user API.
+ *
+ * This engine uses PHP's native process control functions to directly control
+ * the GPG process. The GPG executable is required to be on the system.
+ *
+ * All data is passed to the GPG subprocess using file descriptors. This is the
+ * most secure method of passing data to the GPG subprocess.
+ *
+ * @category Encryption
+ * @package Crypt_GPG
+ * @author Nathan Fredrickson <nathan@silverorange.com>
+ * @author Michael Gauthier <mike@silverorange.com>
+ * @copyright 2005-2010 silverorange
+ * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1
+ * @link http://pear.php.net/package/Crypt_GPG
+ * @link http://www.gnupg.org/
+ */
+class Crypt_GPG_Engine
+{
+ // {{{ constants
+
+ /**
+ * Size of data chunks that are sent to and retrieved from the IPC pipes.
+ *
+ * PHP reads 8192 bytes. If this is set to less than 8192, PHP reads 8192
+ * and buffers the rest so we might as well just read 8192.
+ *
+ * Using values other than 8192 also triggers PHP bugs.
+ *
+ * @see http://bugs.php.net/bug.php?id=35224
+ */
+ const CHUNK_SIZE = 8192;
+
+ /**
+ * Standard input file descriptor. This is used to pass data to the GPG
+ * process.
+ */
+ const FD_INPUT = 0;
+
+ /**
+ * Standard output file descriptor. This is used to receive normal output
+ * from the GPG process.
+ */
+ const FD_OUTPUT = 1;
+
+ /**
+ * Standard output file descriptor. This is used to receive error output
+ * from the GPG process.
+ */
+ const FD_ERROR = 2;
+
+ /**
+ * GPG status output file descriptor. The status file descriptor outputs
+ * detailed information for many GPG commands. See the second section of
+ * the file <b>doc/DETAILS</b> in the
+ * {@link http://www.gnupg.org/download/ GPG package} for a detailed
+ * description of GPG's status output.
+ */
+ const FD_STATUS = 3;
+
+ /**
+ * Command input file descriptor. This is used for methods requiring
+ * passphrases.
+ */
+ const FD_COMMAND = 4;
+
+ /**
+ * Extra message input file descriptor. This is used for passing signed
+ * data when verifying a detached signature.
+ */
+ const FD_MESSAGE = 5;
+
+ /**
+ * Minimum version of GnuPG that is supported.
+ */
+ const MIN_VERSION = '1.0.2';
+
+ // }}}
+ // {{{ private class properties
+
+ /**
+ * Whether or not to use debugging mode
+ *
+ * When set to true, every GPG command is echoed before it is run. Sensitive
+ * data is always handled using pipes and is not specified as part of the
+ * command. As a result, sensitive data is never displayed when debug is
+ * enabled. Sensitive data includes private key data and passphrases.
+ *
+ * Debugging is off by default.
+ *
+ * @var boolean
+ * @see Crypt_GPG_Engine::__construct()
+ */
+ private $_debug = false;
+
+ /**
+ * Location of GPG binary
+ *
+ * @var string
+ * @see Crypt_GPG_Engine::__construct()
+ * @see Crypt_GPG_Engine::_getBinary()
+ */
+ private $_binary = '';
+
+ /**
+ * Directory containing the GPG key files
+ *
+ * This property only contains the path when the <i>homedir</i> option
+ * is specified in the constructor.
+ *
+ * @var string
+ * @see Crypt_GPG_Engine::__construct()
+ */
+ private $_homedir = '';
+
+ /**
+ * File path of the public keyring
+ *
+ * This property only contains the file path when the <i>public_keyring</i>
+ * option is specified in the constructor.
+ *
+ * If the specified file path starts with <kbd>~/</kbd>, the path is
+ * relative to the <i>homedir</i> if specified, otherwise to
+ * <kbd>~/.gnupg</kbd>.
+ *
+ * @var string
+ * @see Crypt_GPG_Engine::__construct()
+ */
+ private $_publicKeyring = '';
+
+ /**
+ * File path of the private (secret) keyring
+ *
+ * This property only contains the file path when the <i>private_keyring</i>
+ * option is specified in the constructor.
+ *
+ * If the specified file path starts with <kbd>~/</kbd>, the path is
+ * relative to the <i>homedir</i> if specified, otherwise to
+ * <kbd>~/.gnupg</kbd>.
+ *
+ * @var string
+ * @see Crypt_GPG_Engine::__construct()
+ */
+ private $_privateKeyring = '';
+
+ /**
+ * File path of the trust database
+ *
+ * This property only contains the file path when the <i>trust_db</i>
+ * option is specified in the constructor.
+ *
+ * If the specified file path starts with <kbd>~/</kbd>, the path is
+ * relative to the <i>homedir</i> if specified, otherwise to
+ * <kbd>~/.gnupg</kbd>.
+ *
+ * @var string
+ * @see Crypt_GPG_Engine::__construct()
+ */
+ private $_trustDb = '';
+
+ /**
+ * Array of pipes used for communication with the GPG binary
+ *
+ * This is an array of file descriptor resources.
+ *
+ * @var array
+ */
+ private $_pipes = array();
+
+ /**
+ * Array of currently opened pipes
+ *
+ * This array is used to keep track of remaining opened pipes so they can
+ * be closed when the GPG subprocess is finished. This array is a subset of
+ * the {@link Crypt_GPG_Engine::$_pipes} array and contains opened file
+ * descriptor resources.
+ *
+ * @var array
+ * @see Crypt_GPG_Engine::_closePipe()
+ */
+ private $_openPipes = array();
+
+ /**
+ * A handle for the GPG process
+ *
+ * @var resource
+ */
+ private $_process = null;
+
+ /**
+ * Whether or not the operating system is Darwin (OS X)
+ *
+ * @var boolean
+ */
+ private $_isDarwin = false;
+
+ /**
+ * Commands to be sent to GPG's command input stream
+ *
+ * @var string
+ * @see Crypt_GPG_Engine::sendCommand()
+ */
+ private $_commandBuffer = '';
+
+ /**
+ * Array of status line handlers
+ *
+ * @var array
+ * @see Crypt_GPG_Engine::addStatusHandler()
+ */
+ private $_statusHandlers = array();
+
+ /**
+ * Array of error line handlers
+ *
+ * @var array
+ * @see Crypt_GPG_Engine::addErrorHandler()
+ */
+ private $_errorHandlers = array();
+
+ /**
+ * The error code of the current operation
+ *
+ * @var integer
+ * @see Crypt_GPG_Engine::getErrorCode()
+ */
+ private $_errorCode = Crypt_GPG::ERROR_NONE;
+
+ /**
+ * File related to the error code of the current operation
+ *
+ * @var string
+ * @see Crypt_GPG_Engine::getErrorFilename()
+ */
+ private $_errorFilename = '';
+
+ /**
+ * Key id related to the error code of the current operation
+ *
+ * @var string
+ * @see Crypt_GPG_Engine::getErrorKeyId()
+ */
+ private $_errorkeyId = '';
+
+ /**
+ * The number of currently needed passphrases
+ *
+ * If this is not zero when the GPG command is completed, the error code is
+ * set to {@link Crypt_GPG::ERROR_MISSING_PASSPHRASE}.
+ *
+ * @var integer
+ */
+ private $_needPassphrase = 0;
+
+ /**
+ * The input source
+ *
+ * This is data to send to GPG. Either a string or a stream resource.
+ *
+ * @var string|resource
+ * @see Crypt_GPG_Engine::setInput()
+ */
+ private $_input = null;
+
+ /**
+ * The extra message input source
+ *
+ * Either a string or a stream resource.
+ *
+ * @var string|resource
+ * @see Crypt_GPG_Engine::setMessage()
+ */
+ private $_message = null;
+
+ /**
+ * The output location
+ *
+ * This is where the output from GPG is sent. Either a string or a stream
+ * resource.
+ *
+ * @var string|resource
+ * @see Crypt_GPG_Engine::setOutput()
+ */
+ private $_output = '';
+
+ /**
+ * The GPG operation to execute
+ *
+ * @var string
+ * @see Crypt_GPG_Engine::setOperation()
+ */
+ private $_operation;
+
+ /**
+ * Arguments for the current operation
+ *
+ * @var array
+ * @see Crypt_GPG_Engine::setOperation()
+ */
+ private $_arguments = array();
+
+ /**
+ * The version number of the GPG binary
+ *
+ * @var string
+ * @see Crypt_GPG_Engine::getVersion()
+ */
+ private $_version = '';
+
+ /**
+ * Cached value indicating whether or not mbstring function overloading is
+ * on for strlen
+ *
+ * This is cached for optimal performance inside the I/O loop.
+ *
+ * @var boolean
+ * @see Crypt_GPG_Engine::_byteLength()
+ * @see Crypt_GPG_Engine::_byteSubstring()
+ */
+ private static $_mbStringOverload = null;
+
+ // }}}
+ // {{{ __construct()
+
+ /**
+ * Creates a new GPG engine
+ *
+ * Available options are:
+ *
+ * - <kbd>string homedir</kbd> - the directory where the GPG
+ * keyring files are stored. If not
+ * specified, Crypt_GPG uses the
+ * default of <kbd>~/.gnupg</kbd>.
+ * - <kbd>string publicKeyring</kbd> - the file path of the public
+ * keyring. Use this if the public
+ * keyring is not in the homedir, or
+ * if the keyring is in a directory
+ * not writable by the process
+ * invoking GPG (like Apache). Then
+ * you can specify the path to the
+ * keyring with this option
+ * (/foo/bar/pubring.gpg), and specify
+ * a writable directory (like /tmp)
+ * using the <i>homedir</i> option.
+ * - <kbd>string privateKeyring</kbd> - the file path of the private
+ * keyring. Use this if the private
+ * keyring is not in the homedir, or
+ * if the keyring is in a directory
+ * not writable by the process
+ * invoking GPG (like Apache). Then
+ * you can specify the path to the
+ * keyring with this option
+ * (/foo/bar/secring.gpg), and specify
+ * a writable directory (like /tmp)
+ * using the <i>homedir</i> option.
+ * - <kbd>string trustDb</kbd> - the file path of the web-of-trust
+ * database. Use this if the trust
+ * database is not in the homedir, or
+ * if the database is in a directory
+ * not writable by the process
+ * invoking GPG (like Apache). Then
+ * you can specify the path to the
+ * trust database with this option
+ * (/foo/bar/trustdb.gpg), and specify
+ * a writable directory (like /tmp)
+ * using the <i>homedir</i> option.
+ * - <kbd>string binary</kbd> - the location of the GPG binary. If
+ * not specified, the driver attempts
+ * to auto-detect the GPG binary
+ * location using a list of known
+ * default locations for the current
+ * operating system. The option
+ * <kbd>gpgBinary</kbd> is a
+ * deprecated alias for this option.
+ * - <kbd>boolean debug</kbd> - whether or not to use debug mode.
+ * When debug mode is on, all
+ * communication to and from the GPG
+ * subprocess is logged. This can be
+ * useful to diagnose errors when
+ * using Crypt_GPG.
+ *
+ * @param array $options optional. An array of options used to create the
+ * GPG object. All options are optional and are
+ * represented as key-value pairs.
+ *
+ * @throws Crypt_GPG_FileException if the <kbd>homedir</kbd> does not exist
+ * and cannot be created. This can happen if <kbd>homedir</kbd> is
+ * not specified, Crypt_GPG is run as the web user, and the web
+ * user has no home directory. This exception is also thrown if any
+ * of the options <kbd>publicKeyring</kbd>,
+ * <kbd>privateKeyring</kbd> or <kbd>trustDb</kbd> options are
+ * specified but the files do not exist or are are not readable.
+ * This can happen if the user running the Crypt_GPG process (for
+ * example, the Apache user) does not have permission to read the
+ * files.
+ *
+ * @throws PEAR_Exception if the provided <kbd>binary</kbd> is invalid, or
+ * if no <kbd>binary</kbd> is provided and no suitable binary could
+ * be found.
+ */
+ public function __construct(array $options = array())
+ {
+ $this->_isDarwin = (strncmp(strtoupper(PHP_OS), 'DARWIN', 6) === 0);
+
+ // populate mbstring overloading cache if not set
+ if (self::$_mbStringOverload === null) {
+ self::$_mbStringOverload = (extension_loaded('mbstring')
+ && (ini_get('mbstring.func_overload') & 0x02) === 0x02);
+ }
+
+ // get homedir
+ if (array_key_exists('homedir', $options)) {
+ $this->_homedir = (string)$options['homedir'];
+ } else {
+ // note: this requires the package OS dep exclude 'windows'
+ $info = posix_getpwuid(posix_getuid());
+ $this->_homedir = $info['dir'].'/.gnupg';
+ }
+
+ // attempt to create homedir if it does not exist
+ if (!is_dir($this->_homedir)) {
+ if (@mkdir($this->_homedir, 0777, true)) {
+ // Set permissions on homedir. Parent directories are created
+ // with 0777, homedir is set to 0700.
+ chmod($this->_homedir, 0700);
+ } else {
+ throw new Crypt_GPG_FileException('The \'homedir\' "' .
+ $this->_homedir . '" is not readable or does not exist '.
+ 'and cannot be created. This can happen if \'homedir\' '.
+ 'is not specified in the Crypt_GPG options, Crypt_GPG is '.
+ 'run as the web user, and the web user has no home '.
+ 'directory.',
+ 0, $this->_homedir);
+ }
+ }
+
+ // get binary
+ if (array_key_exists('binary', $options)) {
+ $this->_binary = (string)$options['binary'];
+ } elseif (array_key_exists('gpgBinary', $options)) {
+ // deprecated alias
+ $this->_binary = (string)$options['gpgBinary'];
+ } else {
+ $this->_binary = $this->_getBinary();
+ }
+
+ if ($this->_binary == '' || !is_executable($this->_binary)) {
+ throw new PEAR_Exception('GPG binary not found. If you are sure '.
+ 'the GPG binary is installed, please specify the location of '.
+ 'the GPG binary using the \'binary\' driver option.');
+ }
+
+ /*
+ * Note:
+ *
+ * Normally, GnuPG expects keyrings to be in the homedir and expects
+ * to be able to write temporary files in the homedir. Sometimes,
+ * keyrings are not in the homedir, or location of the keyrings does
+ * not allow writing temporary files. In this case, the <i>homedir</i>
+ * option by itself is not enough to specify the keyrings because GnuPG
+ * can not write required temporary files. Additional options are
+ * provided so you can specify the location of the keyrings separately
+ * from the homedir.
+ */
+
+ // get public keyring
+ if (array_key_exists('publicKeyring', $options)) {
+ $this->_publicKeyring = (string)$options['publicKeyring'];
+ if (!is_readable($this->_publicKeyring)) {
+ throw new Crypt_GPG_FileException('The \'publicKeyring\' "' .
+ $this->_publicKeyring . '" does not exist or is ' .
+ 'not readable. Check the location and ensure the file ' .
+ 'permissions are correct.', 0, $this->_publicKeyring);
+ }
+ }
+
+ // get private keyring
+ if (array_key_exists('privateKeyring', $options)) {
+ $this->_privateKeyring = (string)$options['privateKeyring'];
+ if (!is_readable($this->_privateKeyring)) {
+ throw new Crypt_GPG_FileException('The \'privateKeyring\' "' .
+ $this->_privateKeyring . '" does not exist or is ' .
+ 'not readable. Check the location and ensure the file ' .
+ 'permissions are correct.', 0, $this->_privateKeyring);
+ }
+ }
+
+ // get trust database
+ if (array_key_exists('trustDb', $options)) {
+ $this->_trustDb = (string)$options['trustDb'];
+ if (!is_readable($this->_trustDb)) {
+ throw new Crypt_GPG_FileException('The \'trustDb\' "' .
+ $this->_trustDb . '" does not exist or is not readable. ' .
+ 'Check the location and ensure the file permissions are ' .
+ 'correct.', 0, $this->_trustDb);
+ }
+ }
+
+ if (array_key_exists('debug', $options)) {
+ $this->_debug = (boolean)$options['debug'];
+ }
+ }
+
+ // }}}
+ // {{{ __destruct()
+
+ /**
+ * Closes open GPG subprocesses when this object is destroyed
+ *
+ * Subprocesses should never be left open by this class unless there is
+ * an unknown error and unexpected script termination occurs.
+ */
+ public function __destruct()
+ {
+ $this->_closeSubprocess();
+ }
+
+ // }}}
+ // {{{ addErrorHandler()
+
+ /**
+ * Adds an error handler method
+ *
+ * The method is run every time a new error line is received from the GPG
+ * subprocess. The handler method must accept the error line to be handled
+ * as its first parameter.
+ *
+ * @param callback $callback the callback method to use.
+ * @param array $args optional. Additional arguments to pass as
+ * parameters to the callback method.
+ *
+ * @return void
+ */
+ public function addErrorHandler($callback, array $args = array())
+ {
+ $this->_errorHandlers[] = array(
+ 'callback' => $callback,
+ 'args' => $args
+ );
+ }
+
+ // }}}
+ // {{{ addStatusHandler()
+
+ /**
+ * Adds a status handler method
+ *
+ * The method is run every time a new status line is received from the
+ * GPG subprocess. The handler method must accept the status line to be
+ * handled as its first parameter.
+ *
+ * @param callback $callback the callback method to use.
+ * @param array $args optional. Additional arguments to pass as
+ * parameters to the callback method.
+ *
+ * @return void
+ */
+ public function addStatusHandler($callback, array $args = array())
+ {
+ $this->_statusHandlers[] = array(
+ 'callback' => $callback,
+ 'args' => $args
+ );
+ }
+
+ // }}}
+ // {{{ sendCommand()
+
+ /**
+ * Sends a command to the GPG subprocess over the command file-descriptor
+ * pipe
+ *
+ * @param string $command the command to send.
+ *
+ * @return void
+ *
+ * @sensitive $command
+ */
+ public function sendCommand($command)
+ {
+ if (array_key_exists(self::FD_COMMAND, $this->_openPipes)) {
+ $this->_commandBuffer .= $command . PHP_EOL;
+ }
+ }
+
+ // }}}
+ // {{{ reset()
+
+ /**
+ * Resets the GPG engine, preparing it for a new operation
+ *
+ * @return void
+ *
+ * @see Crypt_GPG_Engine::run()
+ * @see Crypt_GPG_Engine::setOperation()
+ */
+ public function reset()
+ {
+ $this->_operation = '';
+ $this->_arguments = array();
+ $this->_input = null;
+ $this->_message = null;
+ $this->_output = '';
+ $this->_errorCode = Crypt_GPG::ERROR_NONE;
+ $this->_needPassphrase = 0;
+ $this->_commandBuffer = '';
+
+ $this->_statusHandlers = array();
+ $this->_errorHandlers = array();
+
+ $this->addStatusHandler(array($this, '_handleErrorStatus'));
+ $this->addErrorHandler(array($this, '_handleErrorError'));
+
+ if ($this->_debug) {
+ $this->addStatusHandler(array($this, '_handleDebugStatus'));
+ $this->addErrorHandler(array($this, '_handleDebugError'));
+ }
+ }
+
+ // }}}
+ // {{{ run()
+
+ /**
+ * Runs the current GPG operation
+ *
+ * This creates and manages the GPG subprocess.
+ *
+ * The operation must be set with {@link Crypt_GPG_Engine::setOperation()}
+ * before this method is called.
+ *
+ * @return void
+ *
+ * @throws Crypt_GPG_InvalidOperationException if no operation is specified.
+ *
+ * @see Crypt_GPG_Engine::reset()
+ * @see Crypt_GPG_Engine::setOperation()
+ */
+ public function run()
+ {
+ if ($this->_operation === '') {
+ throw new Crypt_GPG_InvalidOperationException('No GPG operation ' .
+ 'specified. Use Crypt_GPG_Engine::setOperation() before ' .
+ 'calling Crypt_GPG_Engine::run().');
+ }
+
+ $this->_openSubprocess();
+ $this->_process();
+ $this->_closeSubprocess();
+ }
+
+ // }}}
+ // {{{ getErrorCode()
+
+ /**
+ * Gets the error code of the last executed operation
+ *
+ * This value is only meaningful after {@link Crypt_GPG_Engine::run()} has
+ * been executed.
+ *
+ * @return integer the error code of the last executed operation.
+ */
+ public function getErrorCode()
+ {
+ return $this->_errorCode;
+ }
+
+ // }}}
+ // {{{ getErrorFilename()
+
+ /**
+ * Gets the file related to the error code of the last executed operation
+ *
+ * This value is only meaningful after {@link Crypt_GPG_Engine::run()} has
+ * been executed. If there is no file related to the error, an empty string
+ * is returned.
+ *
+ * @return string the file related to the error code of the last executed
+ * operation.
+ */
+ public function getErrorFilename()
+ {
+ return $this->_errorFilename;
+ }
+
+ // }}}
+ // {{{ getErrorKeyId()
+
+ /**
+ * Gets the key id related to the error code of the last executed operation
+ *
+ * This value is only meaningful after {@link Crypt_GPG_Engine::run()} has
+ * been executed. If there is no key id related to the error, an empty
+ * string is returned.
+ *
+ * @return string the key id related to the error code of the last executed
+ * operation.
+ */
+ public function getErrorKeyId()
+ {
+ return $this->_errorKeyId;
+ }
+
+ // }}}
+ // {{{ setInput()
+
+ /**
+ * Sets the input source for the current GPG operation
+ *
+ * @param string|resource &$input either a reference to the string
+ * containing the input data or an open
+ * stream resource containing the input
+ * data.
+ *
+ * @return void
+ */
+ public function setInput(&$input)
+ {
+ $this->_input =& $input;
+ }
+
+ // }}}
+ // {{{ setMessage()
+
+ /**
+ * Sets the message source for the current GPG operation
+ *
+ * Detached signature data should be specified here.
+ *
+ * @param string|resource &$message either a reference to the string
+ * containing the message data or an open
+ * stream resource containing the message
+ * data.
+ *
+ * @return void
+ */
+ public function setMessage(&$message)
+ {
+ $this->_message =& $message;
+ }
+
+ // }}}
+ // {{{ setOutput()
+
+ /**
+ * Sets the output destination for the current GPG operation
+ *
+ * @param string|resource &$output either a reference to the string in
+ * which to store GPG output or an open
+ * stream resource to which the output data
+ * should be written.
+ *
+ * @return void
+ */
+ public function setOutput(&$output)
+ {
+ $this->_output =& $output;
+ }
+
+ // }}}
+ // {{{ setOperation()
+
+ /**
+ * Sets the operation to perform
+ *
+ * @param string $operation the operation to perform. This should be one
+ * of GPG's operations. For example,
+ * <kbd>--encrypt</kbd>, <kbd>--decrypt</kbd>,
+ * <kbd>--sign</kbd>, etc.
+ * @param array $arguments optional. Additional arguments for the GPG
+ * subprocess. See the GPG manual for specific
+ * values.
+ *
+ * @return void
+ *
+ * @see Crypt_GPG_Engine::reset()
+ * @see Crypt_GPG_Engine::run()
+ */
+ public function setOperation($operation, array $arguments = array())
+ {
+ $this->_operation = $operation;
+ $this->_arguments = $arguments;
+ }
+
+ // }}}
+ // {{{ getVersion()
+
+ /**
+ * Gets the version of the GnuPG binary
+ *
+ * @return string a version number string containing the version of GnuPG
+ * being used. This value is suitable to use with PHP's
+ * version_compare() function.
+ *
+ * @throws Crypt_GPG_Exception if an unknown or unexpected error occurs.
+ * Use the <kbd>debug</kbd> option and file a bug report if these
+ * exceptions occur.
+ *
+ * @throws Crypt_GPG_UnsupportedException if the provided binary is not
+ * GnuPG or if the GnuPG version is less than 1.0.2.
+ */
+ public function getVersion()
+ {
+ if ($this->_version == '') {
+
+ $options = array(
+ 'homedir' => $this->_homedir,
+ 'binary' => $this->_binary,
+ 'debug' => $this->_debug
+ );
+
+ $engine = new self($options);
+ $info = '';
+
+ // Set a garbage version so we do not end up looking up the version
+ // recursively.
+ $engine->_version = '1.0.0';
+
+ $engine->reset();
+ $engine->setOutput($info);
+ $engine->setOperation('--version');
+ $engine->run();
+
+ $code = $this->getErrorCode();
+
+ if ($code !== Crypt_GPG::ERROR_NONE) {
+ throw new Crypt_GPG_Exception(
+ 'Unknown error getting GnuPG version information. Please ' .
+ 'use the \'debug\' option when creating the Crypt_GPG ' .
+ 'object, and file a bug report at ' . Crypt_GPG::BUG_URI,
+ $code);
+ }
+
+ $matches = array();
+ $expression = '/gpg \(GnuPG\) (\S+)/';
+
+ if (preg_match($expression, $info, $matches) === 1) {
+ $this->_version = $matches[1];
+ } else {
+ throw new Crypt_GPG_Exception(
+ 'No GnuPG version information provided by the binary "' .
+ $this->_binary . '". Are you sure it is GnuPG?');
+ }
+
+ if (version_compare($this->_version, self::MIN_VERSION, 'lt')) {
+ throw new Crypt_GPG_Exception(
+ 'The version of GnuPG being used (' . $this->_version .
+ ') is not supported by Crypt_GPG. The minimum version ' .
+ 'required by Crypt_GPG is ' . self::MIN_VERSION);
+ }
+ }
+
+
+ return $this->_version;
+ }
+
+ // }}}
+ // {{{ _handleErrorStatus()
+
+ /**
+ * Handles error values in the status output from GPG
+ *
+ * This method is responsible for setting the
+ * {@link Crypt_GPG_Engine::$_errorCode}. See <b>doc/DETAILS</b> in the
+ * {@link http://www.gnupg.org/download/ GPG distribution} for detailed
+ * information on GPG's status output.
+ *
+ * @param string $line the status line to handle.
+ *
+ * @return void
+ */
+ private function _handleErrorStatus($line)
+ {
+ $tokens = explode(' ', $line);
+ switch ($tokens[0]) {
+ case 'BAD_PASSPHRASE':
+ $this->_errorCode = Crypt_GPG::ERROR_BAD_PASSPHRASE;
+ break;
+
+ case 'MISSING_PASSPHRASE':
+ $this->_errorCode = Crypt_GPG::ERROR_MISSING_PASSPHRASE;
+ break;
+
+ case 'NODATA':
+ $this->_errorCode = Crypt_GPG::ERROR_NO_DATA;
+ break;
+
+ case 'DELETE_PROBLEM':
+ if ($tokens[1] == '1') {
+ $this->_errorCode = Crypt_GPG::ERROR_KEY_NOT_FOUND;
+ break;
+ } elseif ($tokens[1] == '2') {
+ $this->_errorCode = Crypt_GPG::ERROR_DELETE_PRIVATE_KEY;
+ break;
+ }
+ break;
+
+ case 'IMPORT_RES':
+ if ($tokens[12] > 0) {
+ $this->_errorCode = Crypt_GPG::ERROR_DUPLICATE_KEY;
+ }
+ break;
+
+ case 'NO_PUBKEY':
+ case 'NO_SECKEY':
+ $this->_errorKeyId = $tokens[1];
+ $this->_errorCode = Crypt_GPG::ERROR_KEY_NOT_FOUND;
+ break;
+
+ case 'NEED_PASSPHRASE':
+ $this->_needPassphrase++;
+ break;
+
+ case 'GOOD_PASSPHRASE':
+ $this->_needPassphrase--;
+ break;
+
+ case 'EXPSIG':
+ case 'EXPKEYSIG':
+ case 'REVKEYSIG':
+ case 'BADSIG':
+ $this->_errorCode = Crypt_GPG::ERROR_BAD_SIGNATURE;
+ break;
+
+ }
+ }
+
+ // }}}
+ // {{{ _handleErrorError()
+
+ /**
+ * Handles error values in the error output from GPG
+ *
+ * This method is responsible for setting the
+ * {@link Crypt_GPG_Engine::$_errorCode}.
+ *
+ * @param string $line the error line to handle.
+ *
+ * @return void
+ */
+ private function _handleErrorError($line)
+ {
+ if ($this->_errorCode === Crypt_GPG::ERROR_NONE) {
+ $pattern = '/no valid OpenPGP data found/';
+ if (preg_match($pattern, $line) === 1) {
+ $this->_errorCode = Crypt_GPG::ERROR_NO_DATA;
+ }
+ }
+
+ if ($this->_errorCode === Crypt_GPG::ERROR_NONE) {
+ $pattern = '/No secret key|secret key not available/';
+ if (preg_match($pattern, $line) === 1) {
+ $this->_errorCode = Crypt_GPG::ERROR_KEY_NOT_FOUND;
+ }
+ }
+
+ if ($this->_errorCode === Crypt_GPG::ERROR_NONE) {
+ $pattern = '/No public key|public key not found/';
+ if (preg_match($pattern, $line) === 1) {
+ $this->_errorCode = Crypt_GPG::ERROR_KEY_NOT_FOUND;
+ }
+ }
+
+ if ($this->_errorCode === Crypt_GPG::ERROR_NONE) {
+ $matches = array();
+ $pattern = '/can\'t (?:access|open) `(.*?)\'/';
+ if (preg_match($pattern, $line, $matches) === 1) {
+ $this->_errorFilename = $matches[1];
+ $this->_errorCode = Crypt_GPG::ERROR_FILE_PERMISSIONS;
+ }
+ }
+ }
+
+ // }}}
+ // {{{ _handleDebugStatus()
+
+ /**
+ * Displays debug output for status lines
+ *
+ * @param string $line the status line to handle.
+ *
+ * @return void
+ */
+ private function _handleDebugStatus($line)
+ {
+ $this->_debug('STATUS: ' . $line);
+ }
+
+ // }}}
+ // {{{ _handleDebugError()
+
+ /**
+ * Displays debug output for error lines
+ *
+ * @param string $line the error line to handle.
+ *
+ * @return void
+ */
+ private function _handleDebugError($line)
+ {
+ $this->_debug('ERROR: ' . $line);
+ }
+
+ // }}}
+ // {{{ _process()
+
+ /**
+ * Performs internal streaming operations for the subprocess using either
+ * strings or streams as input / output points
+ *
+ * This is the main I/O loop for streaming to and from the GPG subprocess.
+ *
+ * The implementation of this method is verbose mainly for performance
+ * reasons. Adding streams to a lookup array and looping the array inside
+ * the main I/O loop would be siginficantly slower for large streams.
+ *
+ * @return void
+ *
+ * @throws Crypt_GPG_Exception if there is an error selecting streams for
+ * reading or writing. If this occurs, please file a bug report at
+ * http://pear.php.net/bugs/report.php?package=Crypt_GPG.
+ */
+ private function _process()
+ {
+ $this->_debug('BEGIN PROCESSING');
+
+ $this->_commandBuffer = ''; // buffers input to GPG
+ $messageBuffer = ''; // buffers input to GPG
+ $inputBuffer = ''; // buffers input to GPG
+ $outputBuffer = ''; // buffers output from GPG
+ $statusBuffer = ''; // buffers output from GPG
+ $errorBuffer = ''; // buffers output from GPG
+ $inputComplete = false; // input stream is completely buffered
+ $messageComplete = false; // message stream is completely buffered
+
+ if (is_string($this->_input)) {
+ $inputBuffer = $this->_input;
+ $inputComplete = true;
+ }
+
+ if (is_string($this->_message)) {
+ $messageBuffer = $this->_message;
+ $messageComplete = true;
+ }
+
+ if (is_string($this->_output)) {
+ $outputBuffer =& $this->_output;
+ }
+
+ // convenience variables
+ $fdInput = $this->_pipes[self::FD_INPUT];
+ $fdOutput = $this->_pipes[self::FD_OUTPUT];
+ $fdError = $this->_pipes[self::FD_ERROR];
+ $fdStatus = $this->_pipes[self::FD_STATUS];
+ $fdCommand = $this->_pipes[self::FD_COMMAND];
+ $fdMessage = $this->_pipes[self::FD_MESSAGE];
+
+ while (true) {
+
+ $inputStreams = array();
+ $outputStreams = array();
+ $exceptionStreams = array();
+
+ // set up input streams
+ if (is_resource($this->_input) && !$inputComplete) {
+ if (feof($this->_input)) {
+ $inputComplete = true;
+ } else {
+ $inputStreams[] = $this->_input;
+ }
+ }
+
+ // close GPG input pipe if there is no more data
+ if ($inputBuffer == '' && $inputComplete) {
+ $this->_debug('=> closing GPG input pipe');
+ $this->_closePipe(self::FD_INPUT);
+ }
+
+ if (is_resource($this->_message) && !$messageComplete) {
+ if (feof($this->_message)) {
+ $messageComplete = true;
+ } else {
+ $inputStreams[] = $this->_message;
+ }
+ }
+
+ // close GPG message pipe if there is no more data
+ if ($messageBuffer == '' && $messageComplete) {
+ $this->_debug('=> closing GPG message pipe');
+ $this->_closePipe(self::FD_MESSAGE);
+ }
+
+ if (!feof($fdOutput)) {
+ $inputStreams[] = $fdOutput;
+ }
+
+ if (!feof($fdStatus)) {
+ $inputStreams[] = $fdStatus;
+ }
+
+ if (!feof($fdError)) {
+ $inputStreams[] = $fdError;
+ }
+
+ // set up output streams
+ if ($outputBuffer != '' && is_resource($this->_output)) {
+ $outputStreams[] = $this->_output;
+ }
+
+ if ($this->_commandBuffer != '') {
+ $outputStreams[] = $fdCommand;
+ }
+
+ if ($messageBuffer != '') {
+ $outputStreams[] = $fdMessage;
+ }
+
+ if ($inputBuffer != '') {
+ $outputStreams[] = $fdInput;
+ }
+
+ // no streams left to read or write, we're all done
+ if (count($inputStreams) === 0 && count($outputStreams) === 0) {
+ break;
+ }
+
+ $this->_debug('selecting streams');
+
+ $ready = stream_select(
+ $inputStreams,
+ $outputStreams,
+ $exceptionStreams,
+ null
+ );
+
+ $this->_debug('=> got ' . $ready);
+
+ if ($ready === false) {
+ throw new Crypt_GPG_Exception(
+ 'Error selecting stream for communication with GPG ' .
+ 'subprocess. Please file a bug report at: ' .
+ 'http://pear.php.net/bugs/report.php?package=Crypt_GPG');
+ }
+
+ if ($ready === 0) {
+ throw new Crypt_GPG_Exception(
+ 'stream_select() returned 0. This can not happen! Please ' .
+ 'file a bug report at: ' .
+ 'http://pear.php.net/bugs/report.php?package=Crypt_GPG');
+ }
+
+ // write input (to GPG)
+ if (in_array($fdInput, $outputStreams)) {
+ $this->_debug('GPG is ready for input');
+
+ $chunk = self::_byteSubstring(
+ $inputBuffer,
+ 0,
+ self::CHUNK_SIZE
+ );
+
+ $length = self::_byteLength($chunk);
+
+ $this->_debug(
+ '=> about to write ' . $length . ' bytes to GPG input'
+ );
+
+ $length = fwrite($fdInput, $chunk, $length);
+
+ $this->_debug('=> wrote ' . $length . ' bytes');
+
+ $inputBuffer = self::_byteSubstring(
+ $inputBuffer,
+ $length
+ );
+ }
+
+ // read input (from PHP stream)
+ if (in_array($this->_input, $inputStreams)) {
+ $this->_debug('input stream is ready for reading');
+ $this->_debug(
+ '=> about to read ' . self::CHUNK_SIZE .
+ ' bytes from input stream'
+ );
+
+ $chunk = fread($this->_input, self::CHUNK_SIZE);
+ $length = self::_byteLength($chunk);
+ $inputBuffer .= $chunk;
+
+ $this->_debug('=> read ' . $length . ' bytes');
+ }
+
+ // write message (to GPG)
+ if (in_array($fdMessage, $outputStreams)) {
+ $this->_debug('GPG is ready for message data');
+
+ $chunk = self::_byteSubstring(
+ $messageBuffer,
+ 0,
+ self::CHUNK_SIZE
+ );
+
+ $length = self::_byteLength($chunk);
+
+ $this->_debug(
+ '=> about to write ' . $length . ' bytes to GPG message'
+ );
+
+ $length = fwrite($fdMessage, $chunk, $length);
+ $this->_debug('=> wrote ' . $length . ' bytes');
+
+ $messageBuffer = self::_byteSubstring($messageBuffer, $length);
+ }
+
+ // read message (from PHP stream)
+ if (in_array($this->_message, $inputStreams)) {
+ $this->_debug('message stream is ready for reading');
+ $this->_debug(
+ '=> about to read ' . self::CHUNK_SIZE .
+ ' bytes from message stream'
+ );
+
+ $chunk = fread($this->_message, self::CHUNK_SIZE);
+ $length = self::_byteLength($chunk);
+ $messageBuffer .= $chunk;
+
+ $this->_debug('=> read ' . $length . ' bytes');
+ }
+
+ // read output (from GPG)
+ if (in_array($fdOutput, $inputStreams)) {
+ $this->_debug('GPG output stream ready for reading');
+ $this->_debug(
+ '=> about to read ' . self::CHUNK_SIZE .
+ ' bytes from GPG output'
+ );
+
+ $chunk = fread($fdOutput, self::CHUNK_SIZE);
+ $length = self::_byteLength($chunk);
+ $outputBuffer .= $chunk;
+
+ $this->_debug('=> read ' . $length . ' bytes');
+ }
+
+ // write output (to PHP stream)
+ if (in_array($this->_output, $outputStreams)) {
+ $this->_debug('output stream is ready for data');
+
+ $chunk = self::_byteSubstring(
+ $outputBuffer,
+ 0,
+ self::CHUNK_SIZE
+ );
+
+ $length = self::_byteLength($chunk);
+
+ $this->_debug(
+ '=> about to write ' . $length . ' bytes to output stream'
+ );
+
+ $length = fwrite($this->_output, $chunk, $length);
+
+ $this->_debug('=> wrote ' . $length . ' bytes');
+
+ $outputBuffer = self::_byteSubstring($outputBuffer, $length);
+ }
+
+ // read error (from GPG)
+ if (in_array($fdError, $inputStreams)) {
+ $this->_debug('GPG error stream ready for reading');
+ $this->_debug(
+ '=> about to read ' . self::CHUNK_SIZE .
+ ' bytes from GPG error'
+ );
+
+ $chunk = fread($fdError, self::CHUNK_SIZE);
+ $length = self::_byteLength($chunk);
+ $errorBuffer .= $chunk;
+
+ $this->_debug('=> read ' . $length . ' bytes');
+
+ // pass lines to error handlers
+ while (($pos = strpos($errorBuffer, PHP_EOL)) !== false) {
+ $line = self::_byteSubstring($errorBuffer, 0, $pos);
+ foreach ($this->_errorHandlers as $handler) {
+ array_unshift($handler['args'], $line);
+ call_user_func_array(
+ $handler['callback'],
+ $handler['args']
+ );
+
+ array_shift($handler['args']);
+ }
+ $errorBuffer = self::_byteSubString(
+ $errorBuffer,
+ $pos + self::_byteLength(PHP_EOL)
+ );
+ }
+ }
+
+ // read status (from GPG)
+ if (in_array($fdStatus, $inputStreams)) {
+ $this->_debug('GPG status stream ready for reading');
+ $this->_debug(
+ '=> about to read ' . self::CHUNK_SIZE .
+ ' bytes from GPG status'
+ );
+
+ $chunk = fread($fdStatus, self::CHUNK_SIZE);
+ $length = self::_byteLength($chunk);
+ $statusBuffer .= $chunk;
+
+ $this->_debug('=> read ' . $length . ' bytes');
+
+ // pass lines to status handlers
+ while (($pos = strpos($statusBuffer, PHP_EOL)) !== false) {
+ $line = self::_byteSubstring($statusBuffer, 0, $pos);
+ // only pass lines beginning with magic prefix
+ if (self::_byteSubstring($line, 0, 9) == '[GNUPG:] ') {
+ $line = self::_byteSubstring($line, 9);
+ foreach ($this->_statusHandlers as $handler) {
+ array_unshift($handler['args'], $line);
+ call_user_func_array(
+ $handler['callback'],
+ $handler['args']
+ );
+
+ array_shift($handler['args']);
+ }
+ }
+ $statusBuffer = self::_byteSubString(
+ $statusBuffer,
+ $pos + self::_byteLength(PHP_EOL)
+ );
+ }
+ }
+
+ // write command (to GPG)
+ if (in_array($fdCommand, $outputStreams)) {
+ $this->_debug('GPG is ready for command data');
+
+ // send commands
+ $chunk = self::_byteSubstring(
+ $this->_commandBuffer,
+ 0,
+ self::CHUNK_SIZE
+ );
+
+ $length = self::_byteLength($chunk);
+
+ $this->_debug(
+ '=> about to write ' . $length . ' bytes to GPG command'
+ );
+
+ $length = fwrite($fdCommand, $chunk, $length);
+
+ $this->_debug('=> wrote ' . $length);
+
+ $this->_commandBuffer = self::_byteSubstring(
+ $this->_commandBuffer,
+ $length
+ );
+ }
+
+ } // end loop while streams are open
+
+ $this->_debug('END PROCESSING');
+ }
+
+ // }}}
+ // {{{ _openSubprocess()
+
+ /**
+ * Opens an internal GPG subprocess for the current operation
+ *
+ * Opens a GPG subprocess, then connects the subprocess to some pipes. Sets
+ * the private class property {@link Crypt_GPG_Engine::$_process} to
+ * the new subprocess.
+ *
+ * @return void
+ *
+ * @throws Crypt_GPG_OpenSubprocessException if the subprocess could not be
+ * opened.
+ *
+ * @see Crypt_GPG_Engine::setOperation()
+ * @see Crypt_GPG_Engine::_closeSubprocess()
+ * @see Crypt_GPG_Engine::$_process
+ */
+ private function _openSubprocess()
+ {
+ $version = $this->getVersion();
+
+ $env = $_ENV;
+
+ // Newer versions of GnuPG return localized results. Crypt_GPG only
+ // works with English, so set the locale to 'C' for the subprocess.
+ $env['LC_ALL'] = 'C';
+
+ $commandLine = $this->_binary;
+
+ $defaultArguments = array(
+ '--status-fd ' . escapeshellarg(self::FD_STATUS),
+ '--command-fd ' . escapeshellarg(self::FD_COMMAND),
+ '--no-secmem-warning',
+ '--no-tty',
+ '--no-default-keyring', // ignored if keying files are not specified
+ '--no-options' // prevent creation of ~/.gnupg directory
+ );
+
+ if (version_compare($version, '1.0.7', 'ge')) {
+ if (version_compare($version, '2.0.0', 'lt')) {
+ $defaultArguments[] = '--no-use-agent';
+ }
+ $defaultArguments[] = '--no-permission-warning';
+ }
+
+ if (version_compare($version, '1.4.2', 'ge')) {
+ $defaultArguments[] = '--exit-on-status-write-error';
+ }
+
+ if (version_compare($version, '1.3.2', 'ge')) {
+ $defaultArguments[] = '--trust-model always';
+ } else {
+ $defaultArguments[] = '--always-trust';
+ }
+
+ $arguments = array_merge($defaultArguments, $this->_arguments);
+
+ if ($this->_homedir) {
+ $arguments[] = '--homedir ' . escapeshellarg($this->_homedir);
+
+ // the random seed file makes subsequent actions faster so only
+ // disable it if we have to.
+ if (!is_writeable($this->_homedir)) {
+ $arguments[] = '--no-random-seed-file';
+ }
+ }
+
+ if ($this->_publicKeyring) {
+ $arguments[] = '--keyring ' . escapeshellarg($this->_publicKeyring);
+ }
+
+ if ($this->_privateKeyring) {
+ $arguments[] = '--secret-keyring ' .
+ escapeshellarg($this->_privateKeyring);
+ }
+
+ if ($this->_trustDb) {
+ $arguments[] = '--trustdb-name ' . escapeshellarg($this->_trustDb);
+ }
+
+ $commandLine .= ' ' . implode(' ', $arguments) . ' ' .
+ $this->_operation;
+
+ // Binary operations will not work on Windows with PHP < 5.2.6. This is
+ // in case stream_select() ever works on Windows.
+ $rb = (version_compare(PHP_VERSION, '5.2.6') < 0) ? 'r' : 'rb';
+ $wb = (version_compare(PHP_VERSION, '5.2.6') < 0) ? 'w' : 'wb';
+
+ $descriptorSpec = array(
+ self::FD_INPUT => array('pipe', $rb), // stdin
+ self::FD_OUTPUT => array('pipe', $wb), // stdout
+ self::FD_ERROR => array('pipe', $wb), // stderr
+ self::FD_STATUS => array('pipe', $wb), // status
+ self::FD_COMMAND => array('pipe', $rb), // command
+ self::FD_MESSAGE => array('pipe', $rb) // message
+ );
+
+ $this->_debug('OPENING SUBPROCESS WITH THE FOLLOWING COMMAND:');
+ $this->_debug($commandLine);
+
+ $this->_process = proc_open(
+ $commandLine,
+ $descriptorSpec,
+ $this->_pipes,
+ null,
+ $env,
+ array('binary_pipes' => true)
+ );
+
+ if (!is_resource($this->_process)) {
+ throw new Crypt_GPG_OpenSubprocessException(
+ 'Unable to open GPG subprocess.', 0, $commandLine);
+ }
+
+ $this->_openPipes = $this->_pipes;
+ $this->_errorCode = Crypt_GPG::ERROR_NONE;
+ }
+
+ // }}}
+ // {{{ _closeSubprocess()
+
+ /**
+ * Closes a the internal GPG subprocess
+ *
+ * Closes the internal GPG subprocess. Sets the private class property
+ * {@link Crypt_GPG_Engine::$_process} to null.
+ *
+ * @return void
+ *
+ * @see Crypt_GPG_Engine::_openSubprocess()
+ * @see Crypt_GPG_Engine::$_process
+ */
+ private function _closeSubprocess()
+ {
+ if (is_resource($this->_process)) {
+ $this->_debug('CLOSING SUBPROCESS');
+
+ // close remaining open pipes
+ foreach (array_keys($this->_openPipes) as $pipeNumber) {
+ $this->_closePipe($pipeNumber);
+ }
+
+ $exitCode = proc_close($this->_process);
+
+ if ($exitCode != 0) {
+ $this->_debug(
+ '=> subprocess returned an unexpected exit code: ' .
+ $exitCode
+ );
+
+ if ($this->_errorCode === Crypt_GPG::ERROR_NONE) {
+ if ($this->_needPassphrase > 0) {
+ $this->_errorCode = Crypt_GPG::ERROR_MISSING_PASSPHRASE;
+ } else {
+ $this->_errorCode = Crypt_GPG::ERROR_UNKNOWN;
+ }
+ }
+ }
+
+ $this->_process = null;
+ $this->_pipes = array();
+ }
+ }
+
+ // }}}
+ // {{{ _closePipe()
+
+ /**
+ * Closes an opened pipe used to communicate with the GPG subprocess
+ *
+ * If the pipe is already closed, it is ignored. If the pipe is open, it
+ * is flushed and then closed.
+ *
+ * @param integer $pipeNumber the file descriptor number of the pipe to
+ * close.
+ *
+ * @return void
+ */
+ private function _closePipe($pipeNumber)
+ {
+ $pipeNumber = intval($pipeNumber);
+ if (array_key_exists($pipeNumber, $this->_openPipes)) {
+ fflush($this->_openPipes[$pipeNumber]);
+ fclose($this->_openPipes[$pipeNumber]);
+ unset($this->_openPipes[$pipeNumber]);
+ }
+ }
+
+ // }}}
+ // {{{ _getBinary()
+
+ /**
+ * Gets the name of the GPG binary for the current operating system
+ *
+ * This method is called if the '<kbd>binary</kbd>' option is <i>not</i>
+ * specified when creating this driver.
+ *
+ * @return string the name of the GPG binary for the current operating
+ * system. If no suitable binary could be found, an empty
+ * string is returned.
+ */
+ private function _getBinary()
+ {
+ $binary = '';
+
+ if ($this->_isDarwin) {
+ $binaryFiles = array(
+ '/opt/local/bin/gpg', // MacPorts
+ '/usr/local/bin/gpg', // Mac GPG
+ '/sw/bin/gpg', // Fink
+ '/usr/bin/gpg'
+ );
+ } else {
+ $binaryFiles = array(
+ '/usr/bin/gpg',
+ '/usr/local/bin/gpg'
+ );
+ }
+
+ foreach ($binaryFiles as $binaryFile) {
+ if (is_executable($binaryFile)) {
+ $binary = $binaryFile;
+ break;
+ }
+ }
+
+ return $binary;
+ }
+
+ // }}}
+ // {{{ _debug()
+
+ /**
+ * Displays debug text if debugging is turned on
+ *
+ * Debugging text is prepended with a debug identifier and echoed to stdout.
+ *
+ * @param string $text the debugging text to display.
+ *
+ * @return void
+ */
+ private function _debug($text)
+ {
+ if ($this->_debug) {
+ if (array_key_exists('SHELL', $_ENV)) {
+ foreach (explode(PHP_EOL, $text) as $line) {
+ echo "Crypt_GPG DEBUG: ", $line, PHP_EOL;
+ }
+ } else {
+ // running on a web server, format debug output nicely
+ foreach (explode(PHP_EOL, $text) as $line) {
+ echo "Crypt_GPG DEBUG: <strong>", $line,
+ '</strong><br />', PHP_EOL;
+ }
+ }
+ }
+ }
+
+ // }}}
+ // {{{ _byteLength()
+
+ /**
+ * Gets the length of a string in bytes even if mbstring function
+ * overloading is turned on
+ *
+ * This is used for stream-based communication with the GPG subprocess.
+ *
+ * @param string $string the string for which to get the length.
+ *
+ * @return integer the length of the string in bytes.
+ *
+ * @see Crypt_GPG_Engine::$_mbStringOverload
+ */
+ private static function _byteLength($string)
+ {
+ if (self::$_mbStringOverload) {
+ return mb_strlen($string, '8bit');
+ }
+
+ return strlen((binary)$string);
+ }
+
+ // }}}
+ // {{{ _byteSubstring()
+
+ /**
+ * Gets the substring of a string in bytes even if mbstring function
+ * overloading is turned on
+ *
+ * This is used for stream-based communication with the GPG subprocess.
+ *
+ * @param string $string the input string.
+ * @param integer $start the starting point at which to get the substring.
+ * @param integer $length optional. The length of the substring.
+ *
+ * @return string the extracted part of the string. Unlike the default PHP
+ * <kbd>substr()</kbd> function, the returned value is
+ * always a string and never false.
+ *
+ * @see Crypt_GPG_Engine::$_mbStringOverload
+ */
+ private static function _byteSubstring($string, $start, $length = null)
+ {
+ if (self::$_mbStringOverload) {
+ if ($length === null) {
+ return mb_substr(
+ $string,
+ $start,
+ self::_byteLength($string) - $start, '8bit'
+ );
+ }
+
+ return mb_substr($string, $start, $length, '8bit');
+ }
+
+ if ($length === null) {
+ return (string)substr((binary)$string, $start);
+ }
+
+ return (string)substr((binary)$string, $start, $length);
+ }
+
+ // }}}
+}
+
+// }}}
+
+?>
diff --git a/plugins/enigma/lib/Crypt/GPG/Exceptions.php b/plugins/enigma/lib/Crypt/GPG/Exceptions.php
new file mode 100644
index 000000000..744acf5d4
--- /dev/null
+++ b/plugins/enigma/lib/Crypt/GPG/Exceptions.php
@@ -0,0 +1,473 @@
+<?php
+
+/* vim: set expandtab tabstop=4 shiftwidth=4 softtabstop=4: */
+
+/**
+ * Various exception handling classes for Crypt_GPG
+ *
+ * Crypt_GPG provides an object oriented interface to GNU Privacy
+ * Guard (GPG). It requires the GPG executable to be on the system.
+ *
+ * This file contains various exception classes used by the Crypt_GPG package.
+ *
+ * PHP version 5
+ *
+ * LICENSE:
+ *
+ * This library is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU Lesser General Public License as
+ * published by the Free Software Foundation; either version 2.1 of the
+ * License, or (at your option) any later version.
+ *
+ * This library is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ * Lesser General Public License for more details.
+ *
+ * You should have received a copy of the GNU Lesser General Public
+ * License along with this library; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+ *
+ * @category Encryption
+ * @package Crypt_GPG
+ * @author Nathan Fredrickson <nathan@silverorange.com>
+ * @author Michael Gauthier <mike@silverorange.com>
+ * @copyright 2005 silverorange
+ * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1
+ * @version CVS: $Id: Exceptions.php 273745 2009-01-18 05:24:25Z gauthierm $
+ * @link http://pear.php.net/package/Crypt_GPG
+ */
+
+/**
+ * PEAR Exception handler and base class
+ */
+require_once 'PEAR/Exception.php';
+
+// {{{ class Crypt_GPG_Exception
+
+/**
+ * An exception thrown by the Crypt_GPG package
+ *
+ * @category Encryption
+ * @package Crypt_GPG
+ * @author Michael Gauthier <mike@silverorange.com>
+ * @copyright 2005 silverorange
+ * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1
+ * @link http://pear.php.net/package/Crypt_GPG
+ */
+class Crypt_GPG_Exception extends PEAR_Exception
+{
+}
+
+// }}}
+// {{{ class Crypt_GPG_FileException
+
+/**
+ * An exception thrown when a file is used in ways it cannot be used
+ *
+ * For example, if an output file is specified and the file is not writeable, or
+ * if an input file is specified and the file is not readable, this exception
+ * is thrown.
+ *
+ * @category Encryption
+ * @package Crypt_GPG
+ * @author Michael Gauthier <mike@silverorange.com>
+ * @copyright 2007-2008 silverorange
+ * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1
+ * @link http://pear.php.net/package/Crypt_GPG
+ */
+class Crypt_GPG_FileException extends Crypt_GPG_Exception
+{
+ // {{{ private class properties
+
+ /**
+ * The name of the file that caused this exception
+ *
+ * @var string
+ */
+ private $_filename = '';
+
+ // }}}
+ // {{{ __construct()
+
+ /**
+ * Creates a new Crypt_GPG_FileException
+ *
+ * @param string $message an error message.
+ * @param integer $code a user defined error code.
+ * @param string $filename the name of the file that caused this exception.
+ */
+ public function __construct($message, $code = 0, $filename = '')
+ {
+ $this->_filename = $filename;
+ parent::__construct($message, $code);
+ }
+
+ // }}}
+ // {{{ getFilename()
+
+ /**
+ * Returns the filename of the file that caused this exception
+ *
+ * @return string the filename of the file that caused this exception.
+ *
+ * @see Crypt_GPG_FileException::$_filename
+ */
+ public function getFilename()
+ {
+ return $this->_filename;
+ }
+
+ // }}}
+}
+
+// }}}
+// {{{ class Crypt_GPG_OpenSubprocessException
+
+/**
+ * An exception thrown when the GPG subprocess cannot be opened
+ *
+ * This exception is thrown when the {@link Crypt_GPG_Engine} tries to open a
+ * new subprocess and fails.
+ *
+ * @category Encryption
+ * @package Crypt_GPG
+ * @author Michael Gauthier <mike@silverorange.com>
+ * @copyright 2005 silverorange
+ * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1
+ * @link http://pear.php.net/package/Crypt_GPG
+ */
+class Crypt_GPG_OpenSubprocessException extends Crypt_GPG_Exception
+{
+ // {{{ private class properties
+
+ /**
+ * The command used to try to open the subprocess
+ *
+ * @var string
+ */
+ private $_command = '';
+
+ // }}}
+ // {{{ __construct()
+
+ /**
+ * Creates a new Crypt_GPG_OpenSubprocessException
+ *
+ * @param string $message an error message.
+ * @param integer $code a user defined error code.
+ * @param string $command the command that was called to open the
+ * new subprocess.
+ *
+ * @see Crypt_GPG::_openSubprocess()
+ */
+ public function __construct($message, $code = 0, $command = '')
+ {
+ $this->_command = $command;
+ parent::__construct($message, $code);
+ }
+
+ // }}}
+ // {{{ getCommand()
+
+ /**
+ * Returns the contents of the internal _command property
+ *
+ * @return string the command used to open the subprocess.
+ *
+ * @see Crypt_GPG_OpenSubprocessException::$_command
+ */
+ public function getCommand()
+ {
+ return $this->_command;
+ }
+
+ // }}}
+}
+
+// }}}
+// {{{ class Crypt_GPG_InvalidOperationException
+
+/**
+ * An exception thrown when an invalid GPG operation is attempted
+ *
+ * @category Encryption
+ * @package Crypt_GPG
+ * @author Michael Gauthier <mike@silverorange.com>
+ * @copyright 2008 silverorange
+ * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1
+ * @link http://pear.php.net/package/Crypt_GPG
+ */
+class Crypt_GPG_InvalidOperationException extends Crypt_GPG_Exception
+{
+ // {{{ private class properties
+
+ /**
+ * The attempted operation
+ *
+ * @var string
+ */
+ private $_operation = '';
+
+ // }}}
+ // {{{ __construct()
+
+ /**
+ * Creates a new Crypt_GPG_OpenSubprocessException
+ *
+ * @param string $message an error message.
+ * @param integer $code a user defined error code.
+ * @param string $operation the operation.
+ */
+ public function __construct($message, $code = 0, $operation = '')
+ {
+ $this->_operation = $operation;
+ parent::__construct($message, $code);
+ }
+
+ // }}}
+ // {{{ getOperation()
+
+ /**
+ * Returns the contents of the internal _operation property
+ *
+ * @return string the attempted operation.
+ *
+ * @see Crypt_GPG_InvalidOperationException::$_operation
+ */
+ public function getOperation()
+ {
+ return $this->_operation;
+ }
+
+ // }}}
+}
+
+// }}}
+// {{{ class Crypt_GPG_KeyNotFoundException
+
+/**
+ * An exception thrown when Crypt_GPG fails to find the key for various
+ * operations
+ *
+ * @category Encryption
+ * @package Crypt_GPG
+ * @author Michael Gauthier <mike@silverorange.com>
+ * @copyright 2005 silverorange
+ * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1
+ * @link http://pear.php.net/package/Crypt_GPG
+ */
+class Crypt_GPG_KeyNotFoundException extends Crypt_GPG_Exception
+{
+ // {{{ private class properties
+
+ /**
+ * The key identifier that was searched for
+ *
+ * @var string
+ */
+ private $_keyId = '';
+
+ // }}}
+ // {{{ __construct()
+
+ /**
+ * Creates a new Crypt_GPG_KeyNotFoundException
+ *
+ * @param string $message an error message.
+ * @param integer $code a user defined error code.
+ * @param string $keyId the key identifier of the key.
+ */
+ public function __construct($message, $code = 0, $keyId= '')
+ {
+ $this->_keyId = $keyId;
+ parent::__construct($message, $code);
+ }
+
+ // }}}
+ // {{{ getKeyId()
+
+ /**
+ * Gets the key identifier of the key that was not found
+ *
+ * @return string the key identifier of the key that was not found.
+ */
+ public function getKeyId()
+ {
+ return $this->_keyId;
+ }
+
+ // }}}
+}
+
+// }}}
+// {{{ class Crypt_GPG_NoDataException
+
+/**
+ * An exception thrown when Crypt_GPG cannot find valid data for various
+ * operations
+ *
+ * @category Encryption
+ * @package Crypt_GPG
+ * @author Michael Gauthier <mike@silverorange.com>
+ * @copyright 2006 silverorange
+ * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1
+ * @link http://pear.php.net/package/Crypt_GPG
+ */
+class Crypt_GPG_NoDataException extends Crypt_GPG_Exception
+{
+}
+
+// }}}
+// {{{ class Crypt_GPG_BadPassphraseException
+
+/**
+ * An exception thrown when a required passphrase is incorrect or missing
+ *
+ * @category Encryption
+ * @package Crypt_GPG
+ * @author Michael Gauthier <mike@silverorange.com>
+ * @copyright 2006-2008 silverorange
+ * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1
+ * @link http://pear.php.net/package/Crypt_GPG
+ */
+class Crypt_GPG_BadPassphraseException extends Crypt_GPG_Exception
+{
+ // {{{ private class properties
+
+ /**
+ * Keys for which the passhprase is missing
+ *
+ * This contains primary user ids indexed by sub-key id.
+ *
+ * @var array
+ */
+ private $_missingPassphrases = array();
+
+ /**
+ * Keys for which the passhprase is incorrect
+ *
+ * This contains primary user ids indexed by sub-key id.
+ *
+ * @var array
+ */
+ private $_badPassphrases = array();
+
+ // }}}
+ // {{{ __construct()
+
+ /**
+ * Creates a new Crypt_GPG_BadPassphraseException
+ *
+ * @param string $message an error message.
+ * @param integer $code a user defined error code.
+ * @param string $badPassphrases an array containing user ids of keys
+ * for which the passphrase is incorrect.
+ * @param string $missingPassphrases an array containing user ids of keys
+ * for which the passphrase is missing.
+ */
+ public function __construct($message, $code = 0,
+ array $badPassphrases = array(), array $missingPassphrases = array()
+ ) {
+ $this->_badPassphrases = $badPassphrases;
+ $this->_missingPassphrases = $missingPassphrases;
+
+ parent::__construct($message, $code);
+ }
+
+ // }}}
+ // {{{ getBadPassphrases()
+
+ /**
+ * Gets keys for which the passhprase is incorrect
+ *
+ * @return array an array of keys for which the passphrase is incorrect.
+ * The array contains primary user ids indexed by the sub-key
+ * id.
+ */
+ public function getBadPassphrases()
+ {
+ return $this->_badPassphrases;
+ }
+
+ // }}}
+ // {{{ getMissingPassphrases()
+
+ /**
+ * Gets keys for which the passhprase is missing
+ *
+ * @return array an array of keys for which the passphrase is missing.
+ * The array contains primary user ids indexed by the sub-key
+ * id.
+ */
+ public function getMissingPassphrases()
+ {
+ return $this->_missingPassphrases;
+ }
+
+ // }}}
+}
+
+// }}}
+// {{{ class Crypt_GPG_DeletePrivateKeyException
+
+/**
+ * An exception thrown when an attempt is made to delete public key that has an
+ * associated private key on the keyring
+ *
+ * @category Encryption
+ * @package Crypt_GPG
+ * @author Michael Gauthier <mike@silverorange.com>
+ * @copyright 2008 silverorange
+ * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1
+ * @link http://pear.php.net/package/Crypt_GPG
+ */
+class Crypt_GPG_DeletePrivateKeyException extends Crypt_GPG_Exception
+{
+ // {{{ private class properties
+
+ /**
+ * The key identifier the deletion attempt was made upon
+ *
+ * @var string
+ */
+ private $_keyId = '';
+
+ // }}}
+ // {{{ __construct()
+
+ /**
+ * Creates a new Crypt_GPG_DeletePrivateKeyException
+ *
+ * @param string $message an error message.
+ * @param integer $code a user defined error code.
+ * @param string $keyId the key identifier of the public key that was
+ * attempted to delete.
+ *
+ * @see Crypt_GPG::deletePublicKey()
+ */
+ public function __construct($message, $code = 0, $keyId = '')
+ {
+ $this->_keyId = $keyId;
+ parent::__construct($message, $code);
+ }
+
+ // }}}
+ // {{{ getKeyId()
+
+ /**
+ * Gets the key identifier of the key that was not found
+ *
+ * @return string the key identifier of the key that was not found.
+ */
+ public function getKeyId()
+ {
+ return $this->_keyId;
+ }
+
+ // }}}
+}
+
+// }}}
+
+?>
diff --git a/plugins/enigma/lib/Crypt/GPG/Key.php b/plugins/enigma/lib/Crypt/GPG/Key.php
new file mode 100644
index 000000000..67a4b9c7d
--- /dev/null
+++ b/plugins/enigma/lib/Crypt/GPG/Key.php
@@ -0,0 +1,223 @@
+<?php
+
+/* vim: set expandtab tabstop=4 shiftwidth=4 softtabstop=4: */
+
+/**
+ * Contains a class representing GPG keys
+ *
+ * PHP version 5
+ *
+ * LICENSE:
+ *
+ * This library is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU Lesser General Public License as
+ * published by the Free Software Foundation; either version 2.1 of the
+ * License, or (at your option) any later version.
+ *
+ * This library is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ * Lesser General Public License for more details.
+ *
+ * You should have received a copy of the GNU Lesser General Public
+ * License along with this library; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+ *
+ * @category Encryption
+ * @package Crypt_GPG
+ * @author Michael Gauthier <mike@silverorange.com>
+ * @copyright 2008-2010 silverorange
+ * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1
+ * @version CVS: $Id: Key.php 295621 2010-03-01 04:18:54Z gauthierm $
+ * @link http://pear.php.net/package/Crypt_GPG
+ */
+
+/**
+ * Sub-key class definition
+ */
+require_once 'Crypt/GPG/SubKey.php';
+
+/**
+ * User id class definition
+ */
+require_once 'Crypt/GPG/UserId.php';
+
+// {{{ class Crypt_GPG_Key
+
+/**
+ * A data class for GPG key information
+ *
+ * This class is used to store the results of the {@link Crypt_GPG::getKeys()}
+ * method.
+ *
+ * @category Encryption
+ * @package Crypt_GPG
+ * @author Michael Gauthier <mike@silverorange.com>
+ * @copyright 2008-2010 silverorange
+ * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1
+ * @link http://pear.php.net/package/Crypt_GPG
+ * @see Crypt_GPG::getKeys()
+ */
+class Crypt_GPG_Key
+{
+ // {{{ class properties
+
+ /**
+ * The user ids associated with this key
+ *
+ * This is an array of {@link Crypt_GPG_UserId} objects.
+ *
+ * @var array
+ *
+ * @see Crypt_GPG_Key::addUserId()
+ * @see Crypt_GPG_Key::getUserIds()
+ */
+ private $_userIds = array();
+
+ /**
+ * The subkeys of this key
+ *
+ * This is an array of {@link Crypt_GPG_SubKey} objects.
+ *
+ * @var array
+ *
+ * @see Crypt_GPG_Key::addSubKey()
+ * @see Crypt_GPG_Key::getSubKeys()
+ */
+ private $_subKeys = array();
+
+ // }}}
+ // {{{ getSubKeys()
+
+ /**
+ * Gets the sub-keys of this key
+ *
+ * @return array the sub-keys of this key.
+ *
+ * @see Crypt_GPG_Key::addSubKey()
+ */
+ public function getSubKeys()
+ {
+ return $this->_subKeys;
+ }
+
+ // }}}
+ // {{{ getUserIds()
+
+ /**
+ * Gets the user ids of this key
+ *
+ * @return array the user ids of this key.
+ *
+ * @see Crypt_GPG_Key::addUserId()
+ */
+ public function getUserIds()
+ {
+ return $this->_userIds;
+ }
+
+ // }}}
+ // {{{ getPrimaryKey()
+
+ /**
+ * Gets the primary sub-key of this key
+ *
+ * The primary key is the first added sub-key.
+ *
+ * @return Crypt_GPG_SubKey the primary sub-key of this key.
+ */
+ public function getPrimaryKey()
+ {
+ $primary_key = null;
+ if (count($this->_subKeys) > 0) {
+ $primary_key = $this->_subKeys[0];
+ }
+ return $primary_key;
+ }
+
+ // }}}
+ // {{{ canSign()
+
+ /**
+ * Gets whether or not this key can sign data
+ *
+ * This key can sign data if any sub-key of this key can sign data.
+ *
+ * @return boolean true if this key can sign data and false if this key
+ * cannot sign data.
+ */
+ public function canSign()
+ {
+ $canSign = false;
+ foreach ($this->_subKeys as $subKey) {
+ if ($subKey->canSign()) {
+ $canSign = true;
+ break;
+ }
+ }
+ return $canSign;
+ }
+
+ // }}}
+ // {{{ canEncrypt()
+
+ /**
+ * Gets whether or not this key can encrypt data
+ *
+ * This key can encrypt data if any sub-key of this key can encrypt data.
+ *
+ * @return boolean true if this key can encrypt data and false if this
+ * key cannot encrypt data.
+ */
+ public function canEncrypt()
+ {
+ $canEncrypt = false;
+ foreach ($this->_subKeys as $subKey) {
+ if ($subKey->canEncrypt()) {
+ $canEncrypt = true;
+ break;
+ }
+ }
+ return $canEncrypt;
+ }
+
+ // }}}
+ // {{{ addSubKey()
+
+ /**
+ * Adds a sub-key to this key
+ *
+ * The first added sub-key will be the primary key of this key.
+ *
+ * @param Crypt_GPG_SubKey $subKey the sub-key to add.
+ *
+ * @return Crypt_GPG_Key the current object, for fluent interface.
+ */
+ public function addSubKey(Crypt_GPG_SubKey $subKey)
+ {
+ $this->_subKeys[] = $subKey;
+ return $this;
+ }
+
+ // }}}
+ // {{{ addUserId()
+
+ /**
+ * Adds a user id to this key
+ *
+ * @param Crypt_GPG_UserId $userId the user id to add.
+ *
+ * @return Crypt_GPG_Key the current object, for fluent interface.
+ */
+ public function addUserId(Crypt_GPG_UserId $userId)
+ {
+ $this->_userIds[] = $userId;
+ return $this;
+ }
+
+ // }}}
+}
+
+// }}}
+
+?>
diff --git a/plugins/enigma/lib/Crypt/GPG/Signature.php b/plugins/enigma/lib/Crypt/GPG/Signature.php
new file mode 100644
index 000000000..03ab44c53
--- /dev/null
+++ b/plugins/enigma/lib/Crypt/GPG/Signature.php
@@ -0,0 +1,428 @@
+<?php
+
+/* vim: set expandtab tabstop=4 shiftwidth=4 softtabstop=4: */
+
+/**
+ * A class representing GPG signatures
+ *
+ * This file contains a data class representing a GPG signature.
+ *
+ * PHP version 5
+ *
+ * LICENSE:
+ *
+ * This library is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU Lesser General Public License as
+ * published by the Free Software Foundation; either version 2.1 of the
+ * License, or (at your option) any later version.
+ *
+ * This library is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ * Lesser General Public License for more details.
+ *
+ * You should have received a copy of the GNU Lesser General Public
+ * License along with this library; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+ *
+ * @category Encryption
+ * @package Crypt_GPG
+ * @author Nathan Fredrickson <nathan@silverorange.com>
+ * @copyright 2005-2010 silverorange
+ * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1
+ * @version CVS: $Id: Signature.php 302773 2010-08-25 14:16:28Z gauthierm $
+ * @link http://pear.php.net/package/Crypt_GPG
+ */
+
+/**
+ * User id class definition
+ */
+require_once 'Crypt/GPG/UserId.php';
+
+// {{{ class Crypt_GPG_Signature
+
+/**
+ * A class for GPG signature information
+ *
+ * This class is used to store the results of the Crypt_GPG::verify() method.
+ *
+ * @category Encryption
+ * @package Crypt_GPG
+ * @author Nathan Fredrickson <nathan@silverorange.com>
+ * @author Michael Gauthier <mike@silverorange.com>
+ * @copyright 2005-2010 silverorange
+ * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1
+ * @link http://pear.php.net/package/Crypt_GPG
+ * @see Crypt_GPG::verify()
+ */
+class Crypt_GPG_Signature
+{
+ // {{{ class properties
+
+ /**
+ * A base64-encoded string containing a unique id for this signature if
+ * this signature has been verified as ok
+ *
+ * This id is used to prevent replay attacks and is not present for all
+ * types of signatures.
+ *
+ * @var string
+ */
+ private $_id = '';
+
+ /**
+ * The fingerprint of the key used to create the signature
+ *
+ * @var string
+ */
+ private $_keyFingerprint = '';
+
+ /**
+ * The id of the key used to create the signature
+ *
+ * @var string
+ */
+ private $_keyId = '';
+
+ /**
+ * The creation date of this signature
+ *
+ * This is a Unix timestamp.
+ *
+ * @var integer
+ */
+ private $_creationDate = 0;
+
+ /**
+ * The expiration date of the signature
+ *
+ * This is a Unix timestamp. If this signature does not expire, this will
+ * be zero.
+ *
+ * @var integer
+ */
+ private $_expirationDate = 0;
+
+ /**
+ * The user id associated with this signature
+ *
+ * @var Crypt_GPG_UserId
+ */
+ private $_userId = null;
+
+ /**
+ * Whether or not this signature is valid
+ *
+ * @var boolean
+ */
+ private $_isValid = false;
+
+ // }}}
+ // {{{ __construct()
+
+ /**
+ * Creates a new signature
+ *
+ * Signatures can be initialized from an array of named values. Available
+ * names are:
+ *
+ * - <kbd>string id</kbd> - the unique id of this signature.
+ * - <kbd>string fingerprint</kbd> - the fingerprint of the key used to
+ * create the signature. The fingerprint
+ * should not contain formatting
+ * characters.
+ * - <kbd>string keyId</kbd> - the id of the key used to create the
+ * the signature.
+ * - <kbd>integer creation</kbd> - the date the signature was created.
+ * This is a UNIX timestamp.
+ * - <kbd>integer expiration</kbd> - the date the signature expired. This
+ * is a UNIX timestamp. If the signature
+ * does not expire, use 0.
+ * - <kbd>boolean valid</kbd> - whether or not the signature is valid.
+ * - <kbd>string userId</kbd> - the user id associated with the
+ * signature. This may also be a
+ * {@link Crypt_GPG_UserId} object.
+ *
+ * @param Crypt_GPG_Signature|array $signature optional. Either an existing
+ * signature object, which is copied; or an array of initial values.
+ */
+ public function __construct($signature = null)
+ {
+ // copy from object
+ if ($signature instanceof Crypt_GPG_Signature) {
+ $this->_id = $signature->_id;
+ $this->_keyFingerprint = $signature->_keyFingerprint;
+ $this->_keyId = $signature->_keyId;
+ $this->_creationDate = $signature->_creationDate;
+ $this->_expirationDate = $signature->_expirationDate;
+ $this->_isValid = $signature->_isValid;
+
+ if ($signature->_userId instanceof Crypt_GPG_UserId) {
+ $this->_userId = clone $signature->_userId;
+ } else {
+ $this->_userId = $signature->_userId;
+ }
+ }
+
+ // initialize from array
+ if (is_array($signature)) {
+ if (array_key_exists('id', $signature)) {
+ $this->setId($signature['id']);
+ }
+
+ if (array_key_exists('fingerprint', $signature)) {
+ $this->setKeyFingerprint($signature['fingerprint']);
+ }
+
+ if (array_key_exists('keyId', $signature)) {
+ $this->setKeyId($signature['keyId']);
+ }
+
+ if (array_key_exists('creation', $signature)) {
+ $this->setCreationDate($signature['creation']);
+ }
+
+ if (array_key_exists('expiration', $signature)) {
+ $this->setExpirationDate($signature['expiration']);
+ }
+
+ if (array_key_exists('valid', $signature)) {
+ $this->setValid($signature['valid']);
+ }
+
+ if (array_key_exists('userId', $signature)) {
+ $userId = new Crypt_GPG_UserId($signature['userId']);
+ $this->setUserId($userId);
+ }
+ }
+ }
+
+ // }}}
+ // {{{ getId()
+
+ /**
+ * Gets the id of this signature
+ *
+ * @return string a base64-encoded string containing a unique id for this
+ * signature. This id is used to prevent replay attacks and
+ * is not present for all types of signatures.
+ */
+ public function getId()
+ {
+ return $this->_id;
+ }
+
+ // }}}
+ // {{{ getKeyFingerprint()
+
+ /**
+ * Gets the fingerprint of the key used to create this signature
+ *
+ * @return string the fingerprint of the key used to create this signature.
+ */
+ public function getKeyFingerprint()
+ {
+ return $this->_keyFingerprint;
+ }
+
+ // }}}
+ // {{{ getKeyId()
+
+ /**
+ * Gets the id of the key used to create this signature
+ *
+ * Whereas the fingerprint of the signing key may not always be available
+ * (for example if the signature is bad), the id should always be
+ * available.
+ *
+ * @return string the id of the key used to create this signature.
+ */
+ public function getKeyId()
+ {
+ return $this->_keyId;
+ }
+
+ // }}}
+ // {{{ getCreationDate()
+
+ /**
+ * Gets the creation date of this signature
+ *
+ * @return integer the creation date of this signature. This is a Unix
+ * timestamp.
+ */
+ public function getCreationDate()
+ {
+ return $this->_creationDate;
+ }
+
+ // }}}
+ // {{{ getExpirationDate()
+
+ /**
+ * Gets the expiration date of the signature
+ *
+ * @return integer the expiration date of this signature. This is a Unix
+ * timestamp. If this signature does not expire, this will
+ * be zero.
+ */
+ public function getExpirationDate()
+ {
+ return $this->_expirationDate;
+ }
+
+ // }}}
+ // {{{ getUserId()
+
+ /**
+ * Gets the user id associated with this signature
+ *
+ * @return Crypt_GPG_UserId the user id associated with this signature.
+ */
+ public function getUserId()
+ {
+ return $this->_userId;
+ }
+
+ // }}}
+ // {{{ isValid()
+
+ /**
+ * Gets whether or no this signature is valid
+ *
+ * @return boolean true if this signature is valid and false if it is not.
+ */
+ public function isValid()
+ {
+ return $this->_isValid;
+ }
+
+ // }}}
+ // {{{ setId()
+
+ /**
+ * Sets the id of this signature
+ *
+ * @param string $id a base64-encoded string containing a unique id for
+ * this signature.
+ *
+ * @return Crypt_GPG_Signature the current object, for fluent interface.
+ *
+ * @see Crypt_GPG_Signature::getId()
+ */
+ public function setId($id)
+ {
+ $this->_id = strval($id);
+ return $this;
+ }
+
+ // }}}
+ // {{{ setKeyFingerprint()
+
+ /**
+ * Sets the key fingerprint of this signature
+ *
+ * @param string $fingerprint the key fingerprint of this signature. This
+ * is the fingerprint of the primary key used to
+ * create this signature.
+ *
+ * @return Crypt_GPG_Signature the current object, for fluent interface.
+ */
+ public function setKeyFingerprint($fingerprint)
+ {
+ $this->_keyFingerprint = strval($fingerprint);
+ return $this;
+ }
+
+ // }}}
+ // {{{ setKeyId()
+
+ /**
+ * Sets the key id of this signature
+ *
+ * @param string $id the key id of this signature. This is the id of the
+ * primary key used to create this signature.
+ *
+ * @return Crypt_GPG_Signature the current object, for fluent interface.
+ */
+ public function setKeyId($id)
+ {
+ $this->_keyId = strval($id);
+ return $this;
+ }
+
+ // }}}
+ // {{{ setCreationDate()
+
+ /**
+ * Sets the creation date of this signature
+ *
+ * @param integer $creationDate the creation date of this signature. This
+ * is a Unix timestamp.
+ *
+ * @return Crypt_GPG_Signature the current object, for fluent interface.
+ */
+ public function setCreationDate($creationDate)
+ {
+ $this->_creationDate = intval($creationDate);
+ return $this;
+ }
+
+ // }}}
+ // {{{ setExpirationDate()
+
+ /**
+ * Sets the expiration date of this signature
+ *
+ * @param integer $expirationDate the expiration date of this signature.
+ * This is a Unix timestamp. Specify zero if
+ * this signature does not expire.
+ *
+ * @return Crypt_GPG_Signature the current object, for fluent interface.
+ */
+ public function setExpirationDate($expirationDate)
+ {
+ $this->_expirationDate = intval($expirationDate);
+ return $this;
+ }
+
+ // }}}
+ // {{{ setUserId()
+
+ /**
+ * Sets the user id associated with this signature
+ *
+ * @param Crypt_GPG_UserId $userId the user id associated with this
+ * signature.
+ *
+ * @return Crypt_GPG_Signature the current object, for fluent interface.
+ */
+ public function setUserId(Crypt_GPG_UserId $userId)
+ {
+ $this->_userId = $userId;
+ return $this;
+ }
+
+ // }}}
+ // {{{ setValid()
+
+ /**
+ * Sets whether or not this signature is valid
+ *
+ * @param boolean $isValid true if this signature is valid and false if it
+ * is not.
+ *
+ * @return Crypt_GPG_Signature the current object, for fluent interface.
+ */
+ public function setValid($isValid)
+ {
+ $this->_isValid = ($isValid) ? true : false;
+ return $this;
+ }
+
+ // }}}
+}
+
+// }}}
+
+?>
diff --git a/plugins/enigma/lib/Crypt/GPG/SubKey.php b/plugins/enigma/lib/Crypt/GPG/SubKey.php
new file mode 100644
index 000000000..b6316e99f
--- /dev/null
+++ b/plugins/enigma/lib/Crypt/GPG/SubKey.php
@@ -0,0 +1,649 @@
+<?php
+
+/* vim: set expandtab tabstop=4 shiftwidth=4 softtabstop=4: */
+
+/**
+ * Contains a class representing GPG sub-keys and constants for GPG algorithms
+ *
+ * PHP version 5
+ *
+ * LICENSE:
+ *
+ * This library is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU Lesser General Public License as
+ * published by the Free Software Foundation; either version 2.1 of the
+ * License, or (at your option) any later version.
+ *
+ * This library is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ * Lesser General Public License for more details.
+ *
+ * You should have received a copy of the GNU Lesser General Public
+ * License along with this library; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+ *
+ * @category Encryption
+ * @package Crypt_GPG
+ * @author Michael Gauthier <mike@silverorange.com>
+ * @author Nathan Fredrickson <nathan@silverorange.com>
+ * @copyright 2005-2010 silverorange
+ * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1
+ * @version CVS: $Id: SubKey.php 302768 2010-08-25 13:45:52Z gauthierm $
+ * @link http://pear.php.net/package/Crypt_GPG
+ */
+
+// {{{ class Crypt_GPG_SubKey
+
+/**
+ * A class for GPG sub-key information
+ *
+ * This class is used to store the results of the {@link Crypt_GPG::getKeys()}
+ * method. Sub-key objects are members of a {@link Crypt_GPG_Key} object.
+ *
+ * @category Encryption
+ * @package Crypt_GPG
+ * @author Michael Gauthier <mike@silverorange.com>
+ * @author Nathan Fredrickson <nathan@silverorange.com>
+ * @copyright 2005-2010 silverorange
+ * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1
+ * @link http://pear.php.net/package/Crypt_GPG
+ * @see Crypt_GPG::getKeys()
+ * @see Crypt_GPG_Key::getSubKeys()
+ */
+class Crypt_GPG_SubKey
+{
+ // {{{ class constants
+
+ /**
+ * RSA encryption algorithm.
+ */
+ const ALGORITHM_RSA = 1;
+
+ /**
+ * Elgamal encryption algorithm (encryption only).
+ */
+ const ALGORITHM_ELGAMAL_ENC = 16;
+
+ /**
+ * DSA encryption algorithm (sometimes called DH, sign only).
+ */
+ const ALGORITHM_DSA = 17;
+
+ /**
+ * Elgamal encryption algorithm (signage and encryption - should not be
+ * used).
+ */
+ const ALGORITHM_ELGAMAL_ENC_SGN = 20;
+
+ // }}}
+ // {{{ class properties
+
+ /**
+ * The id of this sub-key
+ *
+ * @var string
+ */
+ private $_id = '';
+
+ /**
+ * The algorithm used to create this sub-key
+ *
+ * The value is one of the Crypt_GPG_SubKey::ALGORITHM_* constants.
+ *
+ * @var integer
+ */
+ private $_algorithm = 0;
+
+ /**
+ * The fingerprint of this sub-key
+ *
+ * @var string
+ */
+ private $_fingerprint = '';
+
+ /**
+ * Length of this sub-key in bits
+ *
+ * @var integer
+ */
+ private $_length = 0;
+
+ /**
+ * Date this sub-key was created
+ *
+ * This is a Unix timestamp.
+ *
+ * @var integer
+ */
+ private $_creationDate = 0;
+
+ /**
+ * Date this sub-key expires
+ *
+ * This is a Unix timestamp. If this sub-key does not expire, this will be
+ * zero.
+ *
+ * @var integer
+ */
+ private $_expirationDate = 0;
+
+ /**
+ * Whether or not this sub-key can sign data
+ *
+ * @var boolean
+ */
+ private $_canSign = false;
+
+ /**
+ * Whether or not this sub-key can encrypt data
+ *
+ * @var boolean
+ */
+ private $_canEncrypt = false;
+
+ /**
+ * Whether or not the private key for this sub-key exists in the keyring
+ *
+ * @var boolean
+ */
+ private $_hasPrivate = false;
+
+ /**
+ * Whether or not this sub-key is revoked
+ *
+ * @var boolean
+ */
+ private $_isRevoked = false;
+
+ // }}}
+ // {{{ __construct()
+
+ /**
+ * Creates a new sub-key object
+ *
+ * Sub-keys can be initialized from an array of named values. Available
+ * names are:
+ *
+ * - <kbd>string id</kbd> - the key id of the sub-key.
+ * - <kbd>integer algorithm</kbd> - the encryption algorithm of the
+ * sub-key.
+ * - <kbd>string fingerprint</kbd> - the fingerprint of the sub-key. The
+ * fingerprint should not contain
+ * formatting characters.
+ * - <kbd>integer length</kbd> - the length of the sub-key in bits.
+ * - <kbd>integer creation</kbd> - the date the sub-key was created.
+ * This is a UNIX timestamp.
+ * - <kbd>integer expiration</kbd> - the date the sub-key expires. This
+ * is a UNIX timestamp. If the sub-key
+ * does not expire, use 0.
+ * - <kbd>boolean canSign</kbd> - whether or not the sub-key can be
+ * used to sign data.
+ * - <kbd>boolean canEncrypt</kbd> - whether or not the sub-key can be
+ * used to encrypt data.
+ * - <kbd>boolean hasPrivate</kbd> - whether or not the private key for
+ * the sub-key exists in the keyring.
+ * - <kbd>boolean isRevoked</kbd> - whether or not this sub-key is
+ * revoked.
+ *
+ * @param Crypt_GPG_SubKey|string|array $key optional. Either an existing
+ * sub-key object, which is copied; a sub-key string, which is
+ * parsed; or an array of initial values.
+ */
+ public function __construct($key = null)
+ {
+ // parse from string
+ if (is_string($key)) {
+ $key = self::parse($key);
+ }
+
+ // copy from object
+ if ($key instanceof Crypt_GPG_SubKey) {
+ $this->_id = $key->_id;
+ $this->_algorithm = $key->_algorithm;
+ $this->_fingerprint = $key->_fingerprint;
+ $this->_length = $key->_length;
+ $this->_creationDate = $key->_creationDate;
+ $this->_expirationDate = $key->_expirationDate;
+ $this->_canSign = $key->_canSign;
+ $this->_canEncrypt = $key->_canEncrypt;
+ $this->_hasPrivate = $key->_hasPrivate;
+ $this->_isRevoked = $key->_isRevoked;
+ }
+
+ // initialize from array
+ if (is_array($key)) {
+ if (array_key_exists('id', $key)) {
+ $this->setId($key['id']);
+ }
+
+ if (array_key_exists('algorithm', $key)) {
+ $this->setAlgorithm($key['algorithm']);
+ }
+
+ if (array_key_exists('fingerprint', $key)) {
+ $this->setFingerprint($key['fingerprint']);
+ }
+
+ if (array_key_exists('length', $key)) {
+ $this->setLength($key['length']);
+ }
+
+ if (array_key_exists('creation', $key)) {
+ $this->setCreationDate($key['creation']);
+ }
+
+ if (array_key_exists('expiration', $key)) {
+ $this->setExpirationDate($key['expiration']);
+ }
+
+ if (array_key_exists('canSign', $key)) {
+ $this->setCanSign($key['canSign']);
+ }
+
+ if (array_key_exists('canEncrypt', $key)) {
+ $this->setCanEncrypt($key['canEncrypt']);
+ }
+
+ if (array_key_exists('hasPrivate', $key)) {
+ $this->setHasPrivate($key['hasPrivate']);
+ }
+
+ if (array_key_exists('isRevoked', $key)) {
+ $this->setRevoked($key['isRevoked']);
+ }
+ }
+ }
+
+ // }}}
+ // {{{ getId()
+
+ /**
+ * Gets the id of this sub-key
+ *
+ * @return string the id of this sub-key.
+ */
+ public function getId()
+ {
+ return $this->_id;
+ }
+
+ // }}}
+ // {{{ getAlgorithm()
+
+ /**
+ * Gets the algorithm used by this sub-key
+ *
+ * The algorithm should be one of the Crypt_GPG_SubKey::ALGORITHM_*
+ * constants.
+ *
+ * @return integer the algorithm used by this sub-key.
+ */
+ public function getAlgorithm()
+ {
+ return $this->_algorithm;
+ }
+
+ // }}}
+ // {{{ getCreationDate()
+
+ /**
+ * Gets the creation date of this sub-key
+ *
+ * This is a Unix timestamp.
+ *
+ * @return integer the creation date of this sub-key.
+ */
+ public function getCreationDate()
+ {
+ return $this->_creationDate;
+ }
+
+ // }}}
+ // {{{ getExpirationDate()
+
+ /**
+ * Gets the date this sub-key expires
+ *
+ * This is a Unix timestamp. If this sub-key does not expire, this will be
+ * zero.
+ *
+ * @return integer the date this sub-key expires.
+ */
+ public function getExpirationDate()
+ {
+ return $this->_expirationDate;
+ }
+
+ // }}}
+ // {{{ getFingerprint()
+
+ /**
+ * Gets the fingerprint of this sub-key
+ *
+ * @return string the fingerprint of this sub-key.
+ */
+ public function getFingerprint()
+ {
+ return $this->_fingerprint;
+ }
+
+ // }}}
+ // {{{ getLength()
+
+ /**
+ * Gets the length of this sub-key in bits
+ *
+ * @return integer the length of this sub-key in bits.
+ */
+ public function getLength()
+ {
+ return $this->_length;
+ }
+
+ // }}}
+ // {{{ canSign()
+
+ /**
+ * Gets whether or not this sub-key can sign data
+ *
+ * @return boolean true if this sub-key can sign data and false if this
+ * sub-key can not sign data.
+ */
+ public function canSign()
+ {
+ return $this->_canSign;
+ }
+
+ // }}}
+ // {{{ canEncrypt()
+
+ /**
+ * Gets whether or not this sub-key can encrypt data
+ *
+ * @return boolean true if this sub-key can encrypt data and false if this
+ * sub-key can not encrypt data.
+ */
+ public function canEncrypt()
+ {
+ return $this->_canEncrypt;
+ }
+
+ // }}}
+ // {{{ hasPrivate()
+
+ /**
+ * Gets whether or not the private key for this sub-key exists in the
+ * keyring
+ *
+ * @return boolean true the private key for this sub-key exists in the
+ * keyring and false if it does not.
+ */
+ public function hasPrivate()
+ {
+ return $this->_hasPrivate;
+ }
+
+ // }}}
+ // {{{ isRevoked()
+
+ /**
+ * Gets whether or not this sub-key is revoked
+ *
+ * @return boolean true if this sub-key is revoked and false if it is not.
+ */
+ public function isRevoked()
+ {
+ return $this->_isRevoked;
+ }
+
+ // }}}
+ // {{{ setCreationDate()
+
+ /**
+ * Sets the creation date of this sub-key
+ *
+ * The creation date is a Unix timestamp.
+ *
+ * @param integer $creationDate the creation date of this sub-key.
+ *
+ * @return Crypt_GPG_SubKey the current object, for fluent interface.
+ */
+ public function setCreationDate($creationDate)
+ {
+ $this->_creationDate = intval($creationDate);
+ return $this;
+ }
+
+ // }}}
+ // {{{ setExpirationDate()
+
+ /**
+ * Sets the expiration date of this sub-key
+ *
+ * The expiration date is a Unix timestamp. Specify zero if this sub-key
+ * does not expire.
+ *
+ * @param integer $expirationDate the expiration date of this sub-key.
+ *
+ * @return Crypt_GPG_SubKey the current object, for fluent interface.
+ */
+ public function setExpirationDate($expirationDate)
+ {
+ $this->_expirationDate = intval($expirationDate);
+ return $this;
+ }
+
+ // }}}
+ // {{{ setId()
+
+ /**
+ * Sets the id of this sub-key
+ *
+ * @param string $id the id of this sub-key.
+ *
+ * @return Crypt_GPG_SubKey the current object, for fluent interface.
+ */
+ public function setId($id)
+ {
+ $this->_id = strval($id);
+ return $this;
+ }
+
+ // }}}
+ // {{{ setAlgorithm()
+
+ /**
+ * Sets the algorithm used by this sub-key
+ *
+ * @param integer $algorithm the algorithm used by this sub-key.
+ *
+ * @return Crypt_GPG_SubKey the current object, for fluent interface.
+ */
+ public function setAlgorithm($algorithm)
+ {
+ $this->_algorithm = intval($algorithm);
+ return $this;
+ }
+
+ // }}}
+ // {{{ setFingerprint()
+
+ /**
+ * Sets the fingerprint of this sub-key
+ *
+ * @param string $fingerprint the fingerprint of this sub-key.
+ *
+ * @return Crypt_GPG_SubKey the current object, for fluent interface.
+ */
+ public function setFingerprint($fingerprint)
+ {
+ $this->_fingerprint = strval($fingerprint);
+ return $this;
+ }
+
+ // }}}
+ // {{{ setLength()
+
+ /**
+ * Sets the length of this sub-key in bits
+ *
+ * @param integer $length the length of this sub-key in bits.
+ *
+ * @return Crypt_GPG_SubKey the current object, for fluent interface.
+ */
+ public function setLength($length)
+ {
+ $this->_length = intval($length);
+ return $this;
+ }
+
+ // }}}
+ // {{{ setCanSign()
+
+ /**
+ * Sets whether of not this sub-key can sign data
+ *
+ * @param boolean $canSign true if this sub-key can sign data and false if
+ * it can not.
+ *
+ * @return Crypt_GPG_SubKey the current object, for fluent interface.
+ */
+ public function setCanSign($canSign)
+ {
+ $this->_canSign = ($canSign) ? true : false;
+ return $this;
+ }
+
+ // }}}
+ // {{{ setCanEncrypt()
+
+ /**
+ * Sets whether of not this sub-key can encrypt data
+ *
+ * @param boolean $canEncrypt true if this sub-key can encrypt data and
+ * false if it can not.
+ *
+ * @return Crypt_GPG_SubKey the current object, for fluent interface.
+ */
+ public function setCanEncrypt($canEncrypt)
+ {
+ $this->_canEncrypt = ($canEncrypt) ? true : false;
+ return $this;
+ }
+
+ // }}}
+ // {{{ setHasPrivate()
+
+ /**
+ * Sets whether of not the private key for this sub-key exists in the
+ * keyring
+ *
+ * @param boolean $hasPrivate true if the private key for this sub-key
+ * exists in the keyring and false if it does
+ * not.
+ *
+ * @return Crypt_GPG_SubKey the current object, for fluent interface.
+ */
+ public function setHasPrivate($hasPrivate)
+ {
+ $this->_hasPrivate = ($hasPrivate) ? true : false;
+ return $this;
+ }
+
+ // }}}
+ // {{{ setRevoked()
+
+ /**
+ * Sets whether or not this sub-key is revoked
+ *
+ * @param boolean $isRevoked whether or not this sub-key is revoked.
+ *
+ * @return Crypt_GPG_SubKey the current object, for fluent interface.
+ */
+ public function setRevoked($isRevoked)
+ {
+ $this->_isRevoked = ($isRevoked) ? true : false;
+ return $this;
+ }
+
+ // }}}
+ // {{{ parse()
+
+ /**
+ * Parses a sub-key object from a sub-key string
+ *
+ * See <b>doc/DETAILS</b> in the
+ * {@link http://www.gnupg.org/download/ GPG distribution} for information
+ * on how the sub-key string is parsed.
+ *
+ * @param string $string the string containing the sub-key.
+ *
+ * @return Crypt_GPG_SubKey the sub-key object parsed from the string.
+ */
+ public static function parse($string)
+ {
+ $tokens = explode(':', $string);
+
+ $subKey = new Crypt_GPG_SubKey();
+
+ $subKey->setId($tokens[4]);
+ $subKey->setLength($tokens[2]);
+ $subKey->setAlgorithm($tokens[3]);
+ $subKey->setCreationDate(self::_parseDate($tokens[5]));
+ $subKey->setExpirationDate(self::_parseDate($tokens[6]));
+
+ if ($tokens[1] == 'r') {
+ $subKey->setRevoked(true);
+ }
+
+ if (strpos($tokens[11], 's') !== false) {
+ $subKey->setCanSign(true);
+ }
+
+ if (strpos($tokens[11], 'e') !== false) {
+ $subKey->setCanEncrypt(true);
+ }
+
+ return $subKey;
+ }
+
+ // }}}
+ // {{{ _parseDate()
+
+ /**
+ * Parses a date string as provided by GPG into a UNIX timestamp
+ *
+ * @param string $string the date string.
+ *
+ * @return integer the UNIX timestamp corresponding to the provided date
+ * string.
+ */
+ private static function _parseDate($string)
+ {
+ if ($string == '') {
+ $timestamp = 0;
+ } else {
+ // all times are in UTC according to GPG documentation
+ $timeZone = new DateTimeZone('UTC');
+
+ if (strpos($string, 'T') === false) {
+ // interpret as UNIX timestamp
+ $string = '@' . $string;
+ }
+
+ $date = new DateTime($string, $timeZone);
+
+ // convert to UNIX timestamp
+ $timestamp = intval($date->format('U'));
+ }
+
+ return $timestamp;
+ }
+
+ // }}}
+}
+
+// }}}
+
+?>
diff --git a/plugins/enigma/lib/Crypt/GPG/UserId.php b/plugins/enigma/lib/Crypt/GPG/UserId.php
new file mode 100644
index 000000000..04435708c
--- /dev/null
+++ b/plugins/enigma/lib/Crypt/GPG/UserId.php
@@ -0,0 +1,373 @@
+<?php
+
+/* vim: set expandtab tabstop=4 shiftwidth=4 softtabstop=4: */
+
+/**
+ * Contains a data class representing a GPG user id
+ *
+ * PHP version 5
+ *
+ * LICENSE:
+ *
+ * This library is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU Lesser General Public License as
+ * published by the Free Software Foundation; either version 2.1 of the
+ * License, or (at your option) any later version.
+ *
+ * This library is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ * Lesser General Public License for more details.
+ *
+ * You should have received a copy of the GNU Lesser General Public
+ * License along with this library; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+ *
+ * @category Encryption
+ * @package Crypt_GPG
+ * @author Michael Gauthier <mike@silverorange.com>
+ * @copyright 2008-2010 silverorange
+ * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1
+ * @version CVS: $Id: UserId.php 295621 2010-03-01 04:18:54Z gauthierm $
+ * @link http://pear.php.net/package/Crypt_GPG
+ */
+
+// {{{ class Crypt_GPG_UserId
+
+/**
+ * A class for GPG user id information
+ *
+ * This class is used to store the results of the {@link Crypt_GPG::getKeys()}
+ * method. User id objects are members of a {@link Crypt_GPG_Key} object.
+ *
+ * @category Encryption
+ * @package Crypt_GPG
+ * @author Michael Gauthier <mike@silverorange.com>
+ * @copyright 2008-2010 silverorange
+ * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1
+ * @link http://pear.php.net/package/Crypt_GPG
+ * @see Crypt_GPG::getKeys()
+ * @see Crypt_GPG_Key::getUserIds()
+ */
+class Crypt_GPG_UserId
+{
+ // {{{ class properties
+
+ /**
+ * The name field of this user id
+ *
+ * @var string
+ */
+ private $_name = '';
+
+ /**
+ * The comment field of this user id
+ *
+ * @var string
+ */
+ private $_comment = '';
+
+ /**
+ * The email field of this user id
+ *
+ * @var string
+ */
+ private $_email = '';
+
+ /**
+ * Whether or not this user id is revoked
+ *
+ * @var boolean
+ */
+ private $_isRevoked = false;
+
+ /**
+ * Whether or not this user id is valid
+ *
+ * @var boolean
+ */
+ private $_isValid = true;
+
+ // }}}
+ // {{{ __construct()
+
+ /**
+ * Creates a new user id
+ *
+ * User ids can be initialized from an array of named values. Available
+ * names are:
+ *
+ * - <kbd>string name</kbd> - the name field of the user id.
+ * - <kbd>string comment</kbd> - the comment field of the user id.
+ * - <kbd>string email</kbd> - the email field of the user id.
+ * - <kbd>boolean valid</kbd> - whether or not the user id is valid.
+ * - <kbd>boolean revoked</kbd> - whether or not the user id is revoked.
+ *
+ * @param Crypt_GPG_UserId|string|array $userId optional. Either an
+ * existing user id object, which is copied; a user id string, which
+ * is parsed; or an array of initial values.
+ */
+ public function __construct($userId = null)
+ {
+ // parse from string
+ if (is_string($userId)) {
+ $userId = self::parse($userId);
+ }
+
+ // copy from object
+ if ($userId instanceof Crypt_GPG_UserId) {
+ $this->_name = $userId->_name;
+ $this->_comment = $userId->_comment;
+ $this->_email = $userId->_email;
+ $this->_isRevoked = $userId->_isRevoked;
+ $this->_isValid = $userId->_isValid;
+ }
+
+ // initialize from array
+ if (is_array($userId)) {
+ if (array_key_exists('name', $userId)) {
+ $this->setName($userId['name']);
+ }
+
+ if (array_key_exists('comment', $userId)) {
+ $this->setComment($userId['comment']);
+ }
+
+ if (array_key_exists('email', $userId)) {
+ $this->setEmail($userId['email']);
+ }
+
+ if (array_key_exists('revoked', $userId)) {
+ $this->setRevoked($userId['revoked']);
+ }
+
+ if (array_key_exists('valid', $userId)) {
+ $this->setValid($userId['valid']);
+ }
+ }
+ }
+
+ // }}}
+ // {{{ getName()
+
+ /**
+ * Gets the name field of this user id
+ *
+ * @return string the name field of this user id.
+ */
+ public function getName()
+ {
+ return $this->_name;
+ }
+
+ // }}}
+ // {{{ getComment()
+
+ /**
+ * Gets the comments field of this user id
+ *
+ * @return string the comments field of this user id.
+ */
+ public function getComment()
+ {
+ return $this->_comment;
+ }
+
+ // }}}
+ // {{{ getEmail()
+
+ /**
+ * Gets the email field of this user id
+ *
+ * @return string the email field of this user id.
+ */
+ public function getEmail()
+ {
+ return $this->_email;
+ }
+
+ // }}}
+ // {{{ isRevoked()
+
+ /**
+ * Gets whether or not this user id is revoked
+ *
+ * @return boolean true if this user id is revoked and false if it is not.
+ */
+ public function isRevoked()
+ {
+ return $this->_isRevoked;
+ }
+
+ // }}}
+ // {{{ isValid()
+
+ /**
+ * Gets whether or not this user id is valid
+ *
+ * @return boolean true if this user id is valid and false if it is not.
+ */
+ public function isValid()
+ {
+ return $this->_isValid;
+ }
+
+ // }}}
+ // {{{ __toString()
+
+ /**
+ * Gets a string representation of this user id
+ *
+ * The string is formatted as:
+ * <b><kbd>name (comment) <email-address></kbd></b>.
+ *
+ * @return string a string representation of this user id.
+ */
+ public function __toString()
+ {
+ $components = array();
+
+ if (strlen($this->_name) > 0) {
+ $components[] = $this->_name;
+ }
+
+ if (strlen($this->_comment) > 0) {
+ $components[] = '(' . $this->_comment . ')';
+ }
+
+ if (strlen($this->_email) > 0) {
+ $components[] = '<' . $this->_email. '>';
+ }
+
+ return implode(' ', $components);
+ }
+
+ // }}}
+ // {{{ setName()
+
+ /**
+ * Sets the name field of this user id
+ *
+ * @param string $name the name field of this user id.
+ *
+ * @return Crypt_GPG_UserId the current object, for fluent interface.
+ */
+ public function setName($name)
+ {
+ $this->_name = strval($name);
+ return $this;
+ }
+
+ // }}}
+ // {{{ setComment()
+
+ /**
+ * Sets the comment field of this user id
+ *
+ * @param string $comment the comment field of this user id.
+ *
+ * @return Crypt_GPG_UserId the current object, for fluent interface.
+ */
+ public function setComment($comment)
+ {
+ $this->_comment = strval($comment);
+ return $this;
+ }
+
+ // }}}
+ // {{{ setEmail()
+
+ /**
+ * Sets the email field of this user id
+ *
+ * @param string $email the email field of this user id.
+ *
+ * @return Crypt_GPG_UserId the current object, for fluent interface.
+ */
+ public function setEmail($email)
+ {
+ $this->_email = strval($email);
+ return $this;
+ }
+
+ // }}}
+ // {{{ setRevoked()
+
+ /**
+ * Sets whether or not this user id is revoked
+ *
+ * @param boolean $isRevoked whether or not this user id is revoked.
+ *
+ * @return Crypt_GPG_UserId the current object, for fluent interface.
+ */
+ public function setRevoked($isRevoked)
+ {
+ $this->_isRevoked = ($isRevoked) ? true : false;
+ return $this;
+ }
+
+ // }}}
+ // {{{ setValid()
+
+ /**
+ * Sets whether or not this user id is valid
+ *
+ * @param boolean $isValid whether or not this user id is valid.
+ *
+ * @return Crypt_GPG_UserId the current object, for fluent interface.
+ */
+ public function setValid($isValid)
+ {
+ $this->_isValid = ($isValid) ? true : false;
+ return $this;
+ }
+
+ // }}}
+ // {{{ parse()
+
+ /**
+ * Parses a user id object from a user id string
+ *
+ * A user id string is of the form:
+ * <b><kbd>name (comment) <email-address></kbd></b> with the <i>comment</i>
+ * and <i>email-address</i> fields being optional.
+ *
+ * @param string $string the user id string to parse.
+ *
+ * @return Crypt_GPG_UserId the user id object parsed from the string.
+ */
+ public static function parse($string)
+ {
+ $userId = new Crypt_GPG_UserId();
+ $email = '';
+ $comment = '';
+
+ // get email address from end of string if it exists
+ $matches = array();
+ if (preg_match('/^(.+?) <([^>]+)>$/', $string, $matches) === 1) {
+ $string = $matches[1];
+ $email = $matches[2];
+ }
+
+ // get comment from end of string if it exists
+ $matches = array();
+ if (preg_match('/^(.+?) \(([^\)]+)\)$/', $string, $matches) === 1) {
+ $string = $matches[1];
+ $comment = $matches[2];
+ }
+
+ $name = $string;
+
+ $userId->setName($name);
+ $userId->setComment($comment);
+ $userId->setEmail($email);
+
+ return $userId;
+ }
+
+ // }}}
+}
+
+// }}}
+
+?>
diff --git a/plugins/enigma/lib/Crypt/GPG/VerifyStatusHandler.php b/plugins/enigma/lib/Crypt/GPG/VerifyStatusHandler.php
new file mode 100644
index 000000000..083bd3012
--- /dev/null
+++ b/plugins/enigma/lib/Crypt/GPG/VerifyStatusHandler.php
@@ -0,0 +1,216 @@
+<?php
+
+/* vim: set expandtab tabstop=4 shiftwidth=4 softtabstop=4: */
+
+/**
+ * Crypt_GPG is a package to use GPG from PHP
+ *
+ * This file contains an object that handles GPG's status output for the verify
+ * operation.
+ *
+ * PHP version 5
+ *
+ * LICENSE:
+ *
+ * This library is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU Lesser General Public License as
+ * published by the Free Software Foundation; either version 2.1 of the
+ * License, or (at your option) any later version.
+ *
+ * This library is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ * Lesser General Public License for more details.
+ *
+ * You should have received a copy of the GNU Lesser General Public
+ * License along with this library; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+ *
+ * @category Encryption
+ * @package Crypt_GPG
+ * @author Michael Gauthier <mike@silverorange.com>
+ * @copyright 2008 silverorange
+ * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1
+ * @version CVS: $Id: VerifyStatusHandler.php 302908 2010-08-31 03:56:54Z gauthierm $
+ * @link http://pear.php.net/package/Crypt_GPG
+ * @link http://www.gnupg.org/
+ */
+
+/**
+ * Signature object class definition
+ */
+require_once 'Crypt/GPG/Signature.php';
+
+/**
+ * Status line handler for the verify operation
+ *
+ * This class is used internally by Crypt_GPG and does not need be used
+ * directly. See the {@link Crypt_GPG} class for end-user API.
+ *
+ * This class is responsible for building signature objects that are returned
+ * by the {@link Crypt_GPG::verify()} method. See <b>doc/DETAILS</b> in the
+ * {@link http://www.gnupg.org/download/ GPG distribution} for detailed
+ * information on GPG's status output for the verify operation.
+ *
+ * @category Encryption
+ * @package Crypt_GPG
+ * @author Michael Gauthier <mike@silverorange.com>
+ * @copyright 2008 silverorange
+ * @license http://www.gnu.org/copyleft/lesser.html LGPL License 2.1
+ * @link http://pear.php.net/package/Crypt_GPG
+ * @link http://www.gnupg.org/
+ */
+class Crypt_GPG_VerifyStatusHandler
+{
+ // {{{ protected properties
+
+ /**
+ * The current signature id
+ *
+ * Ths signature id is emitted by GPG before the new signature line so we
+ * must remember it temporarily.
+ *
+ * @var string
+ */
+ protected $signatureId = '';
+
+ /**
+ * List of parsed {@link Crypt_GPG_Signature} objects
+ *
+ * @var array
+ */
+ protected $signatures = array();
+
+ /**
+ * Array index of the current signature
+ *
+ * @var integer
+ */
+ protected $index = -1;
+
+ // }}}
+ // {{{ handle()
+
+ /**
+ * Handles a status line
+ *
+ * @param string $line the status line to handle.
+ *
+ * @return void
+ */
+ public function handle($line)
+ {
+ $tokens = explode(' ', $line);
+ switch ($tokens[0]) {
+ case 'GOODSIG':
+ case 'EXPSIG':
+ case 'EXPKEYSIG':
+ case 'REVKEYSIG':
+ case 'BADSIG':
+ $signature = new Crypt_GPG_Signature();
+
+ // if there was a signature id, set it on the new signature
+ if ($this->signatureId != '') {
+ $signature->setId($this->signatureId);
+ $this->signatureId = '';
+ }
+
+ // Detect whether fingerprint or key id was returned and set
+ // signature values appropriately. Key ids are strings of either
+ // 16 or 8 hexadecimal characters. Fingerprints are strings of 40
+ // hexadecimal characters. The key id is the last 16 characters of
+ // the key fingerprint.
+ if (strlen($tokens[1]) > 16) {
+ $signature->setKeyFingerprint($tokens[1]);
+ $signature->setKeyId(substr($tokens[1], -16));
+ } else {
+ $signature->setKeyId($tokens[1]);
+ }
+
+ // get user id string
+ $string = implode(' ', array_splice($tokens, 2));
+ $string = rawurldecode($string);
+
+ $signature->setUserId(Crypt_GPG_UserId::parse($string));
+
+ $this->index++;
+ $this->signatures[$this->index] = $signature;
+ break;
+
+ case 'ERRSIG':
+ $signature = new Crypt_GPG_Signature();
+
+ // if there was a signature id, set it on the new signature
+ if ($this->signatureId != '') {
+ $signature->setId($this->signatureId);
+ $this->signatureId = '';
+ }
+
+ // Detect whether fingerprint or key id was returned and set
+ // signature values appropriately. Key ids are strings of either
+ // 16 or 8 hexadecimal characters. Fingerprints are strings of 40
+ // hexadecimal characters. The key id is the last 16 characters of
+ // the key fingerprint.
+ if (strlen($tokens[1]) > 16) {
+ $signature->setKeyFingerprint($tokens[1]);
+ $signature->setKeyId(substr($tokens[1], -16));
+ } else {
+ $signature->setKeyId($tokens[1]);
+ }
+
+ $this->index++;
+ $this->signatures[$this->index] = $signature;
+
+ break;
+
+ case 'VALIDSIG':
+ if (!array_key_exists($this->index, $this->signatures)) {
+ break;
+ }
+
+ $signature = $this->signatures[$this->index];
+
+ $signature->setValid(true);
+ $signature->setKeyFingerprint($tokens[1]);
+
+ if (strpos($tokens[3], 'T') === false) {
+ $signature->setCreationDate($tokens[3]);
+ } else {
+ $signature->setCreationDate(strtotime($tokens[3]));
+ }
+
+ if (array_key_exists(4, $tokens)) {
+ if (strpos($tokens[4], 'T') === false) {
+ $signature->setExpirationDate($tokens[4]);
+ } else {
+ $signature->setExpirationDate(strtotime($tokens[4]));
+ }
+ }
+
+ break;
+
+ case 'SIG_ID':
+ // note: signature id comes before new signature line and may not
+ // exist for some signature types
+ $this->signatureId = $tokens[1];
+ break;
+ }
+ }
+
+ // }}}
+ // {{{ getSignatures()
+
+ /**
+ * Gets the {@link Crypt_GPG_Signature} objects parsed by this handler
+ *
+ * @return array the signature objects parsed by this handler.
+ */
+ public function getSignatures()
+ {
+ return $this->signatures;
+ }
+
+ // }}}
+}
+
+?>
diff --git a/plugins/enigma/lib/enigma_driver.php b/plugins/enigma/lib/enigma_driver.php
new file mode 100644
index 000000000..a9a3e4715
--- /dev/null
+++ b/plugins/enigma/lib/enigma_driver.php
@@ -0,0 +1,106 @@
+<?php
+/*
+ +-------------------------------------------------------------------------+
+ | Abstract driver for the Enigma Plugin |
+ | |
+ | This program is free software; you can redistribute it and/or modify |
+ | it under the terms of the GNU General Public License version 2 |
+ | as published by the Free Software Foundation. |
+ | |
+ | This program is distributed in the hope that it will be useful, |
+ | but WITHOUT ANY WARRANTY; without even the implied warranty of |
+ | MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the |
+ | GNU General Public License for more details. |
+ | |
+ | You should have received a copy of the GNU General Public License along |
+ | with this program; if not, write to the Free Software Foundation, Inc., |
+ | 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. |
+ | |
+ +-------------------------------------------------------------------------+
+ | Author: Aleksander Machniak <alec@alec.pl> |
+ +-------------------------------------------------------------------------+
+*/
+
+abstract class enigma_driver
+{
+ /**
+ * Class constructor.
+ *
+ * @param string User name (email address)
+ */
+ abstract function __construct($user);
+
+ /**
+ * Driver initialization.
+ *
+ * @return mixed NULL on success, enigma_error on failure
+ */
+ abstract function init();
+
+ /**
+ * Encryption.
+ */
+ abstract function encrypt($text, $keys);
+
+ /**
+ * Decryption..
+ */
+ abstract function decrypt($text, $key, $passwd);
+
+ /**
+ * Signing.
+ */
+ abstract function sign($text, $key, $passwd);
+
+ /**
+ * Signature verification.
+ *
+ * @param string Message body
+ * @param string Signature, if message is of type PGP/MIME and body doesn't contain it
+ *
+ * @return mixed Signature information (enigma_signature) or enigma_error
+ */
+ abstract function verify($text, $signature);
+
+ /**
+ * Key/Cert file import.
+ *
+ * @param string File name or file content
+ * @param bollean True if first argument is a filename
+ *
+ * @return mixed Import status array or enigma_error
+ */
+ abstract function import($content, $isfile=false);
+
+ /**
+ * Keys listing.
+ *
+ * @param string Optional pattern for key ID, user ID or fingerprint
+ *
+ * @return mixed Array of enigma_key objects or enigma_error
+ */
+ abstract function list_keys($pattern='');
+
+ /**
+ * Single key information.
+ *
+ * @param string Key ID, user ID or fingerprint
+ *
+ * @return mixed Key (enigma_key) object or enigma_error
+ */
+ abstract function get_key($keyid);
+
+ /**
+ * Key pair generation.
+ *
+ * @param array Key/User data
+ *
+ * @return mixed Key (enigma_key) object or enigma_error
+ */
+ abstract function gen_key($data);
+
+ /**
+ * Key deletion.
+ */
+ abstract function del_key($keyid);
+}
diff --git a/plugins/enigma/lib/enigma_driver_gnupg.php b/plugins/enigma/lib/enigma_driver_gnupg.php
new file mode 100644
index 000000000..5aa32217e
--- /dev/null
+++ b/plugins/enigma/lib/enigma_driver_gnupg.php
@@ -0,0 +1,305 @@
+<?php
+/*
+ +-------------------------------------------------------------------------+
+ | GnuPG (PGP) driver for the Enigma Plugin |
+ | |
+ | This program is free software; you can redistribute it and/or modify |
+ | it under the terms of the GNU General Public License version 2 |
+ | as published by the Free Software Foundation. |
+ | |
+ | This program is distributed in the hope that it will be useful, |
+ | but WITHOUT ANY WARRANTY; without even the implied warranty of |
+ | MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the |
+ | GNU General Public License for more details. |
+ | |
+ | You should have received a copy of the GNU General Public License along |
+ | with this program; if not, write to the Free Software Foundation, Inc., |
+ | 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. |
+ | |
+ +-------------------------------------------------------------------------+
+ | Author: Aleksander Machniak <alec@alec.pl> |
+ +-------------------------------------------------------------------------+
+*/
+
+require_once 'Crypt/GPG.php';
+
+class enigma_driver_gnupg extends enigma_driver
+{
+ private $rc;
+ private $gpg;
+ private $homedir;
+ private $user;
+
+ function __construct($user)
+ {
+ $rcmail = rcmail::get_instance();
+ $this->rc = $rcmail;
+ $this->user = $user;
+ }
+
+ /**
+ * Driver initialization and environment checking.
+ * Should only return critical errors.
+ *
+ * @return mixed NULL on success, enigma_error on failure
+ */
+ function init()
+ {
+ $homedir = $this->rc->config->get('enigma_pgp_homedir', INSTALL_PATH . '/plugins/enigma/home');
+
+ if (!$homedir)
+ return new enigma_error(enigma_error::E_INTERNAL,
+ "Option 'enigma_pgp_homedir' not specified");
+
+ // check if homedir exists (create it if not) and is readable
+ if (!file_exists($homedir))
+ return new enigma_error(enigma_error::E_INTERNAL,
+ "Keys directory doesn't exists: $homedir");
+ if (!is_writable($homedir))
+ return new enigma_error(enigma_error::E_INTERNAL,
+ "Keys directory isn't writeable: $homedir");
+
+ $homedir = $homedir . '/' . $this->user;
+
+ // check if user's homedir exists (create it if not) and is readable
+ if (!file_exists($homedir))
+ mkdir($homedir, 0700);
+
+ if (!file_exists($homedir))
+ return new enigma_error(enigma_error::E_INTERNAL,
+ "Unable to create keys directory: $homedir");
+ if (!is_writable($homedir))
+ return new enigma_error(enigma_error::E_INTERNAL,
+ "Unable to write to keys directory: $homedir");
+
+ $this->homedir = $homedir;
+
+ // Create Crypt_GPG object
+ try {
+ $this->gpg = new Crypt_GPG(array(
+ 'homedir' => $this->homedir,
+// 'debug' => true,
+ ));
+ }
+ catch (Exception $e) {
+ return $this->get_error_from_exception($e);
+ }
+ }
+
+ function encrypt($text, $keys)
+ {
+/*
+ foreach ($keys as $key) {
+ $this->gpg->addEncryptKey($key);
+ }
+ $enc = $this->gpg->encrypt($text);
+ return $enc;
+*/
+ }
+
+ function decrypt($text, $key, $passwd)
+ {
+// $this->gpg->addDecryptKey($key, $passwd);
+ try {
+ $dec = $this->gpg->decrypt($text);
+ return $dec;
+ }
+ catch (Exception $e) {
+ return $this->get_error_from_exception($e);
+ }
+ }
+
+ function sign($text, $key, $passwd)
+ {
+/*
+ $this->gpg->addSignKey($key, $passwd);
+ $signed = $this->gpg->sign($text, Crypt_GPG::SIGN_MODE_DETACHED);
+ return $signed;
+*/
+ }
+
+ function verify($text, $signature)
+ {
+ try {
+ $verified = $this->gpg->verify($text, $signature);
+ return $this->parse_signature($verified[0]);
+ }
+ catch (Exception $e) {
+ return $this->get_error_from_exception($e);
+ }
+ }
+
+ public function import($content, $isfile=false)
+ {
+ try {
+ if ($isfile)
+ return $this->gpg->importKeyFile($content);
+ else
+ return $this->gpg->importKey($content);
+ }
+ catch (Exception $e) {
+ return $this->get_error_from_exception($e);
+ }
+ }
+
+ public function list_keys($pattern='')
+ {
+ try {
+ $keys = $this->gpg->getKeys($pattern);
+ $result = array();
+//print_r($keys);
+ foreach ($keys as $idx => $key) {
+ $result[] = $this->parse_key($key);
+ unset($keys[$idx]);
+ }
+//print_r($result);
+ return $result;
+ }
+ catch (Exception $e) {
+ return $this->get_error_from_exception($e);
+ }
+ }
+
+ public function get_key($keyid)
+ {
+ $list = $this->list_keys($keyid);
+
+ if (is_array($list))
+ return array_shift($list);
+
+ // error
+ return $list;
+ }
+
+ public function gen_key($data)
+ {
+ }
+
+ public function del_key($keyid)
+ {
+// $this->get_key($keyid);
+
+
+ }
+
+ public function del_privkey($keyid)
+ {
+ try {
+ $this->gpg->deletePrivateKey($keyid);
+ return true;
+ }
+ catch (Exception $e) {
+ return $this->get_error_from_exception($e);
+ }
+ }
+
+ public function del_pubkey($keyid)
+ {
+ try {
+ $this->gpg->deletePublicKey($keyid);
+ return true;
+ }
+ catch (Exception $e) {
+ return $this->get_error_from_exception($e);
+ }
+ }
+
+ /**
+ * Converts Crypt_GPG exception into Enigma's error object
+ *
+ * @param mixed Exception object
+ *
+ * @return enigma_error Error object
+ */
+ private function get_error_from_exception($e)
+ {
+ $data = array();
+
+ if ($e instanceof Crypt_GPG_KeyNotFoundException) {
+ $error = enigma_error::E_KEYNOTFOUND;
+ $data['id'] = $e->getKeyId();
+ }
+ else if ($e instanceof Crypt_GPG_BadPassphraseException) {
+ $error = enigma_error::E_BADPASS;
+ $data['bad'] = $e->getBadPassphrases();
+ $data['missing'] = $e->getMissingPassphrases();
+ }
+ else if ($e instanceof Crypt_GPG_NoDataException)
+ $error = enigma_error::E_NODATA;
+ else if ($e instanceof Crypt_GPG_DeletePrivateKeyException)
+ $error = enigma_error::E_DELKEY;
+ else
+ $error = enigma_error::E_INTERNAL;
+
+ $msg = $e->getMessage();
+
+ return new enigma_error($error, $msg, $data);
+ }
+
+ /**
+ * Converts Crypt_GPG_Signature object into Enigma's signature object
+ *
+ * @param Crypt_GPG_Signature Signature object
+ *
+ * @return enigma_signature Signature object
+ */
+ private function parse_signature($sig)
+ {
+ $user = $sig->getUserId();
+
+ $data = new enigma_signature();
+ $data->id = $sig->getId();
+ $data->valid = $sig->isValid();
+ $data->fingerprint = $sig->getKeyFingerprint();
+ $data->created = $sig->getCreationDate();
+ $data->expires = $sig->getExpirationDate();
+ $data->name = $user->getName();
+ $data->comment = $user->getComment();
+ $data->email = $user->getEmail();
+
+ return $data;
+ }
+
+ /**
+ * Converts Crypt_GPG_Key object into Enigma's key object
+ *
+ * @param Crypt_GPG_Key Key object
+ *
+ * @return enigma_key Key object
+ */
+ private function parse_key($key)
+ {
+ $ekey = new enigma_key();
+
+ foreach ($key->getUserIds() as $idx => $user) {
+ $id = new enigma_userid();
+ $id->name = $user->getName();
+ $id->comment = $user->getComment();
+ $id->email = $user->getEmail();
+ $id->valid = $user->isValid();
+ $id->revoked = $user->isRevoked();
+
+ $ekey->users[$idx] = $id;
+ }
+
+ $ekey->name = trim($ekey->users[0]->name . ' <' . $ekey->users[0]->email . '>');
+
+ foreach ($key->getSubKeys() as $idx => $subkey) {
+ $skey = new enigma_subkey();
+ $skey->id = $subkey->getId();
+ $skey->revoked = $subkey->isRevoked();
+ $skey->created = $subkey->getCreationDate();
+ $skey->expires = $subkey->getExpirationDate();
+ $skey->fingerprint = $subkey->getFingerprint();
+ $skey->has_private = $subkey->hasPrivate();
+ $skey->can_sign = $subkey->canSign();
+ $skey->can_encrypt = $subkey->canEncrypt();
+
+ $ekey->subkeys[$idx] = $skey;
+ };
+
+ $ekey->id = $ekey->subkeys[0]->id;
+
+ return $ekey;
+ }
+}
diff --git a/plugins/enigma/lib/enigma_engine.php b/plugins/enigma/lib/enigma_engine.php
new file mode 100644
index 000000000..59ae1202c
--- /dev/null
+++ b/plugins/enigma/lib/enigma_engine.php
@@ -0,0 +1,547 @@
+<?php
+/*
+ +-------------------------------------------------------------------------+
+ | Engine of the Enigma Plugin |
+ | |
+ | This program is free software; you can redistribute it and/or modify |
+ | it under the terms of the GNU General Public License version 2 |
+ | as published by the Free Software Foundation. |
+ | |
+ | This program is distributed in the hope that it will be useful, |
+ | but WITHOUT ANY WARRANTY; without even the implied warranty of |
+ | MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the |
+ | GNU General Public License for more details. |
+ | |
+ | You should have received a copy of the GNU General Public License along |
+ | with this program; if not, write to the Free Software Foundation, Inc., |
+ | 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. |
+ | |
+ +-------------------------------------------------------------------------+
+ | Author: Aleksander Machniak <alec@alec.pl> |
+ +-------------------------------------------------------------------------+
+
+*/
+
+/*
+ RFC2440: OpenPGP Message Format
+ RFC3156: MIME Security with OpenPGP
+ RFC3851: S/MIME
+*/
+
+class enigma_engine
+{
+ private $rc;
+ private $enigma;
+ private $pgp_driver;
+ private $smime_driver;
+
+ public $decryptions = array();
+ public $signatures = array();
+ public $signed_parts = array();
+
+
+ /**
+ * Plugin initialization.
+ */
+ function __construct($enigma)
+ {
+ $rcmail = rcmail::get_instance();
+ $this->rc = $rcmail;
+ $this->enigma = $enigma;
+ }
+
+ /**
+ * PGP driver initialization.
+ */
+ function load_pgp_driver()
+ {
+ if ($this->pgp_driver)
+ return;
+
+ $driver = 'enigma_driver_' . $this->rc->config->get('enigma_pgp_driver', 'gnupg');
+ $username = $this->rc->user->get_username();
+
+ // Load driver
+ $this->pgp_driver = new $driver($username);
+
+ if (!$this->pgp_driver) {
+ raise_error(array(
+ 'code' => 600, 'type' => 'php',
+ 'file' => __FILE__, 'line' => __LINE__,
+ 'message' => "Enigma plugin: Unable to load PGP driver: $driver"
+ ), true, true);
+ }
+
+ // Initialise driver
+ $result = $this->pgp_driver->init();
+
+ if ($result instanceof enigma_error) {
+ raise_error(array(
+ 'code' => 600, 'type' => 'php',
+ 'file' => __FILE__, 'line' => __LINE__,
+ 'message' => "Enigma plugin: ".$result->getMessage()
+ ), true, true);
+ }
+ }
+
+ /**
+ * S/MIME driver initialization.
+ */
+ function load_smime_driver()
+ {
+ if ($this->smime_driver)
+ return;
+
+ // NOT IMPLEMENTED!
+ return;
+
+ $driver = 'enigma_driver_' . $this->rc->config->get('enigma_smime_driver', 'phpssl');
+ $username = $this->rc->user->get_username();
+
+ // Load driver
+ $this->smime_driver = new $driver($username);
+
+ if (!$this->smime_driver) {
+ raise_error(array(
+ 'code' => 600, 'type' => 'php',
+ 'file' => __FILE__, 'line' => __LINE__,
+ 'message' => "Enigma plugin: Unable to load S/MIME driver: $driver"
+ ), true, true);
+ }
+
+ // Initialise driver
+ $result = $this->smime_driver->init();
+
+ if ($result instanceof enigma_error) {
+ raise_error(array(
+ 'code' => 600, 'type' => 'php',
+ 'file' => __FILE__, 'line' => __LINE__,
+ 'message' => "Enigma plugin: ".$result->getMessage()
+ ), true, true);
+ }
+ }
+
+ /**
+ * Handler for plain/text message.
+ *
+ * @param array Reference to hook's parameters
+ */
+ function parse_plain(&$p)
+ {
+ $part = $p['structure'];
+
+ // Get message body from IMAP server
+ $this->set_part_body($part, $p['object']->uid);
+
+ // @TODO: big message body can be a file resource
+ // PGP signed message
+ if (preg_match('/^-----BEGIN PGP SIGNED MESSAGE-----/', $part->body)) {
+ $this->parse_plain_signed($p);
+ }
+ // PGP encrypted message
+ else if (preg_match('/^-----BEGIN PGP MESSAGE-----/', $part->body)) {
+ $this->parse_plain_encrypted($p);
+ }
+ }
+
+ /**
+ * Handler for multipart/signed message.
+ *
+ * @param array Reference to hook's parameters
+ */
+ function parse_signed(&$p)
+ {
+ $struct = $p['structure'];
+
+ // S/MIME
+ if ($struct->parts[1] && $struct->parts[1]->mimetype == 'application/pkcs7-signature') {
+ $this->parse_smime_signed($p);
+ }
+ // PGP/MIME:
+ // The multipart/signed body MUST consist of exactly two parts.
+ // The first part contains the signed data in MIME canonical format,
+ // including a set of appropriate content headers describing the data.
+ // The second body MUST contain the PGP digital signature. It MUST be
+ // labeled with a content type of "application/pgp-signature".
+ else if ($struct->parts[1] && $struct->parts[1]->mimetype == 'application/pgp-signature') {
+ $this->parse_pgp_signed($p);
+ }
+ }
+
+ /**
+ * Handler for multipart/encrypted message.
+ *
+ * @param array Reference to hook's parameters
+ */
+ function parse_encrypted(&$p)
+ {
+ $struct = $p['structure'];
+
+ // S/MIME
+ if ($struct->mimetype == 'application/pkcs7-mime') {
+ $this->parse_smime_encrypted($p);
+ }
+ // PGP/MIME:
+ // The multipart/encrypted MUST consist of exactly two parts. The first
+ // MIME body part must have a content type of "application/pgp-encrypted".
+ // This body contains the control information.
+ // The second MIME body part MUST contain the actual encrypted data. It
+ // must be labeled with a content type of "application/octet-stream".
+ else if ($struct->parts[0] && $struct->parts[0]->mimetype == 'application/pgp-encrypted' &&
+ $struct->parts[1] && $struct->parts[1]->mimetype == 'application/octet-stream'
+ ) {
+ $this->parse_pgp_encrypted($p);
+ }
+ }
+
+ /**
+ * Handler for plain signed message.
+ * Excludes message and signature bodies and verifies signature.
+ *
+ * @param array Reference to hook's parameters
+ */
+ private function parse_plain_signed(&$p)
+ {
+ $this->load_pgp_driver();
+ $part = $p['structure'];
+
+ // Verify signature
+ if ($this->rc->action == 'show' || $this->rc->action == 'preview') {
+ $sig = $this->pgp_verify($part->body);
+ }
+
+ // @TODO: Handle big bodies using (temp) files
+
+ // In this way we can use fgets on string as on file handle
+ $fh = fopen('php://memory', 'br+');
+ // @TODO: fopen/fwrite errors handling
+ if ($fh) {
+ fwrite($fh, $part->body);
+ rewind($fh);
+ }
+ $part->body = null;
+
+ // Extract body (and signature?)
+ while (!feof($fh)) {
+ $line = fgets($fh, 1024);
+
+ if ($part->body === null)
+ $part->body = '';
+ else if (preg_match('/^-----BEGIN PGP SIGNATURE-----/', $line))
+ break;
+ else
+ $part->body .= $line;
+ }
+
+ // Remove "Hash" Armor Headers
+ $part->body = preg_replace('/^.*\r*\n\r*\n/', '', $part->body);
+ // de-Dash-Escape (RFC2440)
+ $part->body = preg_replace('/(^|\n)- -/', '\\1-', $part->body);
+
+ // Store signature data for display
+ if (!empty($sig)) {
+ $this->signed_parts[$part->mime_id] = $part->mime_id;
+ $this->signatures[$part->mime_id] = $sig;
+ }
+
+ fclose($fh);
+ }
+
+ /**
+ * Handler for PGP/MIME signed message.
+ * Verifies signature.
+ *
+ * @param array Reference to hook's parameters
+ */
+ private function parse_pgp_signed(&$p)
+ {
+ $this->load_pgp_driver();
+ $struct = $p['structure'];
+
+ // Verify signature
+ if ($this->rc->action == 'show' || $this->rc->action == 'preview') {
+ $msg_part = $struct->parts[0];
+ $sig_part = $struct->parts[1];
+
+ // Get bodies
+ $this->set_part_body($msg_part, $p['object']->uid);
+ $this->set_part_body($sig_part, $p['object']->uid);
+
+ // Verify
+ $sig = $this->pgp_verify($msg_part->body, $sig_part->body);
+
+ // Store signature data for display
+ $this->signatures[$struct->mime_id] = $sig;
+
+ // Message can be multipart (assign signature to each subpart)
+ if (!empty($msg_part->parts)) {
+ foreach ($msg_part->parts as $part)
+ $this->signed_parts[$part->mime_id] = $struct->mime_id;
+ }
+ else
+ $this->signed_parts[$msg_part->mime_id] = $struct->mime_id;
+
+ // Remove signature file from attachments list
+ unset($struct->parts[1]);
+ }
+ }
+
+ /**
+ * Handler for S/MIME signed message.
+ * Verifies signature.
+ *
+ * @param array Reference to hook's parameters
+ */
+ private function parse_smime_signed(&$p)
+ {
+ $this->load_smime_driver();
+ }
+
+ /**
+ * Handler for plain encrypted message.
+ *
+ * @param array Reference to hook's parameters
+ */
+ private function parse_plain_encrypted(&$p)
+ {
+ $this->load_pgp_driver();
+ $part = $p['structure'];
+
+ // Get body
+ $this->set_part_body($part, $p['object']->uid);
+
+ // Decrypt
+ $result = $this->pgp_decrypt($part->body);
+
+ // Store decryption status
+ $this->decryptions[$part->mime_id] = $result;
+
+ // Parse decrypted message
+ if ($result === true) {
+ // @TODO
+ }
+ }
+
+ /**
+ * Handler for PGP/MIME encrypted message.
+ *
+ * @param array Reference to hook's parameters
+ */
+ private function parse_pgp_encrypted(&$p)
+ {
+ $this->load_pgp_driver();
+ $struct = $p['structure'];
+ $part = $struct->parts[1];
+
+ // Get body
+ $this->set_part_body($part, $p['object']->uid);
+
+ // Decrypt
+ $result = $this->pgp_decrypt($part->body);
+
+ $this->decryptions[$part->mime_id] = $result;
+//print_r($part);
+ // Parse decrypted message
+ if ($result === true) {
+ // @TODO
+ }
+ else {
+ // Make sure decryption status message will be displayed
+ $part->type = 'content';
+ $p['object']->parts[] = $part;
+ }
+ }
+
+ /**
+ * Handler for S/MIME encrypted message.
+ *
+ * @param array Reference to hook's parameters
+ */
+ private function parse_smime_encrypted(&$p)
+ {
+ $this->load_smime_driver();
+ }
+
+ /**
+ * PGP signature verification.
+ *
+ * @param mixed Message body
+ * @param mixed Signature body (for MIME messages)
+ *
+ * @return mixed enigma_signature or enigma_error
+ */
+ private function pgp_verify(&$msg_body, $sig_body=null)
+ {
+ // @TODO: Handle big bodies using (temp) files
+ // @TODO: caching of verification result
+
+ $sig = $this->pgp_driver->verify($msg_body, $sig_body);
+
+ if (($sig instanceof enigma_error) && $sig->getCode() != enigma_error::E_KEYNOTFOUND)
+ raise_error(array(
+ 'code' => 600, 'type' => 'php',
+ 'file' => __FILE__, 'line' => __LINE__,
+ 'message' => "Enigma plugin: " . $error->getMessage()
+ ), true, false);
+
+//print_r($sig);
+ return $sig;
+ }
+
+ /**
+ * PGP message decryption.
+ *
+ * @param mixed Message body
+ *
+ * @return mixed True or enigma_error
+ */
+ private function pgp_decrypt(&$msg_body)
+ {
+ // @TODO: Handle big bodies using (temp) files
+ // @TODO: caching of verification result
+
+ $result = $this->pgp_driver->decrypt($msg_body, $key, $pass);
+
+//print_r($result);
+
+ if ($result instanceof enigma_error) {
+ $err_code = $result->getCode();
+ if (!in_array($err_code, array(enigma_error::E_KEYNOTFOUND, enigma_error::E_BADPASS)))
+ raise_error(array(
+ 'code' => 600, 'type' => 'php',
+ 'file' => __FILE__, 'line' => __LINE__,
+ 'message' => "Enigma plugin: " . $result->getMessage()
+ ), true, false);
+ return $result;
+ }
+
+// $msg_body = $result;
+ return true;
+ }
+
+ /**
+ * PGP keys listing.
+ *
+ * @param mixed Key ID/Name pattern
+ *
+ * @return mixed Array of keys or enigma_error
+ */
+ function list_keys($pattern='')
+ {
+ $this->load_pgp_driver();
+ $result = $this->pgp_driver->list_keys($pattern);
+
+ if ($result instanceof enigma_error) {
+ raise_error(array(
+ 'code' => 600, 'type' => 'php',
+ 'file' => __FILE__, 'line' => __LINE__,
+ 'message' => "Enigma plugin: " . $result->getMessage()
+ ), true, false);
+ }
+
+ return $result;
+ }
+
+ /**
+ * PGP key details.
+ *
+ * @param mixed Key ID
+ *
+ * @return mixed enigma_key or enigma_error
+ */
+ function get_key($keyid)
+ {
+ $this->load_pgp_driver();
+ $result = $this->pgp_driver->get_key($keyid);
+
+ if ($result instanceof enigma_error) {
+ raise_error(array(
+ 'code' => 600, 'type' => 'php',
+ 'file' => __FILE__, 'line' => __LINE__,
+ 'message' => "Enigma plugin: " . $result->getMessage()
+ ), true, false);
+ }
+
+ return $result;
+ }
+
+ /**
+ * PGP keys/certs importing.
+ *
+ * @param mixed Import file name or content
+ * @param boolean True if first argument is a filename
+ *
+ * @return mixed Import status data array or enigma_error
+ */
+ function import_key($content, $isfile=false)
+ {
+ $this->load_pgp_driver();
+ $result = $this->pgp_driver->import($content, $isfile);
+
+ if ($result instanceof enigma_error) {
+ raise_error(array(
+ 'code' => 600, 'type' => 'php',
+ 'file' => __FILE__, 'line' => __LINE__,
+ 'message' => "Enigma plugin: " . $result->getMessage()
+ ), true, false);
+ }
+ else {
+ $result['imported'] = $result['public_imported'] + $result['private_imported'];
+ $result['unchanged'] = $result['public_unchanged'] + $result['private_unchanged'];
+ }
+
+ return $result;
+ }
+
+ /**
+ * Handler for keys/certs import request action
+ */
+ function import_file()
+ {
+ $uid = get_input_value('_uid', RCUBE_INPUT_POST);
+ $mbox = get_input_value('_mbox', RCUBE_INPUT_POST);
+ $mime_id = get_input_value('_part', RCUBE_INPUT_POST);
+
+ if ($uid && $mime_id) {
+ $part = $this->rc->imap->get_message_part($uid, $mime_id);
+ }
+
+ if ($part && is_array($result = $this->import_key($part))) {
+ $this->rc->output->show_message('enigma.keysimportsuccess', 'confirmation',
+ array('new' => $result['imported'], 'old' => $result['unchanged']));
+ }
+ else
+ $this->rc->output->show_message('enigma.keysimportfailed', 'error');
+
+ $this->rc->output->send();
+ }
+
+ /**
+ * Checks if specified message part contains body data.
+ * If body is not set it will be fetched from IMAP server.
+ *
+ * @param rcube_message_part Message part object
+ * @param integer Message UID
+ */
+ private function set_part_body($part, $uid)
+ {
+ // @TODO: Create such function in core
+ // @TODO: Handle big bodies using file handles
+ if (!isset($part->body)) {
+ $part->body = $this->rc->imap->get_message_part(
+ $uid, $part->mime_id, $part);
+ }
+ }
+
+ /**
+ * Adds CSS style file to the page header.
+ */
+ private function add_css()
+ {
+ $skin = $this->rc->config->get('skin');
+ if (!file_exists($this->home . "/skins/$skin/enigma.css"))
+ $skin = 'default';
+
+ $this->include_stylesheet("skins/$skin/enigma.css");
+ }
+}
diff --git a/plugins/enigma/lib/enigma_error.php b/plugins/enigma/lib/enigma_error.php
new file mode 100644
index 000000000..9f424dc2b
--- /dev/null
+++ b/plugins/enigma/lib/enigma_error.php
@@ -0,0 +1,62 @@
+<?php
+/*
+ +-------------------------------------------------------------------------+
+ | Error class for the Enigma Plugin |
+ | |
+ | This program is free software; you can redistribute it and/or modify |
+ | it under the terms of the GNU General Public License version 2 |
+ | as published by the Free Software Foundation. |
+ | |
+ | This program is distributed in the hope that it will be useful, |
+ | but WITHOUT ANY WARRANTY; without even the implied warranty of |
+ | MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the |
+ | GNU General Public License for more details. |
+ | |
+ | You should have received a copy of the GNU General Public License along |
+ | with this program; if not, write to the Free Software Foundation, Inc., |
+ | 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. |
+ | |
+ +-------------------------------------------------------------------------+
+ | Author: Aleksander Machniak <alec@alec.pl> |
+ +-------------------------------------------------------------------------+
+*/
+
+class enigma_error
+{
+ private $code;
+ private $message;
+ private $data = array();
+
+ // error codes
+ const E_OK = 0;
+ const E_INTERNAL = 1;
+ const E_NODATA = 2;
+ const E_KEYNOTFOUND = 3;
+ const E_DELKEY = 4;
+ const E_BADPASS = 5;
+
+ function __construct($code = null, $message = '', $data = array())
+ {
+ $this->code = $code;
+ $this->message = $message;
+ $this->data = $data;
+ }
+
+ function getCode()
+ {
+ return $this->code;
+ }
+
+ function getMessage()
+ {
+ return $this->message;
+ }
+
+ function getData($name)
+ {
+ if ($name)
+ return $this->data[$name];
+ else
+ return $this->data;
+ }
+}
diff --git a/plugins/enigma/lib/enigma_key.php b/plugins/enigma/lib/enigma_key.php
new file mode 100644
index 000000000..520c36b0b
--- /dev/null
+++ b/plugins/enigma/lib/enigma_key.php
@@ -0,0 +1,129 @@
+<?php
+/*
+ +-------------------------------------------------------------------------+
+ | Key class for the Enigma Plugin |
+ | |
+ | This program is free software; you can redistribute it and/or modify |
+ | it under the terms of the GNU General Public License version 2 |
+ | as published by the Free Software Foundation. |
+ | |
+ | This program is distributed in the hope that it will be useful, |
+ | but WITHOUT ANY WARRANTY; without even the implied warranty of |
+ | MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the |
+ | GNU General Public License for more details. |
+ | |
+ | You should have received a copy of the GNU General Public License along |
+ | with this program; if not, write to the Free Software Foundation, Inc., |
+ | 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. |
+ | |
+ +-------------------------------------------------------------------------+
+ | Author: Aleksander Machniak <alec@alec.pl> |
+ +-------------------------------------------------------------------------+
+*/
+
+class enigma_key
+{
+ public $id;
+ public $name;
+ public $users = array();
+ public $subkeys = array();
+
+ const TYPE_UNKNOWN = 0;
+ const TYPE_KEYPAIR = 1;
+ const TYPE_PUBLIC = 2;
+
+ /**
+ * Keys list sorting callback for usort()
+ */
+ static function cmp($a, $b)
+ {
+ return strcmp($a->name, $b->name);
+ }
+
+ /**
+ * Returns key type
+ */
+ function get_type()
+ {
+ if ($this->subkeys[0]->has_private)
+ return enigma_key::TYPE_KEYPAIR;
+ else if (!empty($this->subkeys[0]))
+ return enigma_key::TYPE_PUBLIC;
+
+ return enigma_key::TYPE_UNKNOWN;
+ }
+
+ /**
+ * Returns true if all user IDs are revoked
+ */
+ function is_revoked()
+ {
+ foreach ($this->subkeys as $subkey)
+ if (!$subkey->revoked)
+ return false;
+
+ return true;
+ }
+
+ /**
+ * Returns true if any user ID is valid
+ */
+ function is_valid()
+ {
+ foreach ($this->users as $user)
+ if ($user->valid)
+ return true;
+
+ return false;
+ }
+
+ /**
+ * Returns true if any of subkeys is not expired
+ */
+ function is_expired()
+ {
+ $now = time();
+
+ foreach ($this->subkeys as $subkey)
+ if (!$subkey->expires || $subkey->expires > $now)
+ return true;
+
+ return false;
+ }
+
+ /**
+ * Converts long ID or Fingerprint to short ID
+ * Crypt_GPG uses internal, but e.g. Thunderbird's Enigmail displays short ID
+ *
+ * @param string Key ID or fingerprint
+ * @return string Key short ID
+ */
+ static function format_id($id)
+ {
+ // E.g. 04622F2089E037A5 => 89E037A5
+
+ return substr($id, -8);
+ }
+
+ /**
+ * Formats fingerprint string
+ *
+ * @param string Key fingerprint
+ *
+ * @return string Formatted fingerprint (with spaces)
+ */
+ static function format_fingerprint($fingerprint)
+ {
+ if (!$fingerprint)
+ return '';
+
+ $result = '';
+ for ($i=0; $i<40; $i++) {
+ if ($i % 4 == 0)
+ $result .= ' ';
+ $result .= $fingerprint[$i];
+ }
+ return $result;
+ }
+
+}
diff --git a/plugins/enigma/lib/enigma_signature.php b/plugins/enigma/lib/enigma_signature.php
new file mode 100644
index 000000000..65990903b
--- /dev/null
+++ b/plugins/enigma/lib/enigma_signature.php
@@ -0,0 +1,34 @@
+<?php
+/*
+ +-------------------------------------------------------------------------+
+ | Signature class for the Enigma Plugin |
+ | |
+ | This program is free software; you can redistribute it and/or modify |
+ | it under the terms of the GNU General Public License version 2 |
+ | as published by the Free Software Foundation. |
+ | |
+ | This program is distributed in the hope that it will be useful, |
+ | but WITHOUT ANY WARRANTY; without even the implied warranty of |
+ | MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the |
+ | GNU General Public License for more details. |
+ | |
+ | You should have received a copy of the GNU General Public License along |
+ | with this program; if not, write to the Free Software Foundation, Inc., |
+ | 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. |
+ | |
+ +-------------------------------------------------------------------------+
+ | Author: Aleksander Machniak <alec@alec.pl> |
+ +-------------------------------------------------------------------------+
+*/
+
+class enigma_signature
+{
+ public $id;
+ public $valid;
+ public $fingerprint;
+ public $created;
+ public $expires;
+ public $name;
+ public $comment;
+ public $email;
+}
diff --git a/plugins/enigma/lib/enigma_subkey.php b/plugins/enigma/lib/enigma_subkey.php
new file mode 100644
index 000000000..1b9fb95ad
--- /dev/null
+++ b/plugins/enigma/lib/enigma_subkey.php
@@ -0,0 +1,57 @@
+<?php
+/*
+ +-------------------------------------------------------------------------+
+ | SubKey class for the Enigma Plugin |
+ | |
+ | This program is free software; you can redistribute it and/or modify |
+ | it under the terms of the GNU General Public License version 2 |
+ | as published by the Free Software Foundation. |
+ | |
+ | This program is distributed in the hope that it will be useful, |
+ | but WITHOUT ANY WARRANTY; without even the implied warranty of |
+ | MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the |
+ | GNU General Public License for more details. |
+ | |
+ | You should have received a copy of the GNU General Public License along |
+ | with this program; if not, write to the Free Software Foundation, Inc., |
+ | 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. |
+ | |
+ +-------------------------------------------------------------------------+
+ | Author: Aleksander Machniak <alec@alec.pl> |
+ +-------------------------------------------------------------------------+
+*/
+
+class enigma_subkey
+{
+ public $id;
+ public $fingerprint;
+ public $expires;
+ public $created;
+ public $revoked;
+ public $has_private;
+ public $can_sign;
+ public $can_encrypt;
+
+ /**
+ * Converts internal ID to short ID
+ * Crypt_GPG uses internal, but e.g. Thunderbird's Enigmail displays short ID
+ *
+ * @return string Key ID
+ */
+ function get_short_id()
+ {
+ // E.g. 04622F2089E037A5 => 89E037A5
+ return enigma_key::format_id($this->id);
+ }
+
+ /**
+ * Getter for formatted fingerprint
+ *
+ * @return string Formatted fingerprint
+ */
+ function get_fingerprint()
+ {
+ return enigma_key::format_fingerprint($this->fingerprint);
+ }
+
+}
diff --git a/plugins/enigma/lib/enigma_ui.php b/plugins/enigma/lib/enigma_ui.php
new file mode 100644
index 000000000..b9ccff53d
--- /dev/null
+++ b/plugins/enigma/lib/enigma_ui.php
@@ -0,0 +1,459 @@
+<?php
+/*
+ +-------------------------------------------------------------------------+
+ | User Interface for the Enigma Plugin |
+ | |
+ | This program is free software; you can redistribute it and/or modify |
+ | it under the terms of the GNU General Public License version 2 |
+ | as published by the Free Software Foundation. |
+ | |
+ | This program is distributed in the hope that it will be useful, |
+ | but WITHOUT ANY WARRANTY; without even the implied warranty of |
+ | MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the |
+ | GNU General Public License for more details. |
+ | |
+ | You should have received a copy of the GNU General Public License along |
+ | with this program; if not, write to the Free Software Foundation, Inc., |
+ | 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. |
+ | |
+ +-------------------------------------------------------------------------+
+ | Author: Aleksander Machniak <alec@alec.pl> |
+ +-------------------------------------------------------------------------+
+*/
+
+class enigma_ui
+{
+ private $rc;
+ private $enigma;
+ private $home;
+ private $css_added;
+ private $data;
+
+
+ function __construct($enigma_plugin, $home='')
+ {
+ $this->enigma = $enigma_plugin;
+ $this->rc = $enigma_plugin->rc;
+ // we cannot use $enigma_plugin->home here
+ $this->home = $home;
+ }
+
+ /**
+ * UI initialization and requests handlers.
+ *
+ * @param string Preferences section
+ */
+ function init($section='')
+ {
+ $this->enigma->include_script('enigma.js');
+
+ // Enigma actions
+ if ($this->rc->action == 'plugin.enigma') {
+ $action = get_input_value('_a', RCUBE_INPUT_GPC);
+
+ switch ($action) {
+ case 'keyedit':
+ $this->key_edit();
+ break;
+ case 'keyimport':
+ $this->key_import();
+ break;
+ case 'keysearch':
+ case 'keylist':
+ $this->key_list();
+ break;
+ case 'keyinfo':
+ default:
+ $this->key_info();
+ }
+ }
+ // Message composing UI
+ else if ($this->rc->action == 'compose') {
+ $this->compose_ui();
+ }
+ // Preferences UI
+ else { // if ($this->rc->action == 'edit-prefs') {
+ if ($section == 'enigmacerts') {
+ $this->rc->output->add_handlers(array(
+ 'keyslist' => array($this, 'tpl_certs_list'),
+ 'keyframe' => array($this, 'tpl_cert_frame'),
+ 'countdisplay' => array($this, 'tpl_certs_rowcount'),
+ 'searchform' => array($this->rc->output, 'search_form'),
+ ));
+ $this->rc->output->set_pagetitle($this->enigma->gettext('enigmacerts'));
+ $this->rc->output->send('enigma.certs');
+ }
+ else {
+ $this->rc->output->add_handlers(array(
+ 'keyslist' => array($this, 'tpl_keys_list'),
+ 'keyframe' => array($this, 'tpl_key_frame'),
+ 'countdisplay' => array($this, 'tpl_keys_rowcount'),
+ 'searchform' => array($this->rc->output, 'search_form'),
+ ));
+ $this->rc->output->set_pagetitle($this->enigma->gettext('enigmakeys'));
+ $this->rc->output->send('enigma.keys');
+ }
+ }
+ }
+
+ /**
+ * Adds CSS style file to the page header.
+ */
+ function add_css()
+ {
+ if ($this->css_loaded)
+ return;
+
+ $skin = $this->rc->config->get('skin');
+ if (!file_exists($this->home . "/skins/$skin/enigma.css"))
+ $skin = 'default';
+
+ $this->enigma->include_stylesheet("skins/$skin/enigma.css");
+ $this->css_added = true;
+ }
+
+ /**
+ * Template object for key info/edit frame.
+ *
+ * @param array Object attributes
+ *
+ * @return string HTML output
+ */
+ function tpl_key_frame($attrib)
+ {
+ if (!$attrib['id']) {
+ $attrib['id'] = 'rcmkeysframe';
+ }
+
+ $attrib['name'] = $attrib['id'];
+
+ $this->rc->output->set_env('contentframe', $attrib['name']);
+ $this->rc->output->set_env('blankpage', $attrib['src'] ?
+ $this->rc->output->abs_url($attrib['src']) : 'program/blank.gif');
+
+ return html::tag('iframe', $attrib);
+ }
+
+ /**
+ * Template object for list of keys.
+ *
+ * @param array Object attributes
+ *
+ * @return string HTML content
+ */
+ function tpl_keys_list($attrib)
+ {
+ // add id to message list table if not specified
+ if (!strlen($attrib['id'])) {
+ $attrib['id'] = 'rcmenigmakeyslist';
+ }
+
+ // define list of cols to be displayed
+ $a_show_cols = array('name');
+
+ // create XHTML table
+ $out = rcube_table_output($attrib, array(), $a_show_cols, 'id');
+
+ // set client env
+ $this->rc->output->add_gui_object('keyslist', $attrib['id']);
+ $this->rc->output->include_script('list.js');
+
+ // add some labels to client
+ $this->rc->output->add_label('enigma.keyconfirmdelete');
+
+ return $out;
+ }
+
+ /**
+ * Key listing (and searching) request handler
+ */
+ private function key_list()
+ {
+ $this->enigma->load_engine();
+
+ $pagesize = $this->rc->config->get('pagesize', 100);
+ $page = max(intval(get_input_value('_p', RCUBE_INPUT_GPC)), 1);
+ $search = get_input_value('_q', RCUBE_INPUT_GPC);
+
+ // define list of cols to be displayed
+ $a_show_cols = array('name');
+ $result = array();
+
+ // Get the list
+ $list = $this->enigma->engine->list_keys($search);
+
+ if ($list && ($list instanceof enigma_error))
+ $this->rc->output->show_message('enigma.keylisterror', 'error');
+ else if (empty($list))
+ $this->rc->output->show_message('enigma.nokeysfound', 'notice');
+ else {
+ if (is_array($list)) {
+ // Save the size
+ $listsize = count($list);
+
+ // Sort the list by key (user) name
+ usort($list, array('enigma_key', 'cmp'));
+
+ // Slice current page
+ $list = array_slice($list, ($page - 1) * $pagesize, $pagesize);
+
+ $size = count($list);
+
+ // Add rows
+ foreach($list as $idx => $key) {
+ $this->rc->output->command('enigma_add_list_row',
+ array('name' => Q($key->name), 'id' => $key->id));
+ }
+ }
+ }
+
+ $this->rc->output->set_env('search_request', $search);
+ $this->rc->output->set_env('pagecount', ceil($listsize/$pagesize));
+ $this->rc->output->set_env('current_page', $page);
+ $this->rc->output->command('set_rowcount',
+ $this->get_rowcount_text($listsize, $size, $page));
+
+ $this->rc->output->send();
+ }
+
+ /**
+ * Template object for list records counter.
+ *
+ * @param array Object attributes
+ *
+ * @return string HTML output
+ */
+ function tpl_keys_rowcount($attrib)
+ {
+ if (!$attrib['id'])
+ $attrib['id'] = 'rcmcountdisplay';
+
+ $this->rc->output->add_gui_object('countdisplay', $attrib['id']);
+
+ return html::span($attrib, $this->get_rowcount_text());
+ }
+
+ /**
+ * Returns text representation of list records counter
+ */
+ private function get_rowcount_text($all=0, $curr_count=0, $page=1)
+ {
+ if (!$curr_count)
+ $out = $this->enigma->gettext('nokeysfound');
+ else {
+ $pagesize = $this->rc->config->get('pagesize', 100);
+ $first = ($page - 1) * $pagesize;
+
+ $out = $this->enigma->gettext(array(
+ 'name' => 'keysfromto',
+ 'vars' => array(
+ 'from' => $first + 1,
+ 'to' => $first + $curr_count,
+ 'count' => $all)
+ ));
+ }
+
+ return $out;
+ }
+
+ /**
+ * Key information page handler
+ */
+ private function key_info()
+ {
+ $id = get_input_value('_id', RCUBE_INPUT_GET);
+
+ $this->enigma->load_engine();
+ $res = $this->enigma->engine->get_key($id);
+
+ if ($res instanceof enigma_key)
+ $this->data = $res;
+ else { // error
+ $this->rc->output->show_message('enigma.keyopenerror', 'error');
+ $this->rc->output->command('parent.enigma_loadframe');
+ $this->rc->output->send('iframe');
+ }
+
+ $this->rc->output->add_handlers(array(
+ 'keyname' => array($this, 'tpl_key_name'),
+ 'keydata' => array($this, 'tpl_key_data'),
+ ));
+
+ $this->rc->output->set_pagetitle($this->enigma->gettext('keyinfo'));
+ $this->rc->output->send('enigma.keyinfo');
+ }
+
+ /**
+ * Template object for key name
+ */
+ function tpl_key_name($attrib)
+ {
+ return Q($this->data->name);
+ }
+
+ /**
+ * Template object for key information page content
+ */
+ function tpl_key_data($attrib)
+ {
+ $out = '';
+ $table = new html_table(array('cols' => 2));
+
+ // Key user ID
+ $table->add('title', $this->enigma->gettext('keyuserid'));
+ $table->add(null, Q($this->data->name));
+ // Key ID
+ $table->add('title', $this->enigma->gettext('keyid'));
+ $table->add(null, $this->data->subkeys[0]->get_short_id());
+ // Key type
+ $keytype = $this->data->get_type();
+ if ($keytype == enigma_key::TYPE_KEYPAIR)
+ $type = $this->enigma->gettext('typekeypair');
+ else if ($keytype == enigma_key::TYPE_PUBLIC)
+ $type = $this->enigma->gettext('typepublickey');
+ $table->add('title', $this->enigma->gettext('keytype'));
+ $table->add(null, $type);
+ // Key fingerprint
+ $table->add('title', $this->enigma->gettext('fingerprint'));
+ $table->add(null, $this->data->subkeys[0]->get_fingerprint());
+
+ $out .= html::tag('fieldset', null,
+ html::tag('legend', null,
+ $this->enigma->gettext('basicinfo')) . $table->show($attrib));
+
+ // Subkeys
+ $table = new html_table(array('cols' => 6));
+ // Columns: Type, ID, Algorithm, Size, Created, Expires
+
+ $out .= html::tag('fieldset', null,
+ html::tag('legend', null,
+ $this->enigma->gettext('subkeys')) . $table->show($attrib));
+
+ // Additional user IDs
+ $table = new html_table(array('cols' => 2));
+ // Columns: User ID, Validity
+
+ $out .= html::tag('fieldset', null,
+ html::tag('legend', null,
+ $this->enigma->gettext('userids')) . $table->show($attrib));
+
+ return $out;
+ }
+
+ /**
+ * Key import page handler
+ */
+ private function key_import()
+ {
+ // Import process
+ if ($_FILES['_file']['tmp_name'] && is_uploaded_file($_FILES['_file']['tmp_name'])) {
+ $this->enigma->load_engine();
+ $result = $this->enigma->engine->import_key($_FILES['_file']['tmp_name'], true);
+
+ if (is_array($result)) {
+ // reload list if any keys has been added
+ if ($result['imported']) {
+ $this->rc->output->command('parent.enigma_list', 1);
+ }
+ else
+ $this->rc->output->command('parent.enigma_loadframe');
+
+ $this->rc->output->show_message('enigma.keysimportsuccess', 'confirmation',
+ array('new' => $result['imported'], 'old' => $result['unchanged']));
+
+ $this->rc->output->send('iframe');
+ }
+ else
+ $this->rc->output->show_message('enigma.keysimportfailed', 'error');
+ }
+ else if ($err = $_FILES['_file']['error']) {
+ if ($err == UPLOAD_ERR_INI_SIZE || $err == UPLOAD_ERR_FORM_SIZE) {
+ $this->rc->output->show_message('filesizeerror', 'error',
+ array('size' => show_bytes(parse_bytes(ini_get('upload_max_filesize')))));
+ } else {
+ $this->rc->output->show_message('fileuploaderror', 'error');
+ }
+ }
+
+ $this->rc->output->add_handlers(array(
+ 'importform' => array($this, 'tpl_key_import_form'),
+ ));
+
+ $this->rc->output->set_pagetitle($this->enigma->gettext('keyimport'));
+ $this->rc->output->send('enigma.keyimport');
+ }
+
+ /**
+ * Template object for key import (upload) form
+ */
+ function tpl_key_import_form($attrib)
+ {
+ $attrib += array('id' => 'rcmKeyImportForm');
+
+ $upload = new html_inputfield(array('type' => 'file', 'name' => '_file',
+ 'id' => 'rcmimportfile', 'size' => 30));
+
+ $form = html::p(null,
+ Q($this->enigma->gettext('keyimporttext'), 'show')
+ . html::br() . html::br() . $upload->show()
+ );
+
+ $this->rc->output->add_label('selectimportfile', 'importwait');
+ $this->rc->output->add_gui_object('importform', $attrib['id']);
+
+ $out = $this->rc->output->form_tag(array(
+ 'action' => $this->rc->url(array('action' => 'plugin.enigma', 'a' => 'keyimport')),
+ 'method' => 'post',
+ 'enctype' => 'multipart/form-data') + $attrib,
+ $form);
+
+ return $out;
+ }
+
+ private function compose_ui()
+ {
+ if (!is_array($_SESSION['compose']) || $_SESSION['compose']['id'] != get_input_value('_id', RCUBE_INPUT_GET))
+ return;
+
+ // Options menu button
+ // @TODO: make this work with non-default skins
+ $this->enigma->add_button(array(
+ 'name' => 'enigmamenu',
+ 'imagepas' => 'skins/default/enigma.png',
+ 'imageact' => 'skins/default/enigma.png',
+ 'onclick' => "rcmail_ui.show_popup('enigmamenu', true); return false",
+ 'title' => 'securityoptions',
+ 'domain' => 'enigma',
+ ), 'toolbar');
+
+ // Options menu contents
+ $this->enigma->add_hook('render_page', array($this, 'compose_menu'));
+ }
+
+ function compose_menu($p)
+ {
+ $menu = new html_table(array('cols' => 2));
+ $chbox = new html_checkbox(array('value' => 1));
+
+ $menu->add(null, html::label(array('for' => 'enigmadefaultopt'),
+ Q($this->enigma->gettext('identdefault'))));
+ $menu->add(null, $chbox->show(1, array('name' => '_enigma_default', 'id' => 'enigmadefaultopt')));
+
+ $menu->add(null, html::label(array('for' => 'enigmasignopt'),
+ Q($this->enigma->gettext('signmsg'))));
+ $menu->add(null, $chbox->show(1, array('name' => '_enigma_sign', 'id' => 'enigmasignopt')));
+
+ $menu->add(null, html::label(array('for' => 'enigmacryptopt'),
+ Q($this->enigma->gettext('encryptmsg'))));
+ $menu->add(null, $chbox->show(1, array('name' => '_enigma_crypt', 'id' => 'enigmacryptopt')));
+
+ $menu = html::div(array('id' => 'enigmamenu', 'class' => 'popupmenu'),
+ $menu->show());
+
+ $p['content'] = preg_replace('/(<form name="form"[^>]+>)/i', '\\1'."\n$menu", $p['content']);
+
+ return $p;
+
+ }
+
+}
diff --git a/plugins/enigma/lib/enigma_userid.php b/plugins/enigma/lib/enigma_userid.php
new file mode 100644
index 000000000..36185e718
--- /dev/null
+++ b/plugins/enigma/lib/enigma_userid.php
@@ -0,0 +1,31 @@
+<?php
+/*
+ +-------------------------------------------------------------------------+
+ | User ID class for the Enigma Plugin |
+ | |
+ | This program is free software; you can redistribute it and/or modify |
+ | it under the terms of the GNU General Public License version 2 |
+ | as published by the Free Software Foundation. |
+ | |
+ | This program is distributed in the hope that it will be useful, |
+ | but WITHOUT ANY WARRANTY; without even the implied warranty of |
+ | MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the |
+ | GNU General Public License for more details. |
+ | |
+ | You should have received a copy of the GNU General Public License along |
+ | with this program; if not, write to the Free Software Foundation, Inc., |
+ | 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. |
+ | |
+ +-------------------------------------------------------------------------+
+ | Author: Aleksander Machniak <alec@alec.pl> |
+ +-------------------------------------------------------------------------+
+*/
+
+class enigma_userid
+{
+ public $revoked;
+ public $valid;
+ public $name;
+ public $comment;
+ public $email;
+}
diff --git a/plugins/enigma/localization/en_US.inc b/plugins/enigma/localization/en_US.inc
new file mode 100644
index 000000000..e0f03d9a0
--- /dev/null
+++ b/plugins/enigma/localization/en_US.inc
@@ -0,0 +1,53 @@
+<?php
+
+$labels = array();
+$labels['enigmasettings'] = 'Enigma: Settings';
+$labels['enigmacerts'] = 'Enigma: Certificates (S/MIME)';
+$labels['enigmakeys'] = 'Enigma: Keys (PGP)';
+$labels['keysfromto'] = 'Keys $from to $to of $count';
+$labels['keyname'] = 'Name';
+$labels['keyid'] = 'Key ID';
+$labels['keyuserid'] = 'User ID';
+$labels['keytype'] = 'Key type';
+$labels['fingerprint'] = 'Fingerprint';
+$labels['subkeys'] = 'Subkeys';
+$labels['basicinfo'] = 'Basic Information';
+$labels['userids'] = 'Additional User IDs';
+$labels['typepublickey'] = 'public key';
+$labels['typekeypair'] = 'key pair';
+$labels['keyattfound'] = 'This message contains attached PGP key(s).';
+$labels['keyattimport'] = 'Import key(s)';
+
+$labels['createkeys'] = 'Create a new key pair';
+$labels['importkeys'] = 'Import key(s)';
+$labels['exportkeys'] = 'Export key(s)';
+$labels['deletekeys'] = 'Delete key(s)';
+$labels['keyactions'] = 'Key actions...';
+$labels['keydisable'] = 'Disable key';
+$labels['keyrevoke'] = 'Revoke key';
+$labels['keysend'] = 'Send public key in a message';
+$labels['keychpass'] = 'Change password';
+
+$labels['securityoptions'] = 'Message security options...';
+$labels['identdefault'] = 'Use settings of selected identity';
+$labels['encryptmsg'] = 'Encrypt this message';
+$labels['signmsg'] = 'Digitally sign this message';
+
+$messages = array();
+$messages['sigvalid'] = 'Verified signature from $sender.';
+$messages['siginvalid'] = 'Invalid signature from $sender.';
+$messages['signokey'] = 'Unverified signature. Public key not found. Key ID: $keyid.';
+$messages['sigerror'] = 'Unverified signature. Internal error.';
+$messages['decryptok'] = 'Message decrypted.';
+$messages['decrypterror'] = 'Decryption failed.';
+$messages['decryptnokey'] = 'Decryption failed. Private key not found. Key ID: $keyid.';
+$messages['decryptbadpass'] = 'Decryption failed. Bad password.';
+$messages['nokeysfound'] = 'No keys found';
+$messages['keyopenerror'] = 'Unable to get key information! Internal error.';
+$messages['keylisterror'] = 'Unable to list keys! Internal error.';
+$messages['keysimportfailed'] = 'Unable to import key(s)! Internal error.';
+$messages['keysimportsuccess'] = 'Key(s) imported successfully. Imported: $new, unchanged: $old.';
+$messages['keyconfirmdelete'] = 'Are you sure, you want to delete selected key(s)?';
+$messages['keyimporttext'] = 'You can import private and public key(s) or revocation signatures in ASCII-Armor format.';
+
+?>
diff --git a/plugins/enigma/localization/ja_JP.inc b/plugins/enigma/localization/ja_JP.inc
new file mode 100644
index 000000000..882014440
--- /dev/null
+++ b/plugins/enigma/localization/ja_JP.inc
@@ -0,0 +1,55 @@
+<?php
+
+// EN-Revision: 4203
+
+$labels = array();
+$labels['enigmasettings'] = 'Enigma: 設定';
+$labels['enigmacerts'] = 'Enigma: 証明書 (S/MIME)';
+$labels['enigmakeys'] = 'Enigma: 鍵 (PGP)';
+$labels['keysfromto'] = '鍵の一覧 $from ~ $to (合計: $count )';
+$labels['keyname'] = '名前';
+$labels['keyid'] = '鍵 ID';
+$labels['keyuserid'] = 'ユーザー ID';
+$labels['keytype'] = '鍵の種類';
+$labels['fingerprint'] = '指紋';
+$labels['subkeys'] = 'Subkeys';
+$labels['basicinfo'] = '基本情報';
+$labels['userids'] = '追加のユーザー ID';
+$labels['typepublickey'] = '公開鍵';
+$labels['typekeypair'] = '鍵のペア';
+$labels['keyattfound'] = 'このメールは PGP 鍵の添付があります。';
+$labels['keyattimport'] = '鍵のインポート';
+
+$labels['createkeys'] = '新しい鍵のペアを作成する';
+$labels['importkeys'] = '鍵のインポート';
+$labels['exportkeys'] = '鍵のエクスポート';
+$labels['deletekeys'] = '鍵の削除';
+$labels['keyactions'] = '鍵の操作...';
+$labels['keydisable'] = '鍵を無効にする';
+$labels['keyrevoke'] = '鍵を取り消す';
+$labels['keysend'] = 'メッセージに公開鍵を含んで送信する';
+$labels['keychpass'] = 'パスワードの変更';
+
+$labels['securityoptions'] = 'メールのセキュリティ オプション...';
+$labels['identdefault'] = '選択した識別子の設定を使う';
+$labels['encryptmsg'] = 'このメールの暗号化';
+$labels['signmsg'] = 'このメールのデジタル署名';
+
+$messages = array();
+$messages['sigvalid'] = '$sender からの署名を検証しました。';
+$messages['siginvalid'] = '$sender からの署名が正しくありません。';
+$messages['signokey'] = '署名は未検証です。公開鍵が見つかりません。鍵 ID: $keyid';
+$messages['sigerror'] = '署名は未検証です。内部エラーです。';
+$messages['decryptok'] = 'メールを復号しました。';
+$messages['decrypterror'] = '復号に失敗しました。';
+$messages['decryptnokey'] = '復号に失敗しました。秘密鍵が見つかりません。鍵 ID: $keyid.';
+$messages['decryptbadpass'] = '復号に失敗しました。パスワードが正しくありません。';
+$messages['nokeysfound'] = '鍵が見つかりません。';
+$messages['keyopenerror'] = '鍵情報の取得に失敗しました! 内部エラーです。';
+$messages['keylisterror'] = '鍵情報のリストに失敗しました! 内部エラーです。';
+$messages['keysimportfailed'] = '鍵のインポートに失敗しました! 内部エラーです。';
+$messages['keysimportsuccess'] = '鍵をインポートしました。インポート: $new, 未変更: $old';
+$messages['keyconfirmdelete'] = '選択した鍵を本当に削除しますか?';
+$messages['keyimporttext'] = '秘密鍵と公開鍵のインポート、または ASCII 形式の署名を無効にできます。';
+
+?>
diff --git a/plugins/enigma/localization/ru_RU.inc b/plugins/enigma/localization/ru_RU.inc
new file mode 100644
index 000000000..3033d002c
--- /dev/null
+++ b/plugins/enigma/localization/ru_RU.inc
@@ -0,0 +1,65 @@
+<?php
+/*
+
++-----------------------------------------------------------------------+
+| plugins/enigma/localization/ru_RU.inc |
+| |
+| Russian translation for roundcube/enigma plugin |
+| Copyright (C) 2010 |
+| Licensed under the GNU GPL |
+| |
++-----------------------------------------------------------------------+
+| Author: Sergey Dukachev <iam@dukess.ru> |
+| Updates: |
++-----------------------------------------------------------------------+
+
+@version 2010-12-23
+
+*/
+
+$labels = array();
+$labels['enigmasettings'] = 'Enigma: Настройки';
+$labels['enigmacerts'] = 'Enigma: Сертификаты (S/MIME)';
+$labels['enigmakeys'] = 'Enigma: Ключи (PGP)';
+$labels['keysfromto'] = 'Ключи от $from к $to в количестве $count';
+$labels['keyname'] = 'Имя';
+$labels['keyid'] = 'Идентификатор ключа';
+$labels['keyuserid'] = 'Идентификатор пользователя';
+$labels['keytype'] = 'Тип ключа';
+$labels['fingerprint'] = 'Отпечаток (хэш) ключа';
+$labels['subkeys'] = 'Подразделы';
+$labels['basicinfo'] = 'Основные сведения';
+$labels['userids'] = 'Дополнительные идентификаторы пользователя';
+$labels['typepublickey'] = 'Открытый ключ';
+$labels['typekeypair'] = 'пара ключей';
+$labels['keyattfound'] = 'Это сообщение содержит один или несколько ключей PGP.';
+$labels['keyattimport'] = 'Импортировать ключи';
+
+$labels['createkeys'] = 'Создать новую пару ключей';
+$labels['importkeys'] = 'Импортировать ключ(и)';
+$labels['exportkeys'] = 'Экспортировать ключ(и)';
+$labels['deletekeys'] = 'Удалить ключ(и)';
+$labels['keyactions'] = 'Действия с ключами...';
+$labels['keydisable'] = 'Отключить ключ';
+$labels['keyrevoke'] = 'Отозвать ключ';
+$labels['keysend'] = 'Отправить публичный ключ в собщении';
+$labels['keychpass'] = 'Изменить пароль';
+
+$messages = array();
+$messages['sigvalid'] = 'Проверенная подпись у $sender.';
+$messages['siginvalid'] = 'Неверная подпись у $sender.';
+$messages['signokey'] = 'Непроверяемая подпись. Открытый ключ не найден. Идентификатор ключа: $keyid.';
+$messages['sigerror'] = 'Непроверяемая подпись. Внутренняя ошибка.';
+$messages['decryptok'] = 'Сообщение расшифровано.';
+$messages['decrypterror'] = 'Расшифровка не удалась.';
+$messages['decryptnokey'] = 'Расшифровка не удалась. Секретный ключ не найден. Идентификатор ключа: $keyid.';
+$messages['decryptbadpass'] = 'Расшифровка не удалась. Неправильный пароль.';
+$messages['nokeysfound'] = 'Ключи не найдены';
+$messages['keyopenerror'] = 'Невозможно получить информацию о ключе! Внутренняя ошибка.';
+$messages['keylisterror'] = 'Невозможно сделать список ключей! Внутренняя ошибка.';
+$messages['keysimportfailed'] = 'Невозможно импортировать ключ(и)! Внутренняя ошибка.';
+$messages['keysimportsuccess'] = 'Ключи успешно импортированы. Импортировано: $new, без изменений: $old.';
+$messages['keyconfirmdelete'] = 'Вы точно хотите удалить выбранные ключи?';
+$messages['keyimporttext'] = 'Вы можете импортировать открытые и секретные ключи или сообщения об отзыве ключей в формате ASCII-Armor.';
+
+?>
diff --git a/plugins/enigma/skins/default/enigma.css b/plugins/enigma/skins/default/enigma.css
new file mode 100644
index 000000000..b1c656f82
--- /dev/null
+++ b/plugins/enigma/skins/default/enigma.css
@@ -0,0 +1,182 @@
+/*** Style for Enigma plugin ***/
+
+/***** Messages displaying *****/
+
+#enigma-message,
+/* fixes border-top */
+#messagebody div #enigma-message
+{
+ margin: 0;
+ margin-bottom: 5px;
+ min-height: 20px;
+ padding: 10px 10px 6px 46px;
+}
+
+div.enigmaerror,
+/* fixes border-top */
+#messagebody div.enigmaerror
+{
+ background: url(enigma_error.png) 6px 1px no-repeat;
+ background-color: #EF9398;
+ border: 1px solid #DC5757;
+}
+
+div.enigmanotice,
+/* fixes border-top */
+#messagebody div.enigmanotice
+{
+ background: url(enigma.png) 6px 1px no-repeat;
+ background-color: #A6EF7B;
+ border: 1px solid #76C83F;
+}
+
+div.enigmawarning,
+/* fixes border-top */
+#messagebody div.enigmawarning
+{
+ background: url(enigma.png) 6px 1px no-repeat;
+ background-color: #F7FDCB;
+ border: 1px solid #C2D071;
+}
+
+#enigma-message a
+{
+ color: #666666;
+ padding-left: 10px;
+}
+
+#enigma-message a:hover
+{
+ color: #333333;
+}
+
+/***** Keys/Certs Management *****/
+
+div.enigmascreen
+{
+ position: absolute;
+ top: 65px;
+ right: 10px;
+ bottom: 10px;
+ left: 10px;
+}
+
+#enigmacontent-box
+{
+ position: absolute;
+ top: 0px;
+ left: 290px;
+ right: 0px;
+ bottom: 0px;
+ border: 1px solid #999999;
+ overflow: hidden;
+}
+
+#enigmakeyslist
+{
+ position: absolute;
+ top: 0;
+ bottom: 0;
+ left: 0;
+ border: 1px solid #999999;
+ background-color: #F9F9F9;
+ overflow: hidden;
+}
+
+#keylistcountbar
+{
+ margin-top: 4px;
+ margin-left: 4px;
+}
+
+#keys-table
+{
+ width: 100%;
+ table-layout: fixed;
+}
+
+#keys-table td
+{
+ cursor: default;
+ text-overflow: ellipsis;
+ -o-text-overflow: ellipsis;
+}
+
+#key-details table td.title
+{
+ font-weight: bold;
+ text-align: right;
+}
+
+#keystoolbar
+{
+ position: absolute;
+ top: 30px;
+ left: 10px;
+ height: 35px;
+}
+
+#keystoolbar a
+{
+ padding-right: 10px;
+}
+
+#keystoolbar a.button,
+#keystoolbar a.buttonPas,
+#keystoolbar span.separator {
+ display: block;
+ float: left;
+ width: 32px;
+ height: 32px;
+ padding: 0;
+ margin-right: 10px;
+ overflow: hidden;
+ background: url(keys_toolbar.png) 0 0 no-repeat transparent;
+ opacity: 0.99; /* this is needed to make buttons appear correctly in Chrome */
+}
+
+#keystoolbar a.buttonPas {
+ opacity: 0.35;
+}
+
+#keystoolbar a.createSel {
+ background-position: 0 -32px;
+}
+
+#keystoolbar a.create {
+ background-position: 0 0;
+}
+
+#keystoolbar a.deleteSel {
+ background-position: -32px -32px;
+}
+
+#keystoolbar a.delete {
+ background-position: -32px 0;
+}
+
+#keystoolbar a.importSel {
+ background-position: -64px -32px;
+}
+
+#keystoolbar a.import {
+ background-position: -64px 0;
+}
+
+#keystoolbar a.exportSel {
+ background-position: -96px -32px;
+}
+
+#keystoolbar a.export {
+ background-position: -96px 0;
+}
+
+#keystoolbar a.keymenu {
+ background-position: -128px 0;
+ width: 36px;
+}
+
+#keystoolbar span.separator {
+ width: 5px;
+ background-position: -166px 0;
+}
diff --git a/plugins/enigma/skins/default/enigma.png b/plugins/enigma/skins/default/enigma.png
new file mode 100644
index 000000000..3ef106e2a
--- /dev/null
+++ b/plugins/enigma/skins/default/enigma.png
Binary files differ
diff --git a/plugins/enigma/skins/default/enigma_error.png b/plugins/enigma/skins/default/enigma_error.png
new file mode 100644
index 000000000..9bf100efd
--- /dev/null
+++ b/plugins/enigma/skins/default/enigma_error.png
Binary files differ
diff --git a/plugins/enigma/skins/default/key.png b/plugins/enigma/skins/default/key.png
new file mode 100644
index 000000000..ea1cbd11c
--- /dev/null
+++ b/plugins/enigma/skins/default/key.png
Binary files differ
diff --git a/plugins/enigma/skins/default/key_add.png b/plugins/enigma/skins/default/key_add.png
new file mode 100644
index 000000000..f22cc870a
--- /dev/null
+++ b/plugins/enigma/skins/default/key_add.png
Binary files differ
diff --git a/plugins/enigma/skins/default/keys_toolbar.png b/plugins/enigma/skins/default/keys_toolbar.png
new file mode 100644
index 000000000..7cc258cc8
--- /dev/null
+++ b/plugins/enigma/skins/default/keys_toolbar.png
Binary files differ
diff --git a/plugins/enigma/skins/default/templates/keyimport.html b/plugins/enigma/skins/default/templates/keyimport.html
new file mode 100644
index 000000000..4e0b304a5
--- /dev/null
+++ b/plugins/enigma/skins/default/templates/keyimport.html
@@ -0,0 +1,20 @@
+<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
+<html xmlns="http://www.w3.org/1999/xhtml">
+<head>
+<title><roundcube:object name="pagetitle" /></title>
+<roundcube:include file="/includes/links.html" />
+<link rel="stylesheet" type="text/css" href="/this/enigma.css" />
+</head>
+<body class="iframe">
+
+<div id="keyimport-title" class="boxtitle"><roundcube:label name="enigma.importkeys" /></div>
+
+<div id="import-form" class="boxcontent">
+ <roundcube:object name="importform" />
+ <p>
+ <br /><roundcube:button command="plugin.enigma-import" type="input" class="button mainaction" label="import" />
+ </p>
+</div>
+
+</body>
+</html>
diff --git a/plugins/enigma/skins/default/templates/keyinfo.html b/plugins/enigma/skins/default/templates/keyinfo.html
new file mode 100644
index 000000000..2e8ed61db
--- /dev/null
+++ b/plugins/enigma/skins/default/templates/keyinfo.html
@@ -0,0 +1,17 @@
+<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
+<html xmlns="http://www.w3.org/1999/xhtml">
+<head>
+<title><roundcube:object name="pagetitle" /></title>
+<roundcube:include file="/includes/links.html" />
+<link rel="stylesheet" type="text/css" href="/this/enigma.css" />
+</head>
+<body class="iframe">
+
+<div id="keyinfo-title" class="boxtitle"><roundcube:object name="keyname" part="name" /></div>
+
+<div id="key-details" class="boxcontent">
+ <roundcube:object name="keydata" />
+</div>
+
+</body>
+</html>
diff --git a/plugins/enigma/skins/default/templates/keys.html b/plugins/enigma/skins/default/templates/keys.html
new file mode 100644
index 000000000..810c4a211
--- /dev/null
+++ b/plugins/enigma/skins/default/templates/keys.html
@@ -0,0 +1,76 @@
+<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
+<html xmlns="http://www.w3.org/1999/xhtml">
+<head>
+<title><roundcube:object name="pagetitle" /></title>
+<roundcube:include file="/includes/links.html" />
+<link rel="stylesheet" type="text/css" href="/this/enigma.css" />
+<script type="text/javascript" src="/functions.js"></script>
+<script type="text/javascript" src="/splitter.js"></script>
+<style type="text/css">
+#enigmakeyslist { width: <roundcube:exp expression="!empty(cookie:enigmaviewsplitter) ? cookie:enigmaviewsplitter-5 : 210" />px; }
+#enigmacontent-box { left: <roundcube:exp expression="!empty(cookie:enigmaviewsplitter) ? cookie:enigmaviewsplitter+5 : 220" />px;
+<roundcube:exp expression="browser:ie ? ('width:expression((parseInt(this.parentNode.offsetWidth)-'.(!empty(cookie:enigmaeviewsplitter) ? cookie:enigmaviewsplitter+5 : 220).')+\\'px\\');') : ''" />
+}
+</style>
+</head>
+<body class="iframe" onload="rcube_init_mail_ui()">
+
+<div id="prefs-title" class="boxtitle"><roundcube:label name="enigma.enigmakeys" /></div>
+<div id="prefs-details" class="boxcontent">
+
+<div id="keystoolbar">
+ <roundcube:button command="plugin.enigma-key-create" type="link" class="buttonPas create" classAct="button create" classSel="button createSel" title="enigma.createkeys" content=" " />
+ <roundcube:button command="plugin.enigma-key-delete" type="link" class="buttonPas delete" classAct="button delete" classSel="button deleteSel" title="enigma.deletekeys" content=" " />
+ <span class="separator">&nbsp;</span>
+ <roundcube:button command="plugin.enigma-key-import" type="link" class="buttonPas import" classAct="button import" classSel="button importSel" title="enigma.importkeys" content=" " />
+ <roundcube:button command="plugin.enigma-key-export" type="link" class="buttonPas export" classAct="button export" classSel="button exportSel" title="enigma.exportkeys" content=" " />
+ <roundcube:button name="messagemenulink" id="messagemenulink" type="link" class="button keymenu" title="enigma.keyactions" onclick="rcmail_ui.show_popup('messagemenu');return false" content=" " />
+</div>
+
+<div id="quicksearchbar" style="top: 35px; right: 10px;">
+ <roundcube:button name="searchmenulink" id="searchmenulink" image="/images/icons/glass.png" />
+ <roundcube:object name="searchform" id="quicksearchbox" />
+ <roundcube:button command="reset-search" id="searchreset" image="/images/icons/reset.gif" title="resetsearch" />
+</div>
+
+<div class="enigmascreen">
+
+<div id="enigmakeyslist">
+<div class="boxtitle"><roundcube:label name="enigma.keyname" /></div>
+<div class="boxlistcontent">
+ <roundcube:object name="keyslist" id="keys-table" class="records-table" cellspacing="0" noheader="true" />
+</div>
+<div class="boxfooter">
+<div id="keylistcountbar" class="pagenav">
+ <roundcube:button command="firstpage" type="link" class="buttonPas firstpage" classAct="button firstpage" classSel="button firstpageSel" title="firstpage" content=" " />
+ <roundcube:button command="previouspage" type="link" class="buttonPas prevpage" classAct="button prevpage" classSel="button prevpageSel" title="previouspage" content=" " />
+ <roundcube:object name="countdisplay" style="padding:0 .5em; float:left" />
+ <roundcube:button command="nextpage" type="link" class="buttonPas nextpage" classAct="button nextpage" classSel="button nextpageSel" title="nextpage" content=" " />
+ <roundcube:button command="lastpage" type="link" class="buttonPas lastpage" classAct="button lastpage" classSel="button lastpageSel" title="lastpage" content=" " />
+</div>
+</div>
+</div>
+
+<script type="text/javascript">
+ var enigmaviewsplit = new rcube_splitter({id:'enigmaviewsplitter', p1: 'enigmakeyslist', p2: 'enigmacontent-box', orientation: 'v', relative: true, start: 215});
+ rcmail.add_onload('enigmaviewsplit.init()');
+</script>
+
+<div id="enigmacontent-box">
+ <roundcube:object name="keyframe" id="keyframe" width="100%" height="100%" frameborder="0" src="/watermark.html" />
+</div>
+
+</div>
+</div>
+
+<div id="messagemenu" class="popupmenu">
+ <ul class="toolbarmenu">
+ <li><roundcube:button class="disablelink" command="enigma.key-disable" label="enigma.keydisable" target="_blank" classAct="disablelink active" /></li>
+ <li><roundcube:button class="revokelink" command="enigma.key-revoke" label="enigma.keyrevoke" classAct="revokelink active" /></li>
+ <li class="separator_below"><roundcube:button class="sendlink" command="enigma.key-send" label="enigma.keysend" classAct="sendlink active" /></li>
+ <li><roundcube:button class="chpasslink" command="enigma.key-chpass" label="enigma.keychpass" classAct="chpasslink active" /></li>
+ </ul>
+</div>
+
+</body>
+</html>
diff --git a/plugins/example_addressbook/example_addressbook.php b/plugins/example_addressbook/example_addressbook.php
new file mode 100644
index 000000000..a15461f44
--- /dev/null
+++ b/plugins/example_addressbook/example_addressbook.php
@@ -0,0 +1,50 @@
+<?php
+
+require_once(dirname(__FILE__) . '/example_addressbook_backend.php');
+
+/**
+ * Sample plugin to add a new address book
+ * with just a static list of contacts
+ */
+class example_addressbook extends rcube_plugin
+{
+ private $abook_id = 'static';
+ private $abook_name = 'Static List';
+
+ public function init()
+ {
+ $this->add_hook('addressbooks_list', array($this, 'address_sources'));
+ $this->add_hook('addressbook_get', array($this, 'get_address_book'));
+
+ // use this address book for autocompletion queries
+ // (maybe this should be configurable by the user?)
+ $config = rcmail::get_instance()->config;
+ $sources = (array) $config->get('autocomplete_addressbooks', array('sql'));
+ if (!in_array($this->abook_id, $sources)) {
+ $sources[] = $this->abook_id;
+ $config->set('autocomplete_addressbooks', $sources);
+ }
+ }
+
+ public function address_sources($p)
+ {
+ $abook = new example_addressbook_backend($this->abook_name);
+ $p['sources'][$this->abook_id] = array(
+ 'id' => $this->abook_id,
+ 'name' => $this->abook_name,
+ 'readonly' => $abook->readonly,
+ 'groups' => $abook->groups,
+ );
+ return $p;
+ }
+
+ public function get_address_book($p)
+ {
+ if ($p['id'] === $this->abook_id) {
+ $p['instance'] = new example_addressbook_backend($this->abook_name);
+ }
+
+ return $p;
+ }
+
+}
diff --git a/plugins/example_addressbook/example_addressbook_backend.php b/plugins/example_addressbook/example_addressbook_backend.php
new file mode 100644
index 000000000..8c143c25f
--- /dev/null
+++ b/plugins/example_addressbook/example_addressbook_backend.php
@@ -0,0 +1,116 @@
+<?php
+
+/**
+ * Example backend class for a custom address book
+ *
+ * This one just holds a static list of address records
+ *
+ * @author Thomas Bruederli
+ */
+class example_addressbook_backend extends rcube_addressbook
+{
+ public $primary_key = 'ID';
+ public $readonly = true;
+ public $groups = true;
+
+ private $filter;
+ private $result;
+ private $name;
+
+ public function __construct($name)
+ {
+ $this->ready = true;
+ $this->name = $name;
+ }
+
+ public function get_name()
+ {
+ return $this->name;
+ }
+
+ public function set_search_set($filter)
+ {
+ $this->filter = $filter;
+ }
+
+ public function get_search_set()
+ {
+ return $this->filter;
+ }
+
+ public function reset()
+ {
+ $this->result = null;
+ $this->filter = null;
+ }
+
+ function list_groups($search = null)
+ {
+ return array(
+ array('ID' => 'testgroup1', 'name' => "Testgroup"),
+ array('ID' => 'testgroup2', 'name' => "Sample Group"),
+ );
+ }
+
+ public function list_records($cols=null, $subset=0)
+ {
+ $this->result = $this->count();
+ $this->result->add(array('ID' => '111', 'name' => "Example Contact", 'firstname' => "Example", 'surname' => "Contact", 'email' => "example@roundcube.net"));
+
+ return $this->result;
+ }
+
+ public function search($fields, $value, $strict=false, $select=true, $nocount=false, $required=array())
+ {
+ // no search implemented, just list all records
+ return $this->list_records();
+ }
+
+ public function count()
+ {
+ return new rcube_result_set(1, ($this->list_page-1) * $this->page_size);
+ }
+
+ public function get_result()
+ {
+ return $this->result;
+ }
+
+ public function get_record($id, $assoc=false)
+ {
+ $this->list_records();
+ $first = $this->result->first();
+ $sql_arr = $first['ID'] == $id ? $first : null;
+
+ return $assoc && $sql_arr ? $sql_arr : $this->result;
+ }
+
+
+ function create_group($name)
+ {
+ $result = false;
+
+ return $result;
+ }
+
+ function delete_group($gid)
+ {
+ return false;
+ }
+
+ function rename_group($gid, $newname)
+ {
+ return $newname;
+ }
+
+ function add_to_group($group_id, $ids)
+ {
+ return false;
+ }
+
+ function remove_from_group($group_id, $ids)
+ {
+ return false;
+ }
+
+}
diff --git a/plugins/filesystem_attachments/filesystem_attachments.php b/plugins/filesystem_attachments/filesystem_attachments.php
new file mode 100644
index 000000000..12c78d973
--- /dev/null
+++ b/plugins/filesystem_attachments/filesystem_attachments.php
@@ -0,0 +1,161 @@
+<?php
+/**
+ * Filesystem Attachments
+ *
+ * This is a core plugin which provides basic, filesystem based
+ * attachment temporary file handling. This includes storing
+ * attachments of messages currently being composed, writing attachments
+ * to disk when drafts with attachments are re-opened and writing
+ * attachments to disk for inline display in current html compositions.
+ *
+ * Developers may wish to extend this class when creating attachment
+ * handler plugins:
+ * require_once('plugins/filesystem_attachments/filesystem_attachments.php');
+ * class myCustom_attachments extends filesystem_attachments
+ *
+ * @author Ziba Scott <ziba@umich.edu>
+ * @author Thomas Bruederli <roundcube@gmail.com>
+ *
+ */
+class filesystem_attachments extends rcube_plugin
+{
+ public $task = '?(?!login).*';
+
+ function init()
+ {
+ // Save a newly uploaded attachment
+ $this->add_hook('attachment_upload', array($this, 'upload'));
+
+ // Save an attachment from a non-upload source (draft or forward)
+ $this->add_hook('attachment_save', array($this, 'save'));
+
+ // Remove an attachment from storage
+ $this->add_hook('attachment_delete', array($this, 'remove'));
+
+ // When composing an html message, image attachments may be shown
+ $this->add_hook('attachment_display', array($this, 'display'));
+
+ // Get the attachment from storage and place it on disk to be sent
+ $this->add_hook('attachment_get', array($this, 'get'));
+
+ // Delete all temp files associated with this user
+ $this->add_hook('attachments_cleanup', array($this, 'cleanup'));
+ $this->add_hook('session_destroy', array($this, 'cleanup'));
+ }
+
+ /**
+ * Save a newly uploaded attachment
+ */
+ function upload($args)
+ {
+ $args['status'] = false;
+ $group = $args['group'];
+ $rcmail = rcmail::get_instance();
+
+ // use common temp dir for file uploads
+ $temp_dir = $rcmail->config->get('temp_dir');
+ $tmpfname = tempnam($temp_dir, 'rcmAttmnt');
+
+ if (move_uploaded_file($args['path'], $tmpfname) && file_exists($tmpfname)) {
+ $args['id'] = $this->file_id();
+ $args['path'] = $tmpfname;
+ $args['status'] = true;
+
+ // Note the file for later cleanup
+ $_SESSION['plugins']['filesystem_attachments'][$group][] = $tmpfname;
+ }
+
+ return $args;
+ }
+
+ /**
+ * Save an attachment from a non-upload source (draft or forward)
+ */
+ function save($args)
+ {
+ $group = $args['group'];
+ $args['status'] = false;
+
+ if (!$args['path']) {
+ $rcmail = rcmail::get_instance();
+ $temp_dir = $rcmail->config->get('temp_dir');
+ $tmp_path = tempnam($temp_dir, 'rcmAttmnt');
+
+ if ($fp = fopen($tmp_path, 'w')) {
+ fwrite($fp, $args['data']);
+ fclose($fp);
+ $args['path'] = $tmp_path;
+ } else
+ return $args;
+ }
+
+ $args['id'] = $this->file_id();
+ $args['status'] = true;
+
+ // Note the file for later cleanup
+ $_SESSION['plugins']['filesystem_attachments'][$group][] = $args['path'];
+
+ return $args;
+ }
+
+ /**
+ * Remove an attachment from storage
+ * This is triggered by the remove attachment button on the compose screen
+ */
+ function remove($args)
+ {
+ $args['status'] = @unlink($args['path']);
+ return $args;
+ }
+
+ /**
+ * When composing an html message, image attachments may be shown
+ * For this plugin, the file is already in place, just check for
+ * the existance of the proper metadata
+ */
+ function display($args)
+ {
+ $args['status'] = file_exists($args['path']);
+ return $args;
+ }
+
+ /**
+ * This attachment plugin doesn't require any steps to put the file
+ * on disk for use. This stub function is kept here to make this
+ * class handy as a parent class for other plugins which may need it.
+ */
+ function get($args)
+ {
+ return $args;
+ }
+
+ /**
+ * Delete all temp files associated with this user
+ */
+ function cleanup($args)
+ {
+ // $_SESSION['compose']['attachments'] is not a complete record of
+ // temporary files because loading a draft or starting a forward copies
+ // the file to disk, but does not make an entry in that array
+ if (is_array($_SESSION['plugins']['filesystem_attachments'])){
+ foreach ($_SESSION['plugins']['filesystem_attachments'] as $group => $files) {
+ if ($args['group'] && $args['group'] != $group)
+ continue;
+ foreach ((array)$files as $filename){
+ if(file_exists($filename)){
+ unlink($filename);
+ }
+ }
+ unset($_SESSION['plugins']['filesystem_attachments'][$group]);
+ }
+ }
+ return $args;
+ }
+
+ function file_id()
+ {
+ $userid = rcmail::get_instance()->user->ID;
+ list($usec, $sec) = explode(' ', microtime());
+ return preg_replace('/[^0-9]/', '', $userid . $sec . $usec);
+ }
+}
diff --git a/plugins/help/config.inc.php.dist b/plugins/help/config.inc.php.dist
new file mode 100644
index 000000000..d440dbbcc
--- /dev/null
+++ b/plugins/help/config.inc.php.dist
@@ -0,0 +1,5 @@
+<?php
+
+// Help content iframe source
+// $rcmail_config['help_source'] = 'http://trac.roundcube.net/wiki';
+$rcmail_config['help_source'] = '';
diff --git a/plugins/help/content/about.html b/plugins/help/content/about.html
new file mode 100644
index 000000000..c5bc2f477
--- /dev/null
+++ b/plugins/help/content/about.html
@@ -0,0 +1,39 @@
+<div id="helpabout">
+<h3 align="center">Copyright &copy; 2005-2010, The Roundcube Dev Team</h3>
+
+<p>This program is free software; you can redistribute it and/or modify
+it under the terms of the GNU General Public License version 2
+as published by the Free Software Foundation.
+</p>
+<p>
+This program is distributed in the hope that it will be useful,
+but WITHOUT ANY WARRANTY; without even the implied warranty of
+MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+GNU General Public License for more details.
+</p>
+<p>
+You should have received a copy of the GNU General Public License along
+with this program; if not, write to the Free Software Foundation, Inc.,
+51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+</p>
+
+<div align="center">
+<h3>Project management and administration</h3>
+<b>Thomas Bruederli (thomasb)</b> - Project leader and head developer<br />
+<b>Till Klampäckel (till)</b> - Co-leader<br />
+<b>Brett Patterson</b> - Forum administrator<br />
+<b>Adam Grelck</b> - Trac administrator<br />
+<b>Jason Fesler</b> - Mailing list administrator<br />
+<b>Brennan Stehling</b> - Mentor, Coordinator
+
+<h3>Developers</h3>
+<b>Eric Stadtherr (estadtherr)</b><br />
+<b>Robin Elfrink (robin, wobin)</b><br />
+<b>Rich Sandberg (richs)</b><br />
+<b>Tomasz Pajor (tomekp)</b><br />
+<b>Fourat Zouari (fourat.zouari)</b><br />
+<b>Aleksander Machniak (alec)</b>
+
+<p><br/>Website: <a href="http://roundcube.net">roundcube.net</a></p>
+</div>
+</div>
diff --git a/plugins/help/content/license.html b/plugins/help/content/license.html
new file mode 100644
index 000000000..2d83c6013
--- /dev/null
+++ b/plugins/help/content/license.html
@@ -0,0 +1,387 @@
+<div id="helplicense">
+<h3>GNU GENERAL PUBLIC LICENSE</h3>
+<p>
+Version 2, June 1991
+</p>
+
+<pre>
+Copyright (C) 1989, 1991 Free Software Foundation, Inc.
+51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA
+
+Everyone is permitted to copy and distribute verbatim copies
+of this license document, but changing it is not allowed.
+</pre>
+
+<h3>Preamble</h3>
+
+<p>
+The licenses for most software are designed to take away your
+freedom to share and change it. By contrast, the GNU General Public
+License is intended to guarantee your freedom to share and change free
+software--to make sure the software is free for all its users. This
+General Public License applies to most of the Free Software
+Foundation's software and to any other program whose authors commit to
+using it. (Some other Free Software Foundation software is covered by
+the GNU Lesser General Public License instead.) You can apply it to
+your programs, too.
+</p>
+
+<p>
+When we speak of free software, we are referring to freedom, not
+price. Our General Public Licenses are designed to make sure that you
+have the freedom to distribute copies of free software (and charge for
+this service if you wish), that you receive source code or can get it
+if you want it, that you can change the software or use pieces of it
+in new free programs; and that you know you can do these things.
+</p>
+
+<p>
+To protect your rights, we need to make restrictions that forbid
+anyone to deny you these rights or to ask you to surrender the rights.
+These restrictions translate to certain responsibilities for you if you
+distribute copies of the software, or if you modify it.
+</p>
+
+<p>
+For example, if you distribute copies of such a program, whether
+gratis or for a fee, you must give the recipients all the rights that
+you have. You must make sure that they, too, receive or can get the
+source code. And you must show them these terms so they know their
+rights.
+</p>
+
+<p>
+We protect your rights with two steps: (1) copyright the software, and
+(2) offer you this license which gives you legal permission to copy,
+distribute and/or modify the software.
+</p>
+
+<p>
+Also, for each author's protection and ours, we want to make certain
+that everyone understands that there is no warranty for this free
+software. If the software is modified by someone else and passed on, we
+want its recipients to know that what they have is not the original, so
+that any problems introduced by others will not reflect on the original
+authors' reputations.
+</p>
+
+<p>
+Finally, any free program is threatened constantly by software
+patents. We wish to avoid the danger that redistributors of a free
+program will individually obtain patent licenses, in effect making the
+program proprietary. To prevent this, we have made it clear that any
+patent must be licensed for everyone's free use or not licensed at all.
+</p>
+
+<p>
+ The precise terms and conditions for copying, distribution and
+modification follow.
+</p>
+
+
+<h3>TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION</h3>
+
+
+<p>
+<strong>0.</strong>
+This License applies to any program or other work which contains
+a notice placed by the copyright holder saying it may be distributed
+under the terms of this General Public License. The "Program", below,
+refers to any such program or work, and a "work based on the Program"
+means either the Program or any derivative work under copyright law:
+that is to say, a work containing the Program or a portion of it,
+either verbatim or with modifications and/or translated into another
+language. (Hereinafter, translation is included without limitation in
+the term "modification".) Each licensee is addressed as "you".
+</p>
+
+<p>
+Activities other than copying, distribution and modification are not
+covered by this License; they are outside its scope. The act of
+running the Program is not restricted, and the output from the Program
+is covered only if its contents constitute a work based on the
+Program (independent of having been made by running the Program).
+Whether that is true depends on what the Program does.
+</p>
+
+<p>
+<strong>1.</strong>
+You may copy and distribute verbatim copies of the Program's
+source code as you receive it, in any medium, provided that you
+conspicuously and appropriately publish on each copy an appropriate
+copyright notice and disclaimer of warranty; keep intact all the
+notices that refer to this License and to the absence of any warranty;
+and give any other recipients of the Program a copy of this License
+along with the Program.
+</p>
+
+<p>
+You may charge a fee for the physical act of transferring a copy, and
+you may at your option offer warranty protection in exchange for a fee.
+</p>
+
+<p>
+<strong>2.</strong>
+You may modify your copy or copies of the Program or any portion
+of it, thus forming a work based on the Program, and copy and
+distribute such modifications or work under the terms of Section 1
+above, provided that you also meet all of these conditions:
+</p>
+
+<dl>
+ <dt></dt>
+ <dd>
+ <strong>a)</strong>
+ You must cause the modified files to carry prominent notices
+ stating that you changed the files and the date of any change.
+ </dd>
+ <dt></dt>
+ <dd>
+ <strong>b)</strong>
+ You must cause any work that you distribute or publish, that in
+ whole or in part contains or is derived from the Program or any
+ part thereof, to be licensed as a whole at no charge to all third
+ parties under the terms of this License.
+ </dd>
+ <dt></dt>
+ <dd>
+ <strong>c)</strong>
+ If the modified program normally reads commands interactively
+ when run, you must cause it, when started running for such
+ interactive use in the most ordinary way, to print or display an
+ announcement including an appropriate copyright notice and a
+ notice that there is no warranty (or else, saying that you provide
+ a warranty) and that users may redistribute the program under
+ these conditions, and telling the user how to view a copy of this
+ License. (Exception: if the Program itself is interactive but
+ does not normally print such an announcement, your work based on
+ the Program is not required to print an announcement.)
+ </dd>
+</dl>
+
+<p>
+These requirements apply to the modified work as a whole. If
+identifiable sections of that work are not derived from the Program,
+and can be reasonably considered independent and separate works in
+themselves, then this License, and its terms, do not apply to those
+sections when you distribute them as separate works. But when you
+distribute the same sections as part of a whole which is a work based
+on the Program, the distribution of the whole must be on the terms of
+this License, whose permissions for other licensees extend to the
+entire whole, and thus to each and every part regardless of who wrote it.
+</p>
+
+<p>
+Thus, it is not the intent of this section to claim rights or contest
+your rights to work written entirely by you; rather, the intent is to
+exercise the right to control the distribution of derivative or
+collective works based on the Program.
+</p>
+
+<p>
+In addition, mere aggregation of another work not based on the Program
+with the Program (or with a work based on the Program) on a volume of
+a storage or distribution medium does not bring the other work under
+the scope of this License.
+</p>
+
+<p>
+<strong>3.</strong>
+You may copy and distribute the Program (or a work based on it,
+under Section 2) in object code or executable form under the terms of
+Sections 1 and 2 above provided that you also do one of the following:
+</p>
+
+<dl>
+ <dt></dt>
+ <dd>
+ <strong>a)</strong>
+ Accompany it with the complete corresponding machine-readable
+ source code, which must be distributed under the terms of Sections
+ 1 and 2 above on a medium customarily used for software interchange; or,
+ </dd>
+ <dt></dt>
+ <dd>
+ <strong>b)</strong>
+ Accompany it with a written offer, valid for at least three
+ years, to give any third party, for a charge no more than your
+ cost of physically performing source distribution, a complete
+ machine-readable copy of the corresponding source code, to be
+ distributed under the terms of Sections 1 and 2 above on a medium
+ customarily used for software interchange; or,
+ </dd>
+ <dt></dt>
+ <dd>
+ <strong>c)</strong>
+ Accompany it with the information you received as to the offer
+ to distribute corresponding source code. (This alternative is
+ allowed only for noncommercial distribution and only if you
+ received the program in object code or executable form with such
+ an offer, in accord with Subsection b above.)
+ </dd>
+</dl>
+
+<p>
+The source code for a work means the preferred form of the work for
+making modifications to it. For an executable work, complete source
+code means all the source code for all modules it contains, plus any
+associated interface definition files, plus the scripts used to
+control compilation and installation of the executable. However, as a
+special exception, the source code distributed need not include
+anything that is normally distributed (in either source or binary
+form) with the major components (compiler, kernel, and so on) of the
+operating system on which the executable runs, unless that component
+itself accompanies the executable.
+</p>
+
+<p>
+If distribution of executable or object code is made by offering
+access to copy from a designated place, then offering equivalent
+access to copy the source code from the same place counts as
+distribution of the source code, even though third parties are not
+compelled to copy the source along with the object code.
+</p>
+
+<p>
+<strong>4.</strong>
+You may not copy, modify, sublicense, or distribute the Program
+except as expressly provided under this License. Any attempt
+otherwise to copy, modify, sublicense or distribute the Program is
+void, and will automatically terminate your rights under this License.
+However, parties who have received copies, or rights, from you under
+this License will not have their licenses terminated so long as such
+parties remain in full compliance.
+</p>
+
+<p>
+<strong>5.</strong>
+You are not required to accept this License, since you have not
+signed it. However, nothing else grants you permission to modify or
+distribute the Program or its derivative works. These actions are
+prohibited by law if you do not accept this License. Therefore, by
+modifying or distributing the Program (or any work based on the
+Program), you indicate your acceptance of this License to do so, and
+all its terms and conditions for copying, distributing or modifying
+the Program or works based on it.
+</p>
+
+<p>
+<strong>6.</strong>
+Each time you redistribute the Program (or any work based on the
+Program), the recipient automatically receives a license from the
+original licensor to copy, distribute or modify the Program subject to
+these terms and conditions. You may not impose any further
+restrictions on the recipients' exercise of the rights granted herein.
+You are not responsible for enforcing compliance by third parties to
+this License.
+</p>
+
+<p>
+<strong>7.</strong>
+If, as a consequence of a court judgment or allegation of patent
+infringement or for any other reason (not limited to patent issues),
+conditions are imposed on you (whether by court order, agreement or
+otherwise) that contradict the conditions of this License, they do not
+excuse you from the conditions of this License. If you cannot
+distribute so as to satisfy simultaneously your obligations under this
+License and any other pertinent obligations, then as a consequence you
+may not distribute the Program at all. For example, if a patent
+license would not permit royalty-free redistribution of the Program by
+all those who receive copies directly or indirectly through you, then
+the only way you could satisfy both it and this License would be to
+refrain entirely from distribution of the Program.
+</p>
+
+<p>
+If any portion of this section is held invalid or unenforceable under
+any particular circumstance, the balance of the section is intended to
+apply and the section as a whole is intended to apply in other
+circumstances.
+</p>
+
+<p>
+It is not the purpose of this section to induce you to infringe any
+patents or other property right claims or to contest validity of any
+such claims; this section has the sole purpose of protecting the
+integrity of the free software distribution system, which is
+implemented by public license practices. Many people have made
+generous contributions to the wide range of software distributed
+through that system in reliance on consistent application of that
+system; it is up to the author/donor to decide if he or she is willing
+to distribute software through any other system and a licensee cannot
+impose that choice.
+</p>
+
+<p>
+This section is intended to make thoroughly clear what is believed to
+be a consequence of the rest of this License.
+</p>
+
+<p>
+<strong>8.</strong>
+If the distribution and/or use of the Program is restricted in
+certain countries either by patents or by copyrighted interfaces, the
+original copyright holder who places the Program under this License
+may add an explicit geographical distribution limitation excluding
+those countries, so that distribution is permitted only in or among
+countries not thus excluded. In such case, this License incorporates
+the limitation as if written in the body of this License.
+</p>
+
+<p>
+<strong>9.</strong>
+The Free Software Foundation may publish revised and/or new versions
+of the General Public License from time to time. Such new versions will
+be similar in spirit to the present version, but may differ in detail to
+address new problems or concerns.
+</p>
+
+<p>
+Each version is given a distinguishing version number. If the Program
+specifies a version number of this License which applies to it and "any
+later version", you have the option of following the terms and conditions
+either of that version or of any later version published by the Free
+Software Foundation. If the Program does not specify a version number of
+this License, you may choose any version ever published by the Free Software
+Foundation.
+</p>
+
+<p>
+<strong>10.</strong>
+If you wish to incorporate parts of the Program into other free
+programs whose distribution conditions are different, write to the author
+to ask for permission. For software which is copyrighted by the Free
+Software Foundation, write to the Free Software Foundation; we sometimes
+make exceptions for this. Our decision will be guided by the two goals
+of preserving the free status of all derivatives of our free software and
+of promoting the sharing and reuse of software generally.
+</p>
+
+<p><strong>NO WARRANTY</strong></p>
+
+<p>
+<strong>11.</strong>
+BECAUSE THE PROGRAM IS LICENSED FREE OF CHARGE, THERE IS NO WARRANTY
+FOR THE PROGRAM, TO THE EXTENT PERMITTED BY APPLICABLE LAW. EXCEPT WHEN
+OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR OTHER PARTIES
+PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY OF ANY KIND, EITHER EXPRESSED
+OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE. THE ENTIRE RISK AS
+TO THE QUALITY AND PERFORMANCE OF THE PROGRAM IS WITH YOU. SHOULD THE
+PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF ALL NECESSARY SERVICING,
+REPAIR OR CORRECTION.
+</p>
+
+<p>
+<strong>12.</strong>
+IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING
+WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY AND/OR
+REDISTRIBUTE THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES,
+INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING
+OUT OF THE USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED
+TO LOSS OF DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY
+YOU OR THIRD PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER
+PROGRAMS), EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE
+POSSIBILITY OF SUCH DAMAGES.
+</p>
+</div>
diff --git a/plugins/help/help.php b/plugins/help/help.php
new file mode 100644
index 000000000..ccf80820b
--- /dev/null
+++ b/plugins/help/help.php
@@ -0,0 +1,107 @@
+<?php
+
+/**
+ * Help Plugin
+ *
+ * @author Aleksander 'A.L.E.C' Machniak
+ * @licence GNU GPL
+ *
+ * Configuration (see config.inc.php.dist)
+ *
+ **/
+
+class help extends rcube_plugin
+{
+ // all task excluding 'login' and 'logout'
+ public $task = '?(?!login|logout).*';
+ // we've got no ajax handlers
+ public $noajax = true;
+ // skip frames
+ public $noframe = true;
+
+ function init()
+ {
+ $rcmail = rcmail::get_instance();
+
+ $this->add_texts('localization/', false);
+
+ // register task
+ $this->register_task('help');
+
+ // register actions
+ $this->register_action('index', array($this, 'action'));
+ $this->register_action('about', array($this, 'action'));
+ $this->register_action('license', array($this, 'action'));
+
+ // add taskbar button
+ $this->add_button(array(
+ 'name' => 'helptask',
+ 'class' => 'button-help',
+ 'label' => 'help.help',
+ 'href' => './?_task=help',
+ 'onclick' => sprintf("return %s.command('help')", JS_OBJECT_NAME)
+ ), 'taskbar');
+
+ $rcmail->output->add_script(
+ JS_OBJECT_NAME . ".enable_command('help', true);\n" .
+ JS_OBJECT_NAME . ".help = function () { location.href = './?_task=help'; }",
+ 'head');
+
+ $skin = $rcmail->config->get('skin');
+ if (!file_exists($this->home."/skins/$skin/help.css"))
+ $skin = 'default';
+
+ // add style for taskbar button (must be here) and Help UI
+ $this->include_stylesheet("skins/$skin/help.css");
+ }
+
+ function action()
+ {
+ $rcmail = rcmail::get_instance();
+
+ $this->load_config();
+
+ // register UI objects
+ $rcmail->output->add_handlers(array(
+ 'helpcontent' => array($this, 'content'),
+ ));
+
+ if ($rcmail->action == 'about')
+ $rcmail->output->set_pagetitle($this->gettext('about'));
+ else if ($rcmail->action == 'license')
+ $rcmail->output->set_pagetitle($this->gettext('license'));
+ else
+ $rcmail->output->set_pagetitle($this->gettext('help'));
+
+ $rcmail->output->send('help.help');
+ }
+
+ function content($attrib)
+ {
+ $rcmail = rcmail::get_instance();
+
+ if ($rcmail->action == 'about') {
+ return @file_get_contents($this->home.'/content/about.html');
+ }
+ else if ($rcmail->action == 'license') {
+ return @file_get_contents($this->home.'/content/license.html');
+ }
+
+ // default content: iframe
+
+ if ($src = $rcmail->config->get('help_source'))
+ $attrib['src'] = $src;
+
+ if (empty($attrib['id']))
+ $attrib['id'] = 'rcmailhelpcontent';
+
+ // allow the following attributes to be added to the <iframe> tag
+ $attrib_str = create_attrib_string($attrib, array(
+ 'id', 'class', 'style', 'src', 'width', 'height', 'frameborder'));
+
+ $out = sprintf('<iframe name="%s"%s></iframe>'."\n", $attrib['id'], $attrib_str);
+
+ return $out;
+ }
+
+}
diff --git a/plugins/help/localization/cs_CZ.inc b/plugins/help/localization/cs_CZ.inc
new file mode 100644
index 000000000..ae8b39a06
--- /dev/null
+++ b/plugins/help/localization/cs_CZ.inc
@@ -0,0 +1,25 @@
+<?php
+
+/*
+
++-----------------------------------------------------------------------+
+| language/cs_CZ/labels.inc |
+| |
+| Language file of the Roundcube help plugin |
+| Copyright (C) 2005-2009, The Roundcube Dev Team |
+| Licensed under the GNU GPL |
+| |
++-----------------------------------------------------------------------+
+| Author: Milan Kozak <hodza@hodza.net> |
++-----------------------------------------------------------------------+
+
+@version $Id: labels.inc 2993 2009-09-26 18:32:07Z alec $
+
+*/
+
+$labels = array();
+$labels['help'] = 'Nápověda';
+$labels['about'] = 'O aplikaci';
+$labels['license'] = 'Licence';
+
+?>
diff --git a/plugins/help/localization/da_DK.inc b/plugins/help/localization/da_DK.inc
new file mode 100644
index 000000000..753301220
--- /dev/null
+++ b/plugins/help/localization/da_DK.inc
@@ -0,0 +1,8 @@
+<?php
+
+$labels = array();
+$labels['help'] = 'Hjælp';
+$labels['about'] = 'Om';
+$labels['license'] = 'Licens';
+
+?>
diff --git a/plugins/help/localization/de_DE.inc b/plugins/help/localization/de_DE.inc
new file mode 100644
index 000000000..55d75e21c
--- /dev/null
+++ b/plugins/help/localization/de_DE.inc
@@ -0,0 +1,8 @@
+<?php
+// translation done by Ulli Heist - http://heist.hobby-site.org/
+$labels = array();
+$labels['help'] = 'Hilfe';
+$labels['about'] = '&Uuml;ber';
+$labels['license'] = 'Lizenz';
+
+?>
diff --git a/plugins/help/localization/en_GB.inc b/plugins/help/localization/en_GB.inc
new file mode 100644
index 000000000..8c2d1517c
--- /dev/null
+++ b/plugins/help/localization/en_GB.inc
@@ -0,0 +1,8 @@
+<?php
+
+$labels = array();
+$labels['help'] = 'Help';
+$labels['about'] = 'About';
+$labels['license'] = 'License';
+
+?>
diff --git a/plugins/help/localization/en_US.inc b/plugins/help/localization/en_US.inc
new file mode 100644
index 000000000..8c2d1517c
--- /dev/null
+++ b/plugins/help/localization/en_US.inc
@@ -0,0 +1,8 @@
+<?php
+
+$labels = array();
+$labels['help'] = 'Help';
+$labels['about'] = 'About';
+$labels['license'] = 'License';
+
+?>
diff --git a/plugins/help/localization/es_ES.inc b/plugins/help/localization/es_ES.inc
new file mode 100644
index 000000000..1d921859a
--- /dev/null
+++ b/plugins/help/localization/es_ES.inc
@@ -0,0 +1,8 @@
+<?php
+
+$labels = array();
+$labels['help'] = 'Ayuda';
+$labels['about'] = 'Acerca de';
+$labels['license'] = 'Licencia';
+
+?>
diff --git a/plugins/help/localization/et_EE.inc b/plugins/help/localization/et_EE.inc
new file mode 100644
index 000000000..f95f09824
--- /dev/null
+++ b/plugins/help/localization/et_EE.inc
@@ -0,0 +1,8 @@
+<?php
+
+$labels = array();
+$labels['help'] = 'Abi';
+$labels['about'] = 'Roundcube info';
+$labels['license'] = 'Litsents';
+
+?>
diff --git a/plugins/help/localization/gl_ES.inc b/plugins/help/localization/gl_ES.inc
new file mode 100644
index 000000000..2895dad30
--- /dev/null
+++ b/plugins/help/localization/gl_ES.inc
@@ -0,0 +1,8 @@
+<?php
+
+$labels = array();
+$labels['help'] = 'Axuda';
+$labels['about'] = 'Acerca de';
+$labels['license'] = 'Licencia';
+
+?>
diff --git a/plugins/help/localization/hu_HU.inc b/plugins/help/localization/hu_HU.inc
new file mode 100644
index 000000000..6ff4f248e
--- /dev/null
+++ b/plugins/help/localization/hu_HU.inc
@@ -0,0 +1,8 @@
+<?php
+
+$labels = array();
+$labels['help'] = 'Segítség';
+$labels['about'] = 'Névjegy';
+$labels['license'] = 'Licenc';
+
+?>
diff --git a/plugins/help/localization/ja_JP.inc b/plugins/help/localization/ja_JP.inc
new file mode 100644
index 000000000..18081bb7d
--- /dev/null
+++ b/plugins/help/localization/ja_JP.inc
@@ -0,0 +1,10 @@
+<?php
+
+// EN-Revision: 3891
+
+$labels = array();
+$labels['help'] = 'ヘルプ';
+$labels['about'] = '紹介';
+$labels['license'] = 'ライセンス';
+
+?>
diff --git a/plugins/help/localization/pl_PL.inc b/plugins/help/localization/pl_PL.inc
new file mode 100644
index 000000000..087bc0726
--- /dev/null
+++ b/plugins/help/localization/pl_PL.inc
@@ -0,0 +1,8 @@
+<?php
+
+$labels = array();
+$labels['help'] = 'Pomoc';
+$labels['about'] = 'O programie';
+$labels['license'] = 'Licencja';
+
+?>
diff --git a/plugins/help/localization/pt_BR.inc b/plugins/help/localization/pt_BR.inc
new file mode 100644
index 000000000..f557ad267
--- /dev/null
+++ b/plugins/help/localization/pt_BR.inc
@@ -0,0 +1,8 @@
+<?php
+
+$labels = array();
+$labels['help'] = 'Ajuda';
+$labels['about'] = 'Sobre';
+$labels['license'] = 'Licença';
+
+?>
diff --git a/plugins/help/localization/ru_RU.inc b/plugins/help/localization/ru_RU.inc
new file mode 100644
index 000000000..9f1de410c
--- /dev/null
+++ b/plugins/help/localization/ru_RU.inc
@@ -0,0 +1,23 @@
+<?php
+
+/*
+
++-----------------------------------------------------------------------+
+| plugins/help/localization/ru_RU.inc |
+| |
+| Language file of the Roundcube help plugin |
+| Copyright (C) 2005-2010, The Roundcube Dev Team |
+| Licensed under the GNU GPL |
+| |
++-----------------------------------------------------------------------+
+| Author: Sergey Dukachev <iam@dukess.ru> |
++-----------------------------------------------------------------------+
+
+*/
+
+$labels = array();
+$labels['help'] = 'Помощь';
+$labels['about'] = 'О программе';
+$labels['license'] = 'Лицензия';
+
+?>
diff --git a/plugins/help/localization/sv_SE.inc b/plugins/help/localization/sv_SE.inc
new file mode 100644
index 000000000..8b0d48741
--- /dev/null
+++ b/plugins/help/localization/sv_SE.inc
@@ -0,0 +1,8 @@
+<?php
+
+$labels = array();
+$labels['help'] = 'Hjälp';
+$labels['about'] = 'Om';
+$labels['license'] = 'Licens';
+
+?>
diff --git a/plugins/help/localization/zh_TW.inc b/plugins/help/localization/zh_TW.inc
new file mode 100644
index 000000000..603283761
--- /dev/null
+++ b/plugins/help/localization/zh_TW.inc
@@ -0,0 +1,8 @@
+<?php
+
+$labels = array();
+$labels['help'] = '說明';
+$labels['about'] = '關於';
+$labels['license'] = '許可證';
+
+?>
diff --git a/plugins/help/skins/default/help.css b/plugins/help/skins/default/help.css
new file mode 100644
index 000000000..8f67f111e
--- /dev/null
+++ b/plugins/help/skins/default/help.css
@@ -0,0 +1,29 @@
+/***** Roundcube|Mail Help task styles *****/
+
+#taskbar a.button-help
+{
+ background-image: url('help.gif');
+}
+
+.help-box
+{
+ overflow: auto;
+ background-color: #F2F2F2;
+}
+
+#helplicense, #helpabout
+{
+ width: 46em;
+ padding: 1em 2em;
+}
+
+#helplicense a, #helpabout a
+{
+ color: #900;
+}
+
+#helpabout
+{
+ margin: 0 auto;
+}
+
diff --git a/plugins/help/skins/default/help.gif b/plugins/help/skins/default/help.gif
new file mode 100644
index 000000000..fe41e43c0
--- /dev/null
+++ b/plugins/help/skins/default/help.gif
Binary files differ
diff --git a/plugins/help/skins/default/templates/help.html b/plugins/help/skins/default/templates/help.html
new file mode 100644
index 000000000..98beb6655
--- /dev/null
+++ b/plugins/help/skins/default/templates/help.html
@@ -0,0 +1,37 @@
+<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
+<html xmlns="http://www.w3.org/1999/xhtml">
+<head>
+<title><roundcube:object name="pagetitle" /></title>
+<roundcube:include file="/includes/links.html" />
+<link rel="stylesheet" type="text/css" href="/this/help.css" />
+<link rel="stylesheet" type="text/css" href="/settings.css" />
+<script type="text/javascript">
+function help_init_settings_tabs()
+{
+ var action, tab = '#helptabdefault';
+ if (window.rcmail && (action = rcmail.env.action)) {
+ tab = '#helptab' + (action ? action : 'default');
+ }
+ $(tab).addClass('tablink-selected');
+}
+</script>
+</head>
+<body>
+
+<roundcube:include file="/includes/taskbar.html" />
+<roundcube:include file="/includes/header.html" />
+
+<div id="tabsbar">
+<span id="helptabdefault" class="tablink"><roundcube:button name="helpdefault" href="?_task=help" type="link" label="help.help" title="help.help" /></span>
+<span id="helptababout" class="tablink"><roundcube:button name="helpabout" href="?_task=help&_action=about" type="link" label="help.about" title="help.about" class="tablink" /></span>
+<span id="helptablicense" class="tablink"><roundcube:button name="helplicense" href="?_task=help&_action=license" type="link" label="help.license" title="help.license" class="tablink" /></span>
+<roundcube:container name="helptabs" id="helptabsbar" />
+<script type="text/javascript"> if (window.rcmail) rcmail.add_onload(help_init_settings_tabs);</script>
+</div>
+
+<div id="mainscreen" class="box help-box">
+<roundcube:object name="helpcontent" id="helpcontentframe" width="100%" height="100%" frameborder="0" src="/watermark.html" />
+</div>
+
+</body>
+</html>
diff --git a/plugins/http_authentication/http_authentication.php b/plugins/http_authentication/http_authentication.php
new file mode 100644
index 000000000..6da6488a0
--- /dev/null
+++ b/plugins/http_authentication/http_authentication.php
@@ -0,0 +1,45 @@
+<?php
+
+/**
+ * HTTP Basic Authentication
+ *
+ * Make use of an existing HTTP authentication and perform login with the existing user credentials
+ *
+ * @version 1.2
+ * @author Thomas Bruederli
+ */
+class http_authentication extends rcube_plugin
+{
+ public $task = 'login';
+
+ function init()
+ {
+ $this->add_hook('startup', array($this, 'startup'));
+ $this->add_hook('authenticate', array($this, 'authenticate'));
+ }
+
+ function startup($args)
+ {
+ // change action to login
+ if (empty($args['action']) && empty($_SESSION['user_id'])
+ && !empty($_SERVER['PHP_AUTH_USER']) && !empty($_SERVER['PHP_AUTH_PW']))
+ $args['action'] = 'login';
+
+ return $args;
+ }
+
+ function authenticate($args)
+ {
+ if (!empty($_SERVER['PHP_AUTH_USER']) && !empty($_SERVER['PHP_AUTH_PW'])) {
+ $args['user'] = $_SERVER['PHP_AUTH_USER'];
+ $args['pass'] = $_SERVER['PHP_AUTH_PW'];
+ }
+
+ $args['cookiecheck'] = false;
+ $args['valid'] = true;
+
+ return $args;
+ }
+
+}
+
diff --git a/plugins/jqueryui/README b/plugins/jqueryui/README
new file mode 100644
index 000000000..10f8dad75
--- /dev/null
+++ b/plugins/jqueryui/README
@@ -0,0 +1,29 @@
++-------------------------------------------------------------------------+
+|
+| Author: Cor Bosman (roundcube@wa.ter.net)
+| Plugin: jqueryui
+| Version: 1.8.14
+| Purpose: Add jquery-ui to roundcube for every plugin to use
+|
++-------------------------------------------------------------------------+
+
+jqueryui adds the complete jquery-ui library including the smoothness
+theme to roundcube. This allows other plugins to use jquery-ui without
+having to load their own version. The benefit of using 1 central jquery-ui
+is that we wont run into problems of conflicting jquery libraries being
+loaded. All plugins that want to use jquery-ui should use this plugin as
+a requirement.
+
+It is possible for plugin authors to override the default smoothness theme.
+To do this, go to the jquery-ui website, and use the download feature to
+download your own theme. In the advanced settings, provide a scope class to
+your theme and add that class to all your UI elements. Finally, load the
+downloaded css files in your own plugin.
+
+Some jquery-ui modules provide localization. One example is the datepicker module.
+If you want to load localization for a specific module, then set up config.inc.php.
+Check the config.inc.php.dist file on how to set this up for the datepicker module.
+
+As of version 1.8.6 this plugin also supports other themes. If you're a theme
+developer and would like a different default theme to be used for your RC theme
+then let me know and we can set things up.
diff --git a/plugins/jqueryui/config.inc.php.dist b/plugins/jqueryui/config.inc.php.dist
new file mode 100644
index 000000000..8526e6a79
--- /dev/null
+++ b/plugins/jqueryui/config.inc.php.dist
@@ -0,0 +1,11 @@
+<?php
+
+// if you want to load localization strings for specific sub-libraries of jquery-ui, configure them here
+$rcmail_config['jquery_ui_i18n'] = array('datepicker');
+
+// map Roundcube skins with jquery-ui themes here
+$rcmail_config['jquery_ui_skin_map'] = array(
+ 'groupvice4' => 'redmond',
+);
+
+?>
diff --git a/plugins/jqueryui/jqueryui.php b/plugins/jqueryui/jqueryui.php
new file mode 100644
index 000000000..7ed201873
--- /dev/null
+++ b/plugins/jqueryui/jqueryui.php
@@ -0,0 +1,54 @@
+<?php
+
+/**
+ * jQuery UI
+ *
+ * Provide the jQuery UI library with according themes.
+ *
+ * @version 1.8.14
+ * @author Cor Bosman <roundcube@wa.ter.net>
+ * @author Thomas Bruederli <roundcube@gmail.com>
+ */
+class jqueryui extends rcube_plugin
+{
+ public $noajax = true;
+
+ public function init()
+ {
+ $version = '1.8.14';
+
+ $rcmail = rcmail::get_instance();
+ $this->load_config();
+
+ // include UI scripts
+ $this->include_script("js/jquery-ui-$version.custom.min.js");
+
+ // include UI stylesheet
+ $skin = $rcmail->config->get('skin', 'default');
+ $ui_map = $rcmail->config->get('jquery_ui_skin_map', array());
+ $ui_theme = $ui_map[$skin] ? $ui_map[$skin] : 'default';
+
+ if (file_exists($this->home . "/themes/$ui_theme/jquery-ui-$version.custom.css")) {
+ $this->include_stylesheet("themes/$ui_theme/jquery-ui-$version.custom.css");
+ }
+ else {
+ $this->include_stylesheet("themes/default/jquery-ui-$version.custom.css");
+ }
+
+ // jquery UI localization
+ $jquery_ui_i18n = $rcmail->config->get('jquery_ui_i18n', array());
+ if (count($jquery_ui_i18n) > 0) {
+ $lang_l = str_replace('_', '-', substr($_SESSION['language'], 0, 5));
+ $lang_s = substr($_SESSION['language'], 0, 2);
+ foreach($jquery_ui_i18n as $package) {
+ if (file_exists($this->home . "/js/i18n/jquery.ui.$package-$lang_l.js")) {
+ $this->include_script("js/i18n/jquery.ui.$package-$lang_l.js");
+ }
+ else if (file_exists($this->home . "/js/i18n/jquery.ui.$package-$lang_s.js")) {
+ $this->include_script("js/i18n/jquery.ui.$package-$lang_s.js");
+ }
+ }
+ }
+ }
+
+}
diff --git a/plugins/jqueryui/js/i18n/jquery-ui-i18n.js b/plugins/jqueryui/js/i18n/jquery-ui-i18n.js
new file mode 100644
index 000000000..1e5977ef6
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery-ui-i18n.js
@@ -0,0 +1,1242 @@
+/* Afrikaans initialisation for the jQuery UI date picker plugin. */
+/* Written by Renier Pretorius. */
+jQuery(function($){
+ $.datepicker.regional['af'] = {
+ closeText: 'Selekteer',
+ prevText: 'Vorige',
+ nextText: 'Volgende',
+ currentText: 'Vandag',
+ monthNames: ['Januarie','Februarie','Maart','April','Mei','Junie',
+ 'Julie','Augustus','September','Oktober','November','Desember'],
+ monthNamesShort: ['Jan', 'Feb', 'Mrt', 'Apr', 'Mei', 'Jun',
+ 'Jul', 'Aug', 'Sep', 'Okt', 'Nov', 'Des'],
+ dayNames: ['Sondag', 'Maandag', 'Dinsdag', 'Woensdag', 'Donderdag', 'Vrydag', 'Saterdag'],
+ dayNamesShort: ['Son', 'Maa', 'Din', 'Woe', 'Don', 'Vry', 'Sat'],
+ dayNamesMin: ['So','Ma','Di','Wo','Do','Vr','Sa'],
+ weekHeader: 'Wk',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['af']);
+});
+/* Arabic Translation for jQuery UI date picker plugin. */
+/* Khaled Al Horani -- koko.dw@gmail.com */
+/* خالد الحوراني -- koko.dw@gmail.com */
+/* NOTE: monthNames are the original months names and they are the Arabic names, not the new months name فبراير - يناير and there isn't any Arabic roots for these months */
+jQuery(function($){
+ $.datepicker.regional['ar'] = {
+ closeText: 'إغلاق',
+ prevText: '&#x3c;السابق',
+ nextText: 'التالي&#x3e;',
+ currentText: 'اليوم',
+ monthNames: ['كانون الثاني', 'شباط', 'آذار', 'نيسان', 'آذار', 'حزيران',
+ 'تموز', 'آب', 'أيلول', 'تشرين الأول', 'تشرين الثاني', 'كانون الأول'],
+ monthNamesShort: ['1','2','3','4','5','6','7','8','9','10','11','12'],
+ dayNames: ['السبت', 'الأحد', 'الاثنين', 'الثلاثاء', 'الأربعاء', 'الخميس', 'الجمعة'],
+ dayNamesShort: ['سبت', 'أحد', 'اثنين', 'ثلاثاء', 'أربعاء', 'خميس', 'جمعة'],
+ dayNamesMin: ['سبت', 'أحد', 'اثنين', 'ثلاثاء', 'أربعاء', 'خميس', 'جمعة'],
+ weekHeader: 'أسبوع',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: true,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['ar']);
+});/* Azerbaijani (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by Jamil Najafov (necefov33@gmail.com). */
+jQuery(function($) {
+ $.datepicker.regional['az'] = {
+ closeText: 'Bağla',
+ prevText: '&#x3c;Geri',
+ nextText: 'İrəli&#x3e;',
+ currentText: 'Bugün',
+ monthNames: ['Yanvar','Fevral','Mart','Aprel','May','İyun',
+ 'İyul','Avqust','Sentyabr','Oktyabr','Noyabr','Dekabr'],
+ monthNamesShort: ['Yan','Fev','Mar','Apr','May','İyun',
+ 'İyul','Avq','Sen','Okt','Noy','Dek'],
+ dayNames: ['Bazar','Bazar ertəsi','Çərşənbə axşamı','Çərşənbə','Cümə axşamı','Cümə','Şənbə'],
+ dayNamesShort: ['B','Be','Ça','Ç','Ca','C','Ş'],
+ dayNamesMin: ['B','B','Ç','С','Ç','C','Ş'],
+ weekHeader: 'Hf',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['az']);
+});/* Bulgarian initialisation for the jQuery UI date picker plugin. */
+/* Written by Stoyan Kyosev (http://svest.org). */
+jQuery(function($){
+ $.datepicker.regional['bg'] = {
+ closeText: 'затвори',
+ prevText: '&#x3c;назад',
+ nextText: 'напред&#x3e;',
+ nextBigText: '&#x3e;&#x3e;',
+ currentText: 'днес',
+ monthNames: ['Януари','Февруари','Март','Април','Май','Юни',
+ 'Юли','Август','Септември','Октомври','Ноември','Декември'],
+ monthNamesShort: ['Яну','Фев','Мар','Апр','Май','Юни',
+ 'Юли','Авг','Сеп','Окт','Нов','Дек'],
+ dayNames: ['Неделя','Понеделник','Вторник','Сряда','Четвъртък','Петък','Събота'],
+ dayNamesShort: ['Нед','Пон','Вто','Сря','Чет','Пет','Съб'],
+ dayNamesMin: ['Не','По','Вт','Ср','Че','Пе','Съ'],
+ weekHeader: 'Wk',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['bg']);
+});
+/* Bosnian i18n for the jQuery UI date picker plugin. */
+/* Written by Kenan Konjo. */
+jQuery(function($){
+ $.datepicker.regional['bs'] = {
+ closeText: 'Zatvori',
+ prevText: '&#x3c;',
+ nextText: '&#x3e;',
+ currentText: 'Danas',
+ monthNames: ['Januar','Februar','Mart','April','Maj','Juni',
+ 'Juli','August','Septembar','Oktobar','Novembar','Decembar'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
+ 'Jul','Aug','Sep','Okt','Nov','Dec'],
+ dayNames: ['Nedelja','Ponedeljak','Utorak','Srijeda','Četvrtak','Petak','Subota'],
+ dayNamesShort: ['Ned','Pon','Uto','Sri','Čet','Pet','Sub'],
+ dayNamesMin: ['Ne','Po','Ut','Sr','Če','Pe','Su'],
+ weekHeader: 'Wk',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['bs']);
+});/* Inicialització en català per a l'extenció 'calendar' per jQuery. */
+/* Writers: (joan.leon@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['ca'] = {
+ closeText: 'Tancar',
+ prevText: '&#x3c;Ant',
+ nextText: 'Seg&#x3e;',
+ currentText: 'Avui',
+ monthNames: ['Gener','Febrer','Mar&ccedil;','Abril','Maig','Juny',
+ 'Juliol','Agost','Setembre','Octubre','Novembre','Desembre'],
+ monthNamesShort: ['Gen','Feb','Mar','Abr','Mai','Jun',
+ 'Jul','Ago','Set','Oct','Nov','Des'],
+ dayNames: ['Diumenge','Dilluns','Dimarts','Dimecres','Dijous','Divendres','Dissabte'],
+ dayNamesShort: ['Dug','Dln','Dmt','Dmc','Djs','Dvn','Dsb'],
+ dayNamesMin: ['Dg','Dl','Dt','Dc','Dj','Dv','Ds'],
+ weekHeader: 'Sm',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['ca']);
+});/* Czech initialisation for the jQuery UI date picker plugin. */
+/* Written by Tomas Muller (tomas@tomas-muller.net). */
+jQuery(function($){
+ $.datepicker.regional['cs'] = {
+ closeText: 'Zavřít',
+ prevText: '&#x3c;Dříve',
+ nextText: 'Později&#x3e;',
+ currentText: 'Nyní',
+ monthNames: ['leden','únor','březen','duben','květen','červen',
+ 'červenec','srpen','září','říjen','listopad','prosinec'],
+ monthNamesShort: ['led','úno','bře','dub','kvě','čer',
+ 'čvc','srp','zář','říj','lis','pro'],
+ dayNames: ['neděle', 'pondělí', 'úterý', 'středa', 'čtvrtek', 'pátek', 'sobota'],
+ dayNamesShort: ['ne', 'po', 'út', 'st', 'čt', 'pá', 'so'],
+ dayNamesMin: ['ne','po','út','st','čt','pá','so'],
+ weekHeader: 'Týd',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['cs']);
+});
+/* Danish initialisation for the jQuery UI date picker plugin. */
+/* Written by Jan Christensen ( deletestuff@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['da'] = {
+ closeText: 'Luk',
+ prevText: '&#x3c;Forrige',
+ nextText: 'Næste&#x3e;',
+ currentText: 'Idag',
+ monthNames: ['Januar','Februar','Marts','April','Maj','Juni',
+ 'Juli','August','September','Oktober','November','December'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
+ 'Jul','Aug','Sep','Okt','Nov','Dec'],
+ dayNames: ['Søndag','Mandag','Tirsdag','Onsdag','Torsdag','Fredag','Lørdag'],
+ dayNamesShort: ['Søn','Man','Tir','Ons','Tor','Fre','Lør'],
+ dayNamesMin: ['Sø','Ma','Ti','On','To','Fr','Lø'],
+ weekHeader: 'Uge',
+ dateFormat: 'dd-mm-yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['da']);
+});
+/* German initialisation for the jQuery UI date picker plugin. */
+/* Written by Milian Wolff (mail@milianw.de). */
+jQuery(function($){
+ $.datepicker.regional['de'] = {
+ closeText: 'schließen',
+ prevText: '&#x3c;zurück',
+ nextText: 'Vor&#x3e;',
+ currentText: 'heute',
+ monthNames: ['Januar','Februar','März','April','Mai','Juni',
+ 'Juli','August','September','Oktober','November','Dezember'],
+ monthNamesShort: ['Jan','Feb','Mär','Apr','Mai','Jun',
+ 'Jul','Aug','Sep','Okt','Nov','Dez'],
+ dayNames: ['Sonntag','Montag','Dienstag','Mittwoch','Donnerstag','Freitag','Samstag'],
+ dayNamesShort: ['So','Mo','Di','Mi','Do','Fr','Sa'],
+ dayNamesMin: ['So','Mo','Di','Mi','Do','Fr','Sa'],
+ weekHeader: 'Wo',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['de']);
+});
+/* Greek (el) initialisation for the jQuery UI date picker plugin. */
+/* Written by Alex Cicovic (http://www.alexcicovic.com) */
+jQuery(function($){
+ $.datepicker.regional['el'] = {
+ closeText: 'Κλείσιμο',
+ prevText: 'Προηγούμενος',
+ nextText: 'Επόμενος',
+ currentText: 'Τρέχων Μήνας',
+ monthNames: ['Ιανουάριος','Φεβρουάριος','Μάρτιος','Απρίλιος','Μάιος','Ιούνιος',
+ 'Ιούλιος','Αύγουστος','Σεπτέμβριος','Οκτώβριος','Νοέμβριος','Δεκέμβριος'],
+ monthNamesShort: ['Ιαν','Φεβ','Μαρ','Απρ','Μαι','Ιουν',
+ 'Ιουλ','Αυγ','Σεπ','Οκτ','Νοε','Δεκ'],
+ dayNames: ['Κυριακή','Δευτέρα','Τρίτη','Τετάρτη','Πέμπτη','Παρασκευή','Σάββατο'],
+ dayNamesShort: ['Κυρ','Δευ','Τρι','Τετ','Πεμ','Παρ','Σαβ'],
+ dayNamesMin: ['Κυ','Δε','Τρ','Τε','Πε','Πα','Σα'],
+ weekHeader: 'Εβδ',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['el']);
+});/* English/UK initialisation for the jQuery UI date picker plugin. */
+/* Written by Stuart. */
+jQuery(function($){
+ $.datepicker.regional['en-GB'] = {
+ closeText: 'Done',
+ prevText: 'Prev',
+ nextText: 'Next',
+ currentText: 'Today',
+ monthNames: ['January','February','March','April','May','June',
+ 'July','August','September','October','November','December'],
+ monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun',
+ 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'],
+ dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'],
+ dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'],
+ dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'],
+ weekHeader: 'Wk',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['en-GB']);
+});
+/* Esperanto initialisation for the jQuery UI date picker plugin. */
+/* Written by Olivier M. (olivierweb@ifrance.com). */
+jQuery(function($){
+ $.datepicker.regional['eo'] = {
+ closeText: 'Fermi',
+ prevText: '&lt;Anta',
+ nextText: 'Sekv&gt;',
+ currentText: 'Nuna',
+ monthNames: ['Januaro','Februaro','Marto','Aprilo','Majo','Junio',
+ 'Julio','Aŭgusto','Septembro','Oktobro','Novembro','Decembro'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
+ 'Jul','Aŭg','Sep','Okt','Nov','Dec'],
+ dayNames: ['Dimanĉo','Lundo','Mardo','Merkredo','Ĵaŭdo','Vendredo','Sabato'],
+ dayNamesShort: ['Dim','Lun','Mar','Mer','Ĵaŭ','Ven','Sab'],
+ dayNamesMin: ['Di','Lu','Ma','Me','Ĵa','Ve','Sa'],
+ weekHeader: 'Sb',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['eo']);
+});
+/* Inicialización en español para la extensión 'UI date picker' para jQuery. */
+/* Traducido por Vester (xvester@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['es'] = {
+ closeText: 'Cerrar',
+ prevText: '&#x3c;Ant',
+ nextText: 'Sig&#x3e;',
+ currentText: 'Hoy',
+ monthNames: ['Enero','Febrero','Marzo','Abril','Mayo','Junio',
+ 'Julio','Agosto','Septiembre','Octubre','Noviembre','Diciembre'],
+ monthNamesShort: ['Ene','Feb','Mar','Abr','May','Jun',
+ 'Jul','Ago','Sep','Oct','Nov','Dic'],
+ dayNames: ['Domingo','Lunes','Martes','Mi&eacute;rcoles','Jueves','Viernes','S&aacute;bado'],
+ dayNamesShort: ['Dom','Lun','Mar','Mi&eacute;','Juv','Vie','S&aacute;b'],
+ dayNamesMin: ['Do','Lu','Ma','Mi','Ju','Vi','S&aacute;'],
+ weekHeader: 'Sm',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['es']);
+});/* Estonian initialisation for the jQuery UI date picker plugin. */
+/* Written by Mart Sõmermaa (mrts.pydev at gmail com). */
+jQuery(function($){
+ $.datepicker.regional['et'] = {
+ closeText: 'Sulge',
+ prevText: 'Eelnev',
+ nextText: 'Järgnev',
+ currentText: 'Täna',
+ monthNames: ['Jaanuar','Veebruar','Märts','Aprill','Mai','Juuni',
+ 'Juuli','August','September','Oktoober','November','Detsember'],
+ monthNamesShort: ['Jaan', 'Veebr', 'Märts', 'Apr', 'Mai', 'Juuni',
+ 'Juuli', 'Aug', 'Sept', 'Okt', 'Nov', 'Dets'],
+ dayNames: ['Pühapäev', 'Esmaspäev', 'Teisipäev', 'Kolmapäev', 'Neljapäev', 'Reede', 'Laupäev'],
+ dayNamesShort: ['Pühap', 'Esmasp', 'Teisip', 'Kolmap', 'Neljap', 'Reede', 'Laup'],
+ dayNamesMin: ['P','E','T','K','N','R','L'],
+ weekHeader: 'Sm',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['et']);
+}); /* Euskarako oinarria 'UI date picker' jquery-ko extentsioarentzat */
+/* Karrikas-ek itzulia (karrikas@karrikas.com) */
+jQuery(function($){
+ $.datepicker.regional['eu'] = {
+ closeText: 'Egina',
+ prevText: '&#x3c;Aur',
+ nextText: 'Hur&#x3e;',
+ currentText: 'Gaur',
+ monthNames: ['Urtarrila','Otsaila','Martxoa','Apirila','Maiatza','Ekaina',
+ 'Uztaila','Abuztua','Iraila','Urria','Azaroa','Abendua'],
+ monthNamesShort: ['Urt','Ots','Mar','Api','Mai','Eka',
+ 'Uzt','Abu','Ira','Urr','Aza','Abe'],
+ dayNames: ['Igandea','Astelehena','Asteartea','Asteazkena','Osteguna','Ostirala','Larunbata'],
+ dayNamesShort: ['Iga','Ast','Ast','Ast','Ost','Ost','Lar'],
+ dayNamesMin: ['Ig','As','As','As','Os','Os','La'],
+ weekHeader: 'Wk',
+ dateFormat: 'yy/mm/dd',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['eu']);
+});/* Persian (Farsi) Translation for the jQuery UI date picker plugin. */
+/* Javad Mowlanezhad -- jmowla@gmail.com */
+/* Jalali calendar should supported soon! (Its implemented but I have to test it) */
+jQuery(function($) {
+ $.datepicker.regional['fa'] = {
+ closeText: 'بستن',
+ prevText: '&#x3c;قبلي',
+ nextText: 'بعدي&#x3e;',
+ currentText: 'امروز',
+ monthNames: ['فروردين','ارديبهشت','خرداد','تير','مرداد','شهريور',
+ 'مهر','آبان','آذر','دي','بهمن','اسفند'],
+ monthNamesShort: ['1','2','3','4','5','6','7','8','9','10','11','12'],
+ dayNames: ['يکشنبه','دوشنبه','سه‌شنبه','چهارشنبه','پنجشنبه','جمعه','شنبه'],
+ dayNamesShort: ['ي','د','س','چ','پ','ج', 'ش'],
+ dayNamesMin: ['ي','د','س','چ','پ','ج', 'ش'],
+ weekHeader: 'هف',
+ dateFormat: 'yy/mm/dd',
+ firstDay: 6,
+ isRTL: true,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['fa']);
+});/* Finnish initialisation for the jQuery UI date picker plugin. */
+/* Written by Harri Kilpi� (harrikilpio@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['fi'] = {
+ closeText: 'Sulje',
+ prevText: '&laquo;Edellinen',
+ nextText: 'Seuraava&raquo;',
+ currentText: 'T&auml;n&auml;&auml;n',
+ monthNames: ['Tammikuu','Helmikuu','Maaliskuu','Huhtikuu','Toukokuu','Kes&auml;kuu',
+ 'Hein&auml;kuu','Elokuu','Syyskuu','Lokakuu','Marraskuu','Joulukuu'],
+ monthNamesShort: ['Tammi','Helmi','Maalis','Huhti','Touko','Kes&auml;',
+ 'Hein&auml;','Elo','Syys','Loka','Marras','Joulu'],
+ dayNamesShort: ['Su','Ma','Ti','Ke','To','Pe','Su'],
+ dayNames: ['Sunnuntai','Maanantai','Tiistai','Keskiviikko','Torstai','Perjantai','Lauantai'],
+ dayNamesMin: ['Su','Ma','Ti','Ke','To','Pe','La'],
+ weekHeader: 'Vk',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['fi']);
+});
+/* Faroese initialisation for the jQuery UI date picker plugin */
+/* Written by Sverri Mohr Olsen, sverrimo@gmail.com */
+jQuery(function($){
+ $.datepicker.regional['fo'] = {
+ closeText: 'Lat aftur',
+ prevText: '&#x3c;Fyrra',
+ nextText: 'Næsta&#x3e;',
+ currentText: 'Í dag',
+ monthNames: ['Januar','Februar','Mars','Apríl','Mei','Juni',
+ 'Juli','August','September','Oktober','November','Desember'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Mei','Jun',
+ 'Jul','Aug','Sep','Okt','Nov','Des'],
+ dayNames: ['Sunnudagur','Mánadagur','Týsdagur','Mikudagur','Hósdagur','Fríggjadagur','Leyardagur'],
+ dayNamesShort: ['Sun','Mán','Týs','Mik','Hós','Frí','Ley'],
+ dayNamesMin: ['Su','Má','Tý','Mi','Hó','Fr','Le'],
+ weekHeader: 'Vk',
+ dateFormat: 'dd-mm-yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['fo']);
+});
+/* Swiss-French initialisation for the jQuery UI date picker plugin. */
+/* Written Martin Voelkle (martin.voelkle@e-tc.ch). */
+jQuery(function($){
+ $.datepicker.regional['fr-CH'] = {
+ closeText: 'Fermer',
+ prevText: '&#x3c;Préc',
+ nextText: 'Suiv&#x3e;',
+ currentText: 'Courant',
+ monthNames: ['Janvier','Février','Mars','Avril','Mai','Juin',
+ 'Juillet','Août','Septembre','Octobre','Novembre','Décembre'],
+ monthNamesShort: ['Jan','Fév','Mar','Avr','Mai','Jun',
+ 'Jul','Aoû','Sep','Oct','Nov','Déc'],
+ dayNames: ['Dimanche','Lundi','Mardi','Mercredi','Jeudi','Vendredi','Samedi'],
+ dayNamesShort: ['Dim','Lun','Mar','Mer','Jeu','Ven','Sam'],
+ dayNamesMin: ['Di','Lu','Ma','Me','Je','Ve','Sa'],
+ weekHeader: 'Sm',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['fr-CH']);
+});/* French initialisation for the jQuery UI date picker plugin. */
+/* Written by Keith Wood (kbwood{at}iinet.com.au) and Stéphane Nahmani (sholby@sholby.net). */
+jQuery(function($){
+ $.datepicker.regional['fr'] = {
+ closeText: 'Fermer',
+ prevText: '&#x3c;Préc',
+ nextText: 'Suiv&#x3e;',
+ currentText: 'Courant',
+ monthNames: ['Janvier','Février','Mars','Avril','Mai','Juin',
+ 'Juillet','Août','Septembre','Octobre','Novembre','Décembre'],
+ monthNamesShort: ['Jan','Fév','Mar','Avr','Mai','Jun',
+ 'Jul','Aoû','Sep','Oct','Nov','Déc'],
+ dayNames: ['Dimanche','Lundi','Mardi','Mercredi','Jeudi','Vendredi','Samedi'],
+ dayNamesShort: ['Dim','Lun','Mar','Mer','Jeu','Ven','Sam'],
+ dayNamesMin: ['Di','Lu','Ma','Me','Je','Ve','Sa'],
+ weekHeader: 'Sm',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['fr']);
+});/* Galician localization for 'UI date picker' jQuery extension. */
+/* Translated by Jorge Barreiro <yortx.barry@gmail.com>. */
+jQuery(function($){
+ $.datepicker.regional['gl'] = {
+ closeText: 'Pechar',
+ prevText: '&#x3c;Ant',
+ nextText: 'Seg&#x3e;',
+ currentText: 'Hoxe',
+ monthNames: ['Xaneiro','Febreiro','Marzo','Abril','Maio','Xuño',
+ 'Xullo','Agosto','Setembro','Outubro','Novembro','Decembro'],
+ monthNamesShort: ['Xan','Feb','Mar','Abr','Mai','Xuñ',
+ 'Xul','Ago','Set','Out','Nov','Dec'],
+ dayNames: ['Domingo','Luns','Martes','M&eacute;rcores','Xoves','Venres','S&aacute;bado'],
+ dayNamesShort: ['Dom','Lun','Mar','M&eacute;r','Xov','Ven','S&aacute;b'],
+ dayNamesMin: ['Do','Lu','Ma','M&eacute;','Xo','Ve','S&aacute;'],
+ weekHeader: 'Sm',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['gl']);
+});/* Hebrew initialisation for the UI Datepicker extension. */
+/* Written by Amir Hardon (ahardon at gmail dot com). */
+jQuery(function($){
+ $.datepicker.regional['he'] = {
+ closeText: 'סגור',
+ prevText: '&#x3c;הקודם',
+ nextText: 'הבא&#x3e;',
+ currentText: 'היום',
+ monthNames: ['ינואר','פברואר','מרץ','אפריל','מאי','יוני',
+ 'יולי','אוגוסט','ספטמבר','אוקטובר','נובמבר','דצמבר'],
+ monthNamesShort: ['1','2','3','4','5','6',
+ '7','8','9','10','11','12'],
+ dayNames: ['ראשון','שני','שלישי','רביעי','חמישי','שישי','שבת'],
+ dayNamesShort: ['א\'','ב\'','ג\'','ד\'','ה\'','ו\'','שבת'],
+ dayNamesMin: ['א\'','ב\'','ג\'','ד\'','ה\'','ו\'','שבת'],
+ weekHeader: 'Wk',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: true,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['he']);
+});
+/* Croatian i18n for the jQuery UI date picker plugin. */
+/* Written by Vjekoslav Nesek. */
+jQuery(function($){
+ $.datepicker.regional['hr'] = {
+ closeText: 'Zatvori',
+ prevText: '&#x3c;',
+ nextText: '&#x3e;',
+ currentText: 'Danas',
+ monthNames: ['Siječanj','Veljača','Ožujak','Travanj','Svibanj','Lipanj',
+ 'Srpanj','Kolovoz','Rujan','Listopad','Studeni','Prosinac'],
+ monthNamesShort: ['Sij','Velj','Ožu','Tra','Svi','Lip',
+ 'Srp','Kol','Ruj','Lis','Stu','Pro'],
+ dayNames: ['Nedjelja','Ponedjeljak','Utorak','Srijeda','Četvrtak','Petak','Subota'],
+ dayNamesShort: ['Ned','Pon','Uto','Sri','Čet','Pet','Sub'],
+ dayNamesMin: ['Ne','Po','Ut','Sr','Če','Pe','Su'],
+ weekHeader: 'Tje',
+ dateFormat: 'dd.mm.yy.',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['hr']);
+});/* Hungarian initialisation for the jQuery UI date picker plugin. */
+/* Written by Istvan Karaszi (jquery@spam.raszi.hu). */
+jQuery(function($){
+ $.datepicker.regional['hu'] = {
+ closeText: 'bezárás',
+ prevText: '&laquo;&nbsp;vissza',
+ nextText: 'előre&nbsp;&raquo;',
+ currentText: 'ma',
+ monthNames: ['Január', 'Február', 'Március', 'Április', 'Május', 'Június',
+ 'Július', 'Augusztus', 'Szeptember', 'Október', 'November', 'December'],
+ monthNamesShort: ['Jan', 'Feb', 'Már', 'Ápr', 'Máj', 'Jún',
+ 'Júl', 'Aug', 'Szep', 'Okt', 'Nov', 'Dec'],
+ dayNames: ['Vasárnap', 'Hétfö', 'Kedd', 'Szerda', 'Csütörtök', 'Péntek', 'Szombat'],
+ dayNamesShort: ['Vas', 'Hét', 'Ked', 'Sze', 'Csü', 'Pén', 'Szo'],
+ dayNamesMin: ['V', 'H', 'K', 'Sze', 'Cs', 'P', 'Szo'],
+ weekHeader: 'Hé',
+ dateFormat: 'yy-mm-dd',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['hu']);
+});
+/* Armenian(UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by Levon Zakaryan (levon.zakaryan@gmail.com)*/
+jQuery(function($){
+ $.datepicker.regional['hy'] = {
+ closeText: 'Փակել',
+ prevText: '&#x3c;Նախ.',
+ nextText: 'Հաջ.&#x3e;',
+ currentText: 'Այսօր',
+ monthNames: ['Հունվար','Փետրվար','Մարտ','Ապրիլ','Մայիս','Հունիս',
+ 'Հուլիս','Օգոստոս','Սեպտեմբեր','Հոկտեմբեր','Նոյեմբեր','Դեկտեմբեր'],
+ monthNamesShort: ['Հունվ','Փետր','Մարտ','Ապր','Մայիս','Հունիս',
+ 'Հուլ','Օգս','Սեպ','Հոկ','Նոյ','Դեկ'],
+ dayNames: ['կիրակի','եկուշաբթի','երեքշաբթի','չորեքշաբթի','հինգշաբթի','ուրբաթ','շաբաթ'],
+ dayNamesShort: ['կիր','երկ','երք','չրք','հնգ','ուրբ','շբթ'],
+ dayNamesMin: ['կիր','երկ','երք','չրք','հնգ','ուրբ','շբթ'],
+ weekHeader: 'ՇԲՏ',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['hy']);
+});/* Indonesian initialisation for the jQuery UI date picker plugin. */
+/* Written by Deden Fathurahman (dedenf@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['id'] = {
+ closeText: 'Tutup',
+ prevText: '&#x3c;mundur',
+ nextText: 'maju&#x3e;',
+ currentText: 'hari ini',
+ monthNames: ['Januari','Februari','Maret','April','Mei','Juni',
+ 'Juli','Agustus','September','Oktober','Nopember','Desember'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Mei','Jun',
+ 'Jul','Agus','Sep','Okt','Nop','Des'],
+ dayNames: ['Minggu','Senin','Selasa','Rabu','Kamis','Jumat','Sabtu'],
+ dayNamesShort: ['Min','Sen','Sel','Rab','kam','Jum','Sab'],
+ dayNamesMin: ['Mg','Sn','Sl','Rb','Km','jm','Sb'],
+ weekHeader: 'Mg',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['id']);
+});/* Icelandic initialisation for the jQuery UI date picker plugin. */
+/* Written by Haukur H. Thorsson (haukur@eskill.is). */
+jQuery(function($){
+ $.datepicker.regional['is'] = {
+ closeText: 'Loka',
+ prevText: '&#x3c; Fyrri',
+ nextText: 'N&aelig;sti &#x3e;',
+ currentText: '&Iacute; dag',
+ monthNames: ['Jan&uacute;ar','Febr&uacute;ar','Mars','Apr&iacute;l','Ma&iacute','J&uacute;n&iacute;',
+ 'J&uacute;l&iacute;','&Aacute;g&uacute;st','September','Okt&oacute;ber','N&oacute;vember','Desember'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Ma&iacute;','J&uacute;n',
+ 'J&uacute;l','&Aacute;g&uacute;','Sep','Okt','N&oacute;v','Des'],
+ dayNames: ['Sunnudagur','M&aacute;nudagur','&THORN;ri&eth;judagur','Mi&eth;vikudagur','Fimmtudagur','F&ouml;studagur','Laugardagur'],
+ dayNamesShort: ['Sun','M&aacute;n','&THORN;ri','Mi&eth;','Fim','F&ouml;s','Lau'],
+ dayNamesMin: ['Su','M&aacute;','&THORN;r','Mi','Fi','F&ouml;','La'],
+ weekHeader: 'Vika',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['is']);
+});/* Italian initialisation for the jQuery UI date picker plugin. */
+/* Written by Antonello Pasella (antonello.pasella@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['it'] = {
+ closeText: 'Chiudi',
+ prevText: '&#x3c;Prec',
+ nextText: 'Succ&#x3e;',
+ currentText: 'Oggi',
+ monthNames: ['Gennaio','Febbraio','Marzo','Aprile','Maggio','Giugno',
+ 'Luglio','Agosto','Settembre','Ottobre','Novembre','Dicembre'],
+ monthNamesShort: ['Gen','Feb','Mar','Apr','Mag','Giu',
+ 'Lug','Ago','Set','Ott','Nov','Dic'],
+ dayNames: ['Domenica','Luned&#236','Marted&#236','Mercoled&#236','Gioved&#236','Venerd&#236','Sabato'],
+ dayNamesShort: ['Dom','Lun','Mar','Mer','Gio','Ven','Sab'],
+ dayNamesMin: ['Do','Lu','Ma','Me','Gi','Ve','Sa'],
+ weekHeader: 'Sm',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['it']);
+});
+/* Japanese initialisation for the jQuery UI date picker plugin. */
+/* Written by Kentaro SATO (kentaro@ranvis.com). */
+jQuery(function($){
+ $.datepicker.regional['ja'] = {
+ closeText: '閉じる',
+ prevText: '&#x3c;前',
+ nextText: '次&#x3e;',
+ currentText: '今日',
+ monthNames: ['1月','2月','3月','4月','5月','6月',
+ '7月','8月','9月','10月','11月','12月'],
+ monthNamesShort: ['1月','2月','3月','4月','5月','6月',
+ '7月','8月','9月','10月','11月','12月'],
+ dayNames: ['日曜日','月曜日','火曜日','水曜日','木曜日','金曜日','土曜日'],
+ dayNamesShort: ['日','月','火','水','木','金','土'],
+ dayNamesMin: ['日','月','火','水','木','金','土'],
+ weekHeader: '週',
+ dateFormat: 'yy/mm/dd',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: true,
+ yearSuffix: '年'};
+ $.datepicker.setDefaults($.datepicker.regional['ja']);
+});/* Korean initialisation for the jQuery calendar extension. */
+/* Written by DaeKwon Kang (ncrash.dk@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['ko'] = {
+ closeText: '닫기',
+ prevText: '이전달',
+ nextText: '다음달',
+ currentText: '오늘',
+ monthNames: ['1월(JAN)','2월(FEB)','3월(MAR)','4월(APR)','5월(MAY)','6월(JUN)',
+ '7월(JUL)','8월(AUG)','9월(SEP)','10월(OCT)','11월(NOV)','12월(DEC)'],
+ monthNamesShort: ['1월(JAN)','2월(FEB)','3월(MAR)','4월(APR)','5월(MAY)','6월(JUN)',
+ '7월(JUL)','8월(AUG)','9월(SEP)','10월(OCT)','11월(NOV)','12월(DEC)'],
+ dayNames: ['일','월','화','수','목','금','토'],
+ dayNamesShort: ['일','월','화','수','목','금','토'],
+ dayNamesMin: ['일','월','화','수','목','금','토'],
+ weekHeader: 'Wk',
+ dateFormat: 'yy-mm-dd',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: '년'};
+ $.datepicker.setDefaults($.datepicker.regional['ko']);
+});/* Kazakh (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by Dmitriy Karasyov (dmitriy.karasyov@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['kz'] = {
+ closeText: 'Жабу',
+ prevText: '&#x3c;Алдыңғы',
+ nextText: 'Келесі&#x3e;',
+ currentText: 'Бүгін',
+ monthNames: ['Қаңтар','Ақпан','Наурыз','Сәуір','Мамыр','Маусым',
+ 'Шілде','Тамыз','Қыркүйек','Қазан','Қараша','Желтоқсан'],
+ monthNamesShort: ['Қаң','Ақп','Нау','Сәу','Мам','Мау',
+ 'Шіл','Там','Қыр','Қаз','Қар','Жел'],
+ dayNames: ['Жексенбі','Дүйсенбі','Сейсенбі','Сәрсенбі','Бейсенбі','Жұма','Сенбі'],
+ dayNamesShort: ['жкс','дсн','ссн','срс','бсн','жма','снб'],
+ dayNamesMin: ['Жк','Дс','Сс','Ср','Бс','Жм','Сн'],
+ weekHeader: 'Не',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['kz']);
+});
+/* Lithuanian (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* @author Arturas Paleicikas <arturas@avalon.lt> */
+jQuery(function($){
+ $.datepicker.regional['lt'] = {
+ closeText: 'Uždaryti',
+ prevText: '&#x3c;Atgal',
+ nextText: 'Pirmyn&#x3e;',
+ currentText: 'Šiandien',
+ monthNames: ['Sausis','Vasaris','Kovas','Balandis','Gegužė','Birželis',
+ 'Liepa','Rugpjūtis','Rugsėjis','Spalis','Lapkritis','Gruodis'],
+ monthNamesShort: ['Sau','Vas','Kov','Bal','Geg','Bir',
+ 'Lie','Rugp','Rugs','Spa','Lap','Gru'],
+ dayNames: ['sekmadienis','pirmadienis','antradienis','trečiadienis','ketvirtadienis','penktadienis','šeštadienis'],
+ dayNamesShort: ['sek','pir','ant','tre','ket','pen','šeš'],
+ dayNamesMin: ['Se','Pr','An','Tr','Ke','Pe','Še'],
+ weekHeader: 'Wk',
+ dateFormat: 'yy-mm-dd',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['lt']);
+});/* Latvian (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* @author Arturas Paleicikas <arturas.paleicikas@metasite.net> */
+jQuery(function($){
+ $.datepicker.regional['lv'] = {
+ closeText: 'Aizvērt',
+ prevText: 'Iepr',
+ nextText: 'Nāka',
+ currentText: 'Šodien',
+ monthNames: ['Janvāris','Februāris','Marts','Aprīlis','Maijs','Jūnijs',
+ 'Jūlijs','Augusts','Septembris','Oktobris','Novembris','Decembris'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Mai','Jūn',
+ 'Jūl','Aug','Sep','Okt','Nov','Dec'],
+ dayNames: ['svētdiena','pirmdiena','otrdiena','trešdiena','ceturtdiena','piektdiena','sestdiena'],
+ dayNamesShort: ['svt','prm','otr','tre','ctr','pkt','sst'],
+ dayNamesMin: ['Sv','Pr','Ot','Tr','Ct','Pk','Ss'],
+ weekHeader: 'Nav',
+ dateFormat: 'dd-mm-yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['lv']);
+});/* Malaysian initialisation for the jQuery UI date picker plugin. */
+/* Written by Mohd Nawawi Mohamad Jamili (nawawi@ronggeng.net). */
+jQuery(function($){
+ $.datepicker.regional['ms'] = {
+ closeText: 'Tutup',
+ prevText: '&#x3c;Sebelum',
+ nextText: 'Selepas&#x3e;',
+ currentText: 'hari ini',
+ monthNames: ['Januari','Februari','Mac','April','Mei','Jun',
+ 'Julai','Ogos','September','Oktober','November','Disember'],
+ monthNamesShort: ['Jan','Feb','Mac','Apr','Mei','Jun',
+ 'Jul','Ogo','Sep','Okt','Nov','Dis'],
+ dayNames: ['Ahad','Isnin','Selasa','Rabu','Khamis','Jumaat','Sabtu'],
+ dayNamesShort: ['Aha','Isn','Sel','Rab','kha','Jum','Sab'],
+ dayNamesMin: ['Ah','Is','Se','Ra','Kh','Ju','Sa'],
+ weekHeader: 'Mg',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['ms']);
+});/* Dutch (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by Mathias Bynens <http://mathiasbynens.be/> */
+jQuery(function($){
+ $.datepicker.regional.nl = {
+ closeText: 'Sluiten',
+ prevText: '←',
+ nextText: '→',
+ currentText: 'Vandaag',
+ monthNames: ['januari', 'februari', 'maart', 'april', 'mei', 'juni',
+ 'juli', 'augustus', 'september', 'oktober', 'november', 'december'],
+ monthNamesShort: ['jan', 'feb', 'maa', 'apr', 'mei', 'jun',
+ 'jul', 'aug', 'sep', 'okt', 'nov', 'dec'],
+ dayNames: ['zondag', 'maandag', 'dinsdag', 'woensdag', 'donderdag', 'vrijdag', 'zaterdag'],
+ dayNamesShort: ['zon', 'maa', 'din', 'woe', 'don', 'vri', 'zat'],
+ dayNamesMin: ['zo', 'ma', 'di', 'wo', 'do', 'vr', 'za'],
+ weekHeader: 'Wk',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional.nl);
+});/* Norwegian initialisation for the jQuery UI date picker plugin. */
+/* Written by Naimdjon Takhirov (naimdjon@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['no'] = {
+ closeText: 'Lukk',
+ prevText: '&laquo;Forrige',
+ nextText: 'Neste&raquo;',
+ currentText: 'I dag',
+ monthNames: ['Januar','Februar','Mars','April','Mai','Juni',
+ 'Juli','August','September','Oktober','November','Desember'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Mai','Jun',
+ 'Jul','Aug','Sep','Okt','Nov','Des'],
+ dayNamesShort: ['Søn','Man','Tir','Ons','Tor','Fre','Lør'],
+ dayNames: ['Søndag','Mandag','Tirsdag','Onsdag','Torsdag','Fredag','Lørdag'],
+ dayNamesMin: ['Sø','Ma','Ti','On','To','Fr','Lø'],
+ weekHeader: 'Uke',
+ dateFormat: 'yy-mm-dd',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['no']);
+});
+/* Polish initialisation for the jQuery UI date picker plugin. */
+/* Written by Jacek Wysocki (jacek.wysocki@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['pl'] = {
+ closeText: 'Zamknij',
+ prevText: '&#x3c;Poprzedni',
+ nextText: 'Następny&#x3e;',
+ currentText: 'Dziś',
+ monthNames: ['Styczeń','Luty','Marzec','Kwiecień','Maj','Czerwiec',
+ 'Lipiec','Sierpień','Wrzesień','Październik','Listopad','Grudzień'],
+ monthNamesShort: ['Sty','Lu','Mar','Kw','Maj','Cze',
+ 'Lip','Sie','Wrz','Pa','Lis','Gru'],
+ dayNames: ['Niedziela','Poniedziałek','Wtorek','Środa','Czwartek','Piątek','Sobota'],
+ dayNamesShort: ['Nie','Pn','Wt','Śr','Czw','Pt','So'],
+ dayNamesMin: ['N','Pn','Wt','Śr','Cz','Pt','So'],
+ weekHeader: 'Tydz',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['pl']);
+});
+/* Brazilian initialisation for the jQuery UI date picker plugin. */
+/* Written by Leonildo Costa Silva (leocsilva@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['pt-BR'] = {
+ closeText: 'Fechar',
+ prevText: '&#x3c;Anterior',
+ nextText: 'Pr&oacute;ximo&#x3e;',
+ currentText: 'Hoje',
+ monthNames: ['Janeiro','Fevereiro','Mar&ccedil;o','Abril','Maio','Junho',
+ 'Julho','Agosto','Setembro','Outubro','Novembro','Dezembro'],
+ monthNamesShort: ['Jan','Fev','Mar','Abr','Mai','Jun',
+ 'Jul','Ago','Set','Out','Nov','Dez'],
+ dayNames: ['Domingo','Segunda-feira','Ter&ccedil;a-feira','Quarta-feira','Quinta-feira','Sexta-feira','S&aacute;bado'],
+ dayNamesShort: ['Dom','Seg','Ter','Qua','Qui','Sex','S&aacute;b'],
+ dayNamesMin: ['Dom','Seg','Ter','Qua','Qui','Sex','S&aacute;b'],
+ weekHeader: 'Sm',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['pt-BR']);
+});/* Portuguese initialisation for the jQuery UI date picker plugin. */
+jQuery(function($){
+ $.datepicker.regional['pt'] = {
+ closeText: 'Fechar',
+ prevText: '&#x3c;Anterior',
+ nextText: 'Seguinte',
+ currentText: 'Hoje',
+ monthNames: ['Janeiro','Fevereiro','Mar&ccedil;o','Abril','Maio','Junho',
+ 'Julho','Agosto','Setembro','Outubro','Novembro','Dezembro'],
+ monthNamesShort: ['Jan','Fev','Mar','Abr','Mai','Jun',
+ 'Jul','Ago','Set','Out','Nov','Dez'],
+ dayNames: ['Domingo','Segunda-feira','Ter&ccedil;a-feira','Quarta-feira','Quinta-feira','Sexta-feira','S&aacute;bado'],
+ dayNamesShort: ['Dom','Seg','Ter','Qua','Qui','Sex','S&aacute;b'],
+ dayNamesMin: ['Dom','Seg','Ter','Qua','Qui','Sex','S&aacute;b'],
+ weekHeader: 'Sem',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['pt']);
+});/* Romanian initialisation for the jQuery UI date picker plugin.
+ *
+ * Written by Edmond L. (ll_edmond@walla.com)
+ * and Ionut G. Stan (ionut.g.stan@gmail.com)
+ */
+jQuery(function($){
+ $.datepicker.regional['ro'] = {
+ closeText: 'Închide',
+ prevText: '&laquo; Luna precedentă',
+ nextText: 'Luna următoare &raquo;',
+ currentText: 'Azi',
+ monthNames: ['Ianuarie','Februarie','Martie','Aprilie','Mai','Iunie',
+ 'Iulie','August','Septembrie','Octombrie','Noiembrie','Decembrie'],
+ monthNamesShort: ['Ian', 'Feb', 'Mar', 'Apr', 'Mai', 'Iun',
+ 'Iul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'],
+ dayNames: ['Duminică', 'Luni', 'Marţi', 'Miercuri', 'Joi', 'Vineri', 'Sâmbătă'],
+ dayNamesShort: ['Dum', 'Lun', 'Mar', 'Mie', 'Joi', 'Vin', 'Sâm'],
+ dayNamesMin: ['Du','Lu','Ma','Mi','Jo','Vi','Sâ'],
+ weekHeader: 'Săpt',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['ro']);
+});
+/* Russian (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by Andrew Stromnov (stromnov@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['ru'] = {
+ closeText: 'Закрыть',
+ prevText: '&#x3c;Пред',
+ nextText: 'След&#x3e;',
+ currentText: 'Сегодня',
+ monthNames: ['Январь','Февраль','Март','Апрель','Май','Июнь',
+ 'Июль','Август','Сентябрь','Октябрь','Ноябрь','Декабрь'],
+ monthNamesShort: ['Янв','Фев','Мар','Апр','Май','Июн',
+ 'Июл','Авг','Сен','Окт','Ноя','Дек'],
+ dayNames: ['воскресенье','понедельник','вторник','среда','четверг','пятница','суббота'],
+ dayNamesShort: ['вск','пнд','втр','срд','чтв','птн','сбт'],
+ dayNamesMin: ['Вс','Пн','Вт','Ср','Чт','Пт','Сб'],
+ weekHeader: 'Нед',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['ru']);
+});/* Slovak initialisation for the jQuery UI date picker plugin. */
+/* Written by Vojtech Rinik (vojto@hmm.sk). */
+jQuery(function($){
+ $.datepicker.regional['sk'] = {
+ closeText: 'Zavrieť',
+ prevText: '&#x3c;Predchádzajúci',
+ nextText: 'Nasledujúci&#x3e;',
+ currentText: 'Dnes',
+ monthNames: ['Január','Február','Marec','Apríl','Máj','Jún',
+ 'Júl','August','September','Október','November','December'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Máj','Jún',
+ 'Júl','Aug','Sep','Okt','Nov','Dec'],
+ dayNames: ['Nedel\'a','Pondelok','Utorok','Streda','Štvrtok','Piatok','Sobota'],
+ dayNamesShort: ['Ned','Pon','Uto','Str','Štv','Pia','Sob'],
+ dayNamesMin: ['Ne','Po','Ut','St','Št','Pia','So'],
+ weekHeader: 'Ty',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['sk']);
+});
+/* Slovenian initialisation for the jQuery UI date picker plugin. */
+/* Written by Jaka Jancar (jaka@kubje.org). */
+/* c = &#x10D;, s = &#x161; z = &#x17E; C = &#x10C; S = &#x160; Z = &#x17D; */
+jQuery(function($){
+ $.datepicker.regional['sl'] = {
+ closeText: 'Zapri',
+ prevText: '&lt;Prej&#x161;nji',
+ nextText: 'Naslednji&gt;',
+ currentText: 'Trenutni',
+ monthNames: ['Januar','Februar','Marec','April','Maj','Junij',
+ 'Julij','Avgust','September','Oktober','November','December'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
+ 'Jul','Avg','Sep','Okt','Nov','Dec'],
+ dayNames: ['Nedelja','Ponedeljek','Torek','Sreda','&#x10C;etrtek','Petek','Sobota'],
+ dayNamesShort: ['Ned','Pon','Tor','Sre','&#x10C;et','Pet','Sob'],
+ dayNamesMin: ['Ne','Po','To','Sr','&#x10C;e','Pe','So'],
+ weekHeader: 'Teden',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['sl']);
+});
+/* Albanian initialisation for the jQuery UI date picker plugin. */
+/* Written by Flakron Bytyqi (flakron@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['sq'] = {
+ closeText: 'mbylle',
+ prevText: '&#x3c;mbrapa',
+ nextText: 'Përpara&#x3e;',
+ currentText: 'sot',
+ monthNames: ['Janar','Shkurt','Mars','Prill','Maj','Qershor',
+ 'Korrik','Gusht','Shtator','Tetor','Nëntor','Dhjetor'],
+ monthNamesShort: ['Jan','Shk','Mar','Pri','Maj','Qer',
+ 'Kor','Gus','Sht','Tet','Nën','Dhj'],
+ dayNames: ['E Diel','E Hënë','E Martë','E Mërkurë','E Enjte','E Premte','E Shtune'],
+ dayNamesShort: ['Di','Hë','Ma','Më','En','Pr','Sh'],
+ dayNamesMin: ['Di','Hë','Ma','Më','En','Pr','Sh'],
+ weekHeader: 'Ja',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['sq']);
+});
+/* Serbian i18n for the jQuery UI date picker plugin. */
+/* Written by Dejan Dimić. */
+jQuery(function($){
+ $.datepicker.regional['sr-SR'] = {
+ closeText: 'Zatvori',
+ prevText: '&#x3c;',
+ nextText: '&#x3e;',
+ currentText: 'Danas',
+ monthNames: ['Januar','Februar','Mart','April','Maj','Jun',
+ 'Jul','Avgust','Septembar','Oktobar','Novembar','Decembar'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
+ 'Jul','Avg','Sep','Okt','Nov','Dec'],
+ dayNames: ['Nedelja','Ponedeljak','Utorak','Sreda','Četvrtak','Petak','Subota'],
+ dayNamesShort: ['Ned','Pon','Uto','Sre','Čet','Pet','Sub'],
+ dayNamesMin: ['Ne','Po','Ut','Sr','Če','Pe','Su'],
+ weekHeader: 'Sed',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['sr-SR']);
+});
+/* Serbian i18n for the jQuery UI date picker plugin. */
+/* Written by Dejan Dimić. */
+jQuery(function($){
+ $.datepicker.regional['sr'] = {
+ closeText: 'Затвори',
+ prevText: '&#x3c;',
+ nextText: '&#x3e;',
+ currentText: 'Данас',
+ monthNames: ['Јануар','Фебруар','Март','Април','Мај','Јун',
+ 'Јул','Август','Септембар','Октобар','Новембар','Децембар'],
+ monthNamesShort: ['Јан','Феб','Мар','Апр','Мај','Јун',
+ 'Јул','Авг','Сеп','Окт','Нов','Дец'],
+ dayNames: ['Недеља','Понедељак','Уторак','Среда','Четвртак','Петак','Субота'],
+ dayNamesShort: ['Нед','Пон','Уто','Сре','Чет','Пет','Суб'],
+ dayNamesMin: ['Не','По','Ут','Ср','Че','Пе','Су'],
+ weekHeader: 'Сед',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['sr']);
+});
+/* Swedish initialisation for the jQuery UI date picker plugin. */
+/* Written by Anders Ekdahl ( anders@nomadiz.se). */
+jQuery(function($){
+ $.datepicker.regional['sv'] = {
+ closeText: 'Stäng',
+ prevText: '&laquo;Förra',
+ nextText: 'Nästa&raquo;',
+ currentText: 'Idag',
+ monthNames: ['Januari','Februari','Mars','April','Maj','Juni',
+ 'Juli','Augusti','September','Oktober','November','December'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
+ 'Jul','Aug','Sep','Okt','Nov','Dec'],
+ dayNamesShort: ['Sön','Mån','Tis','Ons','Tor','Fre','Lör'],
+ dayNames: ['Söndag','Måndag','Tisdag','Onsdag','Torsdag','Fredag','Lördag'],
+ dayNamesMin: ['Sö','Må','Ti','On','To','Fr','Lö'],
+ weekHeader: 'Ve',
+ dateFormat: 'yy-mm-dd',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['sv']);
+});
+/* Tamil (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by S A Sureshkumar (saskumar@live.com). */
+jQuery(function($){
+ $.datepicker.regional['ta'] = {
+ closeText: 'மூடு',
+ prevText: 'முன்னையது',
+ nextText: 'அடுத்தது',
+ currentText: 'இன்று',
+ monthNames: ['தை','மாசி','பங்குனி','சித்திரை','வைகாசி','ஆனி',
+ 'ஆடி','ஆவணி','புரட்டாசி','ஐப்பசி','கார்த்திகை','மார்கழி'],
+ monthNamesShort: ['தை','மாசி','பங்','சித்','வைகா','ஆனி',
+ 'ஆடி','ஆவ','புர','ஐப்','கார்','மார்'],
+ dayNames: ['ஞாயிற்றுக்கிழமை','திங்கட்கிழமை','செவ்வாய்க்கிழமை','புதன்கிழமை','வியாழக்கிழமை','வெள்ளிக்கிழமை','சனிக்கிழமை'],
+ dayNamesShort: ['ஞாயிறு','திங்கள்','செவ்வாய்','புதன்','வியாழன்','வெள்ளி','சனி'],
+ dayNamesMin: ['ஞா','தி','செ','பு','வி','வெ','ச'],
+ weekHeader: 'Не',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['ta']);
+});
+/* Thai initialisation for the jQuery UI date picker plugin. */
+/* Written by pipo (pipo@sixhead.com). */
+jQuery(function($){
+ $.datepicker.regional['th'] = {
+ closeText: 'ปิด',
+ prevText: '&laquo;&nbsp;ย้อน',
+ nextText: 'ถัดไป&nbsp;&raquo;',
+ currentText: 'วันนี้',
+ monthNames: ['มกราคม','กุมภาพันธ์','มีนาคม','เมษายน','พฤษภาคม','มิถุนายน',
+ 'กรกฏาคม','สิงหาคม','กันยายน','ตุลาคม','พฤศจิกายน','ธันวาคม'],
+ monthNamesShort: ['ม.ค.','ก.พ.','มี.ค.','เม.ย.','พ.ค.','มิ.ย.',
+ 'ก.ค.','ส.ค.','ก.ย.','ต.ค.','พ.ย.','ธ.ค.'],
+ dayNames: ['อาทิตย์','จันทร์','อังคาร','พุธ','พฤหัสบดี','ศุกร์','เสาร์'],
+ dayNamesShort: ['อา.','จ.','อ.','พ.','พฤ.','ศ.','ส.'],
+ dayNamesMin: ['อา.','จ.','อ.','พ.','พฤ.','ศ.','ส.'],
+ weekHeader: 'Wk',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['th']);
+});/* Turkish initialisation for the jQuery UI date picker plugin. */
+/* Written by Izzet Emre Erkan (kara@karalamalar.net). */
+jQuery(function($){
+ $.datepicker.regional['tr'] = {
+ closeText: 'kapat',
+ prevText: '&#x3c;geri',
+ nextText: 'ileri&#x3e',
+ currentText: 'bugün',
+ monthNames: ['Ocak','Şubat','Mart','Nisan','Mayıs','Haziran',
+ 'Temmuz','Ağustos','Eylül','Ekim','Kasım','Aralık'],
+ monthNamesShort: ['Oca','Şub','Mar','Nis','May','Haz',
+ 'Tem','Ağu','Eyl','Eki','Kas','Ara'],
+ dayNames: ['Pazar','Pazartesi','Salı','Çarşamba','Perşembe','Cuma','Cumartesi'],
+ dayNamesShort: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'],
+ dayNamesMin: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'],
+ weekHeader: 'Hf',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['tr']);
+});/* Ukrainian (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by Maxim Drogobitskiy (maxdao@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['uk'] = {
+ closeText: 'Закрити',
+ prevText: '&#x3c;',
+ nextText: '&#x3e;',
+ currentText: 'Сьогодні',
+ monthNames: ['Січень','Лютий','Березень','Квітень','Травень','Червень',
+ 'Липень','Серпень','Вересень','Жовтень','Листопад','Грудень'],
+ monthNamesShort: ['Січ','Лют','Бер','Кві','Тра','Чер',
+ 'Лип','Сер','Вер','Жов','Лис','Гру'],
+ dayNames: ['неділя','понеділок','вівторок','середа','четвер','п’ятниця','субота'],
+ dayNamesShort: ['нед','пнд','вів','срд','чтв','птн','сбт'],
+ dayNamesMin: ['Нд','Пн','Вт','Ср','Чт','Пт','Сб'],
+ weekHeader: 'Не',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['uk']);
+});/* Vietnamese initialisation for the jQuery UI date picker plugin. */
+/* Translated by Le Thanh Huy (lthanhhuy@cit.ctu.edu.vn). */
+jQuery(function($){
+ $.datepicker.regional['vi'] = {
+ closeText: 'Đóng',
+ prevText: '&#x3c;Trước',
+ nextText: 'Tiếp&#x3e;',
+ currentText: 'Hôm nay',
+ monthNames: ['Tháng Một', 'Tháng Hai', 'Tháng Ba', 'Tháng Tư', 'Tháng Năm', 'Tháng Sáu',
+ 'Tháng Bảy', 'Tháng Tám', 'Tháng Chín', 'Tháng Mười', 'Tháng Mười Một', 'Tháng Mười Hai'],
+ monthNamesShort: ['Tháng 1', 'Tháng 2', 'Tháng 3', 'Tháng 4', 'Tháng 5', 'Tháng 6',
+ 'Tháng 7', 'Tháng 8', 'Tháng 9', 'Tháng 10', 'Tháng 11', 'Tháng 12'],
+ dayNames: ['Chủ Nhật', 'Thứ Hai', 'Thứ Ba', 'Thứ Tư', 'Thứ Năm', 'Thứ Sáu', 'Thứ Bảy'],
+ dayNamesShort: ['CN', 'T2', 'T3', 'T4', 'T5', 'T6', 'T7'],
+ dayNamesMin: ['CN', 'T2', 'T3', 'T4', 'T5', 'T6', 'T7'],
+ weekHeader: 'Tu',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['vi']);
+});
+/* Chinese initialisation for the jQuery UI date picker plugin. */
+/* Written by Cloudream (cloudream@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['zh-CN'] = {
+ closeText: '关闭',
+ prevText: '&#x3c;上月',
+ nextText: '下月&#x3e;',
+ currentText: '今天',
+ monthNames: ['一月','二月','三月','四月','五月','六月',
+ '七月','八月','九月','十月','十一月','十二月'],
+ monthNamesShort: ['一','二','三','四','五','六',
+ '七','八','九','十','十一','十二'],
+ dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'],
+ dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'],
+ dayNamesMin: ['日','一','二','三','四','五','六'],
+ weekHeader: '周',
+ dateFormat: 'yy-mm-dd',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: true,
+ yearSuffix: '年'};
+ $.datepicker.setDefaults($.datepicker.regional['zh-CN']);
+});
+/* Chinese initialisation for the jQuery UI date picker plugin. */
+/* Written by SCCY (samuelcychan@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['zh-HK'] = {
+ closeText: '關閉',
+ prevText: '&#x3c;上月',
+ nextText: '下月&#x3e;',
+ currentText: '今天',
+ monthNames: ['一月','二月','三月','四月','五月','六月',
+ '七月','八月','九月','十月','十一月','十二月'],
+ monthNamesShort: ['一','二','三','四','五','六',
+ '七','八','九','十','十一','十二'],
+ dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'],
+ dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'],
+ dayNamesMin: ['日','一','二','三','四','五','六'],
+ weekHeader: '周',
+ dateFormat: 'dd-mm-yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: true,
+ yearSuffix: '年'};
+ $.datepicker.setDefaults($.datepicker.regional['zh-HK']);
+});
+/* Chinese initialisation for the jQuery UI date picker plugin. */
+/* Written by Ressol (ressol@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['zh-TW'] = {
+ closeText: '關閉',
+ prevText: '&#x3c;上月',
+ nextText: '下月&#x3e;',
+ currentText: '今天',
+ monthNames: ['一月','二月','三月','四月','五月','六月',
+ '七月','八月','九月','十月','十一月','十二月'],
+ monthNamesShort: ['一','二','三','四','五','六',
+ '七','八','九','十','十一','十二'],
+ dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'],
+ dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'],
+ dayNamesMin: ['日','一','二','三','四','五','六'],
+ weekHeader: '周',
+ dateFormat: 'yy/mm/dd',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: true,
+ yearSuffix: '年'};
+ $.datepicker.setDefaults($.datepicker.regional['zh-TW']);
+});
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-af.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-af.js
new file mode 100644
index 000000000..43fbf6cd8
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-af.js
@@ -0,0 +1,23 @@
+/* Afrikaans initialisation for the jQuery UI date picker plugin. */
+/* Written by Renier Pretorius. */
+jQuery(function($){
+ $.datepicker.regional['af'] = {
+ closeText: 'Selekteer',
+ prevText: 'Vorige',
+ nextText: 'Volgende',
+ currentText: 'Vandag',
+ monthNames: ['Januarie','Februarie','Maart','April','Mei','Junie',
+ 'Julie','Augustus','September','Oktober','November','Desember'],
+ monthNamesShort: ['Jan', 'Feb', 'Mrt', 'Apr', 'Mei', 'Jun',
+ 'Jul', 'Aug', 'Sep', 'Okt', 'Nov', 'Des'],
+ dayNames: ['Sondag', 'Maandag', 'Dinsdag', 'Woensdag', 'Donderdag', 'Vrydag', 'Saterdag'],
+ dayNamesShort: ['Son', 'Maa', 'Din', 'Woe', 'Don', 'Vry', 'Sat'],
+ dayNamesMin: ['So','Ma','Di','Wo','Do','Vr','Sa'],
+ weekHeader: 'Wk',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['af']);
+});
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ar.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ar.js
new file mode 100644
index 000000000..c799b48d8
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ar.js
@@ -0,0 +1,24 @@
+/* Arabic Translation for jQuery UI date picker plugin. */
+/* Khaled Al Horani -- koko.dw@gmail.com */
+/* خالد الحوراني -- koko.dw@gmail.com */
+/* NOTE: monthNames are the original months names and they are the Arabic names, not the new months name فبراير - يناير and there isn't any Arabic roots for these months */
+jQuery(function($){
+ $.datepicker.regional['ar'] = {
+ closeText: 'إغلاق',
+ prevText: '&#x3c;السابق',
+ nextText: 'التالي&#x3e;',
+ currentText: 'اليوم',
+ monthNames: ['كانون الثاني', 'شباط', 'آذار', 'نيسان', 'آذار', 'حزيران',
+ 'تموز', 'آب', 'أيلول', 'تشرين الأول', 'تشرين الثاني', 'كانون الأول'],
+ monthNamesShort: ['1','2','3','4','5','6','7','8','9','10','11','12'],
+ dayNames: ['السبت', 'الأحد', 'الاثنين', 'الثلاثاء', 'الأربعاء', 'الخميس', 'الجمعة'],
+ dayNamesShort: ['سبت', 'أحد', 'اثنين', 'ثلاثاء', 'أربعاء', 'خميس', 'جمعة'],
+ dayNamesMin: ['سبت', 'أحد', 'اثنين', 'ثلاثاء', 'أربعاء', 'خميس', 'جمعة'],
+ weekHeader: 'أسبوع',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: true,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['ar']);
+}); \ No newline at end of file
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-az.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-az.js
new file mode 100644
index 000000000..b5434057b
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-az.js
@@ -0,0 +1,23 @@
+/* Azerbaijani (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by Jamil Najafov (necefov33@gmail.com). */
+jQuery(function($) {
+ $.datepicker.regional['az'] = {
+ closeText: 'Bağla',
+ prevText: '&#x3c;Geri',
+ nextText: 'İrəli&#x3e;',
+ currentText: 'Bugün',
+ monthNames: ['Yanvar','Fevral','Mart','Aprel','May','İyun',
+ 'İyul','Avqust','Sentyabr','Oktyabr','Noyabr','Dekabr'],
+ monthNamesShort: ['Yan','Fev','Mar','Apr','May','İyun',
+ 'İyul','Avq','Sen','Okt','Noy','Dek'],
+ dayNames: ['Bazar','Bazar ertəsi','Çərşənbə axşamı','Çərşənbə','Cümə axşamı','Cümə','Şənbə'],
+ dayNamesShort: ['B','Be','Ça','Ç','Ca','C','Ş'],
+ dayNamesMin: ['B','B','Ç','С','Ç','C','Ş'],
+ weekHeader: 'Hf',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['az']);
+}); \ No newline at end of file
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-bg.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-bg.js
new file mode 100644
index 000000000..b5113f781
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-bg.js
@@ -0,0 +1,24 @@
+/* Bulgarian initialisation for the jQuery UI date picker plugin. */
+/* Written by Stoyan Kyosev (http://svest.org). */
+jQuery(function($){
+ $.datepicker.regional['bg'] = {
+ closeText: 'затвори',
+ prevText: '&#x3c;назад',
+ nextText: 'напред&#x3e;',
+ nextBigText: '&#x3e;&#x3e;',
+ currentText: 'днес',
+ monthNames: ['Януари','Февруари','Март','Април','Май','Юни',
+ 'Юли','Август','Септември','Октомври','Ноември','Декември'],
+ monthNamesShort: ['Яну','Фев','Мар','Апр','Май','Юни',
+ 'Юли','Авг','Сеп','Окт','Нов','Дек'],
+ dayNames: ['Неделя','Понеделник','Вторник','Сряда','Четвъртък','Петък','Събота'],
+ dayNamesShort: ['Нед','Пон','Вто','Сря','Чет','Пет','Съб'],
+ dayNamesMin: ['Не','По','Вт','Ср','Че','Пе','Съ'],
+ weekHeader: 'Wk',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['bg']);
+});
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-bs.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-bs.js
new file mode 100644
index 000000000..30ab826b0
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-bs.js
@@ -0,0 +1,23 @@
+/* Bosnian i18n for the jQuery UI date picker plugin. */
+/* Written by Kenan Konjo. */
+jQuery(function($){
+ $.datepicker.regional['bs'] = {
+ closeText: 'Zatvori',
+ prevText: '&#x3c;',
+ nextText: '&#x3e;',
+ currentText: 'Danas',
+ monthNames: ['Januar','Februar','Mart','April','Maj','Juni',
+ 'Juli','August','Septembar','Oktobar','Novembar','Decembar'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
+ 'Jul','Aug','Sep','Okt','Nov','Dec'],
+ dayNames: ['Nedelja','Ponedeljak','Utorak','Srijeda','Četvrtak','Petak','Subota'],
+ dayNamesShort: ['Ned','Pon','Uto','Sri','Čet','Pet','Sub'],
+ dayNamesMin: ['Ne','Po','Ut','Sr','Če','Pe','Su'],
+ weekHeader: 'Wk',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['bs']);
+}); \ No newline at end of file
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ca.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ca.js
new file mode 100644
index 000000000..b128e699e
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ca.js
@@ -0,0 +1,23 @@
+/* Inicialització en català per a l'extenció 'calendar' per jQuery. */
+/* Writers: (joan.leon@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['ca'] = {
+ closeText: 'Tancar',
+ prevText: '&#x3c;Ant',
+ nextText: 'Seg&#x3e;',
+ currentText: 'Avui',
+ monthNames: ['Gener','Febrer','Mar&ccedil;','Abril','Maig','Juny',
+ 'Juliol','Agost','Setembre','Octubre','Novembre','Desembre'],
+ monthNamesShort: ['Gen','Feb','Mar','Abr','Mai','Jun',
+ 'Jul','Ago','Set','Oct','Nov','Des'],
+ dayNames: ['Diumenge','Dilluns','Dimarts','Dimecres','Dijous','Divendres','Dissabte'],
+ dayNamesShort: ['Dug','Dln','Dmt','Dmc','Djs','Dvn','Dsb'],
+ dayNamesMin: ['Dg','Dl','Dt','Dc','Dj','Dv','Ds'],
+ weekHeader: 'Sm',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['ca']);
+}); \ No newline at end of file
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-cs.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-cs.js
new file mode 100644
index 000000000..c3c07ea67
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-cs.js
@@ -0,0 +1,23 @@
+/* Czech initialisation for the jQuery UI date picker plugin. */
+/* Written by Tomas Muller (tomas@tomas-muller.net). */
+jQuery(function($){
+ $.datepicker.regional['cs'] = {
+ closeText: 'Zavřít',
+ prevText: '&#x3c;Dříve',
+ nextText: 'Později&#x3e;',
+ currentText: 'Nyní',
+ monthNames: ['leden','únor','březen','duben','květen','červen',
+ 'červenec','srpen','září','říjen','listopad','prosinec'],
+ monthNamesShort: ['led','úno','bře','dub','kvě','čer',
+ 'čvc','srp','zář','říj','lis','pro'],
+ dayNames: ['neděle', 'pondělí', 'úterý', 'středa', 'čtvrtek', 'pátek', 'sobota'],
+ dayNamesShort: ['ne', 'po', 'út', 'st', 'čt', 'pá', 'so'],
+ dayNamesMin: ['ne','po','út','st','čt','pá','so'],
+ weekHeader: 'Týd',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['cs']);
+});
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-da.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-da.js
new file mode 100644
index 000000000..4a99a5833
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-da.js
@@ -0,0 +1,23 @@
+/* Danish initialisation for the jQuery UI date picker plugin. */
+/* Written by Jan Christensen ( deletestuff@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['da'] = {
+ closeText: 'Luk',
+ prevText: '&#x3c;Forrige',
+ nextText: 'Næste&#x3e;',
+ currentText: 'Idag',
+ monthNames: ['Januar','Februar','Marts','April','Maj','Juni',
+ 'Juli','August','September','Oktober','November','December'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
+ 'Jul','Aug','Sep','Okt','Nov','Dec'],
+ dayNames: ['Søndag','Mandag','Tirsdag','Onsdag','Torsdag','Fredag','Lørdag'],
+ dayNamesShort: ['Søn','Man','Tir','Ons','Tor','Fre','Lør'],
+ dayNamesMin: ['Sø','Ma','Ti','On','To','Fr','Lø'],
+ weekHeader: 'Uge',
+ dateFormat: 'dd-mm-yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['da']);
+});
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-de-CH.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-de-CH.js
new file mode 100644
index 000000000..f31e418a4
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-de-CH.js
@@ -0,0 +1,23 @@
+/* Swiss-German initialisation for the jQuery UI date picker plugin. */
+/* By Douglas Jose & Juerg Meier. */
+jQuery(function($){
+ $.datepicker.regional['de-CH'] = {
+ closeText: 'schliessen',
+ prevText: '&#x3c;zurück',
+ nextText: 'nächster&#x3e;',
+ currentText: 'heute',
+ monthNames: ['Januar','Februar','März','April','Mai','Juni',
+ 'Juli','August','September','Oktober','November','Dezember'],
+ monthNamesShort: ['Jan','Feb','Mär','Apr','Mai','Jun',
+ 'Jul','Aug','Sep','Okt','Nov','Dez'],
+ dayNames: ['Sonntag','Montag','Dienstag','Mittwoch','Donnerstag','Freitag','Samstag'],
+ dayNamesShort: ['So','Mo','Di','Mi','Do','Fr','Sa'],
+ dayNamesMin: ['So','Mo','Di','Mi','Do','Fr','Sa'],
+ weekHeader: 'Wo',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['de-CH']);
+}); \ No newline at end of file
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-de.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-de.js
new file mode 100644
index 000000000..ac2d516aa
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-de.js
@@ -0,0 +1,23 @@
+/* German initialisation for the jQuery UI date picker plugin. */
+/* Written by Milian Wolff (mail@milianw.de). */
+jQuery(function($){
+ $.datepicker.regional['de'] = {
+ closeText: 'schließen',
+ prevText: '&#x3c;zurück',
+ nextText: 'Vor&#x3e;',
+ currentText: 'heute',
+ monthNames: ['Januar','Februar','März','April','Mai','Juni',
+ 'Juli','August','September','Oktober','November','Dezember'],
+ monthNamesShort: ['Jan','Feb','Mär','Apr','Mai','Jun',
+ 'Jul','Aug','Sep','Okt','Nov','Dez'],
+ dayNames: ['Sonntag','Montag','Dienstag','Mittwoch','Donnerstag','Freitag','Samstag'],
+ dayNamesShort: ['So','Mo','Di','Mi','Do','Fr','Sa'],
+ dayNamesMin: ['So','Mo','Di','Mi','Do','Fr','Sa'],
+ weekHeader: 'Wo',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['de']);
+});
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-el.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-el.js
new file mode 100644
index 000000000..9542769d9
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-el.js
@@ -0,0 +1,23 @@
+/* Greek (el) initialisation for the jQuery UI date picker plugin. */
+/* Written by Alex Cicovic (http://www.alexcicovic.com) */
+jQuery(function($){
+ $.datepicker.regional['el'] = {
+ closeText: 'Κλείσιμο',
+ prevText: 'Προηγούμενος',
+ nextText: 'Επόμενος',
+ currentText: 'Τρέχων Μήνας',
+ monthNames: ['Ιανουάριος','Φεβρουάριος','Μάρτιος','Απρίλιος','Μάιος','Ιούνιος',
+ 'Ιούλιος','Αύγουστος','Σεπτέμβριος','Οκτώβριος','Νοέμβριος','Δεκέμβριος'],
+ monthNamesShort: ['Ιαν','Φεβ','Μαρ','Απρ','Μαι','Ιουν',
+ 'Ιουλ','Αυγ','Σεπ','Οκτ','Νοε','Δεκ'],
+ dayNames: ['Κυριακή','Δευτέρα','Τρίτη','Τετάρτη','Πέμπτη','Παρασκευή','Σάββατο'],
+ dayNamesShort: ['Κυρ','Δευ','Τρι','Τετ','Πεμ','Παρ','Σαβ'],
+ dayNamesMin: ['Κυ','Δε','Τρ','Τε','Πε','Πα','Σα'],
+ weekHeader: 'Εβδ',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['el']);
+}); \ No newline at end of file
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-en-GB.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-en-GB.js
new file mode 100644
index 000000000..aac7b6195
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-en-GB.js
@@ -0,0 +1,23 @@
+/* English/UK initialisation for the jQuery UI date picker plugin. */
+/* Written by Stuart. */
+jQuery(function($){
+ $.datepicker.regional['en-GB'] = {
+ closeText: 'Done',
+ prevText: 'Prev',
+ nextText: 'Next',
+ currentText: 'Today',
+ monthNames: ['January','February','March','April','May','June',
+ 'July','August','September','October','November','December'],
+ monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun',
+ 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'],
+ dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'],
+ dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'],
+ dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'],
+ weekHeader: 'Wk',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['en-GB']);
+});
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-eo.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-eo.js
new file mode 100644
index 000000000..ba5715687
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-eo.js
@@ -0,0 +1,23 @@
+/* Esperanto initialisation for the jQuery UI date picker plugin. */
+/* Written by Olivier M. (olivierweb@ifrance.com). */
+jQuery(function($){
+ $.datepicker.regional['eo'] = {
+ closeText: 'Fermi',
+ prevText: '&lt;Anta',
+ nextText: 'Sekv&gt;',
+ currentText: 'Nuna',
+ monthNames: ['Januaro','Februaro','Marto','Aprilo','Majo','Junio',
+ 'Julio','Aŭgusto','Septembro','Oktobro','Novembro','Decembro'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
+ 'Jul','Aŭg','Sep','Okt','Nov','Dec'],
+ dayNames: ['Dimanĉo','Lundo','Mardo','Merkredo','Ĵaŭdo','Vendredo','Sabato'],
+ dayNamesShort: ['Dim','Lun','Mar','Mer','Ĵaŭ','Ven','Sab'],
+ dayNamesMin: ['Di','Lu','Ma','Me','Ĵa','Ve','Sa'],
+ weekHeader: 'Sb',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['eo']);
+});
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-es.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-es.js
new file mode 100644
index 000000000..a02133de3
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-es.js
@@ -0,0 +1,23 @@
+/* Inicialización en español para la extensión 'UI date picker' para jQuery. */
+/* Traducido por Vester (xvester@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['es'] = {
+ closeText: 'Cerrar',
+ prevText: '&#x3c;Ant',
+ nextText: 'Sig&#x3e;',
+ currentText: 'Hoy',
+ monthNames: ['Enero','Febrero','Marzo','Abril','Mayo','Junio',
+ 'Julio','Agosto','Septiembre','Octubre','Noviembre','Diciembre'],
+ monthNamesShort: ['Ene','Feb','Mar','Abr','May','Jun',
+ 'Jul','Ago','Sep','Oct','Nov','Dic'],
+ dayNames: ['Domingo','Lunes','Martes','Mi&eacute;rcoles','Jueves','Viernes','S&aacute;bado'],
+ dayNamesShort: ['Dom','Lun','Mar','Mi&eacute;','Juv','Vie','S&aacute;b'],
+ dayNamesMin: ['Do','Lu','Ma','Mi','Ju','Vi','S&aacute;'],
+ weekHeader: 'Sm',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['es']);
+}); \ No newline at end of file
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-et.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-et.js
new file mode 100644
index 000000000..f97311f31
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-et.js
@@ -0,0 +1,23 @@
+/* Estonian initialisation for the jQuery UI date picker plugin. */
+/* Written by Mart Sõmermaa (mrts.pydev at gmail com). */
+jQuery(function($){
+ $.datepicker.regional['et'] = {
+ closeText: 'Sulge',
+ prevText: 'Eelnev',
+ nextText: 'Järgnev',
+ currentText: 'Täna',
+ monthNames: ['Jaanuar','Veebruar','Märts','Aprill','Mai','Juuni',
+ 'Juuli','August','September','Oktoober','November','Detsember'],
+ monthNamesShort: ['Jaan', 'Veebr', 'Märts', 'Apr', 'Mai', 'Juuni',
+ 'Juuli', 'Aug', 'Sept', 'Okt', 'Nov', 'Dets'],
+ dayNames: ['Pühapäev', 'Esmaspäev', 'Teisipäev', 'Kolmapäev', 'Neljapäev', 'Reede', 'Laupäev'],
+ dayNamesShort: ['Pühap', 'Esmasp', 'Teisip', 'Kolmap', 'Neljap', 'Reede', 'Laup'],
+ dayNamesMin: ['P','E','T','K','N','R','L'],
+ weekHeader: 'Sm',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['et']);
+}); \ No newline at end of file
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-eu.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-eu.js
new file mode 100644
index 000000000..9ba6ee22e
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-eu.js
@@ -0,0 +1,23 @@
+/* Euskarako oinarria 'UI date picker' jquery-ko extentsioarentzat */
+/* Karrikas-ek itzulia (karrikas@karrikas.com) */
+jQuery(function($){
+ $.datepicker.regional['eu'] = {
+ closeText: 'Egina',
+ prevText: '&#x3c;Aur',
+ nextText: 'Hur&#x3e;',
+ currentText: 'Gaur',
+ monthNames: ['Urtarrila','Otsaila','Martxoa','Apirila','Maiatza','Ekaina',
+ 'Uztaila','Abuztua','Iraila','Urria','Azaroa','Abendua'],
+ monthNamesShort: ['Urt','Ots','Mar','Api','Mai','Eka',
+ 'Uzt','Abu','Ira','Urr','Aza','Abe'],
+ dayNames: ['Igandea','Astelehena','Asteartea','Asteazkena','Osteguna','Ostirala','Larunbata'],
+ dayNamesShort: ['Iga','Ast','Ast','Ast','Ost','Ost','Lar'],
+ dayNamesMin: ['Ig','As','As','As','Os','Os','La'],
+ weekHeader: 'Wk',
+ dateFormat: 'yy/mm/dd',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['eu']);
+}); \ No newline at end of file
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-fa.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-fa.js
new file mode 100644
index 000000000..adb3709fe
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-fa.js
@@ -0,0 +1,23 @@
+/* Persian (Farsi) Translation for the jQuery UI date picker plugin. */
+/* Javad Mowlanezhad -- jmowla@gmail.com */
+/* Jalali calendar should supported soon! (Its implemented but I have to test it) */
+jQuery(function($) {
+ $.datepicker.regional['fa'] = {
+ closeText: 'بستن',
+ prevText: '&#x3c;قبلي',
+ nextText: 'بعدي&#x3e;',
+ currentText: 'امروز',
+ monthNames: ['فروردين','ارديبهشت','خرداد','تير','مرداد','شهريور',
+ 'مهر','آبان','آذر','دي','بهمن','اسفند'],
+ monthNamesShort: ['1','2','3','4','5','6','7','8','9','10','11','12'],
+ dayNames: ['يکشنبه','دوشنبه','سه‌شنبه','چهارشنبه','پنجشنبه','جمعه','شنبه'],
+ dayNamesShort: ['ي','د','س','چ','پ','ج', 'ش'],
+ dayNamesMin: ['ي','د','س','چ','پ','ج', 'ش'],
+ weekHeader: 'هف',
+ dateFormat: 'yy/mm/dd',
+ firstDay: 6,
+ isRTL: true,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['fa']);
+}); \ No newline at end of file
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-fi.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-fi.js
new file mode 100644
index 000000000..e1f25fd84
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-fi.js
@@ -0,0 +1,23 @@
+/* Finnish initialisation for the jQuery UI date picker plugin. */
+/* Written by Harri Kilpi� (harrikilpio@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['fi'] = {
+ closeText: 'Sulje',
+ prevText: '&laquo;Edellinen',
+ nextText: 'Seuraava&raquo;',
+ currentText: 'T&auml;n&auml;&auml;n',
+ monthNames: ['Tammikuu','Helmikuu','Maaliskuu','Huhtikuu','Toukokuu','Kes&auml;kuu',
+ 'Hein&auml;kuu','Elokuu','Syyskuu','Lokakuu','Marraskuu','Joulukuu'],
+ monthNamesShort: ['Tammi','Helmi','Maalis','Huhti','Touko','Kes&auml;',
+ 'Hein&auml;','Elo','Syys','Loka','Marras','Joulu'],
+ dayNamesShort: ['Su','Ma','Ti','Ke','To','Pe','Su'],
+ dayNames: ['Sunnuntai','Maanantai','Tiistai','Keskiviikko','Torstai','Perjantai','Lauantai'],
+ dayNamesMin: ['Su','Ma','Ti','Ke','To','Pe','La'],
+ weekHeader: 'Vk',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['fi']);
+});
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-fo.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-fo.js
new file mode 100644
index 000000000..c14362216
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-fo.js
@@ -0,0 +1,23 @@
+/* Faroese initialisation for the jQuery UI date picker plugin */
+/* Written by Sverri Mohr Olsen, sverrimo@gmail.com */
+jQuery(function($){
+ $.datepicker.regional['fo'] = {
+ closeText: 'Lat aftur',
+ prevText: '&#x3c;Fyrra',
+ nextText: 'Næsta&#x3e;',
+ currentText: 'Í dag',
+ monthNames: ['Januar','Februar','Mars','Apríl','Mei','Juni',
+ 'Juli','August','September','Oktober','November','Desember'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Mei','Jun',
+ 'Jul','Aug','Sep','Okt','Nov','Des'],
+ dayNames: ['Sunnudagur','Mánadagur','Týsdagur','Mikudagur','Hósdagur','Fríggjadagur','Leyardagur'],
+ dayNamesShort: ['Sun','Mán','Týs','Mik','Hós','Frí','Ley'],
+ dayNamesMin: ['Su','Má','Tý','Mi','Hó','Fr','Le'],
+ weekHeader: 'Vk',
+ dateFormat: 'dd-mm-yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['fo']);
+});
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-fr-CH.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-fr-CH.js
new file mode 100644
index 000000000..38212d548
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-fr-CH.js
@@ -0,0 +1,23 @@
+/* Swiss-French initialisation for the jQuery UI date picker plugin. */
+/* Written Martin Voelkle (martin.voelkle@e-tc.ch). */
+jQuery(function($){
+ $.datepicker.regional['fr-CH'] = {
+ closeText: 'Fermer',
+ prevText: '&#x3c;Préc',
+ nextText: 'Suiv&#x3e;',
+ currentText: 'Courant',
+ monthNames: ['Janvier','Février','Mars','Avril','Mai','Juin',
+ 'Juillet','Août','Septembre','Octobre','Novembre','Décembre'],
+ monthNamesShort: ['Jan','Fév','Mar','Avr','Mai','Jun',
+ 'Jul','Aoû','Sep','Oct','Nov','Déc'],
+ dayNames: ['Dimanche','Lundi','Mardi','Mercredi','Jeudi','Vendredi','Samedi'],
+ dayNamesShort: ['Dim','Lun','Mar','Mer','Jeu','Ven','Sam'],
+ dayNamesMin: ['Di','Lu','Ma','Me','Je','Ve','Sa'],
+ weekHeader: 'Sm',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['fr-CH']);
+}); \ No newline at end of file
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-fr.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-fr.js
new file mode 100644
index 000000000..134bda65d
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-fr.js
@@ -0,0 +1,23 @@
+/* French initialisation for the jQuery UI date picker plugin. */
+/* Written by Keith Wood (kbwood{at}iinet.com.au) and Stéphane Nahmani (sholby@sholby.net). */
+jQuery(function($){
+ $.datepicker.regional['fr'] = {
+ closeText: 'Fermer',
+ prevText: '&#x3c;Préc',
+ nextText: 'Suiv&#x3e;',
+ currentText: 'Courant',
+ monthNames: ['Janvier','Février','Mars','Avril','Mai','Juin',
+ 'Juillet','Août','Septembre','Octobre','Novembre','Décembre'],
+ monthNamesShort: ['Jan','Fév','Mar','Avr','Mai','Jun',
+ 'Jul','Aoû','Sep','Oct','Nov','Déc'],
+ dayNames: ['Dimanche','Lundi','Mardi','Mercredi','Jeudi','Vendredi','Samedi'],
+ dayNamesShort: ['Dim','Lun','Mar','Mer','Jeu','Ven','Sam'],
+ dayNamesMin: ['Di','Lu','Ma','Me','Je','Ve','Sa'],
+ weekHeader: 'Sm',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['fr']);
+}); \ No newline at end of file
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-gl.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-gl.js
new file mode 100644
index 000000000..278403e8f
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-gl.js
@@ -0,0 +1,23 @@
+/* Galician localization for 'UI date picker' jQuery extension. */
+/* Translated by Jorge Barreiro <yortx.barry@gmail.com>. */
+jQuery(function($){
+ $.datepicker.regional['gl'] = {
+ closeText: 'Pechar',
+ prevText: '&#x3c;Ant',
+ nextText: 'Seg&#x3e;',
+ currentText: 'Hoxe',
+ monthNames: ['Xaneiro','Febreiro','Marzo','Abril','Maio','Xuño',
+ 'Xullo','Agosto','Setembro','Outubro','Novembro','Decembro'],
+ monthNamesShort: ['Xan','Feb','Mar','Abr','Mai','Xuñ',
+ 'Xul','Ago','Set','Out','Nov','Dec'],
+ dayNames: ['Domingo','Luns','Martes','M&eacute;rcores','Xoves','Venres','S&aacute;bado'],
+ dayNamesShort: ['Dom','Lun','Mar','M&eacute;r','Xov','Ven','S&aacute;b'],
+ dayNamesMin: ['Do','Lu','Ma','M&eacute;','Xo','Ve','S&aacute;'],
+ weekHeader: 'Sm',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['gl']);
+}); \ No newline at end of file
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-he.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-he.js
new file mode 100644
index 000000000..3b3dc387f
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-he.js
@@ -0,0 +1,23 @@
+/* Hebrew initialisation for the UI Datepicker extension. */
+/* Written by Amir Hardon (ahardon at gmail dot com). */
+jQuery(function($){
+ $.datepicker.regional['he'] = {
+ closeText: 'סגור',
+ prevText: '&#x3c;הקודם',
+ nextText: 'הבא&#x3e;',
+ currentText: 'היום',
+ monthNames: ['ינואר','פברואר','מרץ','אפריל','מאי','יוני',
+ 'יולי','אוגוסט','ספטמבר','אוקטובר','נובמבר','דצמבר'],
+ monthNamesShort: ['1','2','3','4','5','6',
+ '7','8','9','10','11','12'],
+ dayNames: ['ראשון','שני','שלישי','רביעי','חמישי','שישי','שבת'],
+ dayNamesShort: ['א\'','ב\'','ג\'','ד\'','ה\'','ו\'','שבת'],
+ dayNamesMin: ['א\'','ב\'','ג\'','ד\'','ה\'','ו\'','שבת'],
+ weekHeader: 'Wk',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: true,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['he']);
+});
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-hr.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-hr.js
new file mode 100644
index 000000000..0285c1aa9
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-hr.js
@@ -0,0 +1,23 @@
+/* Croatian i18n for the jQuery UI date picker plugin. */
+/* Written by Vjekoslav Nesek. */
+jQuery(function($){
+ $.datepicker.regional['hr'] = {
+ closeText: 'Zatvori',
+ prevText: '&#x3c;',
+ nextText: '&#x3e;',
+ currentText: 'Danas',
+ monthNames: ['Siječanj','Veljača','Ožujak','Travanj','Svibanj','Lipanj',
+ 'Srpanj','Kolovoz','Rujan','Listopad','Studeni','Prosinac'],
+ monthNamesShort: ['Sij','Velj','Ožu','Tra','Svi','Lip',
+ 'Srp','Kol','Ruj','Lis','Stu','Pro'],
+ dayNames: ['Nedjelja','Ponedjeljak','Utorak','Srijeda','Četvrtak','Petak','Subota'],
+ dayNamesShort: ['Ned','Pon','Uto','Sri','Čet','Pet','Sub'],
+ dayNamesMin: ['Ne','Po','Ut','Sr','Če','Pe','Su'],
+ weekHeader: 'Tje',
+ dateFormat: 'dd.mm.yy.',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['hr']);
+}); \ No newline at end of file
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-hu.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-hu.js
new file mode 100644
index 000000000..249e7b0ef
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-hu.js
@@ -0,0 +1,23 @@
+/* Hungarian initialisation for the jQuery UI date picker plugin. */
+/* Written by Istvan Karaszi (jquery@spam.raszi.hu). */
+jQuery(function($){
+ $.datepicker.regional['hu'] = {
+ closeText: 'bezárás',
+ prevText: '&laquo;&nbsp;vissza',
+ nextText: 'előre&nbsp;&raquo;',
+ currentText: 'ma',
+ monthNames: ['Január', 'Február', 'Március', 'Április', 'Május', 'Június',
+ 'Július', 'Augusztus', 'Szeptember', 'Október', 'November', 'December'],
+ monthNamesShort: ['Jan', 'Feb', 'Már', 'Ápr', 'Máj', 'Jún',
+ 'Júl', 'Aug', 'Szep', 'Okt', 'Nov', 'Dec'],
+ dayNames: ['Vasárnap', 'Hétfö', 'Kedd', 'Szerda', 'Csütörtök', 'Péntek', 'Szombat'],
+ dayNamesShort: ['Vas', 'Hét', 'Ked', 'Sze', 'Csü', 'Pén', 'Szo'],
+ dayNamesMin: ['V', 'H', 'K', 'Sze', 'Cs', 'P', 'Szo'],
+ weekHeader: 'Hé',
+ dateFormat: 'yy-mm-dd',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['hu']);
+});
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-hy.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-hy.js
new file mode 100644
index 000000000..c6cc1946c
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-hy.js
@@ -0,0 +1,23 @@
+/* Armenian(UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by Levon Zakaryan (levon.zakaryan@gmail.com)*/
+jQuery(function($){
+ $.datepicker.regional['hy'] = {
+ closeText: 'Փակել',
+ prevText: '&#x3c;Նախ.',
+ nextText: 'Հաջ.&#x3e;',
+ currentText: 'Այսօր',
+ monthNames: ['Հունվար','Փետրվար','Մարտ','Ապրիլ','Մայիս','Հունիս',
+ 'Հուլիս','Օգոստոս','Սեպտեմբեր','Հոկտեմբեր','Նոյեմբեր','Դեկտեմբեր'],
+ monthNamesShort: ['Հունվ','Փետր','Մարտ','Ապր','Մայիս','Հունիս',
+ 'Հուլ','Օգս','Սեպ','Հոկ','Նոյ','Դեկ'],
+ dayNames: ['կիրակի','եկուշաբթի','երեքշաբթի','չորեքշաբթի','հինգշաբթի','ուրբաթ','շաբաթ'],
+ dayNamesShort: ['կիր','երկ','երք','չրք','հնգ','ուրբ','շբթ'],
+ dayNamesMin: ['կիր','երկ','երք','չրք','հնգ','ուրբ','շբթ'],
+ weekHeader: 'ՇԲՏ',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['hy']);
+}); \ No newline at end of file
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-id.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-id.js
new file mode 100644
index 000000000..c626fbb7b
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-id.js
@@ -0,0 +1,23 @@
+/* Indonesian initialisation for the jQuery UI date picker plugin. */
+/* Written by Deden Fathurahman (dedenf@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['id'] = {
+ closeText: 'Tutup',
+ prevText: '&#x3c;mundur',
+ nextText: 'maju&#x3e;',
+ currentText: 'hari ini',
+ monthNames: ['Januari','Februari','Maret','April','Mei','Juni',
+ 'Juli','Agustus','September','Oktober','Nopember','Desember'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Mei','Jun',
+ 'Jul','Agus','Sep','Okt','Nop','Des'],
+ dayNames: ['Minggu','Senin','Selasa','Rabu','Kamis','Jumat','Sabtu'],
+ dayNamesShort: ['Min','Sen','Sel','Rab','kam','Jum','Sab'],
+ dayNamesMin: ['Mg','Sn','Sl','Rb','Km','jm','Sb'],
+ weekHeader: 'Mg',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['id']);
+}); \ No newline at end of file
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-is.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-is.js
new file mode 100644
index 000000000..c53235a49
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-is.js
@@ -0,0 +1,23 @@
+/* Icelandic initialisation for the jQuery UI date picker plugin. */
+/* Written by Haukur H. Thorsson (haukur@eskill.is). */
+jQuery(function($){
+ $.datepicker.regional['is'] = {
+ closeText: 'Loka',
+ prevText: '&#x3c; Fyrri',
+ nextText: 'N&aelig;sti &#x3e;',
+ currentText: '&Iacute; dag',
+ monthNames: ['Jan&uacute;ar','Febr&uacute;ar','Mars','Apr&iacute;l','Ma&iacute','J&uacute;n&iacute;',
+ 'J&uacute;l&iacute;','&Aacute;g&uacute;st','September','Okt&oacute;ber','N&oacute;vember','Desember'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Ma&iacute;','J&uacute;n',
+ 'J&uacute;l','&Aacute;g&uacute;','Sep','Okt','N&oacute;v','Des'],
+ dayNames: ['Sunnudagur','M&aacute;nudagur','&THORN;ri&eth;judagur','Mi&eth;vikudagur','Fimmtudagur','F&ouml;studagur','Laugardagur'],
+ dayNamesShort: ['Sun','M&aacute;n','&THORN;ri','Mi&eth;','Fim','F&ouml;s','Lau'],
+ dayNamesMin: ['Su','M&aacute;','&THORN;r','Mi','Fi','F&ouml;','La'],
+ weekHeader: 'Vika',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['is']);
+}); \ No newline at end of file
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-it.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-it.js
new file mode 100644
index 000000000..59da2df67
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-it.js
@@ -0,0 +1,23 @@
+/* Italian initialisation for the jQuery UI date picker plugin. */
+/* Written by Antonello Pasella (antonello.pasella@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['it'] = {
+ closeText: 'Chiudi',
+ prevText: '&#x3c;Prec',
+ nextText: 'Succ&#x3e;',
+ currentText: 'Oggi',
+ monthNames: ['Gennaio','Febbraio','Marzo','Aprile','Maggio','Giugno',
+ 'Luglio','Agosto','Settembre','Ottobre','Novembre','Dicembre'],
+ monthNamesShort: ['Gen','Feb','Mar','Apr','Mag','Giu',
+ 'Lug','Ago','Set','Ott','Nov','Dic'],
+ dayNames: ['Domenica','Luned&#236','Marted&#236','Mercoled&#236','Gioved&#236','Venerd&#236','Sabato'],
+ dayNamesShort: ['Dom','Lun','Mar','Mer','Gio','Ven','Sab'],
+ dayNamesMin: ['Do','Lu','Ma','Me','Gi','Ve','Sa'],
+ weekHeader: 'Sm',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['it']);
+});
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ja.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ja.js
new file mode 100644
index 000000000..79cd827c7
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ja.js
@@ -0,0 +1,23 @@
+/* Japanese initialisation for the jQuery UI date picker plugin. */
+/* Written by Kentaro SATO (kentaro@ranvis.com). */
+jQuery(function($){
+ $.datepicker.regional['ja'] = {
+ closeText: '閉じる',
+ prevText: '&#x3c;前',
+ nextText: '次&#x3e;',
+ currentText: '今日',
+ monthNames: ['1月','2月','3月','4月','5月','6月',
+ '7月','8月','9月','10月','11月','12月'],
+ monthNamesShort: ['1月','2月','3月','4月','5月','6月',
+ '7月','8月','9月','10月','11月','12月'],
+ dayNames: ['日曜日','月曜日','火曜日','水曜日','木曜日','金曜日','土曜日'],
+ dayNamesShort: ['日','月','火','水','木','金','土'],
+ dayNamesMin: ['日','月','火','水','木','金','土'],
+ weekHeader: '週',
+ dateFormat: 'yy/mm/dd',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: true,
+ yearSuffix: '年'};
+ $.datepicker.setDefaults($.datepicker.regional['ja']);
+}); \ No newline at end of file
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ko.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ko.js
new file mode 100644
index 000000000..5b3531652
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ko.js
@@ -0,0 +1,23 @@
+/* Korean initialisation for the jQuery calendar extension. */
+/* Written by DaeKwon Kang (ncrash.dk@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['ko'] = {
+ closeText: '닫기',
+ prevText: '이전달',
+ nextText: '다음달',
+ currentText: '오늘',
+ monthNames: ['1월(JAN)','2월(FEB)','3월(MAR)','4월(APR)','5월(MAY)','6월(JUN)',
+ '7월(JUL)','8월(AUG)','9월(SEP)','10월(OCT)','11월(NOV)','12월(DEC)'],
+ monthNamesShort: ['1월(JAN)','2월(FEB)','3월(MAR)','4월(APR)','5월(MAY)','6월(JUN)',
+ '7월(JUL)','8월(AUG)','9월(SEP)','10월(OCT)','11월(NOV)','12월(DEC)'],
+ dayNames: ['일','월','화','수','목','금','토'],
+ dayNamesShort: ['일','월','화','수','목','금','토'],
+ dayNamesMin: ['일','월','화','수','목','금','토'],
+ weekHeader: 'Wk',
+ dateFormat: 'yy-mm-dd',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: '년'};
+ $.datepicker.setDefaults($.datepicker.regional['ko']);
+}); \ No newline at end of file
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-kz.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-kz.js
new file mode 100644
index 000000000..f1f897b00
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-kz.js
@@ -0,0 +1,23 @@
+/* Kazakh (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by Dmitriy Karasyov (dmitriy.karasyov@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['kz'] = {
+ closeText: 'Жабу',
+ prevText: '&#x3c;Алдыңғы',
+ nextText: 'Келесі&#x3e;',
+ currentText: 'Бүгін',
+ monthNames: ['Қаңтар','Ақпан','Наурыз','Сәуір','Мамыр','Маусым',
+ 'Шілде','Тамыз','Қыркүйек','Қазан','Қараша','Желтоқсан'],
+ monthNamesShort: ['Қаң','Ақп','Нау','Сәу','Мам','Мау',
+ 'Шіл','Там','Қыр','Қаз','Қар','Жел'],
+ dayNames: ['Жексенбі','Дүйсенбі','Сейсенбі','Сәрсенбі','Бейсенбі','Жұма','Сенбі'],
+ dayNamesShort: ['жкс','дсн','ссн','срс','бсн','жма','снб'],
+ dayNamesMin: ['Жк','Дс','Сс','Ср','Бс','Жм','Сн'],
+ weekHeader: 'Не',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['kz']);
+});
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-lt.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-lt.js
new file mode 100644
index 000000000..67d5119ca
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-lt.js
@@ -0,0 +1,23 @@
+/* Lithuanian (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* @author Arturas Paleicikas <arturas@avalon.lt> */
+jQuery(function($){
+ $.datepicker.regional['lt'] = {
+ closeText: 'Uždaryti',
+ prevText: '&#x3c;Atgal',
+ nextText: 'Pirmyn&#x3e;',
+ currentText: 'Šiandien',
+ monthNames: ['Sausis','Vasaris','Kovas','Balandis','Gegužė','Birželis',
+ 'Liepa','Rugpjūtis','Rugsėjis','Spalis','Lapkritis','Gruodis'],
+ monthNamesShort: ['Sau','Vas','Kov','Bal','Geg','Bir',
+ 'Lie','Rugp','Rugs','Spa','Lap','Gru'],
+ dayNames: ['sekmadienis','pirmadienis','antradienis','trečiadienis','ketvirtadienis','penktadienis','šeštadienis'],
+ dayNamesShort: ['sek','pir','ant','tre','ket','pen','šeš'],
+ dayNamesMin: ['Se','Pr','An','Tr','Ke','Pe','Še'],
+ weekHeader: 'Wk',
+ dateFormat: 'yy-mm-dd',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['lt']);
+}); \ No newline at end of file
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-lv.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-lv.js
new file mode 100644
index 000000000..003934e72
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-lv.js
@@ -0,0 +1,23 @@
+/* Latvian (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* @author Arturas Paleicikas <arturas.paleicikas@metasite.net> */
+jQuery(function($){
+ $.datepicker.regional['lv'] = {
+ closeText: 'Aizvērt',
+ prevText: 'Iepr',
+ nextText: 'Nāka',
+ currentText: 'Šodien',
+ monthNames: ['Janvāris','Februāris','Marts','Aprīlis','Maijs','Jūnijs',
+ 'Jūlijs','Augusts','Septembris','Oktobris','Novembris','Decembris'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Mai','Jūn',
+ 'Jūl','Aug','Sep','Okt','Nov','Dec'],
+ dayNames: ['svētdiena','pirmdiena','otrdiena','trešdiena','ceturtdiena','piektdiena','sestdiena'],
+ dayNamesShort: ['svt','prm','otr','tre','ctr','pkt','sst'],
+ dayNamesMin: ['Sv','Pr','Ot','Tr','Ct','Pk','Ss'],
+ weekHeader: 'Nav',
+ dateFormat: 'dd-mm-yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['lv']);
+}); \ No newline at end of file
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ms.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ms.js
new file mode 100644
index 000000000..e953ac04f
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ms.js
@@ -0,0 +1,23 @@
+/* Malaysian initialisation for the jQuery UI date picker plugin. */
+/* Written by Mohd Nawawi Mohamad Jamili (nawawi@ronggeng.net). */
+jQuery(function($){
+ $.datepicker.regional['ms'] = {
+ closeText: 'Tutup',
+ prevText: '&#x3c;Sebelum',
+ nextText: 'Selepas&#x3e;',
+ currentText: 'hari ini',
+ monthNames: ['Januari','Februari','Mac','April','Mei','Jun',
+ 'Julai','Ogos','September','Oktober','November','Disember'],
+ monthNamesShort: ['Jan','Feb','Mac','Apr','Mei','Jun',
+ 'Jul','Ogo','Sep','Okt','Nov','Dis'],
+ dayNames: ['Ahad','Isnin','Selasa','Rabu','Khamis','Jumaat','Sabtu'],
+ dayNamesShort: ['Aha','Isn','Sel','Rab','kha','Jum','Sab'],
+ dayNamesMin: ['Ah','Is','Se','Ra','Kh','Ju','Sa'],
+ weekHeader: 'Mg',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['ms']);
+}); \ No newline at end of file
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-nl-BE.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-nl-BE.js
new file mode 100644
index 000000000..50217d878
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-nl-BE.js
@@ -0,0 +1,23 @@
+/* Dutch/Belgian (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by Mathias Bynens <http://mathiasbynens.be/> */
+jQuery(function($){
+ $.datepicker.regional['nl-BE'] = {
+ closeText: 'Sluiten',
+ prevText: '←',
+ nextText: '→',
+ currentText: 'Vandaag',
+ monthNames: ['januari', 'februari', 'maart', 'april', 'mei', 'juni',
+ 'juli', 'augustus', 'september', 'oktober', 'november', 'december'],
+ monthNamesShort: ['jan', 'feb', 'maa', 'apr', 'mei', 'jun',
+ 'jul', 'aug', 'sep', 'okt', 'nov', 'dec'],
+ dayNames: ['zondag', 'maandag', 'dinsdag', 'woensdag', 'donderdag', 'vrijdag', 'zaterdag'],
+ dayNamesShort: ['zon', 'maa', 'din', 'woe', 'don', 'vri', 'zat'],
+ dayNamesMin: ['zo', 'ma', 'di', 'wo', 'do', 'vr', 'za'],
+ weekHeader: 'Wk',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['nl-BE']);
+}); \ No newline at end of file
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-nl.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-nl.js
new file mode 100644
index 000000000..663d6bb26
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-nl.js
@@ -0,0 +1,23 @@
+/* Dutch (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by Mathias Bynens <http://mathiasbynens.be/> */
+jQuery(function($){
+ $.datepicker.regional.nl = {
+ closeText: 'Sluiten',
+ prevText: '←',
+ nextText: '→',
+ currentText: 'Vandaag',
+ monthNames: ['januari', 'februari', 'maart', 'april', 'mei', 'juni',
+ 'juli', 'augustus', 'september', 'oktober', 'november', 'december'],
+ monthNamesShort: ['jan', 'feb', 'maa', 'apr', 'mei', 'jun',
+ 'jul', 'aug', 'sep', 'okt', 'nov', 'dec'],
+ dayNames: ['zondag', 'maandag', 'dinsdag', 'woensdag', 'donderdag', 'vrijdag', 'zaterdag'],
+ dayNamesShort: ['zon', 'maa', 'din', 'woe', 'don', 'vri', 'zat'],
+ dayNamesMin: ['zo', 'ma', 'di', 'wo', 'do', 'vr', 'za'],
+ weekHeader: 'Wk',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional.nl);
+}); \ No newline at end of file
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-no.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-no.js
new file mode 100644
index 000000000..12b2356bf
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-no.js
@@ -0,0 +1,23 @@
+/* Norwegian initialisation for the jQuery UI date picker plugin. */
+/* Written by Naimdjon Takhirov (naimdjon@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['no'] = {
+ closeText: 'Lukk',
+ prevText: '&laquo;Forrige',
+ nextText: 'Neste&raquo;',
+ currentText: 'I dag',
+ monthNames: ['Januar','Februar','Mars','April','Mai','Juni',
+ 'Juli','August','September','Oktober','November','Desember'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Mai','Jun',
+ 'Jul','Aug','Sep','Okt','Nov','Des'],
+ dayNamesShort: ['Søn','Man','Tir','Ons','Tor','Fre','Lør'],
+ dayNames: ['Søndag','Mandag','Tirsdag','Onsdag','Torsdag','Fredag','Lørdag'],
+ dayNamesMin: ['Sø','Ma','Ti','On','To','Fr','Lø'],
+ weekHeader: 'Uke',
+ dateFormat: 'yy-mm-dd',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['no']);
+});
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-pl.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-pl.js
new file mode 100644
index 000000000..61fa29ccd
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-pl.js
@@ -0,0 +1,23 @@
+/* Polish initialisation for the jQuery UI date picker plugin. */
+/* Written by Jacek Wysocki (jacek.wysocki@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['pl'] = {
+ closeText: 'Zamknij',
+ prevText: '&#x3c;Poprzedni',
+ nextText: 'Następny&#x3e;',
+ currentText: 'Dziś',
+ monthNames: ['Styczeń','Luty','Marzec','Kwiecień','Maj','Czerwiec',
+ 'Lipiec','Sierpień','Wrzesień','Październik','Listopad','Grudzień'],
+ monthNamesShort: ['Sty','Lu','Mar','Kw','Maj','Cze',
+ 'Lip','Sie','Wrz','Pa','Lis','Gru'],
+ dayNames: ['Niedziela','Poniedziałek','Wtorek','Środa','Czwartek','Piątek','Sobota'],
+ dayNamesShort: ['Nie','Pn','Wt','Śr','Czw','Pt','So'],
+ dayNamesMin: ['N','Pn','Wt','Śr','Cz','Pt','So'],
+ weekHeader: 'Tydz',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['pl']);
+});
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-pt-BR.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-pt-BR.js
new file mode 100644
index 000000000..3cc8c796c
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-pt-BR.js
@@ -0,0 +1,23 @@
+/* Brazilian initialisation for the jQuery UI date picker plugin. */
+/* Written by Leonildo Costa Silva (leocsilva@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['pt-BR'] = {
+ closeText: 'Fechar',
+ prevText: '&#x3c;Anterior',
+ nextText: 'Pr&oacute;ximo&#x3e;',
+ currentText: 'Hoje',
+ monthNames: ['Janeiro','Fevereiro','Mar&ccedil;o','Abril','Maio','Junho',
+ 'Julho','Agosto','Setembro','Outubro','Novembro','Dezembro'],
+ monthNamesShort: ['Jan','Fev','Mar','Abr','Mai','Jun',
+ 'Jul','Ago','Set','Out','Nov','Dez'],
+ dayNames: ['Domingo','Segunda-feira','Ter&ccedil;a-feira','Quarta-feira','Quinta-feira','Sexta-feira','S&aacute;bado'],
+ dayNamesShort: ['Dom','Seg','Ter','Qua','Qui','Sex','S&aacute;b'],
+ dayNamesMin: ['Dom','Seg','Ter','Qua','Qui','Sex','S&aacute;b'],
+ weekHeader: 'Sm',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['pt-BR']);
+}); \ No newline at end of file
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-pt.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-pt.js
new file mode 100644
index 000000000..f09f5aeb0
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-pt.js
@@ -0,0 +1,22 @@
+/* Portuguese initialisation for the jQuery UI date picker plugin. */
+jQuery(function($){
+ $.datepicker.regional['pt'] = {
+ closeText: 'Fechar',
+ prevText: '&#x3c;Anterior',
+ nextText: 'Seguinte',
+ currentText: 'Hoje',
+ monthNames: ['Janeiro','Fevereiro','Mar&ccedil;o','Abril','Maio','Junho',
+ 'Julho','Agosto','Setembro','Outubro','Novembro','Dezembro'],
+ monthNamesShort: ['Jan','Fev','Mar','Abr','Mai','Jun',
+ 'Jul','Ago','Set','Out','Nov','Dez'],
+ dayNames: ['Domingo','Segunda-feira','Ter&ccedil;a-feira','Quarta-feira','Quinta-feira','Sexta-feira','S&aacute;bado'],
+ dayNamesShort: ['Dom','Seg','Ter','Qua','Qui','Sex','S&aacute;b'],
+ dayNamesMin: ['Dom','Seg','Ter','Qua','Qui','Sex','S&aacute;b'],
+ weekHeader: 'Sem',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['pt']);
+}); \ No newline at end of file
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ro.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ro.js
new file mode 100644
index 000000000..4fe95aeac
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ro.js
@@ -0,0 +1,26 @@
+/* Romanian initialisation for the jQuery UI date picker plugin.
+ *
+ * Written by Edmond L. (ll_edmond@walla.com)
+ * and Ionut G. Stan (ionut.g.stan@gmail.com)
+ */
+jQuery(function($){
+ $.datepicker.regional['ro'] = {
+ closeText: 'Închide',
+ prevText: '&laquo; Luna precedentă',
+ nextText: 'Luna următoare &raquo;',
+ currentText: 'Azi',
+ monthNames: ['Ianuarie','Februarie','Martie','Aprilie','Mai','Iunie',
+ 'Iulie','August','Septembrie','Octombrie','Noiembrie','Decembrie'],
+ monthNamesShort: ['Ian', 'Feb', 'Mar', 'Apr', 'Mai', 'Iun',
+ 'Iul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'],
+ dayNames: ['Duminică', 'Luni', 'Marţi', 'Miercuri', 'Joi', 'Vineri', 'Sâmbătă'],
+ dayNamesShort: ['Dum', 'Lun', 'Mar', 'Mie', 'Joi', 'Vin', 'Sâm'],
+ dayNamesMin: ['Du','Lu','Ma','Mi','Jo','Vi','Sâ'],
+ weekHeader: 'Săpt',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['ro']);
+});
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ru.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ru.js
new file mode 100644
index 000000000..50a461352
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ru.js
@@ -0,0 +1,23 @@
+/* Russian (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by Andrew Stromnov (stromnov@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['ru'] = {
+ closeText: 'Закрыть',
+ prevText: '&#x3c;Пред',
+ nextText: 'След&#x3e;',
+ currentText: 'Сегодня',
+ monthNames: ['Январь','Февраль','Март','Апрель','Май','Июнь',
+ 'Июль','Август','Сентябрь','Октябрь','Ноябрь','Декабрь'],
+ monthNamesShort: ['Янв','Фев','Мар','Апр','Май','Июн',
+ 'Июл','Авг','Сен','Окт','Ноя','Дек'],
+ dayNames: ['воскресенье','понедельник','вторник','среда','четверг','пятница','суббота'],
+ dayNamesShort: ['вск','пнд','втр','срд','чтв','птн','сбт'],
+ dayNamesMin: ['Вс','Пн','Вт','Ср','Чт','Пт','Сб'],
+ weekHeader: 'Нед',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['ru']);
+}); \ No newline at end of file
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-sk.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-sk.js
new file mode 100644
index 000000000..8a6771c1e
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-sk.js
@@ -0,0 +1,23 @@
+/* Slovak initialisation for the jQuery UI date picker plugin. */
+/* Written by Vojtech Rinik (vojto@hmm.sk). */
+jQuery(function($){
+ $.datepicker.regional['sk'] = {
+ closeText: 'Zavrieť',
+ prevText: '&#x3c;Predchádzajúci',
+ nextText: 'Nasledujúci&#x3e;',
+ currentText: 'Dnes',
+ monthNames: ['Január','Február','Marec','Apríl','Máj','Jún',
+ 'Júl','August','September','Október','November','December'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Máj','Jún',
+ 'Júl','Aug','Sep','Okt','Nov','Dec'],
+ dayNames: ['Nedel\'a','Pondelok','Utorok','Streda','Štvrtok','Piatok','Sobota'],
+ dayNamesShort: ['Ned','Pon','Uto','Str','Štv','Pia','Sob'],
+ dayNamesMin: ['Ne','Po','Ut','St','Št','Pia','So'],
+ weekHeader: 'Ty',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['sk']);
+});
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-sl.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-sl.js
new file mode 100644
index 000000000..516550192
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-sl.js
@@ -0,0 +1,24 @@
+/* Slovenian initialisation for the jQuery UI date picker plugin. */
+/* Written by Jaka Jancar (jaka@kubje.org). */
+/* c = &#x10D;, s = &#x161; z = &#x17E; C = &#x10C; S = &#x160; Z = &#x17D; */
+jQuery(function($){
+ $.datepicker.regional['sl'] = {
+ closeText: 'Zapri',
+ prevText: '&lt;Prej&#x161;nji',
+ nextText: 'Naslednji&gt;',
+ currentText: 'Trenutni',
+ monthNames: ['Januar','Februar','Marec','April','Maj','Junij',
+ 'Julij','Avgust','September','Oktober','November','December'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
+ 'Jul','Avg','Sep','Okt','Nov','Dec'],
+ dayNames: ['Nedelja','Ponedeljek','Torek','Sreda','&#x10C;etrtek','Petek','Sobota'],
+ dayNamesShort: ['Ned','Pon','Tor','Sre','&#x10C;et','Pet','Sob'],
+ dayNamesMin: ['Ne','Po','To','Sr','&#x10C;e','Pe','So'],
+ weekHeader: 'Teden',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['sl']);
+});
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-sq.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-sq.js
new file mode 100644
index 000000000..be84104c0
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-sq.js
@@ -0,0 +1,23 @@
+/* Albanian initialisation for the jQuery UI date picker plugin. */
+/* Written by Flakron Bytyqi (flakron@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['sq'] = {
+ closeText: 'mbylle',
+ prevText: '&#x3c;mbrapa',
+ nextText: 'Përpara&#x3e;',
+ currentText: 'sot',
+ monthNames: ['Janar','Shkurt','Mars','Prill','Maj','Qershor',
+ 'Korrik','Gusht','Shtator','Tetor','Nëntor','Dhjetor'],
+ monthNamesShort: ['Jan','Shk','Mar','Pri','Maj','Qer',
+ 'Kor','Gus','Sht','Tet','Nën','Dhj'],
+ dayNames: ['E Diel','E Hënë','E Martë','E Mërkurë','E Enjte','E Premte','E Shtune'],
+ dayNamesShort: ['Di','Hë','Ma','Më','En','Pr','Sh'],
+ dayNamesMin: ['Di','Hë','Ma','Më','En','Pr','Sh'],
+ weekHeader: 'Ja',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['sq']);
+});
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-sr-SR.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-sr-SR.js
new file mode 100644
index 000000000..8f8ea5e63
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-sr-SR.js
@@ -0,0 +1,23 @@
+/* Serbian i18n for the jQuery UI date picker plugin. */
+/* Written by Dejan Dimić. */
+jQuery(function($){
+ $.datepicker.regional['sr-SR'] = {
+ closeText: 'Zatvori',
+ prevText: '&#x3c;',
+ nextText: '&#x3e;',
+ currentText: 'Danas',
+ monthNames: ['Januar','Februar','Mart','April','Maj','Jun',
+ 'Jul','Avgust','Septembar','Oktobar','Novembar','Decembar'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
+ 'Jul','Avg','Sep','Okt','Nov','Dec'],
+ dayNames: ['Nedelja','Ponedeljak','Utorak','Sreda','Četvrtak','Petak','Subota'],
+ dayNamesShort: ['Ned','Pon','Uto','Sre','Čet','Pet','Sub'],
+ dayNamesMin: ['Ne','Po','Ut','Sr','Če','Pe','Su'],
+ weekHeader: 'Sed',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['sr-SR']);
+});
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-sr.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-sr.js
new file mode 100644
index 000000000..49c9b4a30
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-sr.js
@@ -0,0 +1,23 @@
+/* Serbian i18n for the jQuery UI date picker plugin. */
+/* Written by Dejan Dimić. */
+jQuery(function($){
+ $.datepicker.regional['sr'] = {
+ closeText: 'Затвори',
+ prevText: '&#x3c;',
+ nextText: '&#x3e;',
+ currentText: 'Данас',
+ monthNames: ['Јануар','Фебруар','Март','Април','Мај','Јун',
+ 'Јул','Август','Септембар','Октобар','Новембар','Децембар'],
+ monthNamesShort: ['Јан','Феб','Мар','Апр','Мај','Јун',
+ 'Јул','Авг','Сеп','Окт','Нов','Дец'],
+ dayNames: ['Недеља','Понедељак','Уторак','Среда','Четвртак','Петак','Субота'],
+ dayNamesShort: ['Нед','Пон','Уто','Сре','Чет','Пет','Суб'],
+ dayNamesMin: ['Не','По','Ут','Ср','Че','Пе','Су'],
+ weekHeader: 'Сед',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['sr']);
+});
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-sv.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-sv.js
new file mode 100644
index 000000000..8236b62b5
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-sv.js
@@ -0,0 +1,23 @@
+/* Swedish initialisation for the jQuery UI date picker plugin. */
+/* Written by Anders Ekdahl ( anders@nomadiz.se). */
+jQuery(function($){
+ $.datepicker.regional['sv'] = {
+ closeText: 'Stäng',
+ prevText: '&laquo;Förra',
+ nextText: 'Nästa&raquo;',
+ currentText: 'Idag',
+ monthNames: ['Januari','Februari','Mars','April','Maj','Juni',
+ 'Juli','Augusti','September','Oktober','November','December'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
+ 'Jul','Aug','Sep','Okt','Nov','Dec'],
+ dayNamesShort: ['Sön','Mån','Tis','Ons','Tor','Fre','Lör'],
+ dayNames: ['Söndag','Måndag','Tisdag','Onsdag','Torsdag','Fredag','Lördag'],
+ dayNamesMin: ['Sö','Må','Ti','On','To','Fr','Lö'],
+ weekHeader: 'Ve',
+ dateFormat: 'yy-mm-dd',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['sv']);
+});
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ta.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ta.js
new file mode 100644
index 000000000..91116d387
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-ta.js
@@ -0,0 +1,23 @@
+/* Tamil (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by S A Sureshkumar (saskumar@live.com). */
+jQuery(function($){
+ $.datepicker.regional['ta'] = {
+ closeText: 'மூடு',
+ prevText: 'முன்னையது',
+ nextText: 'அடுத்தது',
+ currentText: 'இன்று',
+ monthNames: ['தை','மாசி','பங்குனி','சித்திரை','வைகாசி','ஆனி',
+ 'ஆடி','ஆவணி','புரட்டாசி','ஐப்பசி','கார்த்திகை','மார்கழி'],
+ monthNamesShort: ['தை','மாசி','பங்','சித்','வைகா','ஆனி',
+ 'ஆடி','ஆவ','புர','ஐப்','கார்','மார்'],
+ dayNames: ['ஞாயிற்றுக்கிழமை','திங்கட்கிழமை','செவ்வாய்க்கிழமை','புதன்கிழமை','வியாழக்கிழமை','வெள்ளிக்கிழமை','சனிக்கிழமை'],
+ dayNamesShort: ['ஞாயிறு','திங்கள்','செவ்வாய்','புதன்','வியாழன்','வெள்ளி','சனி'],
+ dayNamesMin: ['ஞா','தி','செ','பு','வி','வெ','ச'],
+ weekHeader: 'Не',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['ta']);
+});
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-th.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-th.js
new file mode 100644
index 000000000..978500ab1
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-th.js
@@ -0,0 +1,23 @@
+/* Thai initialisation for the jQuery UI date picker plugin. */
+/* Written by pipo (pipo@sixhead.com). */
+jQuery(function($){
+ $.datepicker.regional['th'] = {
+ closeText: 'ปิด',
+ prevText: '&laquo;&nbsp;ย้อน',
+ nextText: 'ถัดไป&nbsp;&raquo;',
+ currentText: 'วันนี้',
+ monthNames: ['มกราคม','กุมภาพันธ์','มีนาคม','เมษายน','พฤษภาคม','มิถุนายน',
+ 'กรกฏาคม','สิงหาคม','กันยายน','ตุลาคม','พฤศจิกายน','ธันวาคม'],
+ monthNamesShort: ['ม.ค.','ก.พ.','มี.ค.','เม.ย.','พ.ค.','มิ.ย.',
+ 'ก.ค.','ส.ค.','ก.ย.','ต.ค.','พ.ย.','ธ.ค.'],
+ dayNames: ['อาทิตย์','จันทร์','อังคาร','พุธ','พฤหัสบดี','ศุกร์','เสาร์'],
+ dayNamesShort: ['อา.','จ.','อ.','พ.','พฤ.','ศ.','ส.'],
+ dayNamesMin: ['อา.','จ.','อ.','พ.','พฤ.','ศ.','ส.'],
+ weekHeader: 'Wk',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['th']);
+}); \ No newline at end of file
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-tr.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-tr.js
new file mode 100644
index 000000000..dedfc7ff9
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-tr.js
@@ -0,0 +1,23 @@
+/* Turkish initialisation for the jQuery UI date picker plugin. */
+/* Written by Izzet Emre Erkan (kara@karalamalar.net). */
+jQuery(function($){
+ $.datepicker.regional['tr'] = {
+ closeText: 'kapat',
+ prevText: '&#x3c;geri',
+ nextText: 'ileri&#x3e',
+ currentText: 'bugün',
+ monthNames: ['Ocak','Şubat','Mart','Nisan','Mayıs','Haziran',
+ 'Temmuz','Ağustos','Eylül','Ekim','Kasım','Aralık'],
+ monthNamesShort: ['Oca','Şub','Mar','Nis','May','Haz',
+ 'Tem','Ağu','Eyl','Eki','Kas','Ara'],
+ dayNames: ['Pazar','Pazartesi','Salı','Çarşamba','Perşembe','Cuma','Cumartesi'],
+ dayNamesShort: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'],
+ dayNamesMin: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'],
+ weekHeader: 'Hf',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['tr']);
+}); \ No newline at end of file
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-uk.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-uk.js
new file mode 100644
index 000000000..112b40e7f
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-uk.js
@@ -0,0 +1,23 @@
+/* Ukrainian (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by Maxim Drogobitskiy (maxdao@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['uk'] = {
+ closeText: 'Закрити',
+ prevText: '&#x3c;',
+ nextText: '&#x3e;',
+ currentText: 'Сьогодні',
+ monthNames: ['Січень','Лютий','Березень','Квітень','Травень','Червень',
+ 'Липень','Серпень','Вересень','Жовтень','Листопад','Грудень'],
+ monthNamesShort: ['Січ','Лют','Бер','Кві','Тра','Чер',
+ 'Лип','Сер','Вер','Жов','Лис','Гру'],
+ dayNames: ['неділя','понеділок','вівторок','середа','четвер','п’ятниця','субота'],
+ dayNamesShort: ['нед','пнд','вів','срд','чтв','птн','сбт'],
+ dayNamesMin: ['Нд','Пн','Вт','Ср','Чт','Пт','Сб'],
+ weekHeader: 'Не',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['uk']);
+}); \ No newline at end of file
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-vi.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-vi.js
new file mode 100644
index 000000000..9813a59e0
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-vi.js
@@ -0,0 +1,23 @@
+/* Vietnamese initialisation for the jQuery UI date picker plugin. */
+/* Translated by Le Thanh Huy (lthanhhuy@cit.ctu.edu.vn). */
+jQuery(function($){
+ $.datepicker.regional['vi'] = {
+ closeText: 'Đóng',
+ prevText: '&#x3c;Trước',
+ nextText: 'Tiếp&#x3e;',
+ currentText: 'Hôm nay',
+ monthNames: ['Tháng Một', 'Tháng Hai', 'Tháng Ba', 'Tháng Tư', 'Tháng Năm', 'Tháng Sáu',
+ 'Tháng Bảy', 'Tháng Tám', 'Tháng Chín', 'Tháng Mười', 'Tháng Mười Một', 'Tháng Mười Hai'],
+ monthNamesShort: ['Tháng 1', 'Tháng 2', 'Tháng 3', 'Tháng 4', 'Tháng 5', 'Tháng 6',
+ 'Tháng 7', 'Tháng 8', 'Tháng 9', 'Tháng 10', 'Tháng 11', 'Tháng 12'],
+ dayNames: ['Chủ Nhật', 'Thứ Hai', 'Thứ Ba', 'Thứ Tư', 'Thứ Năm', 'Thứ Sáu', 'Thứ Bảy'],
+ dayNamesShort: ['CN', 'T2', 'T3', 'T4', 'T5', 'T6', 'T7'],
+ dayNamesMin: ['CN', 'T2', 'T3', 'T4', 'T5', 'T6', 'T7'],
+ weekHeader: 'Tu',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['vi']);
+});
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-zh-CN.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-zh-CN.js
new file mode 100644
index 000000000..6c4883f53
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-zh-CN.js
@@ -0,0 +1,23 @@
+/* Chinese initialisation for the jQuery UI date picker plugin. */
+/* Written by Cloudream (cloudream@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['zh-CN'] = {
+ closeText: '关闭',
+ prevText: '&#x3c;上月',
+ nextText: '下月&#x3e;',
+ currentText: '今天',
+ monthNames: ['一月','二月','三月','四月','五月','六月',
+ '七月','八月','九月','十月','十一月','十二月'],
+ monthNamesShort: ['一','二','三','四','五','六',
+ '七','八','九','十','十一','十二'],
+ dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'],
+ dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'],
+ dayNamesMin: ['日','一','二','三','四','五','六'],
+ weekHeader: '周',
+ dateFormat: 'yy-mm-dd',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: true,
+ yearSuffix: '年'};
+ $.datepicker.setDefaults($.datepicker.regional['zh-CN']);
+});
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-zh-HK.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-zh-HK.js
new file mode 100644
index 000000000..06c4c628c
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-zh-HK.js
@@ -0,0 +1,23 @@
+/* Chinese initialisation for the jQuery UI date picker plugin. */
+/* Written by SCCY (samuelcychan@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['zh-HK'] = {
+ closeText: '關閉',
+ prevText: '&#x3c;上月',
+ nextText: '下月&#x3e;',
+ currentText: '今天',
+ monthNames: ['一月','二月','三月','四月','五月','六月',
+ '七月','八月','九月','十月','十一月','十二月'],
+ monthNamesShort: ['一','二','三','四','五','六',
+ '七','八','九','十','十一','十二'],
+ dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'],
+ dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'],
+ dayNamesMin: ['日','一','二','三','四','五','六'],
+ weekHeader: '周',
+ dateFormat: 'dd-mm-yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: true,
+ yearSuffix: '年'};
+ $.datepicker.setDefaults($.datepicker.regional['zh-HK']);
+});
diff --git a/plugins/jqueryui/js/i18n/jquery.ui.datepicker-zh-TW.js b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-zh-TW.js
new file mode 100644
index 000000000..d211573c6
--- /dev/null
+++ b/plugins/jqueryui/js/i18n/jquery.ui.datepicker-zh-TW.js
@@ -0,0 +1,23 @@
+/* Chinese initialisation for the jQuery UI date picker plugin. */
+/* Written by Ressol (ressol@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['zh-TW'] = {
+ closeText: '關閉',
+ prevText: '&#x3c;上月',
+ nextText: '下月&#x3e;',
+ currentText: '今天',
+ monthNames: ['一月','二月','三月','四月','五月','六月',
+ '七月','八月','九月','十月','十一月','十二月'],
+ monthNamesShort: ['一','二','三','四','五','六',
+ '七','八','九','十','十一','十二'],
+ dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'],
+ dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'],
+ dayNamesMin: ['日','一','二','三','四','五','六'],
+ weekHeader: '周',
+ dateFormat: 'yy/mm/dd',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: true,
+ yearSuffix: '年'};
+ $.datepicker.setDefaults($.datepicker.regional['zh-TW']);
+});
diff --git a/plugins/jqueryui/js/jquery-ui-1.8.14.custom.min.js b/plugins/jqueryui/js/jquery-ui-1.8.14.custom.min.js
new file mode 100755
index 000000000..f9e4f1e84
--- /dev/null
+++ b/plugins/jqueryui/js/jquery-ui-1.8.14.custom.min.js
@@ -0,0 +1,789 @@
+/*!
+ * jQuery UI 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI
+ */
+(function(c,j){function k(a,b){var d=a.nodeName.toLowerCase();if("area"===d){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&l(a)}return(/input|select|textarea|button|object/.test(d)?!a.disabled:"a"==d?a.href||b:b)&&l(a)}function l(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.14",
+keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=this;setTimeout(function(){c(d).focus();
+b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this,"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,
+"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",
+function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,m,n){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(m)g-=parseFloat(c.curCSS(f,"border"+this+"Width",true))||0;if(n)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight,outerWidth:c.fn.outerWidth,
+outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h,d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){return k(a,!isNaN(c.attr(a,"tabindex")))},tabbable:function(a){var b=c.attr(a,"tabindex"),d=isNaN(b);
+return(d||b>=0)&&k(a,!d)}});c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&a.element[0].parentNode)for(var e=
+0;e<b.length;e++)a.options[b[e][0]]&&b[e][1].apply(a.element,d)}},contains:function(a,b){return document.compareDocumentPosition?a.compareDocumentPosition(b)&16:a!==b&&a.contains(b)},hasScroll:function(a,b){if(c(a).css("overflow")==="hidden")return false;b=b&&b==="left"?"scrollLeft":"scrollTop";var d=false;if(a[b]>0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a<b+d},isOver:function(a,b,d,e,h,i){return c.ui.isOverAxis(a,d,h)&&c.ui.isOverAxis(b,e,i)}})}})(jQuery);
+;/*!
+ * jQuery UI Widget 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Widget
+ */
+(function(b,j){if(b.cleanData){var k=b.cleanData;b.cleanData=function(a){for(var c=0,d;(d=a[c])!=null;c++)b(d).triggerHandler("remove");k(a)}}else{var l=b.fn.remove;b.fn.remove=function(a,c){return this.each(function(){if(!c)if(!a||b.filter(a,[this]).length)b("*",this).add([this]).each(function(){b(this).triggerHandler("remove")});return l.call(b(this),a,c)})}}b.widget=function(a,c,d){var e=a.split(".")[0],f;a=a.split(".")[1];f=e+"-"+a;if(!d){d=c;c=b.Widget}b.expr[":"][f]=function(h){return!!b.data(h,
+a)};b[e]=b[e]||{};b[e][a]=function(h,g){arguments.length&&this._createWidget(h,g)};c=new c;c.options=b.extend(true,{},c.options);b[e][a].prototype=b.extend(true,c,{namespace:e,widgetName:a,widgetEventPrefix:b[e][a].prototype.widgetEventPrefix||a,widgetBaseClass:f},d);b.widget.bridge(a,b[e][a])};b.widget.bridge=function(a,c){b.fn[a]=function(d){var e=typeof d==="string",f=Array.prototype.slice.call(arguments,1),h=this;d=!e&&f.length?b.extend.apply(null,[true,d].concat(f)):d;if(e&&d.charAt(0)==="_")return h;
+e?this.each(function(){var g=b.data(this,a),i=g&&b.isFunction(g[d])?g[d].apply(g,f):g;if(i!==g&&i!==j){h=i;return false}}):this.each(function(){var g=b.data(this,a);g?g.option(d||{})._init():b.data(this,a,new c(d,this))});return h}};b.Widget=function(a,c){arguments.length&&this._createWidget(a,c)};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(a,c){b.data(c,this.widgetName,this);this.element=b(c);this.options=b.extend(true,{},this.options,
+this._getCreateOptions(),a);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")},
+widget:function(){return this.element},option:function(a,c){var d=a;if(arguments.length===0)return b.extend({},this.options);if(typeof a==="string"){if(c===j)return this.options[a];d={};d[a]=c}this._setOptions(d);return this},_setOptions:function(a){var c=this;b.each(a,function(d,e){c._setOption(d,e)});return this},_setOption:function(a,c){this.options[a]=c;if(a==="disabled")this.widget()[c?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",c);return this},
+enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(a,c,d){var e=this.options[a];c=b.Event(c);c.type=(a===this.widgetEventPrefix?a:this.widgetEventPrefix+a).toLowerCase();d=d||{};if(c.originalEvent){a=b.event.props.length;for(var f;a;){f=b.event.props[--a];c[f]=c.originalEvent[f]}}this.element.trigger(c,d);return!(b.isFunction(e)&&e.call(this.element[0],c,d)===false||c.isDefaultPrevented())}}})(jQuery);
+;/*!
+ * jQuery UI Mouse 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Mouse
+ *
+ * Depends:
+ * jquery.ui.widget.js
+ */
+(function(b){var d=false;b(document).mousedown(function(){d=false});b.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var a=this;this.element.bind("mousedown."+this.widgetName,function(c){return a._mouseDown(c)}).bind("click."+this.widgetName,function(c){if(true===b.data(c.target,a.widgetName+".preventClickEvent")){b.removeData(c.target,a.widgetName+".preventClickEvent");c.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+
+this.widgetName)},_mouseDown:function(a){if(!d){this._mouseStarted&&this._mouseUp(a);this._mouseDownEvent=a;var c=this,f=a.which==1,g=typeof this.options.cancel=="string"?b(a.target).closest(this.options.cancel).length:false;if(!f||g||!this._mouseCapture(a))return true;this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet)this._mouseDelayTimer=setTimeout(function(){c.mouseDelayMet=true},this.options.delay);if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a)){this._mouseStarted=this._mouseStart(a)!==
+false;if(!this._mouseStarted){a.preventDefault();return true}}true===b.data(a.target,this.widgetName+".preventClickEvent")&&b.removeData(a.target,this.widgetName+".preventClickEvent");this._mouseMoveDelegate=function(e){return c._mouseMove(e)};this._mouseUpDelegate=function(e){return c._mouseUp(e)};b(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);a.preventDefault();return d=true}},_mouseMove:function(a){if(b.browser.msie&&
+!(document.documentMode>=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=
+false;a.target==this._mouseDownEvent.target&&b.data(a.target,this.widgetName+".preventClickEvent",true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery);
+;/*
+ * jQuery UI Position 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Position
+ */
+(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY,
+left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+=
+k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))||0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))||0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-=
+m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left=
+d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+=
+a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b),
+g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery);
+;/*
+ * jQuery UI Draggable 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Draggables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function(d){d.widget("ui.draggable",d.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper==
+"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b=
+this.options;if(this.helper||b.disabled||d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;d(b.iframeFix===true?"iframe":b.iframeFix).each(function(){d('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(d(this).offset()).appendTo("body")});return true},_mouseStart:function(a){var b=this.options;this.helper=
+this._createHelper(a);this._cacheHelperProportions();if(d.ui.ddmanager)d.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});
+this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions();d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);d.ui.ddmanager&&d.ui.ddmanager.dragStart(this,a);return true},
+_mouseDrag:function(a,b){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b=
+false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b=d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!b||this.options.revert=="valid"&&b||this.options.revert===true||d.isFunction(this.options.revert)&&this.options.revert.call(this.element,b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,
+10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop",a)!==false&&this._clear();return false},_mouseUp:function(a){this.options.iframeFix===true&&d("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)});d.ui.ddmanager&&d.ui.ddmanager.dragStop(this,a);return d.ui.mouse.prototype._mouseUp.call(this,a)},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle||
+!d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone().removeAttr("id"):this.element;a.parents("body").length||a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed|absolute)/.test(a.css("position"))&&
+a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=
+this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),
+10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"),
+10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[a.containment=="document"?0:d(window).scrollLeft()-this.offset.relative.left-this.offset.parent.left,a.containment=="document"?0:d(window).scrollTop()-this.offset.relative.top-this.offset.parent.top,
+(a.containment=="document"?0:d(window).scrollLeft())+d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a.containment=="document"?0:d(window).scrollTop())+(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)&&a.containment.constructor!=Array){a=d(a.containment);var b=a[0];if(b){a.offset();var c=d(b).css("overflow")!=
+"hidden";this.containment=[(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0),(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0),(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),
+10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom];this.relative_container=a}}else if(a.containment.constructor==Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName);return{top:b.top+
+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&
+!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName),e=a.pageX,h=a.pageY;if(this.originalPosition){var g;if(this.containment){if(this.relative_container){g=this.relative_container.offset();g=[this.containment[0]+g.left,this.containment[1]+g.top,this.containment[2]+g.left,this.containment[3]+g.top]}else g=this.containment;if(a.pageX-this.offset.click.left<g[0])e=g[0]+this.offset.click.left;
+if(a.pageY-this.offset.click.top<g[1])h=g[1]+this.offset.click.top;if(a.pageX-this.offset.click.left>g[2])e=g[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>g[3])h=g[3]+this.offset.click.top}if(b.grid){h=b.grid[1]?this.originalPageY+Math.round((h-this.originalPageY)/b.grid[1])*b.grid[1]:this.originalPageY;h=g?!(h-this.offset.click.top<g[1]||h-this.offset.click.top>g[3])?h:!(h-this.offset.click.top<g[1])?h-b.grid[1]:h+b.grid[1]:h;e=b.grid[0]?this.originalPageX+Math.round((e-this.originalPageX)/
+b.grid[0])*b.grid[0]:this.originalPageX;e=g?!(e-this.offset.click.left<g[0]||e-this.offset.click.left>g[2])?e:!(e-this.offset.click.left<g[0])?e-b.grid[0]:e+b.grid[0]:e}}return{top:h-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop()),left:e-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&d.browser.version<
+526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())}},_clear:function(){this.helper.removeClass("ui-draggable-dragging");this.helper[0]!=this.element[0]&&!this.cancelHelperRemoval&&this.helper.remove();this.helper=null;this.cancelHelperRemoval=false},_trigger:function(a,b,c){c=c||this._uiHash();d.ui.plugin.call(this,a,[b,c]);if(a=="drag")this.positionAbs=this._convertPositionTo("absolute");return d.Widget.prototype._trigger.call(this,a,b,
+c)},plugins:{},_uiHash:function(){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition,offset:this.positionAbs}}});d.extend(d.ui.draggable,{version:"1.8.14"});d.ui.plugin.add("draggable","connectToSortable",{start:function(a,b){var c=d(this).data("draggable"),f=c.options,e=d.extend({},b,{item:c.element});c.sortables=[];d(f.connectToSortable).each(function(){var h=d.data(this,"sortable");if(h&&!h.options.disabled){c.sortables.push({instance:h,shouldRevert:h.options.revert});
+h.refreshPositions();h._trigger("activate",a,e)}})},stop:function(a,b){var c=d(this).data("draggable"),f=d.extend({},b,{item:c.element});d.each(c.sortables,function(){if(this.instance.isOver){this.instance.isOver=0;c.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert)this.instance.options.revert=true;this.instance._mouseStop(a);this.instance.options.helper=this.instance.options._helper;c.options.helper=="original"&&this.instance.currentItem.css({top:"auto",left:"auto"})}else{this.instance.cancelHelperRemoval=
+false;this.instance._trigger("deactivate",a,f)}})},drag:function(a,b){var c=d(this).data("draggable"),f=this;d.each(c.sortables,function(){this.instance.positionAbs=c.positionAbs;this.instance.helperProportions=c.helperProportions;this.instance.offset.click=c.offset.click;if(this.instance._intersectsWith(this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=1;this.instance.currentItem=d(f).clone().removeAttr("id").appendTo(this.instance.element).data("sortable-item",true);
+this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return b.helper[0]};a.target=this.instance.currentItem[0];this.instance._mouseCapture(a,true);this.instance._mouseStart(a,true,true);this.instance.offset.click.top=c.offset.click.top;this.instance.offset.click.left=c.offset.click.left;this.instance.offset.parent.left-=c.offset.parent.left-this.instance.offset.parent.left;this.instance.offset.parent.top-=c.offset.parent.top-this.instance.offset.parent.top;
+c._trigger("toSortable",a);c.dropped=this.instance.element;c.currentItem=c.element;this.instance.fromOutside=c}this.instance.currentItem&&this.instance._mouseDrag(a)}else if(this.instance.isOver){this.instance.isOver=0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._trigger("out",a,this.instance._uiHash(this.instance));this.instance._mouseStop(a,true);this.instance.options.helper=this.instance.options._helper;this.instance.currentItem.remove();this.instance.placeholder&&
+this.instance.placeholder.remove();c._trigger("fromSortable",a);c.dropped=false}})}});d.ui.plugin.add("draggable","cursor",{start:function(){var a=d("body"),b=d(this).data("draggable").options;if(a.css("cursor"))b._cursor=a.css("cursor");a.css("cursor",b.cursor)},stop:function(){var a=d(this).data("draggable").options;a._cursor&&d("body").css("cursor",a._cursor)}});d.ui.plugin.add("draggable","opacity",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("opacity"))b._opacity=
+a.css("opacity");a.css("opacity",b.opacity)},stop:function(a,b){a=d(this).data("draggable").options;a._opacity&&d(b.helper).css("opacity",a._opacity)}});d.ui.plugin.add("draggable","scroll",{start:function(){var a=d(this).data("draggable");if(a.scrollParent[0]!=document&&a.scrollParent[0].tagName!="HTML")a.overflowOffset=a.scrollParent.offset()},drag:function(a){var b=d(this).data("draggable"),c=b.options,f=false;if(b.scrollParent[0]!=document&&b.scrollParent[0].tagName!="HTML"){if(!c.axis||c.axis!=
+"x")if(b.overflowOffset.top+b.scrollParent[0].offsetHeight-a.pageY<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop+c.scrollSpeed;else if(a.pageY-b.overflowOffset.top<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop-c.scrollSpeed;if(!c.axis||c.axis!="y")if(b.overflowOffset.left+b.scrollParent[0].offsetWidth-a.pageX<c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft+c.scrollSpeed;else if(a.pageX-b.overflowOffset.left<
+c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft-c.scrollSpeed}else{if(!c.axis||c.axis!="x")if(a.pageY-d(document).scrollTop()<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()-c.scrollSpeed);else if(d(window).height()-(a.pageY-d(document).scrollTop())<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()+c.scrollSpeed);if(!c.axis||c.axis!="y")if(a.pageX-d(document).scrollLeft()<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()-
+c.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()+c.scrollSpeed)}f!==false&&d.ui.ddmanager&&!c.dropBehaviour&&d.ui.ddmanager.prepareOffsets(b,a)}});d.ui.plugin.add("draggable","snap",{start:function(){var a=d(this).data("draggable"),b=a.options;a.snapElements=[];d(b.snap.constructor!=String?b.snap.items||":data(draggable)":b.snap).each(function(){var c=d(this),f=c.offset();this!=a.element[0]&&a.snapElements.push({item:this,
+width:c.outerWidth(),height:c.outerHeight(),top:f.top,left:f.left})})},drag:function(a,b){for(var c=d(this).data("draggable"),f=c.options,e=f.snapTolerance,h=b.offset.left,g=h+c.helperProportions.width,n=b.offset.top,o=n+c.helperProportions.height,i=c.snapElements.length-1;i>=0;i--){var j=c.snapElements[i].left,l=j+c.snapElements[i].width,k=c.snapElements[i].top,m=k+c.snapElements[i].height;if(j-e<h&&h<l+e&&k-e<n&&n<m+e||j-e<h&&h<l+e&&k-e<o&&o<m+e||j-e<g&&g<l+e&&k-e<n&&n<m+e||j-e<g&&g<l+e&&k-e<o&&
+o<m+e){if(f.snapMode!="inner"){var p=Math.abs(k-o)<=e,q=Math.abs(m-n)<=e,r=Math.abs(j-g)<=e,s=Math.abs(l-h)<=e;if(p)b.position.top=c._convertPositionTo("relative",{top:k-c.helperProportions.height,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",{top:m,left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:j-c.helperProportions.width}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:l}).left-c.margins.left}var t=
+p||q||r||s;if(f.snapMode!="outer"){p=Math.abs(k-n)<=e;q=Math.abs(m-o)<=e;r=Math.abs(j-h)<=e;s=Math.abs(l-g)<=e;if(p)b.position.top=c._convertPositionTo("relative",{top:k,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",{top:m-c.helperProportions.height,left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:j}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:l-c.helperProportions.width}).left-c.margins.left}if(!c.snapElements[i].snapping&&
+(p||q||r||s||t))c.options.snap.snap&&c.options.snap.snap.call(c.element,a,d.extend(c._uiHash(),{snapItem:c.snapElements[i].item}));c.snapElements[i].snapping=p||q||r||s||t}else{c.snapElements[i].snapping&&c.options.snap.release&&c.options.snap.release.call(c.element,a,d.extend(c._uiHash(),{snapItem:c.snapElements[i].item}));c.snapElements[i].snapping=false}}}});d.ui.plugin.add("draggable","stack",{start:function(){var a=d(this).data("draggable").options;a=d.makeArray(d(a.stack)).sort(function(c,f){return(parseInt(d(c).css("zIndex"),
+10)||0)-(parseInt(d(f).css("zIndex"),10)||0)});if(a.length){var b=parseInt(a[0].style.zIndex)||0;d(a).each(function(c){this.style.zIndex=b+c});this[0].style.zIndex=b+a.length}}});d.ui.plugin.add("draggable","zIndex",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("zIndex"))b._zIndex=a.css("zIndex");a.css("zIndex",b.zIndex)},stop:function(a,b){a=d(this).data("draggable").options;a._zIndex&&d(b.helper).css("zIndex",a._zIndex)}})})(jQuery);
+;/*
+ * jQuery UI Droppable 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Droppables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.mouse.js
+ * jquery.ui.draggable.js
+ */
+(function(d){d.widget("ui.droppable",{widgetEventPrefix:"drop",options:{accept:"*",activeClass:false,addClasses:true,greedy:false,hoverClass:false,scope:"default",tolerance:"intersect"},_create:function(){var a=this.options,b=a.accept;this.isover=0;this.isout=1;this.accept=d.isFunction(b)?b:function(c){return c.is(b)};this.proportions={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight};d.ui.ddmanager.droppables[a.scope]=d.ui.ddmanager.droppables[a.scope]||[];d.ui.ddmanager.droppables[a.scope].push(this);
+a.addClasses&&this.element.addClass("ui-droppable")},destroy:function(){for(var a=d.ui.ddmanager.droppables[this.options.scope],b=0;b<a.length;b++)a[b]==this&&a.splice(b,1);this.element.removeClass("ui-droppable ui-droppable-disabled").removeData("droppable").unbind(".droppable");return this},_setOption:function(a,b){if(a=="accept")this.accept=d.isFunction(b)?b:function(c){return c.is(b)};d.Widget.prototype._setOption.apply(this,arguments)},_activate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&&
+this.element.addClass(this.options.activeClass);b&&this._trigger("activate",a,this.ui(b))},_deactivate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&&this.element.removeClass(this.options.activeClass);b&&this._trigger("deactivate",a,this.ui(b))},_over:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.addClass(this.options.hoverClass);
+this._trigger("over",a,this.ui(b))}},_out:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("out",a,this.ui(b))}},_drop:function(a,b){var c=b||d.ui.ddmanager.current;if(!c||(c.currentItem||c.element)[0]==this.element[0])return false;var e=false;this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function(){var g=
+d.data(this,"droppable");if(g.options.greedy&&!g.options.disabled&&g.options.scope==c.options.scope&&g.accept.call(g.element[0],c.currentItem||c.element)&&d.ui.intersect(c,d.extend(g,{offset:g.element.offset()}),g.options.tolerance)){e=true;return false}});if(e)return false;if(this.accept.call(this.element[0],c.currentItem||c.element)){this.options.activeClass&&this.element.removeClass(this.options.activeClass);this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("drop",
+a,this.ui(c));return this.element}return false},ui:function(a){return{draggable:a.currentItem||a.element,helper:a.helper,position:a.position,offset:a.positionAbs}}});d.extend(d.ui.droppable,{version:"1.8.14"});d.ui.intersect=function(a,b,c){if(!b.offset)return false;var e=(a.positionAbs||a.position.absolute).left,g=e+a.helperProportions.width,f=(a.positionAbs||a.position.absolute).top,h=f+a.helperProportions.height,i=b.offset.left,k=i+b.proportions.width,j=b.offset.top,l=j+b.proportions.height;
+switch(c){case "fit":return i<=e&&g<=k&&j<=f&&h<=l;case "intersect":return i<e+a.helperProportions.width/2&&g-a.helperProportions.width/2<k&&j<f+a.helperProportions.height/2&&h-a.helperProportions.height/2<l;case "pointer":return d.ui.isOver((a.positionAbs||a.position.absolute).top+(a.clickOffset||a.offset.click).top,(a.positionAbs||a.position.absolute).left+(a.clickOffset||a.offset.click).left,j,i,b.proportions.height,b.proportions.width);case "touch":return(f>=j&&f<=l||h>=j&&h<=l||f<j&&h>l)&&(e>=
+i&&e<=k||g>=i&&g<=k||e<i&&g>k);default:return false}};d.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(a,b){var c=d.ui.ddmanager.droppables[a.options.scope]||[],e=b?b.type:null,g=(a.currentItem||a.element).find(":data(droppable)").andSelf(),f=0;a:for(;f<c.length;f++)if(!(c[f].options.disabled||a&&!c[f].accept.call(c[f].element[0],a.currentItem||a.element))){for(var h=0;h<g.length;h++)if(g[h]==c[f].element[0]){c[f].proportions.height=0;continue a}c[f].visible=c[f].element.css("display")!=
+"none";if(c[f].visible){e=="mousedown"&&c[f]._activate.call(c[f],b);c[f].offset=c[f].element.offset();c[f].proportions={width:c[f].element[0].offsetWidth,height:c[f].element[0].offsetHeight}}}},drop:function(a,b){var c=false;d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(this.options){if(!this.options.disabled&&this.visible&&d.ui.intersect(a,this,this.options.tolerance))c=c||this._drop.call(this,b);if(!this.options.disabled&&this.visible&&this.accept.call(this.element[0],a.currentItem||
+a.element)){this.isout=1;this.isover=0;this._deactivate.call(this,b)}}});return c},dragStart:function(a,b){a.element.parentsUntil("body").bind("scroll.droppable",function(){a.options.refreshPositions||d.ui.ddmanager.prepareOffsets(a,b)})},drag:function(a,b){a.options.refreshPositions&&d.ui.ddmanager.prepareOffsets(a,b);d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(!(this.options.disabled||this.greedyChild||!this.visible)){var c=d.ui.intersect(a,this,this.options.tolerance);if(c=
+!c&&this.isover==1?"isout":c&&this.isover==0?"isover":null){var e;if(this.options.greedy){var g=this.element.parents(":data(droppable):eq(0)");if(g.length){e=d.data(g[0],"droppable");e.greedyChild=c=="isover"?1:0}}if(e&&c=="isover"){e.isover=0;e.isout=1;e._out.call(e,b)}this[c]=1;this[c=="isout"?"isover":"isout"]=0;this[c=="isover"?"_over":"_out"].call(this,b);if(e&&c=="isout"){e.isout=0;e.isover=1;e._over.call(e,b)}}}})},dragStop:function(a,b){a.element.parentsUntil("body").unbind("scroll.droppable");
+a.options.refreshPositions||d.ui.ddmanager.prepareOffsets(a,b)}}})(jQuery);
+;/*
+ * jQuery UI Resizable 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Resizables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function(e){e.widget("ui.resizable",e.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1E3},_create:function(){var b=this,a=this.options;this.element.addClass("ui-resizable");e.extend(this,{_aspectRatio:!!a.aspectRatio,aspectRatio:a.aspectRatio,originalElement:this.element,
+_proportionallyResizeElements:[],_helper:a.helper||a.ghost||a.animate?a.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){/relative/.test(this.element.css("position"))&&e.browser.opera&&this.element.css({position:"relative",top:"auto",left:"auto"});this.element.wrap(e('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),
+top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle=
+this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=a.handles||(!e(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",
+nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var c=this.handles.split(",");this.handles={};for(var d=0;d<c.length;d++){var f=e.trim(c[d]),g=e('<div class="ui-resizable-handle '+("ui-resizable-"+f)+'"></div>');/sw|se|ne|nw/.test(f)&&g.css({zIndex:++a.zIndex});"se"==f&&g.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[f]=".ui-resizable-"+f;this.element.append(g)}}this._renderAxis=function(h){h=h||this.element;for(var i in this.handles){if(this.handles[i].constructor==
+String)this.handles[i]=e(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var j=e(this.handles[i],this.element),l=0;l=/sw|ne|nw|se|n|s/.test(i)?j.outerHeight():j.outerWidth();j=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join("");h.css(j,l);this._proportionallyResize()}e(this.handles[i])}};this._renderAxis(this.element);this._handles=e(".ui-resizable-handle",this.element).disableSelection();
+this._handles.mouseover(function(){if(!b.resizing){if(this.className)var h=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=h&&h[1]?h[1]:"se"}});if(a.autoHide){this._handles.hide();e(this.element).addClass("ui-resizable-autohide").hover(function(){if(!a.disabled){e(this).removeClass("ui-resizable-autohide");b._handles.show()}},function(){if(!a.disabled)if(!b.resizing){e(this).addClass("ui-resizable-autohide");b._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();
+var b=function(c){e(c).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){b(this.element);var a=this.element;a.after(this.originalElement.css({position:a.css("position"),width:a.outerWidth(),height:a.outerHeight(),top:a.css("top"),left:a.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);b(this.originalElement);return this},_mouseCapture:function(b){var a=
+false;for(var c in this.handles)if(e(this.handles[c])[0]==b.target)a=true;return!this.options.disabled&&a},_mouseStart:function(b){var a=this.options,c=this.element.position(),d=this.element;this.resizing=true;this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:c.top,left:c.left});e.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"});
+this._renderProxy();c=m(this.helper.css("left"));var f=m(this.helper.css("top"));if(a.containment){c+=e(a.containment).scrollLeft()||0;f+=e(a.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:c,top:f};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:c,top:f};this.sizeDiff=
+{width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:b.pageX,top:b.pageY};this.aspectRatio=typeof a.aspectRatio=="number"?a.aspectRatio:this.originalSize.width/this.originalSize.height||1;a=e(".ui-resizable-"+this.axis).css("cursor");e("body").css("cursor",a=="auto"?this.axis+"-resize":a);d.addClass("ui-resizable-resizing");this._propagate("start",b);return true},_mouseDrag:function(b){var a=this.helper,c=this.originalMousePosition,d=this._change[this.axis];
+if(!d)return false;c=d.apply(this,[b,b.pageX-c.left||0,b.pageY-c.top||0]);this._updateVirtualBoundaries(b.shiftKey);if(this._aspectRatio||b.shiftKey)c=this._updateRatio(c,b);c=this._respectSize(c,b);this._propagate("resize",b);a.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(c);this._trigger("resize",b,this.ui());return false},
+_mouseStop:function(b){this.resizing=false;var a=this.options,c=this;if(this._helper){var d=this._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName);d=f&&e.ui.hasScroll(d[0],"left")?0:c.sizeDiff.height;f=f?0:c.sizeDiff.width;f={width:c.helper.width()-f,height:c.helper.height()-d};d=parseInt(c.element.css("left"),10)+(c.position.left-c.originalPosition.left)||null;var g=parseInt(c.element.css("top"),10)+(c.position.top-c.originalPosition.top)||null;a.animate||this.element.css(e.extend(f,
+{top:g,left:d}));c.helper.height(c.size.height);c.helper.width(c.size.width);this._helper&&!a.animate&&this._proportionallyResize()}e("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",b);this._helper&&this.helper.remove();return false},_updateVirtualBoundaries:function(b){var a=this.options,c,d,f;a={minWidth:k(a.minWidth)?a.minWidth:0,maxWidth:k(a.maxWidth)?a.maxWidth:Infinity,minHeight:k(a.minHeight)?a.minHeight:0,maxHeight:k(a.maxHeight)?a.maxHeight:
+Infinity};if(this._aspectRatio||b){b=a.minHeight*this.aspectRatio;d=a.minWidth/this.aspectRatio;c=a.maxHeight*this.aspectRatio;f=a.maxWidth/this.aspectRatio;if(b>a.minWidth)a.minWidth=b;if(d>a.minHeight)a.minHeight=d;if(c<a.maxWidth)a.maxWidth=c;if(f<a.maxHeight)a.maxHeight=f}this._vBoundaries=a},_updateCache:function(b){this.offset=this.helper.offset();if(k(b.left))this.position.left=b.left;if(k(b.top))this.position.top=b.top;if(k(b.height))this.size.height=b.height;if(k(b.width))this.size.width=
+b.width},_updateRatio:function(b){var a=this.position,c=this.size,d=this.axis;if(k(b.height))b.width=b.height*this.aspectRatio;else if(k(b.width))b.height=b.width/this.aspectRatio;if(d=="sw"){b.left=a.left+(c.width-b.width);b.top=null}if(d=="nw"){b.top=a.top+(c.height-b.height);b.left=a.left+(c.width-b.width)}return b},_respectSize:function(b){var a=this._vBoundaries,c=this.axis,d=k(b.width)&&a.maxWidth&&a.maxWidth<b.width,f=k(b.height)&&a.maxHeight&&a.maxHeight<b.height,g=k(b.width)&&a.minWidth&&
+a.minWidth>b.width,h=k(b.height)&&a.minHeight&&a.minHeight>b.height;if(g)b.width=a.minWidth;if(h)b.height=a.minHeight;if(d)b.width=a.maxWidth;if(f)b.height=a.maxHeight;var i=this.originalPosition.left+this.originalSize.width,j=this.position.top+this.size.height,l=/sw|nw|w/.test(c);c=/nw|ne|n/.test(c);if(g&&l)b.left=i-a.minWidth;if(d&&l)b.left=i-a.maxWidth;if(h&&c)b.top=j-a.minHeight;if(f&&c)b.top=j-a.maxHeight;if((a=!b.width&&!b.height)&&!b.left&&b.top)b.top=null;else if(a&&!b.top&&b.left)b.left=
+null;return b},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var b=this.helper||this.element,a=0;a<this._proportionallyResizeElements.length;a++){var c=this._proportionallyResizeElements[a];if(!this.borderDif){var d=[c.css("borderTopWidth"),c.css("borderRightWidth"),c.css("borderBottomWidth"),c.css("borderLeftWidth")],f=[c.css("paddingTop"),c.css("paddingRight"),c.css("paddingBottom"),c.css("paddingLeft")];this.borderDif=e.map(d,function(g,h){g=parseInt(g,10)||
+0;h=parseInt(f[h],10)||0;return g+h})}e.browser.msie&&(e(b).is(":hidden")||e(b).parents(":hidden").length)||c.css({height:b.height()-this.borderDif[0]-this.borderDif[2]||0,width:b.width()-this.borderDif[1]-this.borderDif[3]||0})}},_renderProxy:function(){var b=this.options;this.elementOffset=this.element.offset();if(this._helper){this.helper=this.helper||e('<div style="overflow:hidden;"></div>');var a=e.browser.msie&&e.browser.version<7,c=a?1:0;a=a?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+
+a,height:this.element.outerHeight()+a,position:"absolute",left:this.elementOffset.left-c+"px",top:this.elementOffset.top-c+"px",zIndex:++b.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(b,a){return{width:this.originalSize.width+a}},w:function(b,a){return{left:this.originalPosition.left+a,width:this.originalSize.width-a}},n:function(b,a,c){return{top:this.originalPosition.top+c,height:this.originalSize.height-c}},s:function(b,a,c){return{height:this.originalSize.height+
+c}},se:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},sw:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,a,c]))},ne:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},nw:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,a,c]))}},_propagate:function(b,a){e.ui.plugin.call(this,b,[a,this.ui()]);
+b!="resize"&&this._trigger(b,a,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});e.extend(e.ui.resizable,{version:"1.8.14"});e.ui.plugin.add("resizable","alsoResize",{start:function(){var b=e(this).data("resizable").options,a=function(c){e(c).each(function(){var d=e(this);d.data("resizable-alsoresize",{width:parseInt(d.width(),
+10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};if(typeof b.alsoResize=="object"&&!b.alsoResize.parentNode)if(b.alsoResize.length){b.alsoResize=b.alsoResize[0];a(b.alsoResize)}else e.each(b.alsoResize,function(c){a(c)});else a(b.alsoResize)},resize:function(b,a){var c=e(this).data("resizable");b=c.options;var d=c.originalSize,f=c.originalPosition,g={height:c.size.height-d.height||0,width:c.size.width-d.width||0,top:c.position.top-
+f.top||0,left:c.position.left-f.left||0},h=function(i,j){e(i).each(function(){var l=e(this),q=e(this).data("resizable-alsoresize"),p={},r=j&&j.length?j:l.parents(a.originalElement[0]).length?["width","height"]:["width","height","top","left"];e.each(r,function(n,o){if((n=(q[o]||0)+(g[o]||0))&&n>=0)p[o]=n||null});if(e.browser.opera&&/relative/.test(l.css("position"))){c._revertToRelativePosition=true;l.css({position:"absolute",top:"auto",left:"auto"})}l.css(p)})};typeof b.alsoResize=="object"&&!b.alsoResize.nodeType?
+e.each(b.alsoResize,function(i,j){h(i,j)}):h(b.alsoResize)},stop:function(){var b=e(this).data("resizable"),a=b.options,c=function(d){e(d).each(function(){var f=e(this);f.css({position:f.data("resizable-alsoresize").position})})};if(b._revertToRelativePosition){b._revertToRelativePosition=false;typeof a.alsoResize=="object"&&!a.alsoResize.nodeType?e.each(a.alsoResize,function(d){c(d)}):c(a.alsoResize)}e(this).removeData("resizable-alsoresize")}});e.ui.plugin.add("resizable","animate",{stop:function(b){var a=
+e(this).data("resizable"),c=a.options,d=a._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName),g=f&&e.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height;f={width:a.size.width-(f?0:a.sizeDiff.width),height:a.size.height-g};g=parseInt(a.element.css("left"),10)+(a.position.left-a.originalPosition.left)||null;var h=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;a.element.animate(e.extend(f,h&&g?{top:h,left:g}:{}),{duration:c.animateDuration,easing:c.animateEasing,
+step:function(){var i={width:parseInt(a.element.css("width"),10),height:parseInt(a.element.css("height"),10),top:parseInt(a.element.css("top"),10),left:parseInt(a.element.css("left"),10)};d&&d.length&&e(d[0]).css({width:i.width,height:i.height});a._updateCache(i);a._propagate("resize",b)}})}});e.ui.plugin.add("resizable","containment",{start:function(){var b=e(this).data("resizable"),a=b.element,c=b.options.containment;if(a=c instanceof e?c.get(0):/parent/.test(c)?a.parent().get(0):c){b.containerElement=
+e(a);if(/document/.test(c)||c==document){b.containerOffset={left:0,top:0};b.containerPosition={left:0,top:0};b.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()||document.body.parentNode.scrollHeight}}else{var d=e(a),f=[];e(["Top","Right","Left","Bottom"]).each(function(i,j){f[i]=m(d.css("padding"+j))});b.containerOffset=d.offset();b.containerPosition=d.position();b.containerSize={height:d.innerHeight()-f[3],width:d.innerWidth()-f[1]};c=b.containerOffset;
+var g=b.containerSize.height,h=b.containerSize.width;h=e.ui.hasScroll(a,"left")?a.scrollWidth:h;g=e.ui.hasScroll(a)?a.scrollHeight:g;b.parentData={element:a,left:c.left,top:c.top,width:h,height:g}}}},resize:function(b){var a=e(this).data("resizable"),c=a.options,d=a.containerOffset,f=a.position;b=a._aspectRatio||b.shiftKey;var g={top:0,left:0},h=a.containerElement;if(h[0]!=document&&/static/.test(h.css("position")))g=d;if(f.left<(a._helper?d.left:0)){a.size.width+=a._helper?a.position.left-d.left:
+a.position.left-g.left;if(b)a.size.height=a.size.width/c.aspectRatio;a.position.left=c.helper?d.left:0}if(f.top<(a._helper?d.top:0)){a.size.height+=a._helper?a.position.top-d.top:a.position.top;if(b)a.size.width=a.size.height*c.aspectRatio;a.position.top=a._helper?d.top:0}a.offset.left=a.parentData.left+a.position.left;a.offset.top=a.parentData.top+a.position.top;c=Math.abs((a._helper?a.offset.left-g.left:a.offset.left-g.left)+a.sizeDiff.width);d=Math.abs((a._helper?a.offset.top-g.top:a.offset.top-
+d.top)+a.sizeDiff.height);f=a.containerElement.get(0)==a.element.parent().get(0);g=/relative|absolute/.test(a.containerElement.css("position"));if(f&&g)c-=a.parentData.left;if(c+a.size.width>=a.parentData.width){a.size.width=a.parentData.width-c;if(b)a.size.height=a.size.width/a.aspectRatio}if(d+a.size.height>=a.parentData.height){a.size.height=a.parentData.height-d;if(b)a.size.width=a.size.height*a.aspectRatio}},stop:function(){var b=e(this).data("resizable"),a=b.options,c=b.containerOffset,d=b.containerPosition,
+f=b.containerElement,g=e(b.helper),h=g.offset(),i=g.outerWidth()-b.sizeDiff.width;g=g.outerHeight()-b.sizeDiff.height;b._helper&&!a.animate&&/relative/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g});b._helper&&!a.animate&&/static/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g})}});e.ui.plugin.add("resizable","ghost",{start:function(){var b=e(this).data("resizable"),a=b.options,c=b.size;b.ghost=b.originalElement.clone();b.ghost.css({opacity:0.25,
+display:"block",position:"relative",height:c.height,width:c.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof a.ghost=="string"?a.ghost:"");b.ghost.appendTo(b.helper)},resize:function(){var b=e(this).data("resizable");b.ghost&&b.ghost.css({position:"relative",height:b.size.height,width:b.size.width})},stop:function(){var b=e(this).data("resizable");b.ghost&&b.helper&&b.helper.get(0).removeChild(b.ghost.get(0))}});e.ui.plugin.add("resizable","grid",{resize:function(){var b=
+e(this).data("resizable"),a=b.options,c=b.size,d=b.originalSize,f=b.originalPosition,g=b.axis;a.grid=typeof a.grid=="number"?[a.grid,a.grid]:a.grid;var h=Math.round((c.width-d.width)/(a.grid[0]||1))*(a.grid[0]||1);a=Math.round((c.height-d.height)/(a.grid[1]||1))*(a.grid[1]||1);if(/^(se|s|e)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else if(/^(ne)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}else{if(/^(sw)$/.test(g)){b.size.width=d.width+h;b.size.height=
+d.height+a}else{b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}b.position.left=f.left-h}}});var m=function(b){return parseInt(b,10)||0},k=function(b){return!isNaN(parseInt(b,10))}})(jQuery);
+;/*
+ * jQuery UI Selectable 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Selectables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function(e){e.widget("ui.selectable",e.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var c=this;this.element.addClass("ui-selectable");this.dragged=false;var f;this.refresh=function(){f=e(c.options.filter,c.element[0]);f.each(function(){var d=e(this),b=d.offset();e.data(this,"selectable-item",{element:this,$element:d,left:b.left,top:b.top,right:b.left+d.outerWidth(),bottom:b.top+d.outerHeight(),startselected:false,selected:d.hasClass("ui-selected"),
+selecting:d.hasClass("ui-selecting"),unselecting:d.hasClass("ui-unselecting")})})};this.refresh();this.selectees=f.addClass("ui-selectee");this._mouseInit();this.helper=e("<div class='ui-selectable-helper'></div>")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(c){var f=this;this.opos=[c.pageX,
+c.pageY];if(!this.options.disabled){var d=this.options;this.selectees=e(d.filter,this.element[0]);this._trigger("start",c);e(d.appendTo).append(this.helper);this.helper.css({left:c.clientX,top:c.clientY,width:0,height:0});d.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var b=e.data(this,"selectable-item");b.startselected=true;if(!c.metaKey){b.$element.removeClass("ui-selected");b.selected=false;b.$element.addClass("ui-unselecting");b.unselecting=true;f._trigger("unselecting",
+c,{unselecting:b.element})}});e(c.target).parents().andSelf().each(function(){var b=e.data(this,"selectable-item");if(b){var g=!c.metaKey||!b.$element.hasClass("ui-selected");b.$element.removeClass(g?"ui-unselecting":"ui-selected").addClass(g?"ui-selecting":"ui-unselecting");b.unselecting=!g;b.selecting=g;(b.selected=g)?f._trigger("selecting",c,{selecting:b.element}):f._trigger("unselecting",c,{unselecting:b.element});return false}})}},_mouseDrag:function(c){var f=this;this.dragged=true;if(!this.options.disabled){var d=
+this.options,b=this.opos[0],g=this.opos[1],h=c.pageX,i=c.pageY;if(b>h){var j=h;h=b;b=j}if(g>i){j=i;i=g;g=j}this.helper.css({left:b,top:g,width:h-b,height:i-g});this.selectees.each(function(){var a=e.data(this,"selectable-item");if(!(!a||a.element==f.element[0])){var k=false;if(d.tolerance=="touch")k=!(a.left>h||a.right<b||a.top>i||a.bottom<g);else if(d.tolerance=="fit")k=a.left>b&&a.right<h&&a.top>g&&a.bottom<i;if(k){if(a.selected){a.$element.removeClass("ui-selected");a.selected=false}if(a.unselecting){a.$element.removeClass("ui-unselecting");
+a.unselecting=false}if(!a.selecting){a.$element.addClass("ui-selecting");a.selecting=true;f._trigger("selecting",c,{selecting:a.element})}}else{if(a.selecting)if(c.metaKey&&a.startselected){a.$element.removeClass("ui-selecting");a.selecting=false;a.$element.addClass("ui-selected");a.selected=true}else{a.$element.removeClass("ui-selecting");a.selecting=false;if(a.startselected){a.$element.addClass("ui-unselecting");a.unselecting=true}f._trigger("unselecting",c,{unselecting:a.element})}if(a.selected)if(!c.metaKey&&
+!a.startselected){a.$element.removeClass("ui-selected");a.selected=false;a.$element.addClass("ui-unselecting");a.unselecting=true;f._trigger("unselecting",c,{unselecting:a.element})}}}});return false}},_mouseStop:function(c){var f=this;this.dragged=false;e(".ui-unselecting",this.element[0]).each(function(){var d=e.data(this,"selectable-item");d.$element.removeClass("ui-unselecting");d.unselecting=false;d.startselected=false;f._trigger("unselected",c,{unselected:d.element})});e(".ui-selecting",this.element[0]).each(function(){var d=
+e.data(this,"selectable-item");d.$element.removeClass("ui-selecting").addClass("ui-selected");d.selecting=false;d.selected=true;d.startselected=true;f._trigger("selected",c,{selected:d.element})});this._trigger("stop",c);this.helper.remove();return false}});e.extend(e.ui.selectable,{version:"1.8.14"})})(jQuery);
+;/*
+ * jQuery UI Sortable 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Sortables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function(d){d.widget("ui.sortable",d.ui.mouse,{widgetEventPrefix:"sort",options:{appendTo:"parent",axis:false,connectWith:false,containment:false,cursor:"auto",cursorAt:false,dropOnEmpty:true,forcePlaceholderSize:false,forceHelperSize:false,grid:false,handle:false,helper:"original",items:"> *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){var a=this.options;this.containerCache={};this.element.addClass("ui-sortable");
+this.refresh();this.floating=this.items.length?a.axis==="x"||/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var a=this.items.length-1;a>=0;a--)this.items[a].item.removeData("sortable-item");return this},_setOption:function(a,b){if(a===
+"disabled"){this.options[a]=b;this.widget()[b?"addClass":"removeClass"]("ui-sortable-disabled")}else d.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(a,b){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(a);var c=null,e=this;d(a.target).parents().each(function(){if(d.data(this,"sortable-item")==e){c=d(this);return false}});if(d.data(a.target,"sortable-item")==e)c=d(a.target);if(!c)return false;if(this.options.handle&&
+!b){var f=false;d(this.options.handle,c).find("*").andSelf().each(function(){if(this==a.target)f=true});if(!f)return false}this.currentItem=c;this._removeCurrentsFromItems();return true},_mouseStart:function(a,b,c){b=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(a);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top,
+left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]};
+this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();b.containment&&this._setContainment();if(b.cursor){if(d("body").css("cursor"))this._storedCursor=d("body").css("cursor");d("body").css("cursor",b.cursor)}if(b.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",b.opacity)}if(b.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",b.zIndex)}if(this.scrollParent[0]!=
+document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",a,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!c)for(c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("activate",a,e._uiHash(this));if(d.ui.ddmanager)d.ui.ddmanager.current=this;d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(a);
+return true},_mouseDrag:function(a){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var b=this.options,c=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-a.pageY<b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop+b.scrollSpeed;else if(a.pageY-this.overflowOffset.top<
+b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop-b.scrollSpeed;if(this.overflowOffset.left+this.scrollParent[0].offsetWidth-a.pageX<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft+b.scrollSpeed;else if(a.pageX-this.overflowOffset.left<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft-b.scrollSpeed}else{if(a.pageY-d(document).scrollTop()<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()-
+b.scrollSpeed);else if(d(window).height()-(a.pageY-d(document).scrollTop())<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()+b.scrollSpeed);if(a.pageX-d(document).scrollLeft()<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()-b.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()+b.scrollSpeed)}c!==false&&d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,
+a)}this.positionAbs=this._convertPositionTo("absolute");if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";for(b=this.items.length-1;b>=0;b--){c=this.items[b];var e=c.item[0],f=this._intersectsWithPointer(c);if(f)if(e!=this.currentItem[0]&&this.placeholder[f==1?"next":"prev"]()[0]!=e&&!d.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!d.ui.contains(this.element[0],
+e):true)){this.direction=f==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(c))this._rearrange(a,c);else break;this._trigger("change",a,this._uiHash());break}}this._contactContainers(a);d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);this._trigger("sort",a,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(a,b){if(a){d.ui.ddmanager&&!this.options.dropBehaviour&&d.ui.ddmanager.drop(this,a);if(this.options.revert){var c=this;b=c.placeholder.offset();
+c.reverting=true;d(this.helper).animate({left:b.left-this.offset.parent.left-c.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:b.top-this.offset.parent.top-c.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){c._clear(a)})}else this._clear(a,b);return false}},cancel:function(){var a=this;if(this.dragging){this._mouseUp({target:null});this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"):
+this.currentItem.show();for(var b=this.containers.length-1;b>=0;b--){this.containers[b]._trigger("deactivate",null,a._uiHash(this));if(this.containers[b].containerCache.over){this.containers[b]._trigger("out",null,a._uiHash(this));this.containers[b].containerCache.over=0}}}if(this.placeholder){this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();d.extend(this,{helper:null,
+dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?d(this.domPosition.prev).after(this.currentItem):d(this.domPosition.parent).prepend(this.currentItem)}return this},serialize:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};d(b).each(function(){var e=(d(a.item||this).attr(a.attribute||"id")||"").match(a.expression||/(.+)[-=_](.+)/);if(e)c.push((a.key||e[1]+"[]")+"="+(a.key&&a.expression?e[1]:e[2]))});!c.length&&a.key&&c.push(a.key+"=");return c.join("&")},
+toArray:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};b.each(function(){c.push(d(a.item||this).attr(a.attribute||"id")||"")});return c},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,e=this.positionAbs.top,f=e+this.helperProportions.height,g=a.left,h=g+a.width,i=a.top,k=i+a.height,j=this.offset.click.top,l=this.offset.click.left;j=e+j>i&&e+j<k&&b+l>g&&b+l<h;return this.options.tolerance=="pointer"||this.options.forcePointerForContainers||
+this.options.tolerance!="pointer"&&this.helperProportions[this.floating?"width":"height"]>a[this.floating?"width":"height"]?j:g<b+this.helperProportions.width/2&&c-this.helperProportions.width/2<h&&i<e+this.helperProportions.height/2&&f-this.helperProportions.height/2<k},_intersectsWithPointer:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left,a.width);b=b&&a;a=this._getDragVerticalDirection();
+var c=this._getDragHorizontalDirection();if(!b)return false;return this.floating?c&&c=="right"||a=="down"?2:1:a&&(a=="down"?2:1)},_intersectsWithSides:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top+a.height/2,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left+a.width/2,a.width);var c=this._getDragVerticalDirection(),e=this._getDragHorizontalDirection();return this.floating&&e?e=="right"&&a||e=="left"&&!a:c&&(c=="down"&&b||c=="up"&&!b)},
+_getDragVerticalDirection:function(){var a=this.positionAbs.top-this.lastPositionAbs.top;return a!=0&&(a>0?"down":"up")},_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){this._refreshItems(a);this.refreshPositions();return this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(a){var b=[],c=[],e=this._connectWith();
+if(e&&a)for(a=e.length-1;a>=0;a--)for(var f=d(e[a]),g=f.length-1;g>=0;g--){var h=d.data(f[g],"sortable");if(h&&h!=this&&!h.options.disabled)c.push([d.isFunction(h.options.items)?h.options.items.call(h.element):d(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}c.push([d.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):d(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),
+this]);for(a=c.length-1;a>=0;a--)c[a][0].each(function(){b.push(this)});return d(b)},_removeCurrentsFromItems:function(){for(var a=this.currentItem.find(":data(sortable-item)"),b=0;b<this.items.length;b++)for(var c=0;c<a.length;c++)a[c]==this.items[b].item[0]&&this.items.splice(b,1)},_refreshItems:function(a){this.items=[];this.containers=[this];var b=this.items,c=[[d.isFunction(this.options.items)?this.options.items.call(this.element[0],a,{item:this.currentItem}):d(this.options.items,this.element),
+this]],e=this._connectWith();if(e)for(var f=e.length-1;f>=0;f--)for(var g=d(e[f]),h=g.length-1;h>=0;h--){var i=d.data(g[h],"sortable");if(i&&i!=this&&!i.options.disabled){c.push([d.isFunction(i.options.items)?i.options.items.call(i.element[0],a,{item:this.currentItem}):d(i.options.items,i.element),i]);this.containers.push(i)}}for(f=c.length-1;f>=0;f--){a=c[f][1];e=c[f][0];h=0;for(g=e.length;h<g;h++){i=d(e[h]);i.data("sortable-item",a);b.push({item:i,instance:a,width:0,height:0,left:0,top:0})}}},refreshPositions:function(a){if(this.offsetParent&&
+this.helper)this.offset.parent=this._getParentOffset();for(var b=this.items.length-1;b>=0;b--){var c=this.items[b];if(!(c.instance!=this.currentContainer&&this.currentContainer&&c.item[0]!=this.currentItem[0])){var e=this.options.toleranceElement?d(this.options.toleranceElement,c.item):c.item;if(!a){c.width=e.outerWidth();c.height=e.outerHeight()}e=e.offset();c.left=e.left;c.top=e.top}}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(b=
+this.containers.length-1;b>=0;b--){e=this.containers[b].element.offset();this.containers[b].containerCache.left=e.left;this.containers[b].containerCache.top=e.top;this.containers[b].containerCache.width=this.containers[b].element.outerWidth();this.containers[b].containerCache.height=this.containers[b].element.outerHeight()}return this},_createPlaceholder:function(a){var b=a||this,c=b.options;if(!c.placeholder||c.placeholder.constructor==String){var e=c.placeholder;c.placeholder={element:function(){var f=
+d(document.createElement(b.currentItem[0].nodeName)).addClass(e||b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!e)f.style.visibility="hidden";return f},update:function(f,g){if(!(e&&!c.forcePlaceholderSize)){g.height()||g.height(b.currentItem.innerHeight()-parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10));g.width()||g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")||
+0,10))}}}}b.placeholder=d(c.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder);c.placeholder.update(b,b.placeholder)},_contactContainers:function(a){for(var b=null,c=null,e=this.containers.length-1;e>=0;e--)if(!d.ui.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(b&&d.ui.contains(this.containers[e].element[0],b.element[0]))){b=this.containers[e];c=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out",
+a,this._uiHash(this));this.containers[e].containerCache.over=0}if(b)if(this.containers.length===1){this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}else if(this.currentContainer!=this.containers[c]){b=1E4;e=null;for(var f=this.positionAbs[this.containers[c].floating?"left":"top"],g=this.items.length-1;g>=0;g--)if(d.ui.contains(this.containers[c].element[0],this.items[g].item[0])){var h=this.items[g][this.containers[c].floating?"left":"top"];if(Math.abs(h-
+f)<b){b=Math.abs(h-f);e=this.items[g]}}if(e||this.options.dropOnEmpty){this.currentContainer=this.containers[c];e?this._rearrange(a,e,null,true):this._rearrange(a,null,this.containers[c].element,true);this._trigger("change",a,this._uiHash());this.containers[c]._trigger("change",a,this._uiHash(this));this.options.placeholder.update(this.currentContainer,this.placeholder);this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}}},_createHelper:function(a){var b=
+this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a,this.currentItem])):b.helper=="clone"?this.currentItem.clone():this.currentItem;a.parents("body").length||d(b.appendTo!="parent"?b.appendTo:this.currentItem[0].parentNode)[0].appendChild(a[0]);if(a[0]==this.currentItem[0])this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")};if(a[0].style.width==
+""||b.forceHelperSize)a.width(this.currentItem.width());if(a[0].style.height==""||b.forceHelperSize)a.height(this.currentItem.height());return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=
+this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a=
+{top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.currentItem.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.currentItem.css("marginLeft"),
+10)||0,top:parseInt(this.currentItem.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,d(a.containment=="document"?
+document:window).width()-this.helperProportions.width-this.margins.left,(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)){var b=d(a.containment)[0];a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0)-this.margins.left,a.top+(parseInt(d(b).css("borderTopWidth"),
+10)||0)+(parseInt(d(b).css("paddingTop"),10)||0)-this.margins.top,a.left+(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(a,b){if(!b)b=
+this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&
+this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);if(this.cssPosition=="relative"&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0]))this.offset.relative=this._getRelativeOffset();
+var f=a.pageX,g=a.pageY;if(this.originalPosition){if(this.containment){if(a.pageX-this.offset.click.left<this.containment[0])f=this.containment[0]+this.offset.click.left;if(a.pageY-this.offset.click.top<this.containment[1])g=this.containment[1]+this.offset.click.top;if(a.pageX-this.offset.click.left>this.containment[2])f=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-
+this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.top<this.containment[1]||g-this.offset.click.top>this.containment[3])?g:!(g-this.offset.click.top<this.containment[1])?g-b.grid[1]:g+b.grid[1]:g;f=this.originalPageX+Math.round((f-this.originalPageX)/b.grid[0])*b.grid[0];f=this.containment?!(f-this.offset.click.left<this.containment[0]||f-this.offset.click.left>this.containment[2])?f:!(f-this.offset.click.left<this.containment[0])?f-b.grid[0]:f+b.grid[0]:f}}return{top:g-
+this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop()),left:f-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:c.scrollLeft())}},_rearrange:function(a,b,c,e){c?c[0].appendChild(this.placeholder[0]):b.item[0].parentNode.insertBefore(this.placeholder[0],
+this.direction=="down"?b.item[0]:b.item[0].nextSibling);this.counter=this.counter?++this.counter:1;var f=this,g=this.counter;window.setTimeout(function(){g==f.counter&&f.refreshPositions(!e)},0)},_clear:function(a,b){this.reverting=false;var c=[];!this._noFinalSort&&this.currentItem.parent().length&&this.placeholder.before(this.currentItem);this._noFinalSort=null;if(this.helper[0]==this.currentItem[0]){for(var e in this._storedCSS)if(this._storedCSS[e]=="auto"||this._storedCSS[e]=="static")this._storedCSS[e]=
+"";this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else this.currentItem.show();this.fromOutside&&!b&&c.push(function(f){this._trigger("receive",f,this._uiHash(this.fromOutside))});if((this.fromOutside||this.domPosition.prev!=this.currentItem.prev().not(".ui-sortable-helper")[0]||this.domPosition.parent!=this.currentItem.parent()[0])&&!b)c.push(function(f){this._trigger("update",f,this._uiHash())});if(!d.ui.contains(this.element[0],this.currentItem[0])){b||c.push(function(f){this._trigger("remove",
+f,this._uiHash())});for(e=this.containers.length-1;e>=0;e--)if(d.ui.contains(this.containers[e].element[0],this.currentItem[0])&&!b){c.push(function(f){return function(g){f._trigger("receive",g,this._uiHash(this))}}.call(this,this.containers[e]));c.push(function(f){return function(g){f._trigger("update",g,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){b||c.push(function(f){return function(g){f._trigger("deactivate",g,this._uiHash(this))}}.call(this,
+this.containers[e]));if(this.containers[e].containerCache.over){c.push(function(f){return function(g){f._trigger("out",g,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over=0}}this._storedCursor&&d("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!b){this._trigger("beforeStop",
+a,this._uiHash());for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}return false}b||this._trigger("beforeStop",a,this._uiHash());this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.helper[0]!=this.currentItem[0]&&this.helper.remove();this.helper=null;if(!b){for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}this.fromOutside=false;return true},_trigger:function(){d.Widget.prototype._trigger.apply(this,arguments)===false&&this.cancel()},
+_uiHash:function(a){var b=a||this;return{helper:b.helper,placeholder:b.placeholder||d([]),position:b.position,originalPosition:b.originalPosition,offset:b.positionAbs,item:b.currentItem,sender:a?a.element:null}}});d.extend(d.ui.sortable,{version:"1.8.14"})})(jQuery);
+;/*
+ * jQuery UI Accordion 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Accordion
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function(c){c.widget("ui.accordion",{options:{active:0,animated:"slide",autoHeight:true,clearStyle:false,collapsible:false,event:"click",fillSpace:false,header:"> li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var a=this,b=a.options;a.running=0;a.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix");
+a.headers=a.element.find(b.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){b.disabled||c(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){b.disabled||c(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){b.disabled||c(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){b.disabled||c(this).removeClass("ui-state-focus")});a.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");
+if(b.navigation){var d=a.element.find("a").filter(b.navigationFilter).eq(0);if(d.length){var h=d.closest(".ui-accordion-header");a.active=h.length?h:d.closest(".ui-accordion-content").prev()}}a.active=a._findActive(a.active||b.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");a.active.next().addClass("ui-accordion-content-active");a._createIcons();a.resize();a.element.attr("role","tablist");a.headers.attr("role","tab").bind("keydown.accordion",
+function(f){return a._keydown(f)}).next().attr("role","tabpanel");a.headers.not(a.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide();a.active.length?a.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}):a.headers.eq(0).attr("tabIndex",0);c.browser.safari||a.headers.find("a").attr("tabIndex",-1);b.event&&a.headers.bind(b.event.split(" ").join(".accordion ")+".accordion",function(f){a._clickHandler.call(a,f,this);f.preventDefault()})},_createIcons:function(){var a=
+this.options;if(a.icons){c("<span></span>").addClass("ui-icon "+a.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(a.icons.header).toggleClass(a.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var a=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex");
+this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var b=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(a.autoHeight||a.fillHeight)b.css("height","");return c.Widget.prototype.destroy.call(this)},_setOption:function(a,b){c.Widget.prototype._setOption.apply(this,arguments);a=="active"&&this.activate(b);if(a=="icons"){this._destroyIcons();
+b&&this._createIcons()}if(a=="disabled")this.headers.add(this.headers.next())[b?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(a){if(!(this.options.disabled||a.altKey||a.ctrlKey)){var b=c.ui.keyCode,d=this.headers.length,h=this.headers.index(a.target),f=false;switch(a.keyCode){case b.RIGHT:case b.DOWN:f=this.headers[(h+1)%d];break;case b.LEFT:case b.UP:f=this.headers[(h-1+d)%d];break;case b.SPACE:case b.ENTER:this._clickHandler({target:a.target},a.target);
+a.preventDefault()}if(f){c(a.target).attr("tabIndex",-1);c(f).attr("tabIndex",0);f.focus();return false}return true}},resize:function(){var a=this.options,b;if(a.fillSpace){if(c.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}b=this.element.parent().height();c.browser.msie&&this.element.parent().css("overflow",d);this.headers.each(function(){b-=c(this).outerHeight(true)});this.headers.next().each(function(){c(this).height(Math.max(0,b-c(this).innerHeight()+
+c(this).height()))}).css("overflow","auto")}else if(a.autoHeight){b=0;this.headers.next().each(function(){b=Math.max(b,c(this).height("").height())}).height(b)}return this},activate:function(a){this.options.active=a;a=this._findActive(a)[0];this._clickHandler({target:a},a);return this},_findActive:function(a){return a?typeof a==="number"?this.headers.filter(":eq("+a+")"):this.headers.not(this.headers.not(a)):a===false?c([]):this.headers.filter(":eq(0)")},_clickHandler:function(a,b){var d=this.options;
+if(!d.disabled)if(a.target){a=c(a.currentTarget||b);b=a[0]===this.active[0];d.active=d.collapsible&&b?false:this.headers.index(a);if(!(this.running||!d.collapsible&&b)){var h=this.active;j=a.next();g=this.active.next();e={options:d,newHeader:b&&d.collapsible?c([]):a,oldHeader:this.active,newContent:b&&d.collapsible?c([]):j,oldContent:g};var f=this.headers.index(this.active[0])>this.headers.index(a[0]);this.active=b?c([]):a;this._toggle(j,g,e,b,f);h.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);
+if(!b){a.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected);a.next().addClass("ui-accordion-content-active")}}}else if(d.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);this.active.next().addClass("ui-accordion-content-active");var g=this.active.next(),
+e={options:d,newHeader:c([]),oldHeader:d.active,newContent:c([]),oldContent:g},j=this.active=c([]);this._toggle(j,g,e)}},_toggle:function(a,b,d,h,f){var g=this,e=g.options;g.toShow=a;g.toHide=b;g.data=d;var j=function(){if(g)return g._completed.apply(g,arguments)};g._trigger("changestart",null,g.data);g.running=b.size()===0?a.size():b.size();if(e.animated){d={};d=e.collapsible&&h?{toShow:c([]),toHide:b,complete:j,down:f,autoHeight:e.autoHeight||e.fillSpace}:{toShow:a,toHide:b,complete:j,down:f,autoHeight:e.autoHeight||
+e.fillSpace};if(!e.proxied)e.proxied=e.animated;if(!e.proxiedDuration)e.proxiedDuration=e.duration;e.animated=c.isFunction(e.proxied)?e.proxied(d):e.proxied;e.duration=c.isFunction(e.proxiedDuration)?e.proxiedDuration(d):e.proxiedDuration;h=c.ui.accordion.animations;var i=e.duration,k=e.animated;if(k&&!h[k]&&!c.easing[k])k="slide";h[k]||(h[k]=function(l){this.slide(l,{easing:k,duration:i||700})});h[k](d)}else{if(e.collapsible&&h)a.toggle();else{b.hide();a.show()}j(true)}b.prev().attr({"aria-expanded":"false",
+"aria-selected":"false",tabIndex:-1}).blur();a.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(a){this.running=a?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");if(this.toHide.length)this.toHide.parent()[0].className=this.toHide.parent()[0].className;this._trigger("change",null,this.data)}}});c.extend(c.ui.accordion,{version:"1.8.14",
+animations:{slide:function(a,b){a=c.extend({easing:"swing",duration:300},a,b);if(a.toHide.size())if(a.toShow.size()){var d=a.toShow.css("overflow"),h=0,f={},g={},e;b=a.toShow;e=b[0].style.width;b.width(parseInt(b.parent().width(),10)-parseInt(b.css("paddingLeft"),10)-parseInt(b.css("paddingRight"),10)-(parseInt(b.css("borderLeftWidth"),10)||0)-(parseInt(b.css("borderRightWidth"),10)||0));c.each(["height","paddingTop","paddingBottom"],function(j,i){g[i]="hide";j=(""+c.css(a.toShow[0],i)).match(/^([\d+-.]+)(.*)$/);
+f[i]={value:j[1],unit:j[2]||"px"}});a.toShow.css({height:0,overflow:"hidden"}).show();a.toHide.filter(":hidden").each(a.complete).end().filter(":visible").animate(g,{step:function(j,i){if(i.prop=="height")h=i.end-i.start===0?0:(i.now-i.start)/(i.end-i.start);a.toShow[0].style[i.prop]=h*f[i.prop].value+f[i.prop].unit},duration:a.duration,easing:a.easing,complete:function(){a.autoHeight||a.toShow.css("height","");a.toShow.css({width:e,overflow:d});a.complete()}})}else a.toHide.animate({height:"hide",
+paddingTop:"hide",paddingBottom:"hide"},a);else a.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},a)},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1E3:200})}}})})(jQuery);
+;/*
+ * jQuery UI Autocomplete 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Autocomplete
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.position.js
+ */
+(function(d){var e=0;d.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:false,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var a=this,b=this.element[0].ownerDocument,g;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(!(a.options.disabled||a.element.attr("readonly"))){g=
+false;var f=d.ui.keyCode;switch(c.keyCode){case f.PAGE_UP:a._move("previousPage",c);break;case f.PAGE_DOWN:a._move("nextPage",c);break;case f.UP:a._move("previous",c);c.preventDefault();break;case f.DOWN:a._move("next",c);c.preventDefault();break;case f.ENTER:case f.NUMPAD_ENTER:if(a.menu.active){g=true;c.preventDefault()}case f.TAB:if(!a.menu.active)return;a.menu.select(c);break;case f.ESCAPE:a.element.val(a.term);a.close(c);break;default:clearTimeout(a.searching);a.searching=setTimeout(function(){if(a.term!=
+a.element.val()){a.selectedItem=null;a.search(null,c)}},a.options.delay);break}}}).bind("keypress.autocomplete",function(c){if(g){g=false;c.preventDefault()}}).bind("focus.autocomplete",function(){if(!a.options.disabled){a.selectedItem=null;a.previous=a.element.val()}}).bind("blur.autocomplete",function(c){if(!a.options.disabled){clearTimeout(a.searching);a.closing=setTimeout(function(){a.close(c);a._change(c)},150)}});this._initSource();this.response=function(){return a._response.apply(a,arguments)};
+this.menu=d("<ul></ul>").addClass("ui-autocomplete").appendTo(d(this.options.appendTo||"body",b)[0]).mousedown(function(c){var f=a.menu.element[0];d(c.target).closest(".ui-menu-item").length||setTimeout(function(){d(document).one("mousedown",function(h){h.target!==a.element[0]&&h.target!==f&&!d.ui.contains(f,h.target)&&a.close()})},1);setTimeout(function(){clearTimeout(a.closing)},13)}).menu({focus:function(c,f){f=f.item.data("item.autocomplete");false!==a._trigger("focus",c,{item:f})&&/^key/.test(c.originalEvent.type)&&
+a.element.val(f.value)},selected:function(c,f){var h=f.item.data("item.autocomplete"),i=a.previous;if(a.element[0]!==b.activeElement){a.element.focus();a.previous=i;setTimeout(function(){a.previous=i;a.selectedItem=h},1)}false!==a._trigger("select",c,{item:h})&&a.element.val(h.value);a.term=a.element.val();a.close(c);a.selectedItem=h},blur:function(){a.menu.element.is(":visible")&&a.element.val()!==a.term&&a.element.val(a.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu");
+d.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");this.menu.element.remove();d.Widget.prototype.destroy.call(this)},_setOption:function(a,b){d.Widget.prototype._setOption.apply(this,arguments);a==="source"&&this._initSource();if(a==="appendTo")this.menu.element.appendTo(d(b||"body",this.element[0].ownerDocument)[0]);a==="disabled"&&
+b&&this.xhr&&this.xhr.abort()},_initSource:function(){var a=this,b,g;if(d.isArray(this.options.source)){b=this.options.source;this.source=function(c,f){f(d.ui.autocomplete.filter(b,c.term))}}else if(typeof this.options.source==="string"){g=this.options.source;this.source=function(c,f){a.xhr&&a.xhr.abort();a.xhr=d.ajax({url:g,data:c,dataType:"json",autocompleteRequest:++e,success:function(h){this.autocompleteRequest===e&&f(h)},error:function(){this.autocompleteRequest===e&&f([])}})}}else this.source=
+this.options.source},search:function(a,b){a=a!=null?a:this.element.val();this.term=this.element.val();if(a.length<this.options.minLength)return this.close(b);clearTimeout(this.closing);if(this._trigger("search",b)!==false)return this._search(a)},_search:function(a){this.pending++;this.element.addClass("ui-autocomplete-loading");this.source({term:a},this.response)},_response:function(a){if(!this.options.disabled&&a&&a.length){a=this._normalize(a);this._suggest(a);this._trigger("open")}else this.close();
+this.pending--;this.pending||this.element.removeClass("ui-autocomplete-loading")},close:function(a){clearTimeout(this.closing);if(this.menu.element.is(":visible")){this.menu.element.hide();this.menu.deactivate();this._trigger("close",a)}},_change:function(a){this.previous!==this.element.val()&&this._trigger("change",a,{item:this.selectedItem})},_normalize:function(a){if(a.length&&a[0].label&&a[0].value)return a;return d.map(a,function(b){if(typeof b==="string")return{label:b,value:b};return d.extend({label:b.label||
+b.value,value:b.value||b.label},b)})},_suggest:function(a){var b=this.menu.element.empty().zIndex(this.element.zIndex()+1);this._renderMenu(b,a);this.menu.deactivate();this.menu.refresh();b.show();this._resizeMenu();b.position(d.extend({of:this.element},this.options.position));this.options.autoFocus&&this.menu.next(new d.Event("mouseover"))},_resizeMenu:function(){var a=this.menu.element;a.outerWidth(Math.max(a.width("").outerWidth(),this.element.outerWidth()))},_renderMenu:function(a,b){var g=this;
+d.each(b,function(c,f){g._renderItem(a,f)})},_renderItem:function(a,b){return d("<li></li>").data("item.autocomplete",b).append(d("<a></a>").text(b.label)).appendTo(a)},_move:function(a,b){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term);this.menu.deactivate()}else this.menu[a](b);else this.search(null,b)},widget:function(){return this.menu.element}});d.extend(d.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g,
+"\\$&")},filter:function(a,b){var g=new RegExp(d.ui.autocomplete.escapeRegex(b),"i");return d.grep(a,function(c){return g.test(c.label||c.value||c)})}})})(jQuery);
+(function(d){d.widget("ui.menu",{_create:function(){var e=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(a){if(d(a.target).closest(".ui-menu-item a").length){a.preventDefault();e.select(a)}});this.refresh()},refresh:function(){var e=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex",
+-1).mouseenter(function(a){e.activate(a,d(this).parent())}).mouseleave(function(){e.deactivate()})},activate:function(e,a){this.deactivate();if(this.hasScroll()){var b=a.offset().top-this.element.offset().top,g=this.element.scrollTop(),c=this.element.height();if(b<0)this.element.scrollTop(g+b);else b>=c&&this.element.scrollTop(g+b-c+a.height())}this.active=a.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",e,{item:a})},deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id");
+this._trigger("blur");this.active=null}},next:function(e){this.move("next",".ui-menu-item:first",e)},previous:function(e){this.move("prev",".ui-menu-item:last",e)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(e,a,b){if(this.active){e=this.active[e+"All"](".ui-menu-item").eq(0);e.length?this.activate(b,e):this.activate(b,this.element.children(a))}else this.activate(b,
+this.element.children(a))},nextPage:function(e){if(this.hasScroll())if(!this.active||this.last())this.activate(e,this.element.children(".ui-menu-item:first"));else{var a=this.active.offset().top,b=this.element.height(),g=this.element.children(".ui-menu-item").filter(function(){var c=d(this).offset().top-a-b+d(this).height();return c<10&&c>-10});g.length||(g=this.element.children(".ui-menu-item:last"));this.activate(e,g)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active||
+this.last()?":first":":last"))},previousPage:function(e){if(this.hasScroll())if(!this.active||this.first())this.activate(e,this.element.children(".ui-menu-item:last"));else{var a=this.active.offset().top,b=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var g=d(this).offset().top-a+b-d(this).height();return g<10&&g>-10});result.length||(result=this.element.children(".ui-menu-item:first"));this.activate(e,result)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active||
+this.first()?":last":":first"))},hasScroll:function(){return this.element.height()<this.element[d.fn.prop?"prop":"attr"]("scrollHeight")},select:function(e){this._trigger("selected",e,{item:this.active})}})})(jQuery);
+;/*
+ * jQuery UI Button 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Button
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function(b){var h,i,j,g,l=function(){var a=b(this).find(":ui-button");setTimeout(function(){a.button("refresh")},1)},k=function(a){var c=a.name,e=a.form,f=b([]);if(c)f=e?b(e).find("[name='"+c+"']"):b("[name='"+c+"']",a.ownerDocument).filter(function(){return!this.form});return f};b.widget("ui.button",{options:{disabled:null,text:true,label:null,icons:{primary:null,secondary:null}},_create:function(){this.element.closest("form").unbind("reset.button").bind("reset.button",l);if(typeof this.options.disabled!==
+"boolean")this.options.disabled=this.element.attr("disabled");this._determineButtonType();this.hasTitle=!!this.buttonElement.attr("title");var a=this,c=this.options,e=this.type==="checkbox"||this.type==="radio",f="ui-state-hover"+(!e?" ui-state-active":"");if(c.label===null)c.label=this.buttonElement.html();if(this.element.is(":disabled"))c.disabled=true;this.buttonElement.addClass("ui-button ui-widget ui-state-default ui-corner-all").attr("role","button").bind("mouseenter.button",function(){if(!c.disabled){b(this).addClass("ui-state-hover");
+this===h&&b(this).addClass("ui-state-active")}}).bind("mouseleave.button",function(){c.disabled||b(this).removeClass(f)}).bind("click.button",function(d){if(c.disabled){d.preventDefault();d.stopImmediatePropagation()}});this.element.bind("focus.button",function(){a.buttonElement.addClass("ui-state-focus")}).bind("blur.button",function(){a.buttonElement.removeClass("ui-state-focus")});if(e){this.element.bind("change.button",function(){g||a.refresh()});this.buttonElement.bind("mousedown.button",function(d){if(!c.disabled){g=
+false;i=d.pageX;j=d.pageY}}).bind("mouseup.button",function(d){if(!c.disabled)if(i!==d.pageX||j!==d.pageY)g=true})}if(this.type==="checkbox")this.buttonElement.bind("click.button",function(){if(c.disabled||g)return false;b(this).toggleClass("ui-state-active");a.buttonElement.attr("aria-pressed",a.element[0].checked)});else if(this.type==="radio")this.buttonElement.bind("click.button",function(){if(c.disabled||g)return false;b(this).addClass("ui-state-active");a.buttonElement.attr("aria-pressed",true);
+var d=a.element[0];k(d).not(d).map(function(){return b(this).button("widget")[0]}).removeClass("ui-state-active").attr("aria-pressed",false)});else{this.buttonElement.bind("mousedown.button",function(){if(c.disabled)return false;b(this).addClass("ui-state-active");h=this;b(document).one("mouseup",function(){h=null})}).bind("mouseup.button",function(){if(c.disabled)return false;b(this).removeClass("ui-state-active")}).bind("keydown.button",function(d){if(c.disabled)return false;if(d.keyCode==b.ui.keyCode.SPACE||
+d.keyCode==b.ui.keyCode.ENTER)b(this).addClass("ui-state-active")}).bind("keyup.button",function(){b(this).removeClass("ui-state-active")});this.buttonElement.is("a")&&this.buttonElement.keyup(function(d){d.keyCode===b.ui.keyCode.SPACE&&b(this).click()})}this._setOption("disabled",c.disabled);this._resetButton()},_determineButtonType:function(){this.type=this.element.is(":checkbox")?"checkbox":this.element.is(":radio")?"radio":this.element.is("input")?"input":"button";if(this.type==="checkbox"||this.type===
+"radio"){var a=this.element.parents().filter(":last"),c="label[for="+this.element.attr("id")+"]";this.buttonElement=a.find(c);if(!this.buttonElement.length){a=a.length?a.siblings():this.element.siblings();this.buttonElement=a.filter(c);if(!this.buttonElement.length)this.buttonElement=a.find(c)}this.element.addClass("ui-helper-hidden-accessible");(a=this.element.is(":checked"))&&this.buttonElement.addClass("ui-state-active");this.buttonElement.attr("aria-pressed",a)}else this.buttonElement=this.element},
+widget:function(){return this.buttonElement},destroy:function(){this.element.removeClass("ui-helper-hidden-accessible");this.buttonElement.removeClass("ui-button ui-widget ui-state-default ui-corner-all ui-state-hover ui-state-active ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only").removeAttr("role").removeAttr("aria-pressed").html(this.buttonElement.find(".ui-button-text").html());this.hasTitle||this.buttonElement.removeAttr("title");
+b.Widget.prototype.destroy.call(this)},_setOption:function(a,c){b.Widget.prototype._setOption.apply(this,arguments);if(a==="disabled")c?this.element.attr("disabled",true):this.element.removeAttr("disabled");else this._resetButton()},refresh:function(){var a=this.element.is(":disabled");a!==this.options.disabled&&this._setOption("disabled",a);if(this.type==="radio")k(this.element[0]).each(function(){b(this).is(":checked")?b(this).button("widget").addClass("ui-state-active").attr("aria-pressed",true):
+b(this).button("widget").removeClass("ui-state-active").attr("aria-pressed",false)});else if(this.type==="checkbox")this.element.is(":checked")?this.buttonElement.addClass("ui-state-active").attr("aria-pressed",true):this.buttonElement.removeClass("ui-state-active").attr("aria-pressed",false)},_resetButton:function(){if(this.type==="input")this.options.label&&this.element.val(this.options.label);else{var a=this.buttonElement.removeClass("ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only"),
+c=b("<span></span>").addClass("ui-button-text").html(this.options.label).appendTo(a.empty()).text(),e=this.options.icons,f=e.primary&&e.secondary,d=[];if(e.primary||e.secondary){if(this.options.text)d.push("ui-button-text-icon"+(f?"s":e.primary?"-primary":"-secondary"));e.primary&&a.prepend("<span class='ui-button-icon-primary ui-icon "+e.primary+"'></span>");e.secondary&&a.append("<span class='ui-button-icon-secondary ui-icon "+e.secondary+"'></span>");if(!this.options.text){d.push(f?"ui-button-icons-only":
+"ui-button-icon-only");this.hasTitle||a.attr("title",c)}}else d.push("ui-button-text-only");a.addClass(d.join(" "))}}});b.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(a,c){a==="disabled"&&this.buttons.button("option",a,c);b.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){var a=this.element.css("direction")===
+"ltr";this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass(a?"ui-corner-left":"ui-corner-right").end().filter(":last").addClass(a?"ui-corner-right":"ui-corner-left").end().end()},destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy");
+b.Widget.prototype.destroy.call(this)}})})(jQuery);
+;/*
+ * jQuery UI Dialog 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Dialog
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.button.js
+ * jquery.ui.draggable.js
+ * jquery.ui.mouse.js
+ * jquery.ui.position.js
+ * jquery.ui.resizable.js
+ */
+(function(c,l){var m={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},n={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true},o=c.attrFn||{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true,click:true};c.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false,
+position:{my:"center",at:"center",collision:"fit",using:function(a){var b=c(this).css(a).offset().top;b<0&&c(this).css("top",a.top-b)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var a=this,b=a.options,d=b.title||"&#160;",e=c.ui.dialog.getTitleId(a.element),g=(a.uiDialog=c("<div></div>")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+
+b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(i){a.moveToTop(false,i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var f=(a.uiDialogTitlebar=c("<div></div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g),
+h=c('<a href="#"></a>').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).click(function(i){a.close(i);return false}).appendTo(f);(a.uiDialogTitlebarCloseText=c("<span></span>")).addClass("ui-icon ui-icon-closethick").text(b.closeText).appendTo(h);c("<span></span>").addClass("ui-dialog-title").attr("id",
+e).html(d).prependTo(f);if(c.isFunction(b.beforeclose)&&!c.isFunction(b.beforeClose))b.beforeClose=b.beforeclose;f.find("*").add(f).disableSelection();b.draggable&&c.fn.draggable&&a._makeDraggable();b.resizable&&c.fn.resizable&&a._makeResizable();a._createButtons(b.buttons);a._isOpen=false;c.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;a.overlay&&a.overlay.destroy();a.uiDialog.hide();a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body");
+a.uiDialog.remove();a.originalTitle&&a.element.attr("title",a.originalTitle);return a},widget:function(){return this.uiDialog},close:function(a){var b=this,d,e;if(false!==b._trigger("beforeClose",a)){b.overlay&&b.overlay.destroy();b.uiDialog.unbind("keypress.ui-dialog");b._isOpen=false;if(b.options.hide)b.uiDialog.hide(b.options.hide,function(){b._trigger("close",a)});else{b.uiDialog.hide();b._trigger("close",a)}c.ui.dialog.overlay.resize();if(b.options.modal){d=0;c(".ui-dialog").each(function(){if(this!==
+b.uiDialog[0]){e=c(this).css("z-index");isNaN(e)||(d=Math.max(d,e))}});c.ui.dialog.maxZ=d}return b}},isOpen:function(){return this._isOpen},moveToTop:function(a,b){var d=this,e=d.options;if(e.modal&&!a||!e.stack&&!e.modal)return d._trigger("focus",b);if(e.zIndex>c.ui.dialog.maxZ)c.ui.dialog.maxZ=e.zIndex;if(d.overlay){c.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=c.ui.dialog.maxZ)}a={scrollTop:d.element.attr("scrollTop"),scrollLeft:d.element.attr("scrollLeft")};c.ui.dialog.maxZ+=
+1;d.uiDialog.css("z-index",c.ui.dialog.maxZ);d.element.attr(a);d._trigger("focus",b);return d},open:function(){if(!this._isOpen){var a=this,b=a.options,d=a.uiDialog;a.overlay=b.modal?new c.ui.dialog.overlay(a):null;a._size();a._position(b.position);d.show(b.show);a.moveToTop(true);b.modal&&d.bind("keypress.ui-dialog",function(e){if(e.keyCode===c.ui.keyCode.TAB){var g=c(":tabbable",this),f=g.filter(":first");g=g.filter(":last");if(e.target===g[0]&&!e.shiftKey){f.focus(1);return false}else if(e.target===
+f[0]&&e.shiftKey){g.focus(1);return false}}});c(a.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();a._isOpen=true;a._trigger("open");return a}},_createButtons:function(a){var b=this,d=false,e=c("<div></div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=c("<div></div>").addClass("ui-dialog-buttonset").appendTo(e);b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a,
+function(){return!(d=true)});if(d){c.each(a,function(f,h){h=c.isFunction(h)?{click:h,text:f}:h;var i=c('<button type="button"></button>').click(function(){h.click.apply(b.element[0],arguments)}).appendTo(g);c.each(h,function(j,k){if(j!=="click")j in o?i[j](k):i.attr(j,k)});c.fn.button&&i.button()});e.appendTo(b.uiDialog)}},_makeDraggable:function(){function a(f){return{position:f.position,offset:f.offset}}var b=this,d=b.options,e=c(document),g;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",
+handle:".ui-dialog-titlebar",containment:"document",start:function(f,h){g=d.height==="auto"?"auto":c(this).height();c(this).height(c(this).height()).addClass("ui-dialog-dragging");b._trigger("dragStart",f,a(h))},drag:function(f,h){b._trigger("drag",f,a(h))},stop:function(f,h){d.position=[h.position.left-e.scrollLeft(),h.position.top-e.scrollTop()];c(this).removeClass("ui-dialog-dragging").height(g);b._trigger("dragStop",f,a(h));c.ui.dialog.overlay.resize()}})},_makeResizable:function(a){function b(f){return{originalPosition:f.originalPosition,
+originalSize:f.originalSize,position:f.position,size:f.size}}a=a===l?this.options.resizable:a;var d=this,e=d.options,g=d.uiDialog.css("position");a=typeof a==="string"?a:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:a,start:function(f,h){c(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",f,b(h))},resize:function(f,h){d._trigger("resize",
+f,b(h))},stop:function(f,h){c(this).removeClass("ui-dialog-resizing");e.height=c(this).height();e.width=c(this).width();d._trigger("resizeStop",f,b(h));c.ui.dialog.overlay.resize()}}).css("position",g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(a){var b=[],d=[0,0],e;if(a){if(typeof a==="string"||typeof a==="object"&&"0"in a){b=a.split?a.split(" "):
+[a[0],a[1]];if(b.length===1)b[1]=b[0];c.each(["left","top"],function(g,f){if(+b[g]===b[g]){d[g]=b[g];b[g]=f}});a={my:b.join(" "),at:b.join(" "),offset:d.join(" ")}}a=c.extend({},c.ui.dialog.prototype.options.position,a)}else a=c.ui.dialog.prototype.options.position;(e=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(c.extend({of:window},a));e||this.uiDialog.hide()},_setOptions:function(a){var b=this,d={},e=false;c.each(a,function(g,f){b._setOption(g,f);
+if(g in m)e=true;if(g in n)d[g]=f});e&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",d)},_setOption:function(a,b){var d=this,e=d.uiDialog;switch(a){case "beforeclose":a="beforeClose";break;case "buttons":d._createButtons(b);break;case "closeText":d.uiDialogTitlebarCloseText.text(""+b);break;case "dialogClass":e.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b);break;case "disabled":b?e.addClass("ui-dialog-disabled"):
+e.removeClass("ui-dialog-disabled");break;case "draggable":var g=e.is(":data(draggable)");g&&!b&&e.draggable("destroy");!g&&b&&d._makeDraggable();break;case "position":d._position(b);break;case "resizable":(g=e.is(":data(resizable)"))&&!b&&e.resizable("destroy");g&&typeof b==="string"&&e.resizable("option","handles",b);!g&&b!==false&&d._makeResizable(b);break;case "title":c(".ui-dialog-title",d.uiDialogTitlebar).html(""+(b||"&#160;"));break}c.Widget.prototype._setOption.apply(d,arguments)},_size:function(){var a=
+this.options,b,d,e=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(a.minWidth>a.width)a.width=a.minWidth;b=this.uiDialog.css({height:"auto",width:a.width}).height();d=Math.max(0,a.minHeight-b);if(a.height==="auto")if(c.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();a=this.element.css("height","auto").height();e||this.uiDialog.hide();this.element.height(Math.max(a,d))}else this.element.height(Math.max(a.height-
+b,0));this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}});c.extend(c.ui.dialog,{version:"1.8.14",uuid:0,maxZ:0,getTitleId:function(a){a=a.attr("id");if(!a){this.uuid+=1;a=this.uuid}return"ui-dialog-title-"+a},overlay:function(a){this.$el=c.ui.dialog.overlay.create(a)}});c.extend(c.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "),
+create:function(a){if(this.instances.length===0){setTimeout(function(){c.ui.dialog.overlay.instances.length&&c(document).bind(c.ui.dialog.overlay.events,function(d){if(c(d.target).zIndex()<c.ui.dialog.overlay.maxZ)return false})},1);c(document).bind("keydown.dialog-overlay",function(d){if(a.options.closeOnEscape&&d.keyCode&&d.keyCode===c.ui.keyCode.ESCAPE){a.close(d);d.preventDefault()}});c(window).bind("resize.dialog-overlay",c.ui.dialog.overlay.resize)}var b=(this.oldInstances.pop()||c("<div></div>").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),
+height:this.height()});c.fn.bgiframe&&b.bgiframe();this.instances.push(b);return b},destroy:function(a){var b=c.inArray(a,this.instances);b!=-1&&this.oldInstances.push(this.instances.splice(b,1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var d=0;c.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);
+b=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a<b?c(window).height()+"px":a+"px"}else return c(document).height()+"px"},width:function(){var a,b;if(c.browser.msie){a=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth);b=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth);return a<b?c(window).width()+"px":a+"px"}else return c(document).width()+"px"},resize:function(){var a=c([]);c.each(c.ui.dialog.overlay.instances,function(){a=
+a.add(this)});a.css({width:0,height:0}).css({width:c.ui.dialog.overlay.width(),height:c.ui.dialog.overlay.height()})}});c.extend(c.ui.dialog.overlay.prototype,{destroy:function(){c.ui.dialog.overlay.destroy(this.$el)}})})(jQuery);
+;/*
+ * jQuery UI Slider 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Slider
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function(d){d.widget("ui.slider",d.ui.mouse,{widgetEventPrefix:"slide",options:{animate:false,distance:0,max:100,min:0,orientation:"horizontal",range:false,step:1,value:0,values:null},_create:function(){var b=this,a=this.options,c=this.element.find(".ui-slider-handle").addClass("ui-state-default ui-corner-all"),f=a.values&&a.values.length||1,e=[];this._mouseSliding=this._keySliding=false;this._animateOff=true;this._handleIndex=null;this._detectOrientation();this._mouseInit();this.element.addClass("ui-slider ui-slider-"+
+this.orientation+" ui-widget ui-widget-content ui-corner-all"+(a.disabled?" ui-slider-disabled ui-disabled":""));this.range=d([]);if(a.range){if(a.range===true){if(!a.values)a.values=[this._valueMin(),this._valueMin()];if(a.values.length&&a.values.length!==2)a.values=[a.values[0],a.values[0]]}this.range=d("<div></div>").appendTo(this.element).addClass("ui-slider-range ui-widget-header"+(a.range==="min"||a.range==="max"?" ui-slider-range-"+a.range:""))}for(var j=c.length;j<f;j+=1)e.push("<a class='ui-slider-handle ui-state-default ui-corner-all' href='#'></a>");
+this.handles=c.add(d(e.join("")).appendTo(b.element));this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(g){g.preventDefault()}).hover(function(){a.disabled||d(this).addClass("ui-state-hover")},function(){d(this).removeClass("ui-state-hover")}).focus(function(){if(a.disabled)d(this).blur();else{d(".ui-slider .ui-state-focus").removeClass("ui-state-focus");d(this).addClass("ui-state-focus")}}).blur(function(){d(this).removeClass("ui-state-focus")});this.handles.each(function(g){d(this).data("index.ui-slider-handle",
+g)});this.handles.keydown(function(g){var k=true,l=d(this).data("index.ui-slider-handle"),i,h,m;if(!b.options.disabled){switch(g.keyCode){case d.ui.keyCode.HOME:case d.ui.keyCode.END:case d.ui.keyCode.PAGE_UP:case d.ui.keyCode.PAGE_DOWN:case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:k=false;if(!b._keySliding){b._keySliding=true;d(this).addClass("ui-state-active");i=b._start(g,l);if(i===false)return}break}m=b.options.step;i=b.options.values&&b.options.values.length?
+(h=b.values(l)):(h=b.value());switch(g.keyCode){case d.ui.keyCode.HOME:h=b._valueMin();break;case d.ui.keyCode.END:h=b._valueMax();break;case d.ui.keyCode.PAGE_UP:h=b._trimAlignValue(i+(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.PAGE_DOWN:h=b._trimAlignValue(i-(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:if(i===b._valueMax())return;h=b._trimAlignValue(i+m);break;case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:if(i===b._valueMin())return;h=b._trimAlignValue(i-
+m);break}b._slide(g,l,h);return k}}).keyup(function(g){var k=d(this).data("index.ui-slider-handle");if(b._keySliding){b._keySliding=false;b._stop(g,k);b._change(g,k);d(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");this._mouseDestroy();
+return this},_mouseCapture:function(b){var a=this.options,c,f,e,j,g;if(a.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();c=this._normValueFromMouse({x:b.pageX,y:b.pageY});f=this._valueMax()-this._valueMin()+1;j=this;this.handles.each(function(k){var l=Math.abs(c-j.values(k));if(f>l){f=l;e=d(this);g=k}});if(a.range===true&&this.values(1)===a.min){g+=1;e=d(this.handles[g])}if(this._start(b,g)===false)return false;
+this._mouseSliding=true;j._handleIndex=g;e.addClass("ui-state-active").focus();a=e.offset();this._clickOffset=!d(b.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:b.pageX-a.left-e.width()/2,top:b.pageY-a.top-e.height()/2-(parseInt(e.css("borderTopWidth"),10)||0)-(parseInt(e.css("borderBottomWidth"),10)||0)+(parseInt(e.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(b,g,c);return this._animateOff=true},_mouseStart:function(){return true},_mouseDrag:function(b){var a=
+this._normValueFromMouse({x:b.pageX,y:b.pageY});this._slide(b,this._handleIndex,a);return false},_mouseStop:function(b){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(b,this._handleIndex);this._change(b,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(b){var a;if(this.orientation==="horizontal"){a=
+this.elementSize.width;b=b.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{a=this.elementSize.height;b=b.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}a=b/a;if(a>1)a=1;if(a<0)a=0;if(this.orientation==="vertical")a=1-a;b=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+a*b)},_start:function(b,a){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(a);
+c.values=this.values()}return this._trigger("start",b,c)},_slide:function(b,a,c){var f;if(this.options.values&&this.options.values.length){f=this.values(a?0:1);if(this.options.values.length===2&&this.options.range===true&&(a===0&&c>f||a===1&&c<f))c=f;if(c!==this.values(a)){f=this.values();f[a]=c;b=this._trigger("slide",b,{handle:this.handles[a],value:c,values:f});this.values(a?0:1);b!==false&&this.values(a,c,true)}}else if(c!==this.value()){b=this._trigger("slide",b,{handle:this.handles[a],value:c});
+b!==false&&this.value(c)}},_stop:function(b,a){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(a);c.values=this.values()}this._trigger("stop",b,c)},_change:function(b,a){if(!this._keySliding&&!this._mouseSliding){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(a);c.values=this.values()}this._trigger("change",b,c)}},value:function(b){if(arguments.length){this.options.value=
+this._trimAlignValue(b);this._refreshValue();this._change(null,0)}else return this._value()},values:function(b,a){var c,f,e;if(arguments.length>1){this.options.values[b]=this._trimAlignValue(a);this._refreshValue();this._change(null,b)}else if(arguments.length)if(d.isArray(arguments[0])){c=this.options.values;f=arguments[0];for(e=0;e<c.length;e+=1){c[e]=this._trimAlignValue(f[e]);this._change(null,e)}this._refreshValue()}else return this.options.values&&this.options.values.length?this._values(b):
+this.value();else return this._values()},_setOption:function(b,a){var c,f=0;if(d.isArray(this.options.values))f=this.options.values.length;d.Widget.prototype._setOption.apply(this,arguments);switch(b){case "disabled":if(a){this.handles.filter(".ui-state-focus").blur();this.handles.removeClass("ui-state-hover");this.handles.attr("disabled","disabled");this.element.addClass("ui-disabled")}else{this.handles.removeAttr("disabled");this.element.removeClass("ui-disabled")}break;case "orientation":this._detectOrientation();
+this.element.removeClass("ui-slider-horizontal ui-slider-vertical").addClass("ui-slider-"+this.orientation);this._refreshValue();break;case "value":this._animateOff=true;this._refreshValue();this._change(null,0);this._animateOff=false;break;case "values":this._animateOff=true;this._refreshValue();for(c=0;c<f;c+=1)this._change(null,c);this._animateOff=false;break}},_value:function(){var b=this.options.value;return b=this._trimAlignValue(b)},_values:function(b){var a,c;if(arguments.length){a=this.options.values[b];
+return a=this._trimAlignValue(a)}else{a=this.options.values.slice();for(c=0;c<a.length;c+=1)a[c]=this._trimAlignValue(a[c]);return a}},_trimAlignValue:function(b){if(b<=this._valueMin())return this._valueMin();if(b>=this._valueMax())return this._valueMax();var a=this.options.step>0?this.options.step:1,c=(b-this._valueMin())%a;alignValue=b-c;if(Math.abs(c)*2>=a)alignValue+=c>0?a:-a;return parseFloat(alignValue.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max},
+_refreshValue:function(){var b=this.options.range,a=this.options,c=this,f=!this._animateOff?a.animate:false,e,j={},g,k,l,i;if(this.options.values&&this.options.values.length)this.handles.each(function(h){e=(c.values(h)-c._valueMin())/(c._valueMax()-c._valueMin())*100;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";d(this).stop(1,1)[f?"animate":"css"](j,a.animate);if(c.options.range===true)if(c.orientation==="horizontal"){if(h===0)c.range.stop(1,1)[f?"animate":"css"]({left:e+"%"},a.animate);
+if(h===1)c.range[f?"animate":"css"]({width:e-g+"%"},{queue:false,duration:a.animate})}else{if(h===0)c.range.stop(1,1)[f?"animate":"css"]({bottom:e+"%"},a.animate);if(h===1)c.range[f?"animate":"css"]({height:e-g+"%"},{queue:false,duration:a.animate})}g=e});else{k=this.value();l=this._valueMin();i=this._valueMax();e=i!==l?(k-l)/(i-l)*100:0;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";this.handle.stop(1,1)[f?"animate":"css"](j,a.animate);if(b==="min"&&this.orientation==="horizontal")this.range.stop(1,
+1)[f?"animate":"css"]({width:e+"%"},a.animate);if(b==="max"&&this.orientation==="horizontal")this.range[f?"animate":"css"]({width:100-e+"%"},{queue:false,duration:a.animate});if(b==="min"&&this.orientation==="vertical")this.range.stop(1,1)[f?"animate":"css"]({height:e+"%"},a.animate);if(b==="max"&&this.orientation==="vertical")this.range[f?"animate":"css"]({height:100-e+"%"},{queue:false,duration:a.animate})}}});d.extend(d.ui.slider,{version:"1.8.14"})})(jQuery);
+;/*
+ * jQuery UI Tabs 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Tabs
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function(d,p){function u(){return++v}function w(){return++x}var v=0,x=0;d.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"<div></div>",remove:null,select:null,show:null,spinner:"<em>Loading&#8230;</em>",tabTemplate:"<li><a href='#{href}'><span>#{label}</span></a></li>"},_create:function(){this._tabify(true)},_setOption:function(b,e){if(b=="selected")this.options.collapsible&&
+e==this.options.selected||this.select(e);else{this.options[b]=e;this._tabify()}},_tabId:function(b){return b.title&&b.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+u()},_sanitizeSelector:function(b){return b.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+w());return d.cookie.apply(null,[b].concat(d.makeArray(arguments)))},_ui:function(b,e){return{tab:b,panel:e,index:this.anchors.index(b)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b=
+d(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(b){function e(g,f){g.css("display","");!d.support.opacity&&f.opacity&&g[0].style.removeAttribute("filter")}var a=this,c=this.options,h=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=d(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return d("a",this)[0]});this.panels=d([]);this.anchors.each(function(g,f){var i=d(f).attr("href"),l=i.split("#")[0],q;if(l&&(l===location.toString().split("#")[0]||
+(q=d("base")[0])&&l===q.href)){i=f.hash;f.href=i}if(h.test(i))a.panels=a.panels.add(a.element.find(a._sanitizeSelector(i)));else if(i&&i!=="#"){d.data(f,"href.tabs",i);d.data(f,"load.tabs",i.replace(/#.*$/,""));i=a._tabId(f);f.href="#"+i;f=a.element.find("#"+i);if(!f.length){f=d(c.panelTemplate).attr("id",i).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(a.panels[g-1]||a.list);f.data("destroy.tabs",true)}a.panels=a.panels.add(f)}else c.disabled.push(g)});if(b){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all");
+this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(c.selected===p){location.hash&&this.anchors.each(function(g,f){if(f.hash==location.hash){c.selected=g;return false}});if(typeof c.selected!=="number"&&c.cookie)c.selected=parseInt(a._cookie(),10);if(typeof c.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)c.selected=
+this.lis.index(this.lis.filter(".ui-tabs-selected"));c.selected=c.selected||(this.lis.length?0:-1)}else if(c.selected===null)c.selected=-1;c.selected=c.selected>=0&&this.anchors[c.selected]||c.selected<0?c.selected:0;c.disabled=d.unique(c.disabled.concat(d.map(this.lis.filter(".ui-state-disabled"),function(g){return a.lis.index(g)}))).sort();d.inArray(c.selected,c.disabled)!=-1&&c.disabled.splice(d.inArray(c.selected,c.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active");
+if(c.selected>=0&&this.anchors.length){a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(c.selected).addClass("ui-tabs-selected ui-state-active");a.element.queue("tabs",function(){a._trigger("show",null,a._ui(a.anchors[c.selected],a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash))[0]))});this.load(c.selected)}d(window).bind("unload",function(){a.lis.add(a.anchors).unbind(".tabs");a.lis=a.anchors=a.panels=null})}else c.selected=this.lis.index(this.lis.filter(".ui-tabs-selected"));
+this.element[c.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");c.cookie&&this._cookie(c.selected,c.cookie);b=0;for(var j;j=this.lis[b];b++)d(j)[d.inArray(b,c.disabled)!=-1&&!d(j).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");c.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(c.event!=="mouseover"){var k=function(g,f){f.is(":not(.ui-state-disabled)")&&f.addClass("ui-state-"+g)},n=function(g,f){f.removeClass("ui-state-"+
+g)};this.lis.bind("mouseover.tabs",function(){k("hover",d(this))});this.lis.bind("mouseout.tabs",function(){n("hover",d(this))});this.anchors.bind("focus.tabs",function(){k("focus",d(this).closest("li"))});this.anchors.bind("blur.tabs",function(){n("focus",d(this).closest("li"))})}var m,o;if(c.fx)if(d.isArray(c.fx)){m=c.fx[0];o=c.fx[1]}else m=o=c.fx;var r=o?function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.hide().removeClass("ui-tabs-hide").animate(o,o.duration||"normal",
+function(){e(f,o);a._trigger("show",null,a._ui(g,f[0]))})}:function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");a._trigger("show",null,a._ui(g,f[0]))},s=m?function(g,f){f.animate(m,m.duration||"normal",function(){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");e(f,m);a.element.dequeue("tabs")})}:function(g,f){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");a.element.dequeue("tabs")};
+this.anchors.bind(c.event+".tabs",function(){var g=this,f=d(g).closest("li"),i=a.panels.filter(":not(.ui-tabs-hide)"),l=a.element.find(a._sanitizeSelector(g.hash));if(f.hasClass("ui-tabs-selected")&&!c.collapsible||f.hasClass("ui-state-disabled")||f.hasClass("ui-state-processing")||a.panels.filter(":animated").length||a._trigger("select",null,a._ui(this,l[0]))===false){this.blur();return false}c.selected=a.anchors.index(this);a.abort();if(c.collapsible)if(f.hasClass("ui-tabs-selected")){c.selected=
+-1;c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){s(g,i)}).dequeue("tabs");this.blur();return false}else if(!i.length){c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this));this.blur();return false}c.cookie&&a._cookie(c.selected,c.cookie);if(l.length){i.length&&a.element.queue("tabs",function(){s(g,i)});a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier.";
+d.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(b){if(typeof b=="string")b=this.anchors.index(this.anchors.filter("[href$="+b+"]"));return b},destroy:function(){var b=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var e=
+d.data(this,"href.tabs");if(e)this.href=e;var a=d(this).unbind(".tabs");d.each(["href","load","cache"],function(c,h){a.removeData(h+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){d.data(this,"destroy.tabs")?d(this).remove():d(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});b.cookie&&this._cookie(null,b.cookie);return this},add:function(b,
+e,a){if(a===p)a=this.anchors.length;var c=this,h=this.options;e=d(h.tabTemplate.replace(/#\{href\}/g,b).replace(/#\{label\}/g,e));b=!b.indexOf("#")?b.replace("#",""):this._tabId(d("a",e)[0]);e.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var j=c.element.find("#"+b);j.length||(j=d(h.panelTemplate).attr("id",b).data("destroy.tabs",true));j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(a>=this.lis.length){e.appendTo(this.list);j.appendTo(this.list[0].parentNode)}else{e.insertBefore(this.lis[a]);
+j.insertBefore(this.panels[a])}h.disabled=d.map(h.disabled,function(k){return k>=a?++k:k});this._tabify();if(this.anchors.length==1){h.selected=0;e.addClass("ui-tabs-selected ui-state-active");j.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){c._trigger("show",null,c._ui(c.anchors[0],c.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[a],this.panels[a]));return this},remove:function(b){b=this._getIndex(b);var e=this.options,a=this.lis.eq(b).remove(),c=this.panels.eq(b).remove();
+if(a.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(b+(b+1<this.anchors.length?1:-1));e.disabled=d.map(d.grep(e.disabled,function(h){return h!=b}),function(h){return h>=b?--h:h});this._tabify();this._trigger("remove",null,this._ui(a.find("a")[0],c[0]));return this},enable:function(b){b=this._getIndex(b);var e=this.options;if(d.inArray(b,e.disabled)!=-1){this.lis.eq(b).removeClass("ui-state-disabled");e.disabled=d.grep(e.disabled,function(a){return a!=b});this._trigger("enable",null,
+this._ui(this.anchors[b],this.panels[b]));return this}},disable:function(b){b=this._getIndex(b);var e=this.options;if(b!=e.selected){this.lis.eq(b).addClass("ui-state-disabled");e.disabled.push(b);e.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[b],this.panels[b]))}return this},select:function(b){b=this._getIndex(b);if(b==-1)if(this.options.collapsible&&this.options.selected!=-1)b=this.options.selected;else return this;this.anchors.eq(b).trigger(this.options.event+".tabs");return this},
+load:function(b){b=this._getIndex(b);var e=this,a=this.options,c=this.anchors.eq(b)[0],h=d.data(c,"load.tabs");this.abort();if(!h||this.element.queue("tabs").length!==0&&d.data(c,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(b).addClass("ui-state-processing");if(a.spinner){var j=d("span",c);j.data("label.tabs",j.html()).html(a.spinner)}this.xhr=d.ajax(d.extend({},a.ajaxOptions,{url:h,success:function(k,n){e.element.find(e._sanitizeSelector(c.hash)).html(k);e._cleanup();a.cache&&d.data(c,
+"cache.tabs",true);e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.success(k,n)}catch(m){}},error:function(k,n){e._cleanup();e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.error(k,n,b,c)}catch(m){}}}));e.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this},
+url:function(b,e){this.anchors.eq(b).removeData("cache.tabs").data("load.tabs",e);return this},length:function(){return this.anchors.length}});d.extend(d.ui.tabs,{version:"1.8.14"});d.extend(d.ui.tabs.prototype,{rotation:null,rotate:function(b,e){var a=this,c=this.options,h=a._rotate||(a._rotate=function(j){clearTimeout(a.rotation);a.rotation=setTimeout(function(){var k=c.selected;a.select(++k<a.anchors.length?k:0)},b);j&&j.stopPropagation()});e=a._unrotate||(a._unrotate=!e?function(j){j.clientX&&
+a.rotate(null)}:function(){t=c.selected;h()});if(b){this.element.bind("tabsshow",h);this.anchors.bind(c.event+".tabs",e);h()}else{clearTimeout(a.rotation);this.element.unbind("tabsshow",h);this.anchors.unbind(c.event+".tabs",e);delete this._rotate;delete this._unrotate}return this}})})(jQuery);
+;/*
+ * jQuery UI Datepicker 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Datepicker
+ *
+ * Depends:
+ * jquery.ui.core.js
+ */
+(function(d,C){function M(){this.debug=false;this._curInst=null;this._keyEvent=false;this._disabledInputs=[];this._inDialog=this._datepickerShowing=false;this._mainDivId="ui-datepicker-div";this._inlineClass="ui-datepicker-inline";this._appendClass="ui-datepicker-append";this._triggerClass="ui-datepicker-trigger";this._dialogClass="ui-datepicker-dialog";this._disableClass="ui-datepicker-disabled";this._unselectableClass="ui-datepicker-unselectable";this._currentClass="ui-datepicker-current-day";this._dayOverClass=
+"ui-datepicker-days-cell-over";this.regional=[];this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su",
+"Mo","Tu","We","Th","Fr","Sa"],weekHeader:"Wk",dateFormat:"mm/dd/yy",firstDay:0,isRTL:false,showMonthAfterYear:false,yearSuffix:""};this._defaults={showOn:"focus",showAnim:"fadeIn",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:false,hideIfNoPrevNext:false,navigationAsDateFormat:false,gotoCurrent:false,changeMonth:false,changeYear:false,yearRange:"c-10:c+10",showOtherMonths:false,selectOtherMonths:false,showWeek:false,calculateWeek:this.iso8601Week,shortYearCutoff:"+10",
+minDate:null,maxDate:null,duration:"fast",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:true,showButtonPanel:false,autoSize:false};d.extend(this._defaults,this.regional[""]);this.dpDiv=N(d('<div id="'+this._mainDivId+'" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))}function N(a){return a.bind("mouseout",function(b){b=
+d(b.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");b.length&&b.removeClass("ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover")}).bind("mouseover",function(b){b=d(b.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");if(!(d.datepicker._isDisabledDatepicker(J.inline?a.parent()[0]:J.input[0])||!b.length)){b.parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");b.addClass("ui-state-hover");
+b.hasClass("ui-datepicker-prev")&&b.addClass("ui-datepicker-prev-hover");b.hasClass("ui-datepicker-next")&&b.addClass("ui-datepicker-next-hover")}})}function H(a,b){d.extend(a,b);for(var c in b)if(b[c]==null||b[c]==C)a[c]=b[c];return a}d.extend(d.ui,{datepicker:{version:"1.8.14"}});var A=(new Date).getTime(),J;d.extend(M.prototype,{markerClassName:"hasDatepicker",maxRows:4,log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(a){H(this._defaults,
+a||{});return this},_attachDatepicker:function(a,b){var c=null;for(var e in this._defaults){var f=a.getAttribute("date:"+e);if(f){c=c||{};try{c[e]=eval(f)}catch(h){c[e]=f}}}e=a.nodeName.toLowerCase();f=e=="div"||e=="span";if(!a.id){this.uuid+=1;a.id="dp"+this.uuid}var i=this._newInst(d(a),f);i.settings=d.extend({},b||{},c||{});if(e=="input")this._connectDatepicker(a,i);else f&&this._inlineDatepicker(a,i)},_newInst:function(a,b){return{id:a[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1"),input:a,selectedDay:0,
+selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:!b?this.dpDiv:N(d('<div class="'+this._inlineClass+' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))}},_connectDatepicker:function(a,b){var c=d(a);b.append=d([]);b.trigger=d([]);if(!c.hasClass(this.markerClassName)){this._attachments(c,b);c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(e,f,h){b.settings[f]=
+h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});this._autoSize(b);d.data(a,"datepicker",b)}},_attachments:function(a,b){var c=this._get(b,"appendText"),e=this._get(b,"isRTL");b.append&&b.append.remove();if(c){b.append=d('<span class="'+this._appendClass+'">'+c+"</span>");a[e?"before":"after"](b.append)}a.unbind("focus",this._showDatepicker);b.trigger&&b.trigger.remove();c=this._get(b,"showOn");if(c=="focus"||c=="both")a.focus(this._showDatepicker);if(c=="button"||c=="both"){c=
+this._get(b,"buttonText");var f=this._get(b,"buttonImage");b.trigger=d(this._get(b,"buttonImageOnly")?d("<img/>").addClass(this._triggerClass).attr({src:f,alt:c,title:c}):d('<button type="button"></button>').addClass(this._triggerClass).html(f==""?c:d("<img/>").attr({src:f,alt:c,title:c})));a[e?"before":"after"](b.trigger);b.trigger.click(function(){d.datepicker._datepickerShowing&&d.datepicker._lastInput==a[0]?d.datepicker._hideDatepicker():d.datepicker._showDatepicker(a[0]);return false})}},_autoSize:function(a){if(this._get(a,
+"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var e=function(f){for(var h=0,i=0,g=0;g<f.length;g++)if(f[g].length>h){h=f[g].length;i=g}return i};b.setMonth(e(this._get(a,c.match(/MM/)?"monthNames":"monthNamesShort")));b.setDate(e(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a,b){var c=d(a);if(!c.hasClass(this.markerClassName)){c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker",
+function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});d.data(a,"datepicker",b);this._setDate(b,this._getDefaultDate(b),true);this._updateDatepicker(b);this._updateAlternate(b);b.dpDiv.show()}},_dialogDatepicker:function(a,b,c,e,f){a=this._dialogInst;if(!a){this.uuid+=1;this._dialogInput=d('<input type="text" id="'+("dp"+this.uuid)+'" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>');this._dialogInput.keydown(this._doKeyDown);d("body").append(this._dialogInput);
+a=this._dialogInst=this._newInst(this._dialogInput,false);a.settings={};d.data(this._dialogInput[0],"datepicker",a)}H(a.settings,e||{});b=b&&b.constructor==Date?this._formatDate(a,b):b;this._dialogInput.val(b);this._pos=f?f.length?f:[f.pageX,f.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left",
+this._pos[0]+20+"px").css("top",this._pos[1]+"px");a.settings.onSelect=c;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);this._showDatepicker(this._dialogInput[0]);d.blockUI&&d.blockUI(this.dpDiv);d.data(this._dialogInput[0],"datepicker",a);return this},_destroyDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();d.removeData(a,"datepicker");if(e=="input"){c.append.remove();c.trigger.remove();b.removeClass(this.markerClassName).unbind("focus",
+this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)}else if(e=="div"||e=="span")b.removeClass(this.markerClassName).empty()}},_enableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=false;c.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(e=="div"||e=="span"){b=
+b.children("."+this._inlineClass);b.children().removeClass("ui-state-disabled");b.find("select.ui-datepicker-month, select.ui-datepicker-year").removeAttr("disabled")}this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:f})}},_disableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=true;c.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",
+cursor:"default"})}else if(e=="div"||e=="span"){b=b.children("."+this._inlineClass);b.children().addClass("ui-state-disabled");b.find("select.ui-datepicker-month, select.ui-datepicker-year").attr("disabled","disabled")}this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:f});this._disabledInputs[this._disabledInputs.length]=a}},_isDisabledDatepicker:function(a){if(!a)return false;for(var b=0;b<this._disabledInputs.length;b++)if(this._disabledInputs[b]==a)return true;return false},
+_getInst:function(a){try{return d.data(a,"datepicker")}catch(b){throw"Missing instance data for this datepicker";}},_optionDatepicker:function(a,b,c){var e=this._getInst(a);if(arguments.length==2&&typeof b=="string")return b=="defaults"?d.extend({},d.datepicker._defaults):e?b=="all"?d.extend({},e.settings):this._get(e,b):null;var f=b||{};if(typeof b=="string"){f={};f[b]=c}if(e){this._curInst==e&&this._hideDatepicker();var h=this._getDateDatepicker(a,true),i=this._getMinMaxDate(e,"min"),g=this._getMinMaxDate(e,
+"max");H(e.settings,f);if(i!==null&&f.dateFormat!==C&&f.minDate===C)e.settings.minDate=this._formatDate(e,i);if(g!==null&&f.dateFormat!==C&&f.maxDate===C)e.settings.maxDate=this._formatDate(e,g);this._attachments(d(a),e);this._autoSize(e);this._setDate(e,h);this._updateAlternate(e);this._updateDatepicker(e)}},_changeDatepicker:function(a,b,c){this._optionDatepicker(a,b,c)},_refreshDatepicker:function(a){(a=this._getInst(a))&&this._updateDatepicker(a)},_setDateDatepicker:function(a,b){if(a=this._getInst(a)){this._setDate(a,
+b);this._updateDatepicker(a);this._updateAlternate(a)}},_getDateDatepicker:function(a,b){(a=this._getInst(a))&&!a.inline&&this._setDateFromField(a,b);return a?this._getDate(a):null},_doKeyDown:function(a){var b=d.datepicker._getInst(a.target),c=true,e=b.dpDiv.is(".ui-datepicker-rtl");b._keyEvent=true;if(d.datepicker._datepickerShowing)switch(a.keyCode){case 9:d.datepicker._hideDatepicker();c=false;break;case 13:c=d("td."+d.datepicker._dayOverClass+":not(."+d.datepicker._currentClass+")",b.dpDiv);
+c[0]?d.datepicker._selectDay(a.target,b.selectedMonth,b.selectedYear,c[0]):d.datepicker._hideDatepicker();return false;case 27:d.datepicker._hideDatepicker();break;case 33:d.datepicker._adjustDate(a.target,a.ctrlKey?-d.datepicker._get(b,"stepBigMonths"):-d.datepicker._get(b,"stepMonths"),"M");break;case 34:d.datepicker._adjustDate(a.target,a.ctrlKey?+d.datepicker._get(b,"stepBigMonths"):+d.datepicker._get(b,"stepMonths"),"M");break;case 35:if(a.ctrlKey||a.metaKey)d.datepicker._clearDate(a.target);
+c=a.ctrlKey||a.metaKey;break;case 36:if(a.ctrlKey||a.metaKey)d.datepicker._gotoToday(a.target);c=a.ctrlKey||a.metaKey;break;case 37:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,e?+1:-1,"D");c=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)d.datepicker._adjustDate(a.target,a.ctrlKey?-d.datepicker._get(b,"stepBigMonths"):-d.datepicker._get(b,"stepMonths"),"M");break;case 38:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,-7,"D");c=a.ctrlKey||a.metaKey;break;case 39:if(a.ctrlKey||
+a.metaKey)d.datepicker._adjustDate(a.target,e?-1:+1,"D");c=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)d.datepicker._adjustDate(a.target,a.ctrlKey?+d.datepicker._get(b,"stepBigMonths"):+d.datepicker._get(b,"stepMonths"),"M");break;case 40:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,+7,"D");c=a.ctrlKey||a.metaKey;break;default:c=false}else if(a.keyCode==36&&a.ctrlKey)d.datepicker._showDatepicker(this);else c=false;if(c){a.preventDefault();a.stopPropagation()}},_doKeyPress:function(a){var b=
+d.datepicker._getInst(a.target);if(d.datepicker._get(b,"constrainInput")){b=d.datepicker._possibleChars(d.datepicker._get(b,"dateFormat"));var c=String.fromCharCode(a.charCode==C?a.keyCode:a.charCode);return a.ctrlKey||a.metaKey||c<" "||!b||b.indexOf(c)>-1}},_doKeyUp:function(a){a=d.datepicker._getInst(a.target);if(a.input.val()!=a.lastVal)try{if(d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),a.input?a.input.val():null,d.datepicker._getFormatConfig(a))){d.datepicker._setDateFromField(a);
+d.datepicker._updateAlternate(a);d.datepicker._updateDatepicker(a)}}catch(b){d.datepicker.log(b)}return true},_showDatepicker:function(a){a=a.target||a;if(a.nodeName.toLowerCase()!="input")a=d("input",a.parentNode)[0];if(!(d.datepicker._isDisabledDatepicker(a)||d.datepicker._lastInput==a)){var b=d.datepicker._getInst(a);if(d.datepicker._curInst&&d.datepicker._curInst!=b){d.datepicker._datepickerShowing&&d.datepicker._triggerOnClose(d.datepicker._curInst);d.datepicker._curInst.dpDiv.stop(true,true)}var c=
+d.datepicker._get(b,"beforeShow");H(b.settings,c?c.apply(a,[a,b]):{});b.lastVal=null;d.datepicker._lastInput=a;d.datepicker._setDateFromField(b);if(d.datepicker._inDialog)a.value="";if(!d.datepicker._pos){d.datepicker._pos=d.datepicker._findPos(a);d.datepicker._pos[1]+=a.offsetHeight}var e=false;d(a).parents().each(function(){e|=d(this).css("position")=="fixed";return!e});if(e&&d.browser.opera){d.datepicker._pos[0]-=document.documentElement.scrollLeft;d.datepicker._pos[1]-=document.documentElement.scrollTop}c=
+{left:d.datepicker._pos[0],top:d.datepicker._pos[1]};d.datepicker._pos=null;b.dpDiv.empty();b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});d.datepicker._updateDatepicker(b);c=d.datepicker._checkOffset(b,c,e);b.dpDiv.css({position:d.datepicker._inDialog&&d.blockUI?"static":e?"fixed":"absolute",display:"none",left:c.left+"px",top:c.top+"px"});if(!b.inline){c=d.datepicker._get(b,"showAnim");var f=d.datepicker._get(b,"duration"),h=function(){var i=b.dpDiv.find("iframe.ui-datepicker-cover");
+if(i.length){var g=d.datepicker._getBorders(b.dpDiv);i.css({left:-g[0],top:-g[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})}};b.dpDiv.zIndex(d(a).zIndex()+1);d.datepicker._datepickerShowing=true;d.effects&&d.effects[c]?b.dpDiv.show(c,d.datepicker._get(b,"showOptions"),f,h):b.dpDiv[c||"show"](c?f:null,h);if(!c||!f)h();b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus();d.datepicker._curInst=b}}},_updateDatepicker:function(a){this.maxRows=4;var b=d.datepicker._getBorders(a.dpDiv);
+J=a;a.dpDiv.empty().append(this._generateHTML(a));var c=a.dpDiv.find("iframe.ui-datepicker-cover");c.length&&c.css({left:-b[0],top:-b[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()});a.dpDiv.find("."+this._dayOverClass+" a").mouseover();b=this._getNumberOfMonths(a);c=b[1];a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");c>1&&a.dpDiv.addClass("ui-datepicker-multi-"+c).css("width",17*c+"em");a.dpDiv[(b[0]!=1||b[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");
+a.dpDiv[(this._get(a,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");a==d.datepicker._curInst&&d.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&!a.input.is(":disabled")&&a.input[0]!=document.activeElement&&a.input.focus();if(a.yearshtml){var e=a.yearshtml;setTimeout(function(){e===a.yearshtml&&a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml);e=a.yearshtml=null},0)}},_getBorders:function(a){var b=function(c){return{thin:1,medium:2,thick:3}[c]||
+c};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]},_checkOffset:function(a,b,c){var e=a.dpDiv.outerWidth(),f=a.dpDiv.outerHeight(),h=a.input?a.input.outerWidth():0,i=a.input?a.input.outerHeight():0,g=document.documentElement.clientWidth+d(document).scrollLeft(),j=document.documentElement.clientHeight+d(document).scrollTop();b.left-=this._get(a,"isRTL")?e-h:0;b.left-=c&&b.left==a.input.offset().left?d(document).scrollLeft():0;b.top-=c&&b.top==a.input.offset().top+
+i?d(document).scrollTop():0;b.left-=Math.min(b.left,b.left+e>g&&g>e?Math.abs(b.left+e-g):0);b.top-=Math.min(b.top,b.top+f>j&&j>f?Math.abs(f+i):0);return b},_findPos:function(a){for(var b=this._get(this._getInst(a),"isRTL");a&&(a.type=="hidden"||a.nodeType!=1||d.expr.filters.hidden(a));)a=a[b?"previousSibling":"nextSibling"];a=d(a).offset();return[a.left,a.top]},_triggerOnClose:function(a){var b=this._get(a,"onClose");if(b)b.apply(a.input?a.input[0]:null,[a.input?a.input.val():"",a])},_hideDatepicker:function(a){var b=
+this._curInst;if(!(!b||a&&b!=d.data(a,"datepicker")))if(this._datepickerShowing){a=this._get(b,"showAnim");var c=this._get(b,"duration"),e=function(){d.datepicker._tidyDialog(b);this._curInst=null};d.effects&&d.effects[a]?b.dpDiv.hide(a,d.datepicker._get(b,"showOptions"),c,e):b.dpDiv[a=="slideDown"?"slideUp":a=="fadeIn"?"fadeOut":"hide"](a?c:null,e);a||e();d.datepicker._triggerOnClose(b);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",
+left:"0",top:"-100px"});if(d.blockUI){d.unblockUI();d("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},_checkExternalClick:function(a){if(d.datepicker._curInst){a=d(a.target);a[0].id!=d.datepicker._mainDivId&&a.parents("#"+d.datepicker._mainDivId).length==0&&!a.hasClass(d.datepicker.markerClassName)&&!a.hasClass(d.datepicker._triggerClass)&&d.datepicker._datepickerShowing&&!(d.datepicker._inDialog&&
+d.blockUI)&&d.datepicker._hideDatepicker()}},_adjustDate:function(a,b,c){a=d(a);var e=this._getInst(a[0]);if(!this._isDisabledDatepicker(a[0])){this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"):0),c);this._updateDatepicker(e)}},_gotoToday:function(a){a=d(a);var b=this._getInst(a[0]);if(this._get(b,"gotoCurrent")&&b.currentDay){b.selectedDay=b.currentDay;b.drawMonth=b.selectedMonth=b.currentMonth;b.drawYear=b.selectedYear=b.currentYear}else{var c=new Date;b.selectedDay=c.getDate();b.drawMonth=
+b.selectedMonth=c.getMonth();b.drawYear=b.selectedYear=c.getFullYear()}this._notifyChange(b);this._adjustDate(a)},_selectMonthYear:function(a,b,c){a=d(a);var e=this._getInst(a[0]);e._selectingMonthYear=false;e["selected"+(c=="M"?"Month":"Year")]=e["draw"+(c=="M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10);this._notifyChange(e);this._adjustDate(a)},_clickMonthYear:function(a){var b=this._getInst(d(a)[0]);b.input&&b._selectingMonthYear&&setTimeout(function(){b.input.focus()},0);b._selectingMonthYear=
+!b._selectingMonthYear},_selectDay:function(a,b,c,e){var f=d(a);if(!(d(e).hasClass(this._unselectableClass)||this._isDisabledDatepicker(f[0]))){f=this._getInst(f[0]);f.selectedDay=f.currentDay=d("a",e).html();f.selectedMonth=f.currentMonth=b;f.selectedYear=f.currentYear=c;this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))}},_clearDate:function(a){a=d(a);this._getInst(a[0]);this._selectDate(a,"")},_selectDate:function(a,b){a=this._getInst(d(a)[0]);b=b!=null?b:this._formatDate(a);
+a.input&&a.input.val(b);this._updateAlternate(a);var c=this._get(a,"onSelect");if(c)c.apply(a.input?a.input[0]:null,[b,a]);else a.input&&a.input.trigger("change");if(a.inline)this._updateDatepicker(a);else{this._hideDatepicker();this._lastInput=a.input[0];typeof a.input[0]!="object"&&a.input.focus();this._lastInput=null}},_updateAlternate:function(a){var b=this._get(a,"altField");if(b){var c=this._get(a,"altFormat")||this._get(a,"dateFormat"),e=this._getDate(a),f=this.formatDate(c,e,this._getFormatConfig(a));
+d(b).each(function(){d(this).val(f)})}},noWeekends:function(a){a=a.getDay();return[a>0&&a<6,""]},iso8601Week:function(a){a=new Date(a.getTime());a.setDate(a.getDate()+4-(a.getDay()||7));var b=a.getTime();a.setMonth(0);a.setDate(1);return Math.floor(Math.round((b-a)/864E5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b=="object"?b.toString():b+"";if(b=="")return null;var e=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff;e=typeof e!="string"?e:(new Date).getFullYear()%
+100+parseInt(e,10);for(var f=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,h=(c?c.dayNames:null)||this._defaults.dayNames,i=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,g=(c?c.monthNames:null)||this._defaults.monthNames,j=c=-1,l=-1,u=-1,k=false,o=function(p){(p=B+1<a.length&&a.charAt(B+1)==p)&&B++;return p},m=function(p){var D=o(p);p=new RegExp("^\\d{1,"+(p=="@"?14:p=="!"?20:p=="y"&&D?4:p=="o"?3:2)+"}");p=b.substring(q).match(p);if(!p)throw"Missing number at position "+q;q+=
+p[0].length;return parseInt(p[0],10)},n=function(p,D,K){p=d.map(o(p)?K:D,function(w,x){return[[x,w]]}).sort(function(w,x){return-(w[1].length-x[1].length)});var E=-1;d.each(p,function(w,x){w=x[1];if(b.substr(q,w.length).toLowerCase()==w.toLowerCase()){E=x[0];q+=w.length;return false}});if(E!=-1)return E+1;else throw"Unknown name at position "+q;},s=function(){if(b.charAt(q)!=a.charAt(B))throw"Unexpected literal at position "+q;q++},q=0,B=0;B<a.length;B++)if(k)if(a.charAt(B)=="'"&&!o("'"))k=false;
+else s();else switch(a.charAt(B)){case "d":l=m("d");break;case "D":n("D",f,h);break;case "o":u=m("o");break;case "m":j=m("m");break;case "M":j=n("M",i,g);break;case "y":c=m("y");break;case "@":var v=new Date(m("@"));c=v.getFullYear();j=v.getMonth()+1;l=v.getDate();break;case "!":v=new Date((m("!")-this._ticksTo1970)/1E4);c=v.getFullYear();j=v.getMonth()+1;l=v.getDate();break;case "'":if(o("'"))s();else k=true;break;default:s()}if(q<b.length)throw"Extra/unparsed characters found in date: "+b.substring(q);
+if(c==-1)c=(new Date).getFullYear();else if(c<100)c+=(new Date).getFullYear()-(new Date).getFullYear()%100+(c<=e?0:-100);if(u>-1){j=1;l=u;do{e=this._getDaysInMonth(c,j-1);if(l<=e)break;j++;l-=e}while(1)}v=this._daylightSavingAdjust(new Date(c,j-1,l));if(v.getFullYear()!=c||v.getMonth()+1!=j||v.getDate()!=l)throw"Invalid date";return v},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",
+TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(a,b,c){if(!b)return"";var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?c.dayNames:null)||this._defaults.dayNames,h=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort;c=(c?c.monthNames:null)||this._defaults.monthNames;var i=function(o){(o=k+1<a.length&&a.charAt(k+1)==o)&&k++;return o},g=function(o,m,n){m=""+m;if(i(o))for(;m.length<
+n;)m="0"+m;return m},j=function(o,m,n,s){return i(o)?s[m]:n[m]},l="",u=false;if(b)for(var k=0;k<a.length;k++)if(u)if(a.charAt(k)=="'"&&!i("'"))u=false;else l+=a.charAt(k);else switch(a.charAt(k)){case "d":l+=g("d",b.getDate(),2);break;case "D":l+=j("D",b.getDay(),e,f);break;case "o":l+=g("o",Math.round(((new Date(b.getFullYear(),b.getMonth(),b.getDate())).getTime()-(new Date(b.getFullYear(),0,0)).getTime())/864E5),3);break;case "m":l+=g("m",b.getMonth()+1,2);break;case "M":l+=j("M",b.getMonth(),h,
+c);break;case "y":l+=i("y")?b.getFullYear():(b.getYear()%100<10?"0":"")+b.getYear()%100;break;case "@":l+=b.getTime();break;case "!":l+=b.getTime()*1E4+this._ticksTo1970;break;case "'":if(i("'"))l+="'";else u=true;break;default:l+=a.charAt(k)}return l},_possibleChars:function(a){for(var b="",c=false,e=function(h){(h=f+1<a.length&&a.charAt(f+1)==h)&&f++;return h},f=0;f<a.length;f++)if(c)if(a.charAt(f)=="'"&&!e("'"))c=false;else b+=a.charAt(f);else switch(a.charAt(f)){case "d":case "m":case "y":case "@":b+=
+"0123456789";break;case "D":case "M":return null;case "'":if(e("'"))b+="'";else c=true;break;default:b+=a.charAt(f)}return b},_get:function(a,b){return a.settings[b]!==C?a.settings[b]:this._defaults[b]},_setDateFromField:function(a,b){if(a.input.val()!=a.lastVal){var c=this._get(a,"dateFormat"),e=a.lastVal=a.input?a.input.val():null,f,h;f=h=this._getDefaultDate(a);var i=this._getFormatConfig(a);try{f=this.parseDate(c,e,i)||h}catch(g){this.log(g);e=b?"":e}a.selectedDay=f.getDate();a.drawMonth=a.selectedMonth=
+f.getMonth();a.drawYear=a.selectedYear=f.getFullYear();a.currentDay=e?f.getDate():0;a.currentMonth=e?f.getMonth():0;a.currentYear=e?f.getFullYear():0;this._adjustInstDate(a)}},_getDefaultDate:function(a){return this._restrictMinMax(a,this._determineDate(a,this._get(a,"defaultDate"),new Date))},_determineDate:function(a,b,c){var e=function(h){var i=new Date;i.setDate(i.getDate()+h);return i},f=function(h){try{return d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),h,d.datepicker._getFormatConfig(a))}catch(i){}var g=
+(h.toLowerCase().match(/^c/)?d.datepicker._getDate(a):null)||new Date,j=g.getFullYear(),l=g.getMonth();g=g.getDate();for(var u=/([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g,k=u.exec(h);k;){switch(k[2]||"d"){case "d":case "D":g+=parseInt(k[1],10);break;case "w":case "W":g+=parseInt(k[1],10)*7;break;case "m":case "M":l+=parseInt(k[1],10);g=Math.min(g,d.datepicker._getDaysInMonth(j,l));break;case "y":case "Y":j+=parseInt(k[1],10);g=Math.min(g,d.datepicker._getDaysInMonth(j,l));break}k=u.exec(h)}return new Date(j,
+l,g)};if(b=(b=b==null||b===""?c:typeof b=="string"?f(b):typeof b=="number"?isNaN(b)?c:e(b):new Date(b.getTime()))&&b.toString()=="Invalid Date"?c:b){b.setHours(0);b.setMinutes(0);b.setSeconds(0);b.setMilliseconds(0)}return this._daylightSavingAdjust(b)},_daylightSavingAdjust:function(a){if(!a)return null;a.setHours(a.getHours()>12?a.getHours()+2:0);return a},_setDate:function(a,b,c){var e=!b,f=a.selectedMonth,h=a.selectedYear;b=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay=
+a.currentDay=b.getDate();a.drawMonth=a.selectedMonth=a.currentMonth=b.getMonth();a.drawYear=a.selectedYear=a.currentYear=b.getFullYear();if((f!=a.selectedMonth||h!=a.selectedYear)&&!c)this._notifyChange(a);this._adjustInstDate(a);if(a.input)a.input.val(e?"":this._formatDate(a))},_getDate:function(a){return!a.currentYear||a.input&&a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay))},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(),
+b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),e=this._get(a,"showButtonPanel"),f=this._get(a,"hideIfNoPrevNext"),h=this._get(a,"navigationAsDateFormat"),i=this._getNumberOfMonths(a),g=this._get(a,"showCurrentAtPos"),j=this._get(a,"stepMonths"),l=i[0]!=1||i[1]!=1,u=this._daylightSavingAdjust(!a.currentDay?new Date(9999,9,9):new Date(a.currentYear,a.currentMonth,a.currentDay)),k=this._getMinMaxDate(a,"min"),o=this._getMinMaxDate(a,"max");g=a.drawMonth-g;var m=a.drawYear;if(g<0){g+=12;m--}if(o){var n=
+this._daylightSavingAdjust(new Date(o.getFullYear(),o.getMonth()-i[0]*i[1]+1,o.getDate()));for(n=k&&n<k?k:n;this._daylightSavingAdjust(new Date(m,g,1))>n;){g--;if(g<0){g=11;m--}}}a.drawMonth=g;a.drawYear=m;n=this._get(a,"prevText");n=!h?n:this.formatDate(n,this._daylightSavingAdjust(new Date(m,g-j,1)),this._getFormatConfig(a));n=this._canAdjustMonth(a,-1,m,g)?'<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_'+A+".datepicker._adjustDate('#"+a.id+"', -"+j+", 'M');\" title=\""+n+'"><span class="ui-icon ui-icon-circle-triangle-'+
+(c?"e":"w")+'">'+n+"</span></a>":f?"":'<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+n+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"e":"w")+'">'+n+"</span></a>";var s=this._get(a,"nextText");s=!h?s:this.formatDate(s,this._daylightSavingAdjust(new Date(m,g+j,1)),this._getFormatConfig(a));f=this._canAdjustMonth(a,+1,m,g)?'<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_'+A+".datepicker._adjustDate('#"+a.id+"', +"+j+", 'M');\" title=\""+s+'"><span class="ui-icon ui-icon-circle-triangle-'+
+(c?"w":"e")+'">'+s+"</span></a>":f?"":'<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+s+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"w":"e")+'">'+s+"</span></a>";j=this._get(a,"currentText");s=this._get(a,"gotoCurrent")&&a.currentDay?u:b;j=!h?j:this.formatDate(j,s,this._getFormatConfig(a));h=!a.inline?'<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_'+A+'.datepicker._hideDatepicker();">'+this._get(a,
+"closeText")+"</button>":"";e=e?'<div class="ui-datepicker-buttonpane ui-widget-content">'+(c?h:"")+(this._isInRange(a,s)?'<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_'+A+".datepicker._gotoToday('#"+a.id+"');\">"+j+"</button>":"")+(c?"":h)+"</div>":"";h=parseInt(this._get(a,"firstDay"),10);h=isNaN(h)?0:h;j=this._get(a,"showWeek");s=this._get(a,"dayNames");this._get(a,"dayNamesShort");var q=this._get(a,"dayNamesMin"),B=
+this._get(a,"monthNames"),v=this._get(a,"monthNamesShort"),p=this._get(a,"beforeShowDay"),D=this._get(a,"showOtherMonths"),K=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var E=this._getDefaultDate(a),w="",x=0;x<i[0];x++){var O="";this.maxRows=4;for(var G=0;G<i[1];G++){var P=this._daylightSavingAdjust(new Date(m,g,a.selectedDay)),t=" ui-corner-all",y="";if(l){y+='<div class="ui-datepicker-group';if(i[1]>1)switch(G){case 0:y+=" ui-datepicker-group-first";t=" ui-corner-"+(c?"right":
+"left");break;case i[1]-1:y+=" ui-datepicker-group-last";t=" ui-corner-"+(c?"left":"right");break;default:y+=" ui-datepicker-group-middle";t="";break}y+='">'}y+='<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix'+t+'">'+(/all|left/.test(t)&&x==0?c?f:n:"")+(/all|right/.test(t)&&x==0?c?n:f:"")+this._generateMonthYearHeader(a,g,m,k,o,x>0||G>0,B,v)+'</div><table class="ui-datepicker-calendar"><thead><tr>';var z=j?'<th class="ui-datepicker-week-col">'+this._get(a,"weekHeader")+"</th>":
+"";for(t=0;t<7;t++){var r=(t+h)%7;z+="<th"+((t+h+6)%7>=5?' class="ui-datepicker-week-end"':"")+'><span title="'+s[r]+'">'+q[r]+"</span></th>"}y+=z+"</tr></thead><tbody>";z=this._getDaysInMonth(m,g);if(m==a.selectedYear&&g==a.selectedMonth)a.selectedDay=Math.min(a.selectedDay,z);t=(this._getFirstDayOfMonth(m,g)-h+7)%7;z=Math.ceil((t+z)/7);this.maxRows=z=l?this.maxRows>z?this.maxRows:z:z;r=this._daylightSavingAdjust(new Date(m,g,1-t));for(var Q=0;Q<z;Q++){y+="<tr>";var R=!j?"":'<td class="ui-datepicker-week-col">'+
+this._get(a,"calculateWeek")(r)+"</td>";for(t=0;t<7;t++){var I=p?p.apply(a.input?a.input[0]:null,[r]):[true,""],F=r.getMonth()!=g,L=F&&!K||!I[0]||k&&r<k||o&&r>o;R+='<td class="'+((t+h+6)%7>=5?" ui-datepicker-week-end":"")+(F?" ui-datepicker-other-month":"")+(r.getTime()==P.getTime()&&g==a.selectedMonth&&a._keyEvent||E.getTime()==r.getTime()&&E.getTime()==P.getTime()?" "+this._dayOverClass:"")+(L?" "+this._unselectableClass+" ui-state-disabled":"")+(F&&!D?"":" "+I[1]+(r.getTime()==u.getTime()?" "+
+this._currentClass:"")+(r.getTime()==b.getTime()?" ui-datepicker-today":""))+'"'+((!F||D)&&I[2]?' title="'+I[2]+'"':"")+(L?"":' onclick="DP_jQuery_'+A+".datepicker._selectDay('#"+a.id+"',"+r.getMonth()+","+r.getFullYear()+', this);return false;"')+">"+(F&&!D?"&#xa0;":L?'<span class="ui-state-default">'+r.getDate()+"</span>":'<a class="ui-state-default'+(r.getTime()==b.getTime()?" ui-state-highlight":"")+(r.getTime()==u.getTime()?" ui-state-active":"")+(F?" ui-priority-secondary":"")+'" href="#">'+
+r.getDate()+"</a>")+"</td>";r.setDate(r.getDate()+1);r=this._daylightSavingAdjust(r)}y+=R+"</tr>"}g++;if(g>11){g=0;m++}y+="</tbody></table>"+(l?"</div>"+(i[0]>0&&G==i[1]-1?'<div class="ui-datepicker-row-break"></div>':""):"");O+=y}w+=O}w+=e+(d.browser.msie&&parseInt(d.browser.version,10)<7&&!a.inline?'<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>':"");a._keyEvent=false;return w},_generateMonthYearHeader:function(a,b,c,e,f,h,i,g){var j=this._get(a,"changeMonth"),
+l=this._get(a,"changeYear"),u=this._get(a,"showMonthAfterYear"),k='<div class="ui-datepicker-title">',o="";if(h||!j)o+='<span class="ui-datepicker-month">'+i[b]+"</span>";else{i=e&&e.getFullYear()==c;var m=f&&f.getFullYear()==c;o+='<select class="ui-datepicker-month" onchange="DP_jQuery_'+A+".datepicker._selectMonthYear('#"+a.id+"', this, 'M');\" onclick=\"DP_jQuery_"+A+".datepicker._clickMonthYear('#"+a.id+"');\">";for(var n=0;n<12;n++)if((!i||n>=e.getMonth())&&(!m||n<=f.getMonth()))o+='<option value="'+
+n+'"'+(n==b?' selected="selected"':"")+">"+g[n]+"</option>";o+="</select>"}u||(k+=o+(h||!(j&&l)?"&#xa0;":""));if(!a.yearshtml){a.yearshtml="";if(h||!l)k+='<span class="ui-datepicker-year">'+c+"</span>";else{g=this._get(a,"yearRange").split(":");var s=(new Date).getFullYear();i=function(q){q=q.match(/c[+-].*/)?c+parseInt(q.substring(1),10):q.match(/[+-].*/)?s+parseInt(q,10):parseInt(q,10);return isNaN(q)?s:q};b=i(g[0]);g=Math.max(b,i(g[1]||""));b=e?Math.max(b,e.getFullYear()):b;g=f?Math.min(g,f.getFullYear()):
+g;for(a.yearshtml+='<select class="ui-datepicker-year" onchange="DP_jQuery_'+A+".datepicker._selectMonthYear('#"+a.id+"', this, 'Y');\" onclick=\"DP_jQuery_"+A+".datepicker._clickMonthYear('#"+a.id+"');\">";b<=g;b++)a.yearshtml+='<option value="'+b+'"'+(b==c?' selected="selected"':"")+">"+b+"</option>";a.yearshtml+="</select>";k+=a.yearshtml;a.yearshtml=null}}k+=this._get(a,"yearSuffix");if(u)k+=(h||!(j&&l)?"&#xa0;":"")+o;k+="</div>";return k},_adjustInstDate:function(a,b,c){var e=a.drawYear+(c==
+"Y"?b:0),f=a.drawMonth+(c=="M"?b:0);b=Math.min(a.selectedDay,this._getDaysInMonth(e,f))+(c=="D"?b:0);e=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(e,f,b)));a.selectedDay=e.getDate();a.drawMonth=a.selectedMonth=e.getMonth();a.drawYear=a.selectedYear=e.getFullYear();if(c=="M"||c=="Y")this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");b=c&&b<c?c:b;return b=a&&b>a?a:b},_notifyChange:function(a){var b=this._get(a,"onChangeMonthYear");
+if(b)b.apply(a.input?a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){a=this._get(a,"numberOfMonths");return a==null?[1,1]:typeof a=="number"?[1,a]:a},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-this._daylightSavingAdjust(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,e){var f=this._getNumberOfMonths(a);
+c=this._daylightSavingAdjust(new Date(c,e+(b<0?b:f[0]*f[1]),1));b<0&&c.setDate(this._getDaysInMonth(c.getFullYear(),c.getMonth()));return this._isInRange(a,c)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!a||b.getTime()<=a.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10);return{shortYearCutoff:b,dayNamesShort:this._get(a,
+"dayNamesShort"),dayNames:this._get(a,"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,e){if(!b){a.currentDay=a.selectedDay;a.currentMonth=a.selectedMonth;a.currentYear=a.selectedYear}b=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(e,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),b,this._getFormatConfig(a))}});d.fn.datepicker=
+function(a){if(!this.length)return this;if(!d.datepicker.initialized){d(document).mousedown(d.datepicker._checkExternalClick).find("body").append(d.datepicker.dpDiv);d.datepicker.initialized=true}var b=Array.prototype.slice.call(arguments,1);if(typeof a=="string"&&(a=="isDisabled"||a=="getDate"||a=="widget"))return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));if(a=="option"&&arguments.length==2&&typeof arguments[1]=="string")return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,
+[this[0]].concat(b));return this.each(function(){typeof a=="string"?d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this].concat(b)):d.datepicker._attachDatepicker(this,a)})};d.datepicker=new M;d.datepicker.initialized=false;d.datepicker.uuid=(new Date).getTime();d.datepicker.version="1.8.14";window["DP_jQuery_"+A]=d})(jQuery);
+;/*
+ * jQuery UI Progressbar 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Progressbar
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function(b,d){b.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=b("<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow");
+this.valueDiv.remove();b.Widget.prototype.destroy.apply(this,arguments)},value:function(a){if(a===d)return this._value();this._setOption("value",a);return this},_setOption:function(a,c){if(a==="value"){this.options.value=c;this._refreshValue();this._value()===this.options.max&&this._trigger("complete")}b.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;if(typeof a!=="number")a=0;return Math.min(this.options.max,Math.max(this.min,a))},_percentage:function(){return 100*
+this._value()/this.options.max},_refreshValue:function(){var a=this.value(),c=this._percentage();if(this.oldValue!==a){this.oldValue=a;this._trigger("change")}this.valueDiv.toggle(a>this.min).toggleClass("ui-corner-right",a===this.options.max).width(c.toFixed(0)+"%");this.element.attr("aria-valuenow",a)}});b.extend(b.ui.progressbar,{version:"1.8.14"})})(jQuery);
+;/*
+ * jQuery UI Effects 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/
+ */
+jQuery.effects||function(f,j){function m(c){var a;if(c&&c.constructor==Array&&c.length==3)return c;if(a=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(c))return[parseInt(a[1],10),parseInt(a[2],10),parseInt(a[3],10)];if(a=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(c))return[parseFloat(a[1])*2.55,parseFloat(a[2])*2.55,parseFloat(a[3])*2.55];if(a=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(c))return[parseInt(a[1],
+16),parseInt(a[2],16),parseInt(a[3],16)];if(a=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(c))return[parseInt(a[1]+a[1],16),parseInt(a[2]+a[2],16),parseInt(a[3]+a[3],16)];if(/rgba\(0, 0, 0, 0\)/.exec(c))return n.transparent;return n[f.trim(c).toLowerCase()]}function s(c,a){var b;do{b=f.curCSS(c,a);if(b!=""&&b!="transparent"||f.nodeName(c,"body"))break;a="backgroundColor"}while(c=c.parentNode);return m(b)}function o(){var c=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle,
+a={},b,d;if(c&&c.length&&c[0]&&c[c[0]])for(var e=c.length;e--;){b=c[e];if(typeof c[b]=="string"){d=b.replace(/\-(\w)/g,function(g,h){return h.toUpperCase()});a[d]=c[b]}}else for(b in c)if(typeof c[b]==="string")a[b]=c[b];return a}function p(c){var a,b;for(a in c){b=c[a];if(b==null||f.isFunction(b)||a in t||/scrollbar/.test(a)||!/color/i.test(a)&&isNaN(parseFloat(b)))delete c[a]}return c}function u(c,a){var b={_:0},d;for(d in a)if(c[d]!=a[d])b[d]=a[d];return b}function k(c,a,b,d){if(typeof c=="object"){d=
+a;b=null;a=c;c=a.effect}if(f.isFunction(a)){d=a;b=null;a={}}if(typeof a=="number"||f.fx.speeds[a]){d=b;b=a;a={}}if(f.isFunction(b)){d=b;b=null}a=a||{};b=b||a.duration;b=f.fx.off?0:typeof b=="number"?b:b in f.fx.speeds?f.fx.speeds[b]:f.fx.speeds._default;d=d||a.complete;return[c,a,b,d]}function l(c){if(!c||typeof c==="number"||f.fx.speeds[c])return true;if(typeof c==="string"&&!f.effects[c])return true;return false}f.effects={};f.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor",
+"borderTopColor","borderColor","color","outlineColor"],function(c,a){f.fx.step[a]=function(b){if(!b.colorInit){b.start=s(b.elem,a);b.end=m(b.end);b.colorInit=true}b.elem.style[a]="rgb("+Math.max(Math.min(parseInt(b.pos*(b.end[0]-b.start[0])+b.start[0],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[1]-b.start[1])+b.start[1],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[2]-b.start[2])+b.start[2],10),255),0)+")"}});var n={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,
+0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,
+211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},q=["add","remove","toggle"],t={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};f.effects.animateClass=function(c,a,b,
+d){if(f.isFunction(b)){d=b;b=null}return this.queue(function(){var e=f(this),g=e.attr("style")||" ",h=p(o.call(this)),r,v=e.attr("class");f.each(q,function(w,i){c[i]&&e[i+"Class"](c[i])});r=p(o.call(this));e.attr("class",v);e.animate(u(h,r),{queue:false,duration:a,easing:b,complete:function(){f.each(q,function(w,i){c[i]&&e[i+"Class"](c[i])});if(typeof e.attr("style")=="object"){e.attr("style").cssText="";e.attr("style").cssText=g}else e.attr("style",g);d&&d.apply(this,arguments);f.dequeue(this)}})})};
+f.fn.extend({_addClass:f.fn.addClass,addClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{add:c},a,b,d]):this._addClass(c)},_removeClass:f.fn.removeClass,removeClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{remove:c},a,b,d]):this._removeClass(c)},_toggleClass:f.fn.toggleClass,toggleClass:function(c,a,b,d,e){return typeof a=="boolean"||a===j?b?f.effects.animateClass.apply(this,[a?{add:c}:{remove:c},b,d,e]):this._toggleClass(c,a):f.effects.animateClass.apply(this,
+[{toggle:c},a,b,d])},switchClass:function(c,a,b,d,e){return f.effects.animateClass.apply(this,[{add:a,remove:c},b,d,e])}});f.extend(f.effects,{version:"1.8.14",save:function(c,a){for(var b=0;b<a.length;b++)a[b]!==null&&c.data("ec.storage."+a[b],c[0].style[a[b]])},restore:function(c,a){for(var b=0;b<a.length;b++)a[b]!==null&&c.css(a[b],c.data("ec.storage."+a[b]))},setMode:function(c,a){if(a=="toggle")a=c.is(":hidden")?"show":"hide";return a},getBaseline:function(c,a){var b;switch(c[0]){case "top":b=
+0;break;case "middle":b=0.5;break;case "bottom":b=1;break;default:b=c[0]/a.height}switch(c[1]){case "left":c=0;break;case "center":c=0.5;break;case "right":c=1;break;default:c=c[1]/a.width}return{x:c,y:b}},createWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent();var a={width:c.outerWidth(true),height:c.outerHeight(true),"float":c.css("float")},b=f("<div></div>").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0});
+c.wrap(b);b=c.parent();if(c.css("position")=="static"){b.css({position:"relative"});c.css({position:"relative"})}else{f.extend(a,{position:c.css("position"),zIndex:c.css("z-index")});f.each(["top","left","bottom","right"],function(d,e){a[e]=c.css(e);if(isNaN(parseInt(a[e],10)))a[e]="auto"});c.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})}return b.css(a).show()},removeWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent().replaceWith(c);return c},setTransition:function(c,
+a,b,d){d=d||{};f.each(a,function(e,g){unit=c.cssUnit(g);if(unit[0]>0)d[g]=unit[0]*b+unit[1]});return d}});f.fn.extend({effect:function(c){var a=k.apply(this,arguments),b={options:a[1],duration:a[2],callback:a[3]};a=b.options.mode;var d=f.effects[c];if(f.fx.off||!d)return a?this[a](b.duration,b.callback):this.each(function(){b.callback&&b.callback.call(this)});return d.call(this,b)},_show:f.fn.show,show:function(c){if(l(c))return this._show.apply(this,arguments);else{var a=k.apply(this,arguments);
+a[1].mode="show";return this.effect.apply(this,a)}},_hide:f.fn.hide,hide:function(c){if(l(c))return this._hide.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="hide";return this.effect.apply(this,a)}},__toggle:f.fn.toggle,toggle:function(c){if(l(c)||typeof c==="boolean"||f.isFunction(c))return this.__toggle.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="toggle";return this.effect.apply(this,a)}},cssUnit:function(c){var a=this.css(c),b=[];f.each(["em","px","%",
+"pt"],function(d,e){if(a.indexOf(e)>0)b=[parseFloat(a),e]});return b}});f.easing.jswing=f.easing.swing;f.extend(f.easing,{def:"easeOutQuad",swing:function(c,a,b,d,e){return f.easing[f.easing.def](c,a,b,d,e)},easeInQuad:function(c,a,b,d,e){return d*(a/=e)*a+b},easeOutQuad:function(c,a,b,d,e){return-d*(a/=e)*(a-2)+b},easeInOutQuad:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a+b;return-d/2*(--a*(a-2)-1)+b},easeInCubic:function(c,a,b,d,e){return d*(a/=e)*a*a+b},easeOutCubic:function(c,a,b,d,e){return d*
+((a=a/e-1)*a*a+1)+b},easeInOutCubic:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a+b;return d/2*((a-=2)*a*a+2)+b},easeInQuart:function(c,a,b,d,e){return d*(a/=e)*a*a*a+b},easeOutQuart:function(c,a,b,d,e){return-d*((a=a/e-1)*a*a*a-1)+b},easeInOutQuart:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a+b;return-d/2*((a-=2)*a*a*a-2)+b},easeInQuint:function(c,a,b,d,e){return d*(a/=e)*a*a*a*a+b},easeOutQuint:function(c,a,b,d,e){return d*((a=a/e-1)*a*a*a*a+1)+b},easeInOutQuint:function(c,a,b,d,e){if((a/=
+e/2)<1)return d/2*a*a*a*a*a+b;return d/2*((a-=2)*a*a*a*a+2)+b},easeInSine:function(c,a,b,d,e){return-d*Math.cos(a/e*(Math.PI/2))+d+b},easeOutSine:function(c,a,b,d,e){return d*Math.sin(a/e*(Math.PI/2))+b},easeInOutSine:function(c,a,b,d,e){return-d/2*(Math.cos(Math.PI*a/e)-1)+b},easeInExpo:function(c,a,b,d,e){return a==0?b:d*Math.pow(2,10*(a/e-1))+b},easeOutExpo:function(c,a,b,d,e){return a==e?b+d:d*(-Math.pow(2,-10*a/e)+1)+b},easeInOutExpo:function(c,a,b,d,e){if(a==0)return b;if(a==e)return b+d;if((a/=
+e/2)<1)return d/2*Math.pow(2,10*(a-1))+b;return d/2*(-Math.pow(2,-10*--a)+2)+b},easeInCirc:function(c,a,b,d,e){return-d*(Math.sqrt(1-(a/=e)*a)-1)+b},easeOutCirc:function(c,a,b,d,e){return d*Math.sqrt(1-(a=a/e-1)*a)+b},easeInOutCirc:function(c,a,b,d,e){if((a/=e/2)<1)return-d/2*(Math.sqrt(1-a*a)-1)+b;return d/2*(Math.sqrt(1-(a-=2)*a)+1)+b},easeInElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/
+h);return-(h*Math.pow(2,10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g))+b},easeOutElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/h);return h*Math.pow(2,-10*a)*Math.sin((a*e-c)*2*Math.PI/g)+d+b},easeInOutElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e/2)==2)return b+d;g||(g=e*0.3*1.5);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/h);if(a<1)return-0.5*
+h*Math.pow(2,10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g)+b;return h*Math.pow(2,-10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g)*0.5+d+b},easeInBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;return d*(a/=e)*a*((g+1)*a-g)+b},easeOutBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;return d*((a=a/e-1)*a*((g+1)*a+g)+1)+b},easeInOutBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;if((a/=e/2)<1)return d/2*a*a*(((g*=1.525)+1)*a-g)+b;return d/2*((a-=2)*a*(((g*=1.525)+1)*a+g)+2)+b},easeInBounce:function(c,a,b,d,e){return d-f.easing.easeOutBounce(c,
+e-a,0,d,e)+b},easeOutBounce:function(c,a,b,d,e){return(a/=e)<1/2.75?d*7.5625*a*a+b:a<2/2.75?d*(7.5625*(a-=1.5/2.75)*a+0.75)+b:a<2.5/2.75?d*(7.5625*(a-=2.25/2.75)*a+0.9375)+b:d*(7.5625*(a-=2.625/2.75)*a+0.984375)+b},easeInOutBounce:function(c,a,b,d,e){if(a<e/2)return f.easing.easeInBounce(c,a*2,0,d,e)*0.5+b;return f.easing.easeOutBounce(c,a*2-e,0,d,e)*0.5+d*0.5+b}})}(jQuery);
+;/*
+ * jQuery UI Effects Blind 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Blind
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(b){b.effects.blind=function(c){return this.queue(function(){var a=b(this),g=["position","top","bottom","left","right"],f=b.effects.setMode(a,c.options.mode||"hide"),d=c.options.direction||"vertical";b.effects.save(a,g);a.show();var e=b.effects.createWrapper(a).css({overflow:"hidden"}),h=d=="vertical"?"height":"width";d=d=="vertical"?e.height():e.width();f=="show"&&e.css(h,0);var i={};i[h]=f=="show"?d:0;e.animate(i,c.duration,c.options.easing,function(){f=="hide"&&a.hide();b.effects.restore(a,
+g);b.effects.removeWrapper(a);c.callback&&c.callback.apply(a[0],arguments);a.dequeue()})})}})(jQuery);
+;/*
+ * jQuery UI Effects Bounce 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Bounce
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(e){e.effects.bounce=function(b){return this.queue(function(){var a=e(this),l=["position","top","bottom","left","right"],h=e.effects.setMode(a,b.options.mode||"effect"),d=b.options.direction||"up",c=b.options.distance||20,m=b.options.times||5,i=b.duration||250;/show|hide/.test(h)&&l.push("opacity");e.effects.save(a,l);a.show();e.effects.createWrapper(a);var f=d=="up"||d=="down"?"top":"left";d=d=="up"||d=="left"?"pos":"neg";c=b.options.distance||(f=="top"?a.outerHeight({margin:true})/3:a.outerWidth({margin:true})/
+3);if(h=="show")a.css("opacity",0).css(f,d=="pos"?-c:c);if(h=="hide")c/=m*2;h!="hide"&&m--;if(h=="show"){var g={opacity:1};g[f]=(d=="pos"?"+=":"-=")+c;a.animate(g,i/2,b.options.easing);c/=2;m--}for(g=0;g<m;g++){var j={},k={};j[f]=(d=="pos"?"-=":"+=")+c;k[f]=(d=="pos"?"+=":"-=")+c;a.animate(j,i/2,b.options.easing).animate(k,i/2,b.options.easing);c=h=="hide"?c*2:c/2}if(h=="hide"){g={opacity:0};g[f]=(d=="pos"?"-=":"+=")+c;a.animate(g,i/2,b.options.easing,function(){a.hide();e.effects.restore(a,l);e.effects.removeWrapper(a);
+b.callback&&b.callback.apply(this,arguments)})}else{j={};k={};j[f]=(d=="pos"?"-=":"+=")+c;k[f]=(d=="pos"?"+=":"-=")+c;a.animate(j,i/2,b.options.easing).animate(k,i/2,b.options.easing,function(){e.effects.restore(a,l);e.effects.removeWrapper(a);b.callback&&b.callback.apply(this,arguments)})}a.queue("fx",function(){a.dequeue()});a.dequeue()})}})(jQuery);
+;/*
+ * jQuery UI Effects Clip 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Clip
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(b){b.effects.clip=function(e){return this.queue(function(){var a=b(this),i=["position","top","bottom","left","right","height","width"],f=b.effects.setMode(a,e.options.mode||"hide"),c=e.options.direction||"vertical";b.effects.save(a,i);a.show();var d=b.effects.createWrapper(a).css({overflow:"hidden"});d=a[0].tagName=="IMG"?d:a;var g={size:c=="vertical"?"height":"width",position:c=="vertical"?"top":"left"};c=c=="vertical"?d.height():d.width();if(f=="show"){d.css(g.size,0);d.css(g.position,
+c/2)}var h={};h[g.size]=f=="show"?c:0;h[g.position]=f=="show"?0:c/2;d.animate(h,{queue:false,duration:e.duration,easing:e.options.easing,complete:function(){f=="hide"&&a.hide();b.effects.restore(a,i);b.effects.removeWrapper(a);e.callback&&e.callback.apply(a[0],arguments);a.dequeue()}})})}})(jQuery);
+;/*
+ * jQuery UI Effects Drop 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Drop
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(c){c.effects.drop=function(d){return this.queue(function(){var a=c(this),h=["position","top","bottom","left","right","opacity"],e=c.effects.setMode(a,d.options.mode||"hide"),b=d.options.direction||"left";c.effects.save(a,h);a.show();c.effects.createWrapper(a);var f=b=="up"||b=="down"?"top":"left";b=b=="up"||b=="left"?"pos":"neg";var g=d.options.distance||(f=="top"?a.outerHeight({margin:true})/2:a.outerWidth({margin:true})/2);if(e=="show")a.css("opacity",0).css(f,b=="pos"?-g:g);var i={opacity:e==
+"show"?1:0};i[f]=(e=="show"?b=="pos"?"+=":"-=":b=="pos"?"-=":"+=")+g;a.animate(i,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){e=="hide"&&a.hide();c.effects.restore(a,h);c.effects.removeWrapper(a);d.callback&&d.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
+;/*
+ * jQuery UI Effects Explode 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Explode
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(j){j.effects.explode=function(a){return this.queue(function(){var c=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3,d=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3;a.options.mode=a.options.mode=="toggle"?j(this).is(":visible")?"hide":"show":a.options.mode;var b=j(this).show().css("visibility","hidden"),g=b.offset();g.top-=parseInt(b.css("marginTop"),10)||0;g.left-=parseInt(b.css("marginLeft"),10)||0;for(var h=b.outerWidth(true),i=b.outerHeight(true),e=0;e<c;e++)for(var f=
+0;f<d;f++)b.clone().appendTo("body").wrap("<div></div>").css({position:"absolute",visibility:"visible",left:-f*(h/d),top:-e*(i/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:h/d,height:i/c,left:g.left+f*(h/d)+(a.options.mode=="show"?(f-Math.floor(d/2))*(h/d):0),top:g.top+e*(i/c)+(a.options.mode=="show"?(e-Math.floor(c/2))*(i/c):0),opacity:a.options.mode=="show"?0:1}).animate({left:g.left+f*(h/d)+(a.options.mode=="show"?0:(f-Math.floor(d/2))*(h/d)),top:g.top+
+e*(i/c)+(a.options.mode=="show"?0:(e-Math.floor(c/2))*(i/c)),opacity:a.options.mode=="show"?1:0},a.duration||500);setTimeout(function(){a.options.mode=="show"?b.css({visibility:"visible"}):b.css({visibility:"visible"}).hide();a.callback&&a.callback.apply(b[0]);b.dequeue();j("div.ui-effects-explode").remove()},a.duration||500)})}})(jQuery);
+;/*
+ * jQuery UI Effects Fade 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Fade
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(b){b.effects.fade=function(a){return this.queue(function(){var c=b(this),d=b.effects.setMode(c,a.options.mode||"hide");c.animate({opacity:d},{queue:false,duration:a.duration,easing:a.options.easing,complete:function(){a.callback&&a.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery);
+;/*
+ * jQuery UI Effects Fold 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Fold
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(c){c.effects.fold=function(a){return this.queue(function(){var b=c(this),j=["position","top","bottom","left","right"],d=c.effects.setMode(b,a.options.mode||"hide"),g=a.options.size||15,h=!!a.options.horizFirst,k=a.duration?a.duration/2:c.fx.speeds._default/2;c.effects.save(b,j);b.show();var e=c.effects.createWrapper(b).css({overflow:"hidden"}),f=d=="show"!=h,l=f?["width","height"]:["height","width"];f=f?[e.width(),e.height()]:[e.height(),e.width()];var i=/([0-9]+)%/.exec(g);if(i)g=parseInt(i[1],
+10)/100*f[d=="hide"?0:1];if(d=="show")e.css(h?{height:0,width:g}:{height:g,width:0});h={};i={};h[l[0]]=d=="show"?f[0]:g;i[l[1]]=d=="show"?f[1]:0;e.animate(h,k,a.options.easing).animate(i,k,a.options.easing,function(){d=="hide"&&b.hide();c.effects.restore(b,j);c.effects.removeWrapper(b);a.callback&&a.callback.apply(b[0],arguments);b.dequeue()})})}})(jQuery);
+;/*
+ * jQuery UI Effects Highlight 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Highlight
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(b){b.effects.highlight=function(c){return this.queue(function(){var a=b(this),e=["backgroundImage","backgroundColor","opacity"],d=b.effects.setMode(a,c.options.mode||"show"),f={backgroundColor:a.css("backgroundColor")};if(d=="hide")f.opacity=0;b.effects.save(a,e);a.show().css({backgroundImage:"none",backgroundColor:c.options.color||"#ffff99"}).animate(f,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){d=="hide"&&a.hide();b.effects.restore(a,e);d=="show"&&!b.support.opacity&&
+this.style.removeAttribute("filter");c.callback&&c.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
+;/*
+ * jQuery UI Effects Pulsate 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Pulsate
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(d){d.effects.pulsate=function(a){return this.queue(function(){var b=d(this),c=d.effects.setMode(b,a.options.mode||"show");times=(a.options.times||5)*2-1;duration=a.duration?a.duration/2:d.fx.speeds._default/2;isVisible=b.is(":visible");animateTo=0;if(!isVisible){b.css("opacity",0).show();animateTo=1}if(c=="hide"&&isVisible||c=="show"&&!isVisible)times--;for(c=0;c<times;c++){b.animate({opacity:animateTo},duration,a.options.easing);animateTo=(animateTo+1)%2}b.animate({opacity:animateTo},duration,
+a.options.easing,function(){animateTo==0&&b.hide();a.callback&&a.callback.apply(this,arguments)});b.queue("fx",function(){b.dequeue()}).dequeue()})}})(jQuery);
+;/*
+ * jQuery UI Effects Scale 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Scale
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(c){c.effects.puff=function(b){return this.queue(function(){var a=c(this),e=c.effects.setMode(a,b.options.mode||"hide"),g=parseInt(b.options.percent,10)||150,h=g/100,i={height:a.height(),width:a.width()};c.extend(b.options,{fade:true,mode:e,percent:e=="hide"?g:100,from:e=="hide"?i:{height:i.height*h,width:i.width*h}});a.effect("scale",b.options,b.duration,b.callback);a.dequeue()})};c.effects.scale=function(b){return this.queue(function(){var a=c(this),e=c.extend(true,{},b.options),g=c.effects.setMode(a,
+b.options.mode||"effect"),h=parseInt(b.options.percent,10)||(parseInt(b.options.percent,10)==0?0:g=="hide"?0:100),i=b.options.direction||"both",f=b.options.origin;if(g!="effect"){e.origin=f||["middle","center"];e.restore=true}f={height:a.height(),width:a.width()};a.from=b.options.from||(g=="show"?{height:0,width:0}:f);h={y:i!="horizontal"?h/100:1,x:i!="vertical"?h/100:1};a.to={height:f.height*h.y,width:f.width*h.x};if(b.options.fade){if(g=="show"){a.from.opacity=0;a.to.opacity=1}if(g=="hide"){a.from.opacity=
+1;a.to.opacity=0}}e.from=a.from;e.to=a.to;e.mode=g;a.effect("size",e,b.duration,b.callback);a.dequeue()})};c.effects.size=function(b){return this.queue(function(){var a=c(this),e=["position","top","bottom","left","right","width","height","overflow","opacity"],g=["position","top","bottom","left","right","overflow","opacity"],h=["width","height","overflow"],i=["fontSize"],f=["borderTopWidth","borderBottomWidth","paddingTop","paddingBottom"],k=["borderLeftWidth","borderRightWidth","paddingLeft","paddingRight"],
+p=c.effects.setMode(a,b.options.mode||"effect"),n=b.options.restore||false,m=b.options.scale||"both",l=b.options.origin,j={height:a.height(),width:a.width()};a.from=b.options.from||j;a.to=b.options.to||j;if(l){l=c.effects.getBaseline(l,j);a.from.top=(j.height-a.from.height)*l.y;a.from.left=(j.width-a.from.width)*l.x;a.to.top=(j.height-a.to.height)*l.y;a.to.left=(j.width-a.to.width)*l.x}var d={from:{y:a.from.height/j.height,x:a.from.width/j.width},to:{y:a.to.height/j.height,x:a.to.width/j.width}};
+if(m=="box"||m=="both"){if(d.from.y!=d.to.y){e=e.concat(f);a.from=c.effects.setTransition(a,f,d.from.y,a.from);a.to=c.effects.setTransition(a,f,d.to.y,a.to)}if(d.from.x!=d.to.x){e=e.concat(k);a.from=c.effects.setTransition(a,k,d.from.x,a.from);a.to=c.effects.setTransition(a,k,d.to.x,a.to)}}if(m=="content"||m=="both")if(d.from.y!=d.to.y){e=e.concat(i);a.from=c.effects.setTransition(a,i,d.from.y,a.from);a.to=c.effects.setTransition(a,i,d.to.y,a.to)}c.effects.save(a,n?e:g);a.show();c.effects.createWrapper(a);
+a.css("overflow","hidden").css(a.from);if(m=="content"||m=="both"){f=f.concat(["marginTop","marginBottom"]).concat(i);k=k.concat(["marginLeft","marginRight"]);h=e.concat(f).concat(k);a.find("*[width]").each(function(){child=c(this);n&&c.effects.save(child,h);var o={height:child.height(),width:child.width()};child.from={height:o.height*d.from.y,width:o.width*d.from.x};child.to={height:o.height*d.to.y,width:o.width*d.to.x};if(d.from.y!=d.to.y){child.from=c.effects.setTransition(child,f,d.from.y,child.from);
+child.to=c.effects.setTransition(child,f,d.to.y,child.to)}if(d.from.x!=d.to.x){child.from=c.effects.setTransition(child,k,d.from.x,child.from);child.to=c.effects.setTransition(child,k,d.to.x,child.to)}child.css(child.from);child.animate(child.to,b.duration,b.options.easing,function(){n&&c.effects.restore(child,h)})})}a.animate(a.to,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){a.to.opacity===0&&a.css("opacity",a.from.opacity);p=="hide"&&a.hide();c.effects.restore(a,
+n?e:g);c.effects.removeWrapper(a);b.callback&&b.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
+;/*
+ * jQuery UI Effects Shake 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Shake
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(d){d.effects.shake=function(a){return this.queue(function(){var b=d(this),j=["position","top","bottom","left","right"];d.effects.setMode(b,a.options.mode||"effect");var c=a.options.direction||"left",e=a.options.distance||20,l=a.options.times||3,f=a.duration||a.options.duration||140;d.effects.save(b,j);b.show();d.effects.createWrapper(b);var g=c=="up"||c=="down"?"top":"left",h=c=="up"||c=="left"?"pos":"neg";c={};var i={},k={};c[g]=(h=="pos"?"-=":"+=")+e;i[g]=(h=="pos"?"+=":"-=")+e*2;k[g]=
+(h=="pos"?"-=":"+=")+e*2;b.animate(c,f,a.options.easing);for(e=1;e<l;e++)b.animate(i,f,a.options.easing).animate(k,f,a.options.easing);b.animate(i,f,a.options.easing).animate(c,f/2,a.options.easing,function(){d.effects.restore(b,j);d.effects.removeWrapper(b);a.callback&&a.callback.apply(this,arguments)});b.queue("fx",function(){b.dequeue()});b.dequeue()})}})(jQuery);
+;/*
+ * jQuery UI Effects Slide 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Slide
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(c){c.effects.slide=function(d){return this.queue(function(){var a=c(this),h=["position","top","bottom","left","right"],f=c.effects.setMode(a,d.options.mode||"show"),b=d.options.direction||"left";c.effects.save(a,h);a.show();c.effects.createWrapper(a).css({overflow:"hidden"});var g=b=="up"||b=="down"?"top":"left";b=b=="up"||b=="left"?"pos":"neg";var e=d.options.distance||(g=="top"?a.outerHeight({margin:true}):a.outerWidth({margin:true}));if(f=="show")a.css(g,b=="pos"?isNaN(e)?"-"+e:-e:e);
+var i={};i[g]=(f=="show"?b=="pos"?"+=":"-=":b=="pos"?"-=":"+=")+e;a.animate(i,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){f=="hide"&&a.hide();c.effects.restore(a,h);c.effects.removeWrapper(a);d.callback&&d.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
+;/*
+ * jQuery UI Effects Transfer 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Transfer
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(e){e.effects.transfer=function(a){return this.queue(function(){var b=e(this),c=e(a.options.to),d=c.offset();c={top:d.top,left:d.left,height:c.innerHeight(),width:c.innerWidth()};d=b.offset();var f=e('<div class="ui-effects-transfer"></div>').appendTo(document.body).addClass(a.options.className).css({top:d.top,left:d.left,height:b.innerHeight(),width:b.innerWidth(),position:"absolute"}).animate(c,a.duration,a.options.easing,function(){f.remove();a.callback&&a.callback.apply(b[0],arguments);
+b.dequeue()})})}})(jQuery);
+; \ No newline at end of file
diff --git a/plugins/jqueryui/themes/default/images/buttongradient.png b/plugins/jqueryui/themes/default/images/buttongradient.png
new file mode 100644
index 000000000..0595474c7
--- /dev/null
+++ b/plugins/jqueryui/themes/default/images/buttongradient.png
Binary files differ
diff --git a/plugins/jqueryui/themes/default/images/listheader.png b/plugins/jqueryui/themes/default/images/listheader.png
new file mode 100644
index 000000000..670df0c4a
--- /dev/null
+++ b/plugins/jqueryui/themes/default/images/listheader.png
Binary files differ
diff --git a/plugins/jqueryui/themes/default/images/ui-bg_flat_0_aaaaaa_40x100.png b/plugins/jqueryui/themes/default/images/ui-bg_flat_0_aaaaaa_40x100.png
new file mode 100755
index 000000000..5b5dab2ab
--- /dev/null
+++ b/plugins/jqueryui/themes/default/images/ui-bg_flat_0_aaaaaa_40x100.png
Binary files differ
diff --git a/plugins/jqueryui/themes/default/images/ui-bg_flat_75_ffffff_40x100.png b/plugins/jqueryui/themes/default/images/ui-bg_flat_75_ffffff_40x100.png
new file mode 100755
index 000000000..ac8b229af
--- /dev/null
+++ b/plugins/jqueryui/themes/default/images/ui-bg_flat_75_ffffff_40x100.png
Binary files differ
diff --git a/plugins/jqueryui/themes/default/images/ui-bg_flat_90_cc3333_40x100.png b/plugins/jqueryui/themes/default/images/ui-bg_flat_90_cc3333_40x100.png
new file mode 100755
index 000000000..6a5d37d65
--- /dev/null
+++ b/plugins/jqueryui/themes/default/images/ui-bg_flat_90_cc3333_40x100.png
Binary files differ
diff --git a/plugins/jqueryui/themes/default/images/ui-bg_glass_95_fef1ec_1x400.png b/plugins/jqueryui/themes/default/images/ui-bg_glass_95_fef1ec_1x400.png
new file mode 100755
index 000000000..4443fdc1a
--- /dev/null
+++ b/plugins/jqueryui/themes/default/images/ui-bg_glass_95_fef1ec_1x400.png
Binary files differ
diff --git a/plugins/jqueryui/themes/default/images/ui-bg_highlight-hard_90_a3a3a3_1x100.png b/plugins/jqueryui/themes/default/images/ui-bg_highlight-hard_90_a3a3a3_1x100.png
new file mode 100755
index 000000000..b3533aafe
--- /dev/null
+++ b/plugins/jqueryui/themes/default/images/ui-bg_highlight-hard_90_a3a3a3_1x100.png
Binary files differ
diff --git a/plugins/jqueryui/themes/default/images/ui-bg_highlight-hard_90_e6e6e7_1x100.png b/plugins/jqueryui/themes/default/images/ui-bg_highlight-hard_90_e6e6e7_1x100.png
new file mode 100755
index 000000000..d0a127f4d
--- /dev/null
+++ b/plugins/jqueryui/themes/default/images/ui-bg_highlight-hard_90_e6e6e7_1x100.png
Binary files differ
diff --git a/plugins/jqueryui/themes/default/images/ui-bg_highlight-hard_90_f4f4f4_1x100.png b/plugins/jqueryui/themes/default/images/ui-bg_highlight-hard_90_f4f4f4_1x100.png
new file mode 100755
index 000000000..ecc0ac16a
--- /dev/null
+++ b/plugins/jqueryui/themes/default/images/ui-bg_highlight-hard_90_f4f4f4_1x100.png
Binary files differ
diff --git a/plugins/jqueryui/themes/default/images/ui-icons_000000_256x240.png b/plugins/jqueryui/themes/default/images/ui-icons_000000_256x240.png
new file mode 100755
index 000000000..7c211aa08
--- /dev/null
+++ b/plugins/jqueryui/themes/default/images/ui-icons_000000_256x240.png
Binary files differ
diff --git a/plugins/jqueryui/themes/default/images/ui-icons_333333_256x240.png b/plugins/jqueryui/themes/default/images/ui-icons_333333_256x240.png
new file mode 100755
index 000000000..fe079a595
--- /dev/null
+++ b/plugins/jqueryui/themes/default/images/ui-icons_333333_256x240.png
Binary files differ
diff --git a/plugins/jqueryui/themes/default/images/ui-icons_666666_256x240.png b/plugins/jqueryui/themes/default/images/ui-icons_666666_256x240.png
new file mode 100755
index 000000000..f87de1ca1
--- /dev/null
+++ b/plugins/jqueryui/themes/default/images/ui-icons_666666_256x240.png
Binary files differ
diff --git a/plugins/jqueryui/themes/default/images/ui-icons_cc3333_256x240.png b/plugins/jqueryui/themes/default/images/ui-icons_cc3333_256x240.png
new file mode 100755
index 000000000..b2fe02927
--- /dev/null
+++ b/plugins/jqueryui/themes/default/images/ui-icons_cc3333_256x240.png
Binary files differ
diff --git a/plugins/jqueryui/themes/default/images/ui-icons_dddddd_256x240.png b/plugins/jqueryui/themes/default/images/ui-icons_dddddd_256x240.png
new file mode 100755
index 000000000..91aada0ab
--- /dev/null
+++ b/plugins/jqueryui/themes/default/images/ui-icons_dddddd_256x240.png
Binary files differ
diff --git a/plugins/jqueryui/themes/default/jquery-ui-1.8.14.custom.css b/plugins/jqueryui/themes/default/jquery-ui-1.8.14.custom.css
new file mode 100755
index 000000000..dbc78fd3b
--- /dev/null
+++ b/plugins/jqueryui/themes/default/jquery-ui-1.8.14.custom.css
@@ -0,0 +1,580 @@
+/*
+ * jQuery UI CSS Framework 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Theming/API
+ */
+
+/* Layout helpers
+----------------------------------*/
+.ui-helper-hidden { display: none; }
+.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); }
+.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
+.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }
+.ui-helper-clearfix { display: inline-block; }
+/* required comment for clearfix to work in Opera \*/
+* html .ui-helper-clearfix { height:1%; }
+.ui-helper-clearfix { display:block; }
+/* end clearfix */
+.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
+
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-disabled { cursor: default !important; }
+
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Overlays */
+.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
+
+
+/*
+ * jQuery UI CSS Framework 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Theming/API
+ *
+ * To view and modify this theme, visit http://jqueryui.com/themeroller/?ctl=themeroller&ffDefault=Lucida%20Grande,%20Verdana,%20Arial,%20Helvetica,%20sans-serif&fwDefault=normal&fsDefault=1em&cornerRadius=0&bgColorHeader=f4f4f4&bgTextureHeader=04_highlight_hard.png&bgImgOpacityHeader=90&borderColorHeader=999999&fcHeader=333333&iconColorHeader=333333&bgColorContent=ffffff&bgTextureContent=01_flat.png&bgImgOpacityContent=75&borderColorContent=aaaaaa&fcContent=000000&iconColorContent=000000&bgColorDefault=e6e6e7&bgTextureDefault=04_highlight_hard.png&bgImgOpacityDefault=90&borderColorDefault=aaaaaa&fcDefault=000000&iconColorDefault=666666&bgColorHover=e6e6e7&bgTextureHover=04_highlight_hard.png&bgImgOpacityHover=90&borderColorHover=999999&fcHover=000000&iconColorHover=333333&bgColorActive=a3a3a3&bgTextureActive=04_highlight_hard.png&bgImgOpacityActive=90&borderColorActive=a4a4a4&fcActive=000000&iconColorActive=333333&bgColorHighlight=cc3333&bgTextureHighlight=01_flat.png&bgImgOpacityHighlight=90&borderColorHighlight=cc3333&fcHighlight=ffffff&iconColorHighlight=dddddd&bgColorError=fef1ec&bgTextureError=02_glass.png&bgImgOpacityError=95&borderColorError=cc3333&fcError=cc3333&iconColorError=cc3333&bgColorOverlay=aaaaaa&bgTextureOverlay=01_flat.png&bgImgOpacityOverlay=0&opacityOverlay=30&bgColorShadow=aaaaaa&bgTextureShadow=01_flat.png&bgImgOpacityShadow=0&opacityShadow=35&thicknessShadow=6px&offsetTopShadow=-6px&offsetLeftShadow=-6px&cornerRadiusShadow=6px
+ */
+
+
+/* Component containers
+----------------------------------*/
+.ui-widget { font-family: Lucida Grande, Verdana, Arial, Helvetica, sans-serif; font-size: 1em; }
+.ui-widget .ui-widget { font-size: 1em; }
+.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Lucida Grande, Verdana, Arial, Helvetica, sans-serif; font-size: 1em; }
+.ui-widget-content { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x; color: #000000; }
+.ui-widget-content a { color: #000000; }
+.ui-widget-header { border: 1px solid #999999; border-width: 0 0 1px 0; background: #f4f4f4 url(images/listheader.png) 50% 50% repeat; color: #333333; font-weight: bold; margin: -0.2em -0.2em 0 -0.2em; }
+.ui-widget-header a { color: #333333; }
+
+/* Interaction states
+----------------------------------*/
+.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #aaaaaa; background: #e6e6e7 url(images/ui-bg_highlight-hard_90_e6e6e7_1x100.png) 50% 50% repeat-x; font-weight: normal; color: #000000; }
+.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #000000; text-decoration: none; }
+.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #999999; background: #e6e6e7 url(images/ui-bg_highlight-hard_90_e6e6e7_1x100.png) 50% 50% repeat-x; font-weight: normal; color: #000000; }
+.ui-state-hover a, .ui-state-hover a:hover { color: #000000; text-decoration: none; }
+.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #a4a4a4; background: #a3a3a3 url(images/ui-bg_highlight-hard_90_a3a3a3_1x100.png) 50% 50% repeat-x; font-weight: normal; color: #000000; }
+.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #000000; text-decoration: none; }
+.ui-state-focus, .ui-widget-content .ui-state-focus { border: 1px solid #c33; color: #a00; }
+.ui-tabs-nav .ui-state-focus { border: 1px solid #a4a4a4; color: #000000; }
+.ui-widget :active { outline: none; }
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #cc3333; background: #cc3333 url(images/ui-bg_flat_90_cc3333_40x100.png) 50% 50% repeat-x; color: #ffffff; }
+.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #ffffff; }
+.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cc3333; background: #fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x; color: #cc3333; }
+.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cc3333; }
+.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cc3333; }
+.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; }
+.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .6; filter:Alpha(Opacity=60); font-weight: normal; }
+.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_000000_256x240.png); }
+.ui-widget-content .ui-icon {background-image: url(images/ui-icons_000000_256x240.png); }
+.ui-widget-header .ui-icon {background-image: url(images/ui-icons_333333_256x240.png); }
+.ui-state-default .ui-icon { background-image: url(images/ui-icons_666666_256x240.png); }
+.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_333333_256x240.png); }
+.ui-state-active .ui-icon {background-image: url(images/ui-icons_333333_256x240.png); }
+.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_dddddd_256x240.png); }
+.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cc3333_256x240.png); }
+
+/* positioning */
+.ui-icon-carat-1-n { background-position: 0 0; }
+.ui-icon-carat-1-ne { background-position: -16px 0; }
+.ui-icon-carat-1-e { background-position: -32px 0; }
+.ui-icon-carat-1-se { background-position: -48px 0; }
+.ui-icon-carat-1-s { background-position: -64px 0; }
+.ui-icon-carat-1-sw { background-position: -80px 0; }
+.ui-icon-carat-1-w { background-position: -96px 0; }
+.ui-icon-carat-1-nw { background-position: -112px 0; }
+.ui-icon-carat-2-n-s { background-position: -128px 0; }
+.ui-icon-carat-2-e-w { background-position: -144px 0; }
+.ui-icon-triangle-1-n { background-position: 0 -16px; }
+.ui-icon-triangle-1-ne { background-position: -16px -16px; }
+.ui-icon-triangle-1-e { background-position: -32px -16px; }
+.ui-icon-triangle-1-se { background-position: -48px -16px; }
+.ui-icon-triangle-1-s { background-position: -64px -16px; }
+.ui-icon-triangle-1-sw { background-position: -80px -16px; }
+.ui-icon-triangle-1-w { background-position: -96px -16px; }
+.ui-icon-triangle-1-nw { background-position: -112px -16px; }
+.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
+.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
+.ui-icon-arrow-1-n { background-position: 0 -32px; }
+.ui-icon-arrow-1-ne { background-position: -16px -32px; }
+.ui-icon-arrow-1-e { background-position: -32px -32px; }
+.ui-icon-arrow-1-se { background-position: -48px -32px; }
+.ui-icon-arrow-1-s { background-position: -64px -32px; }
+.ui-icon-arrow-1-sw { background-position: -80px -32px; }
+.ui-icon-arrow-1-w { background-position: -96px -32px; }
+.ui-icon-arrow-1-nw { background-position: -112px -32px; }
+.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
+.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
+.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
+.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
+.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
+.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
+.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
+.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
+.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
+.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
+.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
+.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
+.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
+.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
+.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
+.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
+.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
+.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
+.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
+.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
+.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
+.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
+.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
+.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
+.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
+.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
+.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
+.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
+.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
+.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
+.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
+.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
+.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
+.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
+.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
+.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
+.ui-icon-arrow-4 { background-position: 0 -80px; }
+.ui-icon-arrow-4-diag { background-position: -16px -80px; }
+.ui-icon-extlink { background-position: -32px -80px; }
+.ui-icon-newwin { background-position: -48px -80px; }
+.ui-icon-refresh { background-position: -64px -80px; }
+.ui-icon-shuffle { background-position: -80px -80px; }
+.ui-icon-transfer-e-w { background-position: -96px -80px; }
+.ui-icon-transferthick-e-w { background-position: -112px -80px; }
+.ui-icon-folder-collapsed { background-position: 0 -96px; }
+.ui-icon-folder-open { background-position: -16px -96px; }
+.ui-icon-document { background-position: -32px -96px; }
+.ui-icon-document-b { background-position: -48px -96px; }
+.ui-icon-note { background-position: -64px -96px; }
+.ui-icon-mail-closed { background-position: -80px -96px; }
+.ui-icon-mail-open { background-position: -96px -96px; }
+.ui-icon-suitcase { background-position: -112px -96px; }
+.ui-icon-comment { background-position: -128px -96px; }
+.ui-icon-person { background-position: -144px -96px; }
+.ui-icon-print { background-position: -160px -96px; }
+.ui-icon-trash { background-position: -176px -96px; }
+.ui-icon-locked { background-position: -192px -96px; }
+.ui-icon-unlocked { background-position: -208px -96px; }
+.ui-icon-bookmark { background-position: -224px -96px; }
+.ui-icon-tag { background-position: -240px -96px; }
+.ui-icon-home { background-position: 0 -112px; }
+.ui-icon-flag { background-position: -16px -112px; }
+.ui-icon-calendar { background-position: -32px -112px; }
+.ui-icon-cart { background-position: -48px -112px; }
+.ui-icon-pencil { background-position: -64px -112px; }
+.ui-icon-clock { background-position: -80px -112px; }
+.ui-icon-disk { background-position: -96px -112px; }
+.ui-icon-calculator { background-position: -112px -112px; }
+.ui-icon-zoomin { background-position: -128px -112px; }
+.ui-icon-zoomout { background-position: -144px -112px; }
+.ui-icon-search { background-position: -160px -112px; }
+.ui-icon-wrench { background-position: -176px -112px; }
+.ui-icon-gear { background-position: -192px -112px; }
+.ui-icon-heart { background-position: -208px -112px; }
+.ui-icon-star { background-position: -224px -112px; }
+.ui-icon-link { background-position: -240px -112px; }
+.ui-icon-cancel { background-position: 0 -128px; }
+.ui-icon-plus { background-position: -16px -128px; }
+.ui-icon-plusthick { background-position: -32px -128px; }
+.ui-icon-minus { background-position: -48px -128px; }
+.ui-icon-minusthick { background-position: -64px -128px; }
+.ui-icon-close { background-position: -80px -128px; }
+.ui-icon-closethick { background-position: -96px -128px; }
+.ui-icon-key { background-position: -112px -128px; }
+.ui-icon-lightbulb { background-position: -128px -128px; }
+.ui-icon-scissors { background-position: -144px -128px; }
+.ui-icon-clipboard { background-position: -160px -128px; }
+.ui-icon-copy { background-position: -176px -128px; }
+.ui-icon-contact { background-position: -192px -128px; }
+.ui-icon-image { background-position: -208px -128px; }
+.ui-icon-video { background-position: -224px -128px; }
+.ui-icon-script { background-position: -240px -128px; }
+.ui-icon-alert { background-position: 0 -144px; }
+.ui-icon-info { background-position: -16px -144px; }
+.ui-icon-notice { background-position: -32px -144px; }
+.ui-icon-help { background-position: -48px -144px; }
+.ui-icon-check { background-position: -64px -144px; }
+.ui-icon-bullet { background-position: -80px -144px; }
+.ui-icon-radio-off { background-position: -96px -144px; }
+.ui-icon-radio-on { background-position: -112px -144px; }
+.ui-icon-pin-w { background-position: -128px -144px; }
+.ui-icon-pin-s { background-position: -144px -144px; }
+.ui-icon-play { background-position: 0 -160px; }
+.ui-icon-pause { background-position: -16px -160px; }
+.ui-icon-seek-next { background-position: -32px -160px; }
+.ui-icon-seek-prev { background-position: -48px -160px; }
+.ui-icon-seek-end { background-position: -64px -160px; }
+.ui-icon-seek-start { background-position: -80px -160px; }
+/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */
+.ui-icon-seek-first { background-position: -80px -160px; }
+.ui-icon-stop { background-position: -96px -160px; }
+.ui-icon-eject { background-position: -112px -160px; }
+.ui-icon-volume-off { background-position: -128px -160px; }
+.ui-icon-volume-on { background-position: -144px -160px; }
+.ui-icon-power { background-position: 0 -176px; }
+.ui-icon-signal-diag { background-position: -16px -176px; }
+.ui-icon-signal { background-position: -32px -176px; }
+.ui-icon-battery-0 { background-position: -48px -176px; }
+.ui-icon-battery-1 { background-position: -64px -176px; }
+.ui-icon-battery-2 { background-position: -80px -176px; }
+.ui-icon-battery-3 { background-position: -96px -176px; }
+.ui-icon-circle-plus { background-position: 0 -192px; }
+.ui-icon-circle-minus { background-position: -16px -192px; }
+.ui-icon-circle-close { background-position: -32px -192px; }
+.ui-icon-circle-triangle-e { background-position: -48px -192px; }
+.ui-icon-circle-triangle-s { background-position: -64px -192px; }
+.ui-icon-circle-triangle-w { background-position: -80px -192px; }
+.ui-icon-circle-triangle-n { background-position: -96px -192px; }
+.ui-icon-circle-arrow-e { background-position: -112px -192px; }
+.ui-icon-circle-arrow-s { background-position: -128px -192px; }
+.ui-icon-circle-arrow-w { background-position: -144px -192px; }
+.ui-icon-circle-arrow-n { background-position: -160px -192px; }
+.ui-icon-circle-zoomin { background-position: -176px -192px; }
+.ui-icon-circle-zoomout { background-position: -192px -192px; }
+.ui-icon-circle-check { background-position: -208px -192px; }
+.ui-icon-circlesmall-plus { background-position: 0 -208px; }
+.ui-icon-circlesmall-minus { background-position: -16px -208px; }
+.ui-icon-circlesmall-close { background-position: -32px -208px; }
+.ui-icon-squaresmall-plus { background-position: -48px -208px; }
+.ui-icon-squaresmall-minus { background-position: -64px -208px; }
+.ui-icon-squaresmall-close { background-position: -80px -208px; }
+.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
+.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
+.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
+.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
+.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
+.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Corner radius */
+.ui-corner-all, .ui-corner-top, .ui-corner-left, .ui-corner-tl { -moz-border-radius-topleft: 0; -webkit-border-top-left-radius: 0; -khtml-border-top-left-radius: 0; border-top-left-radius: 0; }
+.ui-corner-all, .ui-corner-top, .ui-corner-right, .ui-corner-tr { -moz-border-radius-topright: 0; -webkit-border-top-right-radius: 0; -khtml-border-top-right-radius: 0; border-top-right-radius: 0; }
+.ui-corner-all, .ui-corner-bottom, .ui-corner-left, .ui-corner-bl { -moz-border-radius-bottomleft: 0; -webkit-border-bottom-left-radius: 0; -khtml-border-bottom-left-radius: 0; border-bottom-left-radius: 0; }
+.ui-corner-all, .ui-corner-bottom, .ui-corner-right, .ui-corner-br { -moz-border-radius-bottomright: 0; -webkit-border-bottom-right-radius: 0; -khtml-border-bottom-right-radius: 0; border-bottom-right-radius: 0; }
+
+/* Overlays */
+.ui-widget-overlay { background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); }
+.ui-widget-shadow { margin: -6px 0 0 -6px; padding: 6px; background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .35;filter:Alpha(Opacity=35); -moz-border-radius: 6px; -khtml-border-radius: 6px; -webkit-border-radius: 6px; border-radius: 6px; }/*
+ * jQuery UI Resizable 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Resizable#theming
+ */
+.ui-resizable { position: relative;}
+.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block; }
+.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; }
+.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; }
+.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; }
+.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; }
+.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; }
+.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; }
+.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; }
+.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; }
+.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/*
+ * jQuery UI Selectable 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Selectable#theming
+ */
+.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; }
+/*
+ * jQuery UI Accordion 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Accordion#theming
+ */
+/* IE/Win - Fix animation bug - #4615 */
+.ui-accordion { width: 100%; }
+.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; }
+.ui-accordion .ui-accordion-li-fix { display: inline; }
+.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; }
+.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; }
+.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; }
+.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; }
+.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; }
+.ui-accordion .ui-accordion-content-active { display: block; }
+/*
+ * jQuery UI Autocomplete 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Autocomplete#theming
+ */
+.ui-autocomplete { position: absolute; cursor: default; }
+
+/* workarounds */
+* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */
+
+#ui-active-menuitem { background:#c33; border-color:#a22; color:#fff; }
+
+/*
+ * jQuery UI Menu 1.8.14
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Menu#theming
+ */
+.ui-menu {
+ list-style:none;
+ padding: 2px;
+ margin: 0;
+ display:block;
+ float: left;
+ box-shadow: 1px 1px 18px #999;
+ -moz-box-shadow: 1px 1px 12px #999;
+ -webkit-box-shadow: #999 1px 1px 12px;
+}
+.ui-menu .ui-menu {
+ margin-top: -3px;
+}
+.ui-menu .ui-menu-item {
+ margin:0;
+ padding: 0;
+ zoom: 1;
+ float: left;
+ clear: left;
+ width: 100%;
+}
+.ui-menu .ui-menu-item a {
+ text-decoration:none;
+ display:block;
+ padding:.2em .4em;
+ line-height:1.5;
+ zoom:1;
+}
+.ui-menu .ui-menu-item a.ui-state-hover,
+.ui-menu .ui-menu-item a.ui-state-active {
+ font-weight: normal;
+ margin: -1px;
+}
+/*
+ * jQuery UI Button 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Button#theming
+ */
+.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: default; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */
+.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */
+button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */
+.ui-button-icons-only { width: 3.4em; }
+button.ui-button-icons-only { width: 3.7em; }
+button.ui-button-text-only, a.ui-button-text-only { background-image: url(images/buttongradient.png) !important; }
+
+/*button text element */
+.ui-button .ui-button-text { display: block; line-height: 1.4; }
+.ui-button-text-only .ui-button-text { padding: .3em 1em; }
+.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; }
+.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; }
+.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; }
+.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; }
+/* no icon support for input elements, provide padding by default */
+input.ui-button { padding: .4em 1em; }
+
+/*button icon element(s) */
+.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; }
+.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; }
+.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; }
+.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
+.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
+
+/*button sets*/
+.ui-buttonset { margin-right: 7px; }
+.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; }
+
+/* workarounds */
+button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */
+/*
+ * jQuery UI Dialog 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Dialog#theming
+ */
+.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; box-shadow: 1px 1px 18px #999; -moz-box-shadow: 1px 1px 12px #999; -webkit-box-shadow: #999 1px 1px 12px; }
+.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; }
+.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; }
+.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
+.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; }
+.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; }
+.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; }
+.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
+.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; }
+.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: default; }
+.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
+.ui-draggable .ui-dialog-titlebar { cursor: move; }
+/*
+ * jQuery UI Slider 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Slider#theming
+ */
+.ui-slider { position: relative; text-align: left; }
+.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; }
+.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; }
+
+.ui-slider-horizontal { height: .8em; }
+.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; }
+.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; }
+.ui-slider-horizontal .ui-slider-range-min { left: 0; }
+.ui-slider-horizontal .ui-slider-range-max { right: 0; }
+
+.ui-slider-vertical { width: .8em; height: 100px; }
+.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; }
+.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; }
+.ui-slider-vertical .ui-slider-range-min { bottom: 0; }
+.ui-slider-vertical .ui-slider-range-max { top: 0; }/*
+ * jQuery UI Tabs 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Tabs#theming
+ */
+.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */
+.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; }
+.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 0 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; -moz-border-radius-topleft: 2px; -webkit-border-top-left-radius: 2px; border-top-left-radius: 2px; -moz-border-radius-topright: 2px; -webkit-border-top-right-radius: 2px; border-top-right-radius: 2px; }
+.ui-tabs .ui-tabs-nav li a { float: left; padding: .3em 1em; text-decoration: none; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; }
+.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */
+.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; }
+.ui-tabs .ui-tabs-hide { display: none !important; }
+
+.ui-dialog .ui-tabs .ui-tabs-nav li.ui-tabs-selected { background:#fff; }
+
+/*
+ * jQuery UI Datepicker 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Datepicker#theming
+ */
+.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; box-shadow: 1px 1px 18px #999; -moz-box-shadow: 1px 1px 12px #999; -webkit-box-shadow: #999 1px 1px 12px; }
+.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; }
+.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; }
+.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; }
+.ui-datepicker .ui-datepicker-prev { left:2px; }
+.ui-datepicker .ui-datepicker-next { right:2px; }
+.ui-datepicker .ui-datepicker-prev-hover { left:1px; }
+.ui-datepicker .ui-datepicker-next-hover { right:1px; }
+.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; }
+.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; }
+.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; }
+.ui-datepicker select.ui-datepicker-month-year {width: 100%;}
+.ui-datepicker select.ui-datepicker-month,
+.ui-datepicker select.ui-datepicker-year { width: 49%;}
+.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; }
+.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; }
+.ui-datepicker td { border: 0; padding: 1px; }
+.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; }
+.ui-datepicker td.ui-datepicker-current-day .ui-state-active { background:#c33; border-color:#a22; color:#fff; }
+.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; }
+.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: default; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
+.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; }
+
+/* with multiple calendars */
+.ui-datepicker.ui-datepicker-multi { width:auto; }
+.ui-datepicker-multi .ui-datepicker-group { float:left; }
+.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; }
+.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; }
+.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; }
+.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; }
+.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; }
+.ui-datepicker-row-break { clear:both; width:100%; font-size:0em; }
+
+/* RTL support */
+.ui-datepicker-rtl { direction: rtl; }
+.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+
+/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */
+.ui-datepicker-cover {
+ display: none; /*sorry for IE5*/
+ display/**/: block; /*sorry for IE5*/
+ position: absolute; /*must have*/
+ z-index: -1; /*must have*/
+ filter: mask(); /*must have*/
+ top: -4px; /*must have*/
+ left: -4px; /*must have*/
+ width: 200px; /*must have*/
+ height: 200px; /*must have*/
+}/*
+ * jQuery UI Progressbar 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Progressbar#theming
+ */
+.ui-progressbar { height:2em; text-align: left; }
+.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; } \ No newline at end of file
diff --git a/plugins/jqueryui/themes/default/roundcube-custom.diff b/plugins/jqueryui/themes/default/roundcube-custom.diff
new file mode 100644
index 000000000..cd1e300ae
--- /dev/null
+++ b/plugins/jqueryui/themes/default/roundcube-custom.diff
@@ -0,0 +1,124 @@
+--- jquery-ui-1.8.14.custom.css.orig 2011-07-20 13:59:40.000000000 +0200
++++ jquery-ui-1.8.14.custom.css 2011-07-24 16:23:47.000000000 +0200
+@@ -61,7 +61,7 @@
+ .ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Lucida Grande, Verdana, Arial, Helvetica, sans-serif; font-size: 1em; }
+ .ui-widget-content { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x; color: #000000; }
+ .ui-widget-content a { color: #000000; }
+-.ui-widget-header { border: 1px solid #999999; background: #f4f4f4 url(images/ui-bg_highlight-hard_90_f4f4f4_1x100.png) 50% 50% repeat-x; color: #333333; font-weight: bold; }
++.ui-widget-header { border: 1px solid #999999; border-width: 0 0 1px 0; background: #f4f4f4 url(images/listheader.png) 50% 50% repeat; color: #333333; font-weight: bold; margin: -0.2em -0.2em 0 -0.2em; }
+ .ui-widget-header a { color: #333333; }
+
+ /* Interaction states
+@@ -72,6 +72,8 @@
+ .ui-state-hover a, .ui-state-hover a:hover { color: #000000; text-decoration: none; }
+ .ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #a4a4a4; background: #a3a3a3 url(images/ui-bg_highlight-hard_90_a3a3a3_1x100.png) 50% 50% repeat-x; font-weight: normal; color: #000000; }
+ .ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #000000; text-decoration: none; }
++.ui-state-focus, .ui-widget-content .ui-state-focus { border: 1px solid #c33; color: #a00; }
++.ui-tabs-nav .ui-state-focus { border: 1px solid #a4a4a4; color: #000000; }
+ .ui-widget :active { outline: none; }
+
+ /* Interaction Cues
+@@ -82,7 +84,7 @@
+ .ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cc3333; }
+ .ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cc3333; }
+ .ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; }
+-.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
++.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .6; filter:Alpha(Opacity=60); font-weight: normal; }
+ .ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
+
+ /* Icons
+@@ -349,6 +351,8 @@
+ /* workarounds */
+ * html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */
+
++#ui-active-menuitem { background:#c33; border-color:#a22; color:#fff; }
++
+ /*
+ * jQuery UI Menu 1.8.14
+ *
+@@ -364,6 +368,9 @@
+ margin: 0;
+ display:block;
+ float: left;
++ box-shadow: 1px 1px 18px #999;
++ -moz-box-shadow: 1px 1px 12px #999;
++ -webkit-box-shadow: #999 1px 1px 12px;
+ }
+ .ui-menu .ui-menu {
+ margin-top: -3px;
+@@ -397,15 +404,16 @@
+ *
+ * http://docs.jquery.com/UI/Button#theming
+ */
+-.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */
++.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: default; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */
+ .ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */
+ button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */
+ .ui-button-icons-only { width: 3.4em; }
+ button.ui-button-icons-only { width: 3.7em; }
++button.ui-button-text-only, a.ui-button-text-only { background-image: url(images/buttongradient.png) !important; }
+
+ /*button text element */
+ .ui-button .ui-button-text { display: block; line-height: 1.4; }
+-.ui-button-text-only .ui-button-text { padding: .4em 1em; }
++.ui-button-text-only .ui-button-text { padding: .3em 1em; }
+ .ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; }
+ .ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; }
+ .ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; }
+@@ -435,7 +443,7 @@
+ *
+ * http://docs.jquery.com/UI/Dialog#theming
+ */
+-.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; }
++.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; box-shadow: 1px 1px 18px #999; -moz-box-shadow: 1px 1px 12px #999; -webkit-box-shadow: #999 1px 1px 12px; }
+ .ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; }
+ .ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; }
+ .ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
+@@ -444,7 +452,7 @@
+ .ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; }
+ .ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
+ .ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; }
+-.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; }
++.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: default; }
+ .ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
+ .ui-draggable .ui-dialog-titlebar { cursor: move; }
+ /*
+@@ -481,13 +489,16 @@
+ */
+ .ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */
+ .ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; }
+-.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; }
+-.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; }
++.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 0 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; -moz-border-radius-topleft: 2px; -webkit-border-top-left-radius: 2px; border-top-left-radius: 2px; -moz-border-radius-topright: 2px; -webkit-border-top-right-radius: 2px; border-top-right-radius: 2px; }
++.ui-tabs .ui-tabs-nav li a { float: left; padding: .3em 1em; text-decoration: none; }
+ .ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; }
+ .ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; }
+ .ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */
+ .ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; }
+ .ui-tabs .ui-tabs-hide { display: none !important; }
++
++.ui-dialog .ui-tabs .ui-tabs-nav li.ui-tabs-selected { background:#fff; }
++
+ /*
+ * jQuery UI Datepicker 1.8.14
+ *
+@@ -497,7 +508,7 @@
+ *
+ * http://docs.jquery.com/UI/Datepicker#theming
+ */
+-.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; }
++.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; box-shadow: 1px 1px 18px #999; -moz-box-shadow: 1px 1px 12px #999; -webkit-box-shadow: #999 1px 1px 12px; }
+ .ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; }
+ .ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; }
+ .ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; }
+@@ -515,8 +526,9 @@
+ .ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; }
+ .ui-datepicker td { border: 0; padding: 1px; }
+ .ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; }
++.ui-datepicker td.ui-datepicker-current-day .ui-state-active { background:#c33; border-color:#a22; color:#fff; }
+ .ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; }
+-.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
++.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: default; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
+ .ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; }
+
+ /* with multiple calendars */
diff --git a/plugins/jqueryui/themes/redmond/images/ui-bg_flat_0_aaaaaa_40x100.png b/plugins/jqueryui/themes/redmond/images/ui-bg_flat_0_aaaaaa_40x100.png
new file mode 100755
index 000000000..5b5dab2ab
--- /dev/null
+++ b/plugins/jqueryui/themes/redmond/images/ui-bg_flat_0_aaaaaa_40x100.png
Binary files differ
diff --git a/plugins/jqueryui/themes/redmond/images/ui-bg_flat_55_fbec88_40x100.png b/plugins/jqueryui/themes/redmond/images/ui-bg_flat_55_fbec88_40x100.png
new file mode 100755
index 000000000..47acaadd7
--- /dev/null
+++ b/plugins/jqueryui/themes/redmond/images/ui-bg_flat_55_fbec88_40x100.png
Binary files differ
diff --git a/plugins/jqueryui/themes/redmond/images/ui-bg_glass_75_d0e5f5_1x400.png b/plugins/jqueryui/themes/redmond/images/ui-bg_glass_75_d0e5f5_1x400.png
new file mode 100755
index 000000000..9fb564f8d
--- /dev/null
+++ b/plugins/jqueryui/themes/redmond/images/ui-bg_glass_75_d0e5f5_1x400.png
Binary files differ
diff --git a/plugins/jqueryui/themes/redmond/images/ui-bg_glass_85_dfeffc_1x400.png b/plugins/jqueryui/themes/redmond/images/ui-bg_glass_85_dfeffc_1x400.png
new file mode 100755
index 000000000..014951529
--- /dev/null
+++ b/plugins/jqueryui/themes/redmond/images/ui-bg_glass_85_dfeffc_1x400.png
Binary files differ
diff --git a/plugins/jqueryui/themes/redmond/images/ui-bg_glass_95_fef1ec_1x400.png b/plugins/jqueryui/themes/redmond/images/ui-bg_glass_95_fef1ec_1x400.png
new file mode 100755
index 000000000..4443fdc1a
--- /dev/null
+++ b/plugins/jqueryui/themes/redmond/images/ui-bg_glass_95_fef1ec_1x400.png
Binary files differ
diff --git a/plugins/jqueryui/themes/redmond/images/ui-bg_gloss-wave_55_5c9ccc_500x100.png b/plugins/jqueryui/themes/redmond/images/ui-bg_gloss-wave_55_5c9ccc_500x100.png
new file mode 100755
index 000000000..81ecc362d
--- /dev/null
+++ b/plugins/jqueryui/themes/redmond/images/ui-bg_gloss-wave_55_5c9ccc_500x100.png
Binary files differ
diff --git a/plugins/jqueryui/themes/redmond/images/ui-bg_inset-hard_100_f5f8f9_1x100.png b/plugins/jqueryui/themes/redmond/images/ui-bg_inset-hard_100_f5f8f9_1x100.png
new file mode 100755
index 000000000..4f3faf8aa
--- /dev/null
+++ b/plugins/jqueryui/themes/redmond/images/ui-bg_inset-hard_100_f5f8f9_1x100.png
Binary files differ
diff --git a/plugins/jqueryui/themes/redmond/images/ui-bg_inset-hard_100_fcfdfd_1x100.png b/plugins/jqueryui/themes/redmond/images/ui-bg_inset-hard_100_fcfdfd_1x100.png
new file mode 100755
index 000000000..38c38335d
--- /dev/null
+++ b/plugins/jqueryui/themes/redmond/images/ui-bg_inset-hard_100_fcfdfd_1x100.png
Binary files differ
diff --git a/plugins/jqueryui/themes/redmond/images/ui-icons_217bc0_256x240.png b/plugins/jqueryui/themes/redmond/images/ui-icons_217bc0_256x240.png
new file mode 100755
index 000000000..6f4bd87c0
--- /dev/null
+++ b/plugins/jqueryui/themes/redmond/images/ui-icons_217bc0_256x240.png
Binary files differ
diff --git a/plugins/jqueryui/themes/redmond/images/ui-icons_2e83ff_256x240.png b/plugins/jqueryui/themes/redmond/images/ui-icons_2e83ff_256x240.png
new file mode 100755
index 000000000..09d1cdc85
--- /dev/null
+++ b/plugins/jqueryui/themes/redmond/images/ui-icons_2e83ff_256x240.png
Binary files differ
diff --git a/plugins/jqueryui/themes/redmond/images/ui-icons_469bdd_256x240.png b/plugins/jqueryui/themes/redmond/images/ui-icons_469bdd_256x240.png
new file mode 100755
index 000000000..bd2cf079a
--- /dev/null
+++ b/plugins/jqueryui/themes/redmond/images/ui-icons_469bdd_256x240.png
Binary files differ
diff --git a/plugins/jqueryui/themes/redmond/images/ui-icons_6da8d5_256x240.png b/plugins/jqueryui/themes/redmond/images/ui-icons_6da8d5_256x240.png
new file mode 100755
index 000000000..3d6f567f4
--- /dev/null
+++ b/plugins/jqueryui/themes/redmond/images/ui-icons_6da8d5_256x240.png
Binary files differ
diff --git a/plugins/jqueryui/themes/redmond/images/ui-icons_cd0a0a_256x240.png b/plugins/jqueryui/themes/redmond/images/ui-icons_cd0a0a_256x240.png
new file mode 100755
index 000000000..2ab019b73
--- /dev/null
+++ b/plugins/jqueryui/themes/redmond/images/ui-icons_cd0a0a_256x240.png
Binary files differ
diff --git a/plugins/jqueryui/themes/redmond/images/ui-icons_d8e7f3_256x240.png b/plugins/jqueryui/themes/redmond/images/ui-icons_d8e7f3_256x240.png
new file mode 100755
index 000000000..ad2dc6f9d
--- /dev/null
+++ b/plugins/jqueryui/themes/redmond/images/ui-icons_d8e7f3_256x240.png
Binary files differ
diff --git a/plugins/jqueryui/themes/redmond/images/ui-icons_f9bd01_256x240.png b/plugins/jqueryui/themes/redmond/images/ui-icons_f9bd01_256x240.png
new file mode 100755
index 000000000..78625024d
--- /dev/null
+++ b/plugins/jqueryui/themes/redmond/images/ui-icons_f9bd01_256x240.png
Binary files differ
diff --git a/plugins/jqueryui/themes/redmond/jquery-ui-1.8.14.custom.css b/plugins/jqueryui/themes/redmond/jquery-ui-1.8.14.custom.css
new file mode 100755
index 000000000..49dc0abfe
--- /dev/null
+++ b/plugins/jqueryui/themes/redmond/jquery-ui-1.8.14.custom.css
@@ -0,0 +1,568 @@
+/*
+ * jQuery UI CSS Framework 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Theming/API
+ */
+
+/* Layout helpers
+----------------------------------*/
+.ui-helper-hidden { display: none; }
+.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); }
+.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
+.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }
+.ui-helper-clearfix { display: inline-block; }
+/* required comment for clearfix to work in Opera \*/
+* html .ui-helper-clearfix { height:1%; }
+.ui-helper-clearfix { display:block; }
+/* end clearfix */
+.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
+
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-disabled { cursor: default !important; }
+
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Overlays */
+.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
+
+
+/*
+ * jQuery UI CSS Framework 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Theming/API
+ *
+ * To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Lucida%20Grande,%20Lucida%20Sans,%20Arial,%20sans-serif&fwDefault=bold&fsDefault=1.1em&cornerRadius=5px&bgColorHeader=5c9ccc&bgTextureHeader=12_gloss_wave.png&bgImgOpacityHeader=55&borderColorHeader=4297d7&fcHeader=ffffff&iconColorHeader=d8e7f3&bgColorContent=fcfdfd&bgTextureContent=06_inset_hard.png&bgImgOpacityContent=100&borderColorContent=a6c9e2&fcContent=222222&iconColorContent=469bdd&bgColorDefault=dfeffc&bgTextureDefault=02_glass.png&bgImgOpacityDefault=85&borderColorDefault=c5dbec&fcDefault=2e6e9e&iconColorDefault=6da8d5&bgColorHover=d0e5f5&bgTextureHover=02_glass.png&bgImgOpacityHover=75&borderColorHover=79b7e7&fcHover=1d5987&iconColorHover=217bc0&bgColorActive=f5f8f9&bgTextureActive=06_inset_hard.png&bgImgOpacityActive=100&borderColorActive=79b7e7&fcActive=e17009&iconColorActive=f9bd01&bgColorHighlight=fbec88&bgTextureHighlight=01_flat.png&bgImgOpacityHighlight=55&borderColorHighlight=fad42e&fcHighlight=363636&iconColorHighlight=2e83ff&bgColorError=fef1ec&bgTextureError=02_glass.png&bgImgOpacityError=95&borderColorError=cd0a0a&fcError=cd0a0a&iconColorError=cd0a0a&bgColorOverlay=aaaaaa&bgTextureOverlay=01_flat.png&bgImgOpacityOverlay=0&opacityOverlay=30&bgColorShadow=aaaaaa&bgTextureShadow=01_flat.png&bgImgOpacityShadow=0&opacityShadow=30&thicknessShadow=8px&offsetTopShadow=-8px&offsetLeftShadow=-8px&cornerRadiusShadow=8px
+ */
+
+
+/* Component containers
+----------------------------------*/
+.ui-widget { font-family: Lucida Grande, Lucida Sans, Arial, sans-serif; font-size: 1.1em; }
+.ui-widget .ui-widget { font-size: 1em; }
+.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Lucida Grande, Lucida Sans, Arial, sans-serif; font-size: 1em; }
+.ui-widget-content { border: 1px solid #a6c9e2; background: #fcfdfd url(images/ui-bg_inset-hard_100_fcfdfd_1x100.png) 50% bottom repeat-x; color: #222222; }
+.ui-widget-content a { color: #222222; }
+.ui-widget-header { border: 1px solid #4297d7; background: #5c9ccc url(images/ui-bg_gloss-wave_55_5c9ccc_500x100.png) 50% 50% repeat-x; color: #ffffff; font-weight: bold; }
+.ui-widget-header a { color: #ffffff; }
+
+/* Interaction states
+----------------------------------*/
+.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #c5dbec; background: #dfeffc url(images/ui-bg_glass_85_dfeffc_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #2e6e9e; }
+.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #2e6e9e; text-decoration: none; }
+.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #79b7e7; background: #d0e5f5 url(images/ui-bg_glass_75_d0e5f5_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #1d5987; }
+.ui-state-hover a, .ui-state-hover a:hover { color: #1d5987; text-decoration: none; }
+.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #79b7e7; background: #f5f8f9 url(images/ui-bg_inset-hard_100_f5f8f9_1x100.png) 50% 50% repeat-x; font-weight: bold; color: #e17009; }
+.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #e17009; text-decoration: none; }
+.ui-widget :active { outline: none; }
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fad42e; background: #fbec88 url(images/ui-bg_flat_55_fbec88_40x100.png) 50% 50% repeat-x; color: #363636; }
+.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; }
+.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x; color: #cd0a0a; }
+.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd0a0a; }
+.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd0a0a; }
+.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; }
+.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
+.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_469bdd_256x240.png); }
+.ui-widget-content .ui-icon {background-image: url(images/ui-icons_469bdd_256x240.png); }
+.ui-widget-header .ui-icon {background-image: url(images/ui-icons_d8e7f3_256x240.png); }
+.ui-state-default .ui-icon { background-image: url(images/ui-icons_6da8d5_256x240.png); }
+.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_217bc0_256x240.png); }
+.ui-state-active .ui-icon {background-image: url(images/ui-icons_f9bd01_256x240.png); }
+.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png); }
+.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png); }
+
+/* positioning */
+.ui-icon-carat-1-n { background-position: 0 0; }
+.ui-icon-carat-1-ne { background-position: -16px 0; }
+.ui-icon-carat-1-e { background-position: -32px 0; }
+.ui-icon-carat-1-se { background-position: -48px 0; }
+.ui-icon-carat-1-s { background-position: -64px 0; }
+.ui-icon-carat-1-sw { background-position: -80px 0; }
+.ui-icon-carat-1-w { background-position: -96px 0; }
+.ui-icon-carat-1-nw { background-position: -112px 0; }
+.ui-icon-carat-2-n-s { background-position: -128px 0; }
+.ui-icon-carat-2-e-w { background-position: -144px 0; }
+.ui-icon-triangle-1-n { background-position: 0 -16px; }
+.ui-icon-triangle-1-ne { background-position: -16px -16px; }
+.ui-icon-triangle-1-e { background-position: -32px -16px; }
+.ui-icon-triangle-1-se { background-position: -48px -16px; }
+.ui-icon-triangle-1-s { background-position: -64px -16px; }
+.ui-icon-triangle-1-sw { background-position: -80px -16px; }
+.ui-icon-triangle-1-w { background-position: -96px -16px; }
+.ui-icon-triangle-1-nw { background-position: -112px -16px; }
+.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
+.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
+.ui-icon-arrow-1-n { background-position: 0 -32px; }
+.ui-icon-arrow-1-ne { background-position: -16px -32px; }
+.ui-icon-arrow-1-e { background-position: -32px -32px; }
+.ui-icon-arrow-1-se { background-position: -48px -32px; }
+.ui-icon-arrow-1-s { background-position: -64px -32px; }
+.ui-icon-arrow-1-sw { background-position: -80px -32px; }
+.ui-icon-arrow-1-w { background-position: -96px -32px; }
+.ui-icon-arrow-1-nw { background-position: -112px -32px; }
+.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
+.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
+.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
+.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
+.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
+.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
+.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
+.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
+.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
+.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
+.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
+.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
+.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
+.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
+.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
+.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
+.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
+.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
+.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
+.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
+.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
+.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
+.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
+.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
+.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
+.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
+.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
+.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
+.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
+.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
+.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
+.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
+.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
+.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
+.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
+.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
+.ui-icon-arrow-4 { background-position: 0 -80px; }
+.ui-icon-arrow-4-diag { background-position: -16px -80px; }
+.ui-icon-extlink { background-position: -32px -80px; }
+.ui-icon-newwin { background-position: -48px -80px; }
+.ui-icon-refresh { background-position: -64px -80px; }
+.ui-icon-shuffle { background-position: -80px -80px; }
+.ui-icon-transfer-e-w { background-position: -96px -80px; }
+.ui-icon-transferthick-e-w { background-position: -112px -80px; }
+.ui-icon-folder-collapsed { background-position: 0 -96px; }
+.ui-icon-folder-open { background-position: -16px -96px; }
+.ui-icon-document { background-position: -32px -96px; }
+.ui-icon-document-b { background-position: -48px -96px; }
+.ui-icon-note { background-position: -64px -96px; }
+.ui-icon-mail-closed { background-position: -80px -96px; }
+.ui-icon-mail-open { background-position: -96px -96px; }
+.ui-icon-suitcase { background-position: -112px -96px; }
+.ui-icon-comment { background-position: -128px -96px; }
+.ui-icon-person { background-position: -144px -96px; }
+.ui-icon-print { background-position: -160px -96px; }
+.ui-icon-trash { background-position: -176px -96px; }
+.ui-icon-locked { background-position: -192px -96px; }
+.ui-icon-unlocked { background-position: -208px -96px; }
+.ui-icon-bookmark { background-position: -224px -96px; }
+.ui-icon-tag { background-position: -240px -96px; }
+.ui-icon-home { background-position: 0 -112px; }
+.ui-icon-flag { background-position: -16px -112px; }
+.ui-icon-calendar { background-position: -32px -112px; }
+.ui-icon-cart { background-position: -48px -112px; }
+.ui-icon-pencil { background-position: -64px -112px; }
+.ui-icon-clock { background-position: -80px -112px; }
+.ui-icon-disk { background-position: -96px -112px; }
+.ui-icon-calculator { background-position: -112px -112px; }
+.ui-icon-zoomin { background-position: -128px -112px; }
+.ui-icon-zoomout { background-position: -144px -112px; }
+.ui-icon-search { background-position: -160px -112px; }
+.ui-icon-wrench { background-position: -176px -112px; }
+.ui-icon-gear { background-position: -192px -112px; }
+.ui-icon-heart { background-position: -208px -112px; }
+.ui-icon-star { background-position: -224px -112px; }
+.ui-icon-link { background-position: -240px -112px; }
+.ui-icon-cancel { background-position: 0 -128px; }
+.ui-icon-plus { background-position: -16px -128px; }
+.ui-icon-plusthick { background-position: -32px -128px; }
+.ui-icon-minus { background-position: -48px -128px; }
+.ui-icon-minusthick { background-position: -64px -128px; }
+.ui-icon-close { background-position: -80px -128px; }
+.ui-icon-closethick { background-position: -96px -128px; }
+.ui-icon-key { background-position: -112px -128px; }
+.ui-icon-lightbulb { background-position: -128px -128px; }
+.ui-icon-scissors { background-position: -144px -128px; }
+.ui-icon-clipboard { background-position: -160px -128px; }
+.ui-icon-copy { background-position: -176px -128px; }
+.ui-icon-contact { background-position: -192px -128px; }
+.ui-icon-image { background-position: -208px -128px; }
+.ui-icon-video { background-position: -224px -128px; }
+.ui-icon-script { background-position: -240px -128px; }
+.ui-icon-alert { background-position: 0 -144px; }
+.ui-icon-info { background-position: -16px -144px; }
+.ui-icon-notice { background-position: -32px -144px; }
+.ui-icon-help { background-position: -48px -144px; }
+.ui-icon-check { background-position: -64px -144px; }
+.ui-icon-bullet { background-position: -80px -144px; }
+.ui-icon-radio-off { background-position: -96px -144px; }
+.ui-icon-radio-on { background-position: -112px -144px; }
+.ui-icon-pin-w { background-position: -128px -144px; }
+.ui-icon-pin-s { background-position: -144px -144px; }
+.ui-icon-play { background-position: 0 -160px; }
+.ui-icon-pause { background-position: -16px -160px; }
+.ui-icon-seek-next { background-position: -32px -160px; }
+.ui-icon-seek-prev { background-position: -48px -160px; }
+.ui-icon-seek-end { background-position: -64px -160px; }
+.ui-icon-seek-start { background-position: -80px -160px; }
+/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */
+.ui-icon-seek-first { background-position: -80px -160px; }
+.ui-icon-stop { background-position: -96px -160px; }
+.ui-icon-eject { background-position: -112px -160px; }
+.ui-icon-volume-off { background-position: -128px -160px; }
+.ui-icon-volume-on { background-position: -144px -160px; }
+.ui-icon-power { background-position: 0 -176px; }
+.ui-icon-signal-diag { background-position: -16px -176px; }
+.ui-icon-signal { background-position: -32px -176px; }
+.ui-icon-battery-0 { background-position: -48px -176px; }
+.ui-icon-battery-1 { background-position: -64px -176px; }
+.ui-icon-battery-2 { background-position: -80px -176px; }
+.ui-icon-battery-3 { background-position: -96px -176px; }
+.ui-icon-circle-plus { background-position: 0 -192px; }
+.ui-icon-circle-minus { background-position: -16px -192px; }
+.ui-icon-circle-close { background-position: -32px -192px; }
+.ui-icon-circle-triangle-e { background-position: -48px -192px; }
+.ui-icon-circle-triangle-s { background-position: -64px -192px; }
+.ui-icon-circle-triangle-w { background-position: -80px -192px; }
+.ui-icon-circle-triangle-n { background-position: -96px -192px; }
+.ui-icon-circle-arrow-e { background-position: -112px -192px; }
+.ui-icon-circle-arrow-s { background-position: -128px -192px; }
+.ui-icon-circle-arrow-w { background-position: -144px -192px; }
+.ui-icon-circle-arrow-n { background-position: -160px -192px; }
+.ui-icon-circle-zoomin { background-position: -176px -192px; }
+.ui-icon-circle-zoomout { background-position: -192px -192px; }
+.ui-icon-circle-check { background-position: -208px -192px; }
+.ui-icon-circlesmall-plus { background-position: 0 -208px; }
+.ui-icon-circlesmall-minus { background-position: -16px -208px; }
+.ui-icon-circlesmall-close { background-position: -32px -208px; }
+.ui-icon-squaresmall-plus { background-position: -48px -208px; }
+.ui-icon-squaresmall-minus { background-position: -64px -208px; }
+.ui-icon-squaresmall-close { background-position: -80px -208px; }
+.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
+.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
+.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
+.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
+.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
+.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Corner radius */
+.ui-corner-all, .ui-corner-top, .ui-corner-left, .ui-corner-tl { -moz-border-radius-topleft: 5px; -webkit-border-top-left-radius: 5px; -khtml-border-top-left-radius: 5px; border-top-left-radius: 5px; }
+.ui-corner-all, .ui-corner-top, .ui-corner-right, .ui-corner-tr { -moz-border-radius-topright: 5px; -webkit-border-top-right-radius: 5px; -khtml-border-top-right-radius: 5px; border-top-right-radius: 5px; }
+.ui-corner-all, .ui-corner-bottom, .ui-corner-left, .ui-corner-bl { -moz-border-radius-bottomleft: 5px; -webkit-border-bottom-left-radius: 5px; -khtml-border-bottom-left-radius: 5px; border-bottom-left-radius: 5px; }
+.ui-corner-all, .ui-corner-bottom, .ui-corner-right, .ui-corner-br { -moz-border-radius-bottomright: 5px; -webkit-border-bottom-right-radius: 5px; -khtml-border-bottom-right-radius: 5px; border-bottom-right-radius: 5px; }
+
+/* Overlays */
+.ui-widget-overlay { background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); }
+.ui-widget-shadow { margin: -8px 0 0 -8px; padding: 8px; background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); -moz-border-radius: 8px; -khtml-border-radius: 8px; -webkit-border-radius: 8px; border-radius: 8px; }/*
+ * jQuery UI Resizable 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Resizable#theming
+ */
+.ui-resizable { position: relative;}
+.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block; }
+.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; }
+.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; }
+.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; }
+.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; }
+.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; }
+.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; }
+.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; }
+.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; }
+.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/*
+ * jQuery UI Selectable 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Selectable#theming
+ */
+.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; }
+/*
+ * jQuery UI Accordion 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Accordion#theming
+ */
+/* IE/Win - Fix animation bug - #4615 */
+.ui-accordion { width: 100%; }
+.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; }
+.ui-accordion .ui-accordion-li-fix { display: inline; }
+.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; }
+.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; }
+.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; }
+.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; }
+.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; }
+.ui-accordion .ui-accordion-content-active { display: block; }
+/*
+ * jQuery UI Autocomplete 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Autocomplete#theming
+ */
+.ui-autocomplete { position: absolute; cursor: default; }
+
+/* workarounds */
+* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */
+
+/*
+ * jQuery UI Menu 1.8.14
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Menu#theming
+ */
+.ui-menu {
+ list-style:none;
+ padding: 2px;
+ margin: 0;
+ display:block;
+ float: left;
+}
+.ui-menu .ui-menu {
+ margin-top: -3px;
+}
+.ui-menu .ui-menu-item {
+ margin:0;
+ padding: 0;
+ zoom: 1;
+ float: left;
+ clear: left;
+ width: 100%;
+}
+.ui-menu .ui-menu-item a {
+ text-decoration:none;
+ display:block;
+ padding:.2em .4em;
+ line-height:1.5;
+ zoom:1;
+}
+.ui-menu .ui-menu-item a.ui-state-hover,
+.ui-menu .ui-menu-item a.ui-state-active {
+ font-weight: normal;
+ margin: -1px;
+}
+/*
+ * jQuery UI Button 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Button#theming
+ */
+.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */
+.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */
+button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */
+.ui-button-icons-only { width: 3.4em; }
+button.ui-button-icons-only { width: 3.7em; }
+
+/*button text element */
+.ui-button .ui-button-text { display: block; line-height: 1.4; }
+.ui-button-text-only .ui-button-text { padding: .4em 1em; }
+.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; }
+.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; }
+.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; }
+.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; }
+/* no icon support for input elements, provide padding by default */
+input.ui-button { padding: .4em 1em; }
+
+/*button icon element(s) */
+.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; }
+.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; }
+.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; }
+.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
+.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
+
+/*button sets*/
+.ui-buttonset { margin-right: 7px; }
+.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; }
+
+/* workarounds */
+button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */
+/*
+ * jQuery UI Dialog 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Dialog#theming
+ */
+.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; }
+.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; }
+.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; }
+.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
+.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; }
+.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; }
+.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; }
+.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
+.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; }
+.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; }
+.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
+.ui-draggable .ui-dialog-titlebar { cursor: move; }
+/*
+ * jQuery UI Slider 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Slider#theming
+ */
+.ui-slider { position: relative; text-align: left; }
+.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; }
+.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; }
+
+.ui-slider-horizontal { height: .8em; }
+.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; }
+.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; }
+.ui-slider-horizontal .ui-slider-range-min { left: 0; }
+.ui-slider-horizontal .ui-slider-range-max { right: 0; }
+
+.ui-slider-vertical { width: .8em; height: 100px; }
+.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; }
+.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; }
+.ui-slider-vertical .ui-slider-range-min { bottom: 0; }
+.ui-slider-vertical .ui-slider-range-max { top: 0; }/*
+ * jQuery UI Tabs 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Tabs#theming
+ */
+.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */
+.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; }
+.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; }
+.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; }
+.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */
+.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; }
+.ui-tabs .ui-tabs-hide { display: none !important; }
+/*
+ * jQuery UI Datepicker 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Datepicker#theming
+ */
+.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; }
+.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; }
+.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; }
+.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; }
+.ui-datepicker .ui-datepicker-prev { left:2px; }
+.ui-datepicker .ui-datepicker-next { right:2px; }
+.ui-datepicker .ui-datepicker-prev-hover { left:1px; }
+.ui-datepicker .ui-datepicker-next-hover { right:1px; }
+.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; }
+.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; }
+.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; }
+.ui-datepicker select.ui-datepicker-month-year {width: 100%;}
+.ui-datepicker select.ui-datepicker-month,
+.ui-datepicker select.ui-datepicker-year { width: 49%;}
+.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; }
+.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; }
+.ui-datepicker td { border: 0; padding: 1px; }
+.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; }
+.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; }
+.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
+.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; }
+
+/* with multiple calendars */
+.ui-datepicker.ui-datepicker-multi { width:auto; }
+.ui-datepicker-multi .ui-datepicker-group { float:left; }
+.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; }
+.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; }
+.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; }
+.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; }
+.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; }
+.ui-datepicker-row-break { clear:both; width:100%; font-size:0em; }
+
+/* RTL support */
+.ui-datepicker-rtl { direction: rtl; }
+.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+
+/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */
+.ui-datepicker-cover {
+ display: none; /*sorry for IE5*/
+ display/**/: block; /*sorry for IE5*/
+ position: absolute; /*must have*/
+ z-index: -1; /*must have*/
+ filter: mask(); /*must have*/
+ top: -4px; /*must have*/
+ left: -4px; /*must have*/
+ width: 200px; /*must have*/
+ height: 200px; /*must have*/
+}/*
+ * jQuery UI Progressbar 1.8.14
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Progressbar#theming
+ */
+.ui-progressbar { height:2em; text-align: left; }
+.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; } \ No newline at end of file
diff --git a/plugins/managesieve/Changelog b/plugins/managesieve/Changelog
new file mode 100644
index 000000000..4472ccf21
--- /dev/null
+++ b/plugins/managesieve/Changelog
@@ -0,0 +1,196 @@
+* version 4.3 [2011-07-28]
+-----------------------------------------------------------
+- Fixed handling of error in Net_Sieve::listScripts()
+- Fixed handling of REFERRAL responses (http://pear.php.net/bugs/bug.php?id=17107)
+- Fixed bug where wrong folders hierarchy was displayed on folders listing
+
+* version 4.2 [2011-05-24]
+-----------------------------------------------------------
+- Moved elsif replacement code to handle only imports from other formats
+- Fixed mod_mailbox() usage for newer Roundcube versions
+- Fixed regex extension (error: regex require missing)
+
+* version 4.1 [2011-03-07]
+-----------------------------------------------------------
+- Fix fileinto target is always INBOX (#1487776)
+- Fix escaping of backslash character in quoted strings (#1487780)
+- Fix handling of non-safe characters (double-quote, backslash)
+ or UTF-8 characters (dovecot's implementation bug workaround)
+ in script names
+- Fix saving of a script using flags extension on servers with imap4flags support (#1487825)
+
+* version 4.0 [2011-02-10]
+-----------------------------------------------------------
+- Fix STARTTLS for timsieved < 2.3.10
+- Added :regex and :matches support (#1487746)
+- Added setflag/addflag/removeflag support (#1487449)
+- Added support for vacation :subject field (#1487120)
+- rcube_sieve_script class moved to separate file
+- Moved javascript code from skin templates into managesieve.js file
+
+* version 3.0 [2011-02-01]
+-----------------------------------------------------------
+- Added support for SASL proxy authentication (#1486691)
+- Fixed parsing of scripts with \r\n line separator
+- Apply forgotten changes for form errors handling
+- Fix multi-line strings parsing (#1487685)
+- Added tests for script parser
+- Rewritten script parser
+- Fix double request when clicking on Filters tab using Firefox
+
+* version 2.10 [2010-10-10]
+-----------------------------------------------------------
+- Fixed import from Avelsieve
+- Use localized size units (#1486976)
+- Added support for relational operators and i;ascii-numeric comparator
+- Added popups with form errors
+
+* version 2.9 [2010-08-02]
+-----------------------------------------------------------
+- Fixed vacation parameters parsing (#1486883)
+
+* version 2.8 [2010-07-08]
+-----------------------------------------------------------
+- Added managesieve_auth_type option (#1486731)
+
+* version 2.7 [2010-07-06]
+-----------------------------------------------------------
+- Update Net_Sieve to version 1.3.0 (fixes LOGIN athentication)
+- Added support for copying and copy sending of messages (COPY extension)
+
+* version 2.6 [2010-06-03]
+-----------------------------------------------------------
+- Support %n and %d variables in managesieve_host option
+
+* version 2.5 [2010-05-04]
+-----------------------------------------------------------
+- Fix filters set label after activation
+- Fix filters set activation, add possibility to deactivate sets (#1486699)
+- Fix download button state when sets list is empty
+- Fix errors when sets list is empty
+
+* version 2.4 [2010-04-01]
+-----------------------------------------------------------
+- Fixed bug in DIGEST-MD5 authentication (http://pear.php.net/bugs/bug.php?id=17285)
+- Fixed disabling rules with many tests
+- Small css unification with core
+- Scripts import/export
+
+* version 2.3 [2010-03-18]
+-----------------------------------------------------------
+- Added import from Horde-INGO
+- Support for more than one match using if+stop instead of if+elsif structures (#1486078)
+- Support for selectively disabling rules within a single sieve script (#1485882)
+- Added vertical splitter
+
+* version 2.2 [2010-02-06]
+-----------------------------------------------------------
+- Fix handling of "<>" characters in filter names (#1486477)
+
+* version 2.1 [2010-01-12]
+-----------------------------------------------------------
+- Fix "require" structure generation when many modules are used
+- Fix problem with '<' and '>' characters in header tests
+
+* version 2.0 [2009-11-02]
+-----------------------------------------------------------
+- Added 'managesieve_debug' option
+- Added multi-script support
+- Small css improvements + sprite image buttons
+- PEAR::NetSieve 1.2.0b1
+
+* version 1.7 [2009-09-20]
+-----------------------------------------------------------
+- Support multiple managesieve hosts using %h variable
+ in managesieve_host option
+- Fix first rule deleting (#1486140)
+
+* version 1.6 [2009-09-08]
+-----------------------------------------------------------
+- Fix warning when importing squirrelmail rules
+- Fix handling of "true" as "anyof (true)" test
+
+* version 1.5 [2009-09-04]
+-----------------------------------------------------------
+- Added es_ES, ua_UA localizations
+- Added 'managesieve_mbox_encoding' option
+
+* version 1.4 [2009-07-29]
+-----------------------------------------------------------
+- Updated PEAR::Net_Sieve to 1.1.7
+
+* version 1.3 [2009-07-24]
+-----------------------------------------------------------
+- support more languages
+- support config.inc.php file
+
+* version 1.2 [2009-06-28]
+-----------------------------------------------------------
+- Support IMAP namespaces in fileinto (#1485943)
+- Added it_IT localization
+
+* version 1.1 [2009-05-27]
+-----------------------------------------------------------
+- Added new icons
+- Added support for headers lists (coma-separated) in rules
+- Added de_CH localization
+
+* version 1.0 [2009-05-21]
+-----------------------------------------------------------
+- Rewritten using plugin API
+- Added hu_HU localization (Tamas Tevesz)
+
+* version beta7 (svn-r2300) [2009-03-01]
+-----------------------------------------------------------
+- Added SquirrelMail script auto-import (Jonathan Ernst)
+- Added 'vacation' support (Jonathan Ernst & alec)
+- Added 'stop' support (Jonathan Ernst)
+- Added option for extensions disabling (Jonathan Ernst & alec)
+- Added fi_FI, nl_NL, bg_BG localization
+- Small style fixes
+
+* version 0.2-stable1 (svn-r2205) [2009-01-03]
+-----------------------------------------------------------
+- Fix moving down filter row
+- Fixes for compressed js files in stable release package
+- Created patch for svn version r2205
+
+* version 0.2-stable [2008-12-31]
+-----------------------------------------------------------
+- Added ru_RU, fr_FR, zh_CN translation
+- Fixes for Roundcube 0.2-stable
+
+* version rc0.2beta [2008-09-21]
+-----------------------------------------------------------
+- Small css fixes for IE
+- Fixes for Roundcube 0.2-beta
+
+* version beta6 [2008-08-08]
+-----------------------------------------------------------
+- Added de_DE translation
+- Fix for Roundcube r1634
+
+* version beta5 [2008-06-10]
+-----------------------------------------------------------
+- Fixed 'exists' operators
+- Fixed 'not*' operators for custom headers
+- Fixed filters deleting
+
+* version beta4 [2008-06-09]
+-----------------------------------------------------------
+- Fix for Roundcube r1490
+
+* version beta3 [2008-05-22]
+-----------------------------------------------------------
+- Fixed textarea error class setting
+- Added pagetitle setting
+- Added option 'managesieve_replace_delimiter'
+- Fixed errors on IE (still need some css fixes)
+
+* version beta2 [2008-05-20]
+-----------------------------------------------------------
+- Use 'if' only for first filter and 'elsif' for the rest
+
+* version beta1 [2008-05-15]
+-----------------------------------------------------------
+- Initial version for Roundcube r1388.
diff --git a/plugins/managesieve/config.inc.php.dist b/plugins/managesieve/config.inc.php.dist
new file mode 100644
index 000000000..905cfef18
--- /dev/null
+++ b/plugins/managesieve/config.inc.php.dist
@@ -0,0 +1,53 @@
+<?php
+
+// managesieve server port
+$rcmail_config['managesieve_port'] = 2000;
+
+// managesieve server address, default is localhost.
+// Replacement variables supported in host name:
+// %h - user's IMAP hostname
+// %n - http hostname ($_SERVER['SERVER_NAME'])
+// %d - domain (http hostname without the first part)
+// For example %n = mail.domain.tld, %d = domain.tld
+$rcmail_config['managesieve_host'] = 'localhost';
+
+// authentication method. Can be CRAM-MD5, DIGEST-MD5, PLAIN, LOGIN, EXTERNAL
+// or none. Optional, defaults to best method supported by server.
+$rcmail_config['managesieve_auth_type'] = null;
+
+// Optional managesieve authentication identifier to be used as authorization proxy.
+// Authenticate as a different user but act on behalf of the logged in user.
+// Works with PLAIN and DIGEST-MD5 auth.
+$rcmail_config['managesieve_auth_cid'] = null;
+
+// Optional managesieve authentication password to be used for imap_auth_cid
+$rcmail_config['managesieve_auth_pw'] = null;
+
+// use or not TLS for managesieve server connection
+// it's because I've problems with TLS and dovecot's managesieve plugin
+// and it's not needed on localhost
+$rcmail_config['managesieve_usetls'] = false;
+
+// default contents of filters script (eg. default spam filter)
+$rcmail_config['managesieve_default'] = '/etc/dovecot/sieve/global';
+
+// Sieve RFC says that we should use UTF-8 endcoding for mailbox names,
+// but some implementations does not covert UTF-8 to modified UTF-7.
+// Defaults to UTF7-IMAP
+$rcmail_config['managesieve_mbox_encoding'] = 'UTF-8';
+
+// I need this because my dovecot (with listescape plugin) uses
+// ':' delimiter, but creates folders with dot delimiter
+$rcmail_config['managesieve_replace_delimiter'] = '';
+
+// disabled sieve extensions (body, copy, date, editheader, encoded-character,
+// envelope, environment, ereject, fileinto, ihave, imap4flags, index,
+// mailbox, mboxmetadata, regex, reject, relational, servermetadata,
+// spamtest, spamtestplus, subaddress, vacation, variables, virustest, etc.
+// Note: not all extensions are implemented
+$rcmail_config['managesieve_disabled_extensions'] = array();
+
+// Enables debugging of conversation with sieve server. Logs it into <log_dir>/sieve
+$rcmail_config['managesieve_debug'] = false;
+
+?>
diff --git a/plugins/managesieve/lib/Net/Sieve.php b/plugins/managesieve/lib/Net/Sieve.php
new file mode 100644
index 000000000..a8e36d8d7
--- /dev/null
+++ b/plugins/managesieve/lib/Net/Sieve.php
@@ -0,0 +1,1274 @@
+<?php
+/**
+ * This file contains the Net_Sieve class.
+ *
+ * PHP version 4
+ *
+ * +-----------------------------------------------------------------------+
+ * | All rights reserved. |
+ * | |
+ * | Redistribution and use in source and binary forms, with or without |
+ * | modification, are permitted provided that the following conditions |
+ * | are met: |
+ * | |
+ * | o Redistributions of source code must retain the above copyright |
+ * | notice, this list of conditions and the following disclaimer. |
+ * | o Redistributions in binary form must reproduce the above copyright |
+ * | notice, this list of conditions and the following disclaimer in the |
+ * | documentation and/or other materials provided with the distribution.|
+ * | |
+ * | THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS |
+ * | "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT |
+ * | LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR |
+ * | A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT |
+ * | OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, |
+ * | SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT |
+ * | LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, |
+ * | DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY |
+ * | THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT |
+ * | (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE |
+ * | OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. |
+ * +-----------------------------------------------------------------------+
+ *
+ * @category Networking
+ * @package Net_Sieve
+ * @author Richard Heyes <richard@phpguru.org>
+ * @author Damian Fernandez Sosa <damlists@cnba.uba.ar>
+ * @author Anish Mistry <amistry@am-productions.biz>
+ * @author Jan Schneider <jan@horde.org>
+ * @copyright 2002-2003 Richard Heyes
+ * @copyright 2006-2008 Anish Mistry
+ * @license http://www.opensource.org/licenses/bsd-license.php BSD
+ * @version SVN: $Id: Sieve.php 300898 2010-07-01 09:49:02Z yunosh $
+ * @link http://pear.php.net/package/Net_Sieve
+ */
+
+require_once 'PEAR.php';
+require_once 'Net/Socket.php';
+
+/**
+ * TODO
+ *
+ * o supportsAuthMech()
+ */
+
+/**
+ * Disconnected state
+ * @const NET_SIEVE_STATE_DISCONNECTED
+ */
+define('NET_SIEVE_STATE_DISCONNECTED', 1, true);
+
+/**
+ * Authorisation state
+ * @const NET_SIEVE_STATE_AUTHORISATION
+ */
+define('NET_SIEVE_STATE_AUTHORISATION', 2, true);
+
+/**
+ * Transaction state
+ * @const NET_SIEVE_STATE_TRANSACTION
+ */
+define('NET_SIEVE_STATE_TRANSACTION', 3, true);
+
+
+/**
+ * A class for talking to the timsieved server which comes with Cyrus IMAP.
+ *
+ * @category Networking
+ * @package Net_Sieve
+ * @author Richard Heyes <richard@phpguru.org>
+ * @author Damian Fernandez Sosa <damlists@cnba.uba.ar>
+ * @author Anish Mistry <amistry@am-productions.biz>
+ * @author Jan Schneider <jan@horde.org>
+ * @copyright 2002-2003 Richard Heyes
+ * @copyright 2006-2008 Anish Mistry
+ * @license http://www.opensource.org/licenses/bsd-license.php BSD
+ * @version Release: 1.3.0
+ * @link http://pear.php.net/package/Net_Sieve
+ * @link http://www.ietf.org/rfc/rfc3028.txt RFC 3028 (Sieve: A Mail
+ * Filtering Language)
+ * @link http://tools.ietf.org/html/draft-ietf-sieve-managesieve A
+ * Protocol for Remotely Managing Sieve Scripts
+ */
+class Net_Sieve
+{
+ /**
+ * The authentication methods this class supports.
+ *
+ * Can be overwritten if having problems with certain methods.
+ *
+ * @var array
+ */
+ var $supportedAuthMethods = array('DIGEST-MD5', 'CRAM-MD5', 'EXTERNAL',
+ 'PLAIN' , 'LOGIN');
+
+ /**
+ * SASL authentication methods that require Auth_SASL.
+ *
+ * @var array
+ */
+ var $supportedSASLAuthMethods = array('DIGEST-MD5', 'CRAM-MD5');
+
+ /**
+ * The socket handle.
+ *
+ * @var resource
+ */
+ var $_sock;
+
+ /**
+ * Parameters and connection information.
+ *
+ * @var array
+ */
+ var $_data;
+
+ /**
+ * Current state of the connection.
+ *
+ * One of the NET_SIEVE_STATE_* constants.
+ *
+ * @var integer
+ */
+ var $_state;
+
+ /**
+ * Constructor error.
+ *
+ * @var PEAR_Error
+ */
+ var $_error;
+
+ /**
+ * Whether to enable debugging.
+ *
+ * @var boolean
+ */
+ var $_debug = false;
+
+ /**
+ * Debug output handler.
+ *
+ * This has to be a valid callback.
+ *
+ * @var string|array
+ */
+ var $_debug_handler = null;
+
+ /**
+ * Whether to pick up an already established connection.
+ *
+ * @var boolean
+ */
+ var $_bypassAuth = false;
+
+ /**
+ * Whether to use TLS if available.
+ *
+ * @var boolean
+ */
+ var $_useTLS = true;
+
+ /**
+ * Additional options for stream_context_create().
+ *
+ * @var array
+ */
+ var $_options = null;
+
+ /**
+ * Maximum number of referral loops
+ *
+ * @var array
+ */
+ var $_maxReferralCount = 15;
+
+ /**
+ * Constructor.
+ *
+ * Sets up the object, connects to the server and logs in. Stores any
+ * generated error in $this->_error, which can be retrieved using the
+ * getError() method.
+ *
+ * @param string $user Login username.
+ * @param string $pass Login password.
+ * @param string $host Hostname of server.
+ * @param string $port Port of server.
+ * @param string $logintype Type of login to perform (see
+ * $supportedAuthMethods).
+ * @param string $euser Effective user. If authenticating as an
+ * administrator, login as this user.
+ * @param boolean $debug Whether to enable debugging (@see setDebug()).
+ * @param string $bypassAuth Skip the authentication phase. Useful if the
+ * socket is already open.
+ * @param boolean $useTLS Use TLS if available.
+ * @param array $options Additional options for
+ * stream_context_create().
+ * @param mixed $handler A callback handler for the debug output.
+ */
+ function Net_Sieve($user = null, $pass = null, $host = 'localhost',
+ $port = 2000, $logintype = '', $euser = '',
+ $debug = false, $bypassAuth = false, $useTLS = true,
+ $options = null, $handler = null)
+ {
+ $this->_state = NET_SIEVE_STATE_DISCONNECTED;
+ $this->_data['user'] = $user;
+ $this->_data['pass'] = $pass;
+ $this->_data['host'] = $host;
+ $this->_data['port'] = $port;
+ $this->_data['logintype'] = $logintype;
+ $this->_data['euser'] = $euser;
+ $this->_sock = new Net_Socket();
+ $this->_bypassAuth = $bypassAuth;
+ $this->_useTLS = $useTLS;
+ $this->_options = $options;
+ $this->setDebug($debug, $handler);
+
+ /* Try to include the Auth_SASL package. If the package is not
+ * available, we disable the authentication methods that depend upon
+ * it. */
+ if ((@include_once 'Auth/SASL.php') === false) {
+ $this->_debug('Auth_SASL not present');
+ foreach ($this->supportedSASLAuthMethods as $SASLMethod) {
+ $pos = array_search($SASLMethod, $this->supportedAuthMethods);
+ $this->_debug('Disabling method ' . $SASLMethod);
+ unset($this->supportedAuthMethods[$pos]);
+ }
+ }
+
+ if (strlen($user) && strlen($pass)) {
+ $this->_error = $this->_handleConnectAndLogin();
+ }
+ }
+
+ /**
+ * Returns any error that may have been generated in the constructor.
+ *
+ * @return boolean|PEAR_Error False if no error, PEAR_Error otherwise.
+ */
+ function getError()
+ {
+ return PEAR::isError($this->_error) ? $this->_error : false;
+ }
+
+ /**
+ * Sets the debug state and handler function.
+ *
+ * @param boolean $debug Whether to enable debugging.
+ * @param string $handler A custom debug handler. Must be a valid callback.
+ *
+ * @return void
+ */
+ function setDebug($debug = true, $handler = null)
+ {
+ $this->_debug = $debug;
+ $this->_debug_handler = $handler;
+ }
+
+ /**
+ * Connects to the server and logs in.
+ *
+ * @return boolean True on success, PEAR_Error on failure.
+ */
+ function _handleConnectAndLogin()
+ {
+ if (PEAR::isError($res = $this->connect($this->_data['host'], $this->_data['port'], $this->_options, $this->_useTLS))) {
+ return $res;
+ }
+ if ($this->_bypassAuth === false) {
+ if (PEAR::isError($res = $this->login($this->_data['user'], $this->_data['pass'], $this->_data['logintype'], $this->_data['euser'], $this->_bypassAuth))) {
+ return $res;
+ }
+ }
+ return true;
+ }
+
+ /**
+ * Handles connecting to the server and checks the response validity.
+ *
+ * @param string $host Hostname of server.
+ * @param string $port Port of server.
+ * @param array $options List of options to pass to
+ * stream_context_create().
+ * @param boolean $useTLS Use TLS if available.
+ *
+ * @return boolean True on success, PEAR_Error otherwise.
+ */
+ function connect($host, $port, $options = null, $useTLS = true)
+ {
+ $this->_data['host'] = $host;
+ $this->_data['port'] = $port;
+ $this->_useTLS = $useTLS;
+ if (!empty($options) && is_array($options)) {
+ $this->_options = array_merge($this->_options, $options);
+ }
+
+ if (NET_SIEVE_STATE_DISCONNECTED != $this->_state) {
+ return PEAR::raiseError('Not currently in DISCONNECTED state', 1);
+ }
+
+ if (PEAR::isError($res = $this->_sock->connect($host, $port, false, 5, $options))) {
+ return $res;
+ }
+
+ if ($this->_bypassAuth) {
+ $this->_state = NET_SIEVE_STATE_TRANSACTION;
+ } else {
+ $this->_state = NET_SIEVE_STATE_AUTHORISATION;
+ if (PEAR::isError($res = $this->_doCmd())) {
+ return $res;
+ }
+ }
+
+ // Explicitly ask for the capabilities in case the connection is
+ // picked up from an existing connection.
+ if (PEAR::isError($res = $this->_cmdCapability())) {
+ return PEAR::raiseError(
+ 'Failed to connect, server said: ' . $res->getMessage(), 2
+ );
+ }
+
+ // Check if we can enable TLS via STARTTLS.
+ if ($useTLS && !empty($this->_capability['starttls'])
+ && function_exists('stream_socket_enable_crypto')
+ ) {
+ if (PEAR::isError($res = $this->_startTLS())) {
+ return $res;
+ }
+ }
+
+ return true;
+ }
+
+ /**
+ * Disconnect from the Sieve server.
+ *
+ * @param boolean $sendLogoutCMD Whether to send LOGOUT command before
+ * disconnecting.
+ *
+ * @return boolean True on success, PEAR_Error otherwise.
+ */
+ function disconnect($sendLogoutCMD = true)
+ {
+ return $this->_cmdLogout($sendLogoutCMD);
+ }
+
+ /**
+ * Logs into server.
+ *
+ * @param string $user Login username.
+ * @param string $pass Login password.
+ * @param string $logintype Type of login method to use.
+ * @param string $euser Effective UID (perform on behalf of $euser).
+ * @param boolean $bypassAuth Do not perform authentication.
+ *
+ * @return boolean True on success, PEAR_Error otherwise.
+ */
+ function login($user, $pass, $logintype = null, $euser = '', $bypassAuth = false)
+ {
+ $this->_data['user'] = $user;
+ $this->_data['pass'] = $pass;
+ $this->_data['logintype'] = $logintype;
+ $this->_data['euser'] = $euser;
+ $this->_bypassAuth = $bypassAuth;
+
+ if (NET_SIEVE_STATE_AUTHORISATION != $this->_state) {
+ return PEAR::raiseError('Not currently in AUTHORISATION state', 1);
+ }
+
+ if (!$bypassAuth ) {
+ if (PEAR::isError($res = $this->_cmdAuthenticate($user, $pass, $logintype, $euser))) {
+ return $res;
+ }
+ }
+ $this->_state = NET_SIEVE_STATE_TRANSACTION;
+
+ return true;
+ }
+
+ /**
+ * Returns an indexed array of scripts currently on the server.
+ *
+ * @return array Indexed array of scriptnames.
+ */
+ function listScripts()
+ {
+ if (is_array($scripts = $this->_cmdListScripts())) {
+ $this->_active = $scripts[1];
+ return $scripts[0];
+ } else {
+ return $scripts;
+ }
+ }
+
+ /**
+ * Returns the active script.
+ *
+ * @return string The active scriptname.
+ */
+ function getActive()
+ {
+ if (!empty($this->_active)) {
+ return $this->_active;
+ }
+ if (is_array($scripts = $this->_cmdListScripts())) {
+ $this->_active = $scripts[1];
+ return $scripts[1];
+ }
+ }
+
+ /**
+ * Sets the active script.
+ *
+ * @param string $scriptname The name of the script to be set as active.
+ *
+ * @return boolean True on success, PEAR_Error on failure.
+ */
+ function setActive($scriptname)
+ {
+ return $this->_cmdSetActive($scriptname);
+ }
+
+ /**
+ * Retrieves a script.
+ *
+ * @param string $scriptname The name of the script to be retrieved.
+ *
+ * @return string The script on success, PEAR_Error on failure.
+ */
+ function getScript($scriptname)
+ {
+ return $this->_cmdGetScript($scriptname);
+ }
+
+ /**
+ * Adds a script to the server.
+ *
+ * @param string $scriptname Name of the script.
+ * @param string $script The script content.
+ * @param boolean $makeactive Whether to make this the active script.
+ *
+ * @return boolean True on success, PEAR_Error on failure.
+ */
+ function installScript($scriptname, $script, $makeactive = false)
+ {
+ if (PEAR::isError($res = $this->_cmdPutScript($scriptname, $script))) {
+ return $res;
+ }
+ if ($makeactive) {
+ return $this->_cmdSetActive($scriptname);
+ }
+ return true;
+ }
+
+ /**
+ * Removes a script from the server.
+ *
+ * @param string $scriptname Name of the script.
+ *
+ * @return boolean True on success, PEAR_Error on failure.
+ */
+ function removeScript($scriptname)
+ {
+ return $this->_cmdDeleteScript($scriptname);
+ }
+
+ /**
+ * Checks if the server has space to store the script by the server.
+ *
+ * @param string $scriptname The name of the script to mark as active.
+ * @param integer $size The size of the script.
+ *
+ * @return boolean|PEAR_Error True if there is space, PEAR_Error otherwise.
+ *
+ * @todo Rename to hasSpace()
+ */
+ function haveSpace($scriptname, $size)
+ {
+ if (NET_SIEVE_STATE_TRANSACTION != $this->_state) {
+ return PEAR::raiseError('Not currently in TRANSACTION state', 1);
+ }
+
+ $command = sprintf('HAVESPACE %s %d', $this->_escape($scriptname), $size);
+ if (PEAR::isError($res = $this->_doCmd($command))) {
+ return $res;
+ }
+ return true;
+ }
+
+ /**
+ * Returns the list of extensions the server supports.
+ *
+ * @return array List of extensions or PEAR_Error on failure.
+ */
+ function getExtensions()
+ {
+ if (NET_SIEVE_STATE_DISCONNECTED == $this->_state) {
+ return PEAR::raiseError('Not currently connected', 7);
+ }
+ return $this->_capability['extensions'];
+ }
+
+ /**
+ * Returns whether the server supports an extension.
+ *
+ * @param string $extension The extension to check.
+ *
+ * @return boolean Whether the extension is supported or PEAR_Error on
+ * failure.
+ */
+ function hasExtension($extension)
+ {
+ if (NET_SIEVE_STATE_DISCONNECTED == $this->_state) {
+ return PEAR::raiseError('Not currently connected', 7);
+ }
+
+ $extension = trim($this->_toUpper($extension));
+ if (is_array($this->_capability['extensions'])) {
+ foreach ($this->_capability['extensions'] as $ext) {
+ if ($ext == $extension) {
+ return true;
+ }
+ }
+ }
+
+ return false;
+ }
+
+ /**
+ * Returns the list of authentication methods the server supports.
+ *
+ * @return array List of authentication methods or PEAR_Error on failure.
+ */
+ function getAuthMechs()
+ {
+ if (NET_SIEVE_STATE_DISCONNECTED == $this->_state) {
+ return PEAR::raiseError('Not currently connected', 7);
+ }
+ return $this->_capability['sasl'];
+ }
+
+ /**
+ * Returns whether the server supports an authentication method.
+ *
+ * @param string $method The method to check.
+ *
+ * @return boolean Whether the method is supported or PEAR_Error on
+ * failure.
+ */
+ function hasAuthMech($method)
+ {
+ if (NET_SIEVE_STATE_DISCONNECTED == $this->_state) {
+ return PEAR::raiseError('Not currently connected', 7);
+ }
+
+ $method = trim($this->_toUpper($method));
+ if (is_array($this->_capability['sasl'])) {
+ foreach ($this->_capability['sasl'] as $sasl) {
+ if ($sasl == $method) {
+ return true;
+ }
+ }
+ }
+
+ return false;
+ }
+
+ /**
+ * Handles the authentication using any known method.
+ *
+ * @param string $uid The userid to authenticate as.
+ * @param string $pwd The password to authenticate with.
+ * @param string $userMethod The method to use. If empty, the class chooses
+ * the best (strongest) available method.
+ * @param string $euser The effective uid to authenticate as.
+ *
+ * @return void
+ */
+ function _cmdAuthenticate($uid, $pwd, $userMethod = null, $euser = '')
+ {
+ if (PEAR::isError($method = $this->_getBestAuthMethod($userMethod))) {
+ return $method;
+ }
+ switch ($method) {
+ case 'DIGEST-MD5':
+ return $this->_authDigestMD5($uid, $pwd, $euser);
+ case 'CRAM-MD5':
+ $result = $this->_authCRAMMD5($uid, $pwd, $euser);
+ break;
+ case 'LOGIN':
+ $result = $this->_authLOGIN($uid, $pwd, $euser);
+ break;
+ case 'PLAIN':
+ $result = $this->_authPLAIN($uid, $pwd, $euser);
+ break;
+ case 'EXTERNAL':
+ $result = $this->_authEXTERNAL($uid, $pwd, $euser);
+ break;
+ default :
+ $result = PEAR::raiseError(
+ $method . ' is not a supported authentication method'
+ );
+ break;
+ }
+
+ if (PEAR::isError($res = $this->_doCmd())) {
+ return $res;
+ }
+
+ return $result;
+ }
+
+ /**
+ * Authenticates the user using the PLAIN method.
+ *
+ * @param string $user The userid to authenticate as.
+ * @param string $pass The password to authenticate with.
+ * @param string $euser The effective uid to authenticate as.
+ *
+ * @return void
+ */
+ function _authPLAIN($user, $pass, $euser)
+ {
+ return $this->_sendCmd(
+ sprintf(
+ 'AUTHENTICATE "PLAIN" "%s"',
+ base64_encode($euser . chr(0) . $user . chr(0) . $pass)
+ )
+ );
+ }
+
+ /**
+ * Authenticates the user using the LOGIN method.
+ *
+ * @param string $user The userid to authenticate as.
+ * @param string $pass The password to authenticate with.
+ * @param string $euser The effective uid to authenticate as.
+ *
+ * @return void
+ */
+ function _authLOGIN($user, $pass, $euser)
+ {
+ if (PEAR::isError($result = $this->_sendCmd('AUTHENTICATE "LOGIN"'))) {
+ return $result;
+ }
+ if (PEAR::isError($result = $this->_doCmd('"' . base64_encode($user) . '"', true))) {
+ return $result;
+ }
+ return $this->_doCmd('"' . base64_encode($pass) . '"', true);
+ }
+
+ /**
+ * Authenticates the user using the CRAM-MD5 method.
+ *
+ * @param string $user The userid to authenticate as.
+ * @param string $pass The password to authenticate with.
+ * @param string $euser The effective uid to authenticate as.
+ *
+ * @return void
+ */
+ function _authCRAMMD5($user, $pass, $euser)
+ {
+ if (PEAR::isError($challenge = $this->_doCmd('AUTHENTICATE "CRAM-MD5"', true))) {
+ return $challenge;
+ }
+
+ $challenge = base64_decode(trim($challenge));
+ $cram = Auth_SASL::factory('crammd5');
+ if (PEAR::isError($response = $cram->getResponse($user, $pass, $challenge))) {
+ return $response;
+ }
+
+ return $this->_sendStringResponse(base64_encode($response));
+ }
+
+ /**
+ * Authenticates the user using the DIGEST-MD5 method.
+ *
+ * @param string $user The userid to authenticate as.
+ * @param string $pass The password to authenticate with.
+ * @param string $euser The effective uid to authenticate as.
+ *
+ * @return void
+ */
+ function _authDigestMD5($user, $pass, $euser)
+ {
+ if (PEAR::isError($challenge = $this->_doCmd('AUTHENTICATE "DIGEST-MD5"', true))) {
+ return $challenge;
+ }
+
+ $challenge = base64_decode(trim($challenge));
+ $digest = Auth_SASL::factory('digestmd5');
+ // @todo Really 'localhost'?
+ if (PEAR::isError($response = $digest->getResponse($user, $pass, $challenge, 'localhost', 'sieve', $euser))) {
+ return $response;
+ }
+
+ if (PEAR::isError($result = $this->_sendStringResponse(base64_encode($response)))) {
+ return $result;
+ }
+ if (PEAR::isError($result = $this->_doCmd('', true))) {
+ return $result;
+ }
+ if ($this->_toUpper(substr($result, 0, 2)) == 'OK') {
+ return;
+ }
+
+ /* We don't use the protocol's third step because SIEVE doesn't allow
+ * subsequent authentication, so we just silently ignore it. */
+ if (PEAR::isError($result = $this->_sendStringResponse(''))) {
+ return $result;
+ }
+
+ return $this->_doCmd();
+ }
+
+ /**
+ * Authenticates the user using the EXTERNAL method.
+ *
+ * @param string $user The userid to authenticate as.
+ * @param string $pass The password to authenticate with.
+ * @param string $euser The effective uid to authenticate as.
+ *
+ * @return void
+ *
+ * @since 1.1.7
+ */
+ function _authEXTERNAL($user, $pass, $euser)
+ {
+ $cmd = sprintf(
+ 'AUTHENTICATE "EXTERNAL" "%s"',
+ base64_encode(strlen($euser) ? $euser : $user)
+ );
+ return $this->_sendCmd($cmd);
+ }
+
+ /**
+ * Removes a script from the server.
+ *
+ * @param string $scriptname Name of the script to delete.
+ *
+ * @return boolean True on success, PEAR_Error otherwise.
+ */
+ function _cmdDeleteScript($scriptname)
+ {
+ if (NET_SIEVE_STATE_TRANSACTION != $this->_state) {
+ return PEAR::raiseError('Not currently in AUTHORISATION state', 1);
+ }
+
+ $command = sprintf('DELETESCRIPT %s', $this->_escape($scriptname));
+ if (PEAR::isError($res = $this->_doCmd($command))) {
+ return $res;
+ }
+ return true;
+ }
+
+ /**
+ * Retrieves the contents of the named script.
+ *
+ * @param string $scriptname Name of the script to retrieve.
+ *
+ * @return string The script if successful, PEAR_Error otherwise.
+ */
+ function _cmdGetScript($scriptname)
+ {
+ if (NET_SIEVE_STATE_TRANSACTION != $this->_state) {
+ return PEAR::raiseError('Not currently in AUTHORISATION state', 1);
+ }
+
+ $command = sprintf('GETSCRIPT %s', $this->_escape($scriptname));
+ if (PEAR::isError($res = $this->_doCmd($command))) {
+ return $res;
+ }
+
+ return preg_replace('/^{[0-9]+}\r\n/', '', $res);
+ }
+
+ /**
+ * Sets the active script, i.e. the one that gets run on new mail by the
+ * server.
+ *
+ * @param string $scriptname The name of the script to mark as active.
+ *
+ * @return boolean True on success, PEAR_Error otherwise.
+ */
+ function _cmdSetActive($scriptname)
+ {
+ if (NET_SIEVE_STATE_TRANSACTION != $this->_state) {
+ return PEAR::raiseError('Not currently in AUTHORISATION state', 1);
+ }
+
+ $command = sprintf('SETACTIVE %s', $this->_escape($scriptname));
+ if (PEAR::isError($res = $this->_doCmd($command))) {
+ return $res;
+ }
+
+ $this->_activeScript = $scriptname;
+ return true;
+ }
+
+ /**
+ * Returns the list of scripts on the server.
+ *
+ * @return array An array with the list of scripts in the first element
+ * and the active script in the second element on success,
+ * PEAR_Error otherwise.
+ */
+ function _cmdListScripts()
+ {
+ if (NET_SIEVE_STATE_TRANSACTION != $this->_state) {
+ return PEAR::raiseError('Not currently in AUTHORISATION state', 1);
+ }
+
+ if (PEAR::isError($res = $this->_doCmd('LISTSCRIPTS'))) {
+ return $res;
+ }
+
+ $scripts = array();
+ $activescript = null;
+ $res = explode("\r\n", $res);
+ foreach ($res as $value) {
+ if (preg_match('/^"(.*)"( ACTIVE)?$/i', $value, $matches)) {
+ $script_name = stripslashes($matches[1]);
+ $scripts[] = $script_name;
+ if (!empty($matches[2])) {
+ $activescript = $script_name;
+ }
+ }
+ }
+
+ return array($scripts, $activescript);
+ }
+
+ /**
+ * Adds a script to the server.
+ *
+ * @param string $scriptname Name of the new script.
+ * @param string $scriptdata The new script.
+ *
+ * @return boolean True on success, PEAR_Error otherwise.
+ */
+ function _cmdPutScript($scriptname, $scriptdata)
+ {
+ if (NET_SIEVE_STATE_TRANSACTION != $this->_state) {
+ return PEAR::raiseError('Not currently in AUTHORISATION state', 1);
+ }
+
+ $stringLength = $this->_getLineLength($scriptdata);
+ $command = sprintf("PUTSCRIPT %s {%d+}\r\n%s",
+ $this->_escape($scriptname), $stringLength, $scriptdata);
+
+ if (PEAR::isError($res = $this->_doCmd($command))) {
+ return $res;
+ }
+
+ return true;
+ }
+
+ /**
+ * Logs out of the server and terminates the connection.
+ *
+ * @param boolean $sendLogoutCMD Whether to send LOGOUT command before
+ * disconnecting.
+ *
+ * @return boolean True on success, PEAR_Error otherwise.
+ */
+ function _cmdLogout($sendLogoutCMD = true)
+ {
+ if (NET_SIEVE_STATE_DISCONNECTED == $this->_state) {
+ return PEAR::raiseError('Not currently connected', 1);
+ }
+
+ if ($sendLogoutCMD) {
+ if (PEAR::isError($res = $this->_doCmd('LOGOUT'))) {
+ return $res;
+ }
+ }
+
+ $this->_sock->disconnect();
+ $this->_state = NET_SIEVE_STATE_DISCONNECTED;
+
+ return true;
+ }
+
+ /**
+ * Sends the CAPABILITY command
+ *
+ * @return boolean True on success, PEAR_Error otherwise.
+ */
+ function _cmdCapability()
+ {
+ if (NET_SIEVE_STATE_DISCONNECTED == $this->_state) {
+ return PEAR::raiseError('Not currently connected', 1);
+ }
+ if (PEAR::isError($res = $this->_doCmd('CAPABILITY'))) {
+ return $res;
+ }
+ $this->_parseCapability($res);
+ return true;
+ }
+
+ /**
+ * Parses the response from the CAPABILITY command and stores the result
+ * in $_capability.
+ *
+ * @param string $data The response from the capability command.
+ *
+ * @return void
+ */
+ function _parseCapability($data)
+ {
+ // Clear the cached capabilities.
+ $this->_capability = array('sasl' => array(),
+ 'extensions' => array());
+
+ $data = preg_split('/\r?\n/', $this->_toUpper($data), -1, PREG_SPLIT_NO_EMPTY);
+
+ for ($i = 0; $i < count($data); $i++) {
+ if (!preg_match('/^"([A-Z]+)"( "(.*)")?$/', $data[$i], $matches)) {
+ continue;
+ }
+ switch ($matches[1]) {
+ case 'IMPLEMENTATION':
+ $this->_capability['implementation'] = $matches[3];
+ break;
+
+ case 'SASL':
+ $this->_capability['sasl'] = preg_split('/\s+/', $matches[3]);
+ break;
+
+ case 'SIEVE':
+ $this->_capability['extensions'] = preg_split('/\s+/', $matches[3]);
+ break;
+
+ case 'STARTTLS':
+ $this->_capability['starttls'] = true;
+ break;
+ }
+ }
+ }
+
+ /**
+ * Sends a command to the server
+ *
+ * @param string $cmd The command to send.
+ *
+ * @return void
+ */
+ function _sendCmd($cmd)
+ {
+ $status = $this->_sock->getStatus();
+ if (PEAR::isError($status) || $status['eof']) {
+ return PEAR::raiseError('Failed to write to socket: connection lost');
+ }
+ if (PEAR::isError($error = $this->_sock->write($cmd . "\r\n"))) {
+ return PEAR::raiseError(
+ 'Failed to write to socket: ' . $error->getMessage()
+ );
+ }
+ $this->_debug("C: $cmd");
+ }
+
+ /**
+ * Sends a string response to the server.
+ *
+ * @param string $str The string to send.
+ *
+ * @return void
+ */
+ function _sendStringResponse($str)
+ {
+ return $this->_sendCmd('{' . $this->_getLineLength($str) . "+}\r\n" . $str);
+ }
+
+ /**
+ * Receives a single line from the server.
+ *
+ * @return string The server response line.
+ */
+ function _recvLn()
+ {
+ if (PEAR::isError($lastline = $this->_sock->gets(8192))) {
+ return PEAR::raiseError(
+ 'Failed to read from socket: ' . $lastline->getMessage()
+ );
+ }
+
+ $lastline = rtrim($lastline);
+ $this->_debug("S: $lastline");
+
+ if ($lastline === '') {
+ return PEAR::raiseError('Failed to read from socket');
+ }
+
+ return $lastline;
+ }
+
+ /**
+ * Receives x bytes from the server.
+ *
+ * @param int $length Number of bytes to read
+ *
+ * @return string The server response.
+ */
+ function _recvBytes($length)
+ {
+ $response = '';
+ $response_length = 0;
+
+ while ($response_length < $length) {
+ $response .= $this->_sock->read($length - $response_length);
+ $response_length = $this->_getLineLength($response);
+ }
+
+ $this->_debug("S: " . rtrim($response));
+
+ return $response;
+ }
+
+ /**
+ * Send a command and retrieves a response from the server.
+ *
+ * @param string $cmd The command to send.
+ * @param boolean $auth Whether this is an authentication command.
+ *
+ * @return string|PEAR_Error Reponse string if an OK response, PEAR_Error
+ * if a NO response.
+ */
+ function _doCmd($cmd = '', $auth = false)
+ {
+ $referralCount = 0;
+ while ($referralCount < $this->_maxReferralCount) {
+ if (strlen($cmd)) {
+ if (PEAR::isError($error = $this->_sendCmd($cmd))) {
+ return $error;
+ }
+ }
+
+ $response = '';
+ while (true) {
+ if (PEAR::isError($line = $this->_recvLn())) {
+ return $line;
+ }
+ $uc_line = $this->_toUpper($line);
+
+ if ('OK' == substr($uc_line, 0, 2)) {
+ $response .= $line;
+ return rtrim($response);
+ }
+
+ if ('NO' == substr($uc_line, 0, 2)) {
+ // Check for string literal error message.
+ if (preg_match('/{([0-9]+)}$/i', $line, $matches)) {
+ $line = substr($line, 0, -(strlen($matches[1])+2))
+ . str_replace(
+ "\r\n", ' ', $this->_recvBytes($matches[1] + 2)
+ );
+ }
+ return PEAR::raiseError(trim($response . substr($line, 2)), 3);
+ }
+
+ if ('BYE' == substr($uc_line, 0, 3)) {
+ if (PEAR::isError($error = $this->disconnect(false))) {
+ return PEAR::raiseError(
+ 'Cannot handle BYE, the error was: '
+ . $error->getMessage(),
+ 4
+ );
+ }
+ // Check for referral, then follow it. Otherwise, carp an
+ // error.
+ if (preg_match('/^bye \(referral "(sieve:\/\/)?([^"]+)/i', $line, $matches)) {
+ // Replace the old host with the referral host
+ // preserving any protocol prefix.
+ $this->_data['host'] = preg_replace(
+ '/\w+(?!(\w|\:\/\/)).*/', $matches[2],
+ $this->_data['host']
+ );
+ if (PEAR::isError($error = $this->_handleConnectAndLogin())) {
+ return PEAR::raiseError(
+ 'Cannot follow referral to '
+ . $this->_data['host'] . ', the error was: '
+ . $error->getMessage(),
+ 5
+ );
+ }
+ break;
+ }
+ return PEAR::raiseError(trim($response . $line), 6);
+ }
+
+ if (preg_match('/^{([0-9]+)}/i', $line, $matches)) {
+ // Matches literal string responses.
+ $line = $this->_recvBytes($matches[1] + 2);
+
+ if (!$auth) {
+ // Receive the pending OK only if we aren't
+ // authenticating since string responses during
+ // authentication don't need an OK.
+ $this->_recvLn();
+ }
+ return $line;
+ }
+
+ if ($auth) {
+ // String responses during authentication don't need an
+ // OK.
+ $response .= $line;
+ return rtrim($response);
+ }
+
+ $response .= $line . "\r\n";
+ $referralCount++;
+ }
+ }
+
+ return PEAR::raiseError('Max referral count (' . $referralCount . ') reached. Cyrus murder loop error?', 7);
+ }
+
+ /**
+ * Returns the name of the best authentication method that the server
+ * has advertised.
+ *
+ * @param string $userMethod Only consider this method as available.
+ *
+ * @return string The name of the best supported authentication method or
+ * a PEAR_Error object on failure.
+ */
+ function _getBestAuthMethod($userMethod = null)
+ {
+ if (!isset($this->_capability['sasl'])) {
+ return PEAR::raiseError('This server doesn\'t support any authentication methods. SASL problem?');
+ }
+ if (!$this->_capability['sasl']) {
+ return PEAR::raiseError('This server doesn\'t support any authentication methods.');
+ }
+
+ if ($userMethod) {
+ if (in_array($userMethod, $this->_capability['sasl'])) {
+ return $userMethod;
+ }
+ return PEAR::raiseError(
+ sprintf('No supported authentication method found. The server supports these methods: %s, but we want to use: %s',
+ implode(', ', $this->_capability['sasl']),
+ $userMethod));
+ }
+
+ foreach ($this->supportedAuthMethods as $method) {
+ if (in_array($method, $this->_capability['sasl'])) {
+ return $method;
+ }
+ }
+
+ return PEAR::raiseError(
+ sprintf('No supported authentication method found. The server supports these methods: %s, but we only support: %s',
+ implode(', ', $this->_capability['sasl']),
+ implode(', ', $this->supportedAuthMethods)));
+ }
+
+ /**
+ * Starts a TLS connection.
+ *
+ * @return boolean True on success, PEAR_Error on failure.
+ */
+ function _startTLS()
+ {
+ if (PEAR::isError($res = $this->_doCmd('STARTTLS'))) {
+ return $res;
+ }
+
+ if (!stream_socket_enable_crypto($this->_sock->fp, true, STREAM_CRYPTO_METHOD_TLS_CLIENT)) {
+ return PEAR::raiseError('Failed to establish TLS connection', 2);
+ }
+
+ $this->_debug('STARTTLS negotiation successful');
+
+ // The server should be sending a CAPABILITY response after
+ // negotiating TLS. Read it, and ignore if it doesn't.
+ // Doesn't work with older timsieved versions
+ $regexp = '/^CYRUS TIMSIEVED V([0-9.]+)/';
+ if (!preg_match($regexp, $this->_capability['implementation'], $matches)
+ || version_compare($matches[1], '2.3.10', '>=')
+ ) {
+ $this->_doCmd();
+ }
+
+ // RFC says we need to query the server capabilities again now that we
+ // are under encryption.
+ if (PEAR::isError($res = $this->_cmdCapability())) {
+ return PEAR::raiseError(
+ 'Failed to connect, server said: ' . $res->getMessage(), 2
+ );
+ }
+
+ return true;
+ }
+
+ /**
+ * Returns the length of a string.
+ *
+ * @param string $string A string.
+ *
+ * @return integer The length of the string.
+ */
+ function _getLineLength($string)
+ {
+ if (extension_loaded('mbstring')) {
+ return mb_strlen($string, 'latin1');
+ } else {
+ return strlen($string);
+ }
+ }
+
+ /**
+ * Locale independant strtoupper() implementation.
+ *
+ * @param string $string The string to convert to lowercase.
+ *
+ * @return string The lowercased string, based on ASCII encoding.
+ */
+ function _toUpper($string)
+ {
+ $language = setlocale(LC_CTYPE, 0);
+ setlocale(LC_CTYPE, 'C');
+ $string = strtoupper($string);
+ setlocale(LC_CTYPE, $language);
+ return $string;
+ }
+
+ /**
+ * Convert string into RFC's quoted-string or literal-c2s form
+ *
+ * @param string $string The string to convert.
+ *
+ * @return string Result string
+ */
+ function _escape($string)
+ {
+ // Some implementations doesn't allow UTF-8 characters in quoted-string
+ // It's safe to use literal-c2s
+ if (preg_match('/[^\x01-\x09\x0B-\x0C\x0E-\x7F]/', $string)) {
+ return sprintf("{%d+}\r\n%s", $this->_getLineLength($string), $string);
+ }
+
+ return '"' . addcslashes($string, '\\"') . '"';
+ }
+
+ /**
+ * Write debug text to the current debug output handler.
+ *
+ * @param string $message Debug message text.
+ *
+ * @return void
+ */
+ function _debug($message)
+ {
+ if ($this->_debug) {
+ if ($this->_debug_handler) {
+ call_user_func_array($this->_debug_handler, array(&$this, $message));
+ } else {
+ echo "$message\n";
+ }
+ }
+ }
+}
diff --git a/plugins/managesieve/lib/rcube_sieve.php b/plugins/managesieve/lib/rcube_sieve.php
new file mode 100644
index 000000000..230b44bae
--- /dev/null
+++ b/plugins/managesieve/lib/rcube_sieve.php
@@ -0,0 +1,399 @@
+<?php
+
+/**
+ Classes for managesieve operations (using PEAR::Net_Sieve)
+
+ Author: Aleksander Machniak <alec@alec.pl>
+
+ $Id$
+
+*/
+
+// Managesieve Protocol: RFC5804
+
+define('SIEVE_ERROR_CONNECTION', 1);
+define('SIEVE_ERROR_LOGIN', 2);
+define('SIEVE_ERROR_NOT_EXISTS', 3); // script not exists
+define('SIEVE_ERROR_INSTALL', 4); // script installation
+define('SIEVE_ERROR_ACTIVATE', 5); // script activation
+define('SIEVE_ERROR_DELETE', 6); // script deletion
+define('SIEVE_ERROR_INTERNAL', 7); // internal error
+define('SIEVE_ERROR_DEACTIVATE', 8); // script activation
+define('SIEVE_ERROR_OTHER', 255); // other/unknown error
+
+
+class rcube_sieve
+{
+ private $sieve; // Net_Sieve object
+ private $error = false; // error flag
+ private $list = array(); // scripts list
+
+ public $script; // rcube_sieve_script object
+ public $current; // name of currently loaded script
+ private $disabled; // array of disabled extensions
+ private $exts; // array of supported extensions
+
+
+ /**
+ * Object constructor
+ *
+ * @param string Username (for managesieve login)
+ * @param string Password (for managesieve login)
+ * @param string Managesieve server hostname/address
+ * @param string Managesieve server port number
+ * @param string Managesieve authentication method
+ * @param boolean Enable/disable TLS use
+ * @param array Disabled extensions
+ * @param boolean Enable/disable debugging
+ * @param string Proxy authentication identifier
+ * @param string Proxy authentication password
+ */
+ public function __construct($username, $password='', $host='localhost', $port=2000,
+ $auth_type=null, $usetls=true, $disabled=array(), $debug=false,
+ $auth_cid=null, $auth_pw=null)
+ {
+ $this->sieve = new Net_Sieve();
+
+ if ($debug) {
+ $this->sieve->setDebug(true, array($this, 'debug_handler'));
+ }
+
+ if (PEAR::isError($this->sieve->connect($host, $port, null, $usetls))) {
+ return $this->_set_error(SIEVE_ERROR_CONNECTION);
+ }
+
+ if (!empty($auth_cid)) {
+ $authz = $username;
+ $username = $auth_cid;
+ $password = $auth_pw;
+ }
+
+ if (PEAR::isError($this->sieve->login($username, $password,
+ $auth_type ? strtoupper($auth_type) : null, $authz))
+ ) {
+ return $this->_set_error(SIEVE_ERROR_LOGIN);
+ }
+
+ $this->exts = $this->get_extensions();
+ $this->disabled = $disabled;
+ }
+
+ public function __destruct() {
+ $this->sieve->disconnect();
+ }
+
+ /**
+ * Getter for error code
+ */
+ public function error()
+ {
+ return $this->error ? $this->error : false;
+ }
+
+ /**
+ * Saves current script into server
+ */
+ public function save($name = null)
+ {
+ if (!$this->sieve)
+ return $this->_set_error(SIEVE_ERROR_INTERNAL);
+
+ if (!$this->script)
+ return $this->_set_error(SIEVE_ERROR_INTERNAL);
+
+ if (!$name)
+ $name = $this->current;
+
+ $script = $this->script->as_text();
+
+ if (!$script)
+ $script = '/* empty script */';
+
+ if (PEAR::isError($this->sieve->installScript($name, $script)))
+ return $this->_set_error(SIEVE_ERROR_INSTALL);
+
+ return true;
+ }
+
+ /**
+ * Saves text script into server
+ */
+ public function save_script($name, $content = null)
+ {
+ if (!$this->sieve)
+ return $this->_set_error(SIEVE_ERROR_INTERNAL);
+
+ if (!$content)
+ $content = '/* empty script */';
+
+ if (PEAR::isError($this->sieve->installScript($name, $content)))
+ return $this->_set_error(SIEVE_ERROR_INSTALL);
+
+ return true;
+ }
+
+ /**
+ * Activates specified script
+ */
+ public function activate($name = null)
+ {
+ if (!$this->sieve)
+ return $this->_set_error(SIEVE_ERROR_INTERNAL);
+
+ if (!$name)
+ $name = $this->current;
+
+ if (PEAR::isError($this->sieve->setActive($name)))
+ return $this->_set_error(SIEVE_ERROR_ACTIVATE);
+
+ return true;
+ }
+
+ /**
+ * De-activates specified script
+ */
+ public function deactivate()
+ {
+ if (!$this->sieve)
+ return $this->_set_error(SIEVE_ERROR_INTERNAL);
+
+ if (PEAR::isError($this->sieve->setActive('')))
+ return $this->_set_error(SIEVE_ERROR_DEACTIVATE);
+
+ return true;
+ }
+
+ /**
+ * Removes specified script
+ */
+ public function remove($name = null)
+ {
+ if (!$this->sieve)
+ return $this->_set_error(SIEVE_ERROR_INTERNAL);
+
+ if (!$name)
+ $name = $this->current;
+
+ // script must be deactivated first
+ if ($name == $this->sieve->getActive())
+ if (PEAR::isError($this->sieve->setActive('')))
+ return $this->_set_error(SIEVE_ERROR_DELETE);
+
+ if (PEAR::isError($this->sieve->removeScript($name)))
+ return $this->_set_error(SIEVE_ERROR_DELETE);
+
+ if ($name == $this->current)
+ $this->current = null;
+
+ return true;
+ }
+
+ /**
+ * Gets list of supported by server Sieve extensions
+ */
+ public function get_extensions()
+ {
+ if ($this->exts)
+ return $this->exts;
+
+ if (!$this->sieve)
+ return $this->_set_error(SIEVE_ERROR_INTERNAL);
+
+ $ext = $this->sieve->getExtensions();
+ // we're working on lower-cased names
+ $ext = array_map('strtolower', (array) $ext);
+
+ if ($this->script) {
+ $supported = $this->script->get_extensions();
+ foreach ($ext as $idx => $ext_name)
+ if (!in_array($ext_name, $supported))
+ unset($ext[$idx]);
+ }
+
+ return array_values($ext);
+ }
+
+ /**
+ * Gets list of scripts from server
+ */
+ public function get_scripts()
+ {
+ if (!$this->list) {
+
+ if (!$this->sieve)
+ return $this->_set_error(SIEVE_ERROR_INTERNAL);
+
+ $list = $this->sieve->listScripts();
+
+ if (PEAR::isError($list))
+ return $this->_set_error(SIEVE_ERROR_OTHER);
+
+ $this->list = $list;
+ }
+
+ return $this->list;
+ }
+
+ /**
+ * Returns active script name
+ */
+ public function get_active()
+ {
+ if (!$this->sieve)
+ return $this->_set_error(SIEVE_ERROR_INTERNAL);
+
+ return $this->sieve->getActive();
+ }
+
+ /**
+ * Loads script by name
+ */
+ public function load($name)
+ {
+ if (!$this->sieve)
+ return $this->_set_error(SIEVE_ERROR_INTERNAL);
+
+ if ($this->current == $name)
+ return true;
+
+ $script = $this->sieve->getScript($name);
+
+ if (PEAR::isError($script))
+ return $this->_set_error(SIEVE_ERROR_OTHER);
+
+ // try to parse from Roundcube format
+ $this->script = $this->_parse($script);
+
+ $this->current = $name;
+
+ return true;
+ }
+
+ /**
+ * Loads script from text content
+ */
+ public function load_script($script)
+ {
+ if (!$this->sieve)
+ return $this->_set_error(SIEVE_ERROR_INTERNAL);
+
+ // try to parse from Roundcube format
+ $this->script = $this->_parse($script);
+ }
+
+ /**
+ * Creates rcube_sieve_script object from text script
+ */
+ private function _parse($txt)
+ {
+ // try to parse from Roundcube format
+ $script = new rcube_sieve_script($txt, $this->disabled, $this->exts);
+
+ // ... else try to import from different formats
+ if (empty($script->content)) {
+ $script = $this->_import_rules($txt);
+ $script = new rcube_sieve_script($script, $this->disabled, $this->exts);
+
+ // replace all elsif with if+stop, we support only ifs
+ foreach ($script->content as $idx => $rule) {
+ // 'stop' not found?
+ foreach ($rule['actions'] as $action) {
+ if (preg_match('/^(stop|vacation)$/', $action['type'])) {
+ continue 2;
+ }
+ }
+ $script->content[$idx]['actions'][] = array('type' => 'stop');
+ }
+ }
+
+ return $script;
+ }
+
+ /**
+ * Gets specified script as text
+ */
+ public function get_script($name)
+ {
+ if (!$this->sieve)
+ return $this->_set_error(SIEVE_ERROR_INTERNAL);
+
+ $content = $this->sieve->getScript($name);
+
+ if (PEAR::isError($content))
+ return $this->_set_error(SIEVE_ERROR_OTHER);
+
+ return $content;
+ }
+
+ /**
+ * Creates empty script or copy of other script
+ */
+ public function copy($name, $copy)
+ {
+ if (!$this->sieve)
+ return $this->_set_error(SIEVE_ERROR_INTERNAL);
+
+ if ($copy) {
+ $content = $this->sieve->getScript($copy);
+
+ if (PEAR::isError($content))
+ return $this->_set_error(SIEVE_ERROR_OTHER);
+ }
+
+ return $this->save_script($name, $content);
+ }
+
+ private function _import_rules($script)
+ {
+ $i = 0;
+ $name = array();
+
+ // Squirrelmail (Avelsieve)
+ if ($tokens = preg_split('/(#START_SIEVE_RULE.*END_SIEVE_RULE)\r?\n/', $script, -1, PREG_SPLIT_DELIM_CAPTURE)) {
+ foreach($tokens as $token) {
+ if (preg_match('/^#START_SIEVE_RULE.*/', $token, $matches)) {
+ $name[$i] = "unnamed rule ".($i+1);
+ $content .= "# rule:[".$name[$i]."]\n";
+ }
+ elseif (isset($name[$i])) {
+ // This preg_replace is added because I've found some Avelsieve scripts
+ // with rules containing "if" here. I'm not sure it was working
+ // before without this or not.
+ $token = preg_replace('/^if\s+/', '', trim($token));
+ $content .= "if $token\n";
+ $i++;
+ }
+ }
+ }
+ // Horde (INGO)
+ else if ($tokens = preg_split('/(# .+)\r?\n/i', $script, -1, PREG_SPLIT_DELIM_CAPTURE)) {
+ foreach($tokens as $token) {
+ if (preg_match('/^# (.+)/i', $token, $matches)) {
+ $name[$i] = $matches[1];
+ $content .= "# rule:[" . $name[$i] . "]\n";
+ }
+ elseif (isset($name[$i])) {
+ $token = str_replace(":comparator \"i;ascii-casemap\" ", "", $token);
+ $content .= $token . "\n";
+ $i++;
+ }
+ }
+ }
+
+ return $content;
+ }
+
+ private function _set_error($error)
+ {
+ $this->error = $error;
+ return false;
+ }
+
+ /**
+ * This is our own debug handler for connection
+ */
+ public function debug_handler(&$sieve, $message)
+ {
+ write_log('sieve', preg_replace('/\r\n$/', '', $message));
+ }
+}
diff --git a/plugins/managesieve/lib/rcube_sieve_script.php b/plugins/managesieve/lib/rcube_sieve_script.php
new file mode 100644
index 000000000..ee2780266
--- /dev/null
+++ b/plugins/managesieve/lib/rcube_sieve_script.php
@@ -0,0 +1,731 @@
+<?php
+
+/**
+ Class for operations on Sieve scripts
+
+ Author: Aleksander Machniak <alec@alec.pl>
+
+ $Id$
+
+*/
+
+class rcube_sieve_script
+{
+ public $content = array(); // script rules array
+
+ private $supported = array( // extensions supported by class
+ 'fileinto', // RFC3028
+ 'reject', // RFC5429
+ 'ereject', // RFC5429
+ 'copy', // RFC3894
+ 'vacation', // RFC5230
+ 'relational', // RFC3431
+ 'regex', // draft-ietf-sieve-regex-01
+ 'imapflags', // draft-melnikov-sieve-imapflags-06
+ 'imap4flags', // RFC5232
+ // TODO: body, notify
+ );
+
+ private $capabilities;
+
+ /**
+ * Object constructor
+ *
+ * @param string Script's text content
+ * @param array List of disabled extensions
+ * @param array List of capabilities supported by server
+ */
+ public function __construct($script, $disabled=null, $capabilities=null)
+ {
+ if (!empty($disabled)) {
+ // we're working on lower-cased names
+ $disabled = array_map('strtolower', (array) $disabled);
+ foreach ($disabled as $ext) {
+ if (($idx = array_search($ext, $this->supported)) !== false) {
+ unset($this->supported[$idx]);
+ }
+ }
+ }
+
+ $this->capabilities = $capabilities;
+ $this->content = $this->_parse_text($script);
+ }
+
+ /**
+ * Adds script contents as text to the script array (at the end)
+ *
+ * @param string Text script contents
+ */
+ public function add_text($script)
+ {
+ $content = $this->_parse_text($script);
+ $result = false;
+
+ // check existsing script rules names
+ foreach ($this->content as $idx => $elem) {
+ $names[$elem['name']] = $idx;
+ }
+
+ foreach ($content as $elem) {
+ if (!isset($names[$elem['name']])) {
+ array_push($this->content, $elem);
+ $result = true;
+ }
+ }
+
+ return $result;
+ }
+
+ /**
+ * Adds rule to the script (at the end)
+ *
+ * @param string Rule name
+ * @param array Rule content (as array)
+ */
+ public function add_rule($content)
+ {
+ // TODO: check this->supported
+ array_push($this->content, $content);
+ return sizeof($this->content)-1;
+ }
+
+ public function delete_rule($index)
+ {
+ if(isset($this->content[$index])) {
+ unset($this->content[$index]);
+ return true;
+ }
+ return false;
+ }
+
+ public function size()
+ {
+ return sizeof($this->content);
+ }
+
+ public function update_rule($index, $content)
+ {
+ // TODO: check this->supported
+ if ($this->content[$index]) {
+ $this->content[$index] = $content;
+ return $index;
+ }
+ return false;
+ }
+
+ /**
+ * Returns script as text
+ */
+ public function as_text()
+ {
+ $script = '';
+ $exts = array();
+ $idx = 0;
+
+ // rules
+ foreach ($this->content as $rule) {
+ $extension = '';
+ $tests = array();
+ $i = 0;
+
+ // header
+ $script .= '# rule:[' . $rule['name'] . "]\n";
+
+ // constraints expressions
+ foreach ($rule['tests'] as $test) {
+ $tests[$i] = '';
+ switch ($test['test']) {
+ case 'size':
+ $tests[$i] .= ($test['not'] ? 'not ' : '');
+ $tests[$i] .= 'size :' . ($test['type']=='under' ? 'under ' : 'over ') . $test['arg'];
+ break;
+ case 'true':
+ $tests[$i] .= ($test['not'] ? 'false' : 'true');
+ break;
+ case 'exists':
+ $tests[$i] .= ($test['not'] ? 'not ' : '');
+ $tests[$i] .= 'exists ' . self::escape_string($test['arg']);
+ break;
+ case 'header':
+ $tests[$i] .= ($test['not'] ? 'not ' : '');
+
+ // relational operator + comparator
+ if (preg_match('/^(value|count)-([gteqnl]{2})/', $test['type'], $m)) {
+ array_push($exts, 'relational');
+ array_push($exts, 'comparator-i;ascii-numeric');
+
+ $tests[$i] .= 'header :' . $m[1] . ' "' . $m[2] . '" :comparator "i;ascii-numeric"';
+ }
+ else {
+ if ($test['type'] == 'regex') {
+ array_push($exts, 'regex');
+ }
+
+ $tests[$i] .= 'header :' . $test['type'];
+ }
+
+ $tests[$i] .= ' ' . self::escape_string($test['arg1']);
+ $tests[$i] .= ' ' . self::escape_string($test['arg2']);
+ break;
+ }
+ $i++;
+ }
+
+ // disabled rule: if false #....
+ $script .= 'if ' . ($rule['disabled'] ? 'false # ' : '');
+
+ if (empty($tests)) {
+ $tests_str = 'true';
+ }
+ else if (count($tests) > 1) {
+ $tests_str = implode(', ', $tests);
+ }
+ else {
+ $tests_str = $tests[0];
+ }
+
+ if ($rule['join'] || count($tests) > 1) {
+ $script .= sprintf('%s (%s)', $rule['join'] ? 'allof' : 'anyof', $tests_str);
+ }
+ else {
+ $script .= $tests_str;
+ }
+ $script .= "\n{\n";
+
+ // action(s)
+ foreach ($rule['actions'] as $action) {
+ switch ($action['type']) {
+
+ case 'fileinto':
+ array_push($exts, 'fileinto');
+ $script .= "\tfileinto ";
+ if ($action['copy']) {
+ $script .= ':copy ';
+ array_push($exts, 'copy');
+ }
+ $script .= self::escape_string($action['target']) . ";\n";
+ break;
+
+ case 'redirect':
+ $script .= "\tredirect ";
+ if ($action['copy']) {
+ $script .= ':copy ';
+ array_push($exts, 'copy');
+ }
+ $script .= self::escape_string($action['target']) . ";\n";
+ break;
+
+ case 'reject':
+ case 'ereject':
+ array_push($exts, $action['type']);
+ $script .= "\t".$action['type']." "
+ . self::escape_string($action['target']) . ";\n";
+ break;
+
+ case 'addflag':
+ case 'setflag':
+ case 'removeflag':
+ if (is_array($this->capabilities) && in_array('imap4flags', $this->capabilities))
+ array_push($exts, 'imap4flags');
+ else
+ array_push($exts, 'imapflags');
+
+ $script .= "\t".$action['type']." "
+ . self::escape_string($action['target']) . ";\n";
+ break;
+
+ case 'keep':
+ case 'discard':
+ case 'stop':
+ $script .= "\t" . $action['type'] .";\n";
+ break;
+
+ case 'vacation':
+ array_push($exts, 'vacation');
+ $script .= "\tvacation";
+ if (!empty($action['days']))
+ $script .= " :days " . $action['days'];
+ if (!empty($action['addresses']))
+ $script .= " :addresses " . self::escape_string($action['addresses']);
+ if (!empty($action['subject']))
+ $script .= " :subject " . self::escape_string($action['subject']);
+ if (!empty($action['handle']))
+ $script .= " :handle " . self::escape_string($action['handle']);
+ if (!empty($action['from']))
+ $script .= " :from " . self::escape_string($action['from']);
+ if (!empty($action['mime']))
+ $script .= " :mime";
+ $script .= " " . self::escape_string($action['reason']) . ";\n";
+ break;
+ }
+ }
+
+ $script .= "}\n";
+ $idx++;
+ }
+
+ // requires
+ if (!empty($exts))
+ $script = 'require ["' . implode('","', array_unique($exts)) . "\"];\n" . $script;
+
+ return $script;
+ }
+
+ /**
+ * Returns script object
+ *
+ */
+ public function as_array()
+ {
+ return $this->content;
+ }
+
+ /**
+ * Returns array of supported extensions
+ *
+ */
+ public function get_extensions()
+ {
+ return array_values($this->supported);
+ }
+
+ /**
+ * Converts text script to rules array
+ *
+ * @param string Text script
+ */
+ private function _parse_text($script)
+ {
+ $i = 0;
+ $content = array();
+
+ // tokenize rules
+ if ($tokens = preg_split('/(# rule:\[.*\])\r?\n/', $script, -1, PREG_SPLIT_DELIM_CAPTURE)) {
+ foreach($tokens as $token) {
+ if (preg_match('/^# rule:\[(.*)\]/', $token, $matches)) {
+ $content[$i]['name'] = $matches[1];
+ }
+ else if (isset($content[$i]['name']) && sizeof($content[$i]) == 1) {
+ if ($rule = $this->_tokenize_rule($token)) {
+ $content[$i] = array_merge($content[$i], $rule);
+ $i++;
+ }
+ else // unknown rule format
+ unset($content[$i]);
+ }
+ }
+ }
+
+ return $content;
+ }
+
+ /**
+ * Convert text script fragment to rule object
+ *
+ * @param string Text rule
+ */
+ private function _tokenize_rule($content)
+ {
+ $cond = strtolower(self::tokenize($content, 1));
+
+ if ($cond != 'if' && $cond != 'elsif' && $cond != 'else') {
+ return null;
+ }
+
+ $disabled = false;
+ $join = false;
+
+ // disabled rule (false + comment): if false # .....
+ if (preg_match('/^\s*false\s+#/i', $content)) {
+ $content = preg_replace('/^\s*false\s+#\s*/i', '', $content);
+ $disabled = true;
+ }
+
+ while (strlen($content)) {
+ $tokens = self::tokenize($content, true);
+ $separator = array_pop($tokens);
+
+ if (!empty($tokens)) {
+ $token = array_shift($tokens);
+ }
+ else {
+ $token = $separator;
+ }
+
+ $token = strtolower($token);
+
+ if ($token == 'not') {
+ $not = true;
+ $token = strtolower(array_shift($tokens));
+ }
+ else {
+ $not = false;
+ }
+
+ switch ($token) {
+ case 'allof':
+ $join = true;
+ break;
+ case 'anyof':
+ break;
+
+ case 'size':
+ $size = array('test' => 'size', 'not' => $not);
+ for ($i=0, $len=count($tokens); $i<$len; $i++) {
+ if (!is_array($tokens[$i])
+ && preg_match('/^:(under|over)$/i', $tokens[$i])
+ ) {
+ $size['type'] = strtolower(substr($tokens[$i], 1));
+ }
+ else {
+ $size['arg'] = $tokens[$i];
+ }
+ }
+
+ $tests[] = $size;
+ break;
+
+ case 'header':
+ $header = array('test' => 'header', 'not' => $not, 'arg1' => '', 'arg2' => '');
+ for ($i=0, $len=count($tokens); $i<$len; $i++) {
+ if (!is_array($tokens[$i]) && preg_match('/^:comparator$/i', $tokens[$i])) {
+ $i++;
+ }
+ else if (!is_array($tokens[$i]) && preg_match('/^:(count|value)$/i', $tokens[$i])) {
+ $header['type'] = strtolower(substr($tokens[$i], 1)) . '-' . $tokens[++$i];
+ }
+ else if (!is_array($tokens[$i]) && preg_match('/^:(is|contains|matches|regex)$/i', $tokens[$i])) {
+ $header['type'] = strtolower(substr($tokens[$i], 1));
+ }
+ else {
+ $header['arg1'] = $header['arg2'];
+ $header['arg2'] = $tokens[$i];
+ }
+ }
+
+ $tests[] = $header;
+ break;
+
+ case 'exists':
+ $tests[] = array('test' => 'exists', 'not' => $not,
+ 'arg' => array_pop($tokens));
+ break;
+
+ case 'true':
+ $tests[] = array('test' => 'true', 'not' => $not);
+ break;
+
+ case 'false':
+ $tests[] = array('test' => 'true', 'not' => !$not);
+ break;
+ }
+
+ // goto actions...
+ if ($separator == '{') {
+ break;
+ }
+ }
+
+ // ...and actions block
+ if ($tests) {
+ $actions = $this->_parse_actions($content);
+ }
+
+ if ($tests && $actions) {
+ $result = array(
+ 'type' => $cond,
+ 'tests' => $tests,
+ 'actions' => $actions,
+ 'join' => $join,
+ 'disabled' => $disabled,
+ );
+ }
+
+ return $result;
+ }
+
+ /**
+ * Parse body of actions section
+ *
+ * @param string Text body
+ * @return array Array of parsed action type/target pairs
+ */
+ private function _parse_actions($content)
+ {
+ $result = null;
+
+ while (strlen($content)) {
+ $tokens = self::tokenize($content, true);
+ $separator = array_pop($tokens);
+
+ if (!empty($tokens)) {
+ $token = array_shift($tokens);
+ }
+ else {
+ $token = $separator;
+ }
+
+ switch ($token) {
+ case 'discard':
+ case 'keep':
+ case 'stop':
+ $result[] = array('type' => $token);
+ break;
+
+ case 'fileinto':
+ case 'redirect':
+ $copy = false;
+ $target = '';
+
+ for ($i=0, $len=count($tokens); $i<$len; $i++) {
+ if (strtolower($tokens[$i]) == ':copy') {
+ $copy = true;
+ }
+ else {
+ $target = $tokens[$i];
+ }
+ }
+
+ $result[] = array('type' => $token, 'copy' => $copy,
+ 'target' => $target);
+ break;
+
+ case 'reject':
+ case 'ereject':
+ $result[] = array('type' => $token, 'target' => array_pop($tokens));
+ break;
+
+ case 'vacation':
+ $vacation = array('type' => 'vacation', 'reason' => array_pop($tokens));
+
+ for ($i=0, $len=count($tokens); $i<$len; $i++) {
+ $tok = strtolower($tokens[$i]);
+ if ($tok == ':days') {
+ $vacation['days'] = $tokens[++$i];
+ }
+ else if ($tok == ':subject') {
+ $vacation['subject'] = $tokens[++$i];
+ }
+ else if ($tok == ':addresses') {
+ $vacation['addresses'] = $tokens[++$i];
+ }
+ else if ($tok == ':handle') {
+ $vacation['handle'] = $tokens[++$i];
+ }
+ else if ($tok == ':from') {
+ $vacation['from'] = $tokens[++$i];
+ }
+ else if ($tok == ':mime') {
+ $vacation['mime'] = true;
+ }
+ }
+
+ $result[] = $vacation;
+ break;
+
+ case 'setflag':
+ case 'addflag':
+ case 'removeflag':
+ $result[] = array('type' => $token,
+ // Flags list: last token (skip optional variable)
+ 'target' => $tokens[count($tokens)-1]
+ );
+ break;
+ }
+ }
+
+ return $result;
+ }
+
+ /**
+ * Escape special chars into quoted string value or multi-line string
+ * or list of strings
+ *
+ * @param string $str Text or array (list) of strings
+ *
+ * @return string Result text
+ */
+ static function escape_string($str)
+ {
+ if (is_array($str) && count($str) > 1) {
+ foreach($str as $idx => $val)
+ $str[$idx] = self::escape_string($val);
+
+ return '[' . implode(',', $str) . ']';
+ }
+ else if (is_array($str)) {
+ $str = array_pop($str);
+ }
+
+ // multi-line string
+ if (preg_match('/[\r\n\0]/', $str) || strlen($str) > 1024) {
+ return sprintf("text:\n%s\n.\n", self::escape_multiline_string($str));
+ }
+ // quoted-string
+ else {
+ return '"' . addcslashes($str, '\\"') . '"';
+ }
+ }
+
+ /**
+ * Escape special chars in multi-line string value
+ *
+ * @param string $str Text
+ *
+ * @return string Text
+ */
+ static function escape_multiline_string($str)
+ {
+ $str = preg_split('/(\r?\n)/', $str, -1, PREG_SPLIT_DELIM_CAPTURE);
+
+ foreach ($str as $idx => $line) {
+ // dot-stuffing
+ if (isset($line[0]) && $line[0] == '.') {
+ $str[$idx] = '.' . $line;
+ }
+ }
+
+ return implode($str);
+ }
+
+ /**
+ * Splits script into string tokens
+ *
+ * @param string &$str The script
+ * @param mixed $num Number of tokens to return, 0 for all
+ * or True for all tokens until separator is found.
+ * Separator will be returned as last token.
+ * @param int $in_list Enable to called recursively inside a list
+ *
+ * @return mixed Tokens array or string if $num=1
+ */
+ static function tokenize(&$str, $num=0, $in_list=false)
+ {
+ $result = array();
+
+ // remove spaces from the beginning of the string
+ while (($str = ltrim($str)) !== ''
+ && (!$num || $num === true || count($result) < $num)
+ ) {
+ switch ($str[0]) {
+
+ // Quoted string
+ case '"':
+ $len = strlen($str);
+
+ for ($pos=1; $pos<$len; $pos++) {
+ if ($str[$pos] == '"') {
+ break;
+ }
+ if ($str[$pos] == "\\") {
+ if ($str[$pos + 1] == '"' || $str[$pos + 1] == "\\") {
+ $pos++;
+ }
+ }
+ }
+ if ($str[$pos] != '"') {
+ // error
+ }
+ // we need to strip slashes for a quoted string
+ $result[] = stripslashes(substr($str, 1, $pos - 1));
+ $str = substr($str, $pos + 1);
+ break;
+
+ // Parenthesized list
+ case '[':
+ $str = substr($str, 1);
+ $result[] = self::tokenize($str, 0, true);
+ break;
+ case ']':
+ $str = substr($str, 1);
+ return $result;
+ break;
+
+ // list/test separator
+ case ',':
+ // command separator
+ case ';':
+ // block/tests-list
+ case '(':
+ case ')':
+ case '{':
+ case '}':
+ $sep = $str[0];
+ $str = substr($str, 1);
+ if ($num === true) {
+ $result[] = $sep;
+ break 2;
+ }
+ break;
+
+ // bracket-comment
+ case '/':
+ if ($str[1] == '*') {
+ if ($end_pos = strpos($str, '*/')) {
+ $str = substr($str, $end_pos + 2);
+ }
+ else {
+ // error
+ $str = '';
+ }
+ }
+ break;
+
+ // hash-comment
+ case '#':
+ if ($lf_pos = strpos($str, "\n")) {
+ $str = substr($str, $lf_pos);
+ break;
+ }
+ else {
+ $str = '';
+ }
+
+ // String atom
+ default:
+ // empty or one character
+ if ($str === '') {
+ break 2;
+ }
+ if (strlen($str) < 2) {
+ $result[] = $str;
+ $str = '';
+ break;
+ }
+
+ // tag/identifier/number
+ if (preg_match('/^([a-z0-9:_]+)/i', $str, $m)) {
+ $str = substr($str, strlen($m[1]));
+
+ if ($m[1] != 'text:') {
+ $result[] = $m[1];
+ }
+ // multiline string
+ else {
+ // possible hash-comment after "text:"
+ if (preg_match('/^( |\t)*(#[^\n]+)?\n/', $str, $m)) {
+ $str = substr($str, strlen($m[0]));
+ }
+ // get text until alone dot in a line
+ if (preg_match('/^(.*)\r?\n\.\r?\n/sU', $str, $m)) {
+ $text = $m[1];
+ // remove dot-stuffing
+ $text = str_replace("\n..", "\n.", $text);
+ $str = substr($str, strlen($m[0]));
+ }
+ else {
+ $text = '';
+ }
+
+ $result[] = $text;
+ }
+ }
+
+ break;
+ }
+ }
+
+ return $num === 1 ? (isset($result[0]) ? $result[0] : null) : $result;
+ }
+
+}
diff --git a/plugins/managesieve/localization/bg_BG.inc b/plugins/managesieve/localization/bg_BG.inc
new file mode 100644
index 000000000..90f34bf8e
--- /dev/null
+++ b/plugins/managesieve/localization/bg_BG.inc
@@ -0,0 +1,50 @@
+<?php
+
+$labels = array();
+$labels['filters'] = 'Филтри';
+$labels['managefilters'] = 'Управление на филтри за входяща поща';
+$labels['filtername'] = 'Име на филтър';
+$labels['newfilter'] = 'Нов филтър';
+$labels['filteradd'] = 'Добавяне на филтър';
+$labels['filterdel'] = 'Изтриване на филтър';
+$labels['moveup'] = 'Преместване нагоре';
+$labels['movedown'] = 'Преместване надолу';
+$labels['filterallof'] = 'съвпадение на всички следващи правила';
+$labels['filteranyof'] = 'съвпадение на някое от следните правила';
+$labels['filterany'] = 'всички съобщения';
+$labels['filtercontains'] = 'съдържа';
+$labels['filternotcontains'] = 'не съдържа';
+$labels['filteris'] = 'е равно на';
+$labels['filterisnot'] = 'не е равно на';
+$labels['filterexists'] = 'съществува';
+$labels['filternotexists'] = 'не съществува';
+$labels['filterunder'] = 'под';
+$labels['filterover'] = 'над';
+$labels['addrule'] = 'Добавяне на правило';
+$labels['delrule'] = 'Изтриване на правило';
+$labels['messagemoveto'] = 'Преместване на съобщението в';
+$labels['messageredirect'] = 'Пренасочване на съобщението до';
+$labels['messagereply'] = 'Отговор със съобщение';
+$labels['messagedelete'] = 'Изтриване на съобщение';
+$labels['messagediscard'] = 'Отхвърляне със съобщение';
+$labels['messagesrules'] = 'За входящата поща:';
+$labels['messagesactions'] = '...изпълнение на следните действия';
+$labels['add'] = 'Добавяне';
+$labels['del'] = 'Изтриване';
+$labels['sender'] = 'Подател';
+$labels['recipient'] = 'Получател';
+
+$messages = array();
+$messages['filterunknownerror'] = 'Неизвестна грешка на сървъра';
+$messages['filterconnerror'] = 'Невъзможност за свързване с managesieve сървъра ';
+$messages['filterdeleteerror'] = 'Невъзможност за изтриване на филтър. Сървър грешка';
+$messages['filterdeleted'] = 'Филтърът е изтрит успешно';
+$messages['filterdeleteconfirm'] = 'Наистина ли искате да изтриете избрания филтър?';
+$messages['filtersaved'] = 'Филтърът е записан успешно';
+$messages['filtersaveerror'] = 'Филтърът не може да бъде записан. Сървър грешка.';
+$messages['ruledeleteconfirm'] = 'Сигурни ли сте, че искате да изтриете избраното правило?';
+$messages['actiondeleteconfirm'] = 'Сигурни ли сте, че искате да изтриете избраното действие?';
+$messages['forbiddenchars'] = 'Забранени символи в полето';
+$messages['cannotbeempty'] = 'Полето не може да бъде празно';
+
+?>
diff --git a/plugins/managesieve/localization/cs_CZ.inc b/plugins/managesieve/localization/cs_CZ.inc
new file mode 100644
index 000000000..033a1a0e3
--- /dev/null
+++ b/plugins/managesieve/localization/cs_CZ.inc
@@ -0,0 +1,61 @@
+<?php
+
+/**
+ * Czech translation for Roundcube managesieve plugin
+ *
+ * @version 1.0 (2009-09-29)
+ * @author Daniel Kolar <kolar@g2n.cz>
+ *
+ */
+
+$labels['filters'] = 'Filtry';
+$labels['managefilters'] = 'Nastavení filtrů';
+$labels['filtername'] = 'Název filtru';
+$labels['newfilter'] = 'Nový filtr';
+$labels['filteradd'] = 'Přidej filtr';
+$labels['filterdel'] = 'Smaž filtr';
+$labels['moveup'] = 'Posunout nahoru';
+$labels['movedown'] = 'Posunout dolů';
+$labels['filterallof'] = 'Odpovídají všechny pravidla';
+$labels['filteranyof'] = 'Odpovídá kterékoliv pravidlo';
+$labels['filterany'] = 'Všechny zprávy';
+$labels['filtercontains'] = 'obsahuje';
+$labels['filternotcontains'] = 'neobsahuje';
+$labels['filteris'] = 'odpovídá';
+$labels['filterisnot'] = 'neodpovídá';
+$labels['filterexists'] = 'existuje';
+$labels['filternotexists'] = 'neexistuje';
+$labels['filterunder'] = 'pod';
+$labels['filterover'] = 'nad';
+$labels['addrule'] = 'Přidej pravidlo';
+$labels['delrule'] = 'Smaž pravidlo';
+$labels['messagemoveto'] = 'Přesuň zprávu do';
+$labels['messageredirect'] = 'Přeposlat zprávu na';
+$labels['messagereply'] = 'Odpovědět se zprávou';
+$labels['messagedelete'] = 'Smazat zprávu';
+$labels['messagediscard'] = 'Smazat se zprávou';
+$labels['messagesrules'] = 'Pravidla pro příchozí zprávu:';
+$labels['messagesactions'] = '...vykonej následující akce:';
+$labels['add'] = 'Přidej';
+$labels['del'] = 'Smaž';
+$labels['sender'] = 'Odesílatel';
+$labels['recipient'] = 'Příjemce';
+$labels['vacationaddresses'] = 'Seznam příjemců, kterým nebude zpráva odeslána (oddělené čárkou):';
+$labels['vacationdays'] = 'Počet dnů mezi automatickými odpověďmi:';
+$labels['vacationreason'] = 'Zpráva (Důvod nepřítomnosti):';
+$labels['rulestop'] = 'Zastavit pravidla';
+
+$messages = array();
+$messages['filterunknownerror'] = 'Neznámá chyba serveru';
+$messages['filterconnerror'] = 'Nebylo možné se připojit k sieve serveru';
+$messages['filterdeleteerror'] = 'Nebylo možné smazat filtr. Server nahlásil chybu';
+$messages['filterdeleted'] = 'Filtr byl smazán';
+$messages['filterdeleteconfirm'] = 'Opravdu chcete smazat vybraný filtr?';
+$messages['filtersaved'] = 'Filtr byl uložen';
+$messages['filtersaveerror'] = 'Nebylo možné uložit filtr. Server nahlásil chybu.';
+$messages['ruledeleteconfirm'] = 'Jste si jisti, že chcete smazat vybrané pravidlo?';
+$messages['actiondeleteconfirm'] = 'Jste si jisti, že chcete smazat vybranou akci?';
+$messages['forbiddenchars'] = 'Zakázané znaky v poli';
+$messages['cannotbeempty'] = 'Pole nemůže být prázdné';
+
+?>
diff --git a/plugins/managesieve/localization/de_CH.inc b/plugins/managesieve/localization/de_CH.inc
new file mode 100644
index 000000000..c0fe389f5
--- /dev/null
+++ b/plugins/managesieve/localization/de_CH.inc
@@ -0,0 +1,52 @@
+<?php
+
+$labels['filters'] = 'Filter';
+$labels['managefilters'] = 'Verwalte eingehende Nachrichtenfilter';
+$labels['filtername'] = 'Filtername';
+$labels['newfilter'] = 'Neuer Filter';
+$labels['filteradd'] = 'Filter hinzufügen';
+$labels['filterdel'] = 'Filter löschen';
+$labels['moveup'] = 'Nach oben';
+$labels['movedown'] = 'Nach unten';
+$labels['filterallof'] = 'UND (alle Regeln müssen zutreffen)';
+$labels['filteranyof'] = 'ODER (eine der Regeln muss zutreffen';
+$labels['filterany'] = 'Für alle Nachrichten';
+$labels['filtercontains'] = 'enthält';
+$labels['filternotcontains'] = 'enthält nicht';
+$labels['filteris'] = 'ist gleich';
+$labels['filterisnot'] = 'ist ungleich';
+$labels['filterexists'] = 'ist vorhanden';
+$labels['filternotexists'] = 'nicht vorhanden';
+$labels['filterunder'] = 'unter';
+$labels['filterover'] = 'über';
+$labels['addrule'] = 'Regel hinzufügen';
+$labels['delrule'] = 'Regel löschen';
+$labels['messagemoveto'] = 'Verschiebe Nachricht nach';
+$labels['messageredirect'] = 'Leite Nachricht um nach';
+$labels['messagereply'] = 'Antworte mit Nachricht';
+$labels['messagedelete'] = 'Nachricht löschen';
+$labels['messagediscard'] = 'Discard with message';
+$labels['messagesrules'] = 'Für eingehende Nachrichten:';
+$labels['messagesactions'] = 'Führe folgende Aktionen aus:';
+$labels['add'] = 'Hinzufügen';
+$labels['del'] = 'Löschen';
+$labels['sender'] = 'Absender';
+$labels['recipient'] = 'Empfänger';
+$labels['vacationaddresses'] = 'Zusätzliche Liste von Empfängern (Komma getrennt):';
+$labels['vacationdays'] = 'Antwort wird erneut gesendet nach (in Tagen):';
+$labels['vacationreason'] = 'Inhalt der Nachricht (Abwesenheitsgrund):';
+$labels['rulestop'] = 'Regelauswertung anhalten';
+
+$messages['filterunknownerror'] = 'Unbekannter Serverfehler';
+$messages['filterconnerror'] = 'Kann nicht zum Sieve-Server verbinden';
+$messages['filterdeleteerror'] = 'Fehler beim des löschen Filters. Serverfehler';
+$messages['filterdeleted'] = 'Filter erfolgreich gelöscht';
+$messages['filterdeleteconfirm'] = 'Möchten Sie den Filter löschen ?';
+$messages['filtersaved'] = 'Filter gespeichert';
+$messages['filtersaveerror'] = 'Serverfehler, konnte den Filter nicht speichern.';
+$messages['ruledeleteconfirm'] = 'Sicher, dass Sie die Regel löschen wollen?';
+$messages['actiondeleteconfirm'] = 'Sicher, dass Sie die ausgewaehlte Aktion löschen wollen?';
+$messages['forbiddenchars'] = 'Unerlaubte Zeichen im Feld';
+$messages['cannotbeempty'] = 'Feld darf nicht leer sein';
+
+?>
diff --git a/plugins/managesieve/localization/de_DE.inc b/plugins/managesieve/localization/de_DE.inc
new file mode 100644
index 000000000..e71d7e00d
--- /dev/null
+++ b/plugins/managesieve/localization/de_DE.inc
@@ -0,0 +1,92 @@
+<?php
+
+$labels['filters'] = 'Filter';
+$labels['managefilters'] = 'Posteingangs-Filter verwalten';
+$labels['filtername'] = 'Filtername';
+$labels['newfilter'] = 'Filter anlegen';
+$labels['filteradd'] = 'Filter hinzufügen';
+$labels['filterdel'] = 'Filter löschen';
+$labels['moveup'] = 'Nach oben';
+$labels['movedown'] = 'Nach unten';
+$labels['filterallof'] = 'trifft auf alle folgenden Regeln zu';
+$labels['filteranyof'] = 'trifft auf eine der folgenden Regeln zu';
+$labels['filterany'] = 'alle Nachrichten';
+$labels['filtercontains'] = 'enthält';
+$labels['filternotcontains'] = 'enthält nicht';
+$labels['filteris'] = 'ist gleich';
+$labels['filterisnot'] = 'ist ungleich';
+$labels['filterexists'] = 'existiert';
+$labels['filternotexists'] = 'existiert nicht';
+$labels['filterunder'] = 'unter';
+$labels['filterover'] = 'über';
+$labels['addrule'] = 'Regel hinzufügen';
+$labels['delrule'] = 'Regel löschen';
+$labels['messagemoveto'] = 'Verschiebe Nachricht nach';
+$labels['messageredirect'] = 'Leite Nachricht um an';
+$labels['messagecopyto'] = 'Kopiere Nachricht nach';
+$labels['messagesendcopy'] = 'Sende Kopie an';
+$labels['messagereply'] = 'Antworte mit Nachricht';
+$labels['messagedelete'] = 'Lösche Nachricht';
+$labels['messagediscard'] = 'Weise ab mit Nachricht';
+$labels['messagesrules'] = 'Für eingehende Nachrichten:';
+$labels['messagesactions'] = '...führende folgende Aktionen aus:';
+$labels['add'] = 'Hinzufügen';
+$labels['del'] = 'Löschen';
+$labels['sender'] = 'Absender';
+$labels['recipient'] = 'Empfänger';
+$labels['vacationaddresses'] = 'Zusätzliche Liste von E-Mail Empfängern (Komma getrennt):';
+$labels['vacationdays'] = 'Wie oft sollen Nachrichten gesendet werden (in Tagen):';
+$labels['vacationreason'] = 'Nachrichteninhalt (Abwesenheitsgrund):';
+$labels['rulestop'] = 'Regelauswertung anhalten';
+$labels['filterset'] = 'Filtersätze';
+$labels['filtersetadd'] = 'Filtersatz anlegen';
+$labels['filtersetdel'] = 'Aktuellen Filtersatz löschen';
+$labels['filtersetact'] = 'Aktuellen Filtersatz aktivieren';
+$labels['filtersetdeact'] = 'Aktuellen Filtersatz deaktivieren';
+$labels['filtersetget'] = 'Filtersatz im Textformat herunterladen';
+$labels['filterdef'] = 'Filterdefinition';
+$labels['filtersetname'] = 'Filtersatzname';
+$labels['newfilterset'] = 'Neuer Filtersatz';
+$labels['active'] = 'aktiv';
+$labels['none'] = 'keine';
+$labels['fromset'] = 'aus Filtersatz';
+$labels['fromfile'] = 'aus Datei';
+$labels['filterdisabled'] = 'Filter deaktiviert';
+$labels['countisgreaterthan'] = 'Anzahl ist größer als';
+$labels['countisgreaterthanequal'] = 'Anzahl ist gleich oder größer als';
+$labels['countislessthan'] = 'Anzahl ist kleiner als';
+$labels['countislessthanequal'] = 'Anzahl ist gleich oder kleiner als';
+$labels['countequals'] = 'Anzahl ist gleich';
+$labels['countnotequals'] = 'Anzahl ist ungleich';
+$labels['valueisgreaterthan'] = 'Wert ist größer als';
+$labels['valueisgreaterthanequal'] = 'Wert ist gleich oder größer als';
+$labels['valueislessthan'] = 'Wert ist kleiner';
+$labels['valueislessthanequal'] = 'Wert ist gleich oder kleiner als';
+$labels['valueequals'] = 'Wert ist gleich';
+$labels['valuenotequals'] = 'Wert ist ungleich';
+
+$messages = array();
+$messages['filterunknownerror'] = 'Unbekannter Serverfehler';
+$messages['filterconnerror'] = 'Kann keine Verbindung mit Managesieve-Server herstellen';
+$messages['filterdeleteerror'] = 'Fehler beim Löschen des Filters. Serverfehler';
+$messages['filterdeleted'] = 'Filter erfolgreich gelöscht';
+$messages['filtersaved'] = 'Filter erfolgreich gespeichert';
+$messages['filtersaveerror'] = 'Fehler beim Speichern des Filters. Serverfehler';
+$messages['filterdeleteconfirm'] = 'Möchten Sie den ausgewählten Filter wirklich löschen?';
+$messages['ruledeleteconfirm'] = 'Sind Sie sicher, dass Sie die ausgewählte Regel löschen möchten?';
+$messages['actiondeleteconfirm'] = 'Sind Sie sicher, dass Sie die ausgewählte Aktion löschen möchten?';
+$messages['forbiddenchars'] = 'Unzulässige Zeichen im Eingabefeld';
+$messages['cannotbeempty'] = 'Eingabefeld darf nicht leer sein';
+$messages['setactivateerror'] = 'Kann ausgewählten Filtersatz nicht aktivieren. Serverfehler';
+$messages['setdeactivateerror'] = 'Kann ausgewählten Filtersatz nicht deaktivieren. Serverfehler';
+$messages['setdeleteerror'] = 'Kann ausgewählten Filtersatz nicht löschen. Serverfehler';
+$messages['setactivated'] = 'Filtersatz wurde erfolgreich aktiviert';
+$messages['setdeactivated'] = 'Filtersatz wurde erfolgreich deaktiviert';
+$messages['setdeleted'] = 'Filtersatz wurde erfolgreich gelöscht';
+$messages['setdeleteconfirm'] = 'Sind Sie sicher, dass Sie den ausgewählten Filtersatz löschen möchten?';
+$messages['setcreateerror'] = 'Kann Filtersatz nicht erstellen. Serverfehler';
+$messages['setcreated'] = 'Filtersatz wurde erfolgreich erstellt';
+$messages['emptyname'] = 'Kann Filtersatz nicht erstellen. Kein Name vergeben';
+$messages['nametoolong'] = 'Kann Filtersatz nicht erstellen. Name zu lang'
+
+?>
diff --git a/plugins/managesieve/localization/el_GR.inc b/plugins/managesieve/localization/el_GR.inc
new file mode 100644
index 000000000..a1a5eeca3
--- /dev/null
+++ b/plugins/managesieve/localization/el_GR.inc
@@ -0,0 +1,56 @@
+<?php
+
+// Antonis Kanouras (2009-10-22)
+
+$labels = array();
+$labels['filters'] = 'Φίλτρα';
+$labels['managefilters'] = 'Διαχείριση φίλτρων εισερχόμενων';
+$labels['filtername'] = 'Ονομασία φίλτρου';
+$labels['newfilter'] = 'Δημιουργία φίλτρου';
+$labels['filteradd'] = 'Προσθήκη φίλτρου';
+$labels['filterdel'] = 'Διαγραφή φίλτρου';
+$labels['moveup'] = 'Μετακίνηση πάνω';
+$labels['movedown'] = 'Μετακίνηση κάτω';
+$labels['filterallof'] = 'ταιριάζουν με όλους τους παρακάτω κανόνες';
+$labels['filteranyof'] = 'ταιριάζουν με οποιονδήποτε από τους παρακάτω κανόνες';
+$labels['filterany'] = 'όλα τα μηνύματα';
+$labels['filtercontains'] = 'περιέχει';
+$labels['filternotcontains'] = 'δεν περιέχει';
+$labels['filteris'] = 'είναι ίσο με';
+$labels['filterisnot'] = 'δεν είναι ίσο με';
+$labels['filterexists'] = 'υπάρχει';
+$labels['filternotexists'] = 'δεν υπάρχει';
+$labels['filterunder'] = 'κάτω';
+$labels['filterover'] = 'πάνω';
+$labels['addrule'] = 'Προσθήκη κανόνα';
+$labels['delrule'] = 'Διαγραφή κανόνα';
+$labels['messagemoveto'] = 'Μετακίνηση μηνύματος στο';
+$labels['messageredirect'] = 'Προώθηση μηνύματος στο';
+$labels['messagereply'] = 'Απάντηση με μήνυμα';
+$labels['messagedelete'] = 'Διαγραφή μηνύματος';
+$labels['messagediscard'] = 'Απόρριψη με μήνυμα';
+$labels['messagesrules'] = 'Για εισερχόμενα μηνύματα που:';
+$labels['messagesactions'] = '...εκτέλεση των παρακάτω ενεργειών:';
+$labels['add'] = 'Προσθήκη';
+$labels['del'] = 'Διαγραφή';
+$labels['sender'] = 'Αποστολέας';
+$labels['recipient'] = 'Παραλήπτης';
+$labels['vacationaddresses'] = 'Πρόσθετη λίστα email παραληπτών (διαχωρισμένη με κόμματα):';
+$labels['vacationdays'] = 'Συχνότητα αποστολής μηνυμάτων (σε ημέρες):';
+$labels['vacationreason'] = 'Σώμα μηνύματος (λόγος απουσίας):';
+$labels['rulestop'] = 'Παύση επαλήθευσης κανόνων';
+
+$messages = array();
+$messages['filterunknownerror'] = 'Άγνωστο σφάλμα διακομιστή';
+$messages['filterconnerror'] = 'Αδυναμία σύνδεσης στον διακομιστή managesieve';
+$messages['filterdeleteerror'] = 'Αδυναμία διαγραφής φίλτρου. Προέκυψε σφάλμα στον διακομιστή';
+$messages['filterdeleted'] = 'Το φίλτρο διαγράφηκε επιτυχώς';
+$messages['filterconfirmdelete'] = 'Θέλετε όντως να διαγράψετε το επιλεγμένο φίλτρο;';
+$messages['filtersaved'] = 'Το φίλτρο αποθηκεύτηκε επιτυχώς';
+$messages['filtersaveerror'] = 'Αδυναμία αποθήκευσης φίλτρου. Προέκυψε σφάλμα στον διακομιστή';
+$messages['ruledeleteconfirm'] = 'Θέλετε όντως να διαγράψετε τον επιλεγμένο κανόνα;';
+$messages['actiondeleteconfirm'] = 'Θέλετε όντως να διαγράψετε την επιλεγμένη ενέργεια;';
+$messages['forbiddenchars'] = 'Μη επιτρεπτοί χαρακτήρες στο πεδίο';
+$messages['cannotbeempty'] = 'Το πεδίο δεν μπορεί να είναι κενό';
+
+?>
diff --git a/plugins/managesieve/localization/en_GB.inc b/plugins/managesieve/localization/en_GB.inc
new file mode 100644
index 000000000..c62979cc5
--- /dev/null
+++ b/plugins/managesieve/localization/en_GB.inc
@@ -0,0 +1,53 @@
+<?php
+
+$labels['filters'] = 'Filters';
+$labels['managefilters'] = 'Manage incoming mail filters';
+$labels['filtername'] = 'Filter name';
+$labels['newfilter'] = 'New filter';
+$labels['filteradd'] = 'Add filter';
+$labels['filterdel'] = 'Delete filter';
+$labels['moveup'] = 'Move up';
+$labels['movedown'] = 'Move down';
+$labels['filterallof'] = 'matching all of the following rules';
+$labels['filteranyof'] = 'matching any of the following rules';
+$labels['filterany'] = 'all messages';
+$labels['filtercontains'] = 'contains';
+$labels['filternotcontains'] = 'not contains';
+$labels['filteris'] = 'is equal to';
+$labels['filterisnot'] = 'is not equal to';
+$labels['filterexists'] = 'exists';
+$labels['filternotexists'] = 'not exists';
+$labels['filterunder'] = 'under';
+$labels['filterover'] = 'over';
+$labels['addrule'] = 'Add rule';
+$labels['delrule'] = 'Delete rule';
+$labels['messagemoveto'] = 'Move message to';
+$labels['messageredirect'] = 'Redirect message to';
+$labels['messagereply'] = 'Reply with message';
+$labels['messagedelete'] = 'Delete message';
+$labels['messagediscard'] = 'Discard with message';
+$labels['messagesrules'] = 'For incoming mail:';
+$labels['messagesactions'] = '...execute the following actions:';
+$labels['add'] = 'Add';
+$labels['del'] = 'Delete';
+$labels['sender'] = 'Sender';
+$labels['recipient'] = 'Recipient';
+$labels['vacationaddresses'] = 'Additional list of recipient e-mails (comma separated):';
+$labels['vacationdays'] = 'How often send messages (in days):';
+$labels['vacationreason'] = 'Message body (vacation reason):';
+$labels['rulestop'] = 'Stop evaluating rules';
+
+$messages = array();
+$messages['filterunknownerror'] = 'Unknown server error';
+$messages['filterconnerror'] = 'Unable to connect to managesieve server';
+$messages['filterdeleteerror'] = 'Unable to delete filter. Server error occured';
+$messages['filterdeleted'] = 'Filter deleted successfully';
+$messages['filterdeleteconfirm'] = 'Do you really want to delete selected filter?';
+$messages['filtersaved'] = 'Filter saved successfully';
+$messages['filtersaveerror'] = 'Unable to save filter. Server error occured.';
+$messages['ruledeleteconfirm'] = 'Are you sure, you want to delete selected rule?';
+$messages['actiondeleteconfirm'] = 'Are you sure, you want to delete selected action?';
+$messages['forbiddenchars'] = 'Forbidden characters in field';
+$messages['cannotbeempty'] = 'Field cannot be empty';
+
+?>
diff --git a/plugins/managesieve/localization/en_US.inc b/plugins/managesieve/localization/en_US.inc
new file mode 100644
index 000000000..f08357ed9
--- /dev/null
+++ b/plugins/managesieve/localization/en_US.inc
@@ -0,0 +1,105 @@
+<?php
+
+$labels['filters'] = 'Filters';
+$labels['managefilters'] = 'Manage incoming mail filters';
+$labels['filtername'] = 'Filter name';
+$labels['newfilter'] = 'New filter';
+$labels['filteradd'] = 'Add filter';
+$labels['filterdel'] = 'Delete filter';
+$labels['moveup'] = 'Move up';
+$labels['movedown'] = 'Move down';
+$labels['filterallof'] = 'matching all of the following rules';
+$labels['filteranyof'] = 'matching any of the following rules';
+$labels['filterany'] = 'all messages';
+$labels['filtercontains'] = 'contains';
+$labels['filternotcontains'] = 'not contains';
+$labels['filteris'] = 'is equal to';
+$labels['filterisnot'] = 'is not equal to';
+$labels['filterexists'] = 'exists';
+$labels['filternotexists'] = 'not exists';
+$labels['filtermatches'] = 'matches expression';
+$labels['filternotmatches'] = 'not matches expression';
+$labels['filterregex'] = 'matches regular expression';
+$labels['filternotregex'] = 'not matches regular expression';
+$labels['filterunder'] = 'under';
+$labels['filterover'] = 'over';
+$labels['addrule'] = 'Add rule';
+$labels['delrule'] = 'Delete rule';
+$labels['messagemoveto'] = 'Move message to';
+$labels['messageredirect'] = 'Redirect message to';
+$labels['messagecopyto'] = 'Copy message to';
+$labels['messagesendcopy'] = 'Send message copy to';
+$labels['messagereply'] = 'Reply with message';
+$labels['messagedelete'] = 'Delete message';
+$labels['messagediscard'] = 'Discard with message';
+$labels['messagesrules'] = 'For incoming mail:';
+$labels['messagesactions'] = '...execute the following actions:';
+$labels['add'] = 'Add';
+$labels['del'] = 'Delete';
+$labels['sender'] = 'Sender';
+$labels['recipient'] = 'Recipient';
+$labels['vacationaddresses'] = 'Additional list of recipient e-mails (comma separated):';
+$labels['vacationdays'] = 'How often send messages (in days):';
+$labels['vacationreason'] = 'Message body (vacation reason):';
+$labels['vacationsubject'] = 'Message subject:';
+$labels['rulestop'] = 'Stop evaluating rules';
+$labels['filterset'] = 'Filters set';
+$labels['filtersetadd'] = 'Add filters set';
+$labels['filtersetdel'] = 'Delete current filters set';
+$labels['filtersetact'] = 'Activate current filters set';
+$labels['filtersetdeact'] = 'Deactivate current filters set';
+$labels['filtersetget'] = 'Download filters set in text format';
+$labels['filterdef'] = 'Filter definition';
+$labels['filtersetname'] = 'Filters set name';
+$labels['newfilterset'] = 'New filters set';
+$labels['active'] = 'active';
+$labels['none'] = 'none';
+$labels['fromset'] = 'from set';
+$labels['fromfile'] = 'from file';
+$labels['filterdisabled'] = 'Filter disabled';
+$labels['countisgreaterthan'] = 'count is greater than';
+$labels['countisgreaterthanequal'] = 'count is greater than or equal to';
+$labels['countislessthan'] = 'count is less than';
+$labels['countislessthanequal'] = 'count is less than or equal to';
+$labels['countequals'] = 'count is equal to';
+$labels['countnotequals'] = 'count does not equal';
+$labels['valueisgreaterthan'] = 'value is greater than';
+$labels['valueisgreaterthanequal'] = 'value is greater than or equal to';
+$labels['valueislessthan'] = 'value is less than';
+$labels['valueislessthanequal'] = 'value is less than or equal to';
+$labels['valueequals'] = 'value is equal to';
+$labels['valuenotequals'] = 'value does not equal';
+$labels['setflags'] = 'Set flags to the message';
+$labels['addflags'] = 'Add flags to the message';
+$labels['removeflags'] = 'Remove flags from the message';
+$labels['flagread'] = 'Read';
+$labels['flagdeleted'] = 'Deleted';
+$labels['flaganswered'] = 'Answered';
+$labels['flagflagged'] = 'Flagged';
+$labels['flagdraft'] = 'Draft';
+
+$messages = array();
+$messages['filterunknownerror'] = 'Unknown server error';
+$messages['filterconnerror'] = 'Unable to connect to managesieve server';
+$messages['filterdeleteerror'] = 'Unable to delete filter. Server error occured';
+$messages['filterdeleted'] = 'Filter deleted successfully';
+$messages['filtersaved'] = 'Filter saved successfully';
+$messages['filtersaveerror'] = 'Unable to save filter. Server error occured';
+$messages['filterdeleteconfirm'] = 'Do you really want to delete selected filter?';
+$messages['ruledeleteconfirm'] = 'Are you sure, you want to delete selected rule?';
+$messages['actiondeleteconfirm'] = 'Are you sure, you want to delete selected action?';
+$messages['forbiddenchars'] = 'Forbidden characters in field';
+$messages['cannotbeempty'] = 'Field cannot be empty';
+$messages['setactivateerror'] = 'Unable to activate selected filters set. Server error occured';
+$messages['setdeactivateerror'] = 'Unable to deactivate selected filters set. Server error occured';
+$messages['setdeleteerror'] = 'Unable to delete selected filters set. Server error occured';
+$messages['setactivated'] = 'Filters set activated successfully';
+$messages['setdeactivated'] = 'Filters set deactivated successfully';
+$messages['setdeleted'] = 'Filters set deleted successfully';
+$messages['setdeleteconfirm'] = 'Are you sure, you want to delete selected filters set?';
+$messages['setcreateerror'] = 'Unable to create filters set. Server error occured';
+$messages['setcreated'] = 'Filters set created successfully';
+$messages['emptyname'] = 'Unable to create filters set. Empty set name';
+$messages['nametoolong'] = 'Unable to create filters set. Name too long'
+
+?>
diff --git a/plugins/managesieve/localization/es_AR.inc b/plugins/managesieve/localization/es_AR.inc
new file mode 100644
index 000000000..93fd1e9f4
--- /dev/null
+++ b/plugins/managesieve/localization/es_AR.inc
@@ -0,0 +1,81 @@
+<?php
+
+$labels = array();
+$labels['filters'] = 'Filtros';
+$labels['managefilters'] = 'Administrar filtros de correo entrante';
+$labels['filtername'] = 'Nombre del filtro';
+$labels['newfilter'] = 'Nuevo filtro';
+$labels['filteradd'] = 'Agregar filtro';
+$labels['filterdel'] = 'Eliminar filtro';
+$labels['moveup'] = 'Mover arriba';
+$labels['movedown'] = 'Mover abajo';
+$labels['filterallof'] = 'coinidir con todas las reglas siguientes';
+$labels['filteranyof'] = 'coincidir con alguna de las reglas siguientes';
+$labels['filterany'] = 'todos los mensajes';
+$labels['filtercontains'] = 'contiene';
+$labels['filternotcontains'] = 'no contiene';
+$labels['filteris'] = 'es igual a';
+$labels['filterisnot'] = 'no es igual a';
+$labels['filterexists'] = 'existe';
+$labels['filternotexists'] = 'no existe';
+$labels['filterunder'] = 'bajo';
+$labels['filterover'] = 'sobre';
+$labels['addrule'] = 'Agregar regla';
+$labels['delrule'] = 'Eliminar regla';
+$labels['messagemoveto'] = 'Mover mensaje a';
+$labels['messageredirect'] = 'Redirigir mensaje a';
+$labels['messagecopyto'] = 'Copiar mensaje a';
+$labels['messagesendcopy'] = 'Enviar copia del mensaje a';
+$labels['messagereply'] = 'Responder con un mensaje';
+$labels['messagedelete'] = 'Eliminar mensaje';
+$labels['messagediscard'] = 'Descartar con un mensaje';
+$labels['messagesrules'] = 'Para el correo entrante:';
+$labels['messagesactions'] = '... ejecutar las siguientes acciones:';
+$labels['add'] = 'Agregar';
+$labels['del'] = 'Eliminar';
+$labels['sender'] = 'Remitente';
+$labels['recipient'] = 'Destinatario';
+$labels['vacationaddresses'] = 'Lista de direcciones de correo de destinatarios adicionales (separados por comas):';
+$labels['vacationdays'] = 'Cada cuanto enviar mensajes (en días):';
+$labels['vacationreason'] = 'Cuerpo del mensaje (razón de vacaciones):';
+$labels['rulestop'] = 'Parar de evaluar reglas';
+$labels['filterset'] = 'Conjunto de filtros';
+$labels['filtersetadd'] = 'Agregar conjunto de filtros';
+$labels['filtersetdel'] = 'Eliminar conjunto de filtros';
+$labels['filtersetact'] = 'Activar conjunto de filtros';
+$labels['filtersetdeact'] = 'Deactivar conjunto de filtros';
+$labels['filtersetget'] = 'Descargar conjunto de filtros en archivo de texto';
+$labels['filterdef'] = 'Definicion del conjunto de filtros';
+$labels['filtersetname'] = 'Nombre del conjunto de filtros';
+$labels['newfilterset'] = 'Nuevo conjunto de filtros';
+$labels['active'] = 'Activar';
+$labels['none'] = 'none';
+$labels['fromset'] = 'desde conjunto';
+$labels['fromfile'] = 'desde archivo';
+$labels['filterdisabled'] = 'Filtro deshabilitado';
+
+$messages = array();
+$messages['filterunknownerror'] = 'Error desconocido de servidor';
+$messages['filterconnerror'] = 'Imposible conectar con el servidor managesieve';
+$messages['filterdeleteerror'] = 'Imposible borrar filtro. Ha ocurrido un error en el servidor';
+$messages['filterdeleted'] = 'Filtro borrado satisfactoriamente';
+$messages['filterdeleteconfirm'] = '¿Realmente desea borrar el filtro seleccionado?';
+$messages['filtersaved'] = 'Filtro guardado satisfactoriamente';
+$messages['filtersaveerror'] = 'Imposible guardar ell filtro. Ha ocurrido un error en el servidor';
+$messages['ruledeleteconfirm'] = '¿Está seguro de que desea borrar la regla seleccionada?';
+$messages['actiondeleteconfirm'] = '¿Está seguro de que desea borrar la acción seleccionada?';
+$messages['forbiddenchars'] = 'Caracteres prohibidos en el campo';
+$messages['cannotbeempty'] = 'El campo no puede estar vacío';
+$messages['setactivateerror'] = 'Imposible activar el conjunto de filtros. Error en el servidor.';
+$messages['setdeactivateerror'] = 'Imposible desactivar el conjunto de filtros. Error en el servidor.';
+$messages['setdeleteerror'] = 'Imposible eliminar el conjunto de filtros. Error en el servidor.';
+$messages['setactivated'] = 'Conjunto de filtros activados correctamente';
+$messages['setdeactivated'] = 'Conjunto de filtros desactivados correctamente';
+$messages['setdeleted'] = 'Conjunto de filtros eliminados correctamente';
+$messages['setdeleteconfirm'] = '¿Esta seguro, que quiere eliminar el conjunto de filtros seleccionado?';
+$messages['setcreateerror'] = 'Imposible crear el conjunto de filtros. Error en el servidor.';
+$messages['setcreated'] = 'Conjunto de filtros creados correctamente';
+$messages['emptyname'] = 'Imposible crear el conjunto de filtros. Nombre del conjunto de filtros vacio';
+$messages['nametoolong'] = 'Imposible crear el conjunto de filtros. Nombre del conjunto de filtros muy largo';
+
+?>
diff --git a/plugins/managesieve/localization/es_ES.inc b/plugins/managesieve/localization/es_ES.inc
new file mode 100644
index 000000000..1dad18d99
--- /dev/null
+++ b/plugins/managesieve/localization/es_ES.inc
@@ -0,0 +1,81 @@
+<?php
+
+$labels = array();
+$labels['filters'] = 'Filtros';
+$labels['managefilters'] = 'Administrar filtros de correo entrante';
+$labels['filtername'] = 'Nombre del filtro';
+$labels['newfilter'] = 'Nuevo filtro';
+$labels['filteradd'] = 'Agregar filtro';
+$labels['filterdel'] = 'Eliminar filtro';
+$labels['moveup'] = 'Mover arriba';
+$labels['movedown'] = 'Mover abajo';
+$labels['filterallof'] = 'coincidir con todas las reglas siguientes';
+$labels['filteranyof'] = 'coincidir con alguna de las reglas siguientes';
+$labels['filterany'] = 'todos los mensajes';
+$labels['filtercontains'] = 'contiene';
+$labels['filternotcontains'] = 'no contiene';
+$labels['filteris'] = 'es igual a';
+$labels['filterisnot'] = 'no es igual a';
+$labels['filterexists'] = 'existe';
+$labels['filternotexists'] = 'no existe';
+$labels['filterunder'] = 'bajo';
+$labels['filterover'] = 'sobre';
+$labels['addrule'] = 'Agregar regla';
+$labels['delrule'] = 'Eliminar regla';
+$labels['messagemoveto'] = 'Mover mensaje a';
+$labels['messageredirect'] = 'Redirigir mensaje a';
+$labels['messagecopyto'] = 'Copiar mensaje a';
+$labels['messagesendcopy'] = 'Enviar copia del mensaje a';
+$labels['messagereply'] = 'Responder con un mensaje';
+$labels['messagedelete'] = 'Eliminar mensaje';
+$labels['messagediscard'] = 'Descartar con un mensaje';
+$labels['messagesrules'] = 'Para el correo entrante:';
+$labels['messagesactions'] = '... ejecutar las siguientes acciones:';
+$labels['add'] = 'Agregar';
+$labels['del'] = 'Eliminar';
+$labels['sender'] = 'Remitente';
+$labels['recipient'] = 'Destinatario';
+$labels['vacationaddresses'] = 'Lista de direcciones de correo de destinatarios adicionales (separados por comas):';
+$labels['vacationdays'] = 'Cada cuanto enviar mensajes (en días):';
+$labels['vacationreason'] = 'Cuerpo del mensaje (razón de vacaciones):';
+$labels['rulestop'] = 'Parar de evaluar reglas';
+$labels['filterset'] = 'Conjunto de filtros';
+$labels['filtersetadd'] = 'Agregar conjunto de filtros';
+$labels['filtersetdel'] = 'Eliminar conjunto de filtros actual';
+$labels['filtersetact'] = 'Activar conjunto de filtros actual';
+$labels['filtersetdeact'] = 'Desactivar conjunto de filtros actual';
+$labels['filtersetget'] = 'Descargar conjunto de filtros en formato de texto';
+$labels['filterdef'] = 'Definición de filtros';
+$labels['filtersetname'] = 'Nombre del conjunto de filtros';
+$labels['newfilterset'] = 'Nuevo conjunto de filtros';
+$labels['active'] = 'activo';
+$labels['none'] = 'ninguno';
+$labels['fromset'] = 'de conjunto ';
+$labels['fromfile'] = 'de archivo';
+$labels['filterdisabled'] = 'Filtro desactivado';
+
+$messages = array();
+$messages['filterunknownerror'] = 'Error desconocido de servidor';
+$messages['filterconnerror'] = 'Imposible conectar con el servidor managesieve';
+$messages['filterdeleteerror'] = 'Imposible borrar filtro. Ha ocurrido un error en el servidor';
+$messages['filterdeleted'] = 'Filtro borrado satisfactoriamente';
+$messages['filtersaved'] = 'Filtro guardado satisfactoriamente';
+$messages['filtersaveerror'] = 'Imposible guardar el filtro. Ha ocurrido un error en el servidor';
+$messages['filterdeleteconfirm'] = '¿Realmente desea borrar el filtro seleccionado?';
+$messages['ruledeleteconfirm'] = '¿Está seguro de que desea borrar la regla seleccionada?';
+$messages['actiondeleteconfirm'] = '¿Está seguro de que desea borrar la acción seleccionada?';
+$messages['forbiddenchars'] = 'Caracteres prohibidos en el campo';
+$messages['cannotbeempty'] = 'El campo no puede estar vacío';
+$messages['setactivateerror'] = 'Imposible activar el conjunto de filtros seleccionado. Ha ocurrido un error en el servidor';
+$messages['setdeactivateerror'] = 'Imposible desactivar el conjunto de filtros seleccionado. Ha ocurrido un error en el servidor';
+$messages['setdeleteerror'] = 'Imposible borrar el conjunto de filtros seleccionado. Ha ocurrido un error en el servidor';
+$messages['setactivated'] = 'Conjunto de filtros activado satisfactoriamente';
+$messages['setdeactivated'] = 'Conjunto de filtros desactivado satisfactoriamente';
+$messages['setdeleted'] = 'Conjunto de filtros borrado satisfactoriamente';
+$messages['setdeleteconfirm'] = '¿Está seguro de que desea borrar el conjunto de filtros seleccionado?';
+$messages['setcreateerror'] = 'Imposible crear el conjunto de filtros. Ha ocurrido un error en el servidor';
+$messages['setcreated'] = 'Conjunto de filtros creado satisfactoriamente';
+$messages['emptyname'] = 'Imposible crear el conjunto de filtros. Sin nombre';
+$messages['nametoolong'] = 'Imposible crear el conjunto de filtros. Nombre demasiado largo'
+
+?>
diff --git a/plugins/managesieve/localization/et_EE.inc b/plugins/managesieve/localization/et_EE.inc
new file mode 100644
index 000000000..7f891883b
--- /dev/null
+++ b/plugins/managesieve/localization/et_EE.inc
@@ -0,0 +1,53 @@
+<?php
+
+$labels['filters'] = 'Filtrid';
+$labels['managefilters'] = 'Halda sisenevate kirjade filtreid';
+$labels['filtername'] = 'Filtri nimi';
+$labels['newfilter'] = 'Uus filter';
+$labels['filteradd'] = 'Lisa filter';
+$labels['filterdel'] = 'Kustuta filter';
+$labels['moveup'] = 'Liiguta üles';
+$labels['movedown'] = 'Liiguta alla';
+$labels['filterallof'] = 'vastab kõikidele järgnevatele reeglitele';
+$labels['filteranyof'] = 'vastab mõnele järgnevatest reeglitest';
+$labels['filterany'] = 'kõik kirjad';
+$labels['filtercontains'] = 'sisaldab';
+$labels['filternotcontains'] = 'ei sisalda';
+$labels['filteris'] = 'on võrdne kui';
+$labels['filterisnot'] = 'ei ole võrdne kui';
+$labels['filterexists'] = 'on olemas';
+$labels['filternotexists'] = 'pole olemas';
+$labels['filterunder'] = 'alt';
+$labels['filterover'] = 'üle';
+$labels['addrule'] = 'Lisa reegel';
+$labels['delrule'] = 'Kustuta reegel';
+$labels['messagemoveto'] = 'Liiguta kiri';
+$labels['messageredirect'] = 'Suuna kiri ümber';
+$labels['messagereply'] = 'Vasta kirjaga';
+$labels['messagedelete'] = 'Kustuta kiri';
+$labels['messagediscard'] = 'Viska ära teatega';
+$labels['messagesrules'] = 'Siseneva kirja puhul, mis:';
+$labels['messagesactions'] = '...käivita järgnevad tegevused:';
+$labels['add'] = 'Lisa';
+$labels['del'] = 'Kustuta';
+$labels['sender'] = 'Saatja';
+$labels['recipient'] = 'Saaja';
+$labels['vacationaddresses'] = 'Lisanimekiri saaja e-posti aadressidest (komadega eraldatud):';
+$labels['vacationdays'] = 'Kui tihti kirju saata (päevades):';
+$labels['vacationreason'] = 'Kirja sisu (puhkuse põhjus):';
+$labels['rulestop'] = 'Peata reeglite otsimine';
+
+$messages = array();
+$messages['filterunknownerror'] = 'Tundmatu serveri tõrge';
+$messages['filterconnerror'] = 'Managesieve serveriga ühendumine nurjus';
+$messages['filterdeleteerror'] = 'Filtri kustutamine nurjus. Ilmnes serveri tõrge.';
+$messages['filterdeleted'] = 'Filter edukalt kustutatud';
+$messages['filterdeleteconfirm'] = 'Soovid valitud filtri kustutada?';
+$messages['filtersaved'] = 'Filter edukalt salvestatud';
+$messages['filtersaveerror'] = 'Filtri salvestamine nurjus. Ilmnes serveri tõrge.';
+$messages['ruledeleteconfirm'] = 'Soovid valitud reegli kustutada?';
+$messages['actiondeleteconfirm'] = 'Soovid valitud tegevuse kustutada?';
+$messages['forbiddenchars'] = 'Väljal on lubamatu märk';
+$messages['cannotbeempty'] = 'Väli ei või tühi olla';
+
+?>
diff --git a/plugins/managesieve/localization/fi_FI.inc b/plugins/managesieve/localization/fi_FI.inc
new file mode 100644
index 000000000..70d3ccebb
--- /dev/null
+++ b/plugins/managesieve/localization/fi_FI.inc
@@ -0,0 +1,68 @@
+<?php
+
+$labels = array();
+$labels['filters'] = 'Suodattimet';
+$labels['managefilters'] = 'Muokkaa saapuvan sähköpostin suodattimia';
+$labels['filtername'] = 'Suodattimen nimi';
+$labels['newfilter'] = 'Uusi suodatin';
+$labels['filteradd'] = 'Lisää suodatin';
+$labels['filterdel'] = 'Poista suodatin';
+$labels['moveup'] = 'Siirrä ylös';
+$labels['movedown'] = 'Siirrä alas';
+$labels['filterallof'] = 'Täsmää kaikkien sääntöjen mukaan';
+$labels['filteranyof'] = 'Täsmää minkä tahansa sääntöjen mukaan';
+$labels['filterany'] = 'Kaikki viestit';
+$labels['filtercontains'] = 'Sisältää';
+$labels['filternotcontains'] = 'Ei Sisällä';
+$labels['filteris'] = 'on samanlainen kuin';
+$labels['filterisnot'] = 'ei ole samanlainen kuin';
+$labels['filterexists'] = 'on olemassa';
+$labels['filternotexists'] = 'ei ole olemassa';
+$labels['filterunder'] = 'alla';
+$labels['filterover'] = 'yli';
+$labels['addrule'] = 'Lisää sääntö';
+$labels['delrule'] = 'Poista sääntö';
+$labels['messagemoveto'] = 'Siirrä viesti';
+$labels['messageredirect'] = 'Uudelleen ohjaa viesti';
+$labels['messagereply'] = 'Vastaa viestin kanssa';
+$labels['messagedelete'] = 'Poista viesti';
+$labels['messagediscard'] = 'Hylkää viesti';
+$labels['messagesrules'] = 'Saapuva sähköposti';
+$labels['messagesactions'] = 'Suorita seuraavat tapahtumat';
+$labels['add'] = 'Lisää';
+$labels['del'] = 'Poista';
+$labels['sender'] = 'Lähettäjä';
+$labels['recipient'] = 'Vastaanottaja';
+$labels['vacationaddresses'] = 'Lähetä viesti myös seuraaviin osotteisiin (erottele pilkulla):';
+$labels['vacationdays'] = 'Kuinka monen päivän välein lähetetään uusi vastaus:';
+$labels['vacationreason'] = 'Viesti:';
+$labels['rulestop'] = 'Viimeinen sääntö';
+$labels['filterset'] = 'Suodatinlista';
+$labels['filtersetadd'] = 'Lisää suodatinlista';
+$labels['filtersetdel'] = 'Poista valittu suodatinlista';
+$labels['filtersetact'] = 'Aktivoi valittu suodatinlista';
+$labels['filtersetget'] = 'Lataa valittu suodatinlista tekstimuodossa';
+$labels['filterdef'] = 'Suodatinmääritykset';
+$labels['filtersetname'] = 'Suodatinlistan nimi';
+$labels['newfilterset'] = 'Uusi suodatinlista';
+$labels['active'] = 'aktiivinen';
+$labels['none'] = 'ei mitään';
+$labels['fromset'] = 'listasta';
+$labels['fromfile'] = 'tiedostosta';
+$labels['filterdisabled'] = 'Suodatin on poistettu käytöstä';
+
+$messages = array();
+$messages['filterunknownerror'] = 'Tuntematon palvelin virhe';
+$messages['filterconnerror'] = 'Yhdistäminen palvelimeen epäonnistui';
+$messages['filterdeleteerror'] = 'Suodattimen poistaminen epäonnistui. Palvelin virhe';
+$messages['filterdeleted'] = 'Suodatin poistettu';
+$messages['filterdeleteconfirm'] = 'Haluatko varmasti poistaa valitut suodattimet?';
+$messages['filtersaved'] = 'Suodatin tallennettu';
+$messages['filtersaveerror'] = 'Suodattimen tallennus epäonnistui. Palvelin virhe';
+$messages['ruledeleteconfirm'] = 'Haluatko poistaa valitut säännöt?';
+$messages['actiondeleteconfirm'] = 'Haluatko poistaa valitut tapahtumat?';
+$messages['forbiddenchars'] = 'Sisältää kiellettyjä kirjaimia';
+$messages['cannotbeempty'] = 'Kenttä ei voi olla tyhjä';
+
+
+?>
diff --git a/plugins/managesieve/localization/fr_FR.inc b/plugins/managesieve/localization/fr_FR.inc
new file mode 100644
index 000000000..a2a83c21c
--- /dev/null
+++ b/plugins/managesieve/localization/fr_FR.inc
@@ -0,0 +1,63 @@
+<?php
+
+$labels['filters'] = 'Filtres';
+$labels['managefilters'] = 'Gestion des filtres sur les mails entrants';
+$labels['filtername'] = 'Nom du filtre';
+$labels['newfilter'] = 'Nouveau filtre';
+$labels['filteradd'] = 'Ajouter un filtre';
+$labels['filterdel'] = 'Supprimer un filtre';
+$labels['moveup'] = 'Monter';
+$labels['movedown'] = 'Descendre';
+$labels['filterallof'] = 'valident toutes les conditions suivantes';
+$labels['filteranyof'] = 'valident au moins une des conditions suivantes';
+$labels['filterany'] = 'tous les messages';
+$labels['filtercontains'] = 'contient';
+$labels['filternotcontains'] = 'ne contient pas';
+$labels['filteris'] = 'est ';
+$labels['filterisnot'] = 'n\'est pas';
+$labels['filterexists'] = 'existe';
+$labels['filternotexists'] = 'n\'existe pas';
+$labels['filterunder'] = 'est plus petit que';
+$labels['filterover'] = 'est plus grand que';
+$labels['addrule'] = 'Ajouter une règle';
+$labels['delrule'] = 'Supprimer une règle';
+$labels['messagemoveto'] = 'Déplacer le message vers';
+$labels['messageredirect'] = 'Transférer le message à';
+$labels['messagereply'] = 'Répondre avec le message';
+$labels['messagedelete'] = 'Supprimer le message';
+$labels['messagediscard'] = 'Rejeter avec le message';
+$labels['messagecopyto'] = 'Copier le message vers';
+$labels['messagesendcopy'] = 'Envoyer une copie du message à';
+$labels['messagesrules'] = 'Pour les mails entrants:';
+$labels['messagesactions'] = '...exécuter les actions suivantes:';
+$labels['add'] = 'Ajouter';
+$labels['del'] = 'Supprimer';
+$labels['sender'] = 'Expéditeur';
+$labels['recipient'] = 'Destinataire';
+$labels['vacationaddresses'] = 'Liste des destinataires (séparés par une virgule) :';
+$labels['vacationdays'] = 'Ne pas renvoyer un message avant (jours) :';
+$labels['vacationreason'] = 'Corps du message (raison de l\'absence) :';
+$labels['rulestop'] = 'Arrêter d\'évaluer les prochaines règles';
+$labels['setflags'] = 'Mettre les flags au message';
+$labels['addflags'] = 'Ajouter les flags au message';
+$labels['removeflags'] = 'Supprimer les flags du message';
+$labels['flagread'] = 'Lu';
+$labels['flagdeleted'] = 'Suprimé';
+$labels['flaganswered'] = 'répondu';
+$labels['flagflagged'] = 'Favori';
+$labels['flagdraft'] = 'Brouillon';
+
+$messages = array();
+$messages['filterunknownerror'] = 'Erreur du serveur inconnue';
+$messages['filterconnerror'] = 'Connexion au serveur Managesieve impossible';
+$messages['filterdeleteerror'] = 'Suppression du filtre impossible. Le serveur à produit une erreur';
+$messages['filterdeleted'] = 'Le filtre a bien été supprimé';
+$messages['filterdeleteconfirm'] = 'Voulez-vous vraiment supprimer le filtre sélectionné?';
+$messages['filtersaved'] = 'Le filtre a bien été enregistré';
+$messages['filtersaveerror'] = 'Enregistrement du filtre impossibe. Le serveur à produit une erreur';
+$messages['ruledeleteconfirm'] = 'Voulez-vous vraiment supprimer la règle sélectionnée?';
+$messages['actiondeleteconfirm'] = 'Voulez-vous vraiment supprimer l\'action sélectionnée?';
+$messages['forbiddenchars'] = 'Caractères interdits dans le champ';
+$messages['cannotbeempty'] = 'Le champ ne peut pas être vide';
+
+?>
diff --git a/plugins/managesieve/localization/gl_ES.inc b/plugins/managesieve/localization/gl_ES.inc
new file mode 100644
index 000000000..a03d9dec4
--- /dev/null
+++ b/plugins/managesieve/localization/gl_ES.inc
@@ -0,0 +1,81 @@
+<?php
+
+$labels = array();
+$labels['filters'] = 'Filtros';
+$labels['managefilters'] = 'Xestionar os filtros de correo entrante';
+$labels['filtername'] = 'Nome do filtro';
+$labels['newfilter'] = 'Novo filtro';
+$labels['filteradd'] = 'Engadir filtro';
+$labels['filterdel'] = 'Eliminar filtro';
+$labels['moveup'] = 'Mover arriba';
+$labels['movedown'] = 'Mover abaixo';
+$labels['filterallof'] = 'coincidir con tódalas regras siguientes';
+$labels['filteranyof'] = 'coincidir con algunha das regras seguintes';
+$labels['filterany'] = 'tódalas mensaxes';
+$labels['filtercontains'] = 'contén';
+$labels['filternotcontains'] = 'non contén';
+$labels['filteris'] = 'é igual a';
+$labels['filterisnot'] = 'non é igual a';
+$labels['filterexists'] = 'existe';
+$labels['filternotexists'] = 'non existe';
+$labels['filterunder'] = 'baixo';
+$labels['filterover'] = 'sobre';
+$labels['addrule'] = 'Engadir regra';
+$labels['delrule'] = 'Eliminar regra';
+$labels['messagemoveto'] = 'Mover a mensaxe a';
+$labels['messageredirect'] = 'Redirixir a mensaxe a';
+$labels['messagecopyto'] = 'Copiar a mensaxe a';
+$labels['messagesendcopy'] = 'Enviar copia da mensaxe a';
+$labels['messagereply'] = 'Respostar con unha mensaxe';
+$labels['messagedelete'] = 'Eliminar a mensaxe';
+$labels['messagediscard'] = 'Descartar con unha mensaxe';
+$labels['messagesrules'] = 'Para o correo entrante:';
+$labels['messagesactions'] = '... executar as seguintes accións:';
+$labels['add'] = 'Engadir';
+$labels['del'] = 'Eliminar';
+$labels['sender'] = 'Remitente';
+$labels['recipient'] = 'Destinatario';
+$labels['vacationaddresses'] = 'Lista de enderezos de correo de destinatarios adicionais (separados por comas):';
+$labels['vacationdays'] = 'Cada canto enviar mensaxes (en días):';
+$labels['vacationreason'] = 'Corpo da mensaxe (razón de vacacións):';
+$labels['rulestop'] = 'Parar de avaliar regras';
+$labels['filterset'] = 'Conxunto de filtros';
+$labels['filtersetadd'] = 'Engadir un conxunto de filtros';
+$labels['filtersetdel'] = 'Eliminar o conxunto de filtros actual';
+$labels['filtersetact'] = 'Activar o conxunto de filtros actual';
+$labels['filtersetdeact'] = 'Desactivar o conxunto de filtros actual';
+$labels['filtersetget'] = 'Descargar o conxunto de filtros en formato de texto';
+$labels['filterdef'] = 'Definición de filtros';
+$labels['filtersetname'] = 'Nome do conxunto de filtros';
+$labels['newfilterset'] = 'Novo conxunto de filtros';
+$labels['active'] = 'activo';
+$labels['none'] = 'ningún';
+$labels['fromset'] = 'de conxunto ';
+$labels['fromfile'] = 'de arquivo';
+$labels['filterdisabled'] = 'Filtro desactivado';
+
+$messages = array();
+$messages['filterunknownerror'] = 'Erro descoñecido servidor';
+$messages['filterconnerror'] = 'Imposible conectar co servidor managesieve';
+$messages['filterdeleteerror'] = 'Imposible eliminar filtro. Ocurriu un erro no servidor';
+$messages['filterdeleted'] = 'Filtro borrado con éxito';
+$messages['filtersaved'] = 'Filtro gardado con éxito';
+$messages['filtersaveerror'] = 'Imposible gardar o filtro. Ocurriu un erro no servidor';
+$messages['filterdeleteconfirm'] = 'Realmente desexa eliminar o filtro seleccionado?';
+$messages['ruledeleteconfirm'] = 'Está seguro de que desexa eliminar a regra seleccionada?';
+$messages['actiondeleteconfirm'] = 'Está seguro de que desexa eliminar a acción seleccionada?';
+$messages['forbiddenchars'] = 'Caracteres non permitidos no campo';
+$messages['cannotbeempty'] = 'O campo non pode estar baleiro';
+$messages['setactivateerror'] = 'Imposible activar o conxunto de filtros seleccionado. Ocurriu un erro no servidor';
+$messages['setdeactivateerror'] = 'Imposible desactivar o conxunto de filtros seleccionado. Ocurriu un error no servidor';
+$messages['setdeleteerror'] = 'Imposible eliminar o conxunto de filtros seleccionado. Ocurriu un error no servidor';
+$messages['setactivated'] = 'O conxunto de filtros activouse con éxito';
+$messages['setdeactivated'] = 'O conxunto de filtros desactivouse con éxito';
+$messages['setdeleted'] = 'O Conxunto de filtros borrouse con éxito';
+$messages['setdeleteconfirm'] = 'Está seguro de que desexa eliminar o conxunto de filtros seleccionado?';
+$messages['setcreateerror'] = 'Imposible crear o conxunto de filtros. Ocurriu un error no servidor';
+$messages['setcreated'] = 'Conxunto de filtros creado con éxito';
+$messages['emptyname'] = 'Imposible crear o conxunto de filtros. Sen nome';
+$messages['nametoolong'] = 'Imposible crear o conxunto de filtros. O nome é longo de máis'
+
+?>
diff --git a/plugins/managesieve/localization/hr_HR.inc b/plugins/managesieve/localization/hr_HR.inc
new file mode 100644
index 000000000..3b8eb50b4
--- /dev/null
+++ b/plugins/managesieve/localization/hr_HR.inc
@@ -0,0 +1,105 @@
+<?php
+
+$labels['filters'] = 'Filteri';
+$labels['managefilters'] = 'Uredi filtere za pristiglu poštu';
+$labels['filtername'] = 'Naziv filtera';
+$labels['newfilter'] = 'Novi filter';
+$labels['filteradd'] = 'Dodaj filter';
+$labels['filterdel'] = 'Obriši filter';
+$labels['moveup'] = 'Pomakni gore';
+$labels['movedown'] = 'Pomakni dolje';
+$labels['filterallof'] = 'koje odgovaraju svim sljedećim pravilima';
+$labels['filteranyof'] = 'koje odgovaraju bilo kojem od sljedećih pravila';
+$labels['filterany'] = 'sve poruke';
+$labels['filtercontains'] = 'sadrži';
+$labels['filternotcontains'] = 'ne sadrži';
+$labels['filteris'] = 'jednako je';
+$labels['filterisnot'] = 'nije jednako';
+$labels['filterexists'] = 'postoji';
+$labels['filternotexists'] = 'ne postoji';
+$labels['filtermatches'] = 'odgovara izrazu';
+$labels['filternotmatches'] = 'ne odgovara izrazu';
+$labels['filterregex'] = 'odgovara regularnom izrazu';
+$labels['filternotregex'] = 'ne odgovara regularnom izrazu';
+$labels['filterunder'] = 'ispod';
+$labels['filterover'] = 'iznad';
+$labels['addrule'] = 'Dodaj pravilo';
+$labels['delrule'] = 'Obriši pravilo';
+$labels['messagemoveto'] = 'Premjesti poruku u';
+$labels['messageredirect'] = 'Preusmjeri poruku na';
+$labels['messagecopyto'] = 'Kopiraju poruku u';
+$labels['messagesendcopy'] = 'Pošalji kopiju poruke na';
+$labels['messagereply'] = 'Odgovori sa porukom';
+$labels['messagedelete'] = 'Obriši poruku';
+$labels['messagediscard'] = 'Otkaži sa porukom';
+$labels['messagesrules'] = 'Za pristigle poruke:';
+$labels['messagesactions'] = '...primijeni sljedeće akcije:';
+$labels['add'] = 'Dodaj';
+$labels['del'] = 'Obriši';
+$labels['sender'] = 'Pošiljatelj';
+$labels['recipient'] = 'Primatelj';
+$labels['vacationaddresses'] = 'Dodatna lista primatelja (odvojenih zarezom):';
+$labels['vacationdays'] = 'Koliko često slati poruku (u danima):';
+$labels['vacationreason'] = 'Tijelo poruke (razlog odmora):';
+$labels['vacationsubject'] = 'Naslov poruke:';
+$labels['rulestop'] = 'Prekini izvođenje filtera';
+$labels['filterset'] = 'Grupa filtera';
+$labels['filtersetadd'] = 'Dodaj grupu filtera';
+$labels['filtersetdel'] = 'Obriši odabranu grupu filtera';
+$labels['filtersetact'] = 'Aktiviraj odabranu grupu filtera';
+$labels['filtersetdeact'] = 'Deaktiviraj odabranu grupu filtera';
+$labels['filtersetget'] = 'Preuzmi grupu filtera u tekstualnom formatu';
+$labels['filterdef'] = 'Definicije filtera';
+$labels['filtersetname'] = 'Naziv grupe filtera';
+$labels['newfilterset'] = 'Nova grupa filtera';
+$labels['active'] = 'aktivan';
+$labels['none'] = 'nijedan';
+$labels['fromset'] = 'iz grupe';
+$labels['fromfile'] = 'iz datoteke';
+$labels['filterdisabled'] = 'Deaktiviraj filter';
+$labels['countisgreaterthan'] = 'brojač je veći od';
+$labels['countisgreaterthanequal'] = 'brojač je veći ili jednak od';
+$labels['countislessthan'] = 'brojač je manji od';
+$labels['countislessthanequal'] = 'brojač je manji ili jednak od';
+$labels['countequals'] = 'brojač je jednak';
+$labels['countnotequals'] = 'brojač nije jednak';
+$labels['valueisgreaterthan'] = 'vrijednost je veća od';
+$labels['valueisgreaterthanequal'] = 'vrijednost je veća ili jednaka od';
+$labels['valueislessthan'] = 'vrijednost je manja od';
+$labels['valueislessthanequal'] = 'vrijednost je manja ili jednaka od';
+$labels['valueequals'] = 'vrijednost je jednaka';
+$labels['valuenotequals'] = 'vrijednost nije jednaka';
+$labels['setflags'] = 'Postavi oznake na poruku';
+$labels['addflags'] = 'Dodaj oznake na poruku';
+$labels['removeflags'] = 'Ukloni oznake sa poruke';
+$labels['flagread'] = 'Pročitana';
+$labels['flagdeleted'] = 'Obrisana';
+$labels['flaganswered'] = 'Odgovorena';
+$labels['flagflagged'] = 'Označena';
+$labels['flagdraft'] = 'Predložak';
+
+$messages = array();
+$messages['filterunknownerror'] = 'Nepoznata greška na poslužitelju';
+$messages['filterconnerror'] = 'Nemoguće spajanje na poslužitelj (managesieve)';
+$messages['filterdeleteerror'] = 'Nemoguće brisanje filtera. Greška na poslužitelju';
+$messages['filterdeleted'] = 'Filter je uspješno obrisan';
+$messages['filtersaved'] = 'Filter je uspješno spremljen';
+$messages['filtersaveerror'] = 'Nemoguće spremiti filter. Greška na poslužitelju';
+$messages['filterdeleteconfirm'] = 'Sigurno želite obrisati odabrani filter?';
+$messages['ruledeleteconfirm'] = 'Jeste li sigurni da želite obrisati odabrana pravila?';
+$messages['actiondeleteconfirm'] = 'Jeste li sigurni da želite obrisati odabrane akcije?';
+$messages['forbiddenchars'] = 'Nedozvoljeni znakovi u polju';
+$messages['cannotbeempty'] = 'Polje nesmije biti prazno';
+$messages['setactivateerror'] = 'Nemoguće aktivirati odabranu grupu filtera. Greška na poslužitelju';
+$messages['setdeactivateerror'] = 'Nemoguće deaktivirati odabranu grupu filtera. Greška na poslužitelju';
+$messages['setdeleteerror'] = 'Nemoguće obrisati odabranu grupu filtera. Greška na poslužitelju';
+$messages['setactivated'] = 'Grupa filtera je uspješno aktivirana';
+$messages['setdeactivated'] = 'Grupa filtera je uspješno deaktivirana';
+$messages['setdeleted'] = 'Grupa filtera je uspješno obrisana';
+$messages['setdeleteconfirm'] = 'Jeste li sigurni da želite obrisati odabranu grupu filtera?';
+$messages['setcreateerror'] = 'Nemoguće stvoriti grupu filtera. Greška na poslužitelju';
+$messages['setcreated'] = 'Grupa filtera je uspješno stvorena';
+$messages['emptyname'] = 'Nemoguće napraviti grupu filtera. Naziv je prazan';
+$messages['nametoolong'] = 'Nemoguće napraviti grupu filtera. Naziv je predugačak'
+
+?>
diff --git a/plugins/managesieve/localization/hu_HU.inc b/plugins/managesieve/localization/hu_HU.inc
new file mode 100644
index 000000000..47a84f1a6
--- /dev/null
+++ b/plugins/managesieve/localization/hu_HU.inc
@@ -0,0 +1,54 @@
+<?php
+
+$labels = array();
+$labels['filters'] = 'Üzenetszűrők';
+$labels['managefilters'] = 'Bejövő üzenetek szűrői';
+$labels['filtername'] = 'Szűrő neve';
+$labels['newfilter'] = 'Új szűrő';
+$labels['filteradd'] = 'Szűrő hozzáadása';
+$labels['filterdel'] = 'Szűrő törlése';
+$labels['moveup'] = 'Mozgatás felfelé';
+$labels['movedown'] = 'Mozgatás lefelé';
+$labels['filterallof'] = 'A következők mind illeszkedjenek';
+$labels['filteranyof'] = 'A következők bármelyike illeszkedjen';
+$labels['filterany'] = 'Minden üzenet illeszkedjen';
+$labels['filtercontains'] = 'tartalmazza';
+$labels['filternotcontains'] = 'nem tartalmazza';
+$labels['filteris'] = 'megegyezik';
+$labels['filterisnot'] = 'nem egyezik meg';
+$labels['filterexists'] = 'létezik';
+$labels['filternotexists'] = 'nem létezik';
+$labels['filterunder'] = 'alatta';
+$labels['filterover'] = 'felette';
+$labels['addrule'] = 'Szabály hozzáadása';
+$labels['delrule'] = 'Szabály törlése';
+$labels['messagemoveto'] = 'Üzenet áthelyezése ide:';
+$labels['messageredirect'] = 'Üzenet továbbítása ide:';
+$labels['messagereply'] = 'Válaszüzenet küldése (autoreply)';
+$labels['messagedelete'] = 'Üzenet törlése';
+$labels['messagediscard'] = 'Válaszüzenet küldése, a levél törlése';
+$labels['messagesrules'] = 'Az adott tulajdonságú beérkezett üzenetekre:';
+$labels['messagesactions'] = '... a következő műveletek végrehajtása:';
+$labels['add'] = 'Hozzáadás';
+$labels['del'] = 'Törlés';
+$labels['sender'] = 'Feladó';
+$labels['recipient'] = 'Címzett';
+$labels['vacationaddresses'] = 'További címzettek (vesszővel elválasztva):';
+$labels['vacationdays'] = 'Válaszüzenet küldése ennyi naponként:';
+$labels['vacationreason'] = 'Levél szövege (automatikus válasz):';
+$labels['rulestop'] = 'Műveletek végrehajtásának befejezése';
+
+$messages = array();
+$messages['filterunknownerror'] = 'Ismeretlen szerverhiba';
+$messages['filterconnerror'] = 'Nem tudok a szűrőszerverhez kapcsolódni';
+$messages['filterdeleteerror'] = 'A szűrőt nem lehet törölni, szerverhiba történt';
+$messages['filterdeleted'] = 'A szűrő törlése sikeres';
+$messages['filterdeleteconfirm'] = 'Biztosan törli ezt a szűrőt?';
+$messages['filtersaved'] = 'A szűrő mentése sikeres';
+$messages['filtersaveerror'] = 'A szűrő mentése sikertelen, szerverhiba történt';
+$messages['ruledeleteconfirm'] = 'Biztosan törli ezt a szabályt?';
+$messages['actiondeleteconfirm'] = 'Biztosan törli ezt a műveletet?';
+$messages['forbiddenchars'] = 'Érvénytelen karakter a mezőben';
+$messages['cannotbeempty'] = 'A mező nem lehet üres';
+
+?>
diff --git a/plugins/managesieve/localization/it_IT.inc b/plugins/managesieve/localization/it_IT.inc
new file mode 100644
index 000000000..2debf3033
--- /dev/null
+++ b/plugins/managesieve/localization/it_IT.inc
@@ -0,0 +1,79 @@
+<?php
+
+$labels = array();
+$labels['filters'] = 'Filtri';
+$labels['managefilters'] = 'Gestione dei filtri per la posta in arrivo';
+$labels['filtername'] = 'Nome del filtro';
+$labels['newfilter'] = 'Nuovo filtro';
+$labels['filteradd'] = 'Aggiungi filtro';
+$labels['filterdel'] = 'Elimina filtro';
+$labels['moveup'] = 'Sposta sopra';
+$labels['movedown'] = 'Sposta sotto';
+$labels['filterallof'] = 'che soddisfa tutte le regole seguenti';
+$labels['filteranyof'] = 'che soddisfa una qualsiasi delle regole seguenti';
+$labels['filterany'] = 'tutti i messaggi';
+$labels['filtercontains'] = 'contiene';
+$labels['filternotcontains'] = 'non contiene';
+$labels['filteris'] = 'è uguale a';
+$labels['filterisnot'] = 'è diverso da';
+$labels['filterexists'] = 'esiste';
+$labels['filternotexists'] = 'non esiste';
+$labels['filterunder'] = 'sotto';
+$labels['filterover'] = 'sopra';
+$labels['addrule'] = 'Aggiungi regola';
+$labels['delrule'] = 'Elimina regola';
+$labels['messagemoveto'] = 'Sposta il messaggio in';
+$labels['messageredirect'] = 'Inoltra il messaggio a';
+$labels['messagereply'] = 'Rispondi con il messaggio';
+$labels['messagedelete'] = 'Elimina il messaggio';
+$labels['messagediscard'] = 'Rifiuta con messaggio';
+$labels['messagesrules'] = 'Per la posta in arrivo';
+$labels['messagesactions'] = '...esegui le seguenti azioni:';
+$labels['add'] = 'Aggiungi';
+$labels['del'] = 'Elimina';
+$labels['sender'] = 'Mittente';
+$labels['recipient'] = 'Destinatario';
+$labels['vacationaddresses'] = 'Lista di indirizzi e-mail di destinatari addizionali (separati da virgola):';
+$labels['vacationdays'] = 'Ogni quanti giorni ribadire il messaggio allo stesso mittente';
+$labels['vacationreason'] = 'Corpo del messaggio (dettagli relativi all\'assenza):';
+$labels['rulestop'] = 'Non valutare le regole successive';
+$labels['filterset'] = 'Gruppi di filtri';
+$labels['filtersetadd'] = 'Aggiungi gruppo';
+$labels['filtersetdel'] = 'Cancella gruppo selezionato';
+$labels['filtersetact'] = 'Attiva gruppo selezionato';
+$labels['filtersetdeact'] = 'Disattiva gruppo selezionato';
+$labels['filtersetget'] = 'Scarica filtri come testo';
+$labels['filterdef'] = 'Definizione del filtro';
+$labels['filtersetname'] = 'Nome del Gruppo di filtri';
+$labels['newfilterset'] = 'Nuovo gruppo di filri';
+$labels['active'] = 'attivo';
+$labels['none'] = 'nessuno';
+$labels['fromset'] = 'dal set';
+$labels['fromfile'] = 'dal file';
+$labels['filterdisabled'] = 'Filtro disabilitato';
+
+$messages = array();
+$messages['filterunknownerror'] = 'Errore sconosciuto del server';
+$messages['filterconnerror'] = 'Collegamento al server managesieve fallito';
+$messages['filterdeleteerror'] = 'Eliminazione del filtro fallita. Si è verificato un errore nel server';
+$messages['filterdeleted'] = 'Filtro eliminato con successo';
+$messages['filterdeleteconfirm'] = 'Vuoi veramente eliminare il filtro selezionato?';
+$messages['filtersaved'] = 'Filtro salvato con successo';
+$messages['filtersaveerror'] = 'Salvataggio del filtro fallito. Si è verificato un errore nel server';
+$messages['ruledeleteconfirm'] = 'Sei sicuro di voler eliminare la regola selezionata?';
+$messages['actiondeleteconfirm'] = 'Sei sicuro di voler eliminare l\'azione selezionata?';
+$messages['forbiddenchars'] = 'Caratteri non consentiti nel campo';
+$messages['cannotbeempty'] = 'Il campo non può essere vuoto';
+$messages['setactivateerror'] = 'Impossibile attivare il filtro. Errore del server';
+$messages['setdeactivateerror'] = 'Impossibile disattivare il filtro. Errore del server';
+$messages['setdeleteerror'] = 'Impossibile cancellare il filtro. Errore del server';
+$messages['setactivated'] = 'Filtro attivato';
+$messages['setdeactivated'] = 'Filtro disattivato';
+$messages['setdeleted'] = 'Filtro cancellato';
+$messages['setdeleteconfirm'] = 'Sei sicuro di voler cancellare il gruppo di filtri';
+$messages['setcreateerror'] = 'Impossibile creare il gruppo. Errore del server';
+$messages['setcreated'] = 'Gruppo di filtri creato';
+$messages['emptyname'] = 'Impossibile creare il gruppo: Inserire un nome';
+$messages['nametoolong'] = 'Impossibile creare il gruppo: Nome troppo lungo';
+
+?>
diff --git a/plugins/managesieve/localization/ja_JP.inc b/plugins/managesieve/localization/ja_JP.inc
new file mode 100644
index 000000000..a489054ad
--- /dev/null
+++ b/plugins/managesieve/localization/ja_JP.inc
@@ -0,0 +1,82 @@
+<?php
+
+// EN-Revision: 3891
+
+$labels['filters'] = 'フィルター';
+$labels['managefilters'] = '受信メールのフィルターの管理';
+$labels['filtername'] = 'フィルターの名前';
+$labels['newfilter'] = '新規フィルター';
+$labels['filteradd'] = 'フィルターの追加';
+$labels['filterdel'] = 'フィルターの削除';
+$labels['moveup'] = '上に移動';
+$labels['movedown'] = '下に移動';
+$labels['filterallof'] = '次のルールすべてに一致';
+$labels['filteranyof'] = '次のルールのどれかに一致';
+$labels['filterany'] = '全メッセージ';
+$labels['filtercontains'] = '含む';
+$labels['filternotcontains'] = '含まない';
+$labels['filteris'] = '次と一致する';
+$labels['filterisnot'] = '次と一致しない';
+$labels['filterexists'] = '存在する';
+$labels['filternotexists'] = '存在しない';
+$labels['filterunder'] = 'より上';
+$labels['filterover'] = 'より下';
+$labels['addrule'] = 'ルールの追加';
+$labels['delrule'] = 'ルールの削除';
+$labels['messagemoveto'] = '次にメッセージを移動する';
+$labels['messageredirect'] = '次のメールアドレスに転送 (リダイレクト)';
+$labels['messagecopyto'] = '次にメッセージをコピーする';
+$labels['messagesendcopy'] = '次にメッセージのコピーを送信する';
+$labels['messagereply'] = 'メッセージに返信する';
+$labels['messagedelete'] = 'メッセージを削除する';
+$labels['messagediscard'] = 'メッセージを破棄する';
+$labels['messagesrules'] = '受信メールへの処理:';
+$labels['messagesactions'] = '…次の操作の実行:';
+$labels['add'] = '追加';
+$labels['del'] = '削除';
+$labels['sender'] = '送信者';
+$labels['recipient'] = '受信者';
+$labels['vacationaddresses'] = '電子メール受信者の一覧を追加する (カンマ区切り):';
+$labels['vacationdays'] = 'どれ位頻繁にメッセージの送信をするか (1 日あたり):';
+$labels['vacationreason'] = 'メッセージ本文 (vacation reason):';
+$labels['rulestop'] = 'ルール評価の停止';
+$labels['filterset'] = 'フィルター セット';
+$labels['filtersetadd'] = 'フィルター セットの追加';
+$labels['filtersetdel'] = '現在のルールセット の削除';
+$labels['filtersetact'] = '現在のフィルター セットを有効にする';
+$labels['filtersetdeact'] = '現在のフィルター セットを無効にする';
+$labels['filtersetget'] = 'テキスト形式でフィルター セットをダウンロードする';
+$labels['filterdef'] = 'フィルターの定義';
+$labels['filtersetname'] = 'フィルター セットの名前';
+$labels['newfilterset'] = '新規フィルター セット';
+$labels['active'] = '有効';
+$labels['none'] = 'なし';
+$labels['fromset'] = 'セットから';
+$labels['fromfile'] = 'ファイルから';
+$labels['filterdisabled'] = 'フィルターを無効にしました。';
+
+$messages = array();
+$messages['filterunknownerror'] = '不明なサーバーのエラーです';
+$messages['filterconnerror'] = 'managesieve サーバーに接続できません。';
+$messages['filterdeleteerror'] = 'フィルターを削除できませんでした。サーバーでエラーが発生しました。';
+$messages['filterdeleted'] = 'フィルターの削除に成功しました。';
+$messages['filtersaved'] = 'フィルターの保存に成功しました。';
+$messages['filtersaveerror'] = 'フィルターの保存に失敗しました。サーバーでエラーが発生しました。';
+$messages['filterdeleteconfirm'] = '本当に選択したフィルターを削除しますか?';
+$messages['ruledeleteconfirm'] = '本当に選択したルールを削除しますか?';
+$messages['actiondeleteconfirm'] = '本当に選択した操作を削除しますか?';
+$messages['forbiddenchars'] = '項目に禁止文字があります。';
+$messages['cannotbeempty'] = '空にできませんでした';
+$messages['setactivateerror'] = '選択したフィルター セットの有効化に失敗しました。サーバーでエラーが発生しました。';
+$messages['setdeactivateerror'] = '選択したフィルター セットの無効化に失敗しました。サーバーでエラーが発生しました。';
+$messages['setdeleteerror'] = '選択したフィルター セットの削除に失敗しました。サーバーでエラーが発生しました。';
+$messages['setactivated'] = 'フィルターセットの有効化に成功しました。';
+$messages['setdeactivated'] = 'フィルターセットの無効化に成功しました。';
+$messages['setdeleted'] = 'フィルターセットの削除に成功しました。';
+$messages['setdeleteconfirm'] = '本当に選択したフィルター セットを削除しますか?';
+$messages['setcreateerror'] = 'フィルター セットの作成に失敗しました。サーバーでエラーが発生しました。';
+$messages['setcreated'] = 'フィルター セットの作成に成功しました。';
+$messages['emptyname'] = 'フィルター セットの作成に失敗しました。名前が空です。';
+$messages['nametoolong'] = 'フィルター セットの作成に失敗しました。名前が長すぎます。';
+
+?>
diff --git a/plugins/managesieve/localization/nb_NO.inc b/plugins/managesieve/localization/nb_NO.inc
new file mode 100644
index 000000000..a0ed1f3d7
--- /dev/null
+++ b/plugins/managesieve/localization/nb_NO.inc
@@ -0,0 +1,54 @@
+<?php
+
+$labels = array();
+$labels['filters'] = 'Filtre';
+$labels['managefilters'] = 'Rediger filter for innkommende e-post';
+$labels['filtername'] = 'Filternavn';
+$labels['newfilter'] = 'Nytt filter';
+$labels['filteradd'] = 'Legg til filter';
+$labels['filterdel'] = 'Slett filter';
+$labels['moveup'] = 'Flytt opp';
+$labels['movedown'] = 'Flytt ned';
+$labels['filterallof'] = 'som treffer alle følgende regler';
+$labels['filteranyof'] = 'som treffer en av følgende regler';
+$labels['filterany'] = 'og alle meldinger';
+$labels['filtercontains'] = 'inneholder';
+$labels['filternotcontains'] = 'ikke innehold';
+$labels['filteris'] = 'er';
+$labels['filterisnot'] = 'ikke er';
+$labels['filterexists'] = 'eksisterer';
+$labels['filternotexists'] = 'ikke eksisterer';
+$labels['filterunder'] = 'under';
+$labels['filterover'] = 'over';
+$labels['addrule'] = 'Legg til regel';
+$labels['delrule'] = 'Slett regel';
+$labels['messagemoveto'] = 'Flytt meldingen til';
+$labels['messageredirect'] = 'Videresend meldingen til';
+$labels['messagereply'] = 'Svar med melding';
+$labels['messagedelete'] = 'Slett melding';
+$labels['messagediscard'] = 'Avvis med melding';
+$labels['messagesrules'] = 'For innkommende e-post';
+$labels['messagesactions'] = '...gjør følgende';
+$labels['add'] = 'Legg til';
+$labels['del'] = 'Slett';
+$labels['sender'] = 'Avsender';
+$labels['recipient'] = 'Mottaker';
+$labels['vacationaddresses'] = 'Liste med mottakeradresser (adskilt med komma):';
+$labels['vacationdays'] = 'Periode mellom meldinger (i dager):';
+$labels['vacationreason'] = 'Innhold (begrunnelse for fravær)';
+$labels['rulestop'] = 'Stopp evaluering av regler';
+
+$messages = array();
+$messages['filterunknownerror'] = 'Ukjent problem med tjener';
+$messages['filterconnerror'] = 'Kunne ikke koble til MANAGESIEVE-tjener';
+$messages['filterdeleteerror'] = 'Kunne ikke slette filter. Det dukket opp en feil på tjeneren.';
+$messages['filterdeleted'] = 'Filteret er blitt slettet';
+$messages['filterconfirmdelete'] = 'Er du sikker på at du vil slette følgende filter?';
+$messages['filtersaved'] = 'Filter er blitt lagret';
+$messages['filtersaveerror'] = 'Kunne ikke lagre filteret. Det dukket opp en feil på tjeneren.';
+$messages['ruledeleteconfirm'] = 'Er du sikker på at du vil slette valgte regel?';
+$messages['actiondeleteconfirm'] = 'Er du sikker på at du vil slette valgte hendelse?';
+$messages['forbiddenchars'] = 'Ugyldige tegn i felt';
+$messages['cannotbeempty'] = 'Feltet kan ikke stå tomt';
+
+?>
diff --git a/plugins/managesieve/localization/nl_NL.inc b/plugins/managesieve/localization/nl_NL.inc
new file mode 100644
index 000000000..8ee317216
--- /dev/null
+++ b/plugins/managesieve/localization/nl_NL.inc
@@ -0,0 +1,49 @@
+<?php
+
+$labels['filters'] = 'Filters';
+$labels['managefilters'] = 'Beheer inkomende mail filters';
+$labels['filtername'] = 'Filternaam';
+$labels['newfilter'] = 'Nieuw filter';
+$labels['filteradd'] = 'Filter toevoegen';
+$labels['filterdel'] = 'Filter verwijderen';
+$labels['moveup'] = 'Omhoog';
+$labels['movedown'] = 'Omlaag';
+$labels['filterallof'] = 'die voldoen aan alle volgende regels';
+$labels['filteranyof'] = 'die voldoen aan een van de volgende regels';
+$labels['filterany'] = 'alle berichten';
+$labels['filtercontains'] = 'bevat';
+$labels['filternotcontains'] = 'bevat niet';
+$labels['filteris'] = 'is gelijk aan';
+$labels['filterisnot'] = 'is niet gelijk aan';
+$labels['filterexists'] = 'bestaat';
+$labels['filternotexists'] = 'bestaat niet';
+$labels['filterunder'] = 'onder';
+$labels['filterover'] = 'over';
+$labels['addrule'] = 'Regel toevoegen';
+$labels['delrule'] = 'Regel verwijderen';
+$labels['messagemoveto'] = 'Verplaats bericht naar';
+$labels['messageredirect'] = 'Redirect bericht naar';
+$labels['messagereply'] = 'Beantwoord met bericht';
+$labels['messagedelete'] = 'Verwijder bericht';
+$labels['messagediscard'] = 'Wijs af met bericht';
+$labels['messagesrules'] = 'Voor binnenkomende e-mail';
+$labels['messagesactions'] = '...voer de volgende acties uit';
+$labels['add'] = 'Toevoegen';
+$labels['del'] = 'Verwijderen';
+$labels['sender'] = 'Afzender';
+$labels['recipient'] = 'Ontvanger';
+
+$messages = array();
+$messages['filterunknownerror'] = 'Onbekende fout';
+$messages['filterconnerror'] = 'Kan geen verbinding maken met de managesieve server';
+$messages['filterdeleteerror'] = 'Kan filter niet verwijderen. Er is een fout opgetreden';
+$messages['filterdeleted'] = 'Filter succesvol verwijderd';
+$messages['filterdeleteconfirm'] = 'Weet je zeker dat je het geselecteerde filter wilt verwijderen?';
+$messages['filtersaved'] = 'Filter succesvol opgeslagen';
+$messages['filtersaveerror'] = 'Kan filter niet opslaan. Er is een fout opgetreden.';
+$messages['ruledeleteconfirm'] = 'Weet je zeker dat je de geselecteerde regel wilt verwijderen?';
+$messages['actiondeleteconfirm'] = 'Weet je zeker dat je de geselecteerde actie wilt verwijderen?';
+$messages['forbiddenchars'] = 'Verboden karakters in het veld';
+$messages['cannotbeempty'] = 'Veld mag niet leeg zijn';
+
+?>
diff --git a/plugins/managesieve/localization/pl_PL.inc b/plugins/managesieve/localization/pl_PL.inc
new file mode 100644
index 000000000..290dd1a46
--- /dev/null
+++ b/plugins/managesieve/localization/pl_PL.inc
@@ -0,0 +1,106 @@
+<?php
+
+$labels = array();
+$labels['filters'] = 'Filtry';
+$labels['managefilters'] = 'Zarządzaj filtrami wiadomości przychodzących';
+$labels['filtername'] = 'Nazwa filtru';
+$labels['newfilter'] = 'Nowy filtr';
+$labels['filteradd'] = 'Dodaj filtr';
+$labels['filterdel'] = 'Usuń filtr';
+$labels['moveup'] = 'Przenieś wyżej';
+$labels['movedown'] = 'Przenieś niżej';
+$labels['filterallof'] = 'spełniających wszystkie poniższe kryteria';
+$labels['filteranyof'] = 'spełniających dowolne z poniższych kryteriów';
+$labels['filterany'] = 'wszystkich';
+$labels['filtercontains'] = 'zawiera';
+$labels['filternotcontains'] = 'nie zawiera';
+$labels['filteris'] = 'jest równe';
+$labels['filterisnot'] = 'nie jest równe';
+$labels['filterexists'] = 'istnieje';
+$labels['filternotexists'] = 'nie istnieje';
+$labels['filtermatches'] = 'pasuje do wyrażenia';
+$labels['filternotmatches'] = 'nie pasuje do wyrażenia';
+$labels['filterregex'] = 'pasuje do wyrażenia regularnego';
+$labels['filternotregex'] = 'nie pasuje do wyrażenia regularnego';
+$labels['filterunder'] = 'poniżej';
+$labels['filterover'] = 'ponad';
+$labels['addrule'] = 'Dodaj regułę';
+$labels['delrule'] = 'Usuń regułę';
+$labels['messagemoveto'] = 'Przenieś wiadomość do';
+$labels['messageredirect'] = 'Przekaż wiadomość na konto';
+$labels['messagereply'] = 'Odpowiedz wiadomością o treści';
+$labels['messagecopyto'] = 'Skopiuj wiadomość do';
+$labels['messagesendcopy'] = 'Wyślij kopię do';
+$labels['messagedelete'] = 'Usuń wiadomość';
+$labels['messagediscard'] = 'Odrzuć z komunikatem';
+$labels['messagesrules'] = 'W stosunku do przychodzących wiadomości:';
+$labels['messagesactions'] = '...wykonaj następujące czynności:';
+$labels['add'] = 'Dodaj';
+$labels['del'] = 'Usuń';
+$labels['sender'] = 'Nadawca';
+$labels['recipient'] = 'Odbiorca';
+$labels['rulestop'] = 'Przerwij przetwarzanie reguł';
+$labels['vacationdays'] = 'Częstotliwość wysyłania wiadomości (w dniach):';
+$labels['vacationaddresses'] = 'Lista dodatkowych adresów odbiorców (oddzielonych przecinkami):';
+$labels['vacationreason'] = 'Treść (przyczyna nieobecności):';
+$labels['vacationsubject'] = 'Temat wiadomości:';
+$labels['filterset'] = 'Zbiór filtrów';
+$labels['filtersetadd'] = 'Dodaj zbiór filtrów';
+$labels['filtersetdel'] = 'Usuń bieżący zbiór filtrów';
+$labels['filtersetact'] = 'Aktywuj bieżący zbiór filtrów';
+$labels['filtersetdeact'] = 'Deaktywuj bieżący zbiór filtrów';
+$labels['filtersetget'] = 'Pobierz bieżący zbiór filtrów w formacie tekstowym';
+$labels['filterdef'] = 'Definicja filtra';
+$labels['filtersetname'] = 'Nazwa zbioru';
+$labels['newfilterset'] = 'Nowy zbiór filtrów';
+$labels['active'] = 'aktywny';
+$labels['none'] = 'brak';
+$labels['fromset'] = 'ze zbioru';
+$labels['fromfile'] = 'z pliku';
+$labels['filterdisabled'] = 'Filtr wyłączony';
+$labels['countisgreaterthan'] = 'ilość jest większa od';
+$labels['countisgreaterthanequal'] = 'ilość jest równa lub większa od';
+$labels['countislessthan'] = 'ilość jest mniejsza od';
+$labels['countislessthanequal'] = 'ilość jest równa lub mniejsza od';
+$labels['countequals'] = 'ilość jest równa';
+$labels['countnotequals'] = 'ilość jest różna od';
+$labels['valueisgreaterthan'] = 'wartość jest większa od';
+$labels['valueisgreaterthanequal'] = 'wartość jest równa lub większa od';
+$labels['valueislessthan'] = 'wartość jest mniejsza od';
+$labels['valueislessthanequal'] = 'wartość jest równa lub mniejsza od';
+$labels['valueequals'] = 'wartość jest równa';
+$labels['valuenotequals'] = 'wartość jest różna od';
+$labels['setflags'] = 'Ustaw flagi wiadomości';
+$labels['addflags'] = 'Dodaj flagi do wiadomości';
+$labels['removeflags'] = 'Usuń flagi wiadomości';
+$labels['flagread'] = 'Przeczytana';
+$labels['flagdeleted'] = 'Usunięta';
+$labels['flaganswered'] = 'Z odpowiedzią';
+$labels['flagflagged'] = 'Oflagowana';
+$labels['flagdraft'] = 'Szkic';
+
+$messages = array();
+$messages['filterunknownerror'] = 'Nieznany błąd serwera';
+$messages['filterconnerror'] = 'Nie można nawiązać połączenia z serwerem managesieve';
+$messages['filterdeleteerror'] = 'Nie można usunąć filtra. Wystąpił błąd serwera';
+$messages['filterdeleted'] = 'Filtr został usunięty pomyślnie';
+$messages['filterdeleteconfirm'] = 'Czy na pewno chcesz usunąć wybrany filtr?';
+$messages['filtersaved'] = 'Filtr został zapisany pomyślnie';
+$messages['filtersaveerror'] = 'Nie można zapisać filtra. Wystąpił błąd serwera.';
+$messages['ruledeleteconfirm'] = 'Czy na pewno chcesz usunąć wybraną regułę?';
+$messages['actiondeleteconfirm'] = 'Czy na pewno usunąć wybraną akcję?';
+$messages['forbiddenchars'] = 'Pole zawiera niedozwolone znaki';
+$messages['cannotbeempty'] = 'Pole nie może być puste';
+$messages['setactivateerror'] = 'Nie można aktywować wybranego zbioru filtrów. Błąd serwera';
+$messages['setdeactivateerror'] = 'Nie można deaktywować wybranego zbioru filtrów. Błąd serwera';
+$messages['setdeleteerror'] = 'Nie można usunąć wybranego zbioru filtrów. Błąd serwera';
+$messages['setactivated'] = 'Zbiór filtrów został aktywowany pomyślnie';
+$messages['setdeactivated'] = 'Zbiór filtrów został deaktywowany pomyślnie';
+$messages['setdeleted'] = 'Zbiór filtrów został usunięty pomyślnie';
+$messages['setdeleteconfirm'] = 'Czy na pewno chcesz usunąć wybrany zbiór filtrów?';
+$messages['setcreateerror'] = 'Nie można utworzyć zbioru filtrów. Błąd serwera';
+$messages['setcreated'] = 'Zbiór filtrów został utworzony pomyślnie';
+$messages['emptyname'] = 'Nie można utworzyć zbioru filtrów. Pusta nazwa zbioru';
+$messages['nametoolong'] = 'Nie można utworzyć zbioru filtrów. Nazwa zbyt długa'
+
+?>
diff --git a/plugins/managesieve/localization/pt_BR.inc b/plugins/managesieve/localization/pt_BR.inc
new file mode 100644
index 000000000..b48774e97
--- /dev/null
+++ b/plugins/managesieve/localization/pt_BR.inc
@@ -0,0 +1,53 @@
+<?php
+
+$labels['filters'] = 'Filtros';
+$labels['managefilters'] = 'Gerenciar filtros de entrada de e-mail';
+$labels['filtername'] = 'Nome do filtro';
+$labels['newfilter'] = 'Novo filtro';
+$labels['filteradd'] = 'Adicionar filtro';
+$labels['filterdel'] = 'Excluir filtro';
+$labels['moveup'] = 'Mover para cima';
+$labels['movedown'] = 'Mover para baixo';
+$labels['filterallof'] = 'casando todas as seguintes regras';
+$labels['filteranyof'] = 'casando qualquer das seguintes regras';
+$labels['filterany'] = 'todas as mensagens';
+$labels['filtercontains'] = 'contem';
+$labels['filternotcontains'] = 'não contem';
+$labels['filteris'] = 'é igual a';
+$labels['filterisnot'] = 'não é igual a';
+$labels['filterexists'] = 'existe';
+$labels['filternotexists'] = 'não existe';
+$labels['filterunder'] = 'inferior a';
+$labels['filterover'] = 'superior a';
+$labels['addrule'] = 'Adicionar regra';
+$labels['delrule'] = 'Excluir regra';
+$labels['messagemoveto'] = 'Mover mensagem para';
+$labels['messageredirect'] = 'Redirecionar mensagem para';
+$labels['messagereply'] = 'Responder com mensagem';
+$labels['messagedelete'] = 'Excluir mensagem';
+$labels['messagediscard'] = 'Descartar com mensagem';
+$labels['messagesrules'] = 'Para e-mails recebidos:';
+$labels['messagesactions'] = '...execute as seguintes ações:';
+$labels['add'] = 'Adicionar';
+$labels['del'] = 'Excluir';
+$labels['sender'] = 'Remetente';
+$labels['recipient'] = 'Destinatário';
+$labels['vacationaddresses'] = 'Lista adicional de e-mails de remetente (separado por vírgula):';
+$labels['vacationdays'] = 'Enviar mensagens com que frequência (em dias):';
+$labels['vacationreason'] = 'Corpo da mensagem (motivo de férias):';
+$labels['rulestop'] = 'Parar de avaliar regras';
+
+$messages = array();
+$messages['filterunknownerror'] = 'Erro desconhecido de servidor';
+$messages['filterconnerror'] = 'Não foi possível conectar ao servidor managesieve';
+$messages['filterdeleteerror'] = 'Não foi possível excluir filtro. Occorreu um erro de servidor';
+$messages['filterdeleted'] = 'Filtro excluído com sucesso';
+$messages['filterdeleteconfirm'] = 'Deseja realmente excluir o filtro selecionado?';
+$messages['filtersaved'] = 'Filtro gravado com sucesso';
+$messages['filtersaveerror'] = 'Não foi possível gravar filtro. Occoreu um erro de servidor.';
+$messages['ruledeleteconfirm'] = 'Deseja realmente excluir a regra selecionada?';
+$messages['actiondeleteconfirm'] = 'Deseja realmente excluir a ação selecionada?';
+$messages['forbiddenchars'] = 'Caracteres não permitidos no campo';
+$messages['cannotbeempty'] = 'Campo não pode ficar em branco';
+
+?>
diff --git a/plugins/managesieve/localization/pt_PT.inc b/plugins/managesieve/localization/pt_PT.inc
new file mode 100644
index 000000000..592916fc0
--- /dev/null
+++ b/plugins/managesieve/localization/pt_PT.inc
@@ -0,0 +1,185 @@
+<?php
+/* Author: Ling Fude */
+
+$labels = array();
+$labels['filters'] = 'Filtros';
+$labels['managefilters'] = 'Gerir filtros';
+$labels['filtername'] = 'Nome do filtro';
+$labels['disablerule'] = 'Desactivar regra';
+$labels['disabled'] = 'Desactivado';
+$labels['newfilter'] = 'Novo filtro';
+$labels['moveup'] = 'Mover para cima';
+$labels['movedown'] = 'Mover para baixo';
+$labels['filterallof'] = 'corresponde a todas as seguintes regras';
+$labels['filteranyof'] = 'corresponde a uma das seguintes regras';
+$labels['filterany'] = 'todas as mensagens';
+$labels['filtercontains'] = 'contém';
+$labels['filternotcontains'] = 'não contém';
+$labels['filteris'] = 'é igual a';
+$labels['filterisnot'] = 'é diferente de';
+$labels['filterexists'] = 'existe';
+$labels['filternotexists'] = 'não existe';
+$labels['filterregex'] = 'corresponde à expressão';
+$labels['filternotregex'] = 'não corresponde à expressão';
+$labels['filterunder'] = 'é inferior a';
+$labels['filterover'] = 'é superior a';
+$labels['filterbefore'] = 'é antes';
+$labels['filterafter'] = 'é depois';
+$labels['filteradvoptions'] = 'mais opções...';
+$labels['spamtest'] = 'Probabilidade de Spam';
+$labels['operator'] = 'Operador';
+$labels['comparator'] = 'Comparador';
+$labels['isgreaterthan'] = 'é maior que';
+$labels['isgreaterthanequal'] = 'é maior ou igual a';
+$labels['islessthan'] = 'é menor que';
+$labels['islessthanequal'] = 'é menor ou igual a';
+$labels['equals'] = 'é igual a';
+$labels['notequals'] = 'é diferente de';
+$labels['countisgreaterthan'] = 'contagem é maior que';
+$labels['countisgreaterthanequal'] = 'contagem é maior ou igual a';
+$labels['countislessthan'] = 'contagem é menor que';
+$labels['countislessthanequal'] = 'contagem é menor ou igual a';
+$labels['countequals'] = 'contagem é igual a';
+$labels['countnotequals'] = 'contagem é diferente de';
+$labels['valueisgreaterthan'] = 'valor é maior que';
+$labels['valueisgreaterthanequal'] = 'valor é maior ou igual a';
+$labels['valueislessthan'] = 'valor é menor que';
+$labels['valueislessthanequal'] = 'valor é menor ou igual a';
+$labels['valueequals'] = 'valor é igual a';
+$labels['valuenotequals'] = 'valor diferente de';
+$labels['userpart'] = 'parte do utilizador igual a';
+$labels['notuserpart'] = 'parte do utilizador diferente de';
+$labels['detailpart'] = 'parte do detalhe igual a';
+$labels['notdetailpart'] = 'parte do detalhe diferente de';
+$labels['domainpart'] = 'parte do domínio igual a';
+$labels['notdomainpart'] = 'parte do domínio diferente de';
+$labels['teststring'] = 'Texto de teste';
+$labels['messagemoveto'] = 'Mover mensagem para';
+$labels['messageredirect'] = 'Redirecionar mensagem para';
+$labels['messageimapflags'] = 'Marcar mensagem como';
+$labels['messagereject'] = 'Rejeitar com a mensagem';
+$labels['messagevacation'] = 'Mensagem Fora do Escritório';
+$labels['messagekeep'] = 'Manter mensagem';
+$labels['messagediscard'] = 'Rejeitar mensagem';
+$labels['messagenotify'] = 'Enviar notificação';
+$labels['messagestop'] = 'Parar o processamento de filtros';
+$labels['messagehelp'] = 'O que é isto?';
+$labels['sieveorigsubj'] = 'Acrescentar assunto original à resposta';
+$labels['sievevachandle'] = 'Manusear';
+$labels['method'] = 'Método';
+$labels['options'] = 'Opções';
+$labels['messagesrules'] = 'Regras para Filtros';
+$labels['messagesactions'] = 'Acções para Filtros';
+$labels['sieveto'] = 'Alias';
+$labels['sievefrom'] = 'De';
+$labels['flag'] = 'Importância';
+$labels['importancen'] = 'Nenhum';
+$labels['importance1'] = 'Alta';
+$labels['importance2'] = 'Normal';
+$labels['importance3'] = 'Baixa';
+$labels['flagread'] = 'Lida';
+$labels['flagdeleted'] = 'Eliminada';
+$labels['flaganswered'] = 'Respondida';
+$labels['flagdraft'] = 'Rascunho';
+$labels['flagflagged'] = 'Marcada';
+$labels['addsieverule'] = 'Adicionar outra regra, depois desta';
+$labels['addsieveact'] = 'Adicionar outra acção, depois desta';
+$labels['deletesieverule'] = 'Eliminar esta regra';
+$labels['deletesieveact'] = 'Eliminar esta acção';
+$labels['envelopefrom'] = 'Envelope De';
+$labels['envelopeto'] = 'Envelope Para';
+$labels['otherheader'] = 'Outro cabeçalho';
+$labels['days'] = 'Periodo';
+$labels['message'] = 'Mensagem';
+$labels['sieveruleheaders'] = 'Ver exemplos de outros cabecalhos';
+$labels['examplefilters'] = 'Exemplo de Filtros';
+$labels['importfilters'] = 'Importar Filtros';
+$labels['usedefaultfilter'] = 'Usar filtros predefinidos';
+$labels['importfilter'] = 'Importar filtros';
+$labels['moreactions'] = 'Mais opções...';
+$labels['adveditor'] = 'Editor avançado';
+$labels['stdeditor'] = 'Editor padrão';
+$labels['messageredirectcopy'] = 'Enviar cópia para';
+$labels['messagecopyto'] = 'Copiar mensagem para';
+$labels['body'] = 'Corpo';
+$labels['auto'] = 'Auto';
+$labels['raw'] = 'Raw';
+$labels['text'] = 'Texto';
+$labels['other'] = 'Outro';
+$labels['bodycontentpart'] = 'Parte Conteúdo';
+$labels['spamnotchecked'] = 'não verificado';
+$labels['spamlevelisgreaterthanequal'] = 'é maior ou igual a';
+$labels['spamlevelislessthanequal'] = 'é menor ou igual a';
+$labels['spamlevelequals'] = 'é igual a';
+$labels['i;ascii-casemap'] = 'correspondência de texto indeferente a maiúsculas e minúsculas';
+$labels['i;octet'] = 'correspondência exacta do texto';
+$labels['i;ascii-numeric'] = 'correspondência numérica';
+$labels['selectruleset'] = 'Seleccionar conjunto de regras';
+$labels['activeruleset'] = '%s (activo)';
+$labels['activateruleset'] = 'Activar este conjunto de regras';
+$labels['newruleset'] = 'Criar um no grupo de regras';
+$labels['delruleset'] = 'Eliminar este conjunto de regras';
+$labels['renameruleset'] = 'Renomear este conjunto de regras';
+$labels['copy'] = 'Copiar';
+$labels['copyexistingfilter'] = 'Copiar filtros existentes';
+$labels['copytoruleset'] = 'Copiar o filtro para outro conjunto de regras';
+$labels['copyfromruleset'] = 'Copiar filtros de um conjunto regras existente';
+$labels['time'] = 'Tempo';
+$labels['weekday'] = 'dia da semana';
+
+$messages = array();
+$messages['nosieverules'] = 'Nenhum filtro encontrado.';
+$messages['filterdeleteconfirm'] = 'Tem a certeza que pretende eliminar este filtro?';
+$messages['ruledeleteconfirm'] = 'Tem a certeza que pretende eliminar esta regra?';
+$messages['actiondeleteconfirm'] = 'Tem a certeza que pretende eliminar esta acção?';
+$messages['filterunknownerror'] = 'Erro de servidor desconhecido';
+$messages['filterconnerror'] = 'Não é possível ligar ao servidor Sieve';
+$messages['filterdeleteerror'] = 'Não foi possível eliminar o filtro. Erro no servidor';
+$messages['filterdeleted'] = 'Filtro eliminado com sucesso';
+$messages['filtersaved'] = 'Filtro guardado com sucesso';
+$messages['filtersaveerror'] = 'Não foi possível guardar o filtro. Erro no servidor';
+$messages['vacdaysexp'] = 'O período é o número de dias durante o qual a mensagem não será reenviado para o mesmo remetente, não importa quantas vezes ele entre contacto consigo.<br/><br/>Por exemplo: Se o João lhe enviar e-mails na segunda-feira e o período está definido para 7 dias, o João irá receber uma mensagem de Fora do Escritório na segunda-feira, mas não irá receber mais nenhuma até à segunda-feira seguinte, não importa quantos e-mails ele lhe envie durante a semana.';
+$messages['vachandleexp'] = 'Um identificador pode ser usado para ligar as diferentes mensagens de Fora do Escritório em conjunto, uma vez que uma mensagem foi enviada outra mensagem com o mesmo identificador será reenviado no mesmo período.';
+$messages['vactoexp'] = 'Lista de endereços de destinatários adicionais que estão incluídos na resposta automática. Se um destinatário de e-mail não é o seu endereço principal e não está nesta lista, nenhuma mensagem será enviada.';
+$messages['vactoexp_adv'] = 'Separar múltiplos endereços com virgula (,). Exemplo: test1@example.com,test2@example.com,test3@example.com';
+$messages['vactoexp_err'] = 'Erro: Múltiplos endereços devem ser separados por virgula (,).';
+$messages['norulename'] = 'Por favor, indique um nome para este filtro';
+$messages['ruleexists'] = 'Já existe um filtro com este nome. Por favor, indique outro';
+$messages['noheader'] = 'Por favor, indique o nome do cabeçalho para testar';
+$messages['headerbadchars'] = 'Erro: O cabeçalho contém caracteres proibidos';
+$messages['noheadervalue'] = 'Por favor indique um valor para testar o cabeçalho contra';
+$messages['sizewrongformat'] = 'Erro: O tamanho da mensagem deve ser numérico';
+$messages['noredirect'] = 'Indique um endereço de e-mail para redirecionar as mensagens';
+$messages['redirectaddresserror'] = 'Erro: O endereço de e-mail parece ser inválido';
+$messages['noreject'] = 'Indique uma mensagem para enviar juntamente com o e-mail rejeitado';
+$messages['vacnodays'] = 'Por favor insira um número de dias para o período em que a mensagem não será reenviado para a mesma pessoa';
+$messages['vacdayswrongformat'] = 'Erro: O período deve ser um número maior ou igual a 1';
+$messages['vacnomsg'] = 'Insira o texto para a sua mensagem';
+$messages['notifynomethod'] = 'Por favor, indique um método pelo qual a notificação deve ser enviada';
+$messages['notifynomsg'] = 'Insira o texto para a sua mensagem';
+$messages['sieveruleexp'] = 'Por favor, defina uma ou mais regras sobre as quais cada mensagem será testada. Os filtros são executados na ordem em que aparecem à esquerda do ecrã, se for encontrada uma correspondência mais nenhum filtro será testado.';
+$messages['sieveruleexp_stop'] = 'Por favor, defina uma ou mais regras sobre as quais cada mensagem será testada. Os filtros são executados na ordem em que aparecem à esquerda do ecrã até uma acção de \'Stop\' ser encontrada.';
+$messages['sieveactexp'] = 'Por favor, seleccione uma das opções abaixo. Essas acções serão realizadas para qualquer mensagem correspondente à(s) regra(s) acima.';
+$messages['sieveheadershlp'] = 'Abaixo estão alguns exemplos de outros cabeçalhos que podem ser testados pelos filtros. Selecione um cabeçalho para adicioná-lo à regra, ou introduza um personalizado na caixa acima.';
+$messages['movingfilter'] = 'A mover filtro...';
+$messages['noexistingfilters'] = 'Não foi detectado nenhum filtro existente!';
+$messages['importdefault'] = '<b>Usar filtros predefinidos:</b> Há um conjunto de filtros predefinidos disponíveis. Gostaria de usar esses filtros?';
+$messages['importother'] = '<b>Importação de filtros:</b>Foi encontrado outro conjunto de filtros de %s. Gostaria de importar esses filtros para o seu conjunto actual?';
+$messages['switchtoadveditor'] = 'Mudando para o editor avançado permite editar o ficheiro Sieve directamente. Quaisquer alterações aqui efectuadas podem ser ilegíveis no editor normal e podem ser perdidas quando os filtros são guardados usando o editor normal. Deseja continuar?';
+$messages['filterimported'] = 'Filtro importado com sucesso';
+$messages['filterimporterror'] = 'Não foi possível importar o filtro. Ocorreu um erro no servidor.';
+$messages['notifyinvalidmethod'] = 'O método parece não estar escrito num formato válido, ele deve ser um URL. Por exemplo: "mailto: alert@example.com».';
+$messages['nobodycontentpart'] = 'Por favor, indique uma parte de conteúdo para testar';
+$messages['badoperator'] = 'O operador seleccionado não pode ser usado nesta regra';
+$messages['filteractionerror'] = 'A acção solicitada não é suportada pelo servidor';
+$messages['filtermissingerror'] = 'Não foi possível encontrar a regra solicitada';
+$messages['contentpartexp'] = 'O tipo de MIME ou parte específica da mensagem que deve ser testado. Por exemplo: `text/html`, `audio/mp3` or `image`.';
+$messages['delrulesetconf'] = 'Tem certeza que quer eliminar este conjunto de regras?';
+$messages['rulesetexists'] = 'Um conjunto de regras com este nome já existe. Por favor, indique outro nome';
+$messages['copyexisting'] = '<b>Copiar conjunto de regras existente:</b>Gostaria de copiar os filtros de um conjunto de de regras existente para o seu conjunto actual?';
+$messages['filtercopied'] = 'Filtro copiado com sucesso';
+$messages['nosieverulesets'] = 'Nenhum conjunto de regras encontrado.';
+$messages['baddateformat'] = 'Erro: Indique a data no formato AAAA-MM-DD';
+$messages['badtimeformat'] = 'Erro: Indique a hora no formato HH:MM:SS';
+
+?> \ No newline at end of file
diff --git a/plugins/managesieve/localization/ru_RU.inc b/plugins/managesieve/localization/ru_RU.inc
new file mode 100644
index 000000000..68aa411a8
--- /dev/null
+++ b/plugins/managesieve/localization/ru_RU.inc
@@ -0,0 +1,117 @@
+<?php
+/*
+
++-----------------------------------------------------------------------+
+| plugins/managesieve/localization/ru_RU.inc |
+| |
+| Russian translation for roundcube/managesieve plugin |
+| Copyright (C) 2008-2011 |
+| Licensed under the GNU GPL |
+| |
++-----------------------------------------------------------------------+
+| Author: Sergey Dukachev <iam@dukess.ru> |
+| Updates: Sergey Dukachev <iam@dukess.ru> |
++-----------------------------------------------------------------------+
+
+@version 2011-05-11
+
+*/
+
+$labels['filters'] = 'Фильтры';
+$labels['managefilters'] = 'Управление фильтрами для входящей почты';
+$labels['filtername'] = 'Название фильтра';
+$labels['newfilter'] = 'Новый фильтр';
+$labels['filteradd'] = 'Добавить фильтр';
+$labels['filterdel'] = 'Удалить фильтр';
+$labels['moveup'] = 'Сдвинуть вверх';
+$labels['movedown'] = 'Сдвинуть вниз';
+$labels['filterallof'] = 'соответствует всем указанным правилам';
+$labels['filteranyof'] = 'соответствует любому из указанных правил';
+$labels['filterany'] = 'все сообщения';
+$labels['filtercontains'] = 'содержит';
+$labels['filternotcontains'] = 'не содержит';
+$labels['filteris'] = 'соответствует';
+$labels['filterisnot'] = 'не соответствует';
+$labels['filterexists'] = 'существует';
+$labels['filternotexists'] = 'не существует';
+$labels['filterunder'] = 'под';
+$labels['filterover'] = 'на';
+$labels['addrule'] = 'Добавить правило';
+$labels['delrule'] = 'Удалить правило';
+$labels['messagemoveto'] = 'Переместить сообщение в';
+$labels['messageredirect'] = 'Перенаправить сообщение на';
+$labels['messagecopyto'] = 'Скопировать сообщение в';
+$labels['messagesendcopy'] = 'Отправить копию сообщения на';
+$labels['messagereply'] = 'Ответить с сообщением';
+$labels['messagedelete'] = 'Удалить сообщение';
+$labels['messagediscard'] = 'Отбросить с сообщением';
+$labels['messagesrules'] = 'Для входящей почты:';
+$labels['messagesactions'] = '...выполнить следующие действия:';
+$labels['add'] = 'Добавить';
+$labels['del'] = 'Удалить';
+$labels['sender'] = 'Отправитель';
+$labels['recipient'] = 'Получатель';
+$labels['vacationaddresses'] = 'Список дополнительных адресов получателя (разделённых запятыми):';
+$labels['vacationdays'] = 'Как часто отправлять сообщения (в днях):';
+$labels['vacationreason'] = 'Текст сообщения (причина отсутствия):';
+$labels['rulestop'] = 'Закончить выполнение';
+$labels['filterset'] = 'Набор фильтров';
+$labels['filtersetadd'] = 'Добавить набор фильтров';
+$labels['filtersetdel'] = 'Удалить текущий набор фильтров';
+$labels['filtersetact'] = 'Включить текущий набор фильтров';
+$labels['filtersetdeact'] = 'Отключить текущий набор фильтров';
+$labels['filtersetget'] = 'Скачать набор фильтров в виде текста';
+$labels['filterdef'] = 'Описание фильтра';
+$labels['filtersetname'] = 'Название набора фильтров';
+$labels['newfilterset'] = 'Новый набор фильтров';
+$labels['active'] = 'используется';
+$labels['none'] = 'пустой';
+$labels['fromset'] = 'из набора';
+$labels['fromfile'] = 'из файла';
+$labels['filterdisabled'] = 'Отключить фильтр';
+$labels['countisgreaterthan'] = 'количество больше, чем';
+$labels['countisgreaterthanequal'] = 'количество больше или равно';
+$labels['countislessthan'] = 'количество меньше, чем';
+$labels['countislessthanequal'] = 'количество меньше или равно';
+$labels['countequals'] = 'количество равно';
+$labels['countnotequals'] = 'количество не равно';
+$labels['valueisgreaterthan'] = 'значение больше, чем';
+$labels['valueisgreaterthanequal'] = 'значение больше или равно';
+$labels['valueislessthan'] = 'значение меньше, чем';
+$labels['valueislessthanequal'] = 'значение меньше или равно';
+$labels['valueequals'] = 'значение равно';
+$labels['valuenotequals'] = 'значение не равно';
+$labels['setflags'] = 'Установить флаг на сообщение';
+$labels['addflags'] = 'Добавить флаг к сообщению';
+$labels['removeflags'] = 'Убрать флаги из сообщения';
+$labels['flagread'] = 'Прочитано';
+$labels['flagdeleted'] = 'Удалено';
+$labels['flaganswered'] = 'Отвечено';
+$labels['flagflagged'] = 'Помечено';
+$labels['flagdraft'] = 'Черновик';
+
+$messages = array();
+$messages['filterunknownerror'] = 'Неизвестная ошибка сервера';
+$messages['filterconnerror'] = 'Невозможно подсоединится к серверу фильтров';
+$messages['filterdeleteerror'] = 'Невозможно удалить фильтр. Ошибка сервера';
+$messages['filterdeleted'] = 'Фильтр успешно удалён';
+$messages['filterdeleteconfirm'] = 'Вы действительно хотите удалить фильтр?';
+$messages['filtersaved'] = 'Фильтр успешно сохранён';
+$messages['filtersaveerror'] = 'Невозможно сохранить фильтр. Ошибка сервера';
+$messages['ruledeleteconfirm'] = 'Вы уверенны, что хотите удалить это правило?';
+$messages['actiondeleteconfirm'] = 'Вы уверенны, что хотите удалить это действие?';
+$messages['forbiddenchars'] = 'Недопустимые символы в поле';
+$messages['cannotbeempty'] = 'Поле не может быть пустым';
+$messages['setactivateerror'] = 'Невозможно включить выбранный набор фильтров. Ошибка сервера';
+$messages['setdeactivateerror'] = 'Невозможно отключить выбранный набор фильтров. Ошибка сервера';
+$messages['setdeleteerror'] = 'Невозможно удалить выбранный набор фильтров. Ошибка сервера';
+$messages['setactivated'] = 'Набор фильтров успешно включён';
+$messages['setdeactivated'] = 'Набор фильтров успешно отключён';
+$messages['setdeleted'] = 'Набор фильтров успешно удалён';
+$messages['setdeleteconfirm'] = 'Вы уверены в том, что хотите удалить выбранный набор фильтров?';
+$messages['setcreateerror'] = 'Невозможно создать набор фильтров. Ошибка сервера';
+$messages['setcreated'] = 'Набор фильтров успешно создан';
+$messages['emptyname'] = 'Невозможно создать набор фильтров. Название не задано';
+$messages['nametoolong'] = 'Невозможно создать набор фильтров. Название слишком длинное'
+
+?>
diff --git a/plugins/managesieve/localization/sk_SK.inc b/plugins/managesieve/localization/sk_SK.inc
new file mode 100644
index 000000000..89c6a2b49
--- /dev/null
+++ b/plugins/managesieve/localization/sk_SK.inc
@@ -0,0 +1,85 @@
+<?php
+
+/*
+ * Slovak translation for roundcube/managesieve plugin
+ *
+ * @version 1.0
+ * (c) 27.06.2010 by Juraj LUTTER <juraj@lutter.sk>
+ */
+
+$labels['filters'] = 'Filtre';
+$labels['managefilters'] = 'Správa filtrov príchádzajúcej pošty';
+$labels['filtername'] = 'Názov filtra';
+$labels['newfilter'] = 'Nový filter';
+$labels['filteradd'] = 'Pridaj filter';
+$labels['filterdel'] = 'Zmaž filter';
+$labels['moveup'] = 'Presuň vyššie';
+$labels['movedown'] = 'Presuň nižšie';
+$labels['filterallof'] = 'vyhovujúcu VŠETKÝM nasledujúcim pravidlám';
+$labels['filteranyof'] = 'vyhovujúcu ĽUBOVOĽNÉMU z nasledujúcich pravidiel';
+$labels['filterany'] = 'všetky správy';
+$labels['filtercontains'] = 'obsahuje';
+$labels['filternotcontains'] = 'neobsahuje';
+$labels['filteris'] = 'je';
+$labels['filterisnot'] = 'nie je';
+$labels['filterexists'] = 'existuje';
+$labels['filternotexists'] = 'neexistuje';
+$labels['filterunder'] = 'pod';
+$labels['filterover'] = 'nad';
+$labels['addrule'] = 'Pridaj pravidlo';
+$labels['delrule'] = 'Zmaž pravidlo';
+$labels['messagemoveto'] = 'Presuň správu do';
+$labels['messageredirect'] = 'Presmeruj správu na';
+$labels['messagereply'] = 'Pošli automatickú odpoveď';
+$labels['messagedelete'] = 'Zmaž správu';
+$labels['messagediscard'] = 'Zmaž a pošli správu na';
+$labels['messagesrules'] = 'Pre prichádzajúcu poštu';
+$labels['messagesactions'] = 'vykonaj nasledovné akcie';
+$labels['add'] = 'Pridaj';
+$labels['del'] = 'Zmaž';
+$labels['sender'] = 'Odosielateľ';
+$labels['recipient'] = 'Adresát';
+$labels['vacationaddresses'] = 'Dodatoční príjemcovia správy (oddelení čiarkami):';
+$labels['vacationdays'] = 'Počet dní medzi odoslaním správy:';
+$labels['vacationreason'] = 'Dôvod neprítomnosti:';
+$labels['rulestop'] = 'Koniec pravidiel';
+$labels['filterset'] = 'Sada filtrov';
+$labels['filtersetadd'] = 'Pridaj sadu filtrov';
+$labels['filtersetdel'] = 'Zmaž túto sadu filtrov';
+$labels['filtersetact'] = 'Aktivuj túto sadu filtrov';
+$labels['filtersetdeact'] = 'Deaktivuj túto sadu filtrov';
+$labels['filtersetget'] = 'Stiahni definíciu filtrov v textovom súbore';
+$labels['filterdef'] = 'Definícia filtra';
+$labels['filtersetname'] = 'Názov sady filtrov';
+$labels['newfilterset'] = 'Nová sada filtrov';
+$labels['active'] = 'aktívna';
+$labels['none'] = 'žiadne';
+$labels['fromset'] = 'zo sady';
+$labels['fromfile'] = 'zo súboru';
+$labels['filterdisabled'] = 'Filter zakázaný';
+
+$messages = array();
+$messages['filterunknownerror'] = 'Neznáma chyba serveru';
+$messages['filterconnerror'] = 'Nepodarilo sa pripojiť k managesieve serveru';
+$messages['filterdeleteerror'] = 'Nepodarilo sa zmazať filter, server ohlásil chybu';
+$messages['filterdeleted'] = 'Filter bol zmazaný';
+$messages['filtersaved'] = 'Filter bol uložený';
+$messages['filtersaveerror'] = 'Nepodarilo sa uložiť filter, server ohlásil chybu';
+$messages['filterdeleteconfirm'] = 'Naozaj si prajete zmazať tento filter?';
+$messages['ruledeleteconfirm'] = 'Naozaj si prajete zamzať toto pravidlo?';
+$messages['actiondeleteconfirm'] = 'Naozaj si prajete zmazať túto akciu?';
+$messages['forbiddenchars'] = 'Pole obsahuje nepovolené znaky';
+$messages['cannotbeempty'] = 'Pole nemôže byť prázdne';
+$messages['setactivateerror'] = 'Nepodarilo sa aktivovať zvolenú sadu filtrov, server ohlásil chybu';
+$messages['setdeactivateerror'] = 'Nepodarilo sa deaktivovať zvolenú sadu filtrov, server ohlásil chybu';
+$messages['setdeleteerror'] = 'Nepodarilo sa zmazať zvolenú sadu filtrov, server ohlásil chybu';
+$messages['setactivated'] = 'Sada filtrov bola aktivovaná';
+$messages['setdeactivated'] = 'Sada filtrov bola deaktivovaná';
+$messages['setdeleted'] = 'Sada filtrov bola zmazaná';
+$messages['setdeleteconfirm'] = 'Naozaj si prajete zmazať túto sadu filtrov?';
+$messages['setcreateerror'] = 'Nepodarilo sa vytvoriť sadu filtrov, server ohlásil chybu';
+$messages['setcreated'] = 'Sada filtrov bola vytvorená';
+$messages['emptyname'] = 'Názov sady filtrov nemôže byť prázdny';
+$messages['nametoolong'] = 'Názov sady filtrov je príliš dlhý'
+
+?>
diff --git a/plugins/managesieve/localization/sl_SI.inc b/plugins/managesieve/localization/sl_SI.inc
new file mode 100644
index 000000000..ab9ccad66
--- /dev/null
+++ b/plugins/managesieve/localization/sl_SI.inc
@@ -0,0 +1,53 @@
+<?php
+
+$labels['filters'] = 'Pravila';
+$labels['managefilters'] = 'Uredi sporočilna pravila';
+$labels['filtername'] = 'Ime pravila';
+$labels['newfilter'] = 'Novo pravilo';
+$labels['filteradd'] = 'Dodaj pravilo';
+$labels['filterdel'] = 'Izbriši pravilo';
+$labels['moveup'] = 'Pomakni se više';
+$labels['movedown'] = 'Pomakni se niže';
+$labels['filterallof'] = 'izpolnjeni morajo biti vsi pogoji';
+$labels['filteranyof'] = 'izpolnjen mora biti vsaj eden od navedenih pogojev';
+$labels['filterany'] = 'pogoj velja za vsa sporočila';
+$labels['filtercontains'] = 'vsebuje';
+$labels['filternotcontains'] = 'ne vsebuje';
+$labels['filteris'] = 'je enak/a';
+$labels['filterisnot'] = 'ni enak/a';
+$labels['filterexists'] = 'obstaja';
+$labels['filternotexists'] = 'ne obstaja';
+$labels['filterunder'] = 'pod';
+$labels['filterover'] = 'nad';
+$labels['addrule'] = 'Dodaj pravilo';
+$labels['delrule'] = 'Izbriši pravilo';
+$labels['messagemoveto'] = 'Premakni sporočilo v';
+$labels['messageredirect'] = 'Preusmeri sporočilo v';
+$labels['messagereply'] = 'Odgovori s sporočilom';
+$labels['messagedelete'] = 'Izbriši sporočilo';
+$labels['messagediscard'] = 'Zavrži s sporočilom';
+$labels['messagesrules'] = 'Določi pravila za dohodno pošto:';
+$labels['messagesactions'] = '...izvrši naslednja dejanja:';
+$labels['add'] = 'Dodaj';
+$labels['del'] = 'Izbriši';
+$labels['sender'] = 'Pošiljatelj';
+$labels['recipient'] = 'Prejemnik';
+$labels['vacationaddresses'] = 'Dodaten seznam naslovov prejemnikov (ločenih z vejico):';
+$labels['vacationdays'] = 'Kako pogosto naj bodo sporočila poslana (v dnevih):';
+$labels['vacationreason'] = 'Vsebina sporočila (vzrok za odsotnost):';
+$labels['rulestop'] = 'Prekini z izvajanjem pravil';
+
+$messages = array();
+$messages['filterunknownerror'] = 'Prišlo je do neznane napake.';
+$messages['filterconnerror'] = 'Povezave s strežnikom (managesieve) ni bilo mogoče vzpostaviti';
+$messages['filterdeleteerror'] = 'Pravila ni bilo mogoče izbrisati. Prišlo je do napake.';
+$messages['filterdeleted'] = 'Pravilo je bilo uspešno izbrisano.';
+$messages['filterdeleteconfirm'] = 'Ste prepričani, da želite izbrisati izbrano pravilo?';
+$messages['filtersaved'] = 'Pravilo je bilo uspešno shranjeno';
+$messages['filtersaveerror'] = 'Pravilo ni bilo shranjeno. Prišlo je do napake.';
+$messages['ruledeleteconfirm'] = 'Ste prepričani, da želite izbrisati izbrano pravilo?';
+$messages['actiondeleteconfirm'] = 'Ste prepričani, da želite izbrisati izbrano dejanje?';
+$messages['forbiddenchars'] = 'V polju so neveljavni znaki';
+$messages['cannotbeempty'] = 'Polje ne sme biti prazno';
+
+?>
diff --git a/plugins/managesieve/localization/sv_SE.inc b/plugins/managesieve/localization/sv_SE.inc
new file mode 100644
index 000000000..883525b71
--- /dev/null
+++ b/plugins/managesieve/localization/sv_SE.inc
@@ -0,0 +1,93 @@
+<?php
+
+$labels = array();
+$labels['filters'] = 'Filter';
+$labels['managefilters'] = 'Administrera filter';
+$labels['filtername'] = 'Filternamn';
+$labels['newfilter'] = 'Nytt filter';
+$labels['filteradd'] = 'Lägg till filter';
+$labels['filterdel'] = 'Ta bort filter';
+$labels['moveup'] = 'Flytta upp filter';
+$labels['movedown'] = 'Flytta ner filter';
+$labels['filterallof'] = 'Filtrera på alla följande regler';
+$labels['filteranyof'] = 'Filtrera på någon av följande regler';
+$labels['filterany'] = 'Filtrera alla meddelanden';
+$labels['filtercontains'] = 'innehåller';
+$labels['filternotcontains'] = 'inte innehåller';
+$labels['filteris'] = 'är lika med';
+$labels['filterisnot'] = 'är inte lika med';
+$labels['filterexists'] = 'finns';
+$labels['filternotexists'] = 'inte finns';
+$labels['filterunder'] = 'under';
+$labels['filterover'] = 'över';
+$labels['addrule'] = 'Lägg till regel';
+$labels['delrule'] = 'Ta bort regel';
+$labels['messagemoveto'] = 'Flytta meddelande till';
+$labels['messageredirect'] = 'Ändra mottagare till';
+$labels['messagecopyto'] = 'Kopiera meddelande till';
+$labels['messagesendcopy'] = 'Skicka kopia av meddelande till';
+$labels['messagereply'] = 'Besvara meddelande';
+$labels['messagedelete'] = 'Ta bort meddelande';
+$labels['messagediscard'] = 'Avböj med felmeddelande';
+$labels['messagesrules'] = 'För inkommande meddelande';
+$labels['messagesactions'] = 'Utför följande åtgärd';
+$labels['add'] = 'Lägg till';
+$labels['del'] = 'Ta bort';
+$labels['sender'] = 'Avsändare';
+$labels['recipient'] = 'Mottagare';
+$labels['vacationaddresses'] = 'Ytterligare mottagaradresser (avdelade med kommatecken)';
+$labels['vacationdays'] = 'Antal dagar mellan auto-svar:';
+$labels['vacationreason'] = 'Meddelande i auto-svar:';
+$labels['rulestop'] = 'Avsluta filtrering';
+$labels['filterset'] = 'Filtergrupp';
+$labels['filtersetadd'] = 'Lägg till filtergrupp';
+$labels['filtersetdel'] = 'Ta bort filtergrupp';
+$labels['filtersetact'] = 'Aktivera filtergrupp';
+$labels['filtersetdeact'] = 'Deaktivera filtergrupp';
+$labels['filtersetget'] = 'Exportera filtergrupp i textformat';
+$labels['filterdef'] = 'Filterdefinition';
+$labels['filtersetname'] = 'Filtergruppsnamn';
+$labels['newfilterset'] = 'Ny filtergrupp';
+$labels['active'] = 'aktiv';
+$labels['none'] = 'ingen';
+$labels['fromset'] = 'från grupp';
+$labels['fromfile'] = 'från fil';
+$labels['filterdisabled'] = 'Filter deaktiverat';
+$labels['countisgreaterthan'] = 'antal är större än';
+$labels['countisgreaterthanequal'] = 'antal är större än eller lika med';
+$labels['countislessthan'] = 'antal är mindre än';
+$labels['countislessthanequal'] = 'antal är mindre än eller lika med';
+$labels['countequals'] = 'antal är lika med';
+$labels['countnotequals'] = 'antal är inte lika med';
+$labels['valueisgreaterthan'] = 'värde är större än';
+$labels['valueisgreaterthanequal'] = 'värde är större än eller lika med';
+$labels['valueislessthan'] = 'värde är mindre än';
+$labels['valueislessthanequal'] = 'värde är mindre än eller lika med';
+$labels['valueequals'] = 'värde är lika med';
+$labels['valuenotequals'] = 'värde är inte lika med';
+
+$messages = array();
+$messages['filterunknownerror'] = 'Okänt serverfel';
+$messages['filterconnerror'] = 'Anslutning till serverns filtertjänst misslyckades';
+$messages['filterdeleteerror'] = 'Filtret kunde inte tas bort på grund av serverfel';
+$messages['filterdeleted'] = 'Filtret är borttaget';
+$messages['filtersaved'] = 'Filtret har sparats';
+$messages['filtersaveerror'] = 'Filtret kunde inte sparas på grund av serverfel';
+$messages['filterdeleteconfirm'] = 'Vill du ta bort det markerade filtret?';
+$messages['ruledeleteconfirm'] = 'Vill du ta bort filterregeln?';
+$messages['actiondeleteconfirm'] = 'Vill du ta bort filteråtgärden?';
+$messages['forbiddenchars'] = 'Otillåtet tecken i fältet';
+$messages['cannotbeempty'] = 'Fältet kan inte lämnas tomt';
+$messages['setactivateerror'] = 'Filtergruppen kunde inte aktiveras på grund av serverfel';
+$messages['setdeactivateerror'] = 'Filtergruppen kunde inte deaktiveras på grund av serverfel';
+$messages['setdeleteerror'] = 'Filtergruppen kunde inte tas bort på grund av serverfel';
+$messages['setactivated'] = 'Filtergruppen är aktiverad';
+$messages['setdeactivated'] = 'Filtergruppen är deaktiverad';
+$messages['setdeleted'] = 'Filtergruppen är borttagen';
+$messages['setdeleteconfirm'] = 'Vill du ta bort filtergruppen?';
+$messages['setcreateerror'] = 'Filtergruppen kunde inte läggas till på grund av serverfel';
+$messages['setcreated'] = 'Filtergruppen har lagts till';
+$messages['emptyname'] = 'Filtergruppen kan inte läggas till utan namn';
+$messages['nametoolong'] = 'Filtergruppen kan inte läggas till med för långt namn';
+
+?>
diff --git a/plugins/managesieve/localization/uk_UA.inc b/plugins/managesieve/localization/uk_UA.inc
new file mode 100644
index 000000000..9a62af975
--- /dev/null
+++ b/plugins/managesieve/localization/uk_UA.inc
@@ -0,0 +1,76 @@
+<?php
+
+$labels = array();
+$labels['filters'] = 'Фільтри';
+$labels['managefilters'] = 'Керування фільтрами вхідної пошти';
+$labels['filtername'] = 'Назва фільтру';
+$labels['newfilter'] = 'Новий фільтр';
+$labels['filteradd'] = 'Додати фільтр';
+$labels['filterdel'] = 'Видалити фільтр';
+$labels['moveup'] = 'Пересунути вгору';
+$labels['movedown'] = 'Пересунути вниз';
+$labels['filterallof'] = 'задовольняє усім наступним умовам';
+$labels['filteranyof'] = 'задовольняє будь-якій з умов';
+$labels['filterany'] = 'всі повідомлення';
+$labels['filtercontains'] = 'містить';
+$labels['filternotcontains'] = 'не містить';
+$labels['filteris'] = 'ідентичний до';
+$labels['filterisnot'] = 'не ідентичний до';
+$labels['filterexists'] = 'існує';
+$labels['filternotexists'] = 'не існує';
+$labels['filterunder'] = 'менше, ніж';
+$labels['filterover'] = 'більше, ніж';
+$labels['addrule'] = 'Додати правило';
+$labels['delrule'] = 'Видалити правило';
+$labels['messagemoveto'] = 'Пересунути повідомлення до';
+$labels['messageredirect'] = 'Перенаправити повідомлення до';
+$labels['messagereply'] = 'Автовідповідач';
+$labels['messagedelete'] = 'Видалити повідомлення';
+$labels['messagediscard'] = 'Відхилити з повідомленням';
+$labels['messagesrules'] = 'Для вхідної пошти';
+$labels['messagesactions'] = '... виконати дію:';
+$labels['add'] = 'Додати';
+$labels['del'] = 'Видалити';
+$labels['sender'] = 'Відправник';
+$labels['recipient'] = 'Отримувач';
+$labels['vacationaddresses'] = 'Додатковий список адрес отримувачів (розділених комою)';
+$labels['vacationdays'] = 'Як часто повторювати (у днях):';
+$labels['vacationreason'] = 'Текст повідомлення:';
+$labels['rulestop'] = 'Зупинити перевірку правил';
+$labels['filterset'] = 'Набір фільтрів';
+$labels['filtersetadd'] = 'Додати набір фільтрів';
+$labels['filtersetdel'] = 'Видалити поточний набір';
+$labels['filtersetact'] = 'Активувати поточний набір';
+$labels['filtersetget'] = 'Зберегти набір у текстовому форматі';
+$labels['filterdef'] = 'Параметри фільтру';
+$labels['filtersetname'] = 'Назва набору фільтрів';
+$labels['newfilterset'] = 'Новий набір фільтрів';
+$labels['active'] = 'активний';
+$labels['none'] = 'нічого';
+$labels['fromset'] = 'з набору';
+$labels['fromfile'] = 'з файлу';
+$labels['filterdisabled'] = 'Фільтр вимкнено';
+
+$messages = array();
+$messages['filterunknownerror'] = 'Невідома помилка сервера';
+$messages['filterconnerror'] = 'Неможливо з\'єднатися з сервером';
+$messages['filterdeleteerror'] = 'Неможливо видалити фільтр. Помилка сервера';
+$messages['filterdeleted'] = 'Фільтр успішно видалено';
+$messages['filtersaved'] = 'Фільтр успішно збережено';
+$messages['filtersaveerror'] = 'Неможливо зберегти фільтр. Помилка сервера';
+$messages['filterdeleteconfirm'] = 'Ви дійсно хочете видалити обраний фільтр?';
+$messages['ruledeleteconfirm'] = 'Ви дійсно хочете видалити обране правило?';
+$messages['actiondeleteconfirm'] = 'Ви дійсно хочете видалити обрану дію?';
+$messages['forbiddenchars'] = 'Введено заборонений символ';
+$messages['cannotbeempty'] = 'Поле не може бути пустим';
+$messages['setactivateerror'] = 'Неможливо активувати обраний набір. Помилка сервера';
+$messages['setdeleteerror'] = 'Неможливо видалити обраний набір. Помилка сервера';
+$messages['setactivated'] = 'Набір фільтрів активовано успішно';
+$messages['setdeleted'] = 'Набір фільтрів видалено успішно';
+$messages['setdeleteconfirm'] = 'Ви впевнені, що хочете видалити обраний набір?';
+$messages['setcreateerror'] = 'Не вдалося створити набір. Помилка сервера';
+$messages['setcreated'] = 'Набір фільтрів створено успішно';
+$messages['emptyname'] = 'Не вдалося створити набір. Введіть назву набору';
+$messages['nametoolong'] = 'Не вдалося створити набір. Занадто довга назва'
+
+?>
diff --git a/plugins/managesieve/localization/zh_CN.inc b/plugins/managesieve/localization/zh_CN.inc
new file mode 100644
index 000000000..a31a67d33
--- /dev/null
+++ b/plugins/managesieve/localization/zh_CN.inc
@@ -0,0 +1,49 @@
+<?php
+
+$labels['filters'] = '过滤器';
+$labels['managefilters'] = '管理邮件过滤器';
+$labels['filtername'] = '过滤器名称';
+$labels['newfilter'] = '新建过滤器';
+$labels['filteradd'] = '添加过滤器';
+$labels['filterdel'] = '删除过滤器';
+$labels['moveup'] = '上移';
+$labels['movedown'] = '下移';
+$labels['filterallof'] = '匹配所有规则';
+$labels['filteranyof'] = '匹配任意一条规则';
+$labels['filterany'] = '所有邮件';
+$labels['filtercontains'] = '包含';
+$labels['filternotcontains'] = '不包含';
+$labels['filteris'] = '等于';
+$labels['filterisnot'] = '不等于';
+$labels['filterexists'] = '存在';
+$labels['filternotexists'] = '不存在';
+$labels['filterunder'] = '小于';
+$labels['filterover'] = '大于';
+$labels['addrule'] = '添加规则';
+$labels['delrule'] = '删除规则';
+$labels['messagemoveto'] = '将邮件移动到';
+$labels['messageredirect'] = '将邮件转发到';
+$labels['messagereply'] = '回复以下信息';
+$labels['messagedelete'] = '删除邮件';
+$labels['messagediscard'] = '丢弃邮件并回复以下信息';
+$labels['messagesrules'] = '对收取的邮件应用规则:';
+$labels['messagesactions'] = '...执行以下动作:';
+$labels['add'] = '添加';
+$labels['del'] = '删除';
+$labels['sender'] = '发件人';
+$labels['recipient'] = '收件人';
+
+$messages = array();
+$messages['filterunknownerror'] = '未知的服务器错误';
+$messages['filterconnerror'] = '无法连接到 managesieve 服务器';
+$messages['filterdeleteerror'] = '无法删除过滤器。服务器错误';
+$messages['filterdeleted'] = '过滤器已成功删除';
+$messages['filterdeleteconfirm'] = '您确定要删除所选择的过滤器吗?';
+$messages['filtersaved'] = '过滤器已成功保存。';
+$messages['filtersaveerror'] = '无法保存过滤器。服务器错误';
+$messages['ruledeleteconfirm'] = '您确定要删除所选择的规则吗?';
+$messages['actiondeleteconfirm'] = '您确定要删除所选择的动作吗?';
+$messages['forbiddenchars'] = '内容中包含禁用的字符';
+$messages['cannotbeempty'] = '内容不能为空';
+
+?>
diff --git a/plugins/managesieve/localization/zh_TW.inc b/plugins/managesieve/localization/zh_TW.inc
new file mode 100644
index 000000000..8ab37d264
--- /dev/null
+++ b/plugins/managesieve/localization/zh_TW.inc
@@ -0,0 +1,78 @@
+<?php
+
+$labels['filters'] = '篩選器';
+$labels['managefilters'] = '設定篩選器';
+$labels['filtername'] = '篩選器名稱';
+$labels['newfilter'] = '建立新篩選器';
+$labels['filteradd'] = '增加篩選器';
+$labels['filterdel'] = '刪除篩選器';
+$labels['moveup'] = '上移';
+$labels['movedown'] = '下移';
+$labels['filterallof'] = '符合所有規則';
+$labels['filteranyof'] = '符合任一條規則';
+$labels['filterany'] = '所有信件';
+$labels['filtercontains'] = '包含';
+$labels['filternotcontains'] = '不包含';
+$labels['filteris'] = '等於';
+$labels['filterisnot'] = '不等於';
+$labels['filterexists'] = '存在';
+$labels['filternotexists'] = '不存在';
+$labels['filterunder'] = '小於';
+$labels['filterover'] = '大於';
+$labels['addrule'] = '新增規則';
+$labels['delrule'] = '刪除規則';
+$labels['messagemoveto'] = '將信件移至';
+$labels['messageredirect'] = '將信件轉寄至';
+$labels['messagereply'] = '以下列內容回覆';
+$labels['messagedelete'] = '刪除信件';
+$labels['messagediscard'] = '刪除信件並以下列內容回覆';
+$labels['messagesrules'] = '對新收到的信件:';
+$labels['messagesactions'] = '執行下列動作:';
+$labels['add'] = '新增';
+$labels['del'] = '刪除';
+$labels['sender'] = '寄件者';
+$labels['recipient'] = '收件者';
+$labels['vacationaddresses'] = '其他收件者(用半形逗號隔開):';
+$labels['vacationdays'] = '多久回覆一次(單位:天):';
+$labels['vacationreason'] = '信件內容(休假原因):';
+$labels['rulestop'] = '停止評估規則';
+$labels['filterset'] = '篩選器集合';
+$labels['filtersetadd'] = '加入篩選器集合';
+$labels['filtersetdel'] = '刪除目前的篩選器集合';
+$labels['filtersetact'] = '啟用目前的篩選器集合';
+$labels['filtersetdeact'] = '停用目前的篩選器集合';
+$labels['filtersetget'] = '以純文字下載篩選器集合';
+$labels['filterdef'] = '篩選器定義';
+$labels['filtersetname'] = '篩選器集合名稱';
+$labels['newfilterset'] = '建立篩選器集合';
+$labels['active'] = '啟用';
+$labels['none'] = '無';
+$labels['fromset'] = '從集合';
+$labels['fromfile'] = '重檔案';
+$labels['filterdisabled'] = '篩選器已停用';
+
+$messages = array();
+$messages['filterunknownerror'] = '未知的伺服器錯誤';
+$messages['filterconnerror'] = '無法與伺服器連線';
+$messages['filterdeleteerror'] = '無法刪除篩選器。發生伺服器錯誤';
+$messages['filterdeleted'] = '成功刪除篩選器';
+$messages['filterconfirmdelete'] = '您確定要刪除選擇的篩選器嗎?';
+$messages['filtersaved'] = '成功儲存篩選器。';
+$messages['filtersaveerror'] = '無法儲存篩選器。發生伺服器錯誤';
+$messages['ruledeleteconfirm'] = '您確定要刪除選的規則嗎?';
+$messages['actiondeleteconfirm'] = '您確定要刪除選擇的動作嗎?';
+$messages['forbiddenchars'] = '內容包含禁用字元';
+$messages['cannotbeempty'] = '內容不能為空白';
+$messages['setactivateerror'] = '無法啟用選擇的篩選器集合。 伺服器發生錯誤';
+$messages['setdeactivateerror'] = '無法停用選擇的篩選器集合。 伺服器發生錯誤';
+$messages['setdeleteerror'] = '無法刪除選擇的篩選器集合。 伺服器發生錯誤';
+$messages['setactivated'] = '篩選器集合成功啟用';
+$messages['setdeactivated'] = '篩選器集合成功停用';
+$messages['setdeleted'] = '篩選器集合成功刪除';
+$messages['setdeleteconfirm'] = '你確定要刪除選擇的篩選器集合嗎?';
+$messages['setcreateerror'] = '無法建立篩選器集合。 伺服器發生錯誤';
+$messages['setcreated'] = '篩選器集合成功建立';
+$messages['emptyname'] = '無法建立篩選器集合。 集合名稱空白';
+$messages['nametoolong'] = '無法建立篩選器集合。 名稱太長'
+
+?>
diff --git a/plugins/managesieve/managesieve.js b/plugins/managesieve/managesieve.js
new file mode 100644
index 000000000..ec6247aff
--- /dev/null
+++ b/plugins/managesieve/managesieve.js
@@ -0,0 +1,581 @@
+/* Sieve Filters (tab) */
+
+if (window.rcmail) {
+ rcmail.addEventListener('init', function(evt) {
+
+ var tab = $('<span>').attr('id', 'settingstabpluginmanagesieve').addClass('tablink');
+ var button = $('<a>').attr('href', rcmail.env.comm_path+'&_action=plugin.managesieve')
+ .attr('title', rcmail.gettext('managesieve.managefilters'))
+ .html(rcmail.gettext('managesieve.filters'))
+ .appendTo(tab);
+
+ // add button and register commands
+ rcmail.add_element(tab, 'tabs');
+ rcmail.register_command('plugin.managesieve-save', function() { rcmail.managesieve_save() }, true);
+ rcmail.register_command('plugin.managesieve-add', function() { rcmail.managesieve_add() }, true);
+ rcmail.register_command('plugin.managesieve-del', function() { rcmail.managesieve_del() }, true);
+ rcmail.register_command('plugin.managesieve-up', function() { rcmail.managesieve_up() }, true);
+ rcmail.register_command('plugin.managesieve-down', function() { rcmail.managesieve_down() }, true);
+ rcmail.register_command('plugin.managesieve-set', function() { rcmail.managesieve_set() }, true);
+ rcmail.register_command('plugin.managesieve-setadd', function() { rcmail.managesieve_setadd() }, true);
+ rcmail.register_command('plugin.managesieve-setdel', function() { rcmail.managesieve_setdel() }, true);
+ rcmail.register_command('plugin.managesieve-setact', function() { rcmail.managesieve_setact() }, true);
+ rcmail.register_command('plugin.managesieve-setget', function() { rcmail.managesieve_setget() }, true);
+
+ if (rcmail.env.action == 'plugin.managesieve') {
+ if (rcmail.gui_objects.sieveform) {
+ rcmail.enable_command('plugin.managesieve-save', true);
+ }
+ else {
+ rcmail.enable_command('plugin.managesieve-del', 'plugin.managesieve-up',
+ 'plugin.managesieve-down', false);
+ rcmail.enable_command('plugin.managesieve-add', 'plugin.managesieve-setadd', !rcmail.env.sieveconnerror);
+ }
+
+ // Create layer for form tips
+ if (!rcmail.env.framed) {
+ rcmail.env.ms_tip_layer = $('<div id="managesieve-tip" class="popupmenu"></div>');
+ rcmail.env.ms_tip_layer.appendTo(document.body);
+ }
+
+ if (rcmail.gui_objects.filterslist) {
+ var p = rcmail;
+ rcmail.filters_list = new rcube_list_widget(rcmail.gui_objects.filterslist, {multiselect:false, draggable:false, keyboard:false});
+ rcmail.filters_list.addEventListener('select', function(o){ p.managesieve_select(o); });
+ rcmail.filters_list.init();
+ rcmail.filters_list.focus();
+
+ rcmail.enable_command('plugin.managesieve-set', true);
+ rcmail.enable_command('plugin.managesieve-setact', 'plugin.managesieve-setget', rcmail.gui_objects.filtersetslist.length);
+ rcmail.enable_command('plugin.managesieve-setdel', rcmail.gui_objects.filtersetslist.length > 1);
+
+ $('#'+rcmail.buttons['plugin.managesieve-setact'][0].id).attr('title', rcmail.gettext('managesieve.filterset'
+ + (rcmail.gui_objects.filtersetslist.value == rcmail.env.active_set ? 'deact' : 'act')));
+ }
+ }
+ if (rcmail.gui_objects.sieveform && rcmail.env.rule_disabled)
+ $('#disabled').attr('checked', true);
+ });
+};
+
+/*********************************************************/
+/********* Managesieve filters methods *********/
+/*********************************************************/
+
+rcube_webmail.prototype.managesieve_add = function()
+{
+ this.load_managesieveframe();
+ this.filters_list.clear_selection();
+};
+
+rcube_webmail.prototype.managesieve_del = function()
+{
+ var id = this.filters_list.get_single_selection();
+ if (confirm(this.get_label('managesieve.filterdeleteconfirm')))
+ this.http_request('plugin.managesieve',
+ '_act=delete&_fid='+this.filters_list.rows[id].uid, true);
+};
+
+rcube_webmail.prototype.managesieve_up = function()
+{
+ var id = this.filters_list.get_single_selection();
+ this.http_request('plugin.managesieve',
+ '_act=up&_fid='+this.filters_list.rows[id].uid, true);
+};
+
+rcube_webmail.prototype.managesieve_down = function()
+{
+ var id = this.filters_list.get_single_selection();
+ this.http_request('plugin.managesieve',
+ '_act=down&_fid='+this.filters_list.rows[id].uid, true);
+};
+
+rcube_webmail.prototype.managesieve_rowid = function(id)
+{
+ var i, rows = this.filters_list.rows;
+
+ for (i=0; i<rows.length; i++)
+ if (rows[i] != null && rows[i].uid == id)
+ return i;
+};
+
+rcube_webmail.prototype.managesieve_updatelist = function(action, name, id, disabled)
+{
+ this.set_busy(true);
+
+ switch (action) {
+ case 'delete':
+ this.filters_list.remove_row(this.managesieve_rowid(id));
+ this.filters_list.clear_selection();
+ this.enable_command('plugin.managesieve-del', 'plugin.managesieve-up', 'plugin.managesieve-down', false);
+ this.show_contentframe(false);
+
+ // re-numbering filters
+ var i, rows = this.filters_list.rows;
+ for (i=0; i<rows.length; i++) {
+ if (rows[i] != null && rows[i].uid > id)
+ rows[i].uid = rows[i].uid-1;
+ }
+ break;
+
+ case 'down':
+ var from, fromstatus, status, rows = this.filters_list.rows;
+
+ // we need only to replace filter names...
+ for (var i=0; i<rows.length; i++) {
+ if (rows[i]==null) { // removed row
+ continue;
+ }
+ else if (rows[i].uid == id) {
+ from = rows[i].obj;
+ fromstatus = $(from).hasClass('disabled');
+ }
+ else if (rows[i].uid == id+1) {
+ name = rows[i].obj.cells[0].innerHTML;
+ status = $(rows[i].obj).hasClass('disabled');
+ rows[i].obj.cells[0].innerHTML = from.cells[0].innerHTML;
+ from.cells[0].innerHTML = name;
+ $(from)[status?'addClass':'removeClass']('disabled');
+ $(rows[i].obj)[fromstatus?'addClass':'removeClass']('disabled');
+ this.filters_list.highlight_row(i);
+ break;
+ }
+ }
+ // ... and disable/enable Down button
+ this.filters_listbuttons();
+ break;
+
+ case 'up':
+ var from, status, fromstatus, rows = this.filters_list.rows;
+
+ // we need only to replace filter names...
+ for (var i=0; i<rows.length; i++) {
+ if (rows[i] == null) { // removed row
+ continue;
+ }
+ else if (rows[i].uid == id-1) {
+ from = rows[i].obj;
+ fromstatus = $(from).hasClass('disabled');
+ this.filters_list.highlight_row(i);
+ }
+ else if (rows[i].uid == id) {
+ name = rows[i].obj.cells[0].innerHTML;
+ status = $(rows[i].obj).hasClass('disabled');
+ rows[i].obj.cells[0].innerHTML = from.cells[0].innerHTML;
+ from.cells[0].innerHTML = name;
+ $(from)[status?'addClass':'removeClass']('disabled');
+ $(rows[i].obj)[fromstatus?'addClass':'removeClass']('disabled');
+ break;
+ }
+ }
+ // ... and disable/enable Up button
+ this.filters_listbuttons();
+ break;
+
+ case 'update':
+ var rows = parent.rcmail.filters_list.rows;
+ for (var i=0; i<rows.length; i++)
+ if (rows[i] && rows[i].uid == id) {
+ rows[i].obj.cells[0].innerHTML = name;
+ if (disabled)
+ $(rows[i].obj).addClass('disabled');
+ else
+ $(rows[i].obj).removeClass('disabled');
+ break;
+ }
+ break;
+
+ case 'add':
+ var row, new_row, td, list = parent.rcmail.filters_list;
+
+ if (!list)
+ break;
+
+ for (var i=0; i<list.rows.length; i++)
+ if (list.rows[i] != null && String(list.rows[i].obj.id).match(/^rcmrow/))
+ row = list.rows[i].obj;
+
+ if (row) {
+ new_row = parent.document.createElement('tr');
+ new_row.id = 'rcmrow'+id;
+ td = parent.document.createElement('td');
+ new_row.appendChild(td);
+ list.insert_row(new_row, false);
+ if (disabled)
+ $(new_row).addClass('disabled');
+ if (row.cells[0].className)
+ td.className = row.cells[0].className;
+
+ td.innerHTML = name;
+ list.highlight_row(id);
+
+ parent.rcmail.enable_command('plugin.managesieve-del', 'plugin.managesieve-up', true);
+ }
+ else // refresh whole page
+ parent.rcmail.goto_url('plugin.managesieve');
+ break;
+ }
+
+ this.set_busy(false);
+};
+
+rcube_webmail.prototype.managesieve_select = function(list)
+{
+ var id = list.get_single_selection();
+ if (id != null)
+ this.load_managesieveframe(list.rows[id].uid);
+};
+
+rcube_webmail.prototype.managesieve_save = function()
+{
+ if (parent.rcmail && parent.rcmail.filters_list && this.gui_objects.sieveform.name != 'filtersetform') {
+ var id = parent.rcmail.filters_list.get_single_selection();
+ if (id != null)
+ this.gui_objects.sieveform.elements['_fid'].value = parent.rcmail.filters_list.rows[id].uid;
+ }
+ this.gui_objects.sieveform.submit();
+};
+
+// load filter frame
+rcube_webmail.prototype.load_managesieveframe = function(id)
+{
+ if (typeof(id) != 'undefined' && id != null) {
+ this.enable_command('plugin.managesieve-del', true);
+ this.filters_listbuttons();
+ }
+ else
+ this.enable_command('plugin.managesieve-up', 'plugin.managesieve-down', 'plugin.managesieve-del', false);
+
+ if (this.env.contentframe && window.frames && window.frames[this.env.contentframe]) {
+ target = window.frames[this.env.contentframe];
+ var msgid = this.set_busy(true, 'loading');
+ target.location.href = this.env.comm_path+'&_action=plugin.managesieve&_framed=1&_fid='+id+'&_unlock='+msgid;
+ }
+};
+
+// enable/disable Up/Down buttons
+rcube_webmail.prototype.filters_listbuttons = function()
+{
+ var id = this.filters_list.get_single_selection(),
+ rows = this.filters_list.rows;
+
+ for (var i=0; i<rows.length; i++) {
+ if (rows[i] == null) { // removed row
+ }
+ else if (i == id) {
+ this.enable_command('plugin.managesieve-up', false);
+ break;
+ }
+ else {
+ this.enable_command('plugin.managesieve-up', true);
+ break;
+ }
+ }
+
+ for (var i=rows.length-1; i>0; i--) {
+ if (rows[i] == null) { // removed row
+ }
+ else if (i == id) {
+ this.enable_command('plugin.managesieve-down', false);
+ break;
+ }
+ else {
+ this.enable_command('plugin.managesieve-down', true);
+ break;
+ }
+ }
+};
+
+// operations on filters form
+rcube_webmail.prototype.managesieve_ruleadd = function(id)
+{
+ this.http_post('plugin.managesieve', '_act=ruleadd&_rid='+id);
+};
+
+rcube_webmail.prototype.managesieve_rulefill = function(content, id, after)
+{
+ if (content != '') {
+ // create new element
+ var div = document.getElementById('rules'),
+ row = document.createElement('div');
+
+ this.managesieve_insertrow(div, row, after);
+ // fill row after inserting (for IE)
+ row.setAttribute('id', 'rulerow'+id);
+ row.className = 'rulerow';
+ row.innerHTML = content;
+
+ this.managesieve_formbuttons(div);
+ }
+};
+
+rcube_webmail.prototype.managesieve_ruledel = function(id)
+{
+ if (confirm(this.get_label('managesieve.ruledeleteconfirm'))) {
+ var row = document.getElementById('rulerow'+id);
+ row.parentNode.removeChild(row);
+ this.managesieve_formbuttons(document.getElementById('rules'));
+ }
+};
+
+rcube_webmail.prototype.managesieve_actionadd = function(id)
+{
+ this.http_post('plugin.managesieve', '_act=actionadd&_aid='+id);
+};
+
+rcube_webmail.prototype.managesieve_actionfill = function(content, id, after)
+{
+ if (content != '') {
+ var div = document.getElementById('actions'),
+ row = document.createElement('div');
+
+ this.managesieve_insertrow(div, row, after);
+ // fill row after inserting (for IE)
+ row.className = 'actionrow';
+ row.setAttribute('id', 'actionrow'+id);
+ row.innerHTML = content;
+
+ this.managesieve_formbuttons(div);
+ }
+};
+
+rcube_webmail.prototype.managesieve_actiondel = function(id)
+{
+ if (confirm(this.get_label('managesieve.actiondeleteconfirm'))) {
+ var row = document.getElementById('actionrow'+id);
+ row.parentNode.removeChild(row);
+ this.managesieve_formbuttons(document.getElementById('actions'));
+ }
+};
+
+// insert rule/action row in specified place on the list
+rcube_webmail.prototype.managesieve_insertrow = function(div, row, after)
+{
+ for (var i=0; i<div.childNodes.length; i++) {
+ if (div.childNodes[i].id == (div.id == 'rules' ? 'rulerow' : 'actionrow') + after)
+ break;
+ }
+
+ if (div.childNodes[i+1])
+ div.insertBefore(row, div.childNodes[i+1]);
+ else
+ div.appendChild(row);
+};
+
+// update Delete buttons status
+rcube_webmail.prototype.managesieve_formbuttons = function(div)
+{
+ var i, button, buttons = [];
+
+ // count and get buttons
+ for (i=0; i<div.childNodes.length; i++) {
+ if (div.id == 'rules' && div.childNodes[i].id) {
+ if (/rulerow/.test(div.childNodes[i].id))
+ buttons.push('ruledel' + div.childNodes[i].id.replace(/rulerow/, ''));
+ }
+ else if (div.childNodes[i].id) {
+ if (/actionrow/.test(div.childNodes[i].id))
+ buttons.push( 'actiondel' + div.childNodes[i].id.replace(/actionrow/, ''));
+ }
+ }
+
+ for (i=0; i<buttons.length; i++) {
+ button = document.getElementById(buttons[i]);
+ if (i>0 || buttons.length>1) {
+ $(button).removeClass('disabled');
+ button.removeAttribute('disabled');
+ }
+ else {
+ $(button).addClass('disabled');
+ button.setAttribute('disabled', true);
+ }
+ }
+};
+
+// Set change
+rcube_webmail.prototype.managesieve_set = function()
+{
+ var script = $(this.gui_objects.filtersetslist).val();
+ location.href = this.env.comm_path+'&_action=plugin.managesieve&_set='+script;
+};
+
+// Script download
+rcube_webmail.prototype.managesieve_setget = function()
+{
+ var script = $(this.gui_objects.filtersetslist).val();
+ location.href = this.env.comm_path+'&_action=plugin.managesieve&_act=setget&_set='+script;
+};
+
+// Set activate
+rcube_webmail.prototype.managesieve_setact = function()
+{
+ if (!this.gui_objects.filtersetslist)
+ return false;
+
+ var script = this.gui_objects.filtersetslist.value,
+ action = (script == rcmail.env.active_set ? 'deact' : 'setact');
+
+ this.http_post('plugin.managesieve', '_act='+action+'&_set='+script);
+};
+
+// Set activate flag in sets list after set activation
+rcube_webmail.prototype.managesieve_reset = function()
+{
+ if (!this.gui_objects.filtersetslist)
+ return false;
+
+ var list = this.gui_objects.filtersetslist,
+ opts = list.getElementsByTagName('option'),
+ label = ' (' + this.get_label('managesieve.active') + ')',
+ regx = new RegExp(RegExp.escape(label)+'$');
+
+ for (var x=0; x<opts.length; x++) {
+ if (opts[x].value != rcmail.env.active_set && opts[x].innerHTML.match(regx))
+ opts[x].innerHTML = opts[x].innerHTML.replace(regx, '');
+ else if (opts[x].value == rcmail.env.active_set)
+ opts[x].innerHTML = opts[x].innerHTML + label;
+ }
+
+ // change title of setact button
+ $('#'+rcmail.buttons['plugin.managesieve-setact'][0].id).attr('title', rcmail.gettext('managesieve.filterset'
+ + (list.value == rcmail.env.active_set ? 'deact' : 'act')));
+};
+
+// Set delete
+rcube_webmail.prototype.managesieve_setdel = function()
+{
+ if (!this.gui_objects.filtersetslist)
+ return false;
+
+ if (!confirm(this.get_label('managesieve.setdeleteconfirm')))
+ return false;
+
+ var script = this.gui_objects.filtersetslist.value;
+ this.http_post('plugin.managesieve', '_act=setdel&_set='+script);
+};
+
+// Set add
+rcube_webmail.prototype.managesieve_setadd = function()
+{
+ this.filters_list.clear_selection();
+ this.enable_command('plugin.managesieve-up', 'plugin.managesieve-down', 'plugin.managesieve-del', false);
+
+ if (this.env.contentframe && window.frames && window.frames[this.env.contentframe]) {
+ target = window.frames[this.env.contentframe];
+ var msgid = this.set_busy(true, 'loading');
+ target.location.href = this.env.comm_path+'&_action=plugin.managesieve&_framed=1&_newset=1&_unlock='+msgid;
+ }
+};
+
+rcube_webmail.prototype.managesieve_reload = function(set)
+{
+ this.env.reload_set = set;
+ window.setTimeout(function() {
+ location.href = rcmail.env.comm_path + '&_action=plugin.managesieve'
+ + (rcmail.env.reload_set ? '&_set=' + rcmail.env.reload_set : '')
+ }, 500);
+};
+
+// Register onmouse(leave/enter) events for tips on specified form element
+rcube_webmail.prototype.managesieve_tip_register = function(tips)
+{
+ for (var n in tips) {
+ $('#'+tips[n][0])
+ .bind('mouseenter', {str: tips[n][1]},
+ function(e) {
+ var offset = $(this).offset(),
+ tip = rcmail.env.framed ? parent.rcmail.env.ms_tip_layer : rcmail.env.ms_tip_layer,
+ left = offset.left,
+ top = offset.top - 12;
+
+ if (rcmail.env.framed) {
+ offset = $(parent.document.getElementById('filter-box')).offset();
+ top += offset.top;
+ left += offset.left;
+ }
+
+ tip.html(e.data.str)
+ top -= tip.height();
+
+ tip.css({left: left, top: top}).show();
+ })
+ .bind('mouseleave',
+ function(e) {
+ var tip = parent.rcmail && parent.rcmail.env.ms_tip_layer ?
+ parent.rcmail.env.ms_tip_layer : rcmail.env.ms_tip_layer;
+ tip.hide();
+ });
+ }
+};
+
+/*********************************************************/
+/********* Other Managesieve UI methods *********/
+/*********************************************************/
+
+function rule_header_select(id)
+{
+ var obj = document.getElementById('header' + id),
+ size = document.getElementById('rule_size' + id),
+ op = document.getElementById('rule_op' + id),
+ target = document.getElementById('rule_target' + id),
+ header = document.getElementById('custom_header' + id);
+
+ if (obj.value == 'size') {
+ size.style.display = 'inline';
+ op.style.display = 'none';
+ target.style.display = 'none';
+ header.style.display = 'none';
+ }
+ else {
+ header.style.display = obj.value != '...' ? 'none' : 'inline';
+ size.style.display = 'none';
+ op.style.display = 'inline';
+ rule_op_select(id);
+ }
+};
+
+function rule_op_select(id)
+{
+ var obj = document.getElementById('rule_op' + id),
+ target = document.getElementById('rule_target' + id);
+
+ target.style.display = obj.value == 'exists' || obj.value == 'notexists' ? 'none' : 'inline';
+};
+
+function rule_join_radio(value)
+{
+ $('#rules').css('display', value == 'any' ? 'none' : 'block');
+};
+
+function action_type_select(id)
+{
+ var obj = document.getElementById('action_type' + id),
+ enabled = {},
+ elems = {
+ mailbox: document.getElementById('action_mailbox' + id),
+ target: document.getElementById('action_target' + id),
+ target_area: document.getElementById('action_target_area' + id),
+ flags: document.getElementById('action_flags' + id),
+ vacation: document.getElementById('action_vacation' + id)
+ };
+
+ if (obj.value == 'fileinto' || obj.value == 'fileinto_copy') {
+ enabled.mailbox = 1;
+ }
+ else if (obj.value == 'redirect' || obj.value == 'redirect_copy') {
+ enabled.target = 1;
+ }
+ else if (obj.value.match(/^reject|ereject$/)) {
+ enabled.target_area = 1;
+ }
+ else if (obj.value.match(/^(add|set|remove)flag$/)) {
+ enabled.flags = 1;
+ }
+ else if (obj.value == 'vacation') {
+ enabled.vacation = 1;
+ }
+
+ for (var x in elems) {
+ elems[x].style.display = !enabled[x] ? 'none' : 'inline';
+ }
+};
diff --git a/plugins/managesieve/managesieve.php b/plugins/managesieve/managesieve.php
new file mode 100644
index 000000000..8ee3b3bde
--- /dev/null
+++ b/plugins/managesieve/managesieve.php
@@ -0,0 +1,1211 @@
+<?php
+
+/**
+ * Managesieve (Sieve Filters)
+ *
+ * Plugin that adds a possibility to manage Sieve filters in Thunderbird's style.
+ * It's clickable interface which operates on text scripts and communicates
+ * with server using managesieve protocol. Adds Filters tab in Settings.
+ *
+ * @version 4.3
+ * @author Aleksander Machniak <alec@alec.pl>
+ *
+ * Configuration (see config.inc.php.dist)
+ *
+ * Copyright (C) 2008-2011, The Roundcube Dev Team
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2
+ * as published by the Free Software Foundation.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License along
+ * with this program; if not, write to the Free Software Foundation, Inc.,
+ * 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+ *
+ * $Id$
+ */
+
+class managesieve extends rcube_plugin
+{
+ public $task = 'settings';
+
+ private $rc;
+ private $sieve;
+ private $errors;
+ private $form;
+ private $tips = array();
+ private $script = array();
+ private $exts = array();
+ private $headers = array(
+ 'subject' => 'Subject',
+ 'sender' => 'From',
+ 'recipient' => 'To',
+ );
+
+
+ function init()
+ {
+ // add Tab label/title
+ $this->add_texts('localization/', array('filters','managefilters'));
+
+ // register actions
+ $this->register_action('plugin.managesieve', array($this, 'managesieve_actions'));
+ $this->register_action('plugin.managesieve-save', array($this, 'managesieve_save'));
+
+ // include main js script
+ $this->include_script('managesieve.js');
+ }
+
+ function managesieve_start()
+ {
+ $this->rc = rcmail::get_instance();
+ $this->load_config();
+
+ // register UI objects
+ $this->rc->output->add_handlers(array(
+ 'filterslist' => array($this, 'filters_list'),
+ 'filtersetslist' => array($this, 'filtersets_list'),
+ 'filterframe' => array($this, 'filter_frame'),
+ 'filterform' => array($this, 'filter_form'),
+ 'filtersetform' => array($this, 'filterset_form'),
+ ));
+
+ // Add include path for internal classes
+ $include_path = $this->home . '/lib' . PATH_SEPARATOR;
+ $include_path .= ini_get('include_path');
+ set_include_path($include_path);
+
+ $host = rcube_parse_host($this->rc->config->get('managesieve_host', 'localhost'));
+ $port = $this->rc->config->get('managesieve_port', 2000);
+
+ $host = rcube_idn_to_ascii($host);
+
+ // try to connect to managesieve server and to fetch the script
+ $this->sieve = new rcube_sieve($_SESSION['username'],
+ $this->rc->decrypt($_SESSION['password']), $host, $port,
+ $this->rc->config->get('managesieve_auth_type'),
+ $this->rc->config->get('managesieve_usetls', false),
+ $this->rc->config->get('managesieve_disabled_extensions'),
+ $this->rc->config->get('managesieve_debug', false),
+ $this->rc->config->get('managesieve_auth_cid'),
+ $this->rc->config->get('managesieve_auth_pw')
+ );
+
+ if (!($error = $this->sieve->error())) {
+
+ $list = $this->sieve->get_scripts();
+ $active = $this->sieve->get_active();
+ $_SESSION['managesieve_active'] = $active;
+
+ if (!empty($_GET['_set'])) {
+ $script_name = get_input_value('_set', RCUBE_INPUT_GET);
+ }
+ else if (!empty($_SESSION['managesieve_current'])) {
+ $script_name = $_SESSION['managesieve_current'];
+ }
+ else {
+ // get active script
+ if ($active) {
+ $script_name = $active;
+ }
+ else if ($list) {
+ $script_name = $list[0];
+ }
+ // create a new (initial) script
+ else {
+ // if script not exists build default script contents
+ $script_file = $this->rc->config->get('managesieve_default');
+ $script_name = 'roundcube';
+ if ($script_file && is_readable($script_file))
+ $content = file_get_contents($script_file);
+
+ // add script and set it active
+ if ($this->sieve->save_script($script_name, $content))
+ if ($this->sieve->activate($script_name))
+ $_SESSION['managesieve_active'] = $script_name;
+ }
+ }
+
+ if ($script_name)
+ $this->sieve->load($script_name);
+
+ $error = $this->sieve->error();
+ }
+
+ // finally set script objects
+ if ($error) {
+ switch ($error) {
+ case SIEVE_ERROR_CONNECTION:
+ case SIEVE_ERROR_LOGIN:
+ $this->rc->output->show_message('managesieve.filterconnerror', 'error');
+ break;
+ default:
+ $this->rc->output->show_message('managesieve.filterunknownerror', 'error');
+ break;
+ }
+
+ raise_error(array('code' => 403, 'type' => 'php',
+ 'file' => __FILE__, 'line' => __LINE__,
+ 'message' => "Unable to connect to managesieve on $host:$port"), true, false);
+
+ // to disable 'Add filter' button set env variable
+ $this->rc->output->set_env('filterconnerror', true);
+ $this->script = array();
+ }
+ else {
+ $this->script = $this->sieve->script->as_array();
+ $this->exts = $this->sieve->get_extensions();
+ $this->rc->output->set_env('active_set', $_SESSION['managesieve_active']);
+ $_SESSION['managesieve_current'] = $this->sieve->current;
+ }
+
+ return $error;
+ }
+
+ function managesieve_actions()
+ {
+ // Init plugin and handle managesieve connection
+ $error = $this->managesieve_start();
+
+ // Handle user requests
+ if ($action = get_input_value('_act', RCUBE_INPUT_GPC)) {
+ $fid = (int) get_input_value('_fid', RCUBE_INPUT_GET);
+
+ if ($action == 'up' && !$error) {
+ if ($fid && isset($this->script[$fid]) && isset($this->script[$fid-1])) {
+ if ($this->sieve->script->update_rule($fid, $this->script[$fid-1]) !== false
+ && $this->sieve->script->update_rule($fid-1, $this->script[$fid]) !== false) {
+ $result = $this->sieve->save();
+ }
+
+ if ($result) {
+// $this->rc->output->show_message('managesieve.filtersaved', 'confirmation');
+ $this->rc->output->command('managesieve_updatelist', 'up', '', $fid);
+ } else
+ $this->rc->output->show_message('managesieve.filtersaveerror', 'error');
+ }
+ }
+ else if ($action == 'down' && !$error) {
+ if (isset($this->script[$fid]) && isset($this->script[$fid+1])) {
+ if ($this->sieve->script->update_rule($fid, $this->script[$fid+1]) !== false
+ && $this->sieve->script->update_rule($fid+1, $this->script[$fid]) !== false) {
+ $result = $this->sieve->save();
+ }
+
+ if ($result === true) {
+// $this->rc->output->show_message('managesieve.filtersaved', 'confirmation');
+ $this->rc->output->command('managesieve_updatelist', 'down', '', $fid);
+ } else {
+ $this->rc->output->show_message('managesieve.filtersaveerror', 'error');
+ }
+ }
+ }
+ else if ($action == 'delete' && !$error) {
+ if (isset($this->script[$fid])) {
+ if ($this->sieve->script->delete_rule($fid))
+ $result = $this->sieve->save();
+
+ if ($result === true) {
+ $this->rc->output->show_message('managesieve.filterdeleted', 'confirmation');
+ $this->rc->output->command('managesieve_updatelist', 'delete', '', $fid);
+ } else {
+ $this->rc->output->show_message('managesieve.filterdeleteerror', 'error');
+ }
+ }
+ }
+ else if ($action == 'setact' && !$error) {
+ $script_name = get_input_value('_set', RCUBE_INPUT_GPC);
+ $result = $this->sieve->activate($script_name);
+
+ if ($result === true) {
+ $this->rc->output->set_env('active_set', $script_name);
+ $this->rc->output->show_message('managesieve.setactivated', 'confirmation');
+ $this->rc->output->command('managesieve_reset');
+ $_SESSION['managesieve_active'] = $script_name;
+ } else {
+ $this->rc->output->show_message('managesieve.setactivateerror', 'error');
+ }
+ }
+ else if ($action == 'deact' && !$error) {
+ $result = $this->sieve->deactivate();
+
+ if ($result === true) {
+ $this->rc->output->set_env('active_set', '');
+ $this->rc->output->show_message('managesieve.setdeactivated', 'confirmation');
+ $this->rc->output->command('managesieve_reset');
+ $_SESSION['managesieve_active'] = '';
+ } else {
+ $this->rc->output->show_message('managesieve.setdeactivateerror', 'error');
+ }
+ }
+ else if ($action == 'setdel' && !$error) {
+ $script_name = get_input_value('_set', RCUBE_INPUT_GPC);
+ $result = $this->sieve->remove($script_name);
+
+ if ($result === true) {
+ $this->rc->output->show_message('managesieve.setdeleted', 'confirmation');
+ $this->rc->output->command('managesieve_reload');
+ $this->rc->session->remove('managesieve_current');
+ } else {
+ $this->rc->output->show_message('managesieve.setdeleteerror', 'error');
+ }
+ }
+ else if ($action == 'setget') {
+ $script_name = get_input_value('_set', RCUBE_INPUT_GPC);
+ $script = $this->sieve->get_script($script_name);
+
+ if (PEAR::isError($script))
+ exit;
+
+ $browser = new rcube_browser;
+
+ // send download headers
+ header("Content-Type: application/octet-stream");
+ header("Content-Length: ".strlen($script));
+
+ if ($browser->ie)
+ header("Content-Type: application/force-download");
+ if ($browser->ie && $browser->ver < 7)
+ $filename = rawurlencode(abbreviate_string($script_name, 55));
+ else if ($browser->ie)
+ $filename = rawurlencode($script_name);
+ else
+ $filename = addcslashes($script_name, '\\"');
+
+ header("Content-Disposition: attachment; filename=\"$filename.txt\"");
+ echo $script;
+ exit;
+ }
+ elseif ($action == 'ruleadd') {
+ $rid = get_input_value('_rid', RCUBE_INPUT_GPC);
+ $id = $this->genid();
+ $content = $this->rule_div($fid, $id, false);
+
+ $this->rc->output->command('managesieve_rulefill', $content, $id, $rid);
+ }
+ elseif ($action == 'actionadd') {
+ $aid = get_input_value('_aid', RCUBE_INPUT_GPC);
+ $id = $this->genid();
+ $content = $this->action_div($fid, $id, false);
+
+ $this->rc->output->command('managesieve_actionfill', $content, $id, $aid);
+ }
+
+ $this->rc->output->send();
+ }
+
+ $this->managesieve_send();
+ }
+
+ function managesieve_save()
+ {
+ // Init plugin and handle managesieve connection
+ $error = $this->managesieve_start();
+
+ // filters set add action
+ if (!empty($_POST['_newset'])) {
+ $name = get_input_value('_name', RCUBE_INPUT_POST);
+ $copy = get_input_value('_copy', RCUBE_INPUT_POST);
+ $from = get_input_value('_from', RCUBE_INPUT_POST);
+
+ if (!$name)
+ $error = 'managesieve.emptyname';
+ else if (mb_strlen($name)>128)
+ $error = 'managesieve.nametoolong';
+ else if ($from == 'file') {
+ // from file
+ if (is_uploaded_file($_FILES['_file']['tmp_name'])) {
+ $file = file_get_contents($_FILES['_file']['tmp_name']);
+ $file = preg_replace('/\r/', '', $file);
+ // for security don't save script directly
+ // check syntax before, like this...
+ $this->sieve->load_script($file);
+ if (!$this->sieve->save($name)) {
+ $error = 'managesieve.setcreateerror';
+ }
+ }
+ else { // upload failed
+ $err = $_FILES['_file']['error'];
+ $error = true;
+
+ if ($err == UPLOAD_ERR_INI_SIZE || $err == UPLOAD_ERR_FORM_SIZE) {
+ $msg = rcube_label(array('name' => 'filesizeerror',
+ 'vars' => array('size' =>
+ show_bytes(parse_bytes(ini_get('upload_max_filesize'))))));
+ }
+ else {
+ $error = 'fileuploaderror';
+ }
+ }
+ }
+ else if (!$this->sieve->copy($name, $from == 'set' ? $copy : '')) {
+ $error = 'managesieve.setcreateerror';
+ }
+
+ if (!$error) {
+ $this->rc->output->show_message('managesieve.setcreated', 'confirmation');
+ $this->rc->output->command('parent.managesieve_reload', $name);
+ } else if ($msg) {
+ $this->rc->output->command('display_message', $msg, 'error');
+ } else {
+ $this->rc->output->show_message($error, 'error');
+ }
+ }
+ // filter add/edit action
+ else if (isset($_POST['_name'])) {
+ $name = trim(get_input_value('_name', RCUBE_INPUT_POST, true));
+ $fid = trim(get_input_value('_fid', RCUBE_INPUT_POST));
+ $join = trim(get_input_value('_join', RCUBE_INPUT_POST));
+
+ // and arrays
+ $headers = $_POST['_header'];
+ $cust_headers = $_POST['_custom_header'];
+ $ops = $_POST['_rule_op'];
+ $sizeops = $_POST['_rule_size_op'];
+ $sizeitems = $_POST['_rule_size_item'];
+ $sizetargets = $_POST['_rule_size_target'];
+ $targets = $_POST['_rule_target'];
+ $act_types = $_POST['_action_type'];
+ $mailboxes = $_POST['_action_mailbox'];
+ $act_targets = $_POST['_action_target'];
+ $area_targets = $_POST['_action_target_area'];
+ $reasons = $_POST['_action_reason'];
+ $addresses = $_POST['_action_addresses'];
+ $days = $_POST['_action_days'];
+ $subject = $_POST['_action_subject'];
+ $flags = $_POST['_action_flags'];
+
+ // we need a "hack" for radiobuttons
+ foreach ($sizeitems as $item)
+ $items[] = $item;
+
+ $this->form['disabled'] = $_POST['_disabled'] ? true : false;
+ $this->form['join'] = $join=='allof' ? true : false;
+ $this->form['name'] = $name;
+ $this->form['tests'] = array();
+ $this->form['actions'] = array();
+
+ if ($name == '')
+ $this->errors['name'] = $this->gettext('cannotbeempty');
+ else {
+ foreach($this->script as $idx => $rule)
+ if($rule['name'] == $name && $idx != $fid) {
+ $this->errors['name'] = $this->gettext('ruleexist');
+ break;
+ }
+ }
+
+ $i = 0;
+ // rules
+ if ($join == 'any') {
+ $this->form['tests'][0]['test'] = 'true';
+ }
+ else {
+ foreach ($headers as $idx => $header) {
+ $header = $this->strip_value($header);
+ $target = $this->strip_value($targets[$idx], true);
+ $op = $this->strip_value($ops[$idx]);
+
+ // normal header
+ if (in_array($header, $this->headers)) {
+ if (preg_match('/^not/', $op))
+ $this->form['tests'][$i]['not'] = true;
+ $type = preg_replace('/^not/', '', $op);
+
+ if ($type == 'exists') {
+ $this->form['tests'][$i]['test'] = 'exists';
+ $this->form['tests'][$i]['arg'] = $header;
+ }
+ else {
+ $this->form['tests'][$i]['type'] = $type;
+ $this->form['tests'][$i]['test'] = 'header';
+ $this->form['tests'][$i]['arg1'] = $header;
+ $this->form['tests'][$i]['arg2'] = $target;
+
+ if ($target == '')
+ $this->errors['tests'][$i]['target'] = $this->gettext('cannotbeempty');
+ else if (preg_match('/^(value|count)-/', $type) && !preg_match('/[0-9]+/', $target))
+ $this->errors['tests'][$i]['target'] = $this->gettext('forbiddenchars');
+ }
+ }
+ else
+ switch ($header) {
+ case 'size':
+ $sizeop = $this->strip_value($sizeops[$idx]);
+ $sizeitem = $this->strip_value($items[$idx]);
+ $sizetarget = $this->strip_value($sizetargets[$idx]);
+
+ $this->form['tests'][$i]['test'] = 'size';
+ $this->form['tests'][$i]['type'] = $sizeop;
+ $this->form['tests'][$i]['arg'] = $sizetarget.$sizeitem;
+
+ if ($sizetarget == '')
+ $this->errors['tests'][$i]['sizetarget'] = $this->gettext('cannotbeempty');
+ else if (!preg_match('/^[0-9]+(K|M|G)*$/i', $sizetarget))
+ $this->errors['tests'][$i]['sizetarget'] = $this->gettext('forbiddenchars');
+ break;
+ case '...':
+ $cust_header = $headers = $this->strip_value($cust_headers[$idx]);
+
+ if (preg_match('/^not/', $op))
+ $this->form['tests'][$i]['not'] = true;
+ $type = preg_replace('/^not/', '', $op);
+
+ if ($cust_header == '')
+ $this->errors['tests'][$i]['header'] = $this->gettext('cannotbeempty');
+ else {
+ $headers = preg_split('/[\s,]+/', $cust_header, -1, PREG_SPLIT_NO_EMPTY);
+
+ if (!count($headers))
+ $this->errors['tests'][$i]['header'] = $this->gettext('cannotbeempty');
+ else {
+ foreach ($headers as $hr)
+ if (!preg_match('/^[a-z0-9-]+$/i', $hr))
+ $this->errors['tests'][$i]['header'] = $this->gettext('forbiddenchars');
+ }
+ }
+
+ if (empty($this->errors['tests'][$i]['header']))
+ $cust_header = (is_array($headers) && count($headers) == 1) ? $headers[0] : $headers;
+
+ if ($type == 'exists') {
+ $this->form['tests'][$i]['test'] = 'exists';
+ $this->form['tests'][$i]['arg'] = $cust_header;
+ }
+ else {
+ $this->form['tests'][$i]['test'] = 'header';
+ $this->form['tests'][$i]['type'] = $type;
+ $this->form['tests'][$i]['arg1'] = $cust_header;
+ $this->form['tests'][$i]['arg2'] = $target;
+
+ if ($target == '')
+ $this->errors['tests'][$i]['target'] = $this->gettext('cannotbeempty');
+ else if (preg_match('/^(value|count)-/', $type) && !preg_match('/[0-9]+/', $target))
+ $this->errors['tests'][$i]['target'] = $this->gettext('forbiddenchars');
+ }
+ break;
+ }
+ $i++;
+ }
+ }
+
+ $i = 0;
+ // actions
+ foreach($act_types as $idx => $type) {
+ $type = $this->strip_value($type);
+ $target = $this->strip_value($act_targets[$idx]);
+
+ switch ($type) {
+
+ case 'fileinto':
+ case 'fileinto_copy':
+ $mailbox = $this->strip_value($mailboxes[$idx]);
+ $this->form['actions'][$i]['target'] = $this->mod_mailbox($mailbox, 'in');
+ if ($type == 'fileinto_copy') {
+ $type = 'fileinto';
+ $this->form['actions'][$i]['copy'] = true;
+ }
+ break;
+
+ case 'reject':
+ case 'ereject':
+ $target = $this->strip_value($area_targets[$idx]);
+ $this->form['actions'][$i]['target'] = str_replace("\r\n", "\n", $target);
+
+ // if ($target == '')
+// $this->errors['actions'][$i]['targetarea'] = $this->gettext('cannotbeempty');
+ break;
+
+ case 'redirect':
+ case 'redirect_copy':
+ $this->form['actions'][$i]['target'] = $target;
+
+ if ($this->form['actions'][$i]['target'] == '')
+ $this->errors['actions'][$i]['target'] = $this->gettext('cannotbeempty');
+ else if (!check_email($this->form['actions'][$i]['target']))
+ $this->errors['actions'][$i]['target'] = $this->gettext('noemailwarning');
+
+ if ($type == 'redirect_copy') {
+ $type = 'redirect';
+ $this->form['actions'][$i]['copy'] = true;
+ }
+ break;
+
+ case 'addflag':
+ case 'setflag':
+ case 'removeflag':
+ $_target = array();
+ if (empty($flags[$idx])) {
+ $this->errors['actions'][$i]['target'] = $this->gettext('noflagset');
+ }
+ else {
+ foreach ($flags[$idx] as $flag) {
+ $_target[] = $this->strip_value($flag);
+ }
+ }
+ $this->form['actions'][$i]['target'] = $_target;
+ break;
+
+ case 'vacation':
+ $reason = $this->strip_value($reasons[$idx]);
+ $this->form['actions'][$i]['reason'] = str_replace("\r\n", "\n", $reason);
+ $this->form['actions'][$i]['days'] = $days[$idx];
+ $this->form['actions'][$i]['subject'] = $subject[$idx];
+ $this->form['actions'][$i]['addresses'] = explode(',', $addresses[$idx]);
+// @TODO: vacation :mime, :from, :handle
+
+ if ($this->form['actions'][$i]['addresses']) {
+ foreach($this->form['actions'][$i]['addresses'] as $aidx => $address) {
+ $address = trim($address);
+ if (!$address)
+ unset($this->form['actions'][$i]['addresses'][$aidx]);
+ else if(!check_email($address)) {
+ $this->errors['actions'][$i]['addresses'] = $this->gettext('noemailwarning');
+ break;
+ } else
+ $this->form['actions'][$i]['addresses'][$aidx] = $address;
+ }
+ }
+
+ if ($this->form['actions'][$i]['reason'] == '')
+ $this->errors['actions'][$i]['reason'] = $this->gettext('cannotbeempty');
+ if ($this->form['actions'][$i]['days'] && !preg_match('/^[0-9]+$/', $this->form['actions'][$i]['days']))
+ $this->errors['actions'][$i]['days'] = $this->gettext('forbiddenchars');
+ break;
+ }
+
+ $this->form['actions'][$i]['type'] = $type;
+ $i++;
+ }
+
+ if (!$this->errors) {
+ // zapis skryptu
+ if (!isset($this->script[$fid])) {
+ $fid = $this->sieve->script->add_rule($this->form);
+ $new = true;
+ } else
+ $fid = $this->sieve->script->update_rule($fid, $this->form);
+
+ if ($fid !== false)
+ $save = $this->sieve->save();
+
+ if ($save && $fid !== false) {
+ $this->rc->output->show_message('managesieve.filtersaved', 'confirmation');
+ $this->rc->output->add_script(
+ sprintf("rcmail.managesieve_updatelist('%s', '%s', %d, %d);",
+ isset($new) ? 'add' : 'update', Q($this->form['name']),
+ $fid, $this->form['disabled']),
+ 'foot');
+ }
+ else {
+ $this->rc->output->show_message('managesieve.filtersaveerror', 'error');
+// $this->rc->output->send();
+ }
+ }
+ }
+
+ $this->managesieve_send();
+ }
+
+ private function managesieve_send()
+ {
+ // Handle form action
+ if (isset($_GET['_framed']) || isset($_POST['_framed'])) {
+ if (isset($_GET['_newset']) || isset($_POST['_newset'])) {
+ $this->rc->output->send('managesieve.setedit');
+ }
+ else {
+ $this->rc->output->send('managesieve.filteredit');
+ }
+ } else {
+ $this->rc->output->set_pagetitle($this->gettext('filters'));
+ $this->rc->output->send('managesieve.managesieve');
+ }
+ }
+
+ // return the filters list as HTML table
+ function filters_list($attrib)
+ {
+ // add id to message list table if not specified
+ if (!strlen($attrib['id']))
+ $attrib['id'] = 'rcmfilterslist';
+
+ // define list of cols to be displayed
+ $a_show_cols = array('managesieve.filtername');
+
+ foreach($this->script as $idx => $filter)
+ $result[] = array(
+ 'managesieve.filtername' => $filter['name'],
+ 'id' => $idx,
+ 'class' => $filter['disabled'] ? 'disabled' : '',
+ );
+
+ // create XHTML table
+ $out = rcube_table_output($attrib, $result, $a_show_cols, 'id');
+
+ // set client env
+ $this->rc->output->add_gui_object('filterslist', $attrib['id']);
+ $this->rc->output->include_script('list.js');
+
+ // add some labels to client
+ $this->rc->output->add_label('managesieve.filterdeleteconfirm');
+
+ return $out;
+ }
+
+ // return the filters list as <SELECT>
+ function filtersets_list($attrib)
+ {
+ // add id to message list table if not specified
+ if (!strlen($attrib['id']))
+ $attrib['id'] = 'rcmfiltersetslist';
+
+ $list = $this->sieve->get_scripts();
+ $active = $this->sieve->get_active();
+
+ $select = new html_select(array('name' => '_set', 'id' => $attrib['id'],
+ 'onchange' => 'rcmail.managesieve_set()'));
+
+ if ($list) {
+ asort($list, SORT_LOCALE_STRING);
+
+ foreach ($list as $set)
+ $select->add($set . ($set == $active ? ' ('.$this->gettext('active').')' : ''), $set);
+ }
+
+ $out = $select->show($this->sieve->current);
+
+ // set client env
+ $this->rc->output->add_gui_object('filtersetslist', $attrib['id']);
+ $this->rc->output->add_label(
+ 'managesieve.setdeleteconfirm',
+ 'managesieve.active',
+ 'managesieve.filtersetact',
+ 'managesieve.filtersetdeact'
+ );
+
+ return $out;
+ }
+
+ function filter_frame($attrib)
+ {
+ if (!$attrib['id'])
+ $attrib['id'] = 'rcmfilterframe';
+
+ $attrib['name'] = $attrib['id'];
+
+ $this->rc->output->set_env('contentframe', $attrib['name']);
+ $this->rc->output->set_env('blankpage', $attrib['src'] ?
+ $this->rc->output->abs_url($attrib['src']) : 'program/blank.gif');
+
+ return html::tag('iframe', $attrib);
+ }
+
+ function filterset_form($attrib)
+ {
+ if (!$attrib['id'])
+ $attrib['id'] = 'rcmfiltersetform';
+
+ $out = '<form name="filtersetform" action="./" method="post" enctype="multipart/form-data">'."\n";
+
+ $hiddenfields = new html_hiddenfield(array('name' => '_task', 'value' => $this->rc->task));
+ $hiddenfields->add(array('name' => '_action', 'value' => 'plugin.managesieve-save'));
+ $hiddenfields->add(array('name' => '_framed', 'value' => ($_POST['_framed'] || $_GET['_framed'] ? 1 : 0)));
+ $hiddenfields->add(array('name' => '_newset', 'value' => 1));
+
+ $out .= $hiddenfields->show();
+
+ $name = get_input_value('_name', RCUBE_INPUT_POST);
+ $copy = get_input_value('_copy', RCUBE_INPUT_POST);
+ $selected = get_input_value('_from', RCUBE_INPUT_POST);
+
+ // filter set name input
+ $input_name = new html_inputfield(array('name' => '_name', 'id' => '_name', 'size' => 30,
+ 'class' => ($this->errors['name'] ? 'error' : '')));
+
+ $out .= sprintf('<label for="%s"><b>%s:</b></label> %s<br /><br />',
+ '_name', Q($this->gettext('filtersetname')), $input_name->show($name));
+
+ $out .="\n<fieldset class=\"itemlist\"><legend>" . $this->gettext('filters') . ":</legend>\n";
+ $out .= '<input type="radio" id="from_none" name="_from" value="none"'
+ .(!$selected || $selected=='none' ? ' checked="checked"' : '').'></input>';
+ $out .= sprintf('<label for="%s">%s</label> ', 'from_none', Q($this->gettext('none')));
+
+ // filters set list
+ $list = $this->sieve->get_scripts();
+ $active = $this->sieve->get_active();
+
+ $select = new html_select(array('name' => '_copy', 'id' => '_copy'));
+
+ if (is_array($list)) {
+ asort($list, SORT_LOCALE_STRING);
+
+ foreach ($list as $set)
+ $select->add($set . ($set == $active ? ' ('.$this->gettext('active').')' : ''), $set);
+
+ $out .= '<br /><input type="radio" id="from_set" name="_from" value="set"'
+ .($selected=='set' ? ' checked="checked"' : '').'></input>';
+ $out .= sprintf('<label for="%s">%s:</label> ', 'from_set', Q($this->gettext('fromset')));
+ $out .= $select->show($copy);
+ }
+
+ // script upload box
+ $upload = new html_inputfield(array('name' => '_file', 'id' => '_file', 'size' => 30,
+ 'type' => 'file', 'class' => ($this->errors['name'] ? 'error' : '')));
+
+ $out .= '<br /><input type="radio" id="from_file" name="_from" value="file"'
+ .($selected=='file' ? ' checked="checked"' : '').'></input>';
+ $out .= sprintf('<label for="%s">%s:</label> ', 'from_file', Q($this->gettext('fromfile')));
+ $out .= $upload->show();
+ $out .= '</fieldset>';
+
+ $this->rc->output->add_gui_object('sieveform', 'filtersetform');
+
+ return $out;
+ }
+
+
+ function filter_form($attrib)
+ {
+ if (!$attrib['id'])
+ $attrib['id'] = 'rcmfilterform';
+
+ $fid = get_input_value('_fid', RCUBE_INPUT_GPC);
+ $scr = isset($this->form) ? $this->form : $this->script[$fid];
+
+ $hiddenfields = new html_hiddenfield(array('name' => '_task', 'value' => $this->rc->task));
+ $hiddenfields->add(array('name' => '_action', 'value' => 'plugin.managesieve-save'));
+ $hiddenfields->add(array('name' => '_framed', 'value' => ($_POST['_framed'] || $_GET['_framed'] ? 1 : 0)));
+ $hiddenfields->add(array('name' => '_fid', 'value' => $fid));
+
+ $out = '<form name="filterform" action="./" method="post">'."\n";
+ $out .= $hiddenfields->show();
+
+ // 'any' flag
+ if (sizeof($scr['tests']) == 1 && $scr['tests'][0]['test'] == 'true' && !$scr['tests'][0]['not'])
+ $any = true;
+
+ // filter name input
+ $field_id = '_name';
+ $input_name = new html_inputfield(array('name' => '_name', 'id' => $field_id, 'size' => 30,
+ 'class' => ($this->errors['name'] ? 'error' : '')));
+
+ if ($this->errors['name'])
+ $this->add_tip($field_id, $this->errors['name'], true);
+
+ if (isset($scr))
+ $input_name = $input_name->show($scr['name']);
+ else
+ $input_name = $input_name->show();
+
+ $out .= sprintf("\n<label for=\"%s\"><b>%s:</b></label> %s<br /><br />\n",
+ $field_id, Q($this->gettext('filtername')), $input_name);
+
+ $out .= '<fieldset><legend>' . Q($this->gettext('messagesrules')) . "</legend>\n";
+
+ // any, allof, anyof radio buttons
+ $field_id = '_allof';
+ $input_join = new html_radiobutton(array('name' => '_join', 'id' => $field_id, 'value' => 'allof',
+ 'onclick' => 'rule_join_radio(\'allof\')', 'class' => 'radio'));
+
+ if (isset($scr) && !$any)
+ $input_join = $input_join->show($scr['join'] ? 'allof' : '');
+ else
+ $input_join = $input_join->show();
+
+ $out .= sprintf("%s<label for=\"%s\">%s</label>&nbsp;\n",
+ $input_join, $field_id, Q($this->gettext('filterallof')));
+
+ $field_id = '_anyof';
+ $input_join = new html_radiobutton(array('name' => '_join', 'id' => $field_id, 'value' => 'anyof',
+ 'onclick' => 'rule_join_radio(\'anyof\')', 'class' => 'radio'));
+
+ if (isset($scr) && !$any)
+ $input_join = $input_join->show($scr['join'] ? '' : 'anyof');
+ else
+ $input_join = $input_join->show('anyof'); // default
+
+ $out .= sprintf("%s<label for=\"%s\">%s</label>\n",
+ $input_join, $field_id, Q($this->gettext('filteranyof')));
+
+ $field_id = '_any';
+ $input_join = new html_radiobutton(array('name' => '_join', 'id' => $field_id, 'value' => 'any',
+ 'onclick' => 'rule_join_radio(\'any\')', 'class' => 'radio'));
+
+ $input_join = $input_join->show($any ? 'any' : '');
+
+ $out .= sprintf("%s<label for=\"%s\">%s</label>\n",
+ $input_join, $field_id, Q($this->gettext('filterany')));
+
+ $rows_num = isset($scr) ? sizeof($scr['tests']) : 1;
+
+ $out .= '<div id="rules"'.($any ? ' style="display: none"' : '').'>';
+ for ($x=0; $x<$rows_num; $x++)
+ $out .= $this->rule_div($fid, $x);
+ $out .= "</div>\n";
+
+ $out .= "</fieldset>\n";
+
+ // actions
+ $out .= '<fieldset><legend>' . Q($this->gettext('messagesactions')) . "</legend>\n";
+
+ $rows_num = isset($scr) ? sizeof($scr['actions']) : 1;
+
+ $out .= '<div id="actions">';
+ for ($x=0; $x<$rows_num; $x++)
+ $out .= $this->action_div($fid, $x);
+ $out .= "</div>\n";
+
+ $out .= "</fieldset>\n";
+
+ $this->print_tips();
+
+ if ($scr['disabled']) {
+ $this->rc->output->set_env('rule_disabled', true);
+ }
+ $this->rc->output->add_label(
+ 'managesieve.ruledeleteconfirm',
+ 'managesieve.actiondeleteconfirm'
+ );
+ $this->rc->output->add_gui_object('sieveform', 'filterform');
+
+ return $out;
+ }
+
+ function rule_div($fid, $id, $div=true)
+ {
+ $rule = isset($this->form) ? $this->form['tests'][$id] : $this->script[$fid]['tests'][$id];
+ $rows_num = isset($this->form) ? sizeof($this->form['tests']) : sizeof($this->script[$fid]['tests']);
+
+ $out = $div ? '<div class="rulerow" id="rulerow' .$id .'">'."\n" : '';
+
+ $out .= '<table><tr><td class="rowactions">';
+
+ // headers select
+ $select_header = new html_select(array('name' => "_header[]", 'id' => 'header'.$id,
+ 'onchange' => 'rule_header_select(' .$id .')'));
+ foreach($this->headers as $name => $val)
+ $select_header->add(Q($this->gettext($name)), Q($val));
+ $select_header->add(Q($this->gettext('size')), 'size');
+ $select_header->add(Q($this->gettext('...')), '...');
+
+ // TODO: list arguments
+
+ if ((isset($rule['test']) && $rule['test'] == 'header')
+ && !is_array($rule['arg1']) && in_array($rule['arg1'], $this->headers))
+ $out .= $select_header->show($rule['arg1']);
+ else if ((isset($rule['test']) && $rule['test'] == 'exists')
+ && !is_array($rule['arg']) && in_array($rule['arg'], $this->headers))
+ $out .= $select_header->show($rule['arg']);
+ else if (isset($rule['test']) && $rule['test'] == 'size')
+ $out .= $select_header->show('size');
+ else if (isset($rule['test']) && $rule['test'] != 'true')
+ $out .= $select_header->show('...');
+ else
+ $out .= $select_header->show();
+
+ $out .= '</td><td class="rowtargets">';
+
+ if ((isset($rule['test']) && $rule['test'] == 'header')
+ && (is_array($rule['arg1']) || !in_array($rule['arg1'], $this->headers)))
+ $custom = is_array($rule['arg1']) ? implode(', ', $rule['arg1']) : $rule['arg1'];
+ else if ((isset($rule['test']) && $rule['test'] == 'exists')
+ && (is_array($rule['arg']) || !in_array($rule['arg'], $this->headers)))
+ $custom = is_array($rule['arg']) ? implode(', ', $rule['arg']) : $rule['arg'];
+
+ $out .= '<div id="custom_header' .$id. '" style="display:' .(isset($custom) ? 'inline' : 'none'). '">
+ <input type="text" name="_custom_header[]" id="custom_header_i'.$id.'" '
+ . $this->error_class($id, 'test', 'header', 'custom_header_i')
+ .' value="' .Q($custom). '" size="20" />&nbsp;</div>' . "\n";
+
+ // matching type select (operator)
+ $select_op = new html_select(array('name' => "_rule_op[]", 'id' => 'rule_op'.$id,
+ 'style' => 'display:' .($rule['test']!='size' ? 'inline' : 'none'),
+ 'onchange' => 'rule_op_select('.$id.')'));
+ $select_op->add(Q($this->gettext('filtercontains')), 'contains');
+ $select_op->add(Q($this->gettext('filternotcontains')), 'notcontains');
+ $select_op->add(Q($this->gettext('filteris')), 'is');
+ $select_op->add(Q($this->gettext('filterisnot')), 'notis');
+ $select_op->add(Q($this->gettext('filterexists')), 'exists');
+ $select_op->add(Q($this->gettext('filternotexists')), 'notexists');
+ $select_op->add(Q($this->gettext('filtermatches')), 'matches');
+ $select_op->add(Q($this->gettext('filternotmatches')), 'notmatches');
+ if (in_array('regex', $this->exts)) {
+ $select_op->add(Q($this->gettext('filterregex')), 'regex');
+ $select_op->add(Q($this->gettext('filternotregex')), 'notregex');
+ }
+ if (in_array('relational', $this->exts)) {
+ $select_op->add(Q($this->gettext('countisgreaterthan')), 'count-gt');
+ $select_op->add(Q($this->gettext('countisgreaterthanequal')), 'count-ge');
+ $select_op->add(Q($this->gettext('countislessthan')), 'count-lt');
+ $select_op->add(Q($this->gettext('countislessthanequal')), 'count-le');
+ $select_op->add(Q($this->gettext('countequals')), 'count-eq');
+ $select_op->add(Q($this->gettext('countnotequals')), 'count-ne');
+ $select_op->add(Q($this->gettext('valueisgreaterthan')), 'value-gt');
+ $select_op->add(Q($this->gettext('valueisgreaterthanequal')), 'value-ge');
+ $select_op->add(Q($this->gettext('valueislessthan')), 'value-lt');
+ $select_op->add(Q($this->gettext('valueislessthanequal')), 'value-le');
+ $select_op->add(Q($this->gettext('valueequals')), 'value-eq');
+ $select_op->add(Q($this->gettext('valuenotequals')), 'value-ne');
+ }
+
+ // target input (TODO: lists)
+
+ if ($rule['test'] == 'header') {
+ $out .= $select_op->show(($rule['not'] ? 'not' : '').$rule['type']);
+ $target = $rule['arg2'];
+ }
+ else if ($rule['test'] == 'size') {
+ $out .= $select_op->show();
+ if (preg_match('/^([0-9]+)(K|M|G)*$/', $rule['arg'], $matches)) {
+ $sizetarget = $matches[1];
+ $sizeitem = $matches[2];
+ }
+ }
+ else {
+ $out .= $select_op->show(($rule['not'] ? 'not' : '').$rule['test']);
+ $target = '';
+ }
+
+ $out .= '<input type="text" name="_rule_target[]" id="rule_target' .$id. '"
+ value="' .Q($target). '" size="20" ' . $this->error_class($id, 'test', 'target', 'rule_target')
+ . ' style="display:' . ($rule['test']!='size' && $rule['test'] != 'exists' ? 'inline' : 'none') . '" />'."\n";
+
+ $select_size_op = new html_select(array('name' => "_rule_size_op[]", 'id' => 'rule_size_op'.$id));
+ $select_size_op->add(Q($this->gettext('filterunder')), 'under');
+ $select_size_op->add(Q($this->gettext('filterover')), 'over');
+
+ $out .= '<div id="rule_size' .$id. '" style="display:' . ($rule['test']=='size' ? 'inline' : 'none') .'">';
+ $out .= $select_size_op->show($rule['test']=='size' ? $rule['type'] : '');
+ $out .= '<input type="text" name="_rule_size_target[]" id="rule_size_i'.$id.'" value="'.$sizetarget.'" size="10" '
+ . $this->error_class($id, 'test', 'sizetarget', 'rule_size_i') .' />
+ <input type="radio" name="_rule_size_item['.$id.']" value=""'
+ . (!$sizeitem ? ' checked="checked"' : '') .' class="radio" />'.rcube_label('B').'
+ <input type="radio" name="_rule_size_item['.$id.']" value="K"'
+ . ($sizeitem=='K' ? ' checked="checked"' : '') .' class="radio" />'.rcube_label('KB').'
+ <input type="radio" name="_rule_size_item['.$id.']" value="M"'
+ . ($sizeitem=='M' ? ' checked="checked"' : '') .' class="radio" />'.rcube_label('MB').'
+ <input type="radio" name="_rule_size_item['.$id.']" value="G"'
+ . ($sizeitem=='G' ? ' checked="checked"' : '') .' class="radio" />'.rcube_label('GB');
+ $out .= '</div>';
+ $out .= '</td>';
+
+ // add/del buttons
+ $out .= '<td class="rowbuttons">';
+ $out .= '<input type="button" id="ruleadd' . $id .'" value="'. Q($this->gettext('add')). '"
+ onclick="rcmail.managesieve_ruleadd(' . $id .')" class="button" /> ';
+ $out .= '<input type="button" id="ruledel' . $id .'" value="'. Q($this->gettext('del')). '"
+ onclick="rcmail.managesieve_ruledel(' . $id .')" class="button' . ($rows_num<2 ? ' disabled' : '') .'"'
+ . ($rows_num<2 ? ' disabled="disabled"' : '') .' />';
+ $out .= '</td></tr></table>';
+
+ $out .= $div ? "</div>\n" : '';
+
+ return $out;
+ }
+
+ function action_div($fid, $id, $div=true)
+ {
+ $action = isset($this->form) ? $this->form['actions'][$id] : $this->script[$fid]['actions'][$id];
+ $rows_num = isset($this->form) ? sizeof($this->form['actions']) : sizeof($this->script[$fid]['actions']);
+
+ $out = $div ? '<div class="actionrow" id="actionrow' .$id .'">'."\n" : '';
+
+ $out .= '<table><tr><td class="rowactions">';
+
+ // action select
+ $select_action = new html_select(array('name' => "_action_type[]", 'id' => 'action_type'.$id,
+ 'onchange' => 'action_type_select(' .$id .')'));
+ if (in_array('fileinto', $this->exts))
+ $select_action->add(Q($this->gettext('messagemoveto')), 'fileinto');
+ if (in_array('fileinto', $this->exts) && in_array('copy', $this->exts))
+ $select_action->add(Q($this->gettext('messagecopyto')), 'fileinto_copy');
+ $select_action->add(Q($this->gettext('messageredirect')), 'redirect');
+ if (in_array('copy', $this->exts))
+ $select_action->add(Q($this->gettext('messagesendcopy')), 'redirect_copy');
+ if (in_array('reject', $this->exts))
+ $select_action->add(Q($this->gettext('messagediscard')), 'reject');
+ else if (in_array('ereject', $this->exts))
+ $select_action->add(Q($this->gettext('messagediscard')), 'ereject');
+ if (in_array('vacation', $this->exts))
+ $select_action->add(Q($this->gettext('messagereply')), 'vacation');
+ $select_action->add(Q($this->gettext('messagedelete')), 'discard');
+ if (in_array('imapflags', $this->exts) || in_array('imap4flags', $this->exts)) {
+ $select_action->add(Q($this->gettext('setflags')), 'setflag');
+ $select_action->add(Q($this->gettext('addflags')), 'addflag');
+ $select_action->add(Q($this->gettext('removeflags')), 'removeflag');
+ }
+ $select_action->add(Q($this->gettext('rulestop')), 'stop');
+
+ $select_type = $action['type'];
+ if (in_array($action['type'], array('fileinto', 'redirect')) && $action['copy']) {
+ $select_type .= '_copy';
+ }
+
+ $out .= $select_action->show($select_type);
+ $out .= '</td>';
+
+ // actions target inputs
+ $out .= '<td class="rowtargets">';
+ // shared targets
+ $out .= '<input type="text" name="_action_target[]" id="action_target' .$id. '" '
+ .'value="' .($action['type']=='redirect' ? Q($action['target'], 'strict', false) : ''). '" size="40" '
+ .'style="display:' .($action['type']=='redirect' ? 'inline' : 'none') .'" '
+ . $this->error_class($id, 'action', 'target', 'action_target') .' />';
+ $out .= '<textarea name="_action_target_area[]" id="action_target_area' .$id. '" '
+ .'rows="3" cols="40" '. $this->error_class($id, 'action', 'targetarea', 'action_target_area')
+ .'style="display:' .(in_array($action['type'], array('reject', 'ereject')) ? 'inline' : 'none') .'">'
+ . (in_array($action['type'], array('reject', 'ereject')) ? Q($action['target'], 'strict', false) : '')
+ . "</textarea>\n";
+
+ // vacation
+ $out .= '<div id="action_vacation' .$id.'" style="display:' .($action['type']=='vacation' ? 'inline' : 'none') .'">';
+ $out .= '<span class="label">'. Q($this->gettext('vacationreason')) .'</span><br />'
+ .'<textarea name="_action_reason[]" id="action_reason' .$id. '" '
+ .'rows="3" cols="45" '. $this->error_class($id, 'action', 'reason', 'action_reason') . '>'
+ . Q($action['reason'], 'strict', false) . "</textarea>\n";
+ $out .= '<br /><span class="label">' .Q($this->gettext('vacationsubject')) . '</span><br />'
+ .'<input type="text" name="_action_subject[]" id="action_subject'.$id.'" '
+ .'value="' . (is_array($action['subject']) ? Q(implode(', ', $action['subject']), 'strict', false) : $action['subject']) . '" size="50" '
+ . $this->error_class($id, 'action', 'subject', 'action_subject') .' />';
+ $out .= '<br /><span class="label">' .Q($this->gettext('vacationaddresses')) . '</span><br />'
+ .'<input type="text" name="_action_addresses[]" id="action_addr'.$id.'" '
+ .'value="' . (is_array($action['addresses']) ? Q(implode(', ', $action['addresses']), 'strict', false) : $action['addresses']) . '" size="50" '
+ . $this->error_class($id, 'action', 'addresses', 'action_addr') .' />';
+ $out .= '<br /><span class="label">' . Q($this->gettext('vacationdays')) . '</span><br />'
+ .'<input type="text" name="_action_days[]" id="action_days'.$id.'" '
+ .'value="' .Q($action['days'], 'strict', false) . '" size="2" '
+ . $this->error_class($id, 'action', 'days', 'action_days') .' />';
+ $out .= '</div>';
+
+ // flags
+ $flags = array(
+ 'read' => '\\Seen',
+ 'answered' => '\\Answered',
+ 'flagged' => '\\Flagged',
+ 'deleted' => '\\Deleted',
+ 'draft' => '\\Draft',
+ );
+ $flags_target = (array)$action['target'];
+
+ $out .= '<div id="action_flags' .$id.'" style="display:'
+ . (preg_match('/^(set|add|remove)flag$/', $action['type']) ? 'inline' : 'none') . '"'
+ . $this->error_class($id, 'action', 'flags', 'action_flags') . '>';
+ foreach ($flags as $fidx => $flag) {
+ $out .= '<input type="checkbox" name="_action_flags[' .$id .'][]" value="' . $flag . '"'
+ . (in_array_nocase($flag, $flags_target) ? 'checked="checked"' : '') . ' />'
+ . Q($this->gettext('flag'.$fidx)) .'<br>';
+ }
+ $out .= '</div>';
+
+ // mailbox select
+ if ($action['type'] == 'fileinto')
+ $mailbox = $this->mod_mailbox($action['target'], 'out');
+ else
+ $mailbox = '';
+
+ $this->rc->imap_connect();
+ $select = rcmail_mailbox_select(array(
+ 'realnames' => false,
+ 'maxlength' => 100,
+ 'id' => 'action_mailbox' . $id,
+ 'name' => '_action_mailbox[]',
+ 'style' => 'display:'.(!isset($action) || $action['type']=='fileinto' ? 'inline' : 'none')
+ ));
+ $out .= $select->show($mailbox);
+ $out .= '</td>';
+
+ // add/del buttons
+ $out .= '<td class="rowbuttons">';
+ $out .= '<input type="button" id="actionadd' . $id .'" value="'. Q($this->gettext('add')). '"
+ onclick="rcmail.managesieve_actionadd(' . $id .')" class="button" /> ';
+ $out .= '<input type="button" id="actiondel' . $id .'" value="'. Q($this->gettext('del')). '"
+ onclick="rcmail.managesieve_actiondel(' . $id .')" class="button' . ($rows_num<2 ? ' disabled' : '') .'"'
+ . ($rows_num<2 ? ' disabled="disabled"' : '') .' />';
+ $out .= '</td>';
+
+ $out .= '</tr></table>';
+
+ $out .= $div ? "</div>\n" : '';
+
+ return $out;
+ }
+
+ private function genid()
+ {
+ $result = intval(rcube_timer());
+ return $result;
+ }
+
+ private function strip_value($str, $allow_html=false)
+ {
+ if (!$allow_html)
+ $str = strip_tags($str);
+
+ return trim($str);
+ }
+
+ private function error_class($id, $type, $target, $elem_prefix='')
+ {
+ // TODO: tooltips
+ if (($type == 'test' && ($str = $this->errors['tests'][$id][$target])) ||
+ ($type == 'action' && ($str = $this->errors['actions'][$id][$target]))
+ ) {
+ $this->add_tip($elem_prefix.$id, $str, true);
+ return ' class="error"';
+ }
+
+ return '';
+ }
+
+ private function add_tip($id, $str, $error=false)
+ {
+ if ($error)
+ $str = html::span('sieve error', $str);
+
+ $this->tips[] = array($id, $str);
+ }
+
+ private function print_tips()
+ {
+ if (empty($this->tips))
+ return;
+
+ $script = JS_OBJECT_NAME.'.managesieve_tip_register('.json_encode($this->tips).');';
+ $this->rc->output->add_script($script, 'foot');
+ }
+
+ /**
+ * Converts mailbox name from/to UTF7-IMAP from/to internal Sieve encoding
+ * with delimiter replacement.
+ *
+ * @param string $mailbox Mailbox name
+ * @param string $mode Conversion direction ('in'|'out')
+ *
+ * @return string Mailbox name
+ */
+ private function mod_mailbox($mailbox, $mode = 'out')
+ {
+ $delimiter = $_SESSION['imap_delimiter'];
+ $replace_delimiter = $this->rc->config->get('managesieve_replace_delimiter');
+ $mbox_encoding = $this->rc->config->get('managesieve_mbox_encoding', 'UTF7-IMAP');
+
+ if ($mode == 'out') {
+ $mailbox = rcube_charset_convert($mailbox, $mbox_encoding, 'UTF7-IMAP');
+ if ($replace_delimiter && $replace_delimiter != $delimiter)
+ $mailbox = str_replace($replace_delimiter, $delimiter, $mailbox);
+ }
+ else {
+ $mailbox = rcube_charset_convert($mailbox, 'UTF7-IMAP', $mbox_encoding);
+ if ($replace_delimiter && $replace_delimiter != $delimiter)
+ $mailbox = str_replace($delimiter, $replace_delimiter, $mailbox);
+ }
+
+ return $mailbox;
+ }
+}
diff --git a/plugins/managesieve/skins/default/managesieve.css b/plugins/managesieve/skins/default/managesieve.css
new file mode 100644
index 000000000..675c5d0dc
--- /dev/null
+++ b/plugins/managesieve/skins/default/managesieve.css
@@ -0,0 +1,296 @@
+/***** Roundcube|Filters styles *****/
+
+
+#filterslist
+{
+ position: absolute;
+ left: 20px;
+ top: 120px;
+ bottom: 20px;
+ border: 1px solid #999999;
+ overflow: auto;
+ /* css hack for IE */
+ height: expression((parseInt(document.documentElement.clientHeight)-140)+'px');
+}
+
+#filters-table
+{
+ width: 100%;
+ table-layout: fixed;
+ /* css hack for IE */
+ width: expression(document.getElementById('filterslist').clientWidth);
+}
+
+#filters-table tbody td
+{
+ cursor: pointer;
+}
+
+#filters-table tbody tr.disabled td
+{
+ color: #999999;
+}
+
+#filtersbuttons
+{
+ position: absolute;
+ left: 20px;
+ top: 85px;
+}
+
+#filtersetsbuttons
+{
+ position: absolute;
+ left: 230px;
+ top: 85px;
+}
+
+#filtersbuttons a,
+#filtersetsbuttons a
+{
+ display: block;
+ float: left;
+}
+
+#filtersbuttons a.button,
+#filtersbuttons a.buttonPas,
+#filtersetsbuttons a.button,
+#filtersetsbuttons a.buttonPas
+{
+ display: block;
+ float: left;
+ width: 32px;
+ height: 32px;
+ padding: 0;
+ margin-right: 3px;
+ overflow: hidden;
+ background: url(managesieve_toolbar.png) 0 0 no-repeat transparent;
+ opacity: 0.99; /* this is needed to make buttons appear correctly in Chrome */
+}
+
+#filtersbuttons a.buttonPas,
+#filtersetsbuttons a.buttonPas
+{
+ filter: alpha(opacity=35);
+ opacity: 0.35;
+}
+
+#filtersbuttons a.add {
+ background-position: 0px 0px;
+}
+
+#filtersbuttons a.addsel {
+ background-position: 0 -32px;
+}
+
+#filtersbuttons a.del {
+ background-position: -32px 0px;
+}
+
+#filtersbuttons a.delsel {
+ background-position: -32px -32px;
+}
+
+#filtersbuttons a.up {
+ background-position: -64px 0px;
+}
+
+#filtersbuttons a.upsel {
+ background-position: -64px -32px;
+}
+
+#filtersbuttons a.down {
+ background-position: -96px 0px;
+}
+
+#filtersbuttons a.downsel {
+ background-position: -96px -32px;
+}
+
+#filtersetsbuttons a.setadd {
+ background-position: -128px 0px;
+}
+
+#filtersetsbuttons a.setaddsel {
+ background-position: -128px -32px;
+}
+
+#filtersetsbuttons a.setdel {
+ background-position: -160px 0px;
+}
+
+#filtersetsbuttons a.setdelsel {
+ background-position: -160px -32px;
+}
+
+#filtersetsbuttons a.setset {
+ background-position: -192px 0px;
+}
+
+#filtersetsbuttons a.setsetsel {
+ background-position: -192px -32px;
+}
+
+#filtersetsbuttons a.setget {
+ background-position: -224px 0px;
+}
+
+#filtersetsbuttons a.setgetsel {
+ background-position: -224px -32px;
+}
+
+#filtersetselect
+{
+ position: absolute;
+ left: 375px;
+ top: 90px;
+}
+
+#filter-box
+{
+ position: absolute;
+ top: 120px;
+ right: 20px;
+ bottom: 20px;
+ border: 1px solid #999999;
+ overflow: hidden;
+ /* css hack for IE */
+ width: expression((parseInt(document.documentElement.clientWidth)-40-parseInt(document.getElementById('filterslist').offsetWidth))+'px');
+ height: expression((parseInt(document.documentElement.clientHeight)-140)+'px');
+}
+
+#filter-frame
+{
+ border: none;
+}
+
+body.iframe
+{
+ min-width: 740px;
+ width: expression(Math.max(740, document.documentElement.clientWidth)+'px');
+}
+
+#filter-form
+{
+ min-width: 650px;
+ white-space: nowrap;
+ padding: 20px 10px 10px 10px;
+}
+
+legend, label
+{
+ color: #666666;
+}
+
+#rules, #actions
+{
+ margin-top: 5px;
+ padding: 0;
+ border-collapse: collapse;
+}
+
+div.rulerow, div.actionrow
+{
+ width: auto;
+ padding: 2px;
+ white-space: nowrap;
+ border: 1px solid #F2F2F2;
+}
+
+div.rulerow:hover, div.actionrow:hover
+{
+ padding: 2px;
+ white-space: nowrap;
+ background: #F9F9F9;
+ border: 1px solid silver;
+}
+
+div.rulerow table, div.actionrow table
+{
+ padding: 0px;
+ width: 100%;
+}
+
+td.rowbuttons
+{
+ text-align: right;
+ white-space: nowrap;
+ width: 1%;
+}
+
+td.rowactions
+{
+ white-space: nowrap;
+ width: 1%;
+}
+
+td.rowtargets
+{
+ white-space: nowrap;
+ width: 98%;
+ padding-left: 10px;
+}
+
+input.disabled, input.disabled:hover
+{
+ color: #999999;
+}
+
+input.error, textarea.error
+{
+ background-color: #FFFF88;
+}
+
+input.box,
+input.radio
+{
+ border: 0;
+}
+
+span.label
+{
+ color: #666666;
+ font-size: 10px;
+ white-space: nowrap;
+}
+
+#footer
+{
+ padding-top: 5px;
+ width: 100%;
+}
+
+#footer .footerleft
+{
+ padding-left: 2px;
+ white-space: nowrap;
+ float: left;
+}
+
+#footer .footerright
+{
+ padding-right: 2px;
+ white-space: nowrap;
+ text-align: right;
+ float: right;
+}
+
+.itemlist
+{
+ line-height: 25px;
+}
+
+.itemlist input
+{
+ vertical-align: middle;
+}
+
+span.sieve.error
+{
+ color: red;
+}
+
+#managesieve-tip
+{
+ width: 200px;
+}
diff --git a/plugins/managesieve/skins/default/managesieve_toolbar.png b/plugins/managesieve/skins/default/managesieve_toolbar.png
new file mode 100644
index 000000000..473dbc8df
--- /dev/null
+++ b/plugins/managesieve/skins/default/managesieve_toolbar.png
Binary files differ
diff --git a/plugins/managesieve/skins/default/templates/filteredit.html b/plugins/managesieve/skins/default/templates/filteredit.html
new file mode 100644
index 000000000..8b1993528
--- /dev/null
+++ b/plugins/managesieve/skins/default/templates/filteredit.html
@@ -0,0 +1,30 @@
+<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
+<html xmlns="http://www.w3.org/1999/xhtml">
+<head>
+<title><roundcube:object name="pagetitle" /></title>
+<roundcube:include file="/includes/links.html" />
+<link rel="stylesheet" type="text/css" href="/this/managesieve.css" />
+</head>
+<body class="iframe">
+
+<div id="filter-title" class="boxtitle"><roundcube:label name="managesieve.filterdef" /></div>
+
+<div id="filter-form" class="boxcontent">
+<roundcube:object name="filterform" />
+
+<div id="footer">
+<div class="footerleft">
+<roundcube:button command="plugin.managesieve-save" type="input" class="button mainaction" label="save" />
+</div>
+<div class="footerright">
+<label for="disabled"><roundcube:label name="managesieve.filterdisabled" /></label>
+<input type="checkbox" id="disabled" name="_disabled" value="1" />
+</div>
+</div>
+
+</form>
+</div>
+
+
+</body>
+</html>
diff --git a/plugins/managesieve/skins/default/templates/managesieve.html b/plugins/managesieve/skins/default/templates/managesieve.html
new file mode 100644
index 000000000..94cd1f1cc
--- /dev/null
+++ b/plugins/managesieve/skins/default/templates/managesieve.html
@@ -0,0 +1,54 @@
+<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
+<html xmlns="http://www.w3.org/1999/xhtml">
+<head>
+<title><roundcube:object name="pagetitle" /></title>
+<roundcube:include file="/includes/links.html" />
+<link rel="stylesheet" type="text/css" href="/this/managesieve.css" />
+<script type="text/javascript" src="/functions.js"></script>
+<script type="text/javascript" src="/splitter.js"></script>
+
+<style type="text/css">
+#filterslist { width: <roundcube:exp expression="!empty(cookie:sieveviewsplitter) ? cookie:sieveviewsplitter-5 : 210" />px; }
+#filter-box { left: <roundcube:exp expression="!empty(cookie:sieveviewsplitter) ? cookie:sieveviewsplitter+5 : 220" />px;
+<roundcube:exp expression="browser:ie ? ('width:expression((parseInt(this.parentNode.offsetWidth)-'.(!empty(cookie:sieveviewsplitter) ? cookie:sieveviewsplitter+5 : 220).')+\\'px\\');') : ''" />
+}
+</style>
+
+</head>
+<body>
+
+<roundcube:include file="/includes/taskbar.html" />
+<roundcube:include file="/includes/header.html" />
+<roundcube:include file="/includes/settingstabs.html" />
+
+<div id="filtersbuttons">
+<roundcube:button command="plugin.managesieve-add" type="link" class="buttonPas add" classSel="button addsel" classAct="button add" title="managesieve.filteradd" content=" " />
+<roundcube:button command="plugin.managesieve-del" type="link" class="buttonPas del" classSel="button delsel" classAct="button del" title="managesieve.filterdel" content=" " />
+<roundcube:button command="plugin.managesieve-up" type="link" class="buttonPas up" classSel="button upsel" classAct="button up" title="managesieve.moveup" content=" " />
+<roundcube:button command="plugin.managesieve-down" type="link" class="buttonPas down" classSel="button downsel" classAct="button down" title="managesieve.movedown" content=" " />
+</div>
+
+<div id="filtersetsbuttons">
+<roundcube:button command="plugin.managesieve-setadd" type="link" class="buttonPas setadd" classSel="button setaddsel" classAct="button setadd" title="managesieve.filtersetadd" content=" " />
+<roundcube:button command="plugin.managesieve-setdel" type="link" class="buttonPas setdel" classSel="button setdelsel" classAct="button setdel" title="managesieve.filtersetdel" content=" " />
+<roundcube:button command="plugin.managesieve-setact" type="link" class="buttonPas setset" classSel="button setsetsel" classAct="button setset" content=" " />
+<roundcube:button command="plugin.managesieve-setget" type="link" class="buttonPas setget" classSel="button setgetsel" classAct="button setget" title="managesieve.filtersetget" content=" " />
+</div>
+<div id="filtersetselect">
+<roundcube:label name="managesieve.filterset" />:
+<roundcube:object name="filtersetslist" id="filtersets-select" />
+</div>
+
+<div id="filterslist">
+<roundcube:object name="filterslist" id="filters-table" class="records-table" cellspacing="0" summary="Filters list" />
+</div>
+<script type="text/javascript">
+ var sieveviewsplit = new rcube_splitter({id:'sieveviewsplitter', p1: 'filterslist', p2: 'filter-box', orientation: 'v', relative: true, start: 215});
+ rcmail.add_onload('sieveviewsplit.init()');
+</script>
+<div id="filter-box">
+<roundcube:object name="filterframe" id="filter-frame" width="100%" height="100%" frameborder="0" src="/watermark.html" />
+</div>
+
+</body>
+</html>
diff --git a/plugins/managesieve/skins/default/templates/setedit.html b/plugins/managesieve/skins/default/templates/setedit.html
new file mode 100644
index 000000000..26f7fece6
--- /dev/null
+++ b/plugins/managesieve/skins/default/templates/setedit.html
@@ -0,0 +1,24 @@
+<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
+<html xmlns="http://www.w3.org/1999/xhtml">
+<head>
+<title><roundcube:object name="pagetitle" /></title>
+<roundcube:include file="/includes/links.html" />
+<link rel="stylesheet" type="text/css" href="/this/managesieve.css" />
+</head>
+<body class="iframe">
+
+<div id="filter-title" class="boxtitle"><roundcube:label name="managesieve.newfilterset" /></div>
+
+<div id="filter-form" class="boxcontent">
+<roundcube:object name="filtersetform" />
+
+<p>
+<roundcube:button command="plugin.managesieve-save" type="input" class="button mainaction" label="save" />
+</p>
+
+</form>
+</div>
+
+
+</body>
+</html>
diff --git a/plugins/managesieve/tests/Makefile b/plugins/managesieve/tests/Makefile
new file mode 100644
index 000000000..072be2f2c
--- /dev/null
+++ b/plugins/managesieve/tests/Makefile
@@ -0,0 +1,7 @@
+
+clean:
+ rm -f *.log *.php *.diff *.exp *.out
+
+
+test:
+ pear run-tests *.phpt
diff --git a/plugins/managesieve/tests/parser.phpt b/plugins/managesieve/tests/parser.phpt
new file mode 100644
index 000000000..d70353459
--- /dev/null
+++ b/plugins/managesieve/tests/parser.phpt
@@ -0,0 +1,114 @@
+--TEST--
+Main test of script parser
+--SKIPIF--
+--FILE--
+<?php
+include '../lib/rcube_sieve_script.php';
+
+$txt = '
+require ["fileinto","vacation","reject","relational","comparator-i;ascii-numeric","imapflags"];
+# rule:[spam]
+if anyof (header :contains "X-DSPAM-Result" "Spam")
+{
+ fileinto "Spam";
+ stop;
+}
+# rule:[test1]
+if anyof (header :contains ["From","To"] "test@domain.tld")
+{
+ discard;
+ stop;
+}
+# rule:[test2]
+if anyof (not header :contains ["Subject"] "[test]", header :contains "Subject" "[test2]")
+{
+ fileinto "test";
+ stop;
+}
+# rule:[test-vacation]
+if anyof (header :contains "Subject" "vacation")
+{
+ vacation :days 1 text:
+# test
+test test /* test */
+test
+.
+;
+ stop;
+}
+# rule:[comments]
+if anyof (true) /* comment
+ * "comment" #comment */ {
+ /* comment */ stop;
+# comment
+}
+# rule:[reject]
+if size :over 5000K {
+ reject "Message over 5MB size limit. Please contact me before sending this.";
+}
+# rule:[redirect]
+if header :value "ge" :comparator "i;ascii-numeric"
+ ["X-Spam-score"] ["14"] {redirect "test@test.tld";}
+# rule:[imapflags]
+if header :matches "Subject" "^Test$" {
+ setflag "\\\\Seen";
+ addflag ["\\\\Answered","\\\\Deleted"];
+}
+';
+
+$s = new rcube_sieve_script($txt);
+echo $s->as_text();
+
+?>
+--EXPECT--
+require ["fileinto","vacation","reject","relational","comparator-i;ascii-numeric","imapflags"];
+# rule:[spam]
+if header :contains "X-DSPAM-Result" "Spam"
+{
+ fileinto "Spam";
+ stop;
+}
+# rule:[test1]
+if header :contains ["From","To"] "test@domain.tld"
+{
+ discard;
+ stop;
+}
+# rule:[test2]
+if anyof (not header :contains "Subject" "[test]", header :contains "Subject" "[test2]")
+{
+ fileinto "test";
+ stop;
+}
+# rule:[test-vacation]
+if header :contains "Subject" "vacation"
+{
+ vacation :days 1 text:
+# test
+test test /* test */
+test
+.
+;
+ stop;
+}
+# rule:[comments]
+if true
+{
+ stop;
+}
+# rule:[reject]
+if size :over 5000K
+{
+ reject "Message over 5MB size limit. Please contact me before sending this.";
+}
+# rule:[redirect]
+if header :value "ge" :comparator "i;ascii-numeric" "X-Spam-score" "14"
+{
+ redirect "test@test.tld";
+}
+# rule:[imapflags]
+if header :matches "Subject" "^Test$"
+{
+ setflag "\\Seen";
+ addflag ["\\Answered","\\Deleted"];
+}
diff --git a/plugins/managesieve/tests/tokenize.phpt b/plugins/managesieve/tests/tokenize.phpt
new file mode 100644
index 000000000..f988653ee
--- /dev/null
+++ b/plugins/managesieve/tests/tokenize.phpt
@@ -0,0 +1,66 @@
+--TEST--
+Script parsing: tokenizer
+--SKIPIF--
+--FILE--
+<?php
+include '../lib/rcube_sieve_script.php';
+
+$txt[1] = array(1, 'text: #test
+This is test ; message;
+Multi line
+.
+;
+');
+$txt[2] = array(0, '["test1","test2"]');
+$txt[3] = array(1, '["test"]');
+$txt[4] = array(1, '"te\\"st"');
+$txt[5] = array(0, 'test #comment');
+$txt[6] = array(0, 'text:
+test
+.
+text:
+test
+.
+');
+$txt[7] = array(1, '"\\a\\\\\\"a"');
+
+foreach ($txt as $idx => $t) {
+ echo "[$idx]---------------\n";
+ var_dump(rcube_sieve_script::tokenize($t[1], $t[0]));
+}
+?>
+--EXPECT--
+[1]---------------
+string(34) "This is test ; message;
+Multi line"
+[2]---------------
+array(1) {
+ [0]=>
+ array(2) {
+ [0]=>
+ string(5) "test1"
+ [1]=>
+ string(5) "test2"
+ }
+}
+[3]---------------
+array(1) {
+ [0]=>
+ string(4) "test"
+}
+[4]---------------
+string(5) "te"st"
+[5]---------------
+array(1) {
+ [0]=>
+ string(4) "test"
+}
+[6]---------------
+array(2) {
+ [0]=>
+ string(4) "test"
+ [1]=>
+ string(4) "test"
+}
+[7]---------------
+string(4) "a\"a"
diff --git a/plugins/markasjunk/localization/cs_CZ.inc b/plugins/markasjunk/localization/cs_CZ.inc
new file mode 100644
index 000000000..18509cf51
--- /dev/null
+++ b/plugins/markasjunk/localization/cs_CZ.inc
@@ -0,0 +1,24 @@
+<?php
+
+/*
+
++-----------------------------------------------------------------------+
+| language/cs_CZ/labels.inc |
+| |
+| Language file of the Roundcube markasjunk plugin |
+| Copyright (C) 2005-2009, The Roundcube Dev Team |
+| Licensed under the GNU GPL |
+| |
++-----------------------------------------------------------------------+
+| Author: Milan Kozak <hodza@hodza.net> |
++-----------------------------------------------------------------------+
+
+@version $Id: labels.inc 2993 2009-09-26 18:32:07Z alec $
+
+*/
+
+$labels = array();
+$labels['buttontitle'] = 'Označit jako Spam';
+$labels['reportedasjunk'] = 'Úspěšně nahlášeno jako Spam';
+
+?> \ No newline at end of file
diff --git a/plugins/markasjunk/localization/da_DK.inc b/plugins/markasjunk/localization/da_DK.inc
new file mode 100644
index 000000000..e351b0f61
--- /dev/null
+++ b/plugins/markasjunk/localization/da_DK.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['buttontitle'] = 'Marker som junk mail';
+$labels['reportedasjunk'] = 'Successfuldt rapporteret som junk mail';
+
+?>
diff --git a/plugins/markasjunk/localization/de_DE.inc b/plugins/markasjunk/localization/de_DE.inc
new file mode 100644
index 000000000..f21edf7cd
--- /dev/null
+++ b/plugins/markasjunk/localization/de_DE.inc
@@ -0,0 +1,6 @@
+<?php
+// translation done by Ulli Heist - http://heist.hobby-site.org/
+$labels = array();
+$labels['buttontitle'] = 'als SPAM markieren';
+$labels['reportedasjunk'] = 'Erfolgreich als SPAM gemeldet';
+?> \ No newline at end of file
diff --git a/plugins/markasjunk/localization/en_US.inc b/plugins/markasjunk/localization/en_US.inc
new file mode 100644
index 000000000..6f63e161a
--- /dev/null
+++ b/plugins/markasjunk/localization/en_US.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['buttontitle'] = 'Mark as Junk';
+$labels['reportedasjunk'] = 'Successfully reported as Junk';
+
+?> \ No newline at end of file
diff --git a/plugins/markasjunk/localization/es_AR.inc b/plugins/markasjunk/localization/es_AR.inc
new file mode 100644
index 000000000..decdde2a8
--- /dev/null
+++ b/plugins/markasjunk/localization/es_AR.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['buttontitle'] = 'Marcar como SPAM';
+$labels['reportedasjunk'] = 'Mensaje reportado como SPAM';
+
+?>
diff --git a/plugins/markasjunk/localization/es_ES.inc b/plugins/markasjunk/localization/es_ES.inc
new file mode 100644
index 000000000..8e5ca492d
--- /dev/null
+++ b/plugins/markasjunk/localization/es_ES.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['buttontitle'] = 'Marcar como SPAM';
+$labels['reportedasjunk'] = 'Mensaje informado como SPAM';
+
+?>
diff --git a/plugins/markasjunk/localization/et_EE.inc b/plugins/markasjunk/localization/et_EE.inc
new file mode 100644
index 000000000..daf140512
--- /dev/null
+++ b/plugins/markasjunk/localization/et_EE.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['buttontitle'] = 'Märgista Rämpsuks';
+$labels['reportedasjunk'] = 'Edukalt Rämpsuks märgitud';
+
+?>
diff --git a/plugins/markasjunk/localization/gl_ES.inc b/plugins/markasjunk/localization/gl_ES.inc
new file mode 100644
index 000000000..b1f49a23e
--- /dev/null
+++ b/plugins/markasjunk/localization/gl_ES.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['buttontitle'] = 'Marcar como correo lixo';
+$labels['reportedasjunk'] = 'Mensaxe marcada como correo lixo';
+
+?>
diff --git a/plugins/markasjunk/localization/it_IT.inc b/plugins/markasjunk/localization/it_IT.inc
new file mode 100644
index 000000000..cc44fae21
--- /dev/null
+++ b/plugins/markasjunk/localization/it_IT.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['buttontitle'] = 'Marca come Spam';
+$labels['reportedasjunk'] = 'Messaggio marcato come Spam';
+
+?> \ No newline at end of file
diff --git a/plugins/markasjunk/localization/ja_JP.inc b/plugins/markasjunk/localization/ja_JP.inc
new file mode 100644
index 000000000..bd5b8b203
--- /dev/null
+++ b/plugins/markasjunk/localization/ja_JP.inc
@@ -0,0 +1,9 @@
+<?php
+
+// EN-Revision: 3891
+
+$labels = array();
+$labels['buttontitle'] = '迷惑メールとして設定';
+$labels['reportedasjunk'] = '迷惑メールとして報告することに成功しました。';
+
+?> \ No newline at end of file
diff --git a/plugins/markasjunk/localization/pl_PL.inc b/plugins/markasjunk/localization/pl_PL.inc
new file mode 100644
index 000000000..a98f0aab3
--- /dev/null
+++ b/plugins/markasjunk/localization/pl_PL.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['buttontitle'] = 'Oznacz jako SPAM';
+$labels['reportedasjunk'] = 'Pomyślnie oznaczono jako SPAM';
+
+?>
diff --git a/plugins/markasjunk/localization/ru_RU.inc b/plugins/markasjunk/localization/ru_RU.inc
new file mode 100644
index 000000000..32d00c2df
--- /dev/null
+++ b/plugins/markasjunk/localization/ru_RU.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['buttontitle'] = 'Переместить в "СПАМ"';
+$labels['reportedasjunk'] = 'Перемещено в "СПАМ"';
+
+?>
diff --git a/plugins/markasjunk/localization/sk_SK.inc b/plugins/markasjunk/localization/sk_SK.inc
new file mode 100644
index 000000000..b56ac46af
--- /dev/null
+++ b/plugins/markasjunk/localization/sk_SK.inc
@@ -0,0 +1,15 @@
+<?php
+
+/**
+ * Slovak translation for Roundcube markasjunk plugin
+ *
+ * @version 1.0 (2010-10-18)
+ * @author panda <admin@whistler.sk>
+ *
+ */
+
+$labels = array();
+$labels['buttontitle'] = 'Označiť ako Spam';
+$labels['reportedasjunk'] = 'Úspešne nahlásené ako Spam';
+
+?>
diff --git a/plugins/markasjunk/localization/sv_SE.inc b/plugins/markasjunk/localization/sv_SE.inc
new file mode 100644
index 000000000..f4c5959b9
--- /dev/null
+++ b/plugins/markasjunk/localization/sv_SE.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['buttontitle'] = 'Märk som skräp';
+$labels['reportedasjunk'] = 'Framgångsrikt rapporterat som skräp';
+
+?> \ No newline at end of file
diff --git a/plugins/markasjunk/localization/zh_TW.inc b/plugins/markasjunk/localization/zh_TW.inc
new file mode 100644
index 000000000..7b0b22162
--- /dev/null
+++ b/plugins/markasjunk/localization/zh_TW.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['buttontitle'] = '標示為垃圾信';
+$labels['reportedasjunk'] = '成功回報垃圾信';
+
+?>
diff --git a/plugins/markasjunk/markasjunk.js b/plugins/markasjunk/markasjunk.js
new file mode 100644
index 000000000..0e30fb8f2
--- /dev/null
+++ b/plugins/markasjunk/markasjunk.js
@@ -0,0 +1,28 @@
+/* Mark-as-Junk plugin script */
+
+function rcmail_markasjunk(prop)
+{
+ if (!rcmail.env.uid && (!rcmail.message_list || !rcmail.message_list.get_selection().length))
+ return;
+
+ var uids = rcmail.env.uid ? rcmail.env.uid : rcmail.message_list.get_selection().join(','),
+ lock = rcmail.set_busy(true, 'loading');
+
+ rcmail.http_post('plugin.markasjunk', '_uid='+uids+'&_mbox='+urlencode(rcmail.env.mailbox), lock);
+}
+
+// callback for app-onload event
+if (window.rcmail) {
+ rcmail.addEventListener('init', function(evt) {
+
+ // register command (directly enable in message view mode)
+ rcmail.register_command('plugin.markasjunk', rcmail_markasjunk, rcmail.env.uid);
+
+ // add event-listener to message list
+ if (rcmail.message_list)
+ rcmail.message_list.addEventListener('select', function(list){
+ rcmail.enable_command('plugin.markasjunk', list.get_selection().length > 0);
+ });
+ })
+}
+
diff --git a/plugins/markasjunk/markasjunk.php b/plugins/markasjunk/markasjunk.php
new file mode 100644
index 000000000..697d880ca
--- /dev/null
+++ b/plugins/markasjunk/markasjunk.php
@@ -0,0 +1,58 @@
+<?php
+
+/**
+ * Mark as Junk
+ *
+ * Sample plugin that adds a new button to the mailbox toolbar
+ * to mark the selected messages as Junk and move them to the Junk folder
+ *
+ * @version @package_version@
+ * @author Thomas Bruederli
+ */
+class markasjunk extends rcube_plugin
+{
+ public $task = 'mail';
+
+ function init()
+ {
+ $rcmail = rcmail::get_instance();
+
+ $this->register_action('plugin.markasjunk', array($this, 'request_action'));
+
+ if ($rcmail->action == '' || $rcmail->action == 'show') {
+ $skin_path = $this->local_skin_path();
+ $this->include_script('markasjunk.js');
+ $this->add_texts('localization', true);
+ $this->add_button(array(
+ 'command' => 'plugin.markasjunk',
+ 'imagepas' => $skin_path.'/junk_pas.png',
+ 'imageact' => $skin_path.'/junk_act.png',
+ 'width' => 32,
+ 'height' => 32,
+ 'title' => 'markasjunk.buttontitle'), 'toolbar');
+ }
+ }
+
+ function request_action()
+ {
+ $this->add_texts('localization');
+
+ $GLOBALS['IMAP_FLAGS']['JUNK'] = 'Junk';
+ $GLOBALS['IMAP_FLAGS']['NONJUNK'] = 'NonJunk';
+
+ $uids = get_input_value('_uid', RCUBE_INPUT_POST);
+ $mbox = get_input_value('_mbox', RCUBE_INPUT_POST);
+
+ $rcmail = rcmail::get_instance();
+ $rcmail->imap->unset_flag($uids, 'NONJUNK');
+ $rcmail->imap->set_flag($uids, 'JUNK');
+
+ if (($junk_mbox = $rcmail->config->get('junk_mbox')) && $mbox != $junk_mbox) {
+ $rcmail->output->command('move_messages', $junk_mbox);
+ }
+
+ $rcmail->output->command('display_message', $this->gettext('reportedasjunk'), 'confirmation');
+ $rcmail->output->send();
+ }
+
+}
diff --git a/plugins/markasjunk/package.xml b/plugins/markasjunk/package.xml
new file mode 100644
index 000000000..d76bd0c28
--- /dev/null
+++ b/plugins/markasjunk/package.xml
@@ -0,0 +1,67 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<package xmlns="http://pear.php.net/dtd/package-2.0" xmlns:tasks="http://pear.php.net/dtd/tasks-1.0" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" packagerversion="1.9.0" version="2.0" xsi:schemaLocation="http://pear.php.net/dtd/tasks-1.0
+ http://pear.php.net/dtd/tasks-1.0.xsd
+ http://pear.php.net/dtd/package-2.0
+ http://pear.php.net/dtd/package-2.0.xsd">
+ <name>markasjunk</name>
+ <channel>pear.roundcube.net</channel>
+ <summary>Mark messages as Junk</summary>
+ <description>Adds a new button to the mailbox toolbar to mark the selected messages as Junk and move them to the configured Junk folder.</description>
+ <lead>
+ <name>Thomas Bruederli</name>
+ <user>thomasb</user>
+ <email>roundcube@gmail.com</email>
+ <active>yes</active>
+ </lead>
+ <date>2010-03-29</date>
+ <time>13:20:00</time>
+ <version>
+ <release>1.0</release>
+ <api>1.0</api>
+ </version>
+ <stability>
+ <release>stable</release>
+ <api>stable</api>
+ </stability>
+ <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license>
+ <notes>-</notes>
+ <contents>
+ <dir baseinstalldir="/" name="/">
+ <file name="markasjunk.php" role="php">
+ <tasks:replace from="@name@" to="name" type="package-info"/>
+ <tasks:replace from="@package_version@" to="version" type="package-info"/>
+ </file>
+ <file name="markasjunk.js" role="data">
+ <tasks:replace from="@name@" to="name" type="package-info"/>
+ <tasks:replace from="@package_version@" to="version" type="package-info"/>
+ </file>
+ <file name="localization/cs_CZ.inc" role="data"></file>
+ <file name="localization/da_DK.inc" role="data"></file>
+ <file name="localization/de_DE.inc" role="data"></file>
+ <file name="localization/en_US.inc" role="data"></file>
+ <file name="localization/es_AR.inc" role="data"></file>
+ <file name="localization/es_ES.inc" role="data"></file>
+ <file name="localization/et_EE.inc" role="data"></file>
+ <file name="localization/gl_ES.inc" role="data"></file>
+ <file name="localization/ja_JP.inc" role="data"></file>
+ <file name="localization/pl_PL.inc" role="data"></file>
+ <file name="localization/ru_RU.inc" role="data"></file>
+ <file name="localization/sv_SE.inc" role="data"></file>
+ <file name="localization/zh_TW.inc" role="data"></file>
+ <file name="skins/default/junk_act.png" role="data"></file>
+ <file name="skins/default/junk_pas.png" role="data"></file>
+ </dir>
+ <!-- / -->
+ </contents>
+ <dependencies>
+ <required>
+ <php>
+ <min>5.2.1</min>
+ </php>
+ <pearinstaller>
+ <min>1.7.0</min>
+ </pearinstaller>
+ </required>
+ </dependencies>
+ <phprelease/>
+</package>
diff --git a/plugins/markasjunk/skins/default/junk_act.png b/plugins/markasjunk/skins/default/junk_act.png
new file mode 100644
index 000000000..b5a84f604
--- /dev/null
+++ b/plugins/markasjunk/skins/default/junk_act.png
Binary files differ
diff --git a/plugins/markasjunk/skins/default/junk_pas.png b/plugins/markasjunk/skins/default/junk_pas.png
new file mode 100644
index 000000000..b88a561a4
--- /dev/null
+++ b/plugins/markasjunk/skins/default/junk_pas.png
Binary files differ
diff --git a/plugins/new_user_dialog/localization/cs_CZ.inc b/plugins/new_user_dialog/localization/cs_CZ.inc
new file mode 100644
index 000000000..fe05e6aae
--- /dev/null
+++ b/plugins/new_user_dialog/localization/cs_CZ.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['identitydialogtitle'] = 'Prosím doplňte své jméno a e-mail';
+$labels['identitydialoghint'] = 'Tento dialog se objeví pouze při prvním přihlášení.';
+
+?>
diff --git a/plugins/new_user_dialog/localization/de_CH.inc b/plugins/new_user_dialog/localization/de_CH.inc
new file mode 100644
index 000000000..d2a1310d0
--- /dev/null
+++ b/plugins/new_user_dialog/localization/de_CH.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['identitydialogtitle'] = 'Bitte vervollständigen Sie Ihre Absender-Informationen';
+$labels['identitydialoghint'] = 'Dieser Dialog erscheint nur einmal beim ersten Login.';
+
+?> \ No newline at end of file
diff --git a/plugins/new_user_dialog/localization/de_DE.inc b/plugins/new_user_dialog/localization/de_DE.inc
new file mode 100644
index 000000000..d2a1310d0
--- /dev/null
+++ b/plugins/new_user_dialog/localization/de_DE.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['identitydialogtitle'] = 'Bitte vervollständigen Sie Ihre Absender-Informationen';
+$labels['identitydialoghint'] = 'Dieser Dialog erscheint nur einmal beim ersten Login.';
+
+?> \ No newline at end of file
diff --git a/plugins/new_user_dialog/localization/en_US.inc b/plugins/new_user_dialog/localization/en_US.inc
new file mode 100644
index 000000000..d9f531ba7
--- /dev/null
+++ b/plugins/new_user_dialog/localization/en_US.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['identitydialogtitle'] = 'Please complete your sender identity';
+$labels['identitydialoghint'] = 'This box only appears once at the first login.';
+
+?> \ No newline at end of file
diff --git a/plugins/new_user_dialog/localization/es_ES.inc b/plugins/new_user_dialog/localization/es_ES.inc
new file mode 100644
index 000000000..2d2ccfe0a
--- /dev/null
+++ b/plugins/new_user_dialog/localization/es_ES.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['identitydialogtitle'] = 'Por favor, complete sus datos personales';
+$labels['identitydialoghint'] = 'Este diálogo sólo aparecerá la primera vez que se conecte al correo.';
+
+?>
diff --git a/plugins/new_user_dialog/localization/et_EE.inc b/plugins/new_user_dialog/localization/et_EE.inc
new file mode 100644
index 000000000..7c6b3f20d
--- /dev/null
+++ b/plugins/new_user_dialog/localization/et_EE.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['identitydialogtitle'] = 'Palun täida oma saatja identiteet';
+$labels['identitydialoghint'] = 'See kast ilmub ainult esimesel sisselogimisel.';
+
+?>
diff --git a/plugins/new_user_dialog/localization/gl_ES.inc b/plugins/new_user_dialog/localization/gl_ES.inc
new file mode 100644
index 000000000..e29993539
--- /dev/null
+++ b/plugins/new_user_dialog/localization/gl_ES.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['identitydialogtitle'] = 'Por favor, complete os seus datos persoais';
+$labels['identitydialoghint'] = 'Este diálogo só aparecerá a primera vez que se conecte ao correo.';
+
+?>
diff --git a/plugins/new_user_dialog/localization/it_IT.inc b/plugins/new_user_dialog/localization/it_IT.inc
new file mode 100644
index 000000000..6c834a9c8
--- /dev/null
+++ b/plugins/new_user_dialog/localization/it_IT.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['identitydialogtitle'] = 'Per favore completa le informazioni riguardo la tua identità';
+$labels['identitydialoghint'] = 'Questa finestra comparirà una volta sola al primo accesso';
+
+?>
diff --git a/plugins/new_user_dialog/localization/ja_JP.inc b/plugins/new_user_dialog/localization/ja_JP.inc
new file mode 100644
index 000000000..55f47914a
--- /dev/null
+++ b/plugins/new_user_dialog/localization/ja_JP.inc
@@ -0,0 +1,9 @@
+<?php
+
+// EN-Revision: 3891
+
+$labels = array();
+$labels['identitydialogtitle'] = '送信者情報の入力を完了してください。';
+$labels['identitydialoghint'] = 'このボックスには最初のログイン時に一度だけ表示されます。';
+
+?> \ No newline at end of file
diff --git a/plugins/new_user_dialog/localization/nl_NL.inc b/plugins/new_user_dialog/localization/nl_NL.inc
new file mode 100644
index 000000000..3cc9cec68
--- /dev/null
+++ b/plugins/new_user_dialog/localization/nl_NL.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['identitydialogtitle'] = 'Vul uw correcte identiteitgegevens in a.u.b.';
+$labels['identitydialoghint'] = 'Dit scherm verschijnt enkel bij uw eerste login.';
+
+?>
diff --git a/plugins/new_user_dialog/localization/pl_PL.inc b/plugins/new_user_dialog/localization/pl_PL.inc
new file mode 100644
index 000000000..a385836a4
--- /dev/null
+++ b/plugins/new_user_dialog/localization/pl_PL.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['identitydialogtitle'] = 'Uzupełnij tożsamość nadawcy';
+$labels['identitydialoghint'] = 'To okno pojawia się tylko przy pierwszym logowaniu.';
+
+?>
diff --git a/plugins/new_user_dialog/localization/pt_BR.inc b/plugins/new_user_dialog/localization/pt_BR.inc
new file mode 100644
index 000000000..64e3e6a80
--- /dev/null
+++ b/plugins/new_user_dialog/localization/pt_BR.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['identitydialogtitle'] = 'Por favor complete a sua identidade';
+$labels['identitydialoghint'] = 'Esta caixa aparece apenas uma vez no primeiro login.';
+
+?>
diff --git a/plugins/new_user_dialog/localization/pt_PT.inc b/plugins/new_user_dialog/localization/pt_PT.inc
new file mode 100644
index 000000000..64e3e6a80
--- /dev/null
+++ b/plugins/new_user_dialog/localization/pt_PT.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['identitydialogtitle'] = 'Por favor complete a sua identidade';
+$labels['identitydialoghint'] = 'Esta caixa aparece apenas uma vez no primeiro login.';
+
+?>
diff --git a/plugins/new_user_dialog/localization/ru_RU.inc b/plugins/new_user_dialog/localization/ru_RU.inc
new file mode 100644
index 000000000..d1eb28e71
--- /dev/null
+++ b/plugins/new_user_dialog/localization/ru_RU.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['identitydialogtitle'] = 'Пожалуйста, укажите Ваше имя.';
+$labels['identitydialoghint'] = 'Данное сообщение отображается только при первом входе.';
+
+?>
diff --git a/plugins/new_user_dialog/localization/sk_SK.inc b/plugins/new_user_dialog/localization/sk_SK.inc
new file mode 100644
index 000000000..b7b841c4d
--- /dev/null
+++ b/plugins/new_user_dialog/localization/sk_SK.inc
@@ -0,0 +1,16 @@
+<?php
+/*
+ *
+ * Slovak translation for Roundcube new_user_dialog plugin
+ *
+ * @version 1.0 (2010-09-13)
+ * @author panda <admin@whistler.sk>
+ *
+*/
+
+
+$labels = array();
+$labels['identitydialogtitle'] = 'Doplňte prosím Vašu identifikáciu odosielateľa';
+$labels['identitydialoghint'] = 'Toto okno sa objaví len pri prvom prihlásení.';
+
+?>
diff --git a/plugins/new_user_dialog/localization/sl_SI.inc b/plugins/new_user_dialog/localization/sl_SI.inc
new file mode 100644
index 000000000..57f563806
--- /dev/null
+++ b/plugins/new_user_dialog/localization/sl_SI.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['identitydialogtitle'] = 'Izberite identiteto za pošiljanje';
+$labels['identitydialoghint'] = 'To okno se prikaže le ob prvi prijavi v spletno pošto.';
+
+?>
diff --git a/plugins/new_user_dialog/localization/sv_SE.inc b/plugins/new_user_dialog/localization/sv_SE.inc
new file mode 100644
index 000000000..b3e665ef1
--- /dev/null
+++ b/plugins/new_user_dialog/localization/sv_SE.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['identitydialogtitle'] = 'Vänligen fyll i namn och avsändaradress under personliga inställningar';
+$labels['identitydialoghint'] = 'Informationen visas endast vid första inloggningen.';
+
+?> \ No newline at end of file
diff --git a/plugins/new_user_dialog/localization/zh_TW.inc b/plugins/new_user_dialog/localization/zh_TW.inc
new file mode 100644
index 000000000..87261f9cd
--- /dev/null
+++ b/plugins/new_user_dialog/localization/zh_TW.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['identitydialogtitle'] = '請完成您的身份資訊';
+$labels['identitydialoghint'] = '此視窗只會於第一次登入時出現。';
+
+?>
diff --git a/plugins/new_user_dialog/new_user_dialog.php b/plugins/new_user_dialog/new_user_dialog.php
new file mode 100644
index 000000000..0d6837335
--- /dev/null
+++ b/plugins/new_user_dialog/new_user_dialog.php
@@ -0,0 +1,128 @@
+<?php
+
+/**
+ * Present identities settings dialog to new users
+ *
+ * When a new user is created, this plugin checks the default identity
+ * and sets a session flag in case it is incomplete. An overlay box will appear
+ * on the screen until the user has reviewed/completed his identity.
+ *
+ * @version @package_version@
+ * @author Thomas Bruederli
+ */
+class new_user_dialog extends rcube_plugin
+{
+ public $task = 'login|mail';
+
+ function init()
+ {
+ $this->add_hook('identity_create', array($this, 'create_identity'));
+ $this->register_action('plugin.newusersave', array($this, 'save_data'));
+
+ // register additional hooks if session flag is set
+ if ($_SESSION['plugin.newuserdialog']) {
+ $this->add_hook('render_page', array($this, 'render_page'));
+ }
+ }
+
+ /**
+ * Check newly created identity at first login
+ */
+ function create_identity($p)
+ {
+ // set session flag when a new user was created and the default identity seems to be incomplete
+ if ($p['login'] && !$p['complete'])
+ $_SESSION['plugin.newuserdialog'] = true;
+ }
+
+ /**
+ * Callback function when HTML page is rendered
+ * We'll add an overlay box here.
+ */
+ function render_page($p)
+ {
+ if ($_SESSION['plugin.newuserdialog'] && $p['template'] == 'mail') {
+ $this->add_texts('localization');
+
+ $rcmail = rcmail::get_instance();
+ $identity = $rcmail->user->get_identity();
+ $identities_level = intval($rcmail->config->get('identities_level', 0));
+
+ // compose user-identity dialog
+ $table = new html_table(array('cols' => 2));
+
+ $table->add('title', $this->gettext('name'));
+ $table->add(null, html::tag('input', array(
+ 'type' => 'text',
+ 'name' => '_name',
+ 'value' => $identity['name']
+ )));
+
+ $table->add('title', $this->gettext('email'));
+ $table->add(null, html::tag('input', array(
+ 'type' => 'text',
+ 'name' => '_email',
+ 'value' => rcube_idn_to_utf8($identity['email']),
+ 'disabled' => ($identities_level == 1 || $identities_level == 3)
+ )));
+
+ // add overlay input box to html page
+ $rcmail->output->add_footer(html::div(array('id' => 'newuseroverlay'),
+ html::tag('form', array(
+ 'action' => $rcmail->url('plugin.newusersave'),
+ 'method' => 'post'),
+ html::tag('h3', null, Q($this->gettext('identitydialogtitle'))) .
+ html::p('hint', Q($this->gettext('identitydialoghint'))) .
+ $table->show() .
+ html::p(array('class' => 'formbuttons'),
+ html::tag('input', array('type' => 'submit',
+ 'class' => 'button mainaction', 'value' => $this->gettext('save'))))
+ )
+ ));
+
+ // disable keyboard events for messages list (#1486726)
+ $rcmail->output->add_script(
+ "rcmail.message_list.key_press = function(){};
+ rcmail.message_list.key_down = function(){};
+ $('input[name=_name]').focus();
+ ", 'docready');
+
+ $this->include_stylesheet('newuserdialog.css');
+ }
+ }
+
+ /**
+ * Handler for submitted form
+ *
+ * Check fields and save to default identity if valid.
+ * Afterwards the session flag is removed and we're done.
+ */
+ function save_data()
+ {
+ $rcmail = rcmail::get_instance();
+ $identity = $rcmail->user->get_identity();
+ $identities_level = intval($rcmail->config->get('identities_level', 0));
+
+ $save_data = array(
+ 'name' => get_input_value('_name', RCUBE_INPUT_POST),
+ 'email' => get_input_value('_email', RCUBE_INPUT_POST),
+ );
+
+ // don't let the user alter the e-mail address if disabled by config
+ if ($identities_level == 1 || $identities_level == 3)
+ $save_data['email'] = $identity['email'];
+ else
+ $save_data['email'] = rcube_idn_to_ascii($save_data['email']);
+
+ // save data if not empty
+ if (!empty($save_data['name']) && !empty($save_data['email'])) {
+ $rcmail->user->update_identity($identity['identity_id'], $save_data);
+ $rcmail->session->remove('plugin.newuserdialog');
+ }
+
+ $rcmail->output->redirect('');
+ }
+
+}
+
+?> \ No newline at end of file
diff --git a/plugins/new_user_dialog/newuserdialog.css b/plugins/new_user_dialog/newuserdialog.css
new file mode 100644
index 000000000..c03e6fd42
--- /dev/null
+++ b/plugins/new_user_dialog/newuserdialog.css
@@ -0,0 +1,59 @@
+/** Styles for the new-user-dialog overlay box */
+
+#newuseroverlay {
+ position: absolute;
+ top: 0;
+ left: 0;
+ right: 0;
+ bottom: 0;
+ z-index: 10000;
+ background: rgba(0,0,0,0.5) !important;
+ background: #333;
+
+ /** IE hacks */
+ filter: alpha(opacity=90);
+ -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=90)";
+ width: expression(document.documentElement.clientWidth+'px');
+ height: expression(document.documentElement.clientHeight+'px');
+}
+
+#newuseroverlay h3 {
+ color: #333;
+ font-size: normal;
+ margin-top: 0.5em;
+ margin-bottom: 0;
+}
+
+#newuseroverlay p.hint {
+ margin-top: 0.5em;
+ font-style: italic;
+}
+
+#newuseroverlay form {
+ width: 32em;
+ margin: 8em auto;
+ padding: 1em 2em;
+ background: #F6F6F6;
+ border: 2px solid #555;
+ border-radius: 6px;
+ -moz-border-radius: 6px;
+ -webkit-border-radius: 6px;
+}
+
+#newuseroverlay table td.title
+{
+ color: #666;
+ text-align: right;
+ padding-right: 1em;
+ white-space: nowrap;
+}
+
+#newuseroverlay table td input
+{
+ width: 20em;
+}
+
+#newuseroverlay .formbuttons {
+ margin-top: 1.5em;
+ text-align: center;
+} \ No newline at end of file
diff --git a/plugins/new_user_dialog/package.xml b/plugins/new_user_dialog/package.xml
new file mode 100644
index 000000000..52874701f
--- /dev/null
+++ b/plugins/new_user_dialog/package.xml
@@ -0,0 +1,139 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<package xmlns="http://pear.php.net/dtd/package-2.0" xmlns:tasks="http://pear.php.net/dtd/tasks-1.0" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" packagerversion="1.9.0" version="2.0" xsi:schemaLocation="http://pear.php.net/dtd/tasks-1.0
+ http://pear.php.net/dtd/tasks-1.0.xsd
+ http://pear.php.net/dtd/package-2.0
+ http://pear.php.net/dtd/package-2.0.xsd">
+ <name>new_user_dialog</name>
+ <channel>pear.roundcube.net</channel>
+ <summary>Present identities settings dialog to new users</summary>
+ <description>When a new user is created, this plugin checks the default identity and sets a session flag in case it is incomplete. An overlay box will appear on the screen until the user has reviewed/completed his identity.</description>
+ <lead>
+ <name>Thomas Bruederli</name>
+ <user>thomasb</user>
+ <email>roundcube@gmail.com</email>
+ <active>yes</active>
+ </lead>
+ <date>2011-05-12</date>
+ <time>10:00</time>
+ <version>
+ <release>1.4</release>
+ <api>1.0</api>
+ </version>
+ <stability>
+ <release>stable</release>
+ <api>stable</api>
+ </stability>
+ <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license>
+ <notes>
+- Fixed IDNA encoding/decoding of e-mail addresses (#1487909)
+ </notes>
+ <contents>
+ <dir baseinstalldir="/" name="/">
+ <file name="new_user_dialog.php" role="php">
+ <tasks:replace from="@name@" to="name" type="package-info"/>
+ <tasks:replace from="@package_version@" to="version" type="package-info"/>
+ </file>
+ <file name="newuserdialog.css" role="data">
+ <tasks:replace from="@name@" to="name" type="package-info"/>
+ <tasks:replace from="@package_version@" to="version" type="package-info"/>
+ </file>
+ <dir name="localization">
+ <file name="en_US.inc" role="data" />
+ <file name="cs_CZ.inc" role="data" />
+ <file name="de_CH.inc" role="data" />
+ <file name="de_DE.inc" role="data" />
+ <file name="es_ES.inc" role="data" />
+ <file name="et_EE.inc" role="data" />
+ <file name="gl_ES.inc" role="data" />
+ <file name="it_IT.inc" role="data" />
+ <file name="ja_JP.inc" role="data" />
+ <file name="nl_NL.inc" role="data" />
+ <file name="pl_PL.inc" role="data" />
+ <file name="pt_BR.inc" role="data" />
+ <file name="pt_PT.inc" role="data" />
+ <file name="ru_RU.inc" role="data" />
+ <file name="sl_SI.inc" role="data" />
+ <file name="sv_DE.inc" role="data" />
+ <file name="zh_TW.inc" role="data" />
+ </dir>
+ </dir>
+ <!-- / -->
+ </contents>
+ <dependencies>
+ <required>
+ <php>
+ <min>5.2.1</min>
+ </php>
+ <pearinstaller>
+ <min>1.7.0</min>
+ </pearinstaller>
+ </required>
+ </dependencies>
+ <phprelease/>
+ <changelog>
+ <release>
+ <date>2010-03-29</date>
+ <time>13:20:00</time>
+ <version>
+ <release>1.0</release>
+ <api>1.0</api>
+ </version>
+ <stability>
+ <release>stable</release>
+ <api>stable</api>
+ </stability>
+ <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license>
+ <notes></notes>
+ </release>
+ <release>
+ <date>2010-05-13</date>
+ <time>19:35:00</time>
+ <version>
+ <release>1.1</release>
+ <api>1.0</api>
+ </version>
+ <stability>
+ <release>stable</release>
+ <api>stable</api>
+ </stability>
+ <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license>
+ <notes>
+- Fix space bar and backspace buttons not working (#1486726)
+ </notes>
+ </release>
+ <release>
+ <date>2010-05-27</date>
+ <time>12:00:00</time>
+ <version>
+ <release>1.2</release>
+ <api>1.0</api>
+ </version>
+ <stability>
+ <release>stable</release>
+ <api>stable</api>
+ </stability>
+ <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license>
+ <notes>
+- Add overlay box only to mail task main template
+- Fix possible error on form submission (#1486103)
+ </notes>
+ </release>
+ <release>
+ <date>2010-12-02</date>
+ <time>12:00:00</time>
+ <version>
+ <release>1.3</release>
+ <api>1.0</api>
+ </version>
+ <stability>
+ <release>stable</release>
+ <api>stable</api>
+ </stability>
+ <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license>
+ <notes>
+- Added setting of focus on name input
+- Added gl_ES translation
+ </notes>
+ </release>
+ </changelog>
+</package>
diff --git a/plugins/new_user_identity/new_user_identity.php b/plugins/new_user_identity/new_user_identity.php
new file mode 100644
index 000000000..2fc025b59
--- /dev/null
+++ b/plugins/new_user_identity/new_user_identity.php
@@ -0,0 +1,89 @@
+<?php
+/**
+ * New user identity
+ *
+ * Populates a new user's default identity from LDAP on their first visit.
+ *
+ * This plugin requires that a working public_ldap directory be configured.
+ *
+ * @version 1.02
+ * @author Kris Steinhoff
+ *
+ * Example configuration:
+ *
+ * // The id of the address book to use to automatically set a new
+ * // user's full name in their new identity. (This should be an
+ * // string, which refers to the $rcmail_config['ldap_public'] array.)
+ * $rcmail_config['new_user_identity_addressbook'] = 'People';
+ *
+ * // When automatically setting a new users's full name in their
+ * // new identity, match the user's login name against this field.
+ * $rcmail_config['new_user_identity_match'] = 'uid';
+ *
+ * // Use this field (from fieldmap configuration) to fill alias col of
+ * // the new user record.
+ * $rcmail_config['new_user_identity_alias'] = 'alias';
+ */
+class new_user_identity extends rcube_plugin
+{
+ public $task = 'login';
+
+ private $ldap;
+
+ function init()
+ {
+ $this->add_hook('user_create', array($this, 'lookup_user_name'));
+ }
+
+ function lookup_user_name($args)
+ {
+ $rcmail = rcmail::get_instance();
+
+ if ($this->init_ldap()) {
+ $results = $this->ldap->search('*', $args['user'], TRUE);
+ if (count($results->records) == 1) {
+ $args['user_name'] = $results->records[0]['name'];
+ if (!$args['user_email'] && strpos($results->records[0]['email'], '@')) {
+ $args['user_email'] = rcube_idn_to_ascii($results->records[0]['email']);
+ }
+ if (($alias_col = $rcmail->config->get('new_user_identity_alias')) && $results->records[0][$alias_col]) {
+ $args['alias'] = $results->records[0][$alias_col];
+ }
+ }
+ }
+ return $args;
+ }
+
+ private function init_ldap()
+ {
+ if ($this->ldap)
+ return $this->ldap->ready;
+
+ $rcmail = rcmail::get_instance();
+
+ $addressbook = $rcmail->config->get('new_user_identity_addressbook');
+ $ldap_config = (array)$rcmail->config->get('ldap_public');
+ $match = $rcmail->config->get('new_user_identity_match');
+
+ if (empty($addressbook) || empty($match) || empty($ldap_config[$addressbook])) {
+ return false;
+ }
+
+ $this->ldap = new new_user_identity_ldap_backend(
+ $ldap_config[$addressbook],
+ $rcmail->config->get('ldap_debug'),
+ $rcmail->config->mail_domain($_SESSION['imap_host']),
+ $match);
+
+ return $this->ldap->ready;
+ }
+}
+
+class new_user_identity_ldap_backend extends rcube_ldap
+{
+ function __construct($p, $debug=false, $mail_domain=NULL, $search=null)
+ {
+ parent::__construct($p, $debug, $mail_domain);
+ $this->prop['search_fields'] = (array)$search;
+ }
+}
diff --git a/plugins/newmail_notifier/config.inc.php.dist b/plugins/newmail_notifier/config.inc.php.dist
new file mode 100644
index 000000000..21b3d96c2
--- /dev/null
+++ b/plugins/newmail_notifier/config.inc.php.dist
@@ -0,0 +1,9 @@
+<?php
+
+// Enables basic notification
+$rcmail_config['newmail_notifier_basic'] = false;
+
+// Enables sound notification
+$rcmail_config['newmail_notifier_sound'] = false;
+
+?>
diff --git a/plugins/newmail_notifier/favicon.ico b/plugins/newmail_notifier/favicon.ico
new file mode 100644
index 000000000..86e10c1c7
--- /dev/null
+++ b/plugins/newmail_notifier/favicon.ico
Binary files differ
diff --git a/plugins/newmail_notifier/localization/en_US.inc b/plugins/newmail_notifier/localization/en_US.inc
new file mode 100644
index 000000000..fbb5d9aae
--- /dev/null
+++ b/plugins/newmail_notifier/localization/en_US.inc
@@ -0,0 +1,6 @@
+<?php
+
+$labels['basic'] = 'Display notifications on new message';
+$labels['sound'] = 'Play the sound on new message';
+
+?>
diff --git a/plugins/newmail_notifier/localization/pl_PL.inc b/plugins/newmail_notifier/localization/pl_PL.inc
new file mode 100644
index 000000000..5fe37903b
--- /dev/null
+++ b/plugins/newmail_notifier/localization/pl_PL.inc
@@ -0,0 +1,6 @@
+<?php
+
+$labels['basic'] = 'Wyświetlaj powiadomienia o nadejściu nowej wiadomości';
+$labels['sound'] = 'Odtwarzaj dźwięk o nadejściu nowej wiadomości';
+
+?>
diff --git a/plugins/newmail_notifier/newmail_notifier.js b/plugins/newmail_notifier/newmail_notifier.js
new file mode 100644
index 000000000..6e1ae9fbb
--- /dev/null
+++ b/plugins/newmail_notifier/newmail_notifier.js
@@ -0,0 +1,64 @@
+/**
+ * New Mail Notifier plugin script
+ *
+ * @version 0.1
+ * @author Aleksander Machniak <alec@alec.pl>
+ */
+
+if (window.rcmail && rcmail.env.task == 'mail') {
+ rcmail.addEventListener('plugin.newmail_notifier', newmail_notifier_run);
+ rcmail.addEventListener('actionbefore', newmail_notifier_stop);
+ rcmail.addEventListener('init', function() {
+ // bind to messages list select event, so favicon will be reverted on message preview too
+ if (rcmail.message_list)
+ rcmail.message_list.addEventListener('select', newmail_notifier_stop);
+ });
+}
+
+// Executes notification methods
+function newmail_notifier_run(prop)
+{
+ if (prop.basic)
+ newmail_notifier_basic();
+ if (prop.sound)
+ newmail_notifier_sound();
+}
+
+// Stops notification
+function newmail_notifier_stop(prop)
+{
+ // revert original favicon
+ if (rcmail.env.favicon_href && (!prop || prop.action != 'check-recent')) {
+ $('<link rel="shortcut icon" href="'+rcmail.env.favicon_href+'"/>').replaceAll('link[rel="shortcut icon"]');
+ rcmail.env.favicon_href = null;
+ }
+}
+
+// Basic notification: window.focus and favicon change
+function newmail_notifier_basic()
+{
+ window.focus();
+
+ // we cannot simply change a href attribute, we must to replace the link element (at least in FF)
+ var link = $('<link rel="shortcut icon" href="plugins/newmail_notifier/favicon.ico"/>'),
+ oldlink = $('link[rel="shortcut icon"]');
+
+ rcmail.env.favicon_href = oldlink.attr('href');
+ link.replaceAll(oldlink);
+}
+
+// Sound notification
+function newmail_notifier_sound()
+{
+ // HTML5
+ try {
+ var elem = $('<audio src="success.wav" />');
+ elem.get(0).play();
+ }
+ // old method
+ catch (e) {
+ var elem = $('<embed id="sound" src="success.wav" hidden=true autostart=true loop=false />');
+ elem.appendTo($('body'));
+ window.setTimeout("$('#sound').remove()", 5000);
+ }
+}
diff --git a/plugins/newmail_notifier/newmail_notifier.php b/plugins/newmail_notifier/newmail_notifier.php
new file mode 100644
index 000000000..679072c7a
--- /dev/null
+++ b/plugins/newmail_notifier/newmail_notifier.php
@@ -0,0 +1,145 @@
+<?php
+
+/**
+ * New Mail Notifier plugin
+ *
+ * Supports two methods of notification:
+ * 1. Basic - focus browser window and change favicon
+ * 2. Sound - play wav file
+ *
+ * @version 0.1
+ * @author Aleksander Machniak <alec@alec.pl>
+ *
+ *
+ * Copyright (C) 2011, Kolab Systems AG
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2
+ * as published by the Free Software Foundation.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License along
+ * with this program; if not, write to the Free Software Foundation, Inc.,
+ * 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+ */
+
+class newmail_notifier extends rcube_plugin
+{
+ public $task = 'mail|settings';
+
+ private $rc;
+
+ /**
+ * Plugin initialization
+ */
+ function init()
+ {
+ $this->rc = rcmail::get_instance();
+
+ // Preferences hooks
+ if ($this->rc->task == 'settings') {
+ $this->add_hook('preferences_list', array($this, 'prefs_list'));
+ $this->add_hook('preferences_save', array($this, 'prefs_save'));
+ }
+ else { // if ($this->rc->task == 'mail') {
+ $this->add_hook('new_messages', array($this, 'notify'));
+ // add script when not in ajax and not in frame
+ if (is_a($this->rc->output, 'rcube_template') && empty($_REQUEST['_framed'])) {
+ $this->include_script('newmail_notifier.js');
+ }
+ }
+ }
+
+ /**
+ * Handler for user preferences form (preferences_list hook)
+ */
+ function prefs_list($args)
+ {
+ if ($args['section'] != 'mailbox') {
+ return $args;
+ }
+
+ // Load configuration
+ $this->load_config();
+
+ // Load localization and configuration
+ $this->add_texts('localization/');
+
+ // Check that configuration is not disabled
+ $dont_override = (array) $this->rc->config->get('dont_override', array());
+ $basic_override = in_array('newmail_notifier_basic', $dont_override);
+ $sound_override = in_array('newmail_notifier_sound', $dont_override);
+
+ if (!$basic_override) {
+ $field_id = '_newmail_notifier_basic';
+ $input = new html_checkbox(array('name' => $field_id, 'id' => $field_id, 'value' => 1));
+ $args['blocks']['new_message']['options']['newmail_notifier_basic'] = array(
+ 'title' => html::label($field_id, Q($this->gettext('basic'))),
+ 'content' => $input->show($this->rc->config->get('newmail_notifier_basic')),
+ );
+ }
+
+ if (!$sound_override) {
+ $field_id = '_newmail_notifier_sound';
+ $input = new html_checkbox(array('name' => $field_id, 'id' => $field_id, 'value' => 1));
+ $args['blocks']['new_message']['options']['newmail_notifier_sound'] = array(
+ 'title' => html::label($field_id, Q($this->gettext('sound'))),
+ 'content' => $input->show($this->rc->config->get('newmail_notifier_sound')),
+ );
+ }
+
+ return $args;
+ }
+
+ /**
+ * Handler for user preferences save (preferences_save hook)
+ */
+ function prefs_save($args)
+ {
+ if ($args['section'] != 'mailbox') {
+ return $args;
+ }
+
+ // Load configuration
+ $this->load_config();
+
+ // Check that configuration is not disabled
+ $dont_override = (array) $this->rc->config->get('dont_override', array());
+ $basic_override = in_array('newmail_notifier_basic', $dont_override);
+ $sound_override = in_array('newmail_notifier_sound', $dont_override);
+
+ if (!$basic_override) {
+ $key = 'newmail_notifier_basic';
+ $args['prefs'][$key] = get_input_value('_'.$key, RCUBE_INPUT_POST) ? true : false;
+ }
+ if (!$sound_override) {
+ $key = 'newmail_notifier_sound';
+ $args['prefs'][$key] = get_input_value('_'.$key, RCUBE_INPUT_POST) ? true : false;
+ }
+
+ return $args;
+ }
+
+ /**
+ * Handler for new message action (new_messages hook)
+ */
+ function notify($args)
+ {
+ // Load configuration
+ $this->load_config();
+
+ $basic = $this->rc->config->get('newmail_notifier_basic');
+ $sound = $this->rc->config->get('newmail_notifier_sound');
+
+ if ($basic || $sound) {
+ $this->rc->output->command('plugin.newmail_notifier',
+ array('basic' => $basic, 'sound' => $sound));
+ }
+
+ return $args;
+ }
+}
diff --git a/plugins/newmail_notifier/sound.wav b/plugins/newmail_notifier/sound.wav
new file mode 100644
index 000000000..72d3dd857
--- /dev/null
+++ b/plugins/newmail_notifier/sound.wav
Binary files differ
diff --git a/plugins/password/README b/plugins/password/README
new file mode 100644
index 000000000..d9280fb03
--- /dev/null
+++ b/plugins/password/README
@@ -0,0 +1,264 @@
+ -----------------------------------------------------------------------
+ Password Plugin for Roundcube
+ -----------------------------------------------------------------------
+
+ Plugin that adds a possibility to change user password using many
+ methods (drivers) via Settings/Password tab.
+
+ -----------------------------------------------------------------------
+ This program is free software; you can redistribute it and/or modify
+ it under the terms of the GNU General Public License version 2
+ as published by the Free Software Foundation.
+
+ This program is distributed in the hope that it will be useful,
+ but WITHOUT ANY WARRANTY; without even the implied warranty of
+ MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ GNU General Public License for more details.
+
+ You should have received a copy of the GNU General Public License along
+ with this program; if not, write to the Free Software Foundation, Inc.,
+ 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+ @version @package_version@
+ @author Aleksander 'A.L.E.C' Machniak <alec@alec.pl>
+ @author <see driver files for driver authors>
+ -----------------------------------------------------------------------
+
+ 1. Configuration
+ 2. Drivers
+ 2.1. Database (sql)
+ 2.2. Cyrus/SASL (sasl)
+ 2.3. Poppassd/Courierpassd (poppassd)
+ 2.4. LDAP (ldap)
+ 2.5. DirectAdmin Control Panel (directadmin)
+ 2.6. cPanel (cpanel)
+ 2.7. XIMSS/Communigate (ximms)
+ 2.8. Virtualmin (virtualmin)
+ 2.9. hMailServer (hmail)
+ 2.10. PAM (pam)
+ 2.11. Chpasswd (chpasswd)
+ 2.12. LDAP - no PEAR (ldap_simple)
+ 2.13. XMail (xmail)
+ 3. Driver API
+
+
+ 1. Configuration
+ ----------------
+
+ Copy config.inc.php.dist to config.inc.php and set the options as described
+ within the file.
+
+
+ 2. Drivers
+ ----------
+
+ Password plugin supports many password change mechanisms which are
+ handled by included drivers. Just pass driver name in 'password_driver' option.
+
+
+ 2.1. Database (sql)
+ -------------------
+
+ You can specify which database to connect by 'password_db_dsn' option and
+ what SQL query to execute by 'password_query'. See main.inc.php.dist file for
+ more info.
+
+ Example implementations of an update_passwd function:
+
+ - This is for use with LMS (http://lms.org.pl) database and postgres:
+
+ CREATE OR REPLACE FUNCTION update_passwd(hash text, account text) RETURNS integer AS $$
+ DECLARE
+ res integer;
+ BEGIN
+ UPDATE passwd SET password = hash
+ WHERE login = split_part(account, '@', 1)
+ AND domainid = (SELECT id FROM domains WHERE name = split_part(account, '@', 2))
+ RETURNING id INTO res;
+ RETURN res;
+ END;
+ $$ LANGUAGE plpgsql SECURITY DEFINER;
+
+ - This is for use with a SELECT update_passwd(%o,%c,%u) query
+ Updates the password only when the old password matches the MD5 password
+ in the database
+
+ CREATE FUNCTION update_password (oldpass text, cryptpass text, user text) RETURNS text
+ MODIFIES SQL DATA
+ BEGIN
+ DECLARE currentsalt varchar(20);
+ DECLARE error text;
+ SET error = 'incorrect current password';
+ SELECT substring_index(substr(user.password,4),_latin1'$',1) INTO currentsalt FROM users WHERE username=user;
+ SELECT '' INTO error FROM users WHERE username=user AND password=ENCRYPT(oldpass,currentsalt);
+ UPDATE users SET password=cryptpass WHERE username=user AND password=ENCRYPT(oldpass,currentsalt);
+ RETURN error;
+ END
+
+ Example SQL UPDATEs:
+
+ - Plain text passwords:
+ UPDATE users SET password=%p WHERE username=%u AND password=%o AND domain=%h LIMIT 1
+
+ - Crypt text passwords:
+ UPDATE users SET password=%c WHERE username=%u LIMIT 1
+
+ - Use a MYSQL crypt function (*nix only) with random 8 character salt
+ UPDATE users SET password=ENCRYPT(%p,concat(_utf8'$1$',right(md5(rand()),8),_utf8'$')) WHERE username=%u LIMIT 1
+
+ - MD5 stored passwords:
+ UPDATE users SET password=MD5(%p) WHERE username=%u AND password=MD5(%o) LIMIT 1
+
+
+ 2.2. Cyrus/SASL (sasl)
+ ----------------------
+
+ Cyrus SASL database authentication allows your Cyrus+Roundcube
+ installation to host mail users without requiring a Unix Shell account!
+
+ This driver only covers the "sasldb" case when using Cyrus SASL. Kerberos
+ and PAM authentication mechanisms will require other techniques to enable
+ user password manipulations.
+
+ Cyrus SASL includes a shell utility called "saslpasswd" for manipulating
+ user passwords in the "sasldb" database. This plugin attempts to use
+ this utility to perform password manipulations required by your webmail
+ users without any administrative interaction. Unfortunately, this
+ scheme requires that the "saslpasswd" utility be run as the "cyrus"
+ user - kind of a security problem since we have chosen to SUID a small
+ script which will allow this to happen.
+
+ This driver is based on the Squirrelmail Change SASL Password Plugin.
+ See http://www.squirrelmail.org/plugin_view.php?id=107 for details.
+
+ Installation:
+
+ Change into the drivers directory. Edit the chgsaslpasswd.c file as is
+ documented within it.
+
+ Compile the wrapper program:
+ gcc -o chgsaslpasswd chgsaslpasswd.c
+
+ Chown the compiled chgsaslpasswd binary to the cyrus user and group
+ that your browser runs as, then chmod them to 4550.
+
+ For example, if your cyrus user is 'cyrus' and the apache server group is
+ 'nobody' (I've been told Redhat runs Apache as user 'apache'):
+
+ chown cyrus:nobody chgsaslpasswd
+ chmod 4550 chgsaslpasswd
+
+ Stephen Carr has suggested users should try to run the scripts on a test
+ account as the cyrus user eg;
+
+ su cyrus -c "./chgsaslpasswd -p test_account"
+
+ This will allow you to make sure that the script will work for your setup.
+ Should the script not work, make sure that:
+ 1) the user the script runs as has access to the saslpasswd|saslpasswd2
+ file and proper permissions
+ 2) make sure the user in the chgsaslpasswd.c file is set correctly.
+ This could save you some headaches if you are the paranoid type.
+
+
+ 2.3. Poppassd/Courierpassd (poppassd)
+ -------------------------------------
+
+ You can specify which host to connect to via 'password_pop_host' and
+ what port via 'password_pop_port'. See config.inc.php.dist file for more info.
+
+
+ 2.4. LDAP (ldap)
+ ----------------
+
+ See config.inc.php.dist file. Requires PEAR::Net_LDAP2 package.
+
+
+ 2.5. DirectAdmin Control Panel (directadmin)
+ --------------------------------------------
+
+ You can specify which host to connect to via 'password_directadmin_host' (don't
+ forget to use tcp:// or ssl://) and what port via 'password_direactadmin_port'.
+ The password enforcement with plenty customization can be done directly by
+ DirectAdmin, please see http://www.directadmin.com/features.php?id=910
+ See config.inc.php.dist file for more info.
+
+
+ 2.6. cPanel (cpanel)
+ --------------------
+
+ You can specify parameters for HTTP connection to cPanel's admin
+ interface. See config.inc.php.dist file for more info.
+
+
+ 2.7. XIMSS/Communigate (ximms)
+ ------------------------------
+
+ You can specify which host and port to connect to via 'password_ximss_host'
+ and 'password_ximss_port'. See config.inc.php.dist file for more info.
+
+
+ 2.8. Virtualmin (virtualmin)
+ ----------------------------
+
+ As in sasl driver this one allows to change password using shell
+ utility called "virtualmin". See drivers/chgvirtualminpasswd.c for
+ installation instructions. See also config.inc.php.dist file.
+
+
+ 2.9. hMailServer (hmail)
+ ------------------------
+
+ Requires PHP COM (Windows only). For access to hMail server on remote host
+ you'll need to define 'hmailserver_remote_dcom' and 'hmailserver_server'.
+ See config.inc.php.dist file for more info.
+
+
+ 2.10. PAM (pam)
+ ---------------
+
+ This driver is for changing passwords of shell users authenticated with PAM.
+ Requires PECL's PAM exitension to be installed (http://pecl.php.net/package/PAM).
+
+
+ 2.11. Chpasswd (chpasswd)
+ -------------------------
+
+ Driver that adds functionality to change the systems user password via
+ the 'chpasswd' command. See config.inc.php.dist file.
+
+ Attached wrapper script (chpass-wrapper.py) restricts password changes
+ to uids >= 1000 and can deny requests based on a blacklist.
+
+
+ 2.12. LDAP - no PEAR (ldap_simple)
+ -----------------------------------
+
+ It's rewritten ldap driver that doesn't require the Net_LDAP2 PEAR extension.
+ It uses directly PHP's ldap module functions instead (as Roundcube does).
+
+ This driver is fully compatible with the ldap driver, but
+ does not require (or uses) the
+ $rcmail_config['password_ldap_force_replace'] variable.
+ Other advantages:
+ * Connects only once with the LDAP server when using the search user.
+ * Does not read the DN, but only replaces the password within (that is
+ why the 'force replace' is always used).
+
+
+ 2.13. XMail (xmail)
+ -----------------------------------
+
+ Driver for XMail (www.xmailserver.org). See config.inc.php.dist file
+ for configuration description.
+
+
+ 3. Driver API
+ -------------
+
+ Driver file (<driver_name>.php) must define 'password_save' function with
+ two arguments. First - current password, second - new password. Function
+ should return PASSWORD_SUCCESS on success or any of PASSWORD_CONNECT_ERROR,
+ PASSWORD_CRYPT_ERROR, PASSWORD_ERROR when driver was unable to change password.
+ Extended result (as a hash-array with 'message' and 'code' items) can be returned
+ too. See existing drivers in drivers/ directory for examples.
diff --git a/plugins/password/config.inc.php.dist b/plugins/password/config.inc.php.dist
new file mode 100644
index 000000000..94af6d776
--- /dev/null
+++ b/plugins/password/config.inc.php.dist
@@ -0,0 +1,303 @@
+<?php
+
+// Password Plugin options
+// -----------------------
+// A driver to use for password change. Default: "sql".
+// See README file for list of supported driver names.
+$rcmail_config['password_driver'] = 'sql';
+
+// Determine whether current password is required to change password.
+// Default: false.
+$rcmail_config['password_confirm_current'] = true;
+
+// Require the new password to be a certain length.
+// set to blank to allow passwords of any length
+$rcmail_config['password_minimum_length'] = 0;
+
+// Require the new password to contain a letter and punctuation character
+// Change to false to remove this check.
+$rcmail_config['password_require_nonalpha'] = false;
+
+// Enables logging of password changes into logs/password
+$rcmail_config['password_log'] = false;
+
+
+// SQL Driver options
+// ------------------
+// PEAR database DSN for performing the query. By default
+// Roundcube DB settings are used.
+$rcmail_config['password_db_dsn'] = '';
+
+// The SQL query used to change the password.
+// The query can contain the following macros that will be expanded as follows:
+// %p is replaced with the plaintext new password
+// %c is replaced with the crypt version of the new password, MD5 if available
+// otherwise DES.
+// %D is replaced with the dovecotpw-crypted version of the new password
+// %o is replaced with the password before the change
+// %n is replaced with the hashed version of the new password
+// %q is replaced with the hashed password before the change
+// %h is replaced with the imap host (from the session info)
+// %u is replaced with the username (from the session info)
+// %l is replaced with the local part of the username
+// (in case the username is an email address)
+// %d is replaced with the domain part of the username
+// (in case the username is an email address)
+// Escaping of macros is handled by this module.
+// Default: "SELECT update_passwd(%c, %u)"
+$rcmail_config['password_query'] = 'SELECT update_passwd(%c, %u)';
+
+// Path for dovecotpw (if not in $PATH)
+// $rcmail_config['password_dovecotpw'] = '/usr/local/sbin/dovecotpw';
+
+// Dovecot method (dovecotpw -s 'method')
+$rcmail_config['password_dovecotpw_method'] = 'CRAM-MD5';
+
+// Enables use of password with crypt method prefix in %D, e.g. {MD5}$1$LUiMYWqx$fEkg/ggr/L6Mb2X7be4i1/
+$rcmail_config['password_dovecotpw_with_method'] = false;
+
+// Using a password hash for %n and %q variables.
+// Determine which hashing algorithm should be used to generate
+// the hashed new and current password for using them within the
+// SQL query. Requires PHP's 'hash' extension.
+$rcmail_config['password_hash_algorithm'] = 'sha1';
+
+// You can also decide whether the hash should be provided
+// as hex string or in base64 encoded format.
+$rcmail_config['password_hash_base64'] = false;
+
+
+// Poppassd Driver options
+// -----------------------
+// The host which changes the password
+$rcmail_config['password_pop_host'] = 'localhost';
+
+// TCP port used for poppassd connections
+$rcmail_config['password_pop_port'] = 106;
+
+
+// SASL Driver options
+// -------------------
+// Additional arguments for the saslpasswd2 call
+$rcmail_config['password_saslpasswd_args'] = '';
+
+
+// LDAP and LDAP_SIMPLE Driver options
+// -----------------------------------
+// LDAP server name to connect to.
+// You can provide one or several hosts in an array in which case the hosts are tried from left to right.
+// Exemple: array('ldap1.exemple.com', 'ldap2.exemple.com');
+// Default: 'localhost'
+$rcmail_config['password_ldap_host'] = 'localhost';
+
+// LDAP server port to connect to
+// Default: '389'
+$rcmail_config['password_ldap_port'] = '389';
+
+// TLS is started after connecting
+// Using TLS for password modification is recommanded.
+// Default: false
+$rcmail_config['password_ldap_starttls'] = false;
+
+// LDAP version
+// Default: '3'
+$rcmail_config['password_ldap_version'] = '3';
+
+// LDAP base name (root directory)
+// Exemple: 'dc=exemple,dc=com'
+$rcmail_config['password_ldap_basedn'] = 'dc=exemple,dc=com';
+
+// LDAP connection method
+// There is two connection method for changing a user's LDAP password.
+// 'user': use user credential (recommanded, require password_confirm_current=true)
+// 'admin': use admin credential (this mode require password_ldap_adminDN and password_ldap_adminPW)
+// Default: 'user'
+$rcmail_config['password_ldap_method'] = 'user';
+
+// LDAP Admin DN
+// Used only in admin connection mode
+// Default: null
+$rcmail_config['password_ldap_adminDN'] = null;
+
+// LDAP Admin Password
+// Used only in admin connection mode
+// Default: null
+$rcmail_config['password_ldap_adminPW'] = null;
+
+// LDAP user DN mask
+// The user's DN is mandatory and as we only have his login,
+// we need to re-create his DN using a mask
+// '%login' will be replaced by the current roundcube user's login
+// '%name' will be replaced by the current roundcube user's name part
+// '%domain' will be replaced by the current roundcube user's domain part
+// '%dc' will be replaced by domain name hierarchal string e.g. "dc=test,dc=domain,dc=com"
+// Exemple: 'uid=%login,ou=people,dc=exemple,dc=com'
+$rcmail_config['password_ldap_userDN_mask'] = 'uid=%login,ou=people,dc=exemple,dc=com';
+
+// LDAP search DN
+// The DN roundcube should bind with to find out user's DN
+// based on his login. Note that you should comment out the default
+// password_ldap_userDN_mask setting for this to take effect.
+// Use this if you cannot specify a general template for user DN with
+// password_ldap_userDN_mask. You need to perform a search based on
+// users login to find his DN instead. A common reason might be that
+// your users are placed under different ou's like engineering or
+// sales which cannot be derived from their login only.
+$rcmail_config['password_ldap_searchDN'] = 'cn=roundcube,ou=services,dc=example,dc=com';
+
+// LDAP search password
+// If password_ldap_searchDN is set, the password to use for
+// binding to search for user's DN. Note that you should comment out the default
+// password_ldap_userDN_mask setting for this to take effect.
+// Warning: Be sure to set approperiate permissions on this file so this password
+// is only accesible to roundcube and don't forget to restrict roundcube's access to
+// your directory as much as possible using ACLs. Should this password be compromised
+// you want to minimize the damage.
+$rcmail_config['password_ldap_searchPW'] = 'secret';
+
+// LDAP search base
+// If password_ldap_searchDN is set, the base to search in using the filter below.
+// Note that you should comment out the default password_ldap_userDN_mask setting
+// for this to take effect.
+$rcmail_config['password_ldap_search_base'] = 'ou=people,dc=example,dc=com';
+
+// LDAP search filter
+// If password_ldap_searchDN is set, the filter to use when
+// searching for user's DN. Note that you should comment out the default
+// password_ldap_userDN_mask setting for this to take effect.
+// '%login' will be replaced by the current roundcube user's login
+// '%name' will be replaced by the current roundcube user's name part
+// '%domain' will be replaced by the current roundcube user's domain part
+// '%dc' will be replaced by domain name hierarchal string e.g. "dc=test,dc=domain,dc=com"
+// Example: '(uid=%login)'
+// Example: '(&(objectClass=posixAccount)(uid=%login))'
+$rcmail_config['password_ldap_search_filter'] = '(uid=%login)';
+
+// LDAP password hash type
+// Standard LDAP encryption type which must be one of: crypt,
+// ext_des, md5crypt, blowfish, md5, sha, smd5, ssha, or clear.
+// Please note that most encodage types require external libraries
+// to be included in your PHP installation, see function hashPassword in drivers/ldap.php for more info.
+// Default: 'crypt'
+$rcmail_config['password_ldap_encodage'] = 'crypt';
+
+// LDAP password attribute
+// Name of the ldap's attribute used for storing user password
+// Default: 'userPassword'
+$rcmail_config['password_ldap_pwattr'] = 'userPassword';
+
+// LDAP password force replace
+// Force LDAP replace in cases where ACL allows only replace not read
+// See http://pear.php.net/package/Net_LDAP2/docs/latest/Net_LDAP2/Net_LDAP2_Entry.html#methodreplace
+// Default: true
+$rcmail_config['password_ldap_force_replace'] = true;
+
+// LDAP Password Last Change Date
+// Some places use an attribute to store the date of the last password change
+// The date is meassured in "days since epoch" (an integer value)
+// Whenever the password is changed, the attribute will be updated if set (e.g. shadowLastChange)
+$rcmail_config['password_ldap_lchattr'] = '';
+
+// LDAP Samba password attribute, e.g. sambaNTPassword
+// Name of the LDAP's Samba attribute used for storing user password
+$rcmail_config['password_ldap_samba_pwattr'] = '';
+
+// LDAP Samba Password Last Change Date attribute, e.g. sambaPwdLastSet
+// Some places use an attribute to store the date of the last password change
+// The date is meassured in "seconds since epoch" (an integer value)
+// Whenever the password is changed, the attribute will be updated if set
+$rcmail_config['password_ldap_samba_lchattr'] = '';
+
+
+// DirectAdmin Driver options
+// --------------------------
+// The host which changes the password
+// Use 'ssl://host' instead of 'tcp://host' when running DirectAdmin over SSL.
+// The host can contain the following macros that will be expanded as follows:
+// %h is replaced with the imap host (from the session info)
+// %d is replaced with the domain part of the username (if the username is an email)
+$rcmail_config['password_directadmin_host'] = 'tcp://localhost';
+
+// TCP port used for DirectAdmin connections
+$rcmail_config['password_directadmin_port'] = 2222;
+
+
+// vpopmaild Driver options
+// -----------------------
+// The host which changes the password
+$rcmail_config['password_vpopmaild_host'] = 'localhost';
+
+// TCP port used for vpopmaild connections
+$rcmail_config['password_vpopmaild_port'] = 89;
+
+
+// cPanel Driver options
+// --------------------------
+// The cPanel Host name
+$rcmail_config['password_cpanel_host'] = 'host.domain.com';
+
+// The cPanel admin username
+$rcmail_config['password_cpanel_username'] = 'username';
+
+// The cPanel admin password
+$rcmail_config['password_cpanel_password'] = 'password';
+
+// The cPanel port to use
+$rcmail_config['password_cpanel_port'] = 2082;
+
+// Using ssl for cPanel connections?
+$rcmail_config['password_cpanel_ssl'] = true;
+
+// The cPanel theme in use
+$rcmail_config['password_cpanel_theme'] = 'x';
+
+
+// XIMSS (Communigate server) Driver options
+// -----------------------------------------
+// Host name of the Communigate server
+$rcmail_config['password_ximss_host'] = 'mail.example.com';
+
+// XIMSS port on Communigate server
+$rcmail_config['password_ximss_port'] = 11024;
+
+
+// chpasswd Driver options
+// ---------------------
+// Command to use
+$rcmail_config['password_chpasswd_cmd'] = 'sudo /usr/sbin/chpasswd 2> /dev/null';
+
+
+// XMail Driver options
+// ---------------------
+$rcmail_config['xmail_host'] = 'localhost';
+$rcmail_config['xmail_user'] = 'YourXmailControlUser';
+$rcmail_config['xmail_pass'] = 'YourXmailControlPass';
+$rcmail_config['xmail_port'] = 6017;
+
+
+// hMail Driver options
+// -----------------------
+// Remote hMailServer configuration
+// true: HMailserver is on a remote box (php.ini: com.allow_dcom = true)
+// false: Hmailserver is on same box as PHP
+$rcmail_config['hmailserver_remote_dcom'] = false;
+// Windows credentials
+$rcmail_config['hmailserver_server'] = array(
+ 'Server' => 'localhost', // hostname or ip address
+ 'Username' => 'administrator', // windows username
+ 'Password' => 'password' // windows user password
+);
+
+
+// Virtualmin Driver options
+// -------------------------
+// Username format:
+// 0: username@domain
+// 1: username%domain
+// 2: username.domain
+// 3: domain.username
+// 4: username-domain
+// 5: domain-username
+// 6: username_domain
+// 7: domain_username
+$rcmail_config['password_virtualmin_format'] = 0;
diff --git a/plugins/password/drivers/chgsaslpasswd.c b/plugins/password/drivers/chgsaslpasswd.c
new file mode 100644
index 000000000..bcdcb2e0d
--- /dev/null
+++ b/plugins/password/drivers/chgsaslpasswd.c
@@ -0,0 +1,29 @@
+#include <stdio.h>
+#include <unistd.h>
+
+// set the UID this script will run as (cyrus user)
+#define UID 96
+// set the path to saslpasswd or saslpasswd2
+#define CMD "/usr/sbin/saslpasswd2"
+
+/* INSTALLING:
+ gcc -o chgsaslpasswd chgsaslpasswd.c
+ chown cyrus.apache chgsaslpasswd
+ strip chgsaslpasswd
+ chmod 4550 chgsaslpasswd
+*/
+
+main(int argc, char *argv[])
+{
+ int rc,cc;
+
+ cc = setuid(UID);
+ rc = execvp(CMD, argv);
+ if ((rc != 0) || (cc != 0))
+ {
+ fprintf(stderr, "__ %s: failed %d %d\n", argv[0], rc, cc);
+ return 1;
+ }
+
+ return 0;
+}
diff --git a/plugins/password/drivers/chgvirtualminpasswd.c b/plugins/password/drivers/chgvirtualminpasswd.c
new file mode 100644
index 000000000..4e2299c66
--- /dev/null
+++ b/plugins/password/drivers/chgvirtualminpasswd.c
@@ -0,0 +1,28 @@
+#include <stdio.h>
+#include <unistd.h>
+
+// set the UID this script will run as (root user)
+#define UID 0
+#define CMD "/usr/sbin/virtualmin"
+
+/* INSTALLING:
+ gcc -o chgvirtualminpasswd chgvirtualminpasswd.c
+ chown root.apache chgvirtualminpasswd
+ strip chgvirtualminpasswd
+ chmod 4550 chgvirtualminpasswd
+*/
+
+main(int argc, char *argv[])
+{
+ int rc,cc;
+
+ cc = setuid(UID);
+ rc = execvp(CMD, argv);
+ if ((rc != 0) || (cc != 0))
+ {
+ fprintf(stderr, "__ %s: failed %d %d\n", argv[0], rc, cc);
+ return 1;
+ }
+
+ return 0;
+}
diff --git a/plugins/password/drivers/chpass-wrapper.py b/plugins/password/drivers/chpass-wrapper.py
new file mode 100644
index 000000000..61bba849e
--- /dev/null
+++ b/plugins/password/drivers/chpass-wrapper.py
@@ -0,0 +1,32 @@
+#!/usr/bin/env python
+
+import sys
+import pwd
+import subprocess
+
+BLACKLIST = (
+ # add blacklisted users here
+ #'user1',
+)
+
+try:
+ username, password = sys.stdin.readline().split(':', 1)
+except ValueError, e:
+ sys.exit('Malformed input')
+
+try:
+ user = pwd.getpwnam(username)
+except KeyError, e:
+ sys.exit('No such user: %s' % username)
+
+if user.pw_uid < 1000:
+ sys.exit('Changing the password for user id < 1000 is forbidden')
+
+if username in BLACKLIST:
+ sys.exit('Changing password for user %s is forbidden (user blacklisted)' %
+ username)
+
+handle = subprocess.Popen('/usr/sbin/chpasswd', stdin = subprocess.PIPE)
+handle.communicate('%s:%s' % (username, password))
+
+sys.exit(handle.returncode)
diff --git a/plugins/password/drivers/chpasswd.php b/plugins/password/drivers/chpasswd.php
new file mode 100644
index 000000000..28c3e5d7a
--- /dev/null
+++ b/plugins/password/drivers/chpasswd.php
@@ -0,0 +1,36 @@
+<?php
+
+/**
+ * chpasswd Driver
+ *
+ * Driver that adds functionality to change the systems user password via
+ * the 'chpasswd' command.
+ *
+ * For installation instructions please read the README file.
+ *
+ * @version 1.0
+ * @author Alex Cartwright <acartwright@mutinydesign.co.uk)
+ */
+
+function password_save($currpass, $newpass)
+{
+ $cmd = rcmail::get_instance()->config->get('password_chpasswd_cmd');
+ $username = $_SESSION['username'];
+
+ $handle = popen($cmd, "w");
+ fwrite($handle, "$username:$newpass\n");
+
+ if (pclose($handle) == 0) {
+ return PASSWORD_SUCCESS;
+ }
+ else {
+ raise_error(array(
+ 'code' => 600,
+ 'type' => 'php',
+ 'file' => __FILE__, 'line' => __LINE__,
+ 'message' => "Password plugin: Unable to execute $cmd"
+ ), true, false);
+ }
+
+ return PASSWORD_ERROR;
+}
diff --git a/plugins/password/drivers/cpanel.php b/plugins/password/drivers/cpanel.php
new file mode 100644
index 000000000..82bfe74d2
--- /dev/null
+++ b/plugins/password/drivers/cpanel.php
@@ -0,0 +1,121 @@
+<?php
+
+/**
+ * cPanel Password Driver
+ *
+ * Driver that adds functionality to change the users cPanel password.
+ * The cPanel PHP API code has been taken from: http://www.phpclasses.org/browse/package/3534.html
+ *
+ * This driver has been tested with Hostmonster hosting and seems to work fine.
+
+ *
+ * @version 1.0
+ * @author Fulvio Venturelli <fulvio@venturelli.org>
+ */
+
+class HTTP
+{
+ function HTTP($host, $username, $password, $port, $ssl, $theme)
+ {
+ $this->ssl = $ssl ? 'ssl://' : '';
+ $this->username = $username;
+ $this->password = $password;
+ $this->theme = $theme;
+ $this->auth = base64_encode($username . ':' . $password);
+ $this->port = $port;
+ $this->host = $host;
+ $this->path = '/frontend/' . $theme . '/';
+ }
+
+ function getData($url, $data = '')
+ {
+ $url = $this->path . $url;
+ if(is_array($data))
+ {
+ $url = $url . '?';
+ foreach($data as $key=>$value)
+ {
+ $url .= urlencode($key) . '=' . urlencode($value) . '&';
+ }
+ $url = substr($url, 0, -1);
+ }
+ $response = '';
+ $fp = fsockopen($this->ssl . $this->host, $this->port);
+ if(!$fp)
+ {
+ return false;
+ }
+ $out = 'GET ' . $url . ' HTTP/1.0' . "\r\n";
+ $out .= 'Authorization: Basic ' . $this->auth . "\r\n";
+ $out .= 'Connection: Close' . "\r\n\r\n";
+ fwrite($fp, $out);
+ while (!feof($fp))
+ {
+ $response .= @fgets($fp);
+ }
+ fclose($fp);
+ return $response;
+ }
+}
+
+
+class emailAccount
+{
+ function emailAccount($host, $username, $password, $port, $ssl, $theme, $address)
+ {
+ $this->HTTP = new HTTP($host, $username, $password, $port, $ssl, $theme);
+ if(strpos($address, '@'))
+ {
+ list($this->email, $this->domain) = explode('@', $address);
+ }
+ else
+ {
+ list($this->email, $this->domain) = array($address, '');
+ }
+ }
+
+ /*
+ * Change email account password
+ *
+ * Returns true on success or false on failure.
+ * @param string $password email account password
+ * @return bool
+ */
+ function setPassword($password)
+ {
+ $data['email'] = $this->email;
+ $data['domain'] = $this->domain;
+ $data['password'] = $password;
+ $response = $this->HTTP->getData('mail/dopasswdpop.html', $data);
+ if(strpos($response, 'success') && !strpos($response, 'failure'))
+ {
+ return true;
+ }
+ return false;
+ }
+}
+
+
+function password_save($curpas, $newpass)
+{
+ $rcmail = rcmail::get_instance();
+
+ // Create a cPanel email object
+ $cPanel = new emailAccount($rcmail->config->get('password_cpanel_host'),
+ $rcmail->config->get('password_cpanel_username'),
+ $rcmail->config->get('password_cpanel_password'),
+ $rcmail->config->get('password_cpanel_port'),
+ $rcmail->config->get('password_cpanel_ssl'),
+ $rcmail->config->get('password_cpanel_theme'),
+ $_SESSION['username'] );
+
+ if ($cPanel->setPassword($newpass)){
+ return PASSWORD_SUCCESS;
+ }
+ else
+ {
+ return PASSWORD_ERROR;
+ }
+}
+
+?>
diff --git a/plugins/password/drivers/directadmin.php b/plugins/password/drivers/directadmin.php
new file mode 100644
index 000000000..3b6ae9f03
--- /dev/null
+++ b/plugins/password/drivers/directadmin.php
@@ -0,0 +1,489 @@
+<?php
+
+/**
+ * DirectAdmin Password Driver
+ *
+ * Driver to change passwords via DirectAdmin Control Panel
+ *
+ * @version 1.2
+ * @author Victor Benincasa <vbenincasa@gmail.com>
+ *
+ */
+
+
+function password_save($curpass, $passwd){
+
+ $rcmail = rcmail::get_instance();
+ $Socket = new HTTPSocket;
+
+ $da_user = $_SESSION['username'];
+ $da_curpass = $curpass;
+ $da_newpass = $passwd;
+ $da_host = $rcmail->config->get('password_directadmin_host');
+ $da_port = $rcmail->config->get('password_directadmin_port');
+
+ if(strpos($da_user, '@') === false) return array('code' => PASSWORD_ERROR, 'message' => 'Change the SYSTEM user password through control panel!');
+
+ $da_host = str_replace('%h', $_SESSION['imap_host'], $da_host);
+ $da_host = str_replace('%d', $rcmail->user->get_username('domain'), $da_host);
+
+ $Socket->connect($da_host,$da_port);
+ $Socket->set_method('POST');
+ $Socket->query('/CMD_CHANGE_EMAIL_PASSWORD',
+ array(
+ 'email' => $da_user,
+ 'oldpassword' => $da_curpass,
+ 'password1' => $da_newpass,
+ 'password2' => $da_newpass,
+ 'api' => '1'
+ ));
+ $response = $Socket->fetch_parsed_body();
+
+ //DEBUG
+ //console("Password Plugin: [USER: $da_user] [HOST: $da_host] - Response: [SOCKET: ".$Socket->result_status_code."] [DA ERROR: ".strip_tags($response['error'])."] [TEXT: ".$response[text]."]");
+
+ if($Socket->result_status_code != 200)
+ return array('code' => PASSWORD_CONNECT_ERROR, 'message' => $Socket->error[0]);
+ elseif($response['error'] == 1)
+ return array('code' => PASSWORD_ERROR, 'message' => strip_tags($response['text']));
+ else
+ return PASSWORD_SUCCESS;
+
+}
+
+
+/**
+ * Socket communication class.
+ *
+ * Originally designed for use with DirectAdmin's API, this class will fill any HTTP socket need.
+ *
+ * Very, very basic usage:
+ * $Socket = new HTTPSocket;
+ * echo $Socket->get('http://user:pass@somesite.com/somedir/some.file?query=string&this=that');
+ *
+ * @author Phi1 'l0rdphi1' Stier <l0rdphi1@liquenox.net>
+ * @package HTTPSocket
+ * @version 2.7 (Updated by Victor Benincasa <vbenincasa@gmail.com>)
+ */
+class HTTPSocket {
+
+ var $version = '2.7';
+
+ /* all vars are private except $error, $query_cache, and $doFollowLocationHeader */
+
+ var $method = 'GET';
+
+ var $remote_host;
+ var $remote_port;
+ var $remote_uname;
+ var $remote_passwd;
+
+ var $result;
+ var $result_header;
+ var $result_body;
+ var $result_status_code;
+
+ var $lastTransferSpeed;
+
+ var $bind_host;
+
+ var $error = array();
+ var $warn = array();
+ var $query_cache = array();
+
+ var $doFollowLocationHeader = TRUE;
+ var $redirectURL;
+
+ var $extra_headers = array();
+
+ /**
+ * Create server "connection".
+ *
+ */
+ function connect($host, $port = '' )
+ {
+ if (!is_numeric($port))
+ {
+ $port = 80;
+ }
+
+ $this->remote_host = $host;
+ $this->remote_port = $port;
+ }
+
+ function bind( $ip = '' )
+ {
+ if ( $ip == '' )
+ {
+ $ip = $_SERVER['SERVER_ADDR'];
+ }
+
+ $this->bind_host = $ip;
+ }
+
+ /**
+ * Change the method being used to communicate.
+ *
+ * @param string|null request method. supports GET, POST, and HEAD. default is GET
+ */
+ function set_method( $method = 'GET' )
+ {
+ $this->method = strtoupper($method);
+ }
+
+ /**
+ * Specify a username and password.
+ *
+ * @param string|null username. defualt is null
+ * @param string|null password. defualt is null
+ */
+ function set_login( $uname = '', $passwd = '' )
+ {
+ if ( strlen($uname) > 0 )
+ {
+ $this->remote_uname = $uname;
+ }
+
+ if ( strlen($passwd) > 0 )
+ {
+ $this->remote_passwd = $passwd;
+ }
+
+ }
+
+ /**
+ * Query the server
+ *
+ * @param string containing properly formatted server API. See DA API docs and examples. Http:// URLs O.K. too.
+ * @param string|array query to pass to url
+ * @param int if connection KB/s drops below value here, will drop connection
+ */
+ function query( $request, $content = '', $doSpeedCheck = 0 )
+ {
+ $this->error = $this->warn = array();
+ $this->result_status_code = NULL;
+
+ // is our request a http:// ... ?
+ if (preg_match('!^http://!i',$request))
+ {
+ $location = parse_url($request);
+ $this->connect($location['host'],$location['port']);
+ $this->set_login($location['user'],$location['pass']);
+
+ $request = $location['path'];
+ $content = $location['query'];
+
+ if ( strlen($request) < 1 )
+ {
+ $request = '/';
+ }
+
+ }
+
+ $array_headers = array(
+ 'User-Agent' => "HTTPSocket/$this->version",
+ 'Host' => ( $this->remote_port == 80 ? $this->remote_host : "$this->remote_host:$this->remote_port" ),
+ 'Accept' => '*/*',
+ 'Connection' => 'Close' );
+
+ foreach ( $this->extra_headers as $key => $value )
+ {
+ $array_headers[$key] = $value;
+ }
+
+ $this->result = $this->result_header = $this->result_body = '';
+
+ // was content sent as an array? if so, turn it into a string
+ if (is_array($content))
+ {
+ $pairs = array();
+
+ foreach ( $content as $key => $value )
+ {
+ $pairs[] = "$key=".urlencode($value);
+ }
+
+ $content = join('&',$pairs);
+ unset($pairs);
+ }
+
+ $OK = TRUE;
+
+ // instance connection
+ if ($this->bind_host)
+ {
+ $socket = socket_create(AF_INET, SOCK_STREAM, SOL_TCP);
+ socket_bind($socket,$this->bind_host);
+
+ if (!@socket_connect($socket,$this->remote_host,$this->remote_port))
+ {
+ $OK = FALSE;
+ }
+
+ }
+ else
+ {
+ $socket = @fsockopen( $this->remote_host, $this->remote_port, $sock_errno, $sock_errstr, 10 );
+ }
+
+ if ( !$socket || !$OK )
+ {
+ $this->error[] = "Can't create socket connection to $this->remote_host:$this->remote_port.";
+ return 0;
+ }
+
+ // if we have a username and password, add the header
+ if ( isset($this->remote_uname) && isset($this->remote_passwd) )
+ {
+ $array_headers['Authorization'] = 'Basic '.base64_encode("$this->remote_uname:$this->remote_passwd");
+ }
+
+ // for DA skins: if $this->remote_passwd is NULL, try to use the login key system
+ if ( isset($this->remote_uname) && $this->remote_passwd == NULL )
+ {
+ $array_headers['Cookie'] = "session={$_SERVER['SESSION_ID']}; key={$_SERVER['SESSION_KEY']}";
+ }
+
+ // if method is POST, add content length & type headers
+ if ( $this->method == 'POST' )
+ {
+ $array_headers['Content-type'] = 'application/x-www-form-urlencoded';
+ $array_headers['Content-length'] = strlen($content);
+ }
+ // else method is GET or HEAD. we don't support anything else right now.
+ else
+ {
+ if ($content)
+ {
+ $request .= "?$content";
+ }
+ }
+
+ // prepare query
+ $query = "$this->method $request HTTP/1.0\r\n";
+ foreach ( $array_headers as $key => $value )
+ {
+ $query .= "$key: $value\r\n";
+ }
+ $query .= "\r\n";
+
+ // if POST we need to append our content
+ if ( $this->method == 'POST' && $content )
+ {
+ $query .= "$content\r\n\r\n";
+ }
+
+ // query connection
+ if ($this->bind_host)
+ {
+ socket_write($socket,$query);
+
+ // now load results
+ while ( $out = socket_read($socket,2048) )
+ {
+ $this->result .= $out;
+ }
+ }
+ else
+ {
+ fwrite( $socket, $query, strlen($query) );
+
+ // now load results
+ $this->lastTransferSpeed = 0;
+ $status = socket_get_status($socket);
+ $startTime = time();
+ $length = 0;
+ $prevSecond = 0;
+ while ( !feof($socket) && !$status['timed_out'] )
+ {
+ $chunk = fgets($socket,1024);
+ $length += strlen($chunk);
+ $this->result .= $chunk;
+
+ $elapsedTime = time() - $startTime;
+
+ if ( $elapsedTime > 0 )
+ {
+ $this->lastTransferSpeed = ($length/1024)/$elapsedTime;
+ }
+
+ if ( $doSpeedCheck > 0 && $elapsedTime > 5 && $this->lastTransferSpeed < $doSpeedCheck )
+ {
+ $this->warn[] = "kB/s for last 5 seconds is below 50 kB/s (~".( ($length/1024)/$elapsedTime )."), dropping connection...";
+ $this->result_status_code = 503;
+ break;
+ }
+
+ }
+
+ if ( $this->lastTransferSpeed == 0 )
+ {
+ $this->lastTransferSpeed = $length/1024;
+ }
+
+ }
+
+ list($this->result_header,$this->result_body) = preg_split("/\r\n\r\n/",$this->result,2);
+
+ if ($this->bind_host)
+ {
+ socket_close($socket);
+ }
+ else
+ {
+ fclose($socket);
+ }
+
+ $this->query_cache[] = $query;
+
+
+ $headers = $this->fetch_header();
+
+ // what return status did we get?
+ if (!$this->result_status_code)
+ {
+ preg_match("#HTTP/1\.. (\d+)#",$headers[0],$matches);
+ $this->result_status_code = $matches[1];
+ }
+
+ // did we get the full file?
+ if ( !empty($headers['content-length']) && $headers['content-length'] != strlen($this->result_body) )
+ {
+ $this->result_status_code = 206;
+ }
+
+ // now, if we're being passed a location header, should we follow it?
+ if ($this->doFollowLocationHeader)
+ {
+ if ($headers['location'])
+ {
+ $this->redirectURL = $headers['location'];
+ $this->query($headers['location']);
+ }
+ }
+
+ }
+
+ function getTransferSpeed()
+ {
+ return $this->lastTransferSpeed;
+ }
+
+ /**
+ * The quick way to get a URL's content :)
+ *
+ * @param string URL
+ * @param boolean return as array? (like PHP's file() command)
+ * @return string result body
+ */
+ function get($location, $asArray = FALSE )
+ {
+ $this->query($location);
+
+ if ( $this->get_status_code() == 200 )
+ {
+ if ($asArray)
+ {
+ return preg_split("/\n/",$this->fetch_body());
+ }
+
+ return $this->fetch_body();
+ }
+
+ return FALSE;
+ }
+
+ /**
+ * Returns the last status code.
+ * 200 = OK;
+ * 403 = FORBIDDEN;
+ * etc.
+ *
+ * @return int status code
+ */
+ function get_status_code()
+ {
+ return $this->result_status_code;
+ }
+
+ /**
+ * Adds a header, sent with the next query.
+ *
+ * @param string header name
+ * @param string header value
+ */
+ function add_header($key,$value)
+ {
+ $this->extra_headers[$key] = $value;
+ }
+
+ /**
+ * Clears any extra headers.
+ *
+ */
+ function clear_headers()
+ {
+ $this->extra_headers = array();
+ }
+
+ /**
+ * Return the result of a query.
+ *
+ * @return string result
+ */
+ function fetch_result()
+ {
+ return $this->result;
+ }
+
+ /**
+ * Return the header of result (stuff before body).
+ *
+ * @param string (optional) header to return
+ * @return array result header
+ */
+ function fetch_header( $header = '' )
+ {
+ $array_headers = preg_split("/\r\n/",$this->result_header);
+
+ $array_return = array( 0 => $array_headers[0] );
+ unset($array_headers[0]);
+
+ foreach ( $array_headers as $pair )
+ {
+ list($key,$value) = preg_split("/: /",$pair,2);
+ $array_return[strtolower($key)] = $value;
+ }
+
+ if ( $header != '' )
+ {
+ return $array_return[strtolower($header)];
+ }
+
+ return $array_return;
+ }
+
+ /**
+ * Return the body of result (stuff after header).
+ *
+ * @return string result body
+ */
+ function fetch_body()
+ {
+ return $this->result_body;
+ }
+
+ /**
+ * Return parsed body in array format.
+ *
+ * @return array result parsed
+ */
+ function fetch_parsed_body()
+ {
+ parse_str($this->result_body,$x);
+ return $x;
+ }
+
+}
+
+?>
diff --git a/plugins/password/drivers/hmail.php b/plugins/password/drivers/hmail.php
new file mode 100644
index 000000000..39a87ab34
--- /dev/null
+++ b/plugins/password/drivers/hmail.php
@@ -0,0 +1,61 @@
+<?php
+
+/**
+ * hMailserver password driver
+ *
+ * @version 1.3 - 05.11.2010
+ * @author Roland 'rosali' Liebl <myroundcube@mail4us.net>
+ *
+ */
+
+function password_save($curpass, $passwd)
+{
+ $rcmail = rcmail::get_instance();
+
+ if ($curpass == '' || $passwd == '')
+ return PASSWORD_ERROR;
+
+ try {
+ $remote = $rcmail->config->get('hmailserver_remote_dcom', false);
+ if ($remote)
+ $obApp = new COM("hMailServer.Application", $rcmail->config->get('hmailserver_server'));
+ else
+ $obApp = new COM("hMailServer.Application");
+ }
+ catch (Exception $e) {
+ write_log('errors', "Plugin password (hmail driver): " . trim(strip_tags($e->getMessage())));
+ write_log('errors', "Plugin password (hmail driver): This problem is often caused by DCOM permissions not being set.");
+ return PASSWORD_ERROR;
+ }
+
+ $username = $rcmail->user->data['username'];
+ if (strstr($username,'@')){
+ $temparr = explode('@', $username);
+ $domain = $temparr[1];
+ }
+ else {
+ $domain = $rcmail->config->get('username_domain',false);
+ if (!$domain) {
+ write_log('errors','Plugin password (hmail driver): $rcmail_config[\'username_domain\'] is not defined.');
+ write_log('errors','Plugin password (hmail driver): Hint: Use hmail_login plugin (http://myroundcube.googlecode.com');
+ return PASSWORD_ERROR;
+ }
+ $username = $username . "@" . $domain;
+ }
+
+ $obApp->Authenticate($username, $curpass);
+ try {
+ $obDomain = $obApp->Domains->ItemByName($domain);
+ $obAccount = $obDomain->Accounts->ItemByAddress($username);
+ $obAccount->Password = $passwd;
+ $obAccount->Save();
+ return PASSWORD_SUCCESS;
+ }
+ catch (Exception $e) {
+ write_log('errors', "Plugin password (hmail driver): " . trim(strip_tags($e->getMessage())));
+ write_log('errors', "Plugin password (hmail driver): This problem is often caused by DCOM permissions not being set.");
+ return PASSWORD_ERROR;
+ }
+}
+
+?>
diff --git a/plugins/password/drivers/ldap.php b/plugins/password/drivers/ldap.php
new file mode 100644
index 000000000..3ea30a69c
--- /dev/null
+++ b/plugins/password/drivers/ldap.php
@@ -0,0 +1,317 @@
+<?php
+
+/**
+ * LDAP Password Driver
+ *
+ * Driver for passwords stored in LDAP
+ * This driver use the PEAR Net_LDAP2 class (http://pear.php.net/package/Net_LDAP2).
+ *
+ * @version 1.1 (2010-04-07)
+ * @author Edouard MOREAU <edouard.moreau@ensma.fr>
+ *
+ * function hashPassword based on code from the phpLDAPadmin development team (http://phpldapadmin.sourceforge.net/).
+ * function randomSalt based on code from the phpLDAPadmin development team (http://phpldapadmin.sourceforge.net/).
+ *
+ */
+
+function password_save($curpass, $passwd)
+{
+ $rcmail = rcmail::get_instance();
+ require_once ('Net/LDAP2.php');
+
+ // Building user DN
+ if ($userDN = $rcmail->config->get('password_ldap_userDN_mask')) {
+ $userDN = substitute_vars($userDN);
+ } else {
+ $userDN = search_userdn($rcmail);
+ }
+
+ if (empty($userDN)) {
+ return PASSWORD_CONNECT_ERROR;
+ }
+
+ // Connection Method
+ switch($rcmail->config->get('password_ldap_method')) {
+ case 'admin':
+ $binddn = $rcmail->config->get('password_ldap_adminDN');
+ $bindpw = $rcmail->config->get('password_ldap_adminPW');
+ break;
+ case 'user':
+ default:
+ $binddn = $userDN;
+ $bindpw = $curpass;
+ break;
+ }
+
+ // Configuration array
+ $ldapConfig = array (
+ 'binddn' => $binddn,
+ 'bindpw' => $bindpw,
+ 'basedn' => $rcmail->config->get('password_ldap_basedn'),
+ 'host' => $rcmail->config->get('password_ldap_host'),
+ 'port' => $rcmail->config->get('password_ldap_port'),
+ 'starttls' => $rcmail->config->get('password_ldap_starttls'),
+ 'version' => $rcmail->config->get('password_ldap_version'),
+ );
+
+ // Connecting using the configuration array
+ $ldap = Net_LDAP2::connect($ldapConfig);
+
+ // Checking for connection error
+ if (PEAR::isError($ldap)) {
+ return PASSWORD_CONNECT_ERROR;
+ }
+
+ $crypted_pass = hashPassword($passwd, $rcmail->config->get('password_ldap_encodage'));
+ $force = $rcmail->config->get('password_ldap_force_replace');
+ $pwattr = $rcmail->config->get('password_ldap_pwattr');
+ $lchattr = $rcmail->config->get('password_ldap_lchattr');
+ $smbpwattr = $rcmail->config->get('password_ldap_samba_pwattr');
+ $smblchattr = $rcmail->config->get('password_ldap_samba_lchattr');
+ $samba = $rcmail->config->get('password_ldap_samba');
+
+ // Support password_ldap_samba option for backward compat.
+ if ($samba && !$smbpwattr) {
+ $smbpwattr = 'sambaNTPassword';
+ $smblchattr = 'sambaPwdLastSet';
+ }
+
+ // Crypt new password
+ if (!$crypted_pass) {
+ return PASSWORD_CRYPT_ERROR;
+ }
+
+ // Crypt new samba password
+ if ($smbpwattr && !($samba_pass = hashPassword($passwd, 'samba'))) {
+ return PASSWORD_CRYPT_ERROR;
+ }
+
+ // Writing new crypted password to LDAP
+ $userEntry = $ldap->getEntry($userDN);
+ if (Net_LDAP2::isError($userEntry)) {
+ return PASSWORD_CONNECT_ERROR;
+ }
+
+ if (!$userEntry->replace(array($pwattr => $crypted_pass), $force)) {
+ return PASSWORD_CONNECT_ERROR;
+ }
+
+ // Updating PasswordLastChange Attribute if desired
+ if ($lchattr) {
+ $current_day = (int)(time() / 86400);
+ if (!$userEntry->replace(array($lchattr => $current_day), $force)) {
+ return PASSWORD_CONNECT_ERROR;
+ }
+ }
+
+ // Update Samba password and last change fields
+ if ($smbpwattr) {
+ $userEntry->replace(array($smbpwattr => $samba_pass), $force);
+ }
+ // Update Samba password last change field
+ if ($smblchattr) {
+ $userEntry->replace(array($smblchattr => time()), $force);
+ }
+
+ if (Net_LDAP2::isError($userEntry->update())) {
+ return PASSWORD_CONNECT_ERROR;
+ }
+
+ // All done, no error
+ return PASSWORD_SUCCESS;
+}
+
+/**
+ * Bind with searchDN and searchPW and search for the user's DN.
+ * Use search_base and search_filter defined in config file.
+ * Return the found DN.
+ */
+function search_userdn($rcmail)
+{
+ $ldapConfig = array (
+ 'binddn' => $rcmail->config->get('password_ldap_searchDN'),
+ 'bindpw' => $rcmail->config->get('password_ldap_searchPW'),
+ 'basedn' => $rcmail->config->get('password_ldap_basedn'),
+ 'host' => $rcmail->config->get('password_ldap_host'),
+ 'port' => $rcmail->config->get('password_ldap_port'),
+ 'starttls' => $rcmail->config->get('password_ldap_starttls'),
+ 'version' => $rcmail->config->get('password_ldap_version'),
+ );
+
+ $ldap = Net_LDAP2::connect($ldapConfig);
+
+ if (PEAR::isError($ldap)) {
+ return '';
+ }
+
+ $base = $rcmail->config->get('password_ldap_search_base');
+ $filter = substitute_vars($rcmail->config->get('password_ldap_search_filter'));
+ $options = array (
+ 'scope' => 'sub',
+ 'attributes' => array(),
+ );
+
+ $result = $ldap->search($base, $filter, $options);
+ $ldap->done();
+ if (PEAR::isError($result) || ($result->count() != 1)) {
+ return '';
+ }
+
+ return $result->current()->dn();
+}
+
+/**
+ * Substitute %login, %name, %domain, %dc in $str.
+ * See plugin config for details.
+ */
+function substitute_vars($str)
+{
+ $rcmail = rcmail::get_instance();
+ $domain = $rcmail->user->get_username('domain');
+ $dc = 'dc='.strtr($domain, array('.' => ',dc=')); // hierarchal domain string
+
+ $str = str_replace(array(
+ '%login',
+ '%name',
+ '%domain',
+ '%dc',
+ ), array(
+ $_SESSION['username'],
+ $rcmail->user->get_username('local'),
+ $domain,
+ $dc,
+ ), $str
+ );
+
+ return $str;
+}
+
+
+/**
+ * Code originaly from the phpLDAPadmin development team
+ * http://phpldapadmin.sourceforge.net/
+ *
+ * Hashes a password and returns the hash based on the specified enc_type.
+ *
+ * @param string $passwordClear The password to hash in clear text.
+ * @param string $encodageType Standard LDAP encryption type which must be one of
+ * crypt, ext_des, md5crypt, blowfish, md5, sha, smd5, ssha, or clear.
+ * @return string The hashed password.
+ *
+ */
+
+function hashPassword( $passwordClear, $encodageType )
+{
+ $encodageType = strtolower( $encodageType );
+ switch( $encodageType ) {
+ case 'crypt':
+ $cryptedPassword = '{CRYPT}' . crypt($passwordClear,randomSalt(2));
+ break;
+
+ case 'ext_des':
+ // extended des crypt. see OpenBSD crypt man page.
+ if ( ! defined( 'CRYPT_EXT_DES' ) || CRYPT_EXT_DES == 0 ) {
+ // Your system crypt library does not support extended DES encryption.
+ return FALSE;
+ }
+ $cryptedPassword = '{CRYPT}' . crypt( $passwordClear, '_' . randomSalt(8) );
+ break;
+
+ case 'md5crypt':
+ if( ! defined( 'CRYPT_MD5' ) || CRYPT_MD5 == 0 ) {
+ // Your system crypt library does not support md5crypt encryption.
+ return FALSE;
+ }
+ $cryptedPassword = '{CRYPT}' . crypt( $passwordClear , '$1$' . randomSalt(9) );
+ break;
+
+ case 'blowfish':
+ if( ! defined( 'CRYPT_BLOWFISH' ) || CRYPT_BLOWFISH == 0 ) {
+ // Your system crypt library does not support blowfish encryption.
+ return FALSE;
+ }
+ // hardcoded to second blowfish version and set number of rounds
+ $cryptedPassword = '{CRYPT}' . crypt( $passwordClear , '$2a$12$' . randomSalt(13) );
+ break;
+
+ case 'md5':
+ $cryptedPassword = '{MD5}' . base64_encode( pack( 'H*' , md5( $passwordClear) ) );
+ break;
+
+ case 'sha':
+ if( function_exists('sha1') ) {
+ // use php 4.3.0+ sha1 function, if it is available.
+ $cryptedPassword = '{SHA}' . base64_encode( pack( 'H*' , sha1( $passwordClear) ) );
+ } elseif( function_exists( 'mhash' ) ) {
+ $cryptedPassword = '{SHA}' . base64_encode( mhash( MHASH_SHA1, $passwordClear) );
+ } else {
+ return FALSE; //Your PHP install does not have the mhash() function. Cannot do SHA hashes.
+ }
+ break;
+
+ case 'ssha':
+ if( function_exists( 'mhash' ) && function_exists( 'mhash_keygen_s2k' ) ) {
+ mt_srand( (double) microtime() * 1000000 );
+ $salt = mhash_keygen_s2k( MHASH_SHA1, $passwordClear, substr( pack( 'h*', md5( mt_rand() ) ), 0, 8 ), 4 );
+ $cryptedPassword = '{SSHA}'.base64_encode( mhash( MHASH_SHA1, $passwordClear.$salt ).$salt );
+ } else {
+ return FALSE; //Your PHP install does not have the mhash() function. Cannot do SHA hashes.
+ }
+ break;
+
+ case 'smd5':
+ if( function_exists( 'mhash' ) && function_exists( 'mhash_keygen_s2k' ) ) {
+ mt_srand( (double) microtime() * 1000000 );
+ $salt = mhash_keygen_s2k( MHASH_MD5, $passwordClear, substr( pack( 'h*', md5( mt_rand() ) ), 0, 8 ), 4 );
+ $cryptedPassword = '{SMD5}'.base64_encode( mhash( MHASH_MD5, $passwordClear.$salt ).$salt );
+ } else {
+ return FALSE; //Your PHP install does not have the mhash() function. Cannot do SHA hashes.
+ }
+ break;
+
+ case 'samba':
+ if (function_exists('hash')) {
+ $cryptedPassword = hash('md4', rcube_charset_convert($passwordClear, RCMAIL_CHARSET, 'UTF-16LE'));
+ } else {
+ /* Your PHP install does not have the hash() function */
+ return false;
+ }
+ break;
+
+ case 'clear':
+ default:
+ $cryptedPassword = $passwordClear;
+ }
+
+ return $cryptedPassword;
+}
+
+/**
+ * Code originaly from the phpLDAPadmin development team
+ * http://phpldapadmin.sourceforge.net/
+ *
+ * Used to generate a random salt for crypt-style passwords. Salt strings are used
+ * to make pre-built hash cracking dictionaries difficult to use as the hash algorithm uses
+ * not only the user's password but also a randomly generated string. The string is
+ * stored as the first N characters of the hash for reference of hashing algorithms later.
+ *
+ * --- added 20021125 by bayu irawan <bayuir@divnet.telkom.co.id> ---
+ * --- ammended 20030625 by S C Rigler <srigler@houston.rr.com> ---
+ *
+ * @param int $length The length of the salt string to generate.
+ * @return string The generated salt string.
+ */
+function randomSalt( $length )
+{
+ $possible = '0123456789'.
+ 'abcdefghijklmnopqrstuvwxyz'.
+ 'ABCDEFGHIJKLMNOPQRSTUVWXYZ'.
+ './';
+ $str = '';
+// mt_srand((double)microtime() * 1000000);
+
+ while (strlen($str) < $length)
+ $str .= substr($possible, (rand() % strlen($possible)), 1);
+
+ return $str;
+}
diff --git a/plugins/password/drivers/ldap_simple.php b/plugins/password/drivers/ldap_simple.php
new file mode 100644
index 000000000..482b7e56f
--- /dev/null
+++ b/plugins/password/drivers/ldap_simple.php
@@ -0,0 +1,270 @@
+<?php
+
+/**
+ * Simple LDAP Password Driver
+ *
+ * Driver for passwords stored in LDAP
+ * This driver is based on Edouard's LDAP Password Driver, but does not
+ * require PEAR's Net_LDAP2 to be installed
+ *
+ * @version 1.0 (2010-07-31)
+ * @author Wout Decre <wout@canodus.be>
+ */
+function password_save($curpass, $passwd)
+{
+ $rcmail = rcmail::get_instance();
+
+ // Connect
+ if (!$ds = ldap_connect($rcmail->config->get('password_ldap_host'), $rcmail->config->get('password_ldap_port'))) {
+ ldap_unbind($ds);
+ return PASSWORD_CONNECT_ERROR;
+ }
+
+ // Set protocol version
+ if (!ldap_set_option($ds, LDAP_OPT_PROTOCOL_VERSION, $rcmail->config->get('password_ldap_version'))) {
+ ldap_unbind($ds);
+ return PASSWORD_CONNECT_ERROR;
+ }
+
+ // Start TLS
+ if ($rcmail->config->get('password_ldap_starttls')) {
+ if (!ldap_start_tls($ds)) {
+ ldap_unbind($ds);
+ return PASSWORD_CONNECT_ERROR;
+ }
+ }
+
+ // Build user DN
+ if ($user_dn = $rcmail->config->get('password_ldap_userDN_mask')) {
+ $user_dn = ldap_simple_substitute_vars($user_dn);
+ } else {
+ $user_dn = ldap_simple_search_userdn($rcmail, $ds);
+ }
+
+ if (empty($user_dn)) {
+ ldap_unbind($ds);
+ return PASSWORD_CONNECT_ERROR;
+ }
+
+ // Connection method
+ switch ($rcmail->config->get('password_ldap_method')) {
+ case 'admin':
+ $binddn = $rcmail->config->get('password_ldap_adminDN');
+ $bindpw = $rcmail->config->get('password_ldap_adminPW');
+ break;
+ case 'user':
+ default:
+ $binddn = $user_dn;
+ $bindpw = $curpass;
+ break;
+ }
+
+
+ $crypted_pass = ldap_simple_hash_password($passwd, $rcmail->config->get('password_ldap_encodage'));
+ $lchattr = $rcmail->config->get('password_ldap_lchattr');
+ $pwattr = $rcmail->config->get('password_ldap_pwattr');
+ $smbpwattr = $rcmail->config->get('password_ldap_samba_pwattr');
+ $smblchattr = $rcmail->config->get('password_ldap_samba_lchattr');
+ $samba = $rcmail->config->get('password_ldap_samba');
+
+ // Support password_ldap_samba option for backward compat.
+ if ($samba && !$smbpwattr) {
+ $smbpwattr = 'sambaNTPassword';
+ $smblchattr = 'sambaPwdLastSet';
+ }
+
+ // Crypt new password
+ if (!$crypted_pass) {
+ return PASSWORD_CRYPT_ERROR;
+ }
+
+ // Crypt new Samba password
+ if ($smbpwattr && !($samba_pass = ldap_simple_hash_password($passwd, 'samba'))) {
+ return PASSWORD_CRYPT_ERROR;
+ }
+
+ // Bind
+ if (!ldap_bind($ds, $binddn, $bindpw)) {
+ ldap_unbind($ds);
+ return PASSWORD_CONNECT_ERROR;
+ }
+
+ $entree[$pwattr] = $crypted_pass;
+
+ // Update PasswordLastChange Attribute if desired
+ if ($lchattr) {
+ $entree[$lchattr] = (int)(time() / 86400);
+ }
+
+ // Update Samba password
+ if ($smbpwattr) {
+ $entree[$smbpwattr] = $samba_pass;
+ }
+
+ // Update Samba password last change
+ if ($smblchattr) {
+ $entree[$smblchattr] = time();
+ }
+
+ if (!ldap_modify($ds, $user_dn, $entree)) {
+ ldap_unbind($ds);
+ return PASSWORD_CONNECT_ERROR;
+ }
+
+ // All done, no error
+ ldap_unbind($ds);
+ return PASSWORD_SUCCESS;
+}
+
+/**
+ * Bind with searchDN and searchPW and search for the user's DN
+ * Use search_base and search_filter defined in config file
+ * Return the found DN
+ */
+function ldap_simple_search_userdn($rcmail, $ds)
+{
+ /* Bind */
+ if (!ldap_bind($ds, $rcmail->config->get('password_ldap_searchDN'), $rcmail->config->get('password_ldap_searchPW'))) {
+ return false;
+ }
+
+ /* Search for the DN */
+ if (!$sr = ldap_search($ds, $rcmail->config->get('password_ldap_search_base'), ldap_simple_substitute_vars($rcmail->config->get('password_ldap_search_filter')))) {
+ return false;
+ }
+
+ /* If no or more entries were found, return false */
+ if (ldap_count_entries($ds, $sr) != 1) {
+ return false;
+ }
+
+ return ldap_get_dn($ds, ldap_first_entry($ds, $sr));
+}
+
+/**
+ * Substitute %login, %name, %domain, %dc in $str
+ * See plugin config for details
+ */
+function ldap_simple_substitute_vars($str)
+{
+ $str = str_replace('%login', $_SESSION['username'], $str);
+ $str = str_replace('%l', $_SESSION['username'], $str);
+
+ $parts = explode('@', $_SESSION['username']);
+
+ if (count($parts) == 2) {
+ $dc = 'dc='.strtr($parts[1], array('.' => ',dc=')); // hierarchal domain string
+
+ $str = str_replace('%name', $parts[0], $str);
+ $str = str_replace('%n', $parts[0], $str);
+ $str = str_replace('%dc', $dc, $str);
+ $str = str_replace('%domain', $parts[1], $str);
+ $str = str_replace('%d', $parts[1], $str);
+ }
+
+ return $str;
+}
+
+/**
+ * Code originaly from the phpLDAPadmin development team
+ * http://phpldapadmin.sourceforge.net/
+ *
+ * Hashes a password and returns the hash based on the specified enc_type
+ */
+function ldap_simple_hash_password($password_clear, $encodage_type)
+{
+ $encodage_type = strtolower($encodage_type);
+ switch ($encodage_type) {
+ case 'crypt':
+ $crypted_password = '{CRYPT}' . crypt($password_clear, ldap_simple_random_salt(2));
+ break;
+ case 'ext_des':
+ /* Extended DES crypt. see OpenBSD crypt man page */
+ if (!defined('CRYPT_EXT_DES') || CRYPT_EXT_DES == 0) {
+ /* Your system crypt library does not support extended DES encryption */
+ return false;
+ }
+ $crypted_password = '{CRYPT}' . crypt($password_clear, '_' . ldap_simple_random_salt(8));
+ break;
+ case 'md5crypt':
+ if (!defined('CRYPT_MD5') || CRYPT_MD5 == 0) {
+ /* Your system crypt library does not support md5crypt encryption */
+ return false;
+ }
+ $crypted_password = '{CRYPT}' . crypt($password_clear, '$1$' . ldap_simple_random_salt(9));
+ break;
+ case 'blowfish':
+ if (!defined('CRYPT_BLOWFISH') || CRYPT_BLOWFISH == 0) {
+ /* Your system crypt library does not support blowfish encryption */
+ return false;
+ }
+ /* Hardcoded to second blowfish version and set number of rounds */
+ $crypted_password = '{CRYPT}' . crypt($password_clear, '$2a$12$' . ldap_simple_random_salt(13));
+ break;
+ case 'md5':
+ $crypted_password = '{MD5}' . base64_encode(pack('H*', md5($password_clear)));
+ break;
+ case 'sha':
+ if (function_exists('sha1')) {
+ /* Use PHP 4.3.0+ sha1 function, if it is available */
+ $crypted_password = '{SHA}' . base64_encode(pack('H*', sha1($password_clear)));
+ } else if (function_exists('mhash')) {
+ $crypted_password = '{SHA}' . base64_encode(mhash(MHASH_SHA1, $password_clear));
+ } else {
+ /* Your PHP install does not have the mhash() function */
+ return false;
+ }
+ break;
+ case 'ssha':
+ if (function_exists('mhash') && function_exists('mhash_keygen_s2k')) {
+ mt_srand((double) microtime() * 1000000 );
+ $salt = mhash_keygen_s2k(MHASH_SHA1, $password_clear, substr(pack('h*', md5(mt_rand())), 0, 8), 4);
+ $crypted_password = '{SSHA}' . base64_encode(mhash(MHASH_SHA1, $password_clear . $salt) . $salt);
+ } else {
+ /* Your PHP install does not have the mhash() function */
+ return false;
+ }
+ break;
+ case 'smd5':
+ if (function_exists('mhash') && function_exists('mhash_keygen_s2k')) {
+ mt_srand((double) microtime() * 1000000 );
+ $salt = mhash_keygen_s2k(MHASH_MD5, $password_clear, substr(pack('h*', md5(mt_rand())), 0, 8), 4);
+ $crypted_password = '{SMD5}' . base64_encode(mhash(MHASH_MD5, $password_clear . $salt) . $salt);
+ } else {
+ /* Your PHP install does not have the mhash() function */
+ return false;
+ }
+ break;
+ case 'samba':
+ if (function_exists('hash')) {
+ $crypted_password = hash('md4', rcube_charset_convert($password_clear, RCMAIL_CHARSET, 'UTF-16LE'));
+ } else {
+ /* Your PHP install does not have the hash() function */
+ return false;
+ }
+ break;
+ case 'clear':
+ default:
+ $crypted_password = $password_clear;
+ }
+
+ return $crypted_password;
+}
+
+/**
+ * Code originaly from the phpLDAPadmin development team
+ * http://phpldapadmin.sourceforge.net/
+ *
+ * Used to generate a random salt for crypt-style passwords
+ */
+function ldap_simple_random_salt($length)
+{
+ $possible = '0123456789' . 'abcdefghijklmnopqrstuvwxyz' . 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' . './';
+ $str = '';
+ // mt_srand((double)microtime() * 1000000);
+ while (strlen($str) < $length) {
+ $str .= substr($possible, (rand() % strlen($possible)), 1);
+ }
+
+ return $str;
+}
diff --git a/plugins/password/drivers/pam.php b/plugins/password/drivers/pam.php
new file mode 100644
index 000000000..e9363cc5a
--- /dev/null
+++ b/plugins/password/drivers/pam.php
@@ -0,0 +1,41 @@
+<?php
+
+/**
+ * PAM Password Driver
+ *
+ * @version 1.0
+ * @author Aleksander Machniak
+ */
+
+function password_save($currpass, $newpass)
+{
+ $user = $_SESSION['username'];
+
+ if (extension_loaded('pam')) {
+ if (pam_auth($user, $currpass, $error, false)) {
+ if (pam_chpass($user, $currpass, $newpass)) {
+ return PASSWORD_SUCCESS;
+ }
+ }
+ else {
+ raise_error(array(
+ 'code' => 600,
+ 'type' => 'php',
+ 'file' => __FILE__, 'line' => __LINE__,
+ 'message' => "Password plugin: PAM authentication failed for user $user: $error"
+ ), true, false);
+ }
+ }
+ else {
+ raise_error(array(
+ 'code' => 600,
+ 'type' => 'php',
+ 'file' => __FILE__, 'line' => __LINE__,
+ 'message' => "Password plugin: PECL-PAM module not loaded"
+ ), true, false);
+ }
+
+ return PASSWORD_ERROR;
+}
+
+?>
diff --git a/plugins/password/drivers/poppassd.php b/plugins/password/drivers/poppassd.php
new file mode 100644
index 000000000..fc105de47
--- /dev/null
+++ b/plugins/password/drivers/poppassd.php
@@ -0,0 +1,64 @@
+<?php
+
+/**
+ * Poppassd Password Driver
+ *
+ * Driver to change passwords via Poppassd/Courierpassd
+ *
+ * @version 1.1
+ * @author Philip Weir
+ *
+ */
+
+function format_error_result($code, $line)
+{
+ if (preg_match('/^\d\d\d\s+(\S.*)\s*$/', $line, $matches)) {
+ return array('code' => $code, 'message' => $matches[1]);
+ } else {
+ return $code;
+ }
+}
+
+function password_save($curpass, $passwd)
+{
+ $rcmail = rcmail::get_instance();
+// include('Net/Socket.php');
+ $poppassd = new Net_Socket();
+
+ $result = $poppassd->connect($rcmail->config->get('password_pop_host'), $rcmail->config->get('password_pop_port'), null);
+ if (PEAR::isError($result)) {
+ return format_error_result(PASSWORD_CONNECT_ERROR, $result->getMessage());
+ }
+ else {
+ $result = $poppassd->readLine();
+ if(!preg_match('/^2\d\d/', $result)) {
+ $poppassd->disconnect();
+ return format_error_result(PASSWORD_ERROR, $result);
+ }
+ else {
+ $poppassd->writeLine("user ". $_SESSION['username']);
+ $result = $poppassd->readLine();
+ if(!preg_match('/^[23]\d\d/', $result) ) {
+ $poppassd->disconnect();
+ return format_error_result(PASSWORD_CONNECT_ERROR, $result);
+ }
+ else {
+ $poppassd->writeLine("pass ". $curpass);
+ $result = $poppassd->readLine();
+ if(!preg_match('/^[23]\d\d/', $result) ) {
+ $poppassd->disconnect();
+ return format_error_result(PASSWORD_ERROR, $result);
+ }
+ else {
+ $poppassd->writeLine("newpass ". $passwd);
+ $result = $poppassd->readLine();
+ $poppassd->disconnect();
+ if (!preg_match('/^2\d\d/', $result))
+ return format_error_result(PASSWORD_ERROR, $result);
+ else
+ return PASSWORD_SUCCESS;
+ }
+ }
+ }
+ }
+}
diff --git a/plugins/password/drivers/sasl.php b/plugins/password/drivers/sasl.php
new file mode 100644
index 000000000..f8ac5c606
--- /dev/null
+++ b/plugins/password/drivers/sasl.php
@@ -0,0 +1,44 @@
+<?php
+
+/**
+ * SASL Password Driver
+ *
+ * Driver that adds functionality to change the users Cyrus/SASL password.
+ * The code is derrived from the Squirrelmail "Change SASL Password" Plugin
+ * by Galen Johnson.
+ *
+ * It only works with saslpasswd2 on the same host where Roundcube runs
+ * and requires shell access and gcc in order to compile the binary.
+ *
+ * For installation instructions please read the README file.
+ *
+ * @version 1.0
+ * @author Thomas Bruederli
+ */
+
+function password_save($currpass, $newpass)
+{
+ $curdir = realpath(dirname(__FILE__));
+ $username = escapeshellcmd($_SESSION['username']);
+ $args = rcmail::get_instance()->config->get('password_saslpasswd_args', '');
+
+ if ($fh = popen("$curdir/chgsaslpasswd -p $args $username", 'w')) {
+ fwrite($fh, $newpass."\n");
+ $code = pclose($fh);
+
+ if ($code == 0)
+ return PASSWORD_SUCCESS;
+ }
+ else {
+ raise_error(array(
+ 'code' => 600,
+ 'type' => 'php',
+ 'file' => __FILE__, 'line' => __LINE__,
+ 'message' => "Password plugin: Unable to execute $curdir/chgsaslpasswd"
+ ), true, false);
+ }
+
+ return PASSWORD_ERROR;
+}
+
+?>
diff --git a/plugins/password/drivers/sql.php b/plugins/password/drivers/sql.php
new file mode 100644
index 000000000..9ea33df2f
--- /dev/null
+++ b/plugins/password/drivers/sql.php
@@ -0,0 +1,152 @@
+<?php
+
+/**
+ * SQL Password Driver
+ *
+ * Driver for passwords stored in SQL database
+ *
+ * @version 1.3
+ * @author Aleksander 'A.L.E.C' Machniak <alec@alec.pl>
+ *
+ */
+
+function password_save($curpass, $passwd)
+{
+ $rcmail = rcmail::get_instance();
+
+ if (!($sql = $rcmail->config->get('password_query')))
+ $sql = 'SELECT update_passwd(%c, %u)';
+
+ if ($dsn = $rcmail->config->get('password_db_dsn')) {
+ // #1486067: enable new_link option
+ if (is_array($dsn) && empty($dsn['new_link']))
+ $dsn['new_link'] = true;
+ else if (!is_array($dsn) && !preg_match('/\?new_link=true/', $dsn))
+ $dsn .= '?new_link=true';
+
+ $db = new rcube_mdb2($dsn, '', FALSE);
+ $db->set_debug((bool)$rcmail->config->get('sql_debug'));
+ $db->db_connect('w');
+ } else {
+ $db = $rcmail->get_dbh();
+ }
+
+ if ($err = $db->is_error())
+ return PASSWORD_ERROR;
+
+ // crypted password
+ if (strpos($sql, '%c') !== FALSE) {
+ $salt = '';
+ if (CRYPT_MD5) {
+ $len = rand(3, CRYPT_SALT_LENGTH);
+ } else if (CRYPT_STD_DES) {
+ $len = 2;
+ } else {
+ return PASSWORD_CRYPT_ERROR;
+ }
+ for ($i = 0; $i < $len ; $i++) {
+ $salt .= chr(rand(ord('.'), ord('z')));
+ }
+ $sql = str_replace('%c', $db->quote(crypt($passwd, CRYPT_MD5 ? '$1$'.$salt.'$' : $salt)), $sql);
+ }
+
+ // dovecotpw
+ if (strpos($sql, '%D') !== FALSE) {
+ if (!($dovecotpw = $rcmail->config->get('password_dovecotpw')))
+ $dovecotpw = 'dovecotpw';
+ if (!($method = $rcmail->config->get('password_dovecotpw_method')))
+ $method = 'CRAM-MD5';
+
+ // use common temp dir
+ $tmp_dir = $rcmail->config->get('temp_dir');
+ $tmpfile = tempnam($tmp_dir, 'roundcube-');
+
+ $pipe = popen("'$dovecotpw' -s '$method' > '$tmpfile'", "w");
+ if (!$pipe) {
+ unlink($tmpfile);
+ return PASSWORD_CRYPT_ERROR;
+ }
+ else {
+ fwrite($pipe, $passwd . "\n", 1+strlen($passwd)); usleep(1000);
+ fwrite($pipe, $passwd . "\n", 1+strlen($passwd));
+ pclose($pipe);
+ $newpass = trim(file_get_contents($tmpfile), "\n");
+ if (!preg_match('/^\{' . $method . '\}/', $newpass)) {
+ return PASSWORD_CRYPT_ERROR;
+ }
+ if (!$rcmail->config->get('password_dovecotpw_with_method'))
+ $newpass = trim(str_replace('{' . $method . '}', '', $newpass));
+ unlink($tmpfile);
+ }
+ $sql = str_replace('%D', $db->quote($newpass), $sql);
+ }
+
+ // hashed passwords
+ if (preg_match('/%[n|q]/', $sql)) {
+
+ if (!extension_loaded('hash')) {
+ raise_error(array(
+ 'code' => 600,
+ 'type' => 'php',
+ 'file' => __FILE__, 'line' => __LINE__,
+ 'message' => "Password plugin: 'hash' extension not loaded!"
+ ), true, false);
+
+ return PASSWORD_ERROR;
+ }
+
+ if (!($hash_algo = strtolower($rcmail->config->get('password_hash_algorithm'))))
+ $hash_algo = 'sha1';
+
+ $hash_passwd = hash($hash_algo, $passwd);
+ $hash_curpass = hash($hash_algo, $curpass);
+
+ if ($rcmail->config->get('password_hash_base64')) {
+ $hash_passwd = base64_encode(pack('H*', $hash_passwd));
+ $hash_curpass = base64_encode(pack('H*', $hash_curpass));
+ }
+
+ $sql = str_replace('%n', $db->quote($hash_passwd, 'text'), $sql);
+ $sql = str_replace('%q', $db->quote($hash_curpass, 'text'), $sql);
+ }
+
+ // Handle clear text passwords securely (#1487034)
+ $sql_vars = array();
+ if (preg_match_all('/%[p|o]/', $sql, $m)) {
+ foreach ($m[0] as $var) {
+ if ($var == '%p') {
+ $sql = preg_replace('/%p/', '?', $sql, 1);
+ $sql_vars[] = (string) $passwd;
+ }
+ else { // %o
+ $sql = preg_replace('/%o/', '?', $sql, 1);
+ $sql_vars[] = (string) $curpass;
+ }
+ }
+ }
+
+ // at least we should always have the local part
+ $sql = str_replace('%l', $db->quote($rcmail->user->get_username('local'), 'text'), $sql);
+ $sql = str_replace('%d', $db->quote($rcmail->user->get_username('domain'), 'text'), $sql);
+ $sql = str_replace('%u', $db->quote($_SESSION['username'],'text'), $sql);
+ $sql = str_replace('%h', $db->quote($_SESSION['imap_host'],'text'), $sql);
+
+ $res = $db->query($sql, $sql_vars);
+
+ if (!$db->is_error()) {
+ if (strtolower(substr(trim($query),0,6))=='select') {
+ if ($result = $db->fetch_array($res))
+ return PASSWORD_SUCCESS;
+ } else {
+ // This is the good case: 1 row updated
+ if ($db->affected_rows($res) == 1)
+ return PASSWORD_SUCCESS;
+ // @TODO: Some queries don't affect any rows
+ // Should we assume a success if there was no error?
+ }
+ }
+
+ return PASSWORD_ERROR;
+}
+
+?>
diff --git a/plugins/password/drivers/virtualmin.php b/plugins/password/drivers/virtualmin.php
new file mode 100644
index 000000000..78ef4e7c3
--- /dev/null
+++ b/plugins/password/drivers/virtualmin.php
@@ -0,0 +1,75 @@
+<?php
+
+/**
+ * Virtualmin Password Driver
+ *
+ * Driver that adds functionality to change the users Virtualmin password.
+ * The code is derrived from the Squirrelmail "Change Cyrus/SASL Password" Plugin
+ * by Thomas Bruederli.
+ *
+ * It only works with virtualmin on the same host where Roundcube runs
+ * and requires shell access and gcc in order to compile the binary.
+ *
+ * @version 2.0
+ * @author Martijn de Munnik
+ */
+
+function password_save($currpass, $newpass)
+{
+ $rcmail = rcmail::get_instance();
+
+ $format = $rcmail->config->get('password_virtualmin_format', 0);
+ $username = $_SESSION['username'];
+
+ switch ($format) {
+ case 1: // username%domain
+ $domain = substr(strrchr($username, "%"), 1);
+ break;
+ case 2: // username.domain (could be bogus)
+ $pieces = explode(".", $username);
+ $domain = $pieces[count($pieces)-2]. "." . end($pieces);
+ break;
+ case 3: // domain.username (could be bogus)
+ $pieces = explode(".", $username);
+ $domain = $pieces[0]. "." . $pieces[1];
+ break;
+ case 4: // username-domain
+ $domain = substr(strrchr($username, "-"), 1);
+ break;
+ case 5: // domain-username
+ $domain = str_replace(strrchr($username, "-"), "", $username);
+ break;
+ case 6: // username_domain
+ $domain = substr(strrchr($username, "_"), 1);
+ break;
+ case 7: // domain_username
+ $pieces = explode("_", $username);
+ $domain = $pieces[0];
+ break;
+ default: // username@domain
+ $domain = substr(strrchr($username, "@"), 1);
+ }
+
+ $username = escapeshellcmd($username);
+ $domain = escapeshellcmd($domain);
+ $newpass = escapeshellcmd($newpass);
+ $curdir = realpath(dirname(__FILE__));
+
+ exec("$curdir/chgvirtualminpasswd modify-user --domain $domain --user $username --pass $newpass", $output, $returnvalue);
+
+ if ($returnvalue == 0) {
+ return PASSWORD_SUCCESS;
+ }
+ else {
+ raise_error(array(
+ 'code' => 600,
+ 'type' => 'php',
+ 'file' => __FILE__, 'line' => __LINE__,
+ 'message' => "Password plugin: Unable to execute $curdir/chgvirtualminpasswd"
+ ), true, false);
+ }
+
+ return PASSWORD_ERROR;
+}
+
+?>
diff --git a/plugins/password/drivers/vpopmaild.php b/plugins/password/drivers/vpopmaild.php
new file mode 100644
index 000000000..b6fb39343
--- /dev/null
+++ b/plugins/password/drivers/vpopmaild.php
@@ -0,0 +1,51 @@
+<?php
+
+/**
+ * vpopmail Password Driver
+ *
+ * Driver to change passwords via vpopmaild
+ *
+ * @version 1.1
+ * @author Johannes Hessellund
+ *
+ */
+
+function password_save($curpass, $passwd)
+{
+ $rcmail = rcmail::get_instance();
+// include('Net/Socket.php');
+ $vpopmaild = new Net_Socket();
+
+ if (PEAR::isError($vpopmaild->connect($rcmail->config->get('password_vpopmaild_host'),
+ $rcmail->config->get('password_vpopmaild_port'), null))) {
+ return PASSWORD_CONNECT_ERROR;
+ }
+
+ $result = $vpopmaild->readLine();
+ if(!preg_match('/^\+OK/', $result)) {
+ $vpopmaild->disconnect();
+ return PASSWORD_CONNECT_ERROR;
+ }
+
+ $vpopmaild->writeLine("slogin ". $_SESSION['username'] . " " . $curpass);
+ $result = $vpopmaild->readLine();
+ if(!preg_match('/^\+OK/', $result) ) {
+ $vpopmaild->writeLine("quit");
+ $vpopmaild->disconnect();
+ return PASSWORD_ERROR;
+ }
+
+ $vpopmaild->writeLine("mod_user ". $_SESSION['username']);
+ $vpopmaild->writeLine("clear_text_password ". $passwd);
+ $vpopmaild->writeLine(".");
+ $result = $vpopmaild->readLine();
+ $vpopmaild->writeLine("quit");
+ $vpopmaild->disconnect();
+
+ if (!preg_match('/^\+OK/', $result))
+ return PASSWORD_ERROR;
+
+ return PASSWORD_SUCCESS;
+}
+
+?>
diff --git a/plugins/password/drivers/ximss.php b/plugins/password/drivers/ximss.php
new file mode 100644
index 000000000..94aba1874
--- /dev/null
+++ b/plugins/password/drivers/ximss.php
@@ -0,0 +1,81 @@
+<?php
+/**
+ * Communigate driver for the Password Plugin for Roundcube
+ *
+ * Tested with Communigate Pro 5.1.2
+ *
+ * Configuration options:
+ * password_ximss_host - Host name of Communigate server
+ * password_ximss_port - XIMSS port on Communigate server
+ *
+ *
+ * References:
+ * http://www.communigate.com/WebGuide/XMLAPI.html
+ *
+ * @version 1
+ * @author Erik Meitner <erik wanderings.us>
+ */
+
+function password_save($pass, $newpass)
+{
+
+ $rcmail = rcmail::get_instance();
+
+ $sock = stream_socket_client("tcp://".$rcmail->config->get('password_ximss_host').":".$rcmail->config->get('password_ximss_port'), $errno, $errstr, 30) ;
+ if( $sock === FALSE )
+ {
+ return PASSWORD_CONNECT_ERROR;
+ }
+
+ // send all requests at once(pipelined)
+ fwrite( $sock, '<login id="A001" authData="'.$_SESSION['username'].'" password="'.$pass.'" />'."\0");
+ fwrite( $sock, '<passwordModify id="A002" oldPassword="'.$pass.'" newPassword="'.$newpass.'" />'."\0");
+ fwrite( $sock, '<bye id="A003" />'."\0");
+
+ //example responses
+ // <session id="A001" urlID="4815-vN2Txjkggy7gjHRD10jw" userName="user@example.com"/>\0
+ // <response id="A001"/>\0
+ // <response id="A002"/>\0
+ // <response id="A003"/>\0
+ // or an error:
+ // <response id="A001" errorText="incorrect password or account name" errorNum="515"/>\0
+
+ $responseblob = '';
+ while (!feof($sock)) {
+ $responseblob .= fgets($sock, 1024);
+ }
+
+ fclose($sock);
+
+ foreach( explode( "\0",$responseblob) as $response )
+ {
+ $resp = simplexml_load_string("<xml>".$response."</xml>");
+
+ if( $resp->response[0]['id'] == 'A001' )
+ {
+ if( isset( $resp->response[0]['errorNum'] ) )
+ {
+ return PASSWORD_CONNECT_ERROR;
+ }
+ }
+ else if( $resp->response[0]['id'] == 'A002' )
+ {
+ if( isset( $resp->response[0]['errorNum'] ))
+ {
+ return PASSWORD_ERROR;
+ }
+ }
+ else if( $resp->response[0]['id'] == 'A003' )
+ {
+ if( isset($resp->response[0]['errorNum'] ))
+ {
+ //There was a problem during logout(This is probably harmless)
+ }
+ }
+ } //foreach
+
+ return PASSWORD_SUCCESS;
+
+}
+
+?> \ No newline at end of file
diff --git a/plugins/password/drivers/xmail.php b/plugins/password/drivers/xmail.php
new file mode 100644
index 000000000..c7f426158
--- /dev/null
+++ b/plugins/password/drivers/xmail.php
@@ -0,0 +1,101 @@
+<?php
+/**
+ * XMail Password Driver
+ *
+ * Driver for XMail password
+ *
+ * @version 1.0
+ * @author Helio Cavichiolo Jr <helio@hcsistemas.com.br>
+ *
+ * Setup xmail_host, xmail_user, xmail_pass and xmail_port into
+ * config.inc.php of password plugin as follows:
+ *
+ * $rcmail_config['xmail_host'] = 'localhost';
+ * $rcmail_config['xmail_user'] = 'YourXmailControlUser';
+ * $rcmail_config['xmail_pass'] = 'YourXmailControlPass';
+ * $rcmail_config['xmail_port'] = 6017;
+ *
+ */
+
+function password_save($currpass, $newpass)
+{
+ $rcmail = rcmail::get_instance();
+ list($user,$domain) = explode('@', $_SESSION['username']);
+
+ $xmail = new XMail;
+
+ $xmail->hostname = $rcmail->config->get('xmail_host');
+ $xmail->username = $rcmail->config->get('xmail_user');
+ $xmail->password = $rcmail->config->get('xmail_pass');
+ $xmail->port = $rcmail->config->get('xmail_port');
+
+ if (!$xmail->connect()) {
+ raise_error(array(
+ 'code' => 600,
+ 'type' => 'php',
+ 'file' => __FILE__, 'line' => __LINE__,
+ 'message' => "Password plugin: Unable to connect to mail server"
+ ), true, false);
+ return PASSWORD_CONNECT_ERROR;
+ } else if (!$xmail->send("userpasswd\t".$domain."\t".$user."\t".$newpass."\n")) {
+ $xmail->close();
+ raise_error(array(
+ 'code' => 600,
+ 'type' => 'php',
+ 'file' => __FILE__, 'line' => __LINE__,
+ 'message' => "Password plugin: Unable to change password"
+ ), true, false);
+ return PASSWORD_ERROR;
+ } else {
+ $xmail->close();
+ return PASSWORD_SUCCESS;
+ }
+}
+
+class XMail {
+ var $socket;
+ var $hostname = 'localhost';
+ var $username = 'xmail';
+ var $password = '';
+ var $port = 6017;
+
+ function send($msg)
+ {
+ socket_write($this->socket,$msg);
+ if (substr($in = socket_read($this->socket, 512, PHP_BINARY_READ),0,1) != "+") {
+ return false;
+ }
+ return true;
+ }
+
+ function connect()
+ {
+ $this->socket = socket_create(AF_INET, SOCK_STREAM, 0);
+ if ($this->socket < 0)
+ return false;
+
+ $result = socket_connect($this->socket, $this->hostname, $this->port);
+ if ($result < 0) {
+ socket_close($this->socket);
+ return false;
+ }
+
+ if (substr($in = socket_read($this->socket, 512, PHP_BINARY_READ),0,1) != "+") {
+ socket_close($this->socket);
+ return false;
+ }
+
+ if (!$this->send("$this->username\t$this->password\n")) {
+ socket_close($this->socket);
+ return false;
+ }
+ return true;
+ }
+
+ function close()
+ {
+ $this->send("quit\n");
+ socket_close($this->socket);
+ }
+}
+
diff --git a/plugins/password/localization/az_AZ.inc b/plugins/password/localization/az_AZ.inc
new file mode 100644
index 000000000..62df01ba8
--- /dev/null
+++ b/plugins/password/localization/az_AZ.inc
@@ -0,0 +1,24 @@
+<?php
+
+/* Azerbaijani translate for password plugin */
+/* Translated by Nadir Aliyev, nadir at ultel dot net */
+
+$labels = array();
+$labels['changepasswd'] = 'Şifrəni dəyiş';
+$labels['curpasswd'] = 'Hal-hazırki şifrə:';
+$labels['newpasswd'] = 'Yeni şifrə:';
+$labels['confpasswd'] = 'Yeni şifrə: (təkrar)';
+
+$messages = array();
+$messages['nopassword'] = 'Yeni şifrəni daxil edin.';
+$messages['nocurpassword'] = 'Hal-hazırda istifadə etdiyiniz şifrəni daxil edin.';
+$messages['passwordincorrect'] = 'Yalnış şifrə daxil etdiniz.';
+$messages['passwordinconsistency'] = 'Yeni daxil etdiyiniz şifrələr bir-birinə uyğun deyildir.';
+$messages['crypterror'] = 'Yeni şifrənin saxlanılması mümkün olmadı. Şifrələmə metodu tapılmadı.';
+$messages['connecterror'] = 'Yeni şifrənin saxlanılması mümkün olmadı. Qoşulma səhvi.';
+$messages['internalerror'] = 'Yeni şifrənin saxlanılması mümkün olmadı.';
+$messages['passwordshort'] = 'Yeni şifrə $length simvoldan uzun olmalıdır.';
+$messages['passwordweak'] = 'Şifrədə heç olmasa minimum bir rəqəm və simvol olmalıdır.';
+$messages['passwordforbidden'] = 'Şifrədə icazə verilməyən simvollar vardır.';
+
+?>
diff --git a/plugins/password/localization/bg_BG.inc b/plugins/password/localization/bg_BG.inc
new file mode 100644
index 000000000..b4576a0dc
--- /dev/null
+++ b/plugins/password/localization/bg_BG.inc
@@ -0,0 +1,18 @@
+<?php
+
+$labels = array();
+$labels['changepasswd'] = 'Смяна на парола';
+$labels['curpasswd'] = 'Текуща парола:';
+$labels['newpasswd'] = 'Нова парола:';
+$labels['confpasswd'] = 'Повторете:';
+
+$messages = array();
+$messages['nopassword'] = 'Моля въведете нова парола.';
+$messages['nocurpassword'] = 'Моля въведете текущата .';
+$messages['passwordincorrect'] = 'Невалидна текуща парола.';
+$messages['passwordinconsistency'] = 'Паролите не съвпадат, опитайте пак.';
+$messages['crypterror'] = 'Паролата не може да бъде сменена. Грешка в криптирането.';
+$messages['connecterror'] = 'Паролата не може да бъде сменена. Грешка в свързването.';
+$messages['internalerror'] = 'Паролата не може да бъде сменена.';
+
+?>
diff --git a/plugins/password/localization/ca_ES.inc b/plugins/password/localization/ca_ES.inc
new file mode 100644
index 000000000..18c10c80e
--- /dev/null
+++ b/plugins/password/localization/ca_ES.inc
@@ -0,0 +1,20 @@
+<?php
+
+$labels = array();
+$labels['changepasswd'] = 'Canviar contrasenya';
+$labels['curpasswd'] = 'Contrasenya actual:';
+$labels['newpasswd'] = 'Nova contrasenya:';
+$labels['confpasswd'] = 'Confirmar nova contrasenya:';
+
+$messages = array();
+$messages['nopassword'] = 'Si us plau, introdueix la nova contrasenya.';
+$messages['nocurpassword'] = 'Si us plau, introdueix la contrasenya actual.';
+$messages['passwordincorrect'] = 'Contrasenya actual incorrecte.';
+$messages['passwordinconsistency'] = 'La contrasenya nova no coincideix!.';
+$messages['crypterror'] = 'No es pot desar la nova contrasenya. No existeix la funció d\'encriptació.';
+$messages['connecterror'] = 'No es pot desar la nova contrasenya. Error de connexió.';
+$messages['internalerror'] = 'No es pot desar la nova contrasenya.';
+$messages['passwordshort'] = 'La nova contrasenya ha de tenir com a mínim $length caràcters de llarg.';
+$messages['passwordweak'] = 'La nova contrasenya ha d\'incloure com a mínim un nombre i un caràcter de puntuació.';
+
+?>
diff --git a/plugins/password/localization/cs_CZ.inc b/plugins/password/localization/cs_CZ.inc
new file mode 100644
index 000000000..b4b7b29f9
--- /dev/null
+++ b/plugins/password/localization/cs_CZ.inc
@@ -0,0 +1,30 @@
+<?php
+
+/**
+ * Czech translation for Roundcube password plugin
+ *
+ * @version 1.0 (2009-08-29)
+ * @author Milan Kozak <hodza@hodza.net>
+ * @author Tomáš Šafařík <safarik@server.cz>
+ *
+ */
+
+$labels = array();
+$labels['changepasswd'] = 'Změna hesla';
+$labels['curpasswd'] = 'Aktuální heslo:';
+$labels['newpasswd'] = 'Nové heslo:';
+$labels['confpasswd'] = 'Nové heslo (pro kontrolu):';
+
+$messages = array();
+$messages['nopassword'] = 'Prosím zadejte nové heslo.';
+$messages['nocurpassword'] = 'Prosím zadejte aktuální heslo.';
+$messages['passwordincorrect'] = 'Zadané aktuální heslo není správné.';
+$messages['passwordinconsistency'] = 'Zadaná hesla se neshodují. Prosím zkuste to znovu.';
+$messages['crypterror'] = 'Heslo se nepodařilo uložit. Chybí šifrovací funkce.';
+$messages['connecterror'] = 'Heslo se nepodařilo uložit. Problém s připojením.';
+$messages['internalerror'] = 'Heslo se nepodařilo uložit.';
+$messages['passwordshort'] = 'Heslo musí mít alespoň $length znaků.';
+$messages['passwordweak'] = 'Heslo musí obsahovat alespoň jedno číslo a jedno interpuknční znaménko.';
+$messages['passwordforbidden'] = 'Heslo obsahuje nepovolené znaky.';
+
+?>
diff --git a/plugins/password/localization/da_DK.inc b/plugins/password/localization/da_DK.inc
new file mode 100644
index 000000000..5d1d0c9cc
--- /dev/null
+++ b/plugins/password/localization/da_DK.inc
@@ -0,0 +1,18 @@
+<?php
+
+$labels = array();
+$labels['changepasswd'] = 'Skift adgangskode';
+$labels['curpasswd'] = 'Nuværende adgangskode:';
+$labels['newpasswd'] = 'Ny adgangskode:';
+$labels['confpasswd'] = 'Bekræft ny adgangskode:';
+
+$messages = array();
+$messages['nopassword'] = 'Indtast venligst en ny adgangskode.';
+$messages['nocurpassword'] = 'Indtast venligst nyværende adgangskode.';
+$messages['passwordincorrect'] = 'Nyværende adgangskode er forkert.';
+$messages['passwordinconsistency'] = 'Adgangskoderne er ikke ens, prøv igen.';
+$messages['crypterror'] = 'Kunne ikke gemme den nye adgangskode. Krypteringsfunktion mangler.';
+$messages['connecterror'] = 'Kunne ikke gemme den nye adgangskode. Fejl ved forbindelsen.';
+$messages['internalerror'] = 'Kunne ikke gemme den nye adgangskode.';
+
+?>
diff --git a/plugins/password/localization/de_CH.inc b/plugins/password/localization/de_CH.inc
new file mode 100644
index 000000000..a28990d67
--- /dev/null
+++ b/plugins/password/localization/de_CH.inc
@@ -0,0 +1,19 @@
+<?php
+
+$labels = array();
+$labels['changepasswd'] = 'Passwort ändern';
+$labels['curpasswd'] = 'Aktuelles Passwort';
+$labels['newpasswd'] = 'Neues Passwort';
+$labels['confpasswd'] = 'Passwort Wiederholung';
+
+$messages = array();
+$messages['nopassword'] = "Bitte geben Sie ein neues Passwort ein";
+$messages['nocurpassword'] = "Bitte geben Sie Ihr aktuelles Passwort an";
+$messages['passwordincorrect'] = "Das aktuelle Passwort ist nicht korrekt";
+$messages['passwordinconsistency'] = "Das neue Passwort und dessen Wiederholung stimmen nicht überein";
+$messages['crypterror'] = "Neues Passwort nicht gespeichert: Verschlüsselungsfunktion fehlt";
+$messages['connecterror'] = "Neues Passwort nicht gespeichert: Verbindungsfehler";
+$messages['internalerror'] = "Neues Passwort nicht gespeichert";
+
+
+?> \ No newline at end of file
diff --git a/plugins/password/localization/de_DE.inc b/plugins/password/localization/de_DE.inc
new file mode 100644
index 000000000..a28990d67
--- /dev/null
+++ b/plugins/password/localization/de_DE.inc
@@ -0,0 +1,19 @@
+<?php
+
+$labels = array();
+$labels['changepasswd'] = 'Passwort ändern';
+$labels['curpasswd'] = 'Aktuelles Passwort';
+$labels['newpasswd'] = 'Neues Passwort';
+$labels['confpasswd'] = 'Passwort Wiederholung';
+
+$messages = array();
+$messages['nopassword'] = "Bitte geben Sie ein neues Passwort ein";
+$messages['nocurpassword'] = "Bitte geben Sie Ihr aktuelles Passwort an";
+$messages['passwordincorrect'] = "Das aktuelle Passwort ist nicht korrekt";
+$messages['passwordinconsistency'] = "Das neue Passwort und dessen Wiederholung stimmen nicht überein";
+$messages['crypterror'] = "Neues Passwort nicht gespeichert: Verschlüsselungsfunktion fehlt";
+$messages['connecterror'] = "Neues Passwort nicht gespeichert: Verbindungsfehler";
+$messages['internalerror'] = "Neues Passwort nicht gespeichert";
+
+
+?> \ No newline at end of file
diff --git a/plugins/password/localization/en_US.inc b/plugins/password/localization/en_US.inc
new file mode 100644
index 000000000..1ae2158b0
--- /dev/null
+++ b/plugins/password/localization/en_US.inc
@@ -0,0 +1,21 @@
+<?php
+
+$labels = array();
+$labels['changepasswd'] = 'Change Password';
+$labels['curpasswd'] = 'Current Password:';
+$labels['newpasswd'] = 'New Password:';
+$labels['confpasswd'] = 'Confirm New Password:';
+
+$messages = array();
+$messages['nopassword'] = 'Please input new password.';
+$messages['nocurpassword'] = 'Please input current password.';
+$messages['passwordincorrect'] = 'Current password incorrect.';
+$messages['passwordinconsistency'] = 'Passwords do not match, please try again.';
+$messages['crypterror'] = 'Could not save new password. Encryption function missing.';
+$messages['connecterror'] = 'Could not save new password. Connection error.';
+$messages['internalerror'] = 'Could not save new password.';
+$messages['passwordshort'] = 'Password must be at least $length characters long.';
+$messages['passwordweak'] = 'Password must include at least one number and one punctuation character.';
+$messages['passwordforbidden'] = 'Password contains forbidden characters.';
+
+?>
diff --git a/plugins/password/localization/es_AR.inc b/plugins/password/localization/es_AR.inc
new file mode 100644
index 000000000..40c74e673
--- /dev/null
+++ b/plugins/password/localization/es_AR.inc
@@ -0,0 +1,21 @@
+<?php
+
+$labels = array();
+$labels['changepasswd'] = 'Cambiar Contraseña';
+$labels['curpasswd'] = 'Contraseña Actual:';
+$labels['newpasswd'] = 'Contraseña Nueva:';
+$labels['confpasswd'] = 'Confirmar Contraseña:';
+
+$messages = array();
+$messages['nopassword'] = 'Por favor introduce una nueva contraseña.';
+$messages['nocurpassword'] = 'Por favor introduce la contraseña actual.';
+$messages['passwordincorrect'] = 'Contraseña actual incorrecta.';
+$messages['passwordinconsistency'] = 'Las contraseñas no coinciden, por favor inténtalo de nuevo.';
+$messages['crypterror'] = 'No se pudo guardar la contraseña nueva. Falta la función de cifrado.';
+$messages['connecterror'] = 'No se pudo guardar la contraseña nueva. Error de conexión';
+$messages['internalerror'] = 'No se pudo guardar la contraseña nueva.';
+$messages['passwordshort'] = 'Tu contraseña debe tener una longitud mínima de $length.';
+$messages['passwordweak'] = 'Tu nueva contraseña debe incluir al menos un número y un signo de puntuación.';
+$messages['passwordforbidden'] = 'La contraseña contiene caracteres inválidos.';
+
+?>
diff --git a/plugins/password/localization/es_ES.inc b/plugins/password/localization/es_ES.inc
new file mode 100644
index 000000000..32879b4aa
--- /dev/null
+++ b/plugins/password/localization/es_ES.inc
@@ -0,0 +1,21 @@
+<?php
+
+$labels = array();
+$labels['changepasswd'] = 'Cambiar contraseña';
+$labels['curpasswd'] = 'Contraseña actual:';
+$labels['newpasswd'] = 'Contraseña nueva:';
+$labels['confpasswd'] = 'Confirmar contraseña:';
+
+$messages = array();
+$messages['nopassword'] = 'Por favor introduzca una contraseña nueva.';
+$messages['nocurpassword'] = 'Por favor introduzca la contraseña actual.';
+$messages['passwordincorrect'] = 'La contraseña actual es incorrecta.';
+$messages['passwordinconsistency'] = 'Las contraseñas no coinciden. Por favor, inténtelo de nuevo.';
+$messages['crypterror'] = 'No se pudo guardar la contraseña nueva. Falta la función de cifrado.';
+$messages['connecterror'] = 'No se pudo guardar la contraseña nueva. Error de conexión';
+$messages['internalerror'] = 'No se pudo guardar la contraseña nueva.';
+$messages['passwordshort'] = 'La contraseña debe tener por lo menos $length caracteres.';
+$messages['passwordweak'] = 'La contraseña debe incluir al menos un número y un signo de puntuación.';
+$messages['passwordforbidden'] = 'La contraseña introducida contiene caracteres no permitidos.';
+
+?>
diff --git a/plugins/password/localization/et_EE.inc b/plugins/password/localization/et_EE.inc
new file mode 100644
index 000000000..0f351d77b
--- /dev/null
+++ b/plugins/password/localization/et_EE.inc
@@ -0,0 +1,17 @@
+<?php
+
+$labels = array();
+$labels['changepasswd'] = 'Muuda parooli';
+$labels['curpasswd'] = 'Vana parool:';
+$labels['newpasswd'] = 'Uus parool:';
+$labels['confpasswd'] = 'Uus parool uuesti:';
+
+$messages = array();
+$messages['nopassword'] = 'Palun sisesta uus parool.';
+$messages['nocurpassword'] = 'Palun sisesta vana parool.';
+$messages['passwordincorrect'] = 'Vana parool on vale.';
+$messages['passwordinconsistency'] = 'Paroolid ei kattu, palun proovi uuesti.';
+$messages['crypterror'] = 'Serveris ei ole parooli krüpteerimiseks vajalikku funktsiooni.';
+$messages['internalerror'] = 'Uue parooli andmebaasi salvestamine nurjus.';
+
+?>
diff --git a/plugins/password/localization/fi_FI.inc b/plugins/password/localization/fi_FI.inc
new file mode 100644
index 000000000..a2108a524
--- /dev/null
+++ b/plugins/password/localization/fi_FI.inc
@@ -0,0 +1,22 @@
+<?php
+
+// Translation by Tapio Salonsaari <take@nerd.fi>
+
+$labels = array();
+$labels['changepasswd'] = 'Vaihda salasana';
+$labels['curpasswd'] = 'Nykyinen salasana:';
+$labels['newpasswd'] = 'Uusi salasana:';
+$labels['confpasswd'] = 'Uusi salasana uudestaan:';
+
+$messages = array();
+$messages['nopassword'] = 'Syötä uusi salasana.';
+$messages['nocurpassword'] = 'Syötä nykyinen salasana.';
+$messages['passwordincorrect'] = 'Syöttämäsi nykyinen salasana on väärin.';
+$messages['passwordinconsistency'] = 'Syöttämäsi salasanat eivät täsmää, yritä uudelleen.';
+$messages['crypterror'] = 'Salasanaa ei voitu vaihtaa. Kryptausfunktio puuttuu.';
+$messages['connecterror'] = 'Salasanaa ei voitu vaihtaa. Yhteysongelma.';
+$messages['internalerror'] = 'Salasanaa ei voitu vaihtaa.';
+$messages['passwordshort'] = 'Salasanan täytyy olla vähintään $length merkkiä pitkä.';
+$messages['passwordweak'] = 'Salasanan täytyy sisältää vähintään yksi numero ja yksi välimerkki.';
+
+?>
diff --git a/plugins/password/localization/fr_FR.inc b/plugins/password/localization/fr_FR.inc
new file mode 100644
index 000000000..8ba37b148
--- /dev/null
+++ b/plugins/password/localization/fr_FR.inc
@@ -0,0 +1,18 @@
+<?php
+
+$labels = array();
+$labels['changepasswd'] = 'Changer le mot de passe';
+$labels['curpasswd'] = 'Mot de passe actuel:';
+$labels['newpasswd'] = 'Nouveau mot de passe:';
+$labels['confpasswd'] = 'Confirmez le nouveau mot de passe:';
+
+$messages = array();
+$messages['nopassword'] = 'Veuillez saisir le nouveau mot de passe.';
+$messages['nocurpassword'] = 'Veuillez saisir le mot de passe actuel.';
+$messages['passwordincorrect'] = 'Mot de passe actuel incorrect.';
+$messages['passwordinconsistency'] = 'Les nouveaux mots de passe ne correspondent pas, veuillez réessayer.';
+$messages['crypterror'] = 'Impossible d\'enregistrer le nouveau mot de passe. Fonction de cryptage manquante.';
+$messages['connecterror'] = 'Impossible d\'enregistrer le nouveau mot de passe. Erreur de connexion au serveur.';
+$messages['internalerror'] = 'Impossible d\'enregistrer le nouveau mot de passe.';
+
+?>
diff --git a/plugins/password/localization/gl_ES.inc b/plugins/password/localization/gl_ES.inc
new file mode 100644
index 000000000..b7dc7bbee
--- /dev/null
+++ b/plugins/password/localization/gl_ES.inc
@@ -0,0 +1,21 @@
+<?php
+
+$labels = array();
+$labels['changepasswd'] = 'Cambiar contrasinal';
+$labels['curpasswd'] = 'Contrasinal actual:';
+$labels['newpasswd'] = 'Contrasinal novo:';
+$labels['confpasswd'] = 'Confirmar contrasinal:';
+
+$messages = array();
+$messages['nopassword'] = 'Por favor, introduza un contrasinal novo.';
+$messages['nocurpassword'] = 'Por favor, introduza o contrasinal actual.';
+$messages['passwordincorrect'] = 'O contrasinal actual é incorrecto.';
+$messages['passwordinconsistency'] = 'Os contrasinals non coinciden. Por favor, inténteo de novo.';
+$messages['crypterror'] = 'Non foi posible gardar o contrasinal novo. Falta a función de cifrado.';
+$messages['connecterror'] = 'Non foi posible gardar o contrasinal novo. Erro de conexión';
+$messages['internalerror'] = 'Non foi posible gardar o contrasinal novo.';
+$messages['passwordshort'] = 'O contrasinal debe ter polo menos $length caracteres.';
+$messages['passwordweak'] = 'O contrasinal debe incluir polo menos un número e un signo de puntuación.';
+$messages['passwordforbidden'] = 'O contrasinal contén caracteres non permitidos.';
+
+?>
diff --git a/plugins/password/localization/hr_HR.inc b/plugins/password/localization/hr_HR.inc
new file mode 100644
index 000000000..0e35129c0
--- /dev/null
+++ b/plugins/password/localization/hr_HR.inc
@@ -0,0 +1,21 @@
+<?php
+
+$labels = array();
+$labels['changepasswd'] = 'Promijeni zaporku';
+$labels['curpasswd'] = 'Važeća zaporka:';
+$labels['newpasswd'] = 'Nova zaporka:';
+$labels['confpasswd'] = 'Potvrda nove zaporke:';
+
+$messages = array();
+$messages['nopassword'] = 'Molimo unesite novu zaporku.';
+$messages['nocurpassword'] = 'Molimo unesite trenutnu zaporku.';
+$messages['passwordincorrect'] = 'Trenutna zaporka je nevažeća.';
+$messages['passwordinconsistency'] = 'Zaporke su različite, pokušajte ponovo.';
+$messages['crypterror'] = 'Nemoguće promijeniti zaporku. Nedostaje enkripcijska funkcija.';
+$messages['connecterror'] = 'Nemoguće promijeniti zaporku. Greška prilikom spajanja.';
+$messages['internalerror'] = 'Nemoguće promijeniti zaporku.';
+$messages['passwordshort'] = 'Zaporka mora sadržavati barem $length znakova.';
+$messages['passwordweak'] = 'Zaporka mora sadržavati barem jedanu znamenku i jedan interpunkcijski znak.';
+$messages['passwordforbidden'] = 'Zaporka sadrži nedozvoljene znakove.';
+
+?>
diff --git a/plugins/password/localization/hu_HU.inc b/plugins/password/localization/hu_HU.inc
new file mode 100644
index 000000000..c8c3015a1
--- /dev/null
+++ b/plugins/password/localization/hu_HU.inc
@@ -0,0 +1,17 @@
+<?php
+
+$labels = array();
+$labels['changepasswd'] = 'Jelszóváltás';
+$labels['curpasswd'] = 'Jelenlegi jelszó:';
+$labels['newpasswd'] = 'Új jelszó:';
+$labels['confpasswd'] = 'Új jelszó mégegyszer:';
+
+$messages = array();
+$messages['nopassword'] = 'Kérjük adja meg az új jelszót.';
+$messages['nocurpassword'] = 'Kérjük adja meg a jelenlegi jelszót.';
+$messages['passwordincorrect'] = 'Érvénytelen a jelenlegi jelszó.';
+$messages['passwordinconsistency'] = 'A két új jelszó nem egyezik.';
+$messages['crypterror'] = 'Hiba történt a kérés feldolgozása során.';
+$messages['internalerror'] = 'Hiba történt a kérés feldolgozása során.';
+
+?>
diff --git a/plugins/password/localization/it_IT.inc b/plugins/password/localization/it_IT.inc
new file mode 100644
index 000000000..13b4885d7
--- /dev/null
+++ b/plugins/password/localization/it_IT.inc
@@ -0,0 +1,21 @@
+<?php
+
+$labels = array();
+$labels['changepasswd'] = 'Cambia la Password';
+$labels['curpasswd'] = 'Password corrente:';
+$labels['newpasswd'] = 'Nuova Password:';
+$labels['confpasswd'] = 'Conferma la Nuova Password:';
+
+$messages = array();
+$messages['nopassword'] = 'Per favore inserisci la nuova password.';
+$messages['nocurpassword'] = 'Per favore inserisci la password corrente.';
+$messages['passwordincorrect'] = 'Password corrente sbagliata.';
+$messages['passwordinconsistency'] = 'Le password non coincidono, inserirle di nuovo.';
+$messages['crypterror'] = 'Non posso salvare la password, funzione di cifratura assente.';
+$messages['connecterror'] = 'Non posso salvare la password, errore di connessione.';
+$messages['internalerror'] = 'Non posso salvare la password.';
+$messages['passwordshort'] = 'La nuova password deve essere lunga almeno $length caratteri.';
+$messages['passwordweak'] = 'La nuova password deve contenere almeno una cifra e un segno di punteggiatura.';
+$messages['passwordforbidden'] = 'La password scelta contiene dei caratteri non consentiti.';
+
+?>
diff --git a/plugins/password/localization/ja_JP.inc b/plugins/password/localization/ja_JP.inc
new file mode 100644
index 000000000..47cac0430
--- /dev/null
+++ b/plugins/password/localization/ja_JP.inc
@@ -0,0 +1,23 @@
+<?php
+
+// EN-Revision: 3891
+
+$labels = array();
+$labels['changepasswd'] = 'パスワードの変更';
+$labels['curpasswd'] = '現在のパスワード:';
+$labels['newpasswd'] = '新しいパスワード:';
+$labels['confpasswd'] = '新しいパスワード (確認):';
+
+$messages = array();
+$messages['nopassword'] = '新しいパスワードを入力してください。';
+$messages['nocurpassword'] = '現在のパスワードを入力してください。';
+$messages['passwordincorrect'] = '現在のパスワードが間違っています。';
+$messages['passwordinconsistency'] = 'パスワードが一致しません。もう一度やり直してください。';
+$messages['crypterror'] = 'パスワードを保存できませんでした。暗号化関数がみあたりません。';
+$messages['connecterror'] = '新しいパスワードを保存できませんでした。接続エラーです。';
+$messages['internalerror'] = '新しいパスワードを保存できませんでした。';
+$messages['passwordshort'] = 'パスワードは少なくとも $length 文字の長さが必要です。';
+$messages['passwordweak'] = 'パスワードは少なくとも数字を 1 文字と記号が 1 文字含んでなければなりません。';
+$messages['passwordforbidden'] = 'パスワードに禁止された文字が含まれています。';
+
+?>
diff --git a/plugins/password/localization/lt_LT.inc b/plugins/password/localization/lt_LT.inc
new file mode 100644
index 000000000..b4563cc42
--- /dev/null
+++ b/plugins/password/localization/lt_LT.inc
@@ -0,0 +1,21 @@
+<?php
+
+$labels = array();
+$labels['changepasswd'] = 'Slaptažodžio keitimas';
+$labels['curpasswd'] = 'Dabartinis slaptažodis:';
+$labels['newpasswd'] = 'Naujasis slaptažodis:';
+$labels['confpasswd'] = 'Pakartokite naująjį slaptažodį:';
+
+$messages = array();
+$messages['nopassword'] = 'Prašom įvesti naująjį slaptažodį.';
+$messages['nocurpassword'] = 'Prašom įvesti dabartinį slaptažodį.';
+$messages['passwordincorrect'] = 'Dabartinis slaptažodis neteisingas.';
+$messages['passwordinconsistency'] = 'Slaptažodžiai nesutapo. Bandykite dar kartą.';
+$messages['crypterror'] = 'Nepavyko įrašyti naujojo slaptažodžio. Trūksta šifravimo funkcijos.';
+$messages['connecterror'] = 'Nepavyko įrašyti naujojo slaptažodžio. Prisijungimo klaida.';
+$messages['internalerror'] = 'Nepavyko įrašyti naujojo slaptažodžio.';
+$messages['passwordshort'] = 'Slaptažodis turi būti sudarytas iš bent $length simbolių.';
+$messages['passwordweak'] = 'Slaptažodyje turi būti bent vienas skaitmuo ir vienas skyrybos ženklas.';
+$messages['passwordforbidden'] = 'Slaptažodyje rasta neleistinų simbolių.';
+
+?>
diff --git a/plugins/password/localization/lv_LV.inc b/plugins/password/localization/lv_LV.inc
new file mode 100644
index 000000000..8f5f4c2c2
--- /dev/null
+++ b/plugins/password/localization/lv_LV.inc
@@ -0,0 +1,20 @@
+<?php
+
+$labels = array();
+$labels['changepasswd'] = 'Nomainīt paroli';
+$labels['curpasswd'] = 'Pašreizējā parole:';
+$labels['newpasswd'] = 'Jaunā parole:';
+$labels['confpasswd'] = 'Vēlreiz jauno paroli:';
+
+$messages = array();
+$messages['nopassword'] = 'Lūdzu, ievadiet jauno paroli.';
+$messages['nocurpassword'] = 'Lūdzu, ievadiet pašreizējo paroli.';
+$messages['passwordincorrect'] = 'Pašreizējā parole nepareiza.';
+$messages['passwordinconsistency'] = 'Paroles nesakrīt. Lūdzu, ievadiet vēlreiz.';
+$messages['crypterror'] = 'Nevarēja saglabāt jauno paroli. Trūkst kriptēšanas funkcija.';
+$messages['connecterror'] = 'Nevarēja saglabāt jauno paroli. Savienojuma kļūda.';
+$messages['internalerror'] = 'Nevarēja saglabāt jauno paroli.';
+$messages['passwordshort'] = 'Jaunajai parolei jābūt vismaz $length simbola garai.';
+$messages['passwordweak'] = 'Jaunajai parolei jāsatur vismaz viens cipars un punktuācijas simbols.';
+
+?>
diff --git a/plugins/password/localization/nl_NL.inc b/plugins/password/localization/nl_NL.inc
new file mode 100644
index 000000000..6d7c401ac
--- /dev/null
+++ b/plugins/password/localization/nl_NL.inc
@@ -0,0 +1,17 @@
+<?php
+
+$labels = array();
+$labels['changepasswd'] = 'Wijzig Wachtwoord';
+$labels['curpasswd'] = 'Huidig Wachtwoord:';
+$labels['newpasswd'] = 'Nieuw Wachtwoord:';
+$labels['confpasswd'] = 'Bevestig Nieuw Wachtwoord:';
+
+$messages = array();
+$messages['nopassword'] = 'Vul een wachtwoord in.';
+$messages['nocurpassword'] = 'vul het huidige wachtwoord in.';
+$messages['passwordincorrect'] = 'Huidig wachtwoord is onjuist.';
+$messages['passwordinconsistency'] = 'Wachtwoorden komen niet overeen, probeer het opnieuw.';
+$messages['crypterror'] = 'De server mist een functie om uw wachtwoord et beveiligen.';
+$messages['internalerror'] = 'Uw wachtwoord kan niet worden opgeslagen.';
+
+?>
diff --git a/plugins/password/localization/pl_PL.inc b/plugins/password/localization/pl_PL.inc
new file mode 100644
index 000000000..687ca9383
--- /dev/null
+++ b/plugins/password/localization/pl_PL.inc
@@ -0,0 +1,21 @@
+<?php
+
+$labels = array();
+$labels['changepasswd'] = 'Zmiana hasła';
+$labels['curpasswd'] = 'Aktualne hasło:';
+$labels['newpasswd'] = 'Nowe hasło:';
+$labels['confpasswd'] = 'Potwierdź hasło:';
+
+$messages = array();
+$messages['nopassword'] = 'Wprowadź nowe hasło.';
+$messages['nocurpassword'] = 'Wprowadź aktualne hasło.';
+$messages['passwordincorrect'] = 'Błędne aktualne hasło, spróbuj ponownie.';
+$messages['passwordinconsistency'] = 'Hasła nie pasują, spróbuj ponownie.';
+$messages['crypterror'] = 'Nie udało się zapisać nowego hasła. Brak funkcji kodującej.';
+$messages['connecterror'] = 'Nie udało się zapisać nowego hasła. Błąd połączenia.';
+$messages['internalerror'] = 'Nie udało się zapisać nowego hasła.';
+$messages['passwordshort'] = 'Hasło musi posiadać co najmniej $length znaków.';
+$messages['passwordweak'] = 'Hasło musi zawierać co najmniej jedną cyfrę i znak interpunkcyjny.';
+$messages['passwordforbidden'] = 'Hasło zawiera niedozwolone znaki.';
+
+?>
diff --git a/plugins/password/localization/pt_BR.inc b/plugins/password/localization/pt_BR.inc
new file mode 100644
index 000000000..f3626e834
--- /dev/null
+++ b/plugins/password/localization/pt_BR.inc
@@ -0,0 +1,21 @@
+<?php
+
+$labels = array();
+$labels['changepasswd'] = 'Alterar senha';
+$labels['curpasswd'] = 'Senha atual:';
+$labels['newpasswd'] = 'Nova senha:';
+$labels['confpasswd'] = 'Confirmar nova senha:';
+
+$messages = array();
+$messages['nopassword'] = 'Por favor, informe a nova senha.';
+$messages['nocurpassword'] = 'Por favor, informe a senha atual.';
+$messages['passwordincorrect'] = 'Senha atual incorreta.';
+$messages['passwordinconsistency'] = 'Senhas não combinam, por favor tente novamente.';
+$messages['crypterror'] = 'Não foi possível gravar a nova senha. Função de criptografia ausente.';
+$messages['connecterror'] = 'Não foi possível gravar a nova senha. Erro de conexão.';
+$messages['internalerror'] = 'Não foi possível gravar a nova senha.';
+$messages['passwordshort'] = 'A senha precisa ter ao menos $length caracteres.';
+$messages['passwordweak'] = 'A senha precisa conter ao menos um número e um caractere de pontuação.';
+$messages['passwordforbidden'] = 'A senha contém caracteres proibidos.';
+
+?>
diff --git a/plugins/password/localization/pt_PT.inc b/plugins/password/localization/pt_PT.inc
new file mode 100644
index 000000000..5307ad69f
--- /dev/null
+++ b/plugins/password/localization/pt_PT.inc
@@ -0,0 +1,18 @@
+<?php
+
+$labels = array();
+$labels['changepasswd'] = 'Alterar password';
+$labels['curpasswd'] = 'Password atual:';
+$labels['newpasswd'] = 'Nova password:';
+$labels['confpasswd'] = 'Confirmar password:';
+
+$messages = array();
+$messages['nopassword'] = 'Introduza a nova password.';
+$messages['nocurpassword'] = 'Introduza a password actual.';
+$messages['passwordincorrect'] = 'Password actual errada.';
+$messages['passwordinconsistency'] = 'Password\'s não combinam, tente novamente..';
+$messages['crypterror'] = 'Não foi possível gravar a nova password. Função de criptografica inexistente.';
+$messages['connecterror'] = 'Não foi possível gravar a nova password. Erro de ligação.';
+$messages['internalerror'] = 'Não foi possível gravar a nova password.';
+
+?>
diff --git a/plugins/password/localization/ru_RU.inc b/plugins/password/localization/ru_RU.inc
new file mode 100644
index 000000000..3776b4598
--- /dev/null
+++ b/plugins/password/localization/ru_RU.inc
@@ -0,0 +1,35 @@
+<?php
+/*
+
++-----------------------------------------------------------------------+
+| plugins/password/localization/ru_RU.inc |
+| |
+| Language file of the Roundcube help plugin |
+| Copyright (C) 2005-2010, The Roundcube Dev Team |
+| Licensed under the GNU GPL |
+| |
++-----------------------------------------------------------------------+
+| Author: Sergey Dukachev <iam@dukess.ru> |
++-----------------------------------------------------------------------+
+
+*/
+
+$labels = array();
+$labels['changepasswd'] = 'Изменить пароль';
+$labels['curpasswd'] = 'Текущий пароль:';
+$labels['newpasswd'] = 'Новый пароль:';
+$labels['confpasswd'] = 'Подтвердите новый пароль:';
+
+$messages = array();
+$messages['nopassword'] = 'Пожалуйста, введите новый пароль.';
+$messages['nocurpassword'] = 'Пожалуйста, введите текущий пароль.';
+$messages['passwordincorrect'] = 'Текущий пароль неверен.';
+$messages['passwordinconsistency'] = 'Пароли не совпадают, попробуйте, пожалуйста, ещё.';
+$messages['crypterror'] = 'Не могу сохранить новый пароль. Отсутствует криптографическая функция.';
+$messages['connecterror'] = 'Не могу сохранить новый пароль. Ошибка соединения.';
+$messages['internalerror'] = 'Не могу сохранить новый пароль.';
+$messages['passwordshort'] = 'Пароль должен быть длиной как минимум $length символов.';
+$messages['passwordweak'] = 'Пароль должен включать в себя как минимум одну цифру и один знак пунктуации.';
+$messages['passwordforbidden'] = 'Пароль содержит недопустимые символы.';
+
+?>
diff --git a/plugins/password/localization/sk_SK.inc b/plugins/password/localization/sk_SK.inc
new file mode 100644
index 000000000..6def2f914
--- /dev/null
+++ b/plugins/password/localization/sk_SK.inc
@@ -0,0 +1,29 @@
+<?php
+
+/**
+ * Slovak translation for Roundcube password plugin
+ *
+ * @version 1.0 (2010-10-18)
+ * @author panda <admin@whistler.sk>
+ *
+ */
+
+$labels = array();
+$labels['changepasswd'] = 'Zmeniť heslo';
+$labels['curpasswd'] = 'Súčasné heslo:';
+$labels['newpasswd'] = 'Nové heslo:';
+$labels['confpasswd'] = 'Potvrď nové heslo:';
+
+$messages = array();
+$messages['nopassword'] = 'Prosím zadaj nové heslo.';
+$messages['nocurpassword'] = 'Prosím zadaj súčasné heslo.';
+$messages['passwordincorrect'] = 'Súčasné heslo je nesprávne.';
+$messages['passwordinconsistency'] = 'Heslá nie sú rovnaké, skús znova.';
+$messages['crypterror'] = 'Nemôžem uložiť nové heslo. Chýba šifrovacia funkcia.';
+$messages['connecterror'] = 'Nemôžem uložiť nové heslo. Chyba spojenia.';
+$messages['internalerror'] = 'Nemôžem uložiť nové heslo.';
+$messages['passwordshort'] = 'Heslo musí mať najmenej $length znakov.';
+$messages['passwordweak'] = 'Heslo musí obsahovať aspoň jedno číslo a jedno interpunkčné znamienko.';
+$messages['passwordforbidden'] = 'Heslo obsahuje nepovolené znaky.';
+
+?>
diff --git a/plugins/password/localization/sl_SI.inc b/plugins/password/localization/sl_SI.inc
new file mode 100644
index 000000000..df17583be
--- /dev/null
+++ b/plugins/password/localization/sl_SI.inc
@@ -0,0 +1,18 @@
+<?php
+
+$labels = array();
+$labels['changepasswd'] = 'Spremeni geslo';
+$labels['curpasswd'] = 'Obstoječe geslo:';
+$labels['newpasswd'] = 'Novo geslo:';
+$labels['confpasswd'] = 'Potrdi novo geslo:';
+
+$messages = array();
+$messages['nopassword'] = 'Vnesite novo geslo.';
+$messages['nocurpassword'] = 'Vnesite obstoječe geslo.';
+$messages['passwordincorrect'] = 'Obstoječe geslo ni veljavno.';
+$messages['passwordinconsistency'] = 'Gesli se ne ujemata, poskusite znova.';
+$messages['crypterror'] = 'Novega gesla ni bilo mogoče shraniti. Prišlo je do napake pri šifriranju.';
+$messages['connecterror'] = 'Novega gesla ni bilo mogoče shraniti. Prišlo je do napake v povezavi.';
+$messages['internalerror'] = 'Novega gesla ni bilo mogoče shraniti.';
+
+?>
diff --git a/plugins/password/localization/sv_SE.inc b/plugins/password/localization/sv_SE.inc
new file mode 100644
index 000000000..d649bbd9a
--- /dev/null
+++ b/plugins/password/localization/sv_SE.inc
@@ -0,0 +1,21 @@
+<?php
+
+$labels = array();
+$labels['changepasswd'] = 'Ändra lösenord';
+$labels['curpasswd'] = 'Nuvarande lösenord:';
+$labels['newpasswd'] = 'Nytt lösenord:';
+$labels['confpasswd'] = 'Bekräfta nytt lösenord:';
+
+$messages = array();
+$messages['nopassword'] = 'Vänligen ange nytt lösenord.';
+$messages['nocurpassword'] = 'Vänligen ange nuvarande lösenord.';
+$messages['passwordincorrect'] = 'Felaktigt nuvarande lösenord.';
+$messages['passwordinconsistency'] = 'Nya lösenordet och bekräftelsen överensstämmer inte, försök igen.';
+$messages['crypterror'] = 'Lösenordet kunde inte ändras. Krypteringsfunktionen saknas.';
+$messages['connecterror'] = 'Lösenordet kunde inte ändras. Anslutningen misslyckades.';
+$messages['internalerror'] = 'Lösenordet kunde inte ändras.';
+$messages['passwordshort'] = 'Lösenordet måste vara minst $length tecken långt.';
+$messages['passwordweak'] = 'Lösenordet måste innehålla minst en siffra och ett specialtecken.';
+$messages['passwordforbidden'] = 'Lösenordet innehåller otillåtna tecken.';
+
+?> \ No newline at end of file
diff --git a/plugins/password/localization/tr_TR.inc b/plugins/password/localization/tr_TR.inc
new file mode 100644
index 000000000..4f2322a2e
--- /dev/null
+++ b/plugins/password/localization/tr_TR.inc
@@ -0,0 +1,21 @@
+<?php
+
+$labels = array();
+$labels['changepasswd'] = 'Parolayı Değiştir';
+$labels['curpasswd'] = 'Şu anki Parola:';
+$labels['newpasswd'] = 'Yeni Parola:';
+$labels['confpasswd'] = 'Yeni Parolayı Onaylayın:';
+
+$messages = array();
+$messages['nopassword'] = 'Lütfen yeni şifreyi girin.';
+$messages['nocurpassword'] = 'Lütfen şu anki şifrenizi girin.';
+$messages['passwordincorrect'] = 'Parolanızı yanlış girdiniz.';
+$messages['passwordinconsistency'] = 'Girdiğiniz parolalar uyuşmuyor. Lütfen tekrar deneyin..';
+$messages['crypterror'] = 'Yeni şifre kaydedilemedi. Gerekli fonksiyon eksik.';
+$messages['connecterror'] = 'Yeni şifre kaydedilemedi. Bağlantı hatası.';
+$messages['internalerror'] = 'Yeni şifre kaydedilemedi.';
+$messages['passwordshort'] = 'Parola en az $length karakterden oluşmalı.';
+$messages['passwordweak'] = 'Parola en az bir sayı ve bir noktalama işareti içermeli.';
+$messages['passwordforbidden'] = 'Parola uygunsuz karakter(ler) içeriyor.';
+
+?>
diff --git a/plugins/password/localization/zh_TW.inc b/plugins/password/localization/zh_TW.inc
new file mode 100644
index 000000000..7d162274a
--- /dev/null
+++ b/plugins/password/localization/zh_TW.inc
@@ -0,0 +1,21 @@
+<?php
+
+$labels = array();
+$labels['changepasswd'] = '更改密碼';
+$labels['curpasswd'] = '目前的密碼';
+$labels['newpasswd'] = '新密碼';
+$labels['confpasswd'] = '確認新密碼';
+
+$messages = array();
+$messages['nopassword'] = '請輸入新密碼';
+$messages['nocurpassword'] = '請輸入目前的密碼';
+$messages['passwordincorrect'] = '目前的密碼錯誤';
+$messages['passwordinconsistency'] = '密碼不相符,請重新輸入';
+$messages['crypterror'] = '無法更新密碼:無加密機制';
+$messages['connecterror'] = '無法更新密碼:連線失敗';
+$messages['internalerror'] = '無法更新密碼';
+$messages['passwordshort'] = '您的密碼至少需 $length 個字元長';
+$messages['passwordweak'] = '您的新密碼至少需含有一個數字與一個標點符號';
+$messages['passwordforbidden'] = '您的密碼含有禁用字元';
+
+?>
diff --git a/plugins/password/package.xml b/plugins/password/package.xml
new file mode 100644
index 000000000..a4f74c192
--- /dev/null
+++ b/plugins/password/package.xml
@@ -0,0 +1,267 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<package xmlns="http://pear.php.net/dtd/package-2.0" xmlns:tasks="http://pear.php.net/dtd/tasks-1.0" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" packagerversion="1.9.0" version="2.0" xsi:schemaLocation="http://pear.php.net/dtd/tasks-1.0
+ http://pear.php.net/dtd/tasks-1.0.xsd
+ http://pear.php.net/dtd/package-2.0
+ http://pear.php.net/dtd/package-2.0.xsd">
+ <name>password</name>
+ <channel>pear.roundcube.net</channel>
+ <summary>Password Change for Roundcube</summary>
+ <description>Plugin that adds a possibility to change user password using many
+ methods (drivers) via Settings/Password tab.
+ </description>
+ <lead>
+ <name>Aleksander Machniak</name>
+ <user>alec</user>
+ <email>alec@alec.pl</email>
+ <active>yes</active>
+ </lead>
+ <date></date>
+ <time></time>
+ <version>
+ <release></release>
+ <api>1.6</api>
+ </version>
+ <stability>
+ <release>stable</release>
+ <api>stable</api>
+ </stability>
+ <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license>
+ <notes>
+- When old and new passwords are the same, do nothing, return success (#1487823)
+- Fixed Samba password hashing in 'ldap' driver
+- Added 'password_change' hook for plugin actions after successful password change
+ </notes>
+ <contents>
+ <dir baseinstalldir="/" name="/">
+ <file name="password.php" role="php">
+ <tasks:replace from="@name@" to="name" type="package-info"/>
+ <tasks:replace from="@package_version@" to="version" type="package-info"/>
+ </file>
+ <file name="password.js" role="data">
+ <tasks:replace from="@name@" to="name" type="package-info"/>
+ <tasks:replace from="@package_version@" to="version" type="package-info"/>
+ </file>
+ <file name="README" role="data">
+ <tasks:replace from="@name@" to="name" type="package-info"/>
+ <tasks:replace from="@package_version@" to="version" type="package-info"/>
+ </file>
+ <file name="localization/az_AZ.inc" role="data"></file>
+ <file name="localization/bg_BG.inc" role="data"></file>
+ <file name="localization/ca_ES.inc" role="data"></file>
+ <file name="localization/cs_CZ.inc" role="data"></file>
+ <file name="localization/da_DK.inc" role="data"></file>
+ <file name="localization/de_CH.inc" role="data"></file>
+ <file name="localization/de_DE.inc" role="data"></file>
+ <file name="localization/en_US.inc" role="data"></file>
+ <file name="localization/es_ES.inc" role="data"></file>
+ <file name="localization/et_EE.inc" role="data"></file>
+ <file name="localization/fi_FI.inc" role="data"></file>
+ <file name="localization/fr_FR.inc" role="data"></file>
+ <file name="localization/gl_ES.inc" role="data"></file>
+ <file name="localization/hu_HU.inc" role="data"></file>
+ <file name="localization/it_IT.inc" role="data"></file>
+ <file name="localization/lt_LT.inc" role="data"></file>
+ <file name="localization/lv_LV.inc" role="data"></file>
+ <file name="localization/nl_NL.inc" role="data"></file>
+ <file name="localization/pl_PL.inc" role="data"></file>
+ <file name="localization/pt_BR.inc" role="data"></file>
+ <file name="localization/pt_PT.inc" role="data"></file>
+ <file name="localization/sl_SI.inc" role="data"></file>
+ <file name="localization/sv_SE.inc" role="data"></file>
+ <file name="localization/zh_TW.inc" role="data"></file>
+
+ <file name="drivers/chgsaslpasswd.c" role="data"></file>
+ <file name="drivers/chgvirtualminpasswd.c" role="data"></file>
+ <file name="drivers/chpasswd.php" role="php"></file>
+ <file name="drivers/directadmin.php" role="php"></file>
+ <file name="drivers/ldap.php" role="php"></file>
+ <file name="drivers/ldap_simple.php" role="php"></file>
+ <file name="drivers/poppassd.php" role="php"></file>
+ <file name="drivers/sql.php" role="php"></file>
+ <file name="drivers/vpopmaild.php" role="php"></file>
+ <file name="drivers/cpanel.php" role="php"></file>
+ <file name="drivers/hmail.php" role="php"></file>
+ <file name="drivers/pam.php" role="php"></file>
+ <file name="drivers/sasl.php" role="php"></file>
+ <file name="drivers/virtualmin.php" role="php"></file>
+ <file name="drivers/ximss.php" role="php"></file>
+ <file name="drivers/xmail.php" role="php"></file>
+ <file name="drivers/chpass-wrapper.py" role="data"></file>
+
+ <file name="config.inc.php.disc" role="data"></file>
+ </dir>
+ <!-- / -->
+ </contents>
+ <dependencies>
+ <required>
+ <php>
+ <min>5.2.1</min>
+ </php>
+ <pearinstaller>
+ <min>1.7.0</min>
+ </pearinstaller>
+ </required>
+ </dependencies>
+ <phprelease/>
+ <changelog>
+ <release>
+ <date>2010-04-29</date>
+ <time>12:00:00</time>
+ <version>
+ <release>1.4</release>
+ <api>1.4</api>
+ </version>
+ <stability>
+ <release>stable</release>
+ <api>stable</api>
+ </stability>
+ <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license>
+ <notes>
+- Use mail_domain value for domain variables when there is no domain in username:
+ sql and ldap drivers (#1486694)
+- Created package.xml
+ </notes>
+ </release>
+ <release>
+ <date>2010-06-20</date>
+ <time>12:00:00</time>
+ <version>
+ <release>1.5</release>
+ <api>1.5</api>
+ </version>
+ <stability>
+ <release>stable</release>
+ <api>stable</api>
+ </stability>
+ <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license>
+ <notes>
+- Removed user_login/username_local/username_domain methods,
+ use rcube_user::get_username instead (#1486707)
+ </notes>
+ </release>
+ <release>
+ <date>2010-08-01</date>
+ <time>09:00:00</time>
+ <version>
+ <release>1.6</release>
+ <api>1.5</api>
+ </version>
+ <stability>
+ <release>stable</release>
+ <api>stable</api>
+ </stability>
+ <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license>
+ <notes>
+- Added ldap_simple driver
+ </notes>
+ </release>
+ <release>
+ <date>2010-09-10</date>
+ <time>09:00:00</time>
+ <version>
+ <release>1.7</release>
+ <api>1.5</api>
+ </version>
+ <stability>
+ <release>stable</release>
+ <api>stable</api>
+ </stability>
+ <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license>
+ <notes>
+- Added XMail driver
+- Improve security of chpasswd driver using popen instead of exec+echo (#1486987)
+- Added chpass-wrapper.py script to improve security (#1486987)
+ </notes>
+ </release>
+ <release>
+ <date>2010-09-29</date>
+ <time>19:00:00</time>
+ <version>
+ <release>1.8</release>
+ <api>1.6</api>
+ </version>
+ <stability>
+ <release>stable</release>
+ <api>stable</api>
+ </stability>
+ <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license>
+ <notes>
+- Added possibility to display extended error messages (#1486704)
+- Added extended error messages in Poppassd driver (#1486704)
+ </notes>
+ </release>
+ <release>
+ <version>
+ <release>1.9</release>
+ <api>1.6</api>
+ </version>
+ <stability>
+ <release>stable</release>
+ <api>stable</api>
+ </stability>
+ <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license>
+ <notes>
+- Added password_ldap_lchattr option (#1486927)
+ </notes>
+ </release>
+ <release>
+ <date>2010-10-07</date>
+ <time>09:00:00</time>
+ <version>
+ <release>2.0</release>
+ <api>1.6</api>
+ </version>
+ <stability>
+ <release>stable</release>
+ <api>stable</api>
+ </stability>
+ <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license>
+ <notes>
+- Fixed SQL Injection in SQL driver when using %p or %o variables in query (#1487034)
+ </notes>
+ </release>
+ <release>
+ <date>2010-11-02</date>
+ <time>09:00:00</time>
+ <version>
+ <release>2.1</release>
+ <api>1.6</api>
+ </version>
+ <stability>
+ <release>stable</release>
+ <api>stable</api>
+ </stability>
+ <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license>
+ <notes>
+- hMail driver: Add possibility to connect to remote host
+ </notes>
+ </release>
+ <release>
+ <date>2011-02-15</date>
+ <time>12:00</time>
+ <version>
+ <release>2.2</release>
+ <api>1.6</api>
+ </version>
+ <stability>
+ <release>stable</release>
+ <api>stable</api>
+ </stability>
+ <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license>
+ <notes>
+- hMail driver: add username_domain detection (#1487100)
+- hMail driver: HTML tags in logged messages should be stripped off (#1487099)
+- Chpasswd driver: add newline at end of input to chpasswd binary (#1487141)
+- Fix usage of configured temp_dir instead of /tmp (#1487447)
+- ldap_simple driver: fix parse error
+- ldap/ldap_simple drivers: support %dc variable in config
+- ldap/ldap_simple drivers: support Samba password change
+- Fix extended error messages handling (#1487676)
+- Fix double request when clicking on Password tab in Firefox
+- Fix deprecated split() usage in xmail and directadmin drivers (#1487769)
+- Added option (password_log) for logging password changes
+- Virtualmin driver: Add option for setting username format (#1487781)
+ </notes>
+ </release>
+ </changelog>
+</package>
diff --git a/plugins/password/password.js b/plugins/password/password.js
new file mode 100644
index 000000000..26376b36d
--- /dev/null
+++ b/plugins/password/password.js
@@ -0,0 +1,37 @@
+/*
+ * Password plugin script
+ * @version @package_version@
+ */
+
+if (window.rcmail) {
+ rcmail.addEventListener('init', function(evt) {
+ // <span id="settingstabdefault" class="tablink"><roundcube:button command="preferences" type="link" label="preferences" title="editpreferences" /></span>
+ var tab = $('<span>').attr('id', 'settingstabpluginpassword').addClass('tablink');
+ var button = $('<a>').attr('href', rcmail.env.comm_path+'&_action=plugin.password')
+ .html(rcmail.gettext('password')).appendTo(tab);
+
+ // add button and register commands
+ rcmail.add_element(tab, 'tabs');
+ rcmail.register_command('plugin.password-save', function() {
+ var input_curpasswd = rcube_find_object('_curpasswd');
+ var input_newpasswd = rcube_find_object('_newpasswd');
+ var input_confpasswd = rcube_find_object('_confpasswd');
+
+ if (input_curpasswd && input_curpasswd.value=='') {
+ alert(rcmail.gettext('nocurpassword', 'password'));
+ input_curpasswd.focus();
+ } else if (input_newpasswd && input_newpasswd.value=='') {
+ alert(rcmail.gettext('nopassword', 'password'));
+ input_newpasswd.focus();
+ } else if (input_confpasswd && input_confpasswd.value=='') {
+ alert(rcmail.gettext('nopassword', 'password'));
+ input_confpasswd.focus();
+ } else if (input_newpasswd && input_confpasswd && input_newpasswd.value != input_confpasswd.value) {
+ alert(rcmail.gettext('passwordinconsistency', 'password'));
+ input_newpasswd.focus();
+ } else {
+ rcmail.gui_objects.passform.submit();
+ }
+ }, true);
+ })
+}
diff --git a/plugins/password/password.php b/plugins/password/password.php
new file mode 100644
index 000000000..b1c7863fc
--- /dev/null
+++ b/plugins/password/password.php
@@ -0,0 +1,274 @@
+<?php
+
+/*
+ +-------------------------------------------------------------------------+
+ | Password Plugin for Roundcube |
+ | @version @package_version@ |
+ | |
+ | Copyright (C) 2009-2010, Roundcube Dev. |
+ | |
+ | This program is free software; you can redistribute it and/or modify |
+ | it under the terms of the GNU General Public License version 2 |
+ | as published by the Free Software Foundation. |
+ | |
+ | This program is distributed in the hope that it will be useful, |
+ | but WITHOUT ANY WARRANTY; without even the implied warranty of |
+ | MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the |
+ | GNU General Public License for more details. |
+ | |
+ | You should have received a copy of the GNU General Public License along |
+ | with this program; if not, write to the Free Software Foundation, Inc., |
+ | 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. |
+ | |
+ +-------------------------------------------------------------------------+
+ | Author: Aleksander Machniak <alec@alec.pl> |
+ +-------------------------------------------------------------------------+
+
+ $Id: index.php 2645 2009-06-15 07:01:36Z alec $
+
+*/
+
+define('PASSWORD_CRYPT_ERROR', 1);
+define('PASSWORD_ERROR', 2);
+define('PASSWORD_CONNECT_ERROR', 3);
+define('PASSWORD_SUCCESS', 0);
+
+/**
+ * Change password plugin
+ *
+ * Plugin that adds functionality to change a users password.
+ * It provides common functionality and user interface and supports
+ * several backends to finally update the password.
+ *
+ * For installation and configuration instructions please read the README file.
+ *
+ * @author Aleksander Machniak
+ */
+class password extends rcube_plugin
+{
+ public $task = 'settings';
+ public $noframe = true;
+ public $noajax = true;
+
+ function init()
+ {
+ $rcmail = rcmail::get_instance();
+ // add Tab label
+ $rcmail->output->add_label('password');
+ $this->register_action('plugin.password', array($this, 'password_init'));
+ $this->register_action('plugin.password-save', array($this, 'password_save'));
+ $this->include_script('password.js');
+ }
+
+ function password_init()
+ {
+ $this->add_texts('localization/');
+ $this->register_handler('plugin.body', array($this, 'password_form'));
+
+ $rcmail = rcmail::get_instance();
+ $rcmail->output->set_pagetitle($this->gettext('changepasswd'));
+ $rcmail->output->send('plugin');
+ }
+
+ function password_save()
+ {
+ $rcmail = rcmail::get_instance();
+ $this->load_config();
+
+ $this->add_texts('localization/');
+ $this->register_handler('plugin.body', array($this, 'password_form'));
+ $rcmail->output->set_pagetitle($this->gettext('changepasswd'));
+
+ $confirm = $rcmail->config->get('password_confirm_current');
+ $required_length = intval($rcmail->config->get('password_minimum_length'));
+ $check_strength = $rcmail->config->get('password_require_nonalpha');
+
+ if (($confirm && !isset($_POST['_curpasswd'])) || !isset($_POST['_newpasswd'])) {
+ $rcmail->output->command('display_message', $this->gettext('nopassword'), 'error');
+ }
+ else {
+
+ $charset = strtoupper($rcmail->config->get('password_charset', 'ISO-8859-1'));
+ $rc_charset = strtoupper($rcmail->output->get_charset());
+
+ $sespwd = $rcmail->decrypt($_SESSION['password']);
+ $curpwd = $confirm ? get_input_value('_curpasswd', RCUBE_INPUT_POST, true, $charset) : $sespwd;
+ $newpwd = get_input_value('_newpasswd', RCUBE_INPUT_POST, true);
+ $conpwd = get_input_value('_confpasswd', RCUBE_INPUT_POST, true);
+
+ // check allowed characters according to the configured 'password_charset' option
+ // by converting the password entered by the user to this charset and back to UTF-8
+ $orig_pwd = $newpwd;
+ $chk_pwd = rcube_charset_convert($orig_pwd, $rc_charset, $charset);
+ $chk_pwd = rcube_charset_convert($chk_pwd, $charset, $rc_charset);
+
+ // WARNING: Default password_charset is ISO-8859-1, so conversion will
+ // change national characters. This may disable possibility of using
+ // the same password in other MUA's.
+ // We're doing this for consistence with Roundcube core
+ $newpwd = rcube_charset_convert($newpwd, $rc_charset, $charset);
+ $conpwd = rcube_charset_convert($conpwd, $rc_charset, $charset);
+
+ if ($chk_pwd != $orig_pwd) {
+ $rcmail->output->command('display_message', $this->gettext('passwordforbidden'), 'error');
+ }
+ // other passwords validity checks
+ else if ($conpwd != $newpwd) {
+ $rcmail->output->command('display_message', $this->gettext('passwordinconsistency'), 'error');
+ }
+ else if ($confirm && $sespwd != $curpwd) {
+ $rcmail->output->command('display_message', $this->gettext('passwordincorrect'), 'error');
+ }
+ else if ($required_length && strlen($newpwd) < $required_length) {
+ $rcmail->output->command('display_message', $this->gettext(
+ array('name' => 'passwordshort', 'vars' => array('length' => $required_length))), 'error');
+ }
+ else if ($check_strength && (!preg_match("/[0-9]/", $newpwd) || !preg_match("/[^A-Za-z0-9]/", $newpwd))) {
+ $rcmail->output->command('display_message', $this->gettext('passwordweak'), 'error');
+ }
+ // password is the same as the old one, do nothing, return success
+ else if ($sespwd == $newpwd) {
+ $rcmail->output->command('display_message', $this->gettext('successfullysaved'), 'confirmation');
+ }
+ // try to save the password
+ else if (!($res = $this->_save($curpwd, $newpwd))) {
+ $rcmail->output->command('display_message', $this->gettext('successfullysaved'), 'confirmation');
+
+ // allow additional actions after password change (e.g. reset some backends)
+ $plugin = $rcmail->plugins->exec_hook('password_change', array(
+ 'old_pass' => $curpwd, 'new_pass' => $newpwd));
+
+ // Reset session password
+ $_SESSION['password'] = $rcmail->encrypt($plugin['new_pass']);
+
+ // Log password change
+ if ($rcmail->config->get('password_log')) {
+ write_log('password', sprintf('Password changed for user %s (ID: %d) from %s',
+ $rcmail->user->get_username(), $rcmail->user->ID, rcmail_remote_ip()));
+ }
+ }
+ else {
+ $rcmail->output->command('display_message', $res, 'error');
+ }
+ }
+
+ rcmail_overwrite_action('plugin.password');
+ $rcmail->output->send('plugin');
+ }
+
+ function password_form()
+ {
+ $rcmail = rcmail::get_instance();
+ $this->load_config();
+
+ // add some labels to client
+ $rcmail->output->add_label(
+ 'password.nopassword',
+ 'password.nocurpassword',
+ 'password.passwordinconsistency'
+ );
+
+ $rcmail->output->set_env('product_name', $rcmail->config->get('product_name'));
+
+ $table = new html_table(array('cols' => 2));
+
+ if ($rcmail->config->get('password_confirm_current')) {
+ // show current password selection
+ $field_id = 'curpasswd';
+ $input_curpasswd = new html_passwordfield(array('name' => '_curpasswd', 'id' => $field_id,
+ 'size' => 20, 'autocomplete' => 'off'));
+
+ $table->add('title', html::label($field_id, Q($this->gettext('curpasswd'))));
+ $table->add(null, $input_curpasswd->show());
+ }
+
+ // show new password selection
+ $field_id = 'newpasswd';
+ $input_newpasswd = new html_passwordfield(array('name' => '_newpasswd', 'id' => $field_id,
+ 'size' => 20, 'autocomplete' => 'off'));
+
+ $table->add('title', html::label($field_id, Q($this->gettext('newpasswd'))));
+ $table->add(null, $input_newpasswd->show());
+
+ // show confirm password selection
+ $field_id = 'confpasswd';
+ $input_confpasswd = new html_passwordfield(array('name' => '_confpasswd', 'id' => $field_id,
+ 'size' => 20, 'autocomplete' => 'off'));
+
+ $table->add('title', html::label($field_id, Q($this->gettext('confpasswd'))));
+ $table->add(null, $input_confpasswd->show());
+
+ $out = html::div(array('class' => 'box'),
+ html::div(array('id' => 'prefs-title', 'class' => 'boxtitle'), $this->gettext('changepasswd')) .
+ html::div(array('class' => 'boxcontent'), $table->show() .
+ html::p(null,
+ $rcmail->output->button(array(
+ 'command' => 'plugin.password-save',
+ 'type' => 'input',
+ 'class' => 'button mainaction',
+ 'label' => 'save'
+ )))));
+
+ $rcmail->output->add_gui_object('passform', 'password-form');
+
+ return $rcmail->output->form_tag(array(
+ 'id' => 'password-form',
+ 'name' => 'password-form',
+ 'method' => 'post',
+ 'action' => './?_task=settings&_action=plugin.password-save',
+ ), $out);
+ }
+
+ private function _save($curpass, $passwd)
+ {
+ $config = rcmail::get_instance()->config;
+ $driver = $this->home.'/drivers/'.$config->get('password_driver', 'sql').'.php';
+
+ if (!is_readable($driver)) {
+ raise_error(array(
+ 'code' => 600,
+ 'type' => 'php',
+ 'file' => __FILE__, 'line' => __LINE__,
+ 'message' => "Password plugin: Unable to open driver file $driver"
+ ), true, false);
+ return $this->gettext('internalerror');
+ }
+
+ include($driver);
+
+ if (!function_exists('password_save')) {
+ raise_error(array(
+ 'code' => 600,
+ 'type' => 'php',
+ 'file' => __FILE__, 'line' => __LINE__,
+ 'message' => "Password plugin: Broken driver: $driver"
+ ), true, false);
+ return $this->gettext('internalerror');
+ }
+
+ $result = password_save($curpass, $passwd);
+
+ if (is_array($result)) {
+ $message = $result['message'];
+ $result = $result['code'];
+ }
+
+ switch ($result) {
+ case PASSWORD_SUCCESS:
+ return;
+ case PASSWORD_CRYPT_ERROR;
+ $reason = $this->gettext('crypterror');
+ case PASSWORD_CONNECT_ERROR;
+ $reason = $this->gettext('connecterror');
+ case PASSWORD_ERROR:
+ default:
+ $reason = $this->gettext('internalerror');
+ }
+
+ if ($message) {
+ $reason .= ' ' . $message;
+ }
+
+ return $reason;
+ }
+}
diff --git a/plugins/redundant_attachments/config.inc.php.dist b/plugins/redundant_attachments/config.inc.php.dist
new file mode 100644
index 000000000..6c317ead1
--- /dev/null
+++ b/plugins/redundant_attachments/config.inc.php.dist
@@ -0,0 +1,13 @@
+<?php
+
+// By default this plugin stores attachments in filesystem
+// and copies them into sql database.
+// In environments with replicated database it is possible
+// to use memcache as a fallback when write-master is unavailable.
+$rcmail_config['redundant_attachments_memcache'] = false;
+
+// When memcache is used, attachment data expires after
+// specied TTL time in seconds (max.2592000). Default is 12 hours.
+$rcmail_config['redundant_attachments_memcache_ttl'] = 12 * 60 * 60;
+
+?>
diff --git a/plugins/redundant_attachments/redundant_attachments.php b/plugins/redundant_attachments/redundant_attachments.php
new file mode 100644
index 000000000..3c71dcb40
--- /dev/null
+++ b/plugins/redundant_attachments/redundant_attachments.php
@@ -0,0 +1,232 @@
+<?php
+/**
+ * Redundant attachments
+ *
+ * This plugin provides a redundant storage for temporary uploaded
+ * attachment files. They are stored in both the database backend
+ * as well as on the local file system.
+ *
+ * It provides also memcache store as a fallback (see config file).
+ *
+ * This plugin relies on the core filesystem_attachments plugin
+ * and combines it with the functionality of the database_attachments plugin.
+ *
+ * @author Thomas Bruederli <roundcube@gmail.com>
+ * @author Aleksander Machniak <machniak@kolabsys.com>
+ *
+ * Copyright (C) 2011, The Roundcube Dev Team
+ * Copyright (C) 2011, Kolab Systems AG
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2
+ * as published by the Free Software Foundation.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License along
+ * with this program; if not, write to the Free Software Foundation, Inc.,
+ * 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+ */
+
+require_once(INSTALL_PATH . 'plugins/filesystem_attachments/filesystem_attachments.php');
+
+class redundant_attachments extends filesystem_attachments
+{
+ // A prefix for the cache key used in the session and in the key field of the cache table
+ private $prefix = "ATTACH";
+
+ // rcube_cache instance for SQL DB
+ private $cache;
+
+ // rcube_cache instance for memcache
+ private $mem_cache;
+
+ private $loaded;
+
+ /**
+ * Default constructor
+ */
+ function init()
+ {
+ parent::init();
+ }
+
+ /**
+ * Loads plugin configuration and initializes cache object(s)
+ */
+ private function _load_drivers()
+ {
+ if ($this->loaded) {
+ return;
+ }
+
+ $rcmail = rcmail::get_instance();
+
+ // load configuration
+ $this->load_config();
+
+ // Init SQL cache (disable cache data serialization)
+ $this->cache = $rcmail->get_cache($this->prefix, 'db', 0, false);
+
+ // Init memcache (fallback) cache
+ if ($rcmail->config->get('redundant_attachments_memcache')) {
+ $ttl = 12 * 60 * 60; // 12 hours
+ $ttl = (int) $rcmail->config->get('redundant_attachments_memcache_ttl', $ttl);
+ $this->mem_cache = $rcmail->get_cache($this->prefix, 'memcache', $ttl, false);
+ }
+
+ $this->loaded = true;
+ }
+
+ /**
+ * Helper method to generate a unique key for the given attachment file
+ */
+ private function _key($args)
+ {
+ $uname = $args['path'] ? $args['path'] : $args['name'];
+ return $args['group'] . md5(mktime() . $uname . $_SESSION['user_id']);
+ }
+
+ /**
+ * Save a newly uploaded attachment
+ */
+ function upload($args)
+ {
+ $args = parent::upload($args);
+
+ $this->_load_drivers();
+
+ $key = $this->_key($args);
+ $data = base64_encode(file_get_contents($args['path']));
+
+ $status = $this->cache->write($key, $data);
+
+ if (!$status && $this->mem_cache) {
+ $status = $this->mem_cache->write($key, $data);
+ }
+
+ if ($status) {
+ $args['id'] = $key;
+ $args['status'] = true;
+ }
+
+ return $args;
+ }
+
+ /**
+ * Save an attachment from a non-upload source (draft or forward)
+ */
+ function save($args)
+ {
+ $args = parent::save($args);
+
+ $this->_load_drivers();
+
+ if ($args['path'])
+ $args['data'] = file_get_contents($args['path']);
+
+ $key = $this->_key($args);
+ $data = base64_encode($args['data']);
+
+ $status = $this->cache->write($key, $data);
+
+ if (!$status && $this->mem_cache) {
+ $status = $this->mem_cache->write($key, $data);
+ }
+
+ if ($status) {
+ $args['id'] = $key;
+ $args['status'] = true;
+ }
+
+ return $args;
+ }
+
+ /**
+ * Remove an attachment from storage
+ * This is triggered by the remove attachment button on the compose screen
+ */
+ function remove($args)
+ {
+ parent::remove($args);
+
+ $this->_load_drivers();
+
+ $status = $this->cache->remove($args['id']);
+
+ if (!$status && $this->mem_cache) {
+ $status = $this->cache->remove($args['id']);
+ }
+
+ // we cannot trust the result of any of the methods above
+ // assume true, attachments will be removed on cleanup
+ $args['status'] = true;
+
+ return $args;
+ }
+
+ /**
+ * When composing an html message, image attachments may be shown
+ * For this plugin, $this->get() will check the file and
+ * return it's contents
+ */
+ function display($args)
+ {
+ return $this->get($args);
+ }
+
+ /**
+ * When displaying or sending the attachment the file contents are fetched
+ * using this method. This is also called by the attachment_display hook.
+ */
+ function get($args)
+ {
+ // attempt to get file from local file system
+ $args = parent::get($args);
+
+ if ($args['path'] && ($args['status'] = file_exists($args['path'])))
+ return $args;
+
+ $this->_load_drivers();
+
+ // fetch from database if not found on FS
+ $data = $this->cache->read($args['id']);
+
+ // fetch from memcache if not found on FS and DB
+ if (($data === false || $data === null) && $this->mem_cache) {
+ $data = $this->mem_cache->read($args['id']);
+ }
+
+ if ($data) {
+ $args['data'] = base64_decode($data);
+ $args['status'] = true;
+ }
+
+ return $args;
+ }
+
+ /**
+ * Delete all temp files associated with this user
+ */
+ function cleanup($args)
+ {
+ $this->_load_drivers();
+
+ if ($this->cache) {
+ $this->cache->remove($args['group'], true);
+ }
+
+ if ($this->mem_cache) {
+ $this->mem_cache->remove($args['group'], true);
+ }
+
+ parent::cleanup($args);
+
+ $args['status'] = true;
+
+ return $args;
+ }
+}
diff --git a/plugins/show_additional_headers/show_additional_headers.php b/plugins/show_additional_headers/show_additional_headers.php
new file mode 100644
index 000000000..0007ce335
--- /dev/null
+++ b/plugins/show_additional_headers/show_additional_headers.php
@@ -0,0 +1,52 @@
+<?php
+
+/**
+ * Show additional message headers
+ *
+ * Proof-of-concept plugin which will fetch additional headers
+ * and display them in the message view.
+ *
+ * Enable the plugin in config/main.inc.php and add your desired headers:
+ * $rcmail_config['show_additional_headers'] = array('User-Agent');
+ *
+ * @version 1.0
+ * @author Thomas Bruederli
+ * @website http://roundcube.net
+ */
+class show_additional_headers extends rcube_plugin
+{
+ public $task = 'mail';
+
+ function init()
+ {
+ $rcmail = rcmail::get_instance();
+ if ($rcmail->action == 'show' || $rcmail->action == 'preview') {
+ $this->add_hook('imap_init', array($this, 'imap_init'));
+ $this->add_hook('message_headers_output', array($this, 'message_headers'));
+ } else if ($rcmail->action == '') {
+ // with enabled_caching we're fetching additional headers before show/preview
+ $this->add_hook('imap_init', array($this, 'imap_init'));
+ }
+ }
+
+ function imap_init($p)
+ {
+ $rcmail = rcmail::get_instance();
+ if ($add_headers = (array)$rcmail->config->get('show_additional_headers', array()))
+ $p['fetch_headers'] = trim($p['fetch_headers'].' ' . strtoupper(join(' ', $add_headers)));
+
+ return $p;
+ }
+
+ function message_headers($p)
+ {
+ $rcmail = rcmail::get_instance();
+ foreach ((array)$rcmail->config->get('show_additional_headers', array()) as $header) {
+ $key = strtolower($header);
+ if ($value = $p['headers']->others[$key])
+ $p['output'][$key] = array('title' => $header, 'value' => Q($value));
+ }
+
+ return $p;
+ }
+}
diff --git a/plugins/squirrelmail_usercopy/config.inc.php.dist b/plugins/squirrelmail_usercopy/config.inc.php.dist
new file mode 100644
index 000000000..0dc0abb02
--- /dev/null
+++ b/plugins/squirrelmail_usercopy/config.inc.php.dist
@@ -0,0 +1,25 @@
+<?php
+
+// Driver - 'file' or 'sql'
+$rcmail_config['squirrelmail_driver'] = 'sql';
+
+// full path to the squirrelmail data directory
+$rcmail_config['squirrelmail_data_dir'] = '';
+$rcmail_config['squirrelmail_data_dir_hash_level'] = 0;
+
+// 'mysql://dbuser:dbpass@localhost/database'
+$rcmail_config['squirrelmail_dsn'] = 'mysql://user:password@localhost/webmail';
+$rcmail_config['squirrelmail_db_charset'] = 'iso-8859-1';
+
+$rcmail_config['squirrelmail_address_table'] = 'address';
+$rcmail_config['squirrelmail_userprefs_table'] = 'userprefs';
+
+// identities_level option value for squirrelmail plugin
+// With this you can bypass/change identities_level checks
+// for operations inside this plugin. See #1486773
+$rcmail_config['squirrelmail_identities_level'] = null;
+
+// Set to false if you don't want the email address of the default identity
+// (squirrelmail preference "email_address") to be saved as alias.
+// Recommended: set to false if your squirrelmail config setting $edit_identity has been true.
+$rcmail_config['squirrelmail_set_alias'] = true;
diff --git a/plugins/squirrelmail_usercopy/squirrelmail_usercopy.php b/plugins/squirrelmail_usercopy/squirrelmail_usercopy.php
new file mode 100644
index 000000000..ee6bcc04b
--- /dev/null
+++ b/plugins/squirrelmail_usercopy/squirrelmail_usercopy.php
@@ -0,0 +1,190 @@
+<?php
+
+/**
+ * Copy a new users identity and settings from a nearby Squirrelmail installation
+ *
+ * @version 1.4
+ * @author Thomas Bruederli, Johannes Hessellund, pommi, Thomas Lueder
+ */
+class squirrelmail_usercopy extends rcube_plugin
+{
+ public $task = 'login';
+
+ private $prefs = null;
+ private $identities_level = 0;
+ private $abook = array();
+
+ public function init()
+ {
+ $this->add_hook('user_create', array($this, 'create_user'));
+ $this->add_hook('identity_create', array($this, 'create_identity'));
+ }
+
+ public function create_user($p)
+ {
+ $rcmail = rcmail::get_instance();
+
+ // Read plugin's config
+ $this->initialize();
+
+ // read prefs and add email address
+ $this->read_squirrel_prefs($p['user']);
+ if (($this->identities_level == 0 || $this->identities_level == 2) && $rcmail->config->get('squirrelmail_set_alias') && $this->prefs['email_address'])
+ $p['user_email'] = $this->prefs['email_address'];
+ return $p;
+ }
+
+ public function create_identity($p)
+ {
+ $rcmail = rcmail::get_instance();
+
+ // prefs are set in create_user()
+ if ($this->prefs) {
+ if ($this->prefs['full_name'])
+ $p['record']['name'] = $this->prefs['full_name'];
+ if (($this->identities_level == 0 || $this->identities_level == 2) && $this->prefs['email_address'])
+ $p['record']['email'] = $this->prefs['email_address'];
+ if ($this->prefs['___signature___'])
+ $p['record']['signature'] = $this->prefs['___signature___'];
+ if ($this->prefs['reply_to'])
+ $p['record']['reply-to'] = $this->prefs['reply_to'];
+ if (($this->identities_level == 0 || $this->identities_level == 1) && isset($this->prefs['identities']) && $this->prefs['identities'] > 1) {
+ for ($i=1; $i < $this->prefs['identities']; $i++) {
+ unset($ident_data);
+ $ident_data = array('name' => '', 'email' => ''); // required data
+ if ($this->prefs['full_name'.$i])
+ $ident_data['name'] = $this->prefs['full_name'.$i];
+ if ($this->identities_level == 0 && $this->prefs['email_address'.$i])
+ $ident_data['email'] = $this->prefs['email_address'.$i];
+ else
+ $ident_data['email'] = $p['record']['email'];
+ if ($this->prefs['reply_to'.$i])
+ $ident_data['reply-to'] = $this->prefs['reply_to'.$i];
+ if ($this->prefs['___sig'.$i.'___'])
+ $ident_data['signature'] = $this->prefs['___sig'.$i.'___'];
+ // insert identity
+ $identid = $rcmail->user->insert_identity($ident_data);
+ }
+ }
+
+ // copy address book
+ $contacts = $rcmail->get_address_book(null, true);
+ if ($contacts && count($this->abook)) {
+ foreach ($this->abook as $rec) {
+ // #1487096 handle multi-address and/or too long items
+ $rec['email'] = array_shift(explode(';', $rec['email']));
+ if (check_email(rcube_idn_to_ascii($rec['email']))) {
+ $rec['email'] = rcube_idn_to_utf8($rec['email']);
+ $contacts->insert($rec, true);
+ }
+ }
+ }
+
+ // mark identity as complete for following hooks
+ $p['complete'] = true;
+ }
+
+ return $p;
+ }
+
+ private function initialize()
+ {
+ $rcmail = rcmail::get_instance();
+
+ // Load plugin's config file
+ $this->load_config();
+
+ // Set identities_level for operations of this plugin
+ $ilevel = $rcmail->config->get('squirrelmail_identities_level');
+ if ($ilevel === null)
+ $ilevel = $rcmail->config->get('identities_level', 0);
+
+ $this->identities_level = intval($ilevel);
+ }
+
+ private function read_squirrel_prefs($uname)
+ {
+ $rcmail = rcmail::get_instance();
+
+ /**** File based backend ****/
+ if ($rcmail->config->get('squirrelmail_driver') == 'file' && ($srcdir = $rcmail->config->get('squirrelmail_data_dir'))) {
+ if (($hash_level = $rcmail->config->get('squirrelmail_data_dir_hash_level')) > 0)
+ $srcdir = slashify($srcdir).chunk_split(substr(base_convert(crc32($uname), 10, 16), 0, $hash_level), 1, '/');
+ $prefsfile = slashify($srcdir) . $uname . '.pref';
+ $abookfile = slashify($srcdir) . $uname . '.abook';
+ $sigfile = slashify($srcdir) . $uname . '.sig';
+ $sigbase = slashify($srcdir) . $uname . '.si';
+
+ if (is_readable($prefsfile)) {
+ $this->prefs = array();
+ foreach (file($prefsfile) as $line) {
+ list($key, $value) = explode('=', $line);
+ $this->prefs[$key] = utf8_encode(rtrim($value));
+ }
+
+ // also read signature file if exists
+ if (is_readable($sigfile)) {
+ $this->prefs['___signature___'] = utf8_encode(file_get_contents($sigfile));
+ }
+
+ if (isset($this->prefs['identities']) && $this->prefs['identities'] > 1) {
+ for ($i=1; $i < $this->prefs['identities']; $i++) {
+ // read signature file if exists
+ if (is_readable($sigbase.$i)) {
+ $this->prefs['___sig'.$i.'___'] = utf8_encode(file_get_contents($sigbase.$i));
+ }
+ }
+ }
+
+ // parse addres book file
+ if (filesize($abookfile)) {
+ foreach(file($abookfile) as $line) {
+ list($rec['name'], $rec['firstname'], $rec['surname'], $rec['email']) = explode('|', utf8_encode(rtrim($line)));
+ if ($rec['name'] && $rec['email'])
+ $this->abook[] = $rec;
+ }
+ }
+ }
+ }
+ /**** Database backend ****/
+ else if ($rcmail->config->get('squirrelmail_driver') == 'sql') {
+ $this->prefs = array();
+
+ /* connect to squirrelmail database */
+ $db = new rcube_mdb2($rcmail->config->get('squirrelmail_dsn'));
+ $db->db_connect('r'); // connect in read mode
+
+ // $db->set_debug(true);
+
+ /* retrieve prefs */
+ $userprefs_table = $rcmail->config->get('squirrelmail_userprefs_table');
+ $address_table = $rcmail->config->get('squirrelmail_address_table');
+ $db_charset = $rcmail->config->get('squirrelmail_db_charset');
+
+ if ($db_charset)
+ $db->query('SET NAMES '.$db_charset);
+
+ $sql_result = $db->query('SELECT * FROM '.$userprefs_table.' WHERE user=?', $uname); // ? is replaced with emailaddress
+
+ while ($sql_array = $db->fetch_assoc($sql_result) ) { // fetch one row from result
+ $this->prefs[$sql_array['prefkey']] = rcube_charset_convert(rtrim($sql_array['prefval']), $db_charset);
+ }
+
+ /* retrieve address table data */
+ $sql_result = $db->query('SELECT * FROM '.$address_table.' WHERE owner=?', $uname); // ? is replaced with emailaddress
+
+ // parse addres book
+ while ($sql_array = $db->fetch_assoc($sql_result) ) { // fetch one row from result
+ $rec['name'] = rcube_charset_convert(rtrim($sql_array['nickname']), $db_charset);
+ $rec['firstname'] = rcube_charset_convert(rtrim($sql_array['firstname']), $db_charset);
+ $rec['surname'] = rcube_charset_convert(rtrim($sql_array['lastname']), $db_charset);
+ $rec['email'] = rcube_charset_convert(rtrim($sql_array['email']), $db_charset);
+ $rec['note'] = rcube_charset_convert(rtrim($sql_array['label']), $db_charset);
+
+ if ($rec['name'] && $rec['email'])
+ $this->abook[] = $rec;
+ }
+ } // end if 'sql'-driver
+ }
+
+}
diff --git a/plugins/subscriptions_option/localization/cs_CZ.inc b/plugins/subscriptions_option/localization/cs_CZ.inc
new file mode 100644
index 000000000..0d9c1fc73
--- /dev/null
+++ b/plugins/subscriptions_option/localization/cs_CZ.inc
@@ -0,0 +1,23 @@
+<?php
+
+/*
+
++-----------------------------------------------------------------------+
+| language/cs_CZ/labels.inc |
+| |
+| Language file of the Roundcube subscriptions option plugin |
+| Copyright (C) 2005-2009, The Roundcube Dev Team |
+| Licensed under the GNU GPL |
+| |
++-----------------------------------------------------------------------+
+| Author: Milan Kozak <hodza@hodza.net> |
++-----------------------------------------------------------------------+
+
+@version $Id: labels.inc 2993 2009-09-26 18:32:07Z alec $
+
+*/
+
+$labels = array();
+$labels['useimapsubscriptions'] = 'Používat odebírání IMAP složek';
+
+?>
diff --git a/plugins/subscriptions_option/localization/de_CH.inc b/plugins/subscriptions_option/localization/de_CH.inc
new file mode 100644
index 000000000..b4affe0c8
--- /dev/null
+++ b/plugins/subscriptions_option/localization/de_CH.inc
@@ -0,0 +1,6 @@
+<?php
+
+$labels = array();
+$labels['useimapsubscriptions'] = 'Nur abonnierte Ordner anzeigen';
+
+?>
diff --git a/plugins/subscriptions_option/localization/de_DE.inc b/plugins/subscriptions_option/localization/de_DE.inc
new file mode 100644
index 000000000..b4affe0c8
--- /dev/null
+++ b/plugins/subscriptions_option/localization/de_DE.inc
@@ -0,0 +1,6 @@
+<?php
+
+$labels = array();
+$labels['useimapsubscriptions'] = 'Nur abonnierte Ordner anzeigen';
+
+?>
diff --git a/plugins/subscriptions_option/localization/en_US.inc b/plugins/subscriptions_option/localization/en_US.inc
new file mode 100644
index 000000000..5a348e0ee
--- /dev/null
+++ b/plugins/subscriptions_option/localization/en_US.inc
@@ -0,0 +1,6 @@
+<?php
+
+$labels = array();
+$labels['useimapsubscriptions'] = 'Use IMAP Subscriptions';
+
+?>
diff --git a/plugins/subscriptions_option/localization/es_ES.inc b/plugins/subscriptions_option/localization/es_ES.inc
new file mode 100644
index 000000000..ca9a42126
--- /dev/null
+++ b/plugins/subscriptions_option/localization/es_ES.inc
@@ -0,0 +1,6 @@
+<?php
+
+$labels = array();
+$labels['useimapsubscriptions'] = 'Usar suscripciones IMAP';
+
+?>
diff --git a/plugins/subscriptions_option/localization/et_EE.inc b/plugins/subscriptions_option/localization/et_EE.inc
new file mode 100644
index 000000000..6c5f6f435
--- /dev/null
+++ b/plugins/subscriptions_option/localization/et_EE.inc
@@ -0,0 +1,6 @@
+<?php
+
+$labels = array();
+$labels['useimapsubscriptions'] = 'Kasuta IMAP tellimusi';
+
+?>
diff --git a/plugins/subscriptions_option/localization/gl_ES.inc b/plugins/subscriptions_option/localization/gl_ES.inc
new file mode 100644
index 000000000..d7db28d2e
--- /dev/null
+++ b/plugins/subscriptions_option/localization/gl_ES.inc
@@ -0,0 +1,6 @@
+<?php
+
+$labels = array();
+$labels['useimapsubscriptions'] = 'Usar suscripcións IMAP';
+
+?>
diff --git a/plugins/subscriptions_option/localization/ja_JP.inc b/plugins/subscriptions_option/localization/ja_JP.inc
new file mode 100644
index 000000000..dacea2956
--- /dev/null
+++ b/plugins/subscriptions_option/localization/ja_JP.inc
@@ -0,0 +1,8 @@
+<?php
+
+// EN-Revision: 3891
+
+$labels = array();
+$labels['useimapsubscriptions'] = 'IMAP 購読リストを使う';
+
+?>
diff --git a/plugins/subscriptions_option/localization/pl_PL.inc b/plugins/subscriptions_option/localization/pl_PL.inc
new file mode 100644
index 000000000..8544c7d30
--- /dev/null
+++ b/plugins/subscriptions_option/localization/pl_PL.inc
@@ -0,0 +1,6 @@
+<?php
+
+$labels = array();
+$labels['useimapsubscriptions'] = 'Używaj subskrypcji IMAP';
+
+?>
diff --git a/plugins/subscriptions_option/localization/ru_RU.inc b/plugins/subscriptions_option/localization/ru_RU.inc
new file mode 100644
index 000000000..5deb84e0d
--- /dev/null
+++ b/plugins/subscriptions_option/localization/ru_RU.inc
@@ -0,0 +1,6 @@
+<?php
+
+$labels = array();
+$labels['useimapsubscriptions'] = 'Использовать IMAP подписку';
+
+?>
diff --git a/plugins/subscriptions_option/localization/sv_SE.inc b/plugins/subscriptions_option/localization/sv_SE.inc
new file mode 100644
index 000000000..05b7006f4
--- /dev/null
+++ b/plugins/subscriptions_option/localization/sv_SE.inc
@@ -0,0 +1,6 @@
+<?php
+
+$labels = array();
+$labels['useimapsubscriptions'] = 'Använd IMAP-prenumerationer';
+
+?>
diff --git a/plugins/subscriptions_option/localization/zh_TW.inc b/plugins/subscriptions_option/localization/zh_TW.inc
new file mode 100644
index 000000000..f310b51b7
--- /dev/null
+++ b/plugins/subscriptions_option/localization/zh_TW.inc
@@ -0,0 +1,6 @@
+<?php
+
+$labels = array();
+$labels['useimapsubscriptions'] = '使用IMAP訂閱';
+
+?>
diff --git a/plugins/subscriptions_option/subscriptions_option.php b/plugins/subscriptions_option/subscriptions_option.php
new file mode 100644
index 000000000..c0eb90c22
--- /dev/null
+++ b/plugins/subscriptions_option/subscriptions_option.php
@@ -0,0 +1,92 @@
+<?php
+
+/**
+ * Subscription Options
+ *
+ * A plugin which can enable or disable the use of imap subscriptions.
+ * It includes a toggle on the settings page under "Server Settings".
+ * The preference can also be locked
+ *
+ * Add it to the plugins list in config/main.inc.php to enable the user option
+ * The user option can be hidden and set globally by adding 'use_subscriptions'
+ * to the the 'dont_override' configure line:
+ * $rcmail_config['dont_override'] = array('use_subscriptions');
+ * and then set the global preference
+ * $rcmail_config['use_subscriptions'] = true; // or false
+ *
+ * Roundcube caches folder lists. When a user changes this option or visits
+ * their folder list, this cache is refreshed. If the option is on the
+ * 'dont_override' list and the global option has changed, don't expect
+ * to see the change until the folder list cache is refreshed.
+ *
+ * @version 1.1
+ * @author Ziba Scott
+ */
+class subscriptions_option extends rcube_plugin
+{
+ public $task = 'mail|settings';
+
+ function init()
+ {
+ $this->add_texts('localization/', false);
+ $dont_override = rcmail::get_instance()->config->get('dont_override', array());
+ if (!in_array('use_subscriptions', $dont_override)) {
+ $this->add_hook('preferences_list', array($this, 'settings_blocks'));
+ $this->add_hook('preferences_save', array($this, 'save_prefs'));
+ }
+ $this->add_hook('mailboxes_list', array($this, 'mailboxes_list'));
+ $this->add_hook('folders_list', array($this, 'folders_list'));
+ }
+
+ function settings_blocks($args)
+ {
+ if ($args['section'] == 'server') {
+ $use_subscriptions = rcmail::get_instance()->config->get('use_subscriptions');
+ $field_id = 'rcmfd_use_subscriptions';
+ $checkbox = new html_checkbox(array('name' => '_use_subscriptions', 'id' => $field_id, 'value' => 1));
+
+ $args['blocks']['main']['options']['use_subscriptions'] = array(
+ 'title' => html::label($field_id, Q($this->gettext('useimapsubscriptions'))),
+ 'content' => $checkbox->show($use_subscriptions?1:0),
+ );
+ }
+
+ return $args;
+ }
+
+ function save_prefs($args)
+ {
+ if ($args['section'] == 'server') {
+ $rcmail = rcmail::get_instance();
+ $use_subscriptions = $rcmail->config->get('use_subscriptions');
+
+ $args['prefs']['use_subscriptions'] = isset($_POST['_use_subscriptions']) ? true : false;
+
+ // if the use_subscriptions preference changes, flush the folder cache
+ if (($use_subscriptions && !isset($_POST['_use_subscriptions'])) ||
+ (!$use_subscriptions && isset($_POST['_use_subscriptions']))) {
+ $rcmail->imap_connect();
+ $rcmail->imap->clear_cache('mailboxes');
+ }
+ }
+ return $args;
+ }
+
+ function mailboxes_list($args)
+ {
+ $rcmail = rcmail::get_instance();
+ if (!$rcmail->config->get('use_subscriptions', true)) {
+ $args['folders'] = $rcmail->imap->conn->listMailboxes($args['root'], $args['name']);
+ }
+ return $args;
+ }
+
+ function folders_list($args)
+ {
+ $rcmail = rcmail::get_instance();
+ if (!$rcmail->config->get('use_subscriptions', true)) {
+ $args['table']->remove_column('subscribed');
+ }
+ return $args;
+ }
+}
diff --git a/plugins/userinfo/localization/cs_CZ.inc b/plugins/userinfo/localization/cs_CZ.inc
new file mode 100644
index 000000000..20cd4ae9b
--- /dev/null
+++ b/plugins/userinfo/localization/cs_CZ.inc
@@ -0,0 +1,27 @@
+<?php
+
+/*
+
++-----------------------------------------------------------------------+
+| language/cs_CZ/labels.inc |
+| |
+| Language file of the Roundcube userinfo plugin |
+| Copyright (C) 2005-2009, The Roundcube Dev Team |
+| Licensed under the GNU GPL |
+| |
++-----------------------------------------------------------------------+
+| Author: Milan Kozak <hodza@hodza.net> |
++-----------------------------------------------------------------------+
+
+@version $Id: labels.inc 2993 2009-09-26 18:32:07Z alec $
+
+*/
+
+$labels = array();
+$labels['infosfor'] = 'Informace pro';
+$labels['userinfo'] = 'Uživatel';
+$labels['created'] = 'Vytvořen';
+$labels['lastlogin'] = 'Naspoledy přihlášen';
+$labels['defaultidentity'] = 'Výchozí identita';
+
+?> \ No newline at end of file
diff --git a/plugins/userinfo/localization/da_DK.inc b/plugins/userinfo/localization/da_DK.inc
new file mode 100644
index 000000000..0fed30935
--- /dev/null
+++ b/plugins/userinfo/localization/da_DK.inc
@@ -0,0 +1,9 @@
+<?php
+
+$labels = array();
+$labels['userinfo'] = 'Bruger info';
+$labels['created'] = 'Oprettet';
+$labels['lastlogin'] = 'Sidste login';
+$labels['defaultidentity'] = 'Standard identitet';
+
+?>
diff --git a/plugins/userinfo/localization/de_CH.inc b/plugins/userinfo/localization/de_CH.inc
new file mode 100644
index 000000000..5f236b66c
--- /dev/null
+++ b/plugins/userinfo/localization/de_CH.inc
@@ -0,0 +1,9 @@
+<?php
+
+$labels = array();
+$labels['userinfo'] = 'Benutzerinfo';
+$labels['created'] = 'Erstellt';
+$labels['lastlogin'] = 'Letztes Login';
+$labels['defaultidentity'] = 'Standard-Absender';
+
+?> \ No newline at end of file
diff --git a/plugins/userinfo/localization/en_US.inc b/plugins/userinfo/localization/en_US.inc
new file mode 100644
index 000000000..1a2fd9016
--- /dev/null
+++ b/plugins/userinfo/localization/en_US.inc
@@ -0,0 +1,9 @@
+<?php
+
+$labels = array();
+$labels['userinfo'] = 'User info';
+$labels['created'] = 'Created';
+$labels['lastlogin'] = 'Last Login';
+$labels['defaultidentity'] = 'Default Identity';
+
+?> \ No newline at end of file
diff --git a/plugins/userinfo/localization/es_ES.inc b/plugins/userinfo/localization/es_ES.inc
new file mode 100644
index 000000000..dd6662fc0
--- /dev/null
+++ b/plugins/userinfo/localization/es_ES.inc
@@ -0,0 +1,9 @@
+<?php
+
+$labels = array();
+$labels['userinfo'] = 'Información de usuario';
+$labels['created'] = 'Creado';
+$labels['lastlogin'] = 'Última conexión';
+$labels['defaultidentity'] = 'Identidad predeterminada';
+
+?> \ No newline at end of file
diff --git a/plugins/userinfo/localization/et_EE.inc b/plugins/userinfo/localization/et_EE.inc
new file mode 100644
index 000000000..97830b45c
--- /dev/null
+++ b/plugins/userinfo/localization/et_EE.inc
@@ -0,0 +1,9 @@
+<?php
+
+$labels = array();
+$labels['userinfo'] = 'Kasutaja info';
+$labels['created'] = 'Loodud';
+$labels['lastlogin'] = 'Viimane logimine';
+$labels['defaultidentity'] = 'Vaikeidentiteet';
+
+?>
diff --git a/plugins/userinfo/localization/gl_ES.inc b/plugins/userinfo/localization/gl_ES.inc
new file mode 100644
index 000000000..bf285d37f
--- /dev/null
+++ b/plugins/userinfo/localization/gl_ES.inc
@@ -0,0 +1,9 @@
+<?php
+
+$labels = array();
+$labels['userinfo'] = 'Información do usuario';
+$labels['created'] = 'Creado';
+$labels['lastlogin'] = 'Última conexión';
+$labels['defaultidentity'] = 'Identidade predeterminada';
+
+?> \ No newline at end of file
diff --git a/plugins/userinfo/localization/ja_JP.inc b/plugins/userinfo/localization/ja_JP.inc
new file mode 100644
index 000000000..1fd4eaf51
--- /dev/null
+++ b/plugins/userinfo/localization/ja_JP.inc
@@ -0,0 +1,11 @@
+<?php
+
+// EN-Revision: 3891
+
+$labels = array();
+$labels['userinfo'] = 'ユーザー情報';
+$labels['created'] = '作成日';
+$labels['lastlogin'] = '最終ログイン';
+$labels['defaultidentity'] = '標準の識別情報';
+
+?> \ No newline at end of file
diff --git a/plugins/userinfo/localization/pl_PL.inc b/plugins/userinfo/localization/pl_PL.inc
new file mode 100644
index 000000000..6b03c32e7
--- /dev/null
+++ b/plugins/userinfo/localization/pl_PL.inc
@@ -0,0 +1,9 @@
+<?php
+
+$labels = array();
+$labels['userinfo'] = 'Informacje';
+$labels['created'] = 'Utworzony';
+$labels['lastlogin'] = 'Ostatnie logowanie';
+$labels['defaultidentity'] = 'Domyślna tożsamość';
+
+?>
diff --git a/plugins/userinfo/localization/pt_BR.inc b/plugins/userinfo/localization/pt_BR.inc
new file mode 100644
index 000000000..4ca54eb94
--- /dev/null
+++ b/plugins/userinfo/localization/pt_BR.inc
@@ -0,0 +1,9 @@
+<?php
+
+$labels = array();
+$labels['userinfo'] = 'Info do usuário';
+$labels['created'] = 'Criado';
+$labels['lastlogin'] = 'Último Login';
+$labels['defaultidentity'] = 'Identidade Padrão';
+
+?> \ No newline at end of file
diff --git a/plugins/userinfo/localization/pt_PT.inc b/plugins/userinfo/localization/pt_PT.inc
new file mode 100644
index 000000000..45009f9f4
--- /dev/null
+++ b/plugins/userinfo/localization/pt_PT.inc
@@ -0,0 +1,9 @@
+<?php
+
+$labels = array();
+$labels['userinfo'] = 'Informação do utilizador';
+$labels['created'] = 'Criado';
+$labels['lastlogin'] = 'Último login';
+$labels['defaultidentity'] = 'Identidade pré-definida';
+
+?>
diff --git a/plugins/userinfo/localization/ru_RU.inc b/plugins/userinfo/localization/ru_RU.inc
new file mode 100644
index 000000000..0e7ed4f8a
--- /dev/null
+++ b/plugins/userinfo/localization/ru_RU.inc
@@ -0,0 +1,9 @@
+<?php
+
+$labels = array();
+$labels['userinfo'] = 'Информация';
+$labels['created'] = 'Создан';
+$labels['lastlogin'] = 'Последний вход';
+$labels['defaultidentity'] = 'Профиль по умолчанию';
+
+?>
diff --git a/plugins/userinfo/localization/sv_SE.inc b/plugins/userinfo/localization/sv_SE.inc
new file mode 100644
index 000000000..a34923a88
--- /dev/null
+++ b/plugins/userinfo/localization/sv_SE.inc
@@ -0,0 +1,9 @@
+<?php
+
+$labels = array();
+$labels['userinfo'] = 'Användarinfo';
+$labels['created'] = 'Skapad';
+$labels['lastlogin'] = 'Senast inloggad';
+$labels['defaultidentity'] = 'Standardprofil';
+
+?> \ No newline at end of file
diff --git a/plugins/userinfo/localization/zh_TW.inc b/plugins/userinfo/localization/zh_TW.inc
new file mode 100644
index 000000000..d3124459e
--- /dev/null
+++ b/plugins/userinfo/localization/zh_TW.inc
@@ -0,0 +1,9 @@
+<?php
+
+$labels = array();
+$labels['userinfo'] = '使用者資訊';
+$labels['created'] = '建立時間';
+$labels['lastlogin'] = '上次登入';
+$labels['defaultidentity'] = '預設身份';
+
+?>
diff --git a/plugins/userinfo/userinfo.js b/plugins/userinfo/userinfo.js
new file mode 100644
index 000000000..70a5085b3
--- /dev/null
+++ b/plugins/userinfo/userinfo.js
@@ -0,0 +1,16 @@
+/* Show user-info plugin script */
+
+if (window.rcmail) {
+ rcmail.addEventListener('init', function(evt) {
+ // <span id="settingstabdefault" class="tablink"><roundcube:button command="preferences" type="link" label="preferences" title="editpreferences" /></span>
+ var tab = $('<span>').attr('id', 'settingstabpluginuserinfo').addClass('tablink');
+
+ var button = $('<a>').attr('href', rcmail.env.comm_path+'&_action=plugin.userinfo').html(rcmail.gettext('userinfo', 'userinfo')).appendTo(tab);
+ button.bind('click', function(e){ return rcmail.command('plugin.userinfo', this) });
+
+ // add button and register command
+ rcmail.add_element(tab, 'tabs');
+ rcmail.register_command('plugin.userinfo', function(){ rcmail.goto_url('plugin.userinfo') }, true);
+ })
+}
+
diff --git a/plugins/userinfo/userinfo.php b/plugins/userinfo/userinfo.php
new file mode 100644
index 000000000..efb65f51d
--- /dev/null
+++ b/plugins/userinfo/userinfo.php
@@ -0,0 +1,55 @@
+<?php
+
+/**
+ * Sample plugin that adds a new tab to the settings section
+ * to display some information about the current user
+ */
+class userinfo extends rcube_plugin
+{
+ public $task = 'settings';
+ public $noajax = true;
+ public $noframe = true;
+
+ function init()
+ {
+ $this->add_texts('localization/', array('userinfo'));
+ $this->register_action('plugin.userinfo', array($this, 'infostep'));
+ $this->include_script('userinfo.js');
+ }
+
+ function infostep()
+ {
+ $this->register_handler('plugin.body', array($this, 'infohtml'));
+ rcmail::get_instance()->output->send('plugin');
+ }
+
+ function infohtml()
+ {
+ $rcmail = rcmail::get_instance();
+ $user = $rcmail->user;
+
+ $table = new html_table(array('cols' => 2, 'cellpadding' => 3));
+
+ $table->add('title', 'ID');
+ $table->add('', Q($user->ID));
+
+ $table->add('title', Q($this->gettext('username')));
+ $table->add('', Q($user->data['username']));
+
+ $table->add('title', Q($this->gettext('server')));
+ $table->add('', Q($user->data['mail_host']));
+
+ $table->add('title', Q($this->gettext('created')));
+ $table->add('', Q($user->data['created']));
+
+ $table->add('title', Q($this->gettext('lastlogin')));
+ $table->add('', Q($user->data['last_login']));
+
+ $identity = $user->get_identity();
+ $table->add('title', Q($this->gettext('defaultidentity')));
+ $table->add('', Q($identity['name'] . ' <' . $identity['email'] . '>'));
+
+ return html::tag('h4', null, Q('Infos for ' . $user->get_username())) . $table->show();
+ }
+
+}
diff --git a/plugins/vcard_attachments/localization/cs_CZ.inc b/plugins/vcard_attachments/localization/cs_CZ.inc
new file mode 100644
index 000000000..11ae8c98f
--- /dev/null
+++ b/plugins/vcard_attachments/localization/cs_CZ.inc
@@ -0,0 +1,21 @@
+<?php
+
+/*
++-----------------------------------------------------------------------+
+| language/cs_CZ/labels.inc |
+| |
+| Language file of the Roundcube Webmail client |
+| Copyright (C) 2008-2010, The Roundcube Dev Team |
+| Licensed under the GNU GPL |
+| |
++-----------------------------------------------------------------------+
+| Author: Ales Pospichal <ales@pospichalales.info> |
++-----------------------------------------------------------------------+
+
+*/
+
+$labels = array();
+$labels['addvcardmsg'] = 'Přidat vCard do adresáře';
+$labels['vcardsavefailed'] = 'Nelze uložit vCard';
+
+?>
diff --git a/plugins/vcard_attachments/localization/de_CH.inc b/plugins/vcard_attachments/localization/de_CH.inc
new file mode 100644
index 000000000..48bb90013
--- /dev/null
+++ b/plugins/vcard_attachments/localization/de_CH.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['addvcardmsg'] = 'Kontakt im Adressbuch speichern';
+$labels['vcardsavefailed'] = 'Der Kontakt konnte nicht gespeichert werden';
+
+?> \ No newline at end of file
diff --git a/plugins/vcard_attachments/localization/de_DE.inc b/plugins/vcard_attachments/localization/de_DE.inc
new file mode 100644
index 000000000..48bb90013
--- /dev/null
+++ b/plugins/vcard_attachments/localization/de_DE.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['addvcardmsg'] = 'Kontakt im Adressbuch speichern';
+$labels['vcardsavefailed'] = 'Der Kontakt konnte nicht gespeichert werden';
+
+?> \ No newline at end of file
diff --git a/plugins/vcard_attachments/localization/en_US.inc b/plugins/vcard_attachments/localization/en_US.inc
new file mode 100644
index 000000000..bce44d739
--- /dev/null
+++ b/plugins/vcard_attachments/localization/en_US.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['addvcardmsg'] = 'Add vCard to addressbook';
+$labels['vcardsavefailed'] = 'Unable to save vCard';
+
+?> \ No newline at end of file
diff --git a/plugins/vcard_attachments/localization/es_ES.inc b/plugins/vcard_attachments/localization/es_ES.inc
new file mode 100644
index 000000000..0aba6b391
--- /dev/null
+++ b/plugins/vcard_attachments/localization/es_ES.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['addvcardmsg'] = 'Añadir la tarjeta a la libreta de direcciones';
+$labels['vcardsavefailed'] = 'No ha sido posible guardar la tarjeta';
+
+?> \ No newline at end of file
diff --git a/plugins/vcard_attachments/localization/et_EE.inc b/plugins/vcard_attachments/localization/et_EE.inc
new file mode 100644
index 000000000..eb6ce230f
--- /dev/null
+++ b/plugins/vcard_attachments/localization/et_EE.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['addvcardmsg'] = 'Lisa vCard aadressiraamatusse';
+$labels['vcardsavefailed'] = 'vCard salvestamine nurjus';
+
+?>
diff --git a/plugins/vcard_attachments/localization/gl_ES.inc b/plugins/vcard_attachments/localization/gl_ES.inc
new file mode 100644
index 000000000..4c3574a8f
--- /dev/null
+++ b/plugins/vcard_attachments/localization/gl_ES.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['addvcardmsg'] = 'Engadir a tarxeta ao caderno de enderezos';
+$labels['vcardsavefailed'] = 'Non foi posible gardar a tarxeta';
+
+?> \ No newline at end of file
diff --git a/plugins/vcard_attachments/localization/it_IT.inc b/plugins/vcard_attachments/localization/it_IT.inc
new file mode 100644
index 000000000..55cde3961
--- /dev/null
+++ b/plugins/vcard_attachments/localization/it_IT.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['addvcardmsg'] = 'Aggiungi vCard alla Agenda';
+$labels['vcardsavefailed'] = 'Abilita a salvare vCard';
+
+?>
diff --git a/plugins/vcard_attachments/localization/ja_JP.inc b/plugins/vcard_attachments/localization/ja_JP.inc
new file mode 100644
index 000000000..0b4d0d91d
--- /dev/null
+++ b/plugins/vcard_attachments/localization/ja_JP.inc
@@ -0,0 +1,9 @@
+<?php
+
+// EN-Revision: 3891
+
+$labels = array();
+$labels['addvardmsg'] = 'アドレス帳に vCard を追加する';
+$labels['vcardsavefailed'] = 'vCard を保存できませんでした。';
+
+?> \ No newline at end of file
diff --git a/plugins/vcard_attachments/localization/pl_PL.inc b/plugins/vcard_attachments/localization/pl_PL.inc
new file mode 100644
index 000000000..800e35b38
--- /dev/null
+++ b/plugins/vcard_attachments/localization/pl_PL.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['addvcardmsg'] = 'Dodaj wizytówkę (vCard) do kontaktów';
+$labels['vcardsavefailed'] = 'Nie można zapisać wizytówki (vCard)';
+
+?>
diff --git a/plugins/vcard_attachments/localization/pt_BR.inc b/plugins/vcard_attachments/localization/pt_BR.inc
new file mode 100644
index 000000000..263f88442
--- /dev/null
+++ b/plugins/vcard_attachments/localization/pt_BR.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['addvcardmsg'] = 'Adicionar o vCard ao Catálogo de Endereços';
+$labels['vcardsavefailed'] = 'Impossível salvar o vCard';
+
+?> \ No newline at end of file
diff --git a/plugins/vcard_attachments/localization/ru_RU.inc b/plugins/vcard_attachments/localization/ru_RU.inc
new file mode 100644
index 000000000..1688c5dc8
--- /dev/null
+++ b/plugins/vcard_attachments/localization/ru_RU.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['addvcardmsg'] = 'Добавить в контакты';
+$labels['vcardsavefailed'] = 'Не удалось сохранить vCard';
+
+?> \ No newline at end of file
diff --git a/plugins/vcard_attachments/localization/sv_SE.inc b/plugins/vcard_attachments/localization/sv_SE.inc
new file mode 100644
index 000000000..4c9faddf9
--- /dev/null
+++ b/plugins/vcard_attachments/localization/sv_SE.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['addvcardmsg'] = 'Lägg till vCard i adressbok';
+$labels['vcardsavefailed'] = 'Kunde inte spara vCard';
+
+?> \ No newline at end of file
diff --git a/plugins/vcard_attachments/localization/zh_TW.inc b/plugins/vcard_attachments/localization/zh_TW.inc
new file mode 100644
index 000000000..361837bfc
--- /dev/null
+++ b/plugins/vcard_attachments/localization/zh_TW.inc
@@ -0,0 +1,7 @@
+<?php
+
+$labels = array();
+$labels['addvcardmsg'] = '加入 vCard 到通訊錄';
+$labels['vcardsavefailed'] = '無法儲存 vCard';
+
+?> \ No newline at end of file
diff --git a/plugins/vcard_attachments/package.xml b/plugins/vcard_attachments/package.xml
new file mode 100644
index 000000000..e5eaf7187
--- /dev/null
+++ b/plugins/vcard_attachments/package.xml
@@ -0,0 +1,100 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<package xmlns="http://pear.php.net/dtd/package-2.0" xmlns:tasks="http://pear.php.net/dtd/tasks-1.0" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" packagerversion="1.9.0" version="2.0" xsi:schemaLocation="http://pear.php.net/dtd/tasks-1.0
+ http://pear.php.net/dtd/tasks-1.0.xsd
+ http://pear.php.net/dtd/package-2.0
+ http://pear.php.net/dtd/package-2.0.xsd">
+ <name>vcard_attachments</name>
+ <channel>pear.roundcube.net</channel>
+ <summary>vCard handler for Roundcube</summary>
+ <description>This plugin detects vCard attachments/bodies and shows a button(s) to add them to address book</description>
+ <lead>
+ <name>Thomas Bruederli</name>
+ <user>thomasb</user>
+ <email>roundcube@gmail.com</email>
+ <active>yes</active>
+ </lead>
+ <lead>
+ <name>Aleksander Machniak</name>
+ <user>alec</user>
+ <email>alec@alec.pl</email>
+ <active>yes</active>
+ </lead>
+ <date>2010-10-14</date>
+ <time>19:00</time>
+ <version>
+ <release>3.0</release>
+ <api>3.0</api>
+ </version>
+ <stability>
+ <release>stable</release>
+ <api>stable</api>
+ </stability>
+ <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license>
+ <notes>
+- Exec contact_create hook when adding contact (#1486964)
+- Make icons skinable
+- Display vcard icon on messages list when message is of type vcard
+ </notes>
+ <contents>
+ <dir baseinstalldir="/" name="/">
+ <file name="vcard_attachments.php" role="php">
+ <tasks:replace from="@name@" to="name" type="package-info"/>
+ <tasks:replace from="@package_version@" to="version" type="package-info"/>
+ </file>
+ <file name="vcardattach.js" role="data">
+ <tasks:replace from="@name@" to="name" type="package-info"/>
+ <tasks:replace from="@package_version@" to="version" type="package-info"/>
+ </file>
+ <file name="localization/cs_CZ.inc" role="data"></file>
+ <file name="localization/en_US.inc" role="data"></file>
+ <file name="localization/de_CH.inc" role="data"></file>
+ <file name="localization/de_DE.inc" role="data"></file>
+ <file name="localization/es_ES.inc" role="data"></file>
+ <file name="localization/et_EE.inc" role="data"></file>
+ <file name="localization/gl_ES.inc" role="data"></file>
+ <file name="localization/it_IT.inc" role="data"></file>
+ <file name="localization/ja_JP.inc" role="data"></file>
+ <file name="localization/es_ES.inc" role="data"></file>
+ <file name="localization/pl_PL.inc" role="data"></file>
+ <file name="localization/ru_RU.inc" role="data"></file>
+ <file name="localization/sv_SE.inc" role="data"></file>
+ <file name="localization/zh_TW.inc" role="data"></file>
+ <file name="skins/default/vcard_add_contact.png" role="data"></file>
+ <file name="skins/default/vcard.png" role="data"></file>
+ </dir>
+ <!-- / -->
+ </contents>
+ <dependencies>
+ <required>
+ <php>
+ <min>5.2.1</min>
+ </php>
+ <pearinstaller>
+ <min>1.7.0</min>
+ </pearinstaller>
+ </required>
+ </dependencies>
+ <phprelease/>
+ <changelog>
+ <release>
+ <date>2010-04-28</date>
+ <time>12:00:00</time>
+ <version>
+ <release>2.0</release>
+ <api>2.0</api>
+ </version>
+ <stability>
+ <release>stable</release>
+ <api>stable</api>
+ </stability>
+ <license uri="http://www.gnu.org/licenses/gpl-2.0.html">GNU GPLv2</license>
+ <notes>
+- Added support for Content-Type: text/directory; profile=vCard
+- Added handler for message bodies of type vCard (#1486683)
+- Added support for more than one vCard attachment/body
+- Added support for more than one contact in one vCard file
+- Created package.xml
+ </notes>
+ </release>
+ </changelog>
+</package>
diff --git a/plugins/vcard_attachments/skins/default/vcard.png b/plugins/vcard_attachments/skins/default/vcard.png
new file mode 100644
index 000000000..8bf6b1b72
--- /dev/null
+++ b/plugins/vcard_attachments/skins/default/vcard.png
Binary files differ
diff --git a/plugins/vcard_attachments/skins/default/vcard_add_contact.png b/plugins/vcard_attachments/skins/default/vcard_add_contact.png
new file mode 100644
index 000000000..478c1f3f2
--- /dev/null
+++ b/plugins/vcard_attachments/skins/default/vcard_add_contact.png
Binary files differ
diff --git a/plugins/vcard_attachments/vcard_attachments.php b/plugins/vcard_attachments/vcard_attachments.php
new file mode 100644
index 000000000..3fb3bf9ad
--- /dev/null
+++ b/plugins/vcard_attachments/vcard_attachments.php
@@ -0,0 +1,184 @@
+<?php
+
+/**
+ * Detect VCard attachments and show a button to add them to address book
+ *
+ * @version @package_version@
+ * @author Thomas Bruederli, Aleksander Machniak
+ */
+class vcard_attachments extends rcube_plugin
+{
+ public $task = 'mail';
+
+ private $message;
+ private $vcard_parts = array();
+ private $vcard_bodies = array();
+
+ function init()
+ {
+ $rcmail = rcmail::get_instance();
+ if ($rcmail->action == 'show' || $rcmail->action == 'preview') {
+ $this->add_hook('message_load', array($this, 'message_load'));
+ $this->add_hook('template_object_messagebody', array($this, 'html_output'));
+ }
+ else if (!$rcmail->output->framed && (!$rcmail->action || $rcmail->action == 'list')) {
+ $icon = 'plugins/vcard_attachments/' .$this->local_skin_path(). '/vcard.png';
+ $rcmail->output->set_env('vcard_icon', $icon);
+ $this->include_script('vcardattach.js');
+ }
+
+ $this->register_action('plugin.savevcard', array($this, 'save_vcard'));
+ }
+
+ /**
+ * Check message bodies and attachments for vcards
+ */
+ function message_load($p)
+ {
+ $this->message = $p['object'];
+
+ // handle attachments vcard attachments
+ foreach ((array)$this->message->attachments as $attachment) {
+ if ($this->is_vcard($attachment)) {
+ $this->vcard_parts[] = $attachment->mime_id;
+ }
+ }
+ // the same with message bodies
+ foreach ((array)$this->message->parts as $idx => $part) {
+ if ($this->is_vcard($part)) {
+ $this->vcard_parts[] = $part->mime_id;
+ $this->vcard_bodies[] = $part->mime_id;
+ }
+ }
+
+ if ($this->vcard_parts)
+ $this->add_texts('localization');
+ }
+
+ /**
+ * This callback function adds a box below the message content
+ * if there is a vcard attachment available
+ */
+ function html_output($p)
+ {
+ $attach_script = false;
+ $icon = 'plugins/vcard_attachments/' .$this->local_skin_path(). '/vcard_add_contact.png';
+
+ foreach ($this->vcard_parts as $part) {
+ $vcards = rcube_vcard::import($this->message->get_part_content($part));
+
+ // successfully parsed vcards?
+ if (empty($vcards))
+ continue;
+
+ // remove part's body
+ if (in_array($part, $this->vcard_bodies))
+ $p['content'] = '';
+
+ $style = 'margin:0.5em 1em; padding:0.2em 0.5em; border:1px solid #999; '
+ .'border-radius:4px; -moz-border-radius:4px; -webkit-border-radius:4px; width: auto';
+
+ foreach ($vcards as $idx => $vcard) {
+ $display = $vcard->displayname;
+ if ($vcard->email[0])
+ $display .= ' <'.$vcard->email[0].'>';
+
+ // add box below messsage body
+ $p['content'] .= html::p(array('style' => $style),
+ html::a(array(
+ 'href' => "#",
+ 'onclick' => "return plugin_vcard_save_contact('".JQ($part.':'.$idx)."')",
+ 'title' => $this->gettext('addvcardmsg')),
+ html::img(array('src' => $icon, 'style' => "vertical-align:middle")))
+ . ' ' . html::span(null, Q($display)));
+ }
+
+ $attach_script = true;
+ }
+
+ if ($attach_script)
+ $this->include_script('vcardattach.js');
+
+ return $p;
+ }
+
+ /**
+ * Handler for request action
+ */
+ function save_vcard()
+ {
+ $this->add_texts('localization', true);
+
+ $uid = get_input_value('_uid', RCUBE_INPUT_POST);
+ $mbox = get_input_value('_mbox', RCUBE_INPUT_POST);
+ $mime_id = get_input_value('_part', RCUBE_INPUT_POST);
+
+ $rcmail = rcmail::get_instance();
+
+ if ($uid && $mime_id) {
+ list($mime_id, $index) = explode(':', $mime_id);
+ $part = $rcmail->imap->get_message_part($uid, $mime_id);
+ }
+
+ $error_msg = $this->gettext('vcardsavefailed');
+
+ if ($part && ($vcards = rcube_vcard::import($part))
+ && ($vcard = $vcards[$index]) && $vcard->displayname && $vcard->email) {
+
+ $contacts = $rcmail->get_address_book(null, true);
+
+ // check for existing contacts
+ $existing = $contacts->search('email', $vcard->email[0], true, false);
+ if ($existing->count) {
+ $rcmail->output->command('display_message', $this->gettext('contactexists'), 'warning');
+ }
+ else {
+ // add contact
+ $contact = array(
+ 'name' => $vcard->displayname,
+ 'firstname' => $vcard->firstname,
+ 'surname' => $vcard->surname,
+ 'email' => $vcard->email[0],
+ 'vcard' => $vcard->export(),
+ );
+
+ $plugin = $rcmail->plugins->exec_hook('contact_create', array('record' => $contact, 'source' => null));
+ $contact = $plugin['record'];
+
+ if (!$plugin['abort'] && ($done = $contacts->insert($contact)))
+ $rcmail->output->command('display_message', $this->gettext('addedsuccessfully'), 'confirmation');
+ else
+ $rcmail->output->command('display_message', $error_msg, 'error');
+ }
+ }
+ else
+ $rcmail->output->command('display_message', $error_msg, 'error');
+
+ $rcmail->output->send();
+ }
+
+ /**
+ * Checks if specified message part is a vcard data
+ *
+ * @param rcube_message_part Part object
+ *
+ * @return boolean True if part is of type vcard
+ */
+ function is_vcard($part)
+ {
+ return (
+ // Content-Type: text/vcard;
+ $part->mimetype == 'text/vcard' ||
+ // Content-Type: text/x-vcard;
+ $part->mimetype == 'text/x-vcard' ||
+ // Content-Type: text/directory; profile=vCard;
+ ($part->mimetype == 'text/directory' && (
+ ($part->ctype_parameters['profile'] &&
+ strtolower($part->ctype_parameters['profile']) == 'vcard')
+ // Content-Type: text/directory; (with filename=*.vcf)
+ || ($part->filename && preg_match('/\.vcf$/i', $part->filename))
+ )
+ )
+ );
+ }
+}
diff --git a/plugins/vcard_attachments/vcardattach.js b/plugins/vcard_attachments/vcardattach.js
new file mode 100644
index 000000000..ef19190e7
--- /dev/null
+++ b/plugins/vcard_attachments/vcardattach.js
@@ -0,0 +1,23 @@
+/*
+ * vcard_attachments plugin script
+ * @version @package_version@
+ */
+function plugin_vcard_save_contact(mime_id)
+{
+ var lock = rcmail.set_busy(true, 'loading');
+ rcmail.http_post('plugin.savevcard', '_uid='+rcmail.env.uid+'&_mbox='+urlencode(rcmail.env.mailbox)+'&_part='+urlencode(mime_id), lock);
+
+ return false;
+}
+
+function plugin_vcard_insertrow(data)
+{
+ var ctype = data.row.ctype;
+ if (ctype == 'text/vcard' || ctype == 'text/x-vcard' || ctype == 'text/directory') {
+ $('#rcmrow'+data.uid+' > td.attachment').html('<img src="'+rcmail.env.vcard_icon+'" alt="">');
+ }
+}
+
+if (window.rcmail && rcmail.gui_objects.messagelist) {
+ rcmail.addEventListener('insertrow', function(data, evt) { plugin_vcard_insertrow(data); });
+}
diff --git a/plugins/virtuser_file/virtuser_file.php b/plugins/virtuser_file/virtuser_file.php
new file mode 100644
index 000000000..9d4efd12b
--- /dev/null
+++ b/plugins/virtuser_file/virtuser_file.php
@@ -0,0 +1,106 @@
+<?php
+
+/**
+ * File based User-to-Email and Email-to-User lookup
+ *
+ * Add it to the plugins list in config/main.inc.php and set
+ * path to a virtuser table file to resolve user names and e-mail
+ * addresses
+ * $rcmail_config['virtuser_file'] = '';
+ *
+ * @version 1.0
+ * @author Aleksander Machniak
+ */
+class virtuser_file extends rcube_plugin
+{
+ private $file;
+ private $app;
+
+ function init()
+ {
+ $this->app = rcmail::get_instance();
+ $this->file = $this->app->config->get('virtuser_file');
+
+ if ($this->file) {
+ $this->add_hook('user2email', array($this, 'user2email'));
+ $this->add_hook('email2user', array($this, 'email2user'));
+ }
+ }
+
+ /**
+ * User > Email
+ */
+ function user2email($p)
+ {
+ $r = $this->findinvirtual('/\s' . preg_quote($p['user'], '/') . '\s*$/');
+ $result = array();
+
+ for ($i=0; $i<count($r); $i++)
+ {
+ $arr = preg_split('/\s+/', $r[$i]);
+
+ if (count($arr) > 0 && strpos($arr[0], '@')) {
+ $result[] = rcube_idn_to_ascii(trim(str_replace('\\@', '@', $arr[0])));
+
+ if ($p['first']) {
+ $p['email'] = $result[0];
+ break;
+ }
+ }
+ }
+
+ $p['email'] = empty($result) ? NULL : $result;
+
+ return $p;
+ }
+
+ /**
+ * Email > User
+ */
+ function email2user($p)
+ {
+ $r = $this->findinvirtual('/^' . preg_quote($p['email'], '/') . '\s/');
+
+ for ($i=0; $i<count($r); $i++) {
+ $arr = preg_split('/\s+/', trim($r[$i]));
+
+ if (count($arr) > 0) {
+ $p['user'] = trim($arr[count($arr)-1]);
+ break;
+ }
+ }
+
+ return $p;
+ }
+
+ /**
+ * Find matches of the given pattern in virtuser file
+ *
+ * @param string Regular expression to search for
+ * @return array Matching entries
+ */
+ private function findinvirtual($pattern)
+ {
+ $result = array();
+ $virtual = null;
+
+ if ($this->file)
+ $virtual = file($this->file);
+
+ if (empty($virtual))
+ return $result;
+
+ // check each line for matches
+ foreach ($virtual as $line) {
+ $line = trim($line);
+ if (empty($line) || $line[0]=='#')
+ continue;
+
+ if (preg_match($pattern, $line))
+ $result[] = $line;
+ }
+
+ return $result;
+ }
+
+}
diff --git a/plugins/virtuser_query/virtuser_query.php b/plugins/virtuser_query/virtuser_query.php
new file mode 100644
index 000000000..e59095f29
--- /dev/null
+++ b/plugins/virtuser_query/virtuser_query.php
@@ -0,0 +1,117 @@
+<?php
+
+/**
+ * DB based User-to-Email and Email-to-User lookup
+ *
+ * Add it to the plugins list in config/main.inc.php and set
+ * SQL queries to resolve usernames, e-mail addresses and hostnames from the database
+ * %u will be replaced with the current username for login.
+ * %m will be replaced with the current e-mail address for login.
+ *
+ * Queries should select the user's e-mail address, username or the imap hostname as first column
+ * The email query could optionally select identity data columns in specified order:
+ * name, organization, reply-to, bcc, signature, html_signature
+ *
+ * $rcmail_config['virtuser_query'] = array('email' => '', 'user' => '', 'host' => '');
+ *
+ * @version 1.1
+ * @author Aleksander Machniak
+ * @author Steffen Vogel
+ */
+class virtuser_query extends rcube_plugin
+{
+ private $config;
+ private $app;
+
+ function init()
+ {
+ $this->app = rcmail::get_instance();
+ $this->config = $this->app->config->get('virtuser_query');
+
+ if (!empty($this->config)) {
+ if (is_string($this->config)) {
+ $this->config = array('email' => $this->config);
+ }
+
+ if ($this->config['email']) {
+ $this->add_hook('user2email', array($this, 'user2email'));
+ }
+ if ($this->config['user']) {
+ $this->add_hook('email2user', array($this, 'email2user'));
+ }
+ if ($this->config['host']) {
+ $this->add_hook('authenticate', array($this, 'user2host'));
+ }
+ }
+ }
+
+ /**
+ * User > Email
+ */
+ function user2email($p)
+ {
+ $dbh = $this->app->get_dbh();
+
+ $sql_result = $dbh->query(preg_replace('/%u/', $dbh->escapeSimple($p['user']), $this->config['email']));
+
+ while ($sql_arr = $dbh->fetch_array($sql_result)) {
+ if (strpos($sql_arr[0], '@')) {
+ if ($p['extended'] && count($sql_arr) > 1) {
+ $result[] = array(
+ 'email' => rcube_idn_to_ascii($sql_arr[0]),
+ 'name' => $sql_arr[1],
+ 'organization' => $sql_arr[2],
+ 'reply-to' => rcube_idn_to_ascii($sql_arr[3]),
+ 'bcc' => rcube_idn_to_ascii($sql_arr[4]),
+ 'signature' => $sql_arr[5],
+ 'html_signature' => (int)$sql_arr[6],
+ );
+ }
+ else {
+ $result[] = $sql_arr[0];
+ }
+
+ if ($p['first'])
+ break;
+ }
+ }
+
+ $p['email'] = $result;
+
+ return $p;
+ }
+
+ /**
+ * EMail > User
+ */
+ function email2user($p)
+ {
+ $dbh = $this->app->get_dbh();
+
+ $sql_result = $dbh->query(preg_replace('/%m/', $dbh->escapeSimple($p['email']), $this->config['user']));
+
+ if ($sql_arr = $dbh->fetch_array($sql_result)) {
+ $p['user'] = $sql_arr[0];
+ }
+
+ return $p;
+ }
+
+ /**
+ * User > Host
+ */
+ function user2host($p)
+ {
+ $dbh = $this->app->get_dbh();
+
+ $sql_result = $dbh->query(preg_replace('/%u/', $dbh->escapeSimple($p['user']), $this->config['host']));
+
+ if ($sql_arr = $dbh->fetch_array($sql_result)) {
+ $p['host'] = $sql_arr[0];
+ }
+
+ return $p;
+ }
+
+}
+